{"version":3,"file":"main.9ade0800bca30726.js","mappings":"0mBAQO,IAAMA,EAAsB,MAA7B,MAAOA,GALbC,cAOWC,KAAAC,kBAAuC,CAC9CC,UAAU,GAGbC,SAAAH,KAAA,mBAAAI,mBANYN,GAAsB,EAAAK,SAAAH,KAAA,UAAAK,EAAAC,IAAA,MAAtBR,GAAsBS,UAAA,yBAAAC,OAAA,CAAAP,kBAAA,qBAAAQ,mBAAAC,EAAAC,MAAA,GAAAC,KAAA,EAAAC,OAAA,q9EAAAC,SAAA,SAAAC,GAAAC,IAAA,EAAAD,aCRnCE,MAAA,SACEA,MAAA,GACAA,MAAA,SACEA,MAAA,WACFA,QACAA,MAAA,SACEA,MAAA,WACFA,QACAA,MAAA,SACEA,MAAA,WACFA,QACAA,MAAA,SACEA,MAAA,WACFA,QACAA,MAAA,UACEA,MAAA,YACFA,iBAhBGA,MAAAD,GAAAf,kBAAAC,SAAA,+2BDQQJ,EAAsB,oEEI5B,IAAMoB,EAAmB,MAA1B,MAAOA,GAAmBf,SAAAH,KAAA,mBAAAI,mBAAnBc,GAAmB,EAAAf,SAAAH,KAAA,UAAAK,EAAAc,IAAA,MAAnBD,KAAmBf,SAAAH,KAAA,UAAAK,EAAAe,IAAA,UAJ5BC,eAISH,EAAmB,yDCJzB,IAAMI,EAAa,MAApB,MAAOA,EALbvB,cAOWC,KAAAuB,SAAqB,CAC5BC,SAAS,GAGZrB,SAAAH,KAAA,mBAAAI,iBANYkB,EAAa,EAAAnB,SAAAH,KAAA,UAAAK,EAAAC,IAAA,MAAbgB,EAAaf,UAAA,eAAAC,OAAA,CAAAe,SAAA,YAAAZ,MAAA,EAAAC,KAAA,EAAAC,OAAA,8NAAAC,SAAA,SAAAC,EAAAC,IAAA,EAAAD,ICR1BE,MAAA,SACIA,MAAA,WACAA,MAAA,UACIA,MAAA,2FAAcA,MAAA,QAAMA,MAAA,sIAAsBA,MAAA,QAAMA,MAAA,iIACpDA,gBAJYA,MAAAD,GAAAO,SAAAC,QAAA,+ZDQHF,CAAa,oEEMnB,IAAMG,EAAU,MAAjB,MAAOA,GAAUtB,SAAAH,KAAA,mBAAAI,mBAAVqB,GAAU,EAAAtB,SAAAH,KAAA,UAAAK,EAAAc,IAAA,MAAVM,KAAUtB,SAAAH,KAAA,UAAAK,EAAAe,IAAA,UAJnBC,eAISI,EAAU,oECRhB,IAAMC,EAAa,MAApB,MAAOA,GAWX3B,cATQC,KAAA2B,OAASC,IAAYC,OACrB7B,KAAA8B,mBAAqBF,IAAYE,mBACjC9B,KAAA+B,oBAAsBH,IAAYG,oBAClC/B,KAAAgC,WAAaJ,IAAYK,UACzBjC,KAAAkC,QAAUN,IAAYO,OACtBnC,KAAAoC,4BAA8B,8CAE9BpC,KAAAqC,iBAAmBT,IAAYU,eAEvB,CAETC,YACL,OAAOvC,KAAK2B,MACd,CAEA,sBAAIa,GACF,OAAOxC,KAAK8B,kBACd,CAEA,uBAAIW,GACF,OAAOzC,KAAK+B,mBACd,CAEA,aAAIW,GACF,OAAO1C,KAAKgC,UACd,CAEA,mBAAIM,GACF,OAAOtC,KAAKqC,gBACd,CAEA,8BAAIM,GACF,OAAO3C,KAAKoC,2BACd,CAEA,UAAIQ,GACF,OAAO5C,KAAKkC,OACd,CAAC/B,SAAAH,KAAA,mBAAAI,mBAvCUsB,GAAa,EAAAvB,SAAAH,KAAA,WAAA6C,EAAAC,IAAA,OAAbpB,GAAaqB,QAAbrB,GAAasB,UAAAC,WAFZ,gBAEDvB,EAAa,0CCNnB,MAAME,EAAc,CACzBsB,YAAY,EACZrB,OAAQ,qCACRC,mBAAoB,gDACpBC,oBAAqB,cACrBI,OAAQ,8CACRgB,cAAc,EACdb,gBAAiB,iDACjBL,UAAW,+DCmBb,SAASmB,EAAYC,GACnB,OAAOA,GAAOA,EAAIC,MAAQA,KAAOD,OAAME,CACzC,CAGA,MAAMC,EACkB,iBAAdC,YAA0BL,EAAYK,aAE5B,iBAAVC,QAAsBN,EAAYM,SAC1B,iBAARC,MAAoBP,EAAYO,OACtB,iBAAVC,QAAsBR,EAAYQ,SACzC,WACC,OAAO5D,IACT,CAFC,IAGD,CAAC,EAKH,SAAS6D,KACP,OAAOL,CACT,CAaA,SAASM,GAAmBC,EAAMC,EAASX,GACzC,MAAMY,EAAOZ,GAAOG,EACdU,EAAcD,EAAIC,WAAaD,EAAIC,YAAc,CAAC,EAExD,OADkBA,EAAWH,KAAUG,EAAWH,GAAQC,IAE5D,CClEA,MAAMG,EAAsB,aCCtBC,GAAiBC,OAAOC,UAAUC,SASxC,SAASC,GAAQC,GACf,OAAQL,GAAeM,KAAKD,IAC1B,IAAK,iBACL,IAAK,qBACL,IAAK,wBACH,OAAO,EACT,QACE,OAAOE,GAAaF,EAAKG,OAE/B,CAQA,SAASC,GAAUJ,EAAKK,GACtB,OAAOV,GAAeM,KAAKD,KAAU,WAAUK,IACjD,CASA,SAASC,GAAaN,GACpB,OAAOI,GAAUJ,EAAK,aACxB,CASA,SAASO,GAAWP,GAClB,OAAOI,GAAUJ,EAAK,WACxB,CAoBA,SAASQ,GAASR,GAChB,OAAOI,GAAUJ,EAAK,SACxB,CASA,SAASS,GAAsBT,GAC7B,MACiB,iBAARA,GACC,OAARA,GACA,+BAAgCA,GAChC,+BAAgCA,CAEpC,CASA,SAASU,GAAYV,GACnB,OAAe,OAARA,GAAgBS,GAAsBT,IAAwB,iBAARA,GAAmC,mBAARA,CAC1F,CASA,SAASW,GAAcX,GACrB,OAAOI,GAAUJ,EAAK,SACxB,CASA,SAASY,GAAQZ,GACf,cAAca,MAAU,KAAeX,GAAaF,EAAKa,MAC3D,CA4BA,SAASC,GAAWd,GAElB,SAAeA,IAAOA,EAAIe,MAA4B,mBAAbf,EAAIe,KAC/C,CAoBA,SAASC,GAAMhB,GACb,MAAsB,iBAARA,GAAoBA,GAAQA,CAC5C,CAUA,SAASE,GAAaF,EAAKiB,GACzB,IACE,OAAOjB,aAAeiB,CACxB,OACE,OAAO,CACT,CACF,CAQA,SAASC,GAAelB,GAEtB,QAAyB,iBAARA,GAA4B,OAARA,IAAkBA,EAAMmB,UAAYnB,EAAMoB,OACjF,CCtMA,MAAMC,GAASjC,KAETkC,GAA4B,GAQlC,SAASC,GACPC,EACAC,EAAU,CAAC,GAEX,IAAKD,EACH,MAAO,YAOT,IACE,IAAIE,EAAcF,EAClB,MAAMG,EAAsB,EACtBC,EAAM,GACZ,IAAIC,EAAS,EACTC,EAAM,EACV,MAAMC,EAAY,MACZC,EAAYD,EAAUE,OAC5B,IAAIC,EACJ,MAAMC,EAAWC,MAAMC,QAAQZ,GAAWA,EAAUA,EAAQU,SACtDG,GAAoBF,MAAMC,QAAQZ,IAAYA,EAAQa,iBAAoBhB,GAEhF,KAAOI,GAAeG,IAAWF,IAC/BO,EAAUK,GAAqBb,EAAaS,KAK5B,SAAZD,GAAuBL,EAAS,GAAKC,EAAMF,EAAIK,OAASD,EAAYE,EAAQD,QAAUK,KAI1FV,EAAIY,KAAKN,GAETJ,GAAOI,EAAQD,OACfP,EAAcA,EAAYe,WAG5B,OAAOb,EAAIc,UAAUC,KAAKZ,EAC5B,OACE,MAAO,WACT,CACF,CAOA,SAASQ,GAAqBK,EAAIT,GAChC,MAAMX,EAAOoB,EAIPhB,EAAM,GACZ,IAAIvB,EACAwC,EACAC,EACAC,EACAC,EAEJ,IAAKxB,IAASA,EAAKyB,QACjB,MAAO,GAIT,GAAI5B,GAAO6B,aAEL1B,aAAgB0B,aAAe1B,EAAK2B,SAAW3B,EAAK2B,QAAQC,gBAC9D,OAAO5B,EAAK2B,QAAQC,gBAIxBxB,EAAIY,KAAKhB,EAAKyB,QAAQI,eAGtB,MAAMC,EACJnB,GAAYA,EAASF,OACjBE,EAASoB,OAAOC,GAAWhC,EAAKiC,aAAaD,IAAUE,IAAIF,GAAW,CAACA,EAAShC,EAAKiC,aAAaD,KAClG,KAEN,GAAIF,GAAgBA,EAAarB,OAC/BqB,EAAaK,QAAQC,IACnBhC,EAAIY,KAAM,IAAGoB,EAAY,OAAOA,EAAY,OAAM,QACnD,GAEGpC,EAAKqC,IACPjC,EAAIY,KAAM,IAAGhB,EAAKqC,MAIpBxD,EAAYmB,EAAKnB,UACbA,GAAaG,GAASH,GAExB,IADAwC,EAAUxC,EAAUyD,MAAM,OACrBd,EAAI,EAAGA,EAAIH,EAAQZ,OAAQe,IAC9BpB,EAAIY,KAAM,IAAGK,EAAQG,MAI3B,MAAMe,EAAe,CAAC,aAAc,OAAQ,OAAQ,QAAS,OAC7D,IAAKf,EAAI,EAAGA,EAAIe,EAAa9B,OAAQe,IACnCF,EAAMiB,EAAaf,GACnBD,EAAOvB,EAAKiC,aAAaX,GACrBC,GACFnB,EAAIY,KAAM,IAAGM,MAAQC,OAGzB,OAAOnB,EAAIe,KAAK,GAClB,CA4CA,SAASqB,GAAiBxC,GAExB,IAAKH,GAAO6B,YACV,OAAO,KAGT,IAAIxB,EAAcF,EAElB,QAASwB,EAAI,EAAGA,EADY,EACaA,IAAK,CAC5C,IAAKtB,EACH,OAAO,KAGT,GAAIA,aAAuBwB,aAAexB,EAAYyB,QAAQC,gBAC5D,OAAO1B,EAAYyB,QAAQC,gBAG7B1B,EAAcA,EAAYe,UAC5B,CAEA,OAAO,IACT,CCxLA,MAAMwB,UAAsBC,iBAAqB,KAAeA,iBCC1DC,GAAiB,CACrB,QACA,OACA,OACA,QACA,MACA,SACA,SAIIC,GAEH,CAAC,EAUJ,SAASC,GAAeC,GACtB,KAAM,YAAAvF,GACJ,OAAOuF,IAGT,MAAMC,EAAUxF,EAAWwF,QACrBC,EAAe,CAAC,EAEhBC,EAAgB7E,OAAO8E,KAAKN,IAGlCK,EAAcd,QAAQgB,IACpB,MAAMC,EAAwBR,GAAuBO,GACrDH,EAAaG,GAASJ,EAAQI,GAC9BJ,EAAQI,GAASC,IAGnB,IACE,OAAON,GACT,SAEEG,EAAcd,QAAQgB,IACpBJ,EAAQI,GAASH,EAAaG,EAAK,EAEvC,CACF,CAkCA,MAAME,EAhCN,SAASC,IACP,IAAIC,GAAU,EACd,MAAMF,EAAS,CACbG,OAAQA,KACND,GAAU,GAEZE,QAASA,KACPF,GAAU,GAEZG,UAAWA,IAAMH,GAGnB,OACEZ,GAAeR,QADbM,GACqB3E,IAErBuF,EAAOvF,GAAQ,IAAI6F,KACbJ,GACFV,GAAe,KACbtF,EAAWwF,QAAQjF,GAAO,kBAAYA,SAAa6F,EAAI,EACxD,CAEL,EAGqB7F,IACrBuF,EAAOvF,GAAQ,SAIZuF,CACT,CAEeC,GC/Ef,SAASM,GAASC,EAAKC,EAAM,GAC3B,MAAmB,iBAARD,GAA4B,IAARC,GAGxBD,EAAIpD,QAAUqD,EAFZD,EAEyB,GAAEA,EAAIE,MAAM,EAAGD,OACnD,CAoDA,SAASE,GAASC,EAAOC,GACvB,IAAKtD,MAAMC,QAAQoD,GACjB,MAAO,GAGT,MAAME,EAAS,GAEf,QAAS3C,EAAI,EAAGA,EAAIyC,EAAMxD,OAAQe,IAAK,CACrC,MAAM4C,EAAQH,EAAMzC,GACpB,IAMM9B,GAAe0E,GACjBD,EAAOnD,KAAK,kBAEZmD,EAAOnD,KAAKqD,OAAOD,GAEvB,OACED,EAAOnD,KAAK,+BACd,CACF,CAEA,OAAOmD,EAAOhD,KAAK+C,EACrB,CAuCA,SAASI,GACPC,EACAC,EAAW,GACXC,GAA0B,GAE1B,OAAOD,EAASE,KAAKC,GAlCvB,SAASC,GACPR,EACAO,EACAF,GAA0B,GAE1B,QAAKzF,GAASoF,KJmChB,SAASS,GAASrG,GAChB,OAAOI,GAAUJ,EAAK,SACxB,CIjCMqG,CAASF,GACJA,EAAQG,KAAKV,KAElBpF,GAAS2F,KACJF,EAA0BL,IAAUO,EAAUP,EAAMW,SAASJ,IAIxE,CAiBkCC,CAAkBL,EAAYI,EAASF,GACzE,CCxHA,SAASO,GAAKC,EAAQnH,EAAMoH,GAC1B,KAAMpH,KAAQmH,GACZ,OAGF,MAAME,EAAWF,EAAOnH,GAClBsH,EAAUF,EAAmBC,GAIZ,mBAAZC,GACTC,GAAoBD,EAASD,GAG/BF,EAAOnH,GAAQsH,CACjB,CASA,SAASE,GAAyBlI,EAAKU,EAAMsG,GAC3C,IACEhG,OAAOmH,eAAenI,EAAKU,EAAM,CAE/BsG,MAAOA,EACPoB,UAAU,EACVC,cAAc,GAElB,OACEhD,IAAeY,EAAOqC,IAAK,0CAAyC5H,eAAmBV,EACzF,CACF,CASA,SAASiI,GAAoBD,EAASD,GACpC,IAEEC,EAAQ/G,UAAY8G,EAAS9G,UADf8G,EAAS9G,WAAa,CAAC,EAErCiH,GAAyBF,EAAS,sBAAuBD,EAC3D,OAAe,CACjB,CASA,SAASQ,GAAoBC,GAC3B,OAAOA,EAAKC,mBACd,CAsBA,SAASC,GACP1B,GAIA,GAAI7F,GAAQ6F,GACV,MAAO,CACL2B,QAAS3B,EAAM2B,QACfjI,KAAMsG,EAAMtG,KACZkI,MAAO5B,EAAM4B,SACVC,GAAiB7B,IAEjB,GAAIhF,GAAQgF,GAAQ,CACzB,MAAM8B,EAEP,CACGC,KAAM/B,EAAM+B,KACZC,OAAQC,GAAqBjC,EAAMgC,QACnCE,cAAeD,GAAqBjC,EAAMkC,kBACvCL,GAAiB7B,IAGtB,cAAWmC,YAAgB,KAAe7H,GAAa0F,EAAOmC,eAC5DL,EAAOM,OAASpC,EAAMoC,QAGjBN,CACT,CACE,OAAO9B,CAEX,CAGA,SAASiC,GAAqBD,GAC5B,IACE,OLJJ,SAASK,GAAUjI,GACjB,cAAckI,QAAY,KAAehI,GAAaF,EAAKkI,QAC7D,CKEWD,CAAUL,GAAUrG,GAAiBqG,GAAUhI,OAAOC,UAAUC,SAASG,KAAK2H,EACvF,OACE,MAAO,WACT,CACF,CAGA,SAASH,GAAiB7I,GACxB,GAAmB,iBAARA,GAA4B,OAARA,EAAc,CAC3C,MAAMuJ,EAAiB,CAAC,EACxB,UAAWC,KAAYxJ,EACjBgB,OAAOC,UAAUwI,eAAepI,KAAKrB,EAAKwJ,KAC5CD,EAAeC,GAAaxJ,EAAMwJ,IAGtC,OAAOD,CACT,CACE,MAAO,CAAC,CAEZ,CAuCA,SAASG,GAAkBC,GAOzB,OAAOC,GAAmBD,EAHH,IAAIE,IAI7B,CAEA,SAASD,GAAmBD,EAAYG,GACtC,GAyCF,SAASC,GAAOlD,GACd,IAAK9E,GAAc8E,GACjB,OAAO,EAGT,IACE,MAAMnG,EAAQM,OAAOgJ,eAAenD,GAASnK,YAAYgE,KACzD,OAAQA,GAAiB,WAATA,CAClB,OACE,OAAO,CACT,CACF,CApDMqJ,CAAOJ,GAAa,CAEtB,MAAMM,EAAUH,EAAeI,IAAIP,GACnC,QAAgBzJ,IAAZ+J,EACF,OAAOA,EAGT,MAAME,EAAc,CAAC,EAErBL,EAAeM,IAAIT,EAAYQ,GAE/B,UAAWjG,KAAOlD,OAAO8E,KAAK6D,UACjBA,EAAWzF,GAAS,MAC7BiG,EAAYjG,GAAO0F,GAAmBD,EAAWzF,GAAM4F,IAI3D,OAAOK,CACT,CAEA,GAAI3G,MAAMC,QAAQkG,GAAa,CAE7B,MAAMM,EAAUH,EAAeI,IAAIP,GACnC,QAAgBzJ,IAAZ+J,EACF,OAAOA,EAGT,MAAME,EAAc,GAEpBL,SAAeM,IAAIT,EAAYQ,GAE/BR,EAAW5E,QAASsF,IAClBF,EAAYvG,KAAKgG,GAAmBS,EAAMP,GAAe,GAGpDK,CACT,CAEA,OAAOR,CACT,CC1OA,SAASW,KACP,MACMC,EADMpK,EACOoK,QADPpK,EACqBqK,SAEjC,IAAIC,EAAgBA,IAAsB,GAAhBxK,KAAKyK,SAC/B,IACE,GAAIH,GAAUA,EAAOI,WACnB,OAAOJ,EAAOI,aAAaC,QAAQ,KAAM,IAEvCL,GAAUA,EAAOM,kBACnBJ,EAAgBA,KAKd,MAAMK,EAAa,IAAIC,WAAW,GAClCR,SAAOM,gBAAgBC,GAChBA,EAAW,EAAC,EAGzB,OAEE,CAKF,OAAS,CAAC,KAAS,IAAM,IAAM,IAAM,MAAMF,QAAQ,SAAUI,IAEzDA,GAA0B,GAAlBP,MAA2BO,EAAM,GAAK9J,SAAS,IAE7D,CAEA,SAAS+J,GAAkBC,GACzB,OAAOA,EAAMC,WAAaD,EAAMC,UAAUC,OAASF,EAAMC,UAAUC,OAAO,QAAKlL,CACjF,CAMA,SAASmL,GAAoBH,GAC3B,MAAQvC,UAAS2C,SAAUC,GAAYL,EACvC,GAAIvC,EACF,OAAOA,EAGT,MAAM6C,EAAiBP,GAAkBC,GACzC,OAAIM,EACEA,EAAezC,MAAQyC,EAAexE,MAChC,GAAEwE,EAAezC,SAASyC,EAAexE,QAE5CwE,EAAezC,MAAQyC,EAAexE,OAASuE,GAAW,YAE5DA,GAAW,WACpB,CASA,SAASE,GAAsBP,EAAOlE,EAAO+B,GAC3C,MAAMoC,EAAaD,EAAMC,UAAYD,EAAMC,WAAa,CAAC,EACnDC,EAAUD,EAAUC,OAASD,EAAUC,QAAU,GACjDI,EAAkBJ,EAAO,GAAKA,EAAO,IAAM,CAAC,EAC7CI,EAAexE,QAClBwE,EAAexE,MAAQA,GAAS,IAE7BwE,EAAezC,OAClByC,EAAezC,KAAOA,GAAQ,QAElC,CASA,SAAS2C,GAAsBR,EAAOS,GACpC,MAAMH,EAAiBP,GAAkBC,GACzC,IAAKM,EACH,OAGF,MACMI,EAAmBJ,EAAeK,UAGxC,GAFAL,EAAeK,UAAY,CAFA9C,KAAM,UAAW+C,SAAS,KAEAF,KAAqBD,GAEtEA,GAAgB,SAAUA,EAAc,CAC1C,MAAMI,EAAa,IAAMH,GAAoBA,EAAiBI,QAAUL,EAAaK,MACrFR,EAAeK,UAAUG,KAAOD,CAClC,CACF,CA4EA,SAASE,GAAwBd,GAE/B,GAAIA,GAAcA,EAAYe,oBAC5B,OAAO,EAGT,IAGEhE,GAAyBiD,EAAY,uBAAuB,EAC9D,OACE,CAGF,OAAO,CACT,CAQA,SAASgB,GAASC,GAChB,OAAO5I,MAAMC,QAAQ2I,GAAcA,EAAa,CAACA,EACnD,CC7MA,MAAMC,GAAmB,IAYzB,SAASC,KACP,OAAOC,KAAKC,MAAQH,EACtB,CA0CA,MAAMI,GAlCN,SAASC,KACP,MAAQC,eAAgBxM,EACxB,IAAKwM,IAAgBA,EAAYH,IAC/B,OAAOF,GAKT,MAAMM,EAA2BL,KAAKC,MAAQG,EAAYH,MACpDK,EAAuC3M,MAA1ByM,EAAYE,WAA0BD,EAA2BD,EAAYE,WAWhG,MAAO,KACGA,EAAaF,EAAYH,OAASH,EAE9C,CAW2BK,GAa3B,IAAII,GAMJ,MAAMC,SAKJ,MAAQJ,eAAgBxM,EACxB,IAAKwM,IAAgBA,EAAYH,IAE/B,YADAM,GAAoC,QAItC,MAAME,EAAY,KACZC,EAAiBN,EAAYH,MAC7BU,EAAUX,KAAKC,MAGfW,EAAkBR,EAAYE,WAChC5M,KAAKmN,IAAIT,EAAYE,WAAaI,EAAiBC,GACnDF,EACEK,EAAuBF,EAAkBH,EAQzCM,EAAkBX,EAAYY,QAAUZ,EAAYY,OAAOD,gBAG3DE,EAFgD,iBAApBF,EAEgBrN,KAAKmN,IAAIE,EAAkBL,EAAiBC,GAAWF,EAGzG,OAAIK,GAF8BG,EAAuBR,EAInDG,GAAmBK,GACrBV,GAAoC,aAC7BH,EAAYE,aAEnBC,GAAoC,kBAC7BQ,IAKXR,GAAoC,UAC7BI,EACT,EA/CMH,GCxEA1H,UAAsBC,iBAAqB,KAAeA,iBCAhE,IAAImI,GAiBJ,SAASC,GAAoB1G,GAC3B,OAAO,IAAI2G,GAAYC,IACrBA,EAAQ5G,EAAK,EAEjB,CAQA,SAAS6G,GAAoBC,GAC3B,OAAO,IAAIH,GAAY,CAACI,EAAGC,KACzBA,EAAOF,EAAM,EAEjB,EAjCY,SAAWL,GAEFA,EAAOA,EAAOQ,QAAaA,GAAW,UAErCR,EAAOA,EAAOS,SAAjB,GAA2C,WAExCT,EAAOA,EAAOU,SAAjB,GAA2C,UAC9D,CAPY,CAOTV,KAAWA,GAAS,CAAC,IAgCxB,MAAME,GAEHjR,YACC0R,GACCT,GAAY1M,UAAUoN,OAAOhN,KAAK1E,MAAMgR,GAAY1M,UAAUqN,QAAQjN,KAAK1E,MAAMgR,GAAY1M,UAAUsN,QAAQlN,KAAK1E,MAAMgR,GAAY1M,UAAUuN,QAAQnN,KAAK1E,MAC9JA,KAAK8R,OAAShB,GAAOQ,QACrBtR,KAAK+R,UAAY,GAEjB,IACEN,EAASzR,KAAKgS,SAAUhS,KAAKiS,QAC/B,OAASC,GACPlS,KAAKiS,QAAQC,EACf,CACF,CAGC1M,KACC2M,EACAC,GAEA,OAAO,IAAIpB,GAAY,CAACC,EAASI,KAC/BrR,KAAK+R,UAAU9K,KAAK,EAClB,EACAoL,IACE,GAAKF,EAKH,IACElB,EAAQkB,EAAYE,GACtB,OAASH,GACPb,EAAOa,EACT,MANAjB,EAAQoB,EAMR,EAGJlB,IACE,GAAKiB,EAGH,IACEnB,EAAQmB,EAAWjB,GACrB,OAASe,GACPb,EAAOa,EACT,MANAb,EAAOF,EAMP,IAINnR,KAAKsS,kBAAiB,EAE1B,CAGCC,MACCH,GAEA,OAAOpS,KAAKwF,KAAKgN,GAAOA,EAAKJ,EAC/B,CAGCK,QAAQC,GACP,OAAO,IAAI1B,GAAY,CAACC,EAASI,KAC/B,IAAImB,EACAG,EAEJ,OAAO3S,KAAKwF,KACV6E,IACEsI,GAAa,EACbH,EAAMnI,EACFqI,GACFA,GAAU,EAGdvB,IACEwB,GAAa,EACbH,EAAMrB,EACFuB,GACFA,GAAU,GAGdlN,KAAK,KACDmN,EACFtB,EAAOmB,GAITvB,EAAQuB,EAAI,EACb,EAEL,CAGEd,SAAU1R,KAAKgS,SAAY3H,IAC3BrK,KAAK4S,WAAW9B,GAAOS,SAAUlH,EAAK,CACtC,CAGAsH,UAAW3R,KAAKiS,QAAWd,IAC3BnR,KAAK4S,WAAW9B,GAAOU,SAAUL,EAAM,CACvC,CAGAS,UAAW5R,KAAK4S,WAAa,CAACC,EAAOxI,KACrC,GAAIrK,KAAK8R,SAAWhB,GAAOQ,QAI3B,IAAI/L,GAAW8E,GAEb,YADMA,EAAQ7E,KAAKxF,KAAKgS,SAAUhS,KAAKiS,SAIzCjS,KAAK8R,OAASe,EACd7S,KAAK8S,OAASzI,EAEdrK,KAAKsS,kBAAiB,EACtB,CAGAT,UAAW7R,KAAKsS,iBAAmB,KACnC,GAAItS,KAAK8R,SAAWhB,GAAOQ,QACzB,OAGF,MAAMyB,EAAiB/S,KAAK+R,UAAU/H,QACtChK,KAAK+R,UAAY,GAEjBgB,EAAe3K,QAAQ4K,IACjBA,EAAQ,KAIRhT,KAAK8R,SAAWhB,GAAOS,UAEzByB,EAAQ,GAAGhT,KAAK8S,QAGd9S,KAAK8R,SAAWhB,GAAOU,UACzBwB,EAAQ,GAAGhT,KAAK8S,QAGlBE,EAAQ,IAAK,IACd,CACD,ECpLJ,SAASC,KACP,OAAOnP,GAAmB,wBAAyB,IAAM,GAC3D,CAMA,SAASoP,GAAwBnK,GAE/BkK,KAA2BhM,KAAK8B,EAClC,CAKA,SAASoK,GACPC,EACA7E,EACA8E,EACAC,EAAQ,GAER,OAAO,IAAItC,GAAY,CAACC,EAASI,KAC/B,MAAMkC,EAAYH,EAAWE,GAC7B,GAAc,OAAV/E,GAAuC,mBAAdgF,EAC3BtC,EAAQ1C,OACH,CACL,MAAM8D,EAASkB,EAAU,IAAKhF,GAAS8E,GAEvC3K,IAAe6K,EAAUjL,IAAiB,OAAX+J,GAAmB/I,EAAOqC,IAAK,oBAAmB4H,EAAUjL,qBAEvF/C,GAAW8M,GACRA,EACF7M,KAAKgO,GAASL,GAAsBC,EAAYI,EAAOH,EAAMC,EAAQ,GAAG9N,KAAKyL,IAC7EzL,KAAK,KAAM6L,GAET8B,GAAsBC,EAAYf,EAAQgB,EAAMC,EAAQ,GAC1D9N,KAAKyL,GACLzL,KAAK,KAAM6L,EAElB,GAEJ,CCvCA,SAASoC,GAAYC,GAEnB,MAAMC,EAAe7D,KAEf8D,EAAU,CACdC,IAAKlG,KACLmG,MAAM,EACNC,UAAWJ,EACXK,QAASL,EACTM,SAAU,EACVC,OAAQ,KACRC,OAAQ,EACRC,gBAAgB,EAChBC,OAAQA,IAkHZ,SAASC,EAAcV,GACrB,OAAO7G,GAAkB,CACvB8G,IAAM,GAAED,EAAQC,MAChBC,KAAMF,EAAQE,KAEdE,QAAS,IAAIpE,KAAuB,IAAlBgE,EAAQI,SAAgBO,cAC1CR,UAAW,IAAInE,KAAyB,IAApBgE,EAAQG,WAAkBQ,cAC9CL,OAAQN,EAAQM,OAChBC,OAAQP,EAAQO,OAChBK,IAA4B,iBAAhBZ,EAAQY,KAA2C,iBAAhBZ,EAAQY,IAAoB,GAAEZ,EAAQY,WAAQjR,EAC7F0Q,SAAUL,EAAQK,SAClBQ,mBAAoBb,EAAQa,mBAC5BC,MAAO,CACLC,QAASf,EAAQe,QACjB/S,YAAagS,EAAQhS,YACrBgT,WAAYhB,EAAQiB,UACpBC,WAAYlB,EAAQmB,YAG1B,CArIkBT,CAAcV,IAG9B,OAAIF,GACFsB,GAAcpB,EAASF,GAGlBE,CACT,CAcA,SAASoB,GAAcpB,EAASF,EAAU,CAAC,GAiCzC,GAhCIA,EAAQuB,QACLrB,EAAQiB,WAAanB,EAAQuB,KAAKL,aACrChB,EAAQiB,UAAYnB,EAAQuB,KAAKL,aAG9BhB,EAAQY,MAAQd,EAAQc,MAC3BZ,EAAQY,IAAMd,EAAQuB,KAAK3M,IAAMoL,EAAQuB,KAAKC,OAASxB,EAAQuB,KAAKE,WAIxEvB,EAAQG,UAAYL,EAAQK,WAAajE,KAErC4D,EAAQe,qBACVb,EAAQa,mBAAqBf,EAAQe,oBAGnCf,EAAQU,iBACVR,EAAQQ,eAAiBV,EAAQU,gBAE/BV,EAAQG,MAEVD,EAAQC,IAA6B,KAAvBH,EAAQG,IAAInN,OAAgBgN,EAAQG,IAAMlG,WAErCpK,IAAjBmQ,EAAQI,OACVF,EAAQE,KAAOJ,EAAQI,OAEpBF,EAAQY,KAAOd,EAAQc,MAC1BZ,EAAQY,IAAO,GAAEd,EAAQc,OAEI,iBAApBd,EAAQM,UACjBJ,EAAQI,QAAUN,EAAQM,SAExBJ,EAAQQ,eACVR,EAAQK,cAAW1Q,UACkB,iBAArBmQ,EAAQO,SACxBL,EAAQK,SAAWP,EAAQO,aACtB,CACL,MAAMA,EAAWL,EAAQG,UAAYH,EAAQI,QAC7CJ,EAAQK,SAAWA,GAAY,EAAIA,EAAW,CAChD,CACIP,EAAQiB,UACVf,EAAQe,QAAUjB,EAAQiB,SAExBjB,EAAQ9R,cACVgS,EAAQhS,YAAc8R,EAAQ9R,cAE3BgS,EAAQiB,WAAanB,EAAQmB,YAChCjB,EAAQiB,UAAYnB,EAAQmB,YAEzBjB,EAAQmB,WAAarB,EAAQqB,YAChCnB,EAAQmB,UAAYrB,EAAQqB,WAEA,iBAAnBrB,EAAQS,SACjBP,EAAQO,OAAST,EAAQS,QAEvBT,EAAQQ,SACVN,EAAQM,OAASR,EAAQQ,OAE7B,CAaA,SAASkB,GAAaxB,EAASM,GAC7B,IAAIR,EAAU,CAAC,EACXQ,EACFR,EAAU,CAAEQ,UACgB,OAAnBN,EAAQM,SACjBR,EAAU,CAAEQ,OAAQ,WAGtBc,GAAcpB,EAASF,EACzB,CCtHA,SAAS2B,EAAYC,GAGnB,OAAOA,EAAKC,WACd,CCRA,MAAMC,EAAsB,UAEtBC,GAA4B,UAE5BC,GAAkC,WAOlCC,GAA4B,KAmElC,SAASC,GAEPC,GAEA,GAAKA,EAeL,OA0BF,SAASC,GAAsBC,GAC7B,GAAmC,IAA/B1R,OAAO8E,KAAK4M,GAAQrP,OAKxB,OAAOrC,OAAO2R,QAAQD,GAAQE,OAAO,CAACC,GAAgBC,EAAWC,GAAcC,KAC7E,MAAMC,EAAgB,GAAEC,mBAAmBJ,MAAcI,mBAAmBH,KACtEI,EAAoC,IAAjBH,EAAqBC,EAAgB,GAAEJ,KAAiBI,IACjF,OAAIE,EAAiB9P,OAASiP,IAC5BjN,IACEY,EAAOmN,KACJ,mBAAkBN,eAAuBC,6DAEvCF,GAEAM,GAER,GACL,CA7CSV,CAVmBzR,OAAO2R,QAAQH,GAAwBI,OAC/D,CAACS,GAAMC,EAAQC,MACTA,IACFF,EAAK,GAAEjB,KAA4BkB,KAAYC,GAE1CF,GAET,CAAC,GAIL,CAQA,SAASG,GAAsBX,GAC7B,OAAOA,EACJ3N,MAAM,KACNJ,IAAImO,GAAgBA,EAAa/N,MAAM,KAAKJ,IAAI2O,GAAcC,mBAAmBD,EAAWE,UAC5Ff,OAAO,CAACS,GAAMnP,EAAK8C,MAClBqM,EAAInP,GAAO8C,EACJqM,GACN,CAAC,EACR,CClHA,MAAMO,GAAqB,IAAIC,OAC7B,6DA4EF,SAASC,EACPC,EAAUzJ,KACV0J,EAAS1J,KAAQ2J,UAAU,IAC3BC,GAEA,IAAIC,EAAgB,GACpB,YAAgBjU,IAAZgU,IACFC,EAAgBD,EAAU,KAAO,MAE3B,GAAEH,KAAWC,IAASG,GAChC,CCxFA,MACMC,GAAqB,EAK3B,SAASC,GAAmBpC,GAC1B,MAAQ+B,OAAQM,EAASP,QAASQ,GAAatC,EAAKuC,eAC5CxI,OAAMyI,KAAIC,iBAAgB7D,SAAQ8D,OAAMC,UAAWC,GAAW5C,GAEtE,OAAOvI,GAAkB,CACvBsC,OACAyI,KACAC,iBACAJ,UACAzD,SACA8D,OACAJ,WACAK,UAEJ,CAKA,SAASE,GAAkB7C,GACzB,MAAQ8B,UAASC,UAAW/B,EAAKuC,cAEjC,OAAOV,EAA0BC,EAASC,EAD1Be,GAAc9C,GAEhC,CAKA,SAAS+C,GAAuBnO,GAC9B,MAAqB,iBAAVA,EACFoO,GAAyBpO,GAG9BrD,MAAMC,QAAQoD,GAETA,EAAM,GAAKA,EAAM,GAAK,IAG3BA,aAAiB0F,KACZ0I,GAAyBpO,EAAMqO,WAGjCzI,IACT,CAKA,SAASwI,GAAyBvE,GAEhC,OADaA,EAAY,WACXA,EAAY,IAAOA,CACnC,CAWA,SAASmE,GAAW5C,GAClB,OAkBF,SAASkD,GAAgBlD,GACvB,MAAsC,mBAAvBA,EAAOmD,WACxB,CApBMD,CAAgBlD,GACXA,EAAKmD,cAKa,mBAAhBnD,EAAKjB,OAEPiB,EAAKjB,SAGP,CAAC,CACV,CAgBA,SAAS+D,GAAc9C,GAGrB,MAAQoD,cAAepD,EAAKuC,cAE5B,SAAea,EAAajB,GAC9B,CC/FA,SAASkB,GACPf,EACAgB,EACAC,GAEA,MAAM3S,EAAU0S,EAAOE,cAEfC,UAAWC,GAAeJ,EAAOK,UAAY,CAAC,GAG9CC,QAASC,GAAkBN,GAASA,EAAMO,WAAc,CAAC,EAE3DC,EAAMtM,GAAkB,CAC5BnL,YAAasE,EAAQtE,aAAeuC,EACpCwQ,QAASzO,EAAQyO,QACjBwE,eACAH,aACApB,aAGFgB,SAAOU,MAAQV,EAAOU,KAAK,YAAaD,GAEjCA,CACT,CAaA,SAASE,GAAkCjE,GACzC,MAAMsD,EAASY,KACf,IAAKZ,EACH,MAAO,CAAC,EAIV,MAAMS,EAAMV,GAAoCT,GAAW5C,GAAMsC,UAAY,GAAIgB,EAAQa,MAGnFC,EAAMrE,EAAYC,GACxB,IAAKoE,EACH,OAAOL,EAMT,MAAMM,EAAcD,GAAOA,EAAIE,8BAC/B,GAAID,EACF,OAAOA,EAMT,MAAQE,WAAYC,EAAiB5O,UAAWwO,EAAIK,SAC7B,MAAnBD,IACFT,EAAIW,YAAe,GAAEF,KAIvB,MAAMG,EAAW/B,GAAWwB,GAG5B,OAAIxO,GAAqB,QAAXA,IACZmO,EAAI9D,YAAc0E,EAASC,aAG7Bb,EAAI9B,QAAUjN,OAAO8N,GAAcsB,IAEnCd,EAAOU,MAAQV,EAAOU,KAAK,YAAaD,GAEjCA,CACT,CCnFA,SAASc,GAAsB5L,EAAOc,GACpC,MAAQ+K,cAAa9E,OAAM+E,cAAaC,wBAAuBC,sBAAuBlL,GA4FxF,SAASmL,GAAiBjM,EAAOc,GAC/B,MACEoL,QACAzC,OACA/C,OACAyF,WACAtR,QAEAuR,mBACEtL,EAEEuL,EAAe7N,GAAkB0N,GACnCG,GAAgBvW,OAAO8E,KAAKyR,GAAclU,SAC5C6H,EAAMkM,MAAQ,IAAKG,KAAiBrM,EAAMkM,QAG5C,MAAMI,EAAc9N,GAAkBiL,GAClC6C,GAAexW,OAAO8E,KAAK0R,GAAanU,SAC1C6H,EAAMyJ,KAAO,IAAK6C,KAAgBtM,EAAMyJ,OAG1C,MAAM8C,EAAc/N,GAAkBkI,GAClC6F,GAAezW,OAAO8E,KAAK2R,GAAapU,SAC1C6H,EAAM0G,KAAO,IAAK6F,KAAgBvM,EAAM0G,OAG1C,MAAM8F,EAAkBhO,GAAkB2N,GACtCK,GAAmB1W,OAAO8E,KAAK4R,GAAiBrU,SAClD6H,EAAMmM,SAAW,IAAKK,KAAoBxM,EAAMmM,WAG9CtR,IACFmF,EAAMnF,MAAQA,GAGZuR,IACFpM,EAAMgH,YAAcoF,EAExB,EA/HEH,CAAiBjM,EAAOc,GAKpBiG,GA6IN,SAAS0F,GAAiBzM,EAAO+G,GAC/B/G,EAAMmM,SAAW,CAAEO,MAAOvD,GAAmBpC,MAAU/G,EAAMmM,UAC7D,MAAMQ,EAAW7F,EAAYC,GAC7B,GAAI4F,EAAU,CACZ3M,EAAM+L,sBAAwB,CAC5BzE,uBAAwB0D,GAAkCjE,MACvD/G,EAAM+L,uBAEX,MAAMK,EAAkBzC,GAAWgD,GAAUhB,YACzCS,IACFpM,EAAMyJ,KAAO,CAAEzC,YAAaoF,KAAoBpM,EAAMyJ,MAE1D,CACF,CAzJIgD,CAAiBzM,EAAO+G,GA+J5B,SAAS6F,GAAwB5M,EAAO6L,GAEtC7L,EAAM6L,YAAc7L,EAAM6L,YAAc5K,GAASjB,EAAM6L,aAAe,GAGlEA,IACF7L,EAAM6L,YAAc7L,EAAM6L,YAAYgB,OAAOhB,IAI3C7L,EAAM6L,cAAgB7L,EAAM6L,YAAY1T,eACnC6H,EAAM6L,WAEjB,CAzKEe,CAAwB5M,EAAO6L,GAwHjC,SAASiB,GAAwB9M,EAAO8L,GACtC,MAAMiB,EAAoB,IAAK/M,EAAM8L,aAAe,MAAQA,GAC5D9L,EAAM8L,YAAciB,EAAkB5U,OAAS4U,OAAoB/X,CACrE,CA1HE8X,CAAwB9M,EAAO8L,GA4HjC,SAASkB,GACPhN,EACA+L,EACAC,GAEAhM,EAAM+L,sBAAwB,IACzB/L,EAAM+L,yBACNA,EACHC,mBAAoBA,EAExB,CArIEgB,CAAwBhN,EAAO+L,EAAuBC,EACxD,CAGA,SAASiB,GAAenM,EAAMoM,GAC5B,MACEhB,QACAzC,OACA/C,OACAyF,WACAtR,QACAkR,wBACAD,cACAD,cACAsB,kBACAC,cACApB,qBAEAI,mBACArF,SACEmG,EAEJG,GAA2BvM,EAAM,QAASoL,GAC1CmB,GAA2BvM,EAAM,OAAQ2I,GACzC4D,GAA2BvM,EAAM,OAAQ4F,GACzC2G,GAA2BvM,EAAM,WAAYqL,GAC7CkB,GAA2BvM,EAAM,wBAAyBiL,GAEtDlR,IACFiG,EAAKjG,MAAQA,GAGXuR,KAEFtL,EAAKsL,gBAAkBA,IAGrBrF,KACFjG,EAAKiG,KAAOA,IAGV+E,EAAY3T,SACd2I,EAAKgL,YAAc,IAAIhL,EAAKgL,eAAgBA,IAG1CD,EAAY1T,SACd2I,EAAK+K,YAAc,IAAI/K,EAAK+K,eAAgBA,IAG1CsB,EAAgBhV,SAClB2I,EAAKqM,gBAAkB,IAAIrM,EAAKqM,mBAAoBA,IAGlDC,EAAYjV,SACd2I,EAAKsM,YAAc,IAAItM,EAAKsM,eAAgBA,IAG9CtM,EAAKkL,mBAAqB,IAAKlL,EAAKkL,sBAAuBA,EAC7D,CAMA,SAASqB,GAERvM,EAAMwM,EAAMC,GACX,GAAIA,GAAYzX,OAAO8E,KAAK2S,GAAUpV,OAAQ,CAE5C2I,EAAKwM,GAAQ,IAAKxM,EAAKwM,IACvB,UAAWtU,KAAOuU,EACZzX,OAAOC,UAAUwI,eAAepI,KAAKoX,EAAUvU,KACjD8H,EAAKwM,GAAMtU,GAAOuU,EAASvU,GAGjC,CACF,CCrFA,IAAIwU,GAMJ,MAAMC,GA6CHjc,cACCC,KAAKic,qBAAsB,EAC3Bjc,KAAKkc,gBAAkB,GACvBlc,KAAKmc,iBAAmB,GACxBnc,KAAKoc,aAAe,GACpBpc,KAAKqc,aAAe,GACpBrc,KAAKsc,MAAQ,CAAC,EACdtc,KAAKuc,MAAQ,CAAC,EACdvc,KAAKwc,OAAS,CAAC,EACfxc,KAAKyc,UAAY,CAAC,EAClBzc,KAAK0c,uBAAyB,CAAC,EAC/B1c,KAAK2c,oBAAsBC,IAC7B,CAMC,YAAOC,CAAMhE,GACZ,OAAOA,EAAQA,EAAMgE,QAAU,IAAIb,EACrC,CAKCa,QACC,MAAMC,EAAW,IAAId,GACrBc,SAASV,aAAe,IAAIpc,KAAKoc,cACjCU,EAASP,MAAQ,IAAKvc,KAAKuc,OAC3BO,EAASN,OAAS,IAAKxc,KAAKwc,QAC5BM,EAASL,UAAY,IAAKzc,KAAKyc,WAC/BK,EAASR,MAAQtc,KAAKsc,MACtBQ,EAASC,OAAS/c,KAAK+c,OACvBD,EAASE,MAAQhd,KAAKgd,MACtBF,EAASG,SAAWjd,KAAKid,SACzBH,EAASI,iBAAmBld,KAAKkd,iBACjCJ,EAASK,aAAend,KAAKmd,aAC7BL,EAASX,iBAAmB,IAAInc,KAAKmc,kBACrCW,EAASM,gBAAkBpd,KAAKod,gBAChCN,EAAST,aAAe,IAAIrc,KAAKqc,cACjCS,EAASJ,uBAAyB,IAAK1c,KAAK0c,wBAC5CI,EAASH,oBAAsB,IAAK3c,KAAK2c,qBACzCG,EAASO,QAAUrd,KAAKqd,QAEjBP,CACT,CAGCQ,UAAU1E,GACT5Y,KAAKqd,QAAUzE,CACjB,CAOCY,YACC,OAAOxZ,KAAKqd,OACd,CAMCE,iBAAiBxU,GAChB/I,KAAKkc,gBAAgBjV,KAAK8B,EAC5B,CAKCyU,kBAAkBzU,GACjB,OAAA/I,KAAKmc,iBAAiBlV,KAAK8B,GACpB/I,IACT,CAKCyd,QAAQxI,GAGP,OAAAjV,KAAKsc,MAAQrH,GAAQ,CACnBC,WAAO3R,EACP+E,QAAI/E,EACJqR,gBAAYrR,EACZ2V,aAAS3V,EACT4R,cAAU5R,GAGRvD,KAAKid,UACPjI,GAAchV,KAAKid,SAAU,CAAEhI,SAGjCjV,KAAK0d,wBACE1d,IACT,CAKCoZ,UACC,OAAOpZ,KAAKsc,KACd,CAKCqB,oBACC,OAAO3d,KAAKod,eACd,CAKCQ,kBAAkBC,GACjB,OAAA7d,KAAKod,gBAAkBS,EAChB7d,IACT,CAKC8d,QAAQ9F,GACP,OAAAhY,KAAKuc,MAAQ,IACRvc,KAAKuc,SACLvE,GAELhY,KAAK0d,wBACE1d,IACT,CAKC+d,OAAOxW,EAAK8C,GACX,OAAArK,KAAKuc,MAAQ,IAAKvc,KAAKuc,MAAOyB,CAACzW,GAAM8C,GACrCrK,KAAK0d,wBACE1d,IACT,CAKCie,UAAUC,GACT,OAAAle,KAAKwc,OAAS,IACTxc,KAAKwc,UACL0B,GAELle,KAAK0d,wBACE1d,IACT,CAKCme,SAAS5W,EAAKkT,GACb,OAAAza,KAAKwc,OAAS,IAAKxc,KAAKwc,OAAQwB,CAACzW,GAAMkT,GACvCza,KAAK0d,wBACE1d,IACT,CAKCoe,eAAehE,GACd,OAAApa,KAAKmd,aAAe/C,EACpBpa,KAAK0d,wBACE1d,IACT,CAKCqe,SAECjV,GAEA,OAAApJ,KAAK+c,OAAS3T,EACdpJ,KAAK0d,wBACE1d,IACT,CAMCse,mBAAmBva,GAClB,OAAA/D,KAAKkd,iBAAmBnZ,EACxB/D,KAAK0d,wBACE1d,IACT,CAKCue,WAAWhX,EAAKmM,GACf,OAAgB,OAAZA,SAEK1T,KAAKyc,UAAUlV,GAEtBvH,KAAKyc,UAAUlV,GAAOmM,EAGxB1T,KAAK0d,wBACE1d,IACT,CAOCwe,QAAQlJ,GACP,OAAAtV,KAAKgd,MAAQ1H,EACbtV,KAAK0d,wBACE1d,IACT,CAMCye,UACC,OAAOze,KAAKgd,KACd,CAMC0B,iBAGC,MAAMpJ,EAAOtV,KAAKgd,MAIlB,OAAO1H,GAAQA,EAAKC,WACtB,CAKCoJ,WAAW/K,GACV,OAAKA,EAGH5T,KAAKid,SAAWrJ,SAFT5T,KAAKid,SAIdjd,KAAK0d,wBACE1d,IACT,CAKC4e,aACC,OAAO5e,KAAKid,QACd,CAKC4B,OAAOC,GACN,IAAKA,EACH,OAAO9e,KAGT,GAA8B,mBAAnB8e,EAA+B,CACxC,MAAMC,EAAgBD,EAAiB9e,MACvC,OAAO+e,aAAwB/C,GAAQ+C,EAAe/e,IACxD,CAEA,OAAI8e,aAA0B9C,IAC5Bhc,KAAKuc,MAAQ,IAAKvc,KAAKuc,SAAUuC,EAAevC,OAChDvc,KAAKwc,OAAS,IAAKxc,KAAKwc,UAAWsC,EAAetC,QAClDxc,KAAKyc,UAAY,IAAKzc,KAAKyc,aAAcqC,EAAerC,WACpDqC,EAAexC,OAASjY,OAAO8E,KAAK2V,EAAexC,OAAO5V,SAC5D1G,KAAKsc,MAAQwC,EAAexC,OAE1BwC,EAAe/B,SACjB/c,KAAK+c,OAAS+B,EAAe/B,QAE3B+B,EAAe3B,eACjBnd,KAAKmd,aAAe2B,EAAe3B,cAEjC2B,EAAe1B,kBACjBpd,KAAKod,gBAAkB0B,EAAe1B,iBAEpC0B,EAAenC,sBACjB3c,KAAK2c,oBAAsBmC,EAAenC,sBAEnCvX,GAAc0Z,KAGvB9e,KAAKuc,MAAQ,IAAKvc,KAAKuc,SAAUuC,EAAe9G,MAChDhY,KAAKwc,OAAS,IAAKxc,KAAKwc,UAAWsC,EAAerE,OAClDza,KAAKyc,UAAY,IAAKzc,KAAKyc,aAAcqC,EAAepE,UACpDoE,EAAe7J,OACjBjV,KAAKsc,MAAQwC,EAAe7J,MAE1B6J,EAAe1V,QACjBpJ,KAAK+c,OAAS+B,EAAe1V,OAE3B0V,EAAe1E,cACjBpa,KAAKmd,aAAe2B,EAAe1E,aAEjC0E,EAAejB,iBACjB7d,KAAKod,gBAAkB0B,EAAejB,gBAEpCiB,EAAevE,qBACjBva,KAAK2c,oBAAsBmC,EAAevE,qBAIvCva,IACT,CAKCgf,QACC,OAAAhf,KAAKoc,aAAe,GACpBpc,KAAKuc,MAAQ,CAAC,EACdvc,KAAKwc,OAAS,CAAC,EACfxc,KAAKsc,MAAQ,CAAC,EACdtc,KAAKyc,UAAY,CAAC,EAClBzc,KAAK+c,YAASxZ,EACdvD,KAAKkd,sBAAmB3Z,EACxBvD,KAAKmd,kBAAe5Z,EACpBvD,KAAKod,qBAAkB7Z,EACvBvD,KAAKgd,WAAQzZ,EACbvD,KAAKid,cAAW1Z,EAChBvD,KAAK0d,wBACL1d,KAAKqc,aAAe,GACpBrc,KAAK2c,oBAAsBC,KACpB5c,IACT,CAKCif,cAAcC,EAAYC,GACzB,MAAMC,EAAsC,iBAAnBD,EAA8BA,EAlZ3B,IAqZ5B,GAAIC,GAAa,EACf,OAAOpf,KAGT,MAAMqf,EAAmB,CACvBtL,UAAWpE,QACRuP,GAGC7E,EAAcra,KAAKoc,aACzB/B,SAAYpT,KAAKoY,GACjBrf,KAAKoc,aAAe/B,EAAY3T,OAAS0Y,EAAY/E,EAAYrQ,OAAOoV,GAAa/E,EAErFra,KAAK0d,wBAEE1d,IACT,CAKCsf,oBACC,OAAOtf,KAAKoc,aAAapc,KAAKoc,aAAa1V,OAAS,EACtD,CAKC6Y,mBACC,OAAAvf,KAAKoc,aAAe,GACpBpc,KAAK0d,wBACE1d,IACT,CAKCwf,cAAcC,GACb,OAAAzf,KAAKqc,aAAapV,KAAKwY,GAChBzf,IACT,CAMC0f,iBAGC,OAFa1f,KAAK2f,eAENhE,WACd,CAKCiE,mBACC,OAAA5f,KAAKqc,aAAe,GACbrc,IACT,CAGC2f,eACC,MACEvD,eACAC,eACAI,YACAF,QACAC,SACAF,QACAS,SACAI,eACAhB,mBACAQ,sBACAD,yBACAQ,mBACAF,UACEhd,KAEJ,MAAO,CACLqa,YAAa+B,EACbT,YAAaU,EACb3B,SAAU+B,EACVzE,KAAMuE,EACN9B,MAAO+B,EACPvH,KAAMqH,EACNlT,MAAO2T,EACP3C,YAAa+C,GAAgB,GAC7BzB,gBAAiBS,EACjB5B,mBAAoBoC,EACpBrC,sBAAuBoC,EACvB/B,gBAAiBuC,EACjB5H,KAAM0H,GAEV,CAUC6C,aACCtR,EACA8E,EAAO,CAAC,EACRyM,EAA4B,IAY5B,OAVA3F,GAAsB5L,EAAOvO,KAAK2f,gBAU3BxM,GAPiB,IACnB2M,KAEA7M,QACAjT,KAAKmc,kBAGoC5N,EAAO8E,EACvD,CAKC0M,yBAAyBC,GACxB,OAAAhgB,KAAK0c,uBAAyB,IAAK1c,KAAK0c,0BAA2BsD,GAE5DhgB,IACT,CAKCigB,sBAAsBvM,GACrB,OAAA1T,KAAK2c,oBAAsBjJ,EACpB1T,IACT,CAKCkgB,wBACC,OAAOlgB,KAAK2c,mBACd,CASCwD,iBAAiB3R,EAAW6E,GAC3B,MAAMzE,EAAUyE,GAAQA,EAAK1E,SAAW0E,EAAK1E,SAAWhB,KAExD,IAAK3N,KAAKqd,QACR/T,SAAOmN,KAAK,+DACL7H,EAGT,MAAMwR,EAAqB,IAAIxb,MAAM,6BAErC,OAAA5E,KAAKqd,QAAQ8C,iBACX3R,EACA,CACE6R,kBAAmB7R,EACnB4R,wBACG/M,EACH1E,SAAUC,GAEZ5O,MAGK4O,CACT,CAUC0R,eAAetU,EAAS5C,EAAOiK,GAC9B,MAAMzE,EAAUyE,GAAQA,EAAK1E,SAAW0E,EAAK1E,SAAWhB,KAExD,IAAK3N,KAAKqd,QACR/T,SAAOmN,KAAK,6DACL7H,EAGT,MAAMwR,EAAqB,IAAIxb,MAAMoH,GAErC,OAAAhM,KAAKqd,QAAQiD,eACXtU,EACA5C,EACA,CACEiX,kBAAmBrU,EACnBoU,wBACG/M,EACH1E,SAAUC,GAEZ5O,MAGK4O,CACT,CASC2R,aAAahS,EAAO8E,GACnB,MAAMzE,EAAUyE,GAAQA,EAAK1E,SAAW0E,EAAK1E,SAAWhB,KAExD,OAAK3N,KAAKqd,SAKVrd,KAAKqd,QAAQkD,aAAahS,EAAO,IAAK8E,EAAM1E,SAAUC,GAAW5O,MAE1D4O,IANLtF,EAAOmN,KAAK,2DACL7H,EAMX,CAKC8O,wBAIM1d,KAAKic,sBACRjc,KAAKic,qBAAsB,EAC3Bjc,KAAKkc,gBAAgB9T,QAAQW,IAC3BA,EAAS/I,KAAI,GAEfA,KAAKic,qBAAsB,EAE/B,EAwBF,SAASW,KACP,MAAO,CACLxF,QAASzJ,KACT0J,OAAQ1J,KAAQ2J,UAAU,IAE9B,CC7qBA,MAAMkJ,GAAc,SCedC,GAAcC,WAAWF,IAMzBG,GAAsB,IAK5B,MAAMC,GAaH7gB,YACC6Y,EACAC,EACAgI,EACEC,EAAWL,IAEb,IAAIM,EAQAC,EATHhhB,KAAK8gB,SAAWA,EAEZjI,EAIHkI,EAAgBlI,GAHhBkI,EAAgB,IAAI/E,GACpB+E,EAAczD,UAAU1E,IAMrBiI,EAIHG,EAAyBH,GAHzBG,EAAyB,IAAIhF,GAC7BgF,EAAuB1D,UAAU1E,IAKnC5Y,KAAKihB,OAAS,CAAC,CAAEpI,MAAOkI,IAEpBnI,GAEF5Y,KAAKkhB,WAAWtI,GAGlB5Y,KAAKmhB,gBAAkBH,CACzB,CAUCI,YAAYC,GACX,OAAOrhB,KAAK8gB,SAAWO,CACzB,CAQCH,WAAWtI,GAEV,MAAM0I,EAAMthB,KAAKuhB,cACjBD,EAAI1I,OAASA,EACb0I,EAAIzI,MAAMyE,UAAU1E,GAEhBA,GAAUA,EAAO4I,mBAEnB5I,EAAO4I,mBAEX,CAOCC,YAGC,MAAM5I,EAAQ7Y,KAAK0hB,WAAW7E,QAE9B,OAAA7c,KAAK2hB,WAAW1a,KAAK,CAEnB2R,OAAQ5Y,KAAKwZ,YACbX,UAEKA,CACT,CAOC+I,WAEC,QAAI5hB,KAAK2hB,WAAWjb,QAAU,IAErB1G,KAAK2hB,WAAWE,MAC3B,CAOCC,UAAU/Y,GAET,MAAM8P,EAAQ7Y,KAAKyhB,YAEnB,IAAIM,EACJ,IACEA,EAAqBhZ,EAAS8P,EAChC,OAAS3G,GAEP,MAAAlS,KAAK4hB,WACC1P,CACR,CAEA,OAAI3M,GAAWwc,GAENA,EAAmBvc,KACxBwc,IAEEhiB,KAAK4hB,WACEI,GAET9P,IAEE,MAAAlS,KAAK4hB,WACC1P,KAMZlS,KAAK4hB,WACEG,EACT,CAOCvI,YAEC,OAAOxZ,KAAKuhB,cAAc3I,MAC5B,CAOC8I,WAEC,OAAO1hB,KAAKuhB,cAAc1I,KAC5B,CAKCoJ,oBACC,OAAOjiB,KAAKmhB,eACd,CAMCQ,WACC,OAAO3hB,KAAKihB,MACd,CAMCM,cACC,OAAOvhB,KAAKihB,OAAOjhB,KAAKihB,OAAOva,OAAS,EAC1C,CAOCyZ,iBAAiB3R,EAAW6E,GAC3B,MAAMzE,EAAW5O,KAAKkiB,aAAe7O,GAAQA,EAAK1E,SAAW0E,EAAK1E,SAAWhB,KACvEyS,EAAqB,IAAIxb,MAAM,6BAErC,OAAA5E,KAAK0hB,WAAWvB,iBAAiB3R,EAAW,CAC1C6R,kBAAmB7R,EACnB4R,wBACG/M,EACH1E,SAAUC,IAGLA,CACT,CAOC0R,eACCtU,EAEA5C,EACAiK,GAEA,MAAMzE,EAAW5O,KAAKkiB,aAAe7O,GAAQA,EAAK1E,SAAW0E,EAAK1E,SAAWhB,KACvEyS,EAAqB,IAAIxb,MAAMoH,GAErC,OAAAhM,KAAK0hB,WAAWpB,eAAetU,EAAS5C,EAAO,CAC7CiX,kBAAmBrU,EACnBoU,wBACG/M,EACH1E,SAAUC,IAGLA,CACT,CAOC2R,aAAahS,EAAO8E,GACnB,MAAMzE,EAAUyE,GAAQA,EAAK1E,SAAW0E,EAAK1E,SAAWhB,KACxD,OAAKY,EAAMnC,OACTpM,KAAKkiB,aAAetT,GAGtB5O,KAAK0hB,WAAWnB,aAAahS,EAAO,IAAK8E,EAAM1E,SAAUC,IAClDA,CACT,CAOCuT,cACC,OAAOniB,KAAKkiB,YACd,CAOCjD,cAAcC,EAAY7L,GAEzB,MAAQwF,QAAOD,UAAW5Y,KAAKuhB,cAE/B,IAAK3I,EAAQ,OAEb,MAAQwJ,mBAAmB,KAAMjD,iBAAiBwB,IAC/C/H,EAAOE,YAAcF,EAAOE,cAAiB,CAAC,EAEjD,GAAIqG,GAAkB,EAAG,OAGzB,MAAME,EAAmB,CAAEtL,UADTpE,QACuBuP,GACnCmD,EAAkBD,EACnBtZ,GAAe,IAAMsZ,EAAiB/C,EAAkBhM,IACzDgM,EAEoB,OAApBgD,IAEAzJ,EAAOU,MACTV,EAAOU,KAAK,sBAAuB+I,EAAiBhP,GAWtDwF,EAAMoG,cAAcoD,EAAiBlD,GACvC,CAMC1B,QAAQxI,GAGPjV,KAAK0hB,WAAWjE,QAAQxI,GAExBjV,KAAKiiB,oBAAoBxE,QAAQxI,EACnC,CAMC6I,QAAQ9F,GAGPhY,KAAK0hB,WAAW5D,QAAQ9F,GAExBhY,KAAKiiB,oBAAoBnE,QAAQ9F,EACnC,CAMCiG,UAAUC,GAGTle,KAAK0hB,WAAWzD,UAAUC,GAE1Ble,KAAKiiB,oBAAoBhE,UAAUC,EACrC,CAMCH,OAAOxW,EAAK8C,GAGXrK,KAAK0hB,WAAW3D,OAAOxW,EAAK8C,GAE5BrK,KAAKiiB,oBAAoBlE,OAAOxW,EAAK8C,EACvC,CAMC8T,SAAS5W,EAAKkT,GAGbza,KAAK0hB,WAAWvD,SAAS5W,EAAKkT,GAE9Bza,KAAKiiB,oBAAoB9D,SAAS5W,EAAKkT,EACzC,CAOC8D,WAAWxa,EAAM2P,GAGhB1T,KAAK0hB,WAAWnD,WAAWxa,EAAM2P,GAEjC1T,KAAKiiB,oBAAoB1D,WAAWxa,EAAM2P,EAC5C,CAOC4O,eAAevZ,GAEd,MAAQ8P,QAAOD,UAAW5Y,KAAKuhB,cAC3B3I,GACF7P,EAAS8P,EAEb,CAKC0J,IAAIxZ,GAEH,MAAMyZ,EAASC,GAASziB,MACxB,IACE+I,EAAS/I,KACX,SAEEyiB,GAASD,EACX,CACF,CAMCE,eAAeC,GAEd,MAAM/J,EAAS5Y,KAAKwZ,YACpB,IAAKZ,EAAQ,OAAO,KACpB,IAEE,OAAOA,EAAO8J,eAAeC,EAC/B,OACEja,WAAeY,EAAOmN,KAAM,+BAA8BkM,EAAYra,2BAC/D,IACT,CACF,CAqBCsa,iBAAiBlP,EAASmP,GACzB,MAAMxQ,EAASrS,KAAK8iB,qBAAqB,mBAAoBpP,EAASmP,GAEtE,OAAIna,KAAgB2J,IAEHrS,KAAKwZ,YAMlBlQ,EAAOmN,KAAM,sKAJbnN,EAAOmN,KACL,iHAUCpE,CACT,CAMC0Q,eACC,OAAO/iB,KAAK8iB,qBAAqB,eACnC,CAOCE,eAAeC,GAAa,GAE3B,GAAIA,EAEF,OAAOjjB,KAAKijB,aAIdjjB,KAAKkjB,oBACP,CAMCD,aAGC,MAAMpK,EADQ7Y,KAAKuhB,cACC1I,MACdjF,EAAUiF,EAAM+F,aAClBhL,GACFwB,GAAaxB,GAEf5T,KAAKkjB,qBAGLrK,EAAM8F,YACR,CAMCwE,aAAazP,GAEZ,MAAQmF,QAAOD,UAAW5Y,KAAKuhB,eACvB5M,UAAS/S,cAAcuC,GAAyByU,GAAUA,EAAOE,cAAiB,CAAC,GAGnF/D,aAAcvR,EAAW4f,WAAa,CAAC,EAEzCxP,EAAUH,GAAY,CAC1BkB,UACA/S,cACAqT,KAAM4D,EAAMO,aACRrE,GAAa,CAAEA,gBAChBrB,IAIC2P,EAAiBxK,EAAM+F,YAAc/F,EAAM+F,aACjD,OAAIyE,GAA4C,OAA1BA,EAAenP,QACnCc,GAAcqO,EAAgB,CAAEnP,OAAQ,WAG1ClU,KAAKijB,aAGLpK,EAAM8F,WAAW/K,GAEVA,CACT,CASC0P,uBAEC,MAAM1K,EAAS5Y,KAAKwZ,YACdtT,EAAU0S,GAAUA,EAAOE,aACjC,SAAe5S,IAAWA,EAAQqd,eACpC,CAKCL,qBAEC,MAAQrK,QAAOD,UAAW5Y,KAAKuhB,cAEzB3N,EAAUiF,EAAM+F,aAClBhL,GAAWgF,GAAUA,EAAOoK,gBAC9BpK,EAAOoK,eAAepP,EAE1B,CAOCkP,qBAAqBU,KAAW5Z,GAE/B,MAAM6Z,EADUC,KACOxf,WACvB,GAAIuf,GAAUA,EAAOE,YAAmD,mBAA9BF,EAAOE,WAAWH,GAC1D,OAAOC,EAAOE,WAAWH,GAAQI,MAAM5jB,KAAM4J,GAE/ClB,IAAeY,EAAOmN,KAAM,oBAAmB+M,sCACjD,EAUF,SAASE,KACPlgB,SAAWU,WAAaV,EAAWU,YAAc,CAC/Cyf,WAAY,CAAC,EACbE,SAAKtgB,GAEAC,CACT,CASA,SAASif,GAASoB,GAChB,MAAMC,EAAWJ,KACXlB,EAASuB,GAAkBD,GACjCE,UAAgBF,EAAUD,GACnBrB,CACT,CAWA,SAASyB,KAEP,MAAMH,EAAWJ,KAEjB,GAAII,EAAS5f,YAAc4f,EAAS5f,WAAWggB,IAAK,CAClD,MAAML,EAAMC,EAAS5f,WAAWggB,IAAID,gBAEpC,GAAIJ,EACF,OAAOA,CAEX,CAGA,OAaF,SAASM,GAAaL,EAAWJ,MAG/B,QAoEF,SAASU,GAAgBC,GACvB,SAAUA,GAAWA,EAAQngB,YAAcmgB,EAAQngB,WAAW2f,IAChE,CArEKO,CAAgBN,IAEjBC,GAAkBD,GAAU1C,YAAYX,MAExCuD,GAAgBF,EAAU,IAAIlD,IAIzBmD,GAAkBD,EAC3B,CA1BSK,CAAaL,EACtB,CAOA,SAAS7B,KAEP,OAAOgC,KAAgBhC,mBACzB,CAmFA,SAAS8B,GAAkBM,GACzB,OAAOvgB,GAAmB,MAAO,IAAM,IAAI8c,GAAOyD,EACpD,CAQA,SAASL,GAAgBK,EAASR,GAChC,QAAKQ,KACeA,EAAQngB,WAAamgB,EAAQngB,YAAc,CAAC,GACrD2f,IAAMA,GACV,EACT,CC/uBA,MAAMS,GAAyB,GAEzBC,GAAuB,kBACvBC,GAAqB,kCAS3B,SAASC,MAAqBC,GAC5B,MAAMC,EAAgBD,EAAQE,KAAK,CAACC,EAAGC,IAAMD,EAAE,GAAKC,EAAE,IAAI3c,IAAI4c,GAAKA,EAAE,IAErE,MAAO,CAAC9Y,EAAO+Y,EAAY,KACzB,MAAMC,EAAS,GACTC,EAAQjZ,EAAM1D,MAAM,MAE1B,QAASd,EAAIud,EAAWvd,EAAIyd,EAAMxe,OAAQe,IAAK,CAC7C,MAAM0d,EAAOD,EAAMzd,GAKnB,GAAI0d,EAAKze,OAAS,KAChB,SAKF,MAAM0e,EAAcb,GAAqBxZ,KAAKoa,GAAQA,EAAKlX,QAAQsW,GAAsB,MAAQY,EAIjG,IAAIC,EAAYC,MAAM,cAItB,WAAWC,KAAUX,EAAe,CAClC,MAAMY,EAAQD,EAAOF,GAErB,GAAIG,EAAO,CACTN,EAAOhe,KAAKse,GACZ,KACF,CACF,CAEA,GAAIN,EAAOve,QAAU4d,GACnB,MAEJ,CAEA,OAuBJ,SAASkB,GAA4BvZ,GACnC,IAAKA,EAAMvF,OACT,MAAO,GAGT,MAAM+e,EAAa5e,MAAM6e,KAAKzZ,GAG9B,MAAI,gBAAgBlB,KAAK0a,EAAWA,EAAW/e,OAAS,GAAGif,UAAY,KACrEF,EAAW5D,MAIb4D,EAAWte,UAGPqd,GAAmBzZ,KAAK0a,EAAWA,EAAW/e,OAAS,GAAGif,UAAY,MACxEF,EAAW5D,MAUP2C,GAAmBzZ,KAAK0a,EAAWA,EAAW/e,OAAS,GAAGif,UAAY,KACxEF,EAAW5D,OAIR4D,EAAWzb,MAAM,EAAGsa,IAAwBnc,IAAIod,QAClDA,EACHK,SAAUL,EAAMK,UAAYH,EAAWA,EAAW/e,OAAS,GAAGkf,SAC9DD,SAAUJ,EAAMI,UAAY,MAEhC,CA5DWH,CAA4BP,EAAM,CAE7C,CAQA,SAASY,GAAkCC,GACzC,OAAIjf,MAAMC,QAAQgf,GACTrB,MAAqBqB,GAEvBA,CACT,CA+CA,MAAMC,GAAsB,cAK5B,SAASC,GAAgBC,GACvB,IACE,OAAKA,GAAoB,mBAAPA,GAGXA,EAAGliB,MAFDgiB,EAGX,OAGE,OAAOA,EACT,CACF,CC7GA,SAASG,GAAUhc,EAAOic,EAAQ,IAAKC,EAAgB,KACrD,IAEE,OAAOC,GAAM,GAAInc,EAAOic,EAAOC,EACjC,OAASE,GACP,MAAO,CAAEC,MAAQ,yBAAwBD,KAC3C,CACF,CAGA,SAASE,GAEPzQ,EAEAoQ,EAAQ,EAERM,EAAU,QAEV,MAAMC,EAAaR,GAAUnQ,EAAQoQ,GAErC,OAwNF,SAASQ,GAAStc,GAChB,OARF,SAASuc,GAAWvc,GAElB,QAASwc,UAAUxc,GAAO9B,MAAM,SAAS7B,MAC3C,CAKSkgB,CAAWE,KAAKC,UAAU1c,GACnC,CA1NMsc,CAASD,GAAcD,EAClBD,GAAgBzQ,EAAQoQ,EAAQ,EAAGM,GAGrCC,CACT,CAWA,SAASL,GACP9e,EACA8C,EACA8b,EAAQ,IACRC,EAAgB,IAChBY,EC5DF,SAASC,KACP,MAAMC,EAAgC,mBAAZC,QACpBC,EAAQF,EAAa,IAAIC,QAAY,GAgC3C,MAAO,CA/BP,SAASE,EAAQhkB,GACf,GAAI6jB,EACF,QAAIE,EAAME,IAAIjkB,KAGd+jB,EAAMG,IAAIlkB,IACH,GAGT,QAASoE,EAAI,EAAGA,EAAI2f,EAAM1gB,OAAQe,IAEhC,GADc2f,EAAM3f,KACNpE,EACZ,OAAO,EAGX+jB,SAAMngB,KAAK5D,IACJ,CACT,EAEA,SAASmkB,EAAUnkB,GACjB,GAAI6jB,EACFE,EAAMK,OAAOpkB,QAEb,QAASoE,EAAI,EAAGA,EAAI2f,EAAM1gB,OAAQe,IAChC,GAAI2f,EAAM3f,KAAOpE,EAAK,CACpB+jB,EAAMM,OAAOjgB,EAAG,GAChB,KACF,CAGN,EAEF,CDyBSwf,IAEP,MAAOI,EAASG,GAAaR,EAG7B,GACW,MAAT3c,GACC,CAAC,SAAU,UAAW,UAAUW,gBAAgBX,KAAW5E,GAAM4E,GAElE,OAAOA,EAGT,MAAMsd,EA6FR,SAASC,GACPrgB,EAGA8C,GAEA,IACE,GAAY,WAAR9C,GAAoB8C,GAA0B,iBAAVA,GAAuBA,EAAQwd,QACrE,MAAO,WAGT,GAAY,kBAARtgB,EACF,MAAO,kBAMT,UAAW3D,OAAW,KAAeyG,IAAUzG,OAC7C,MAAO,WAIT,UAAWF,OAAW,KAAe2G,IAAU3G,OAC7C,MAAO,WAIT,UAAWokB,SAAa,KAAezd,IAAUyd,SAC/C,MAAO,aAGT,GAAIniB,GAAe0E,GACjB,MAAO,iBAIT,GtB9CJ,SAAS0d,GAAiBtjB,GACxB,OAAOW,GAAcX,IAAQ,gBAAiBA,GAAO,mBAAoBA,GAAO,oBAAqBA,CACvG,CsB4CQsjB,CAAiB1d,GACnB,MAAO,mBAGT,GAAqB,iBAAVA,GAAsBA,GAAUA,EACzC,MAAO,QAGT,GAAqB,mBAAVA,EACT,MAAQ,cAAa2b,GAAgB3b,MAGvC,GAAqB,iBAAVA,EACT,MAAQ,IAAGC,OAAOD,MAIpB,GAAqB,iBAAVA,EACT,MAAQ,YAAWC,OAAOD,MAO5B,MAAM2d,EAcV,SAASC,GAAmB5d,GAC1B,MAAM/F,EAAYD,OAAOgJ,eAAehD,GAExC,OAAO/F,EAAYA,EAAUvE,YAAYgE,KAAO,gBAClD,CAlBoBkkB,CAAmB5d,GAGnC,MAAI,qBAAqBU,KAAKid,GACpB,iBAAgBA,KAGlB,WAAUA,IACpB,OAAS1B,GACP,MAAQ,yBAAwBA,IAClC,CACF,CAtKsBsB,CAAergB,EAAK8C,GAIxC,IAAKsd,EAAYO,WAAW,YAC1B,OAAOP,EAQT,GAAKtd,EAAQ8d,8BACX,OAAO9d,EAMT,MAAM+d,EAC2D,iBAAvD/d,EAAQge,wCACVhe,EAAQge,wCACVlC,EAGN,GAAuB,IAAnBiC,EAEF,OAAOT,EAAY1Z,QAAQ,UAAW,IAIxC,GAAIoZ,EAAQhd,GACV,MAAO,eAIT,MAAMie,EAAkBje,EACxB,GAAIie,GAAqD,mBAA3BA,EAAgBjU,OAC5C,IAGE,OAAOgS,GAAM,GAFKiC,EAAgBjU,SAEN+T,EAAiB,EAAGhC,EAAeY,EACjE,OACE,CAOJ,MAAMN,EAAc7f,MAAMC,QAAQuD,GAAS,GAAK,CAAC,EACjD,IAAIke,EAAW,EAIf,MAAMC,EAAYzc,GAAqB1B,GAEvC,UAAWoe,MAAYD,EAErB,GAAKnkB,OAAOC,UAAUwI,eAAepI,KAAK8jB,EAAWC,IAArD,CAIA,GAAIF,GAAYnC,EAAe,CAC7BM,EAAW+B,IAAY,oBACvB,KACF,CAIA/B,EAAW+B,IAAYpC,GAAMoC,GADVD,EAAUC,IACsBL,EAAiB,EAAGhC,EAAeY,GAEtFuB,GAZE,CAgBJf,SAAUnd,GAGHqc,CACT,CEjIA,SAASgC,GACPxiB,EACAqI,EACA8E,EACAwF,EACAD,EACAiI,GAEA,MAAQ8H,iBAAiB,EAAGC,sBAAsB,KAAS1iB,EACrD2iB,EAAW,IACZta,EACHI,SAAUJ,EAAMI,UAAY0E,EAAK1E,UAAYhB,KAC7CoG,UAAWxF,EAAMwF,WAAapE,MAE1BmZ,EAAezV,EAAKyV,cAAgB5iB,EAAQ4iB,aAAa3gB,IAAIV,IAAKA,GAAE1D,OA2E5E,SAASglB,GAAmBxa,EAAOrI,GACjC,MAAQtE,cAAa+S,UAASqU,OAAMC,iBAAiB,KAAQ/iB,EAEvD,gBAAiBqI,IACrBA,EAAM3M,YAAc,gBAAiBsE,EAAUtE,EAAcuC,QAGzCZ,IAAlBgL,EAAMoG,cAAqCpR,IAAZoR,IACjCpG,EAAMoG,QAAUA,QAGCpR,IAAfgL,EAAMya,WAA+BzlB,IAATylB,IAC9Bza,EAAMya,KAAOA,GAGXza,EAAMvC,UACRuC,EAAMvC,QAAUnC,GAAS0E,EAAMvC,QAASid,IAG1C,MAAMza,EAAYD,EAAMC,WAAaD,EAAMC,UAAUC,QAAUF,EAAMC,UAAUC,OAAO,GAClFD,GAAaA,EAAUnE,QACzBmE,EAAUnE,MAAQR,GAAS2E,EAAUnE,MAAO4e,IAG9C,MAAMC,EAAU3a,EAAM2a,QAClBA,GAAWA,EAAQC,MACrBD,EAAQC,IAAMtf,GAASqf,EAAQC,IAAKF,GAExC,EArGEF,CAAmBF,EAAU3iB,GA8M/B,SAASkjB,GAA0B7a,EAAO8a,GACpCA,EAAiB3iB,OAAS,IAC5B6H,EAAM+a,IAAM/a,EAAM+a,KAAO,CAAC,EAC1B/a,EAAM+a,IAAIR,aAAe,IAAKva,EAAM+a,IAAIR,cAAgB,MAAQO,GAEpE,CAlNED,CAA0BP,EAAUC,QAGjBvlB,IAAfgL,EAAMnC,MAwGZ,SAASmd,GAAchb,EAAOuX,GAC5B,MAAM0D,EAAahmB,EAAWimB,gBAE9B,IAAKD,EACH,OAGF,IAAIE,EACJ,MAAMC,EAA+BC,GAAwBrc,IAAIuY,GAC7D6D,EACFD,EAA0BC,GAE1BD,EAA0B,IAAIxc,IAC9B0c,GAAwBnc,IAAIqY,EAAa4D,IAI3C,MAAMG,EAAqBxlB,OAAO8E,KAAKqgB,GAAYvT,OAAO,CAACS,EAAKoT,KAC9D,IAAIC,EACJ,MAAMC,EAAoBN,EAAwBnc,IAAIuc,GAClDE,EACFD,EAAcC,GAEdD,EAAcjE,EAAYgE,GAC1BJ,EAAwBjc,IAAIqc,EAAmBC,IAGjD,QAAStiB,EAAIsiB,EAAYrjB,OAAS,EAAGe,GAAK,EAAGA,IAAK,CAChD,MAAMwiB,EAAaF,EAAYtiB,GAC/B,GAAIwiB,EAAWrE,SAAU,CACvBlP,EAAIuT,EAAWrE,UAAY4D,EAAWM,GACtC,KACF,CACF,CACA,OAAOpT,GACN,CAAC,GAEJ,IAEEnI,EAAMC,UAAUC,OAAOrG,QAAQoG,IAE7BA,EAAU0b,WAAWjF,OAAO7c,QAAQmd,IAC9BA,EAAMK,WACRL,EAAM4E,SAAWN,EAAmBtE,EAAMK,UAAQ,EAErD,EAEL,OACE,CAEJ,CAzJI2D,CAAcV,EAAU3iB,EAAQ4f,aAKlC,MAAMsE,EAiRR,SAASC,GAAcxR,EAAOiG,GAC5B,IAAKA,EACH,OAAOjG,EAGT,MAAMuR,EAAavR,EAAQA,EAAMgE,QAAU,IAAIb,GAC/CoO,SAAWvL,OAAOC,GACXsL,CACT,CAzRqBC,CAAcxR,EAAOxF,EAAKyL,gBAEzCzL,EAAKnE,WACPH,GAAsB8Z,EAAUxV,EAAKnE,WAGvC,MAAMob,EAAwB1R,GAAUA,EAAO2R,mBAAqB3R,EAAO2R,qBAAuB,GAK5Flb,ENolBR,SAASmb,KACP,OAAKzO,KACHA,GAAc,IAAIC,IAGbD,EACT,CM1lBeyO,GAAiB7K,eAE1BkB,GAEFrF,GAAenM,EADOwR,EAAelB,gBAInCyK,GAEF5O,GAAenM,EADQ+a,EAAWzK,gBAIpC,MAAMhE,GAAc,IAAKtI,EAAKsI,aAAe,MAAQtM,EAAKsM,aAkB1D,OAjBIA,GAAYjV,SACd2M,EAAKsI,YAAcA,IAGrBxB,GAAsB0O,EAAUxZ,GAWjB8D,GARS,IACnBmX,KAEArX,QAEA5D,EAAKqM,iBAG4CmN,EAAUxV,GAElD7N,KAAKilB,KACbA,IA+GR,SAASC,GAAenc,GAEtB,MAAMsb,EAAqB,CAAC,EAC5B,IAEEtb,EAAMC,UAAUC,OAAOrG,QAAQoG,IAE7BA,EAAU0b,WAAWjF,OAAO7c,QAAQmd,IAC9BA,EAAM4E,WACJ5E,EAAMoF,SACRd,EAAmBtE,EAAMoF,UAAYpF,EAAM4E,SAClC5E,EAAMK,WACfiE,EAAmBtE,EAAMK,UAAYL,EAAM4E,iBAEtC5E,EAAM4E,WAEhB,EAEL,OACE,CAGF,GAA+C,IAA3C9lB,OAAO8E,KAAK0gB,GAAoBnjB,OAClC,OAIF6H,EAAMqc,WAAarc,EAAMqc,YAAc,CAAC,EACxCrc,EAAMqc,WAAWC,OAAStc,EAAMqc,WAAWC,QAAU,GACrD,MAAMA,EAAStc,EAAMqc,WAAWC,OAChCxmB,OAAO8E,KAAK0gB,GAAoBzhB,QAAQwd,IACtCiF,EAAO5jB,KAAK,CACVmF,KAAM,YACN0e,UAAWlF,EACXuE,SAAUN,EAAmBjE,IAC9B,EAEL,CA/IM8E,CAAeD,IAGa,iBAAnB9B,GAA+BA,EAAiB,EAmK/D,SAASoC,GAAexc,EAAO4X,EAAO6E,GACpC,IAAKzc,EACH,OAAO,KAGT,MAAMmY,EAAa,IACdnY,KACCA,EAAM8L,aAAe,CACvBA,YAAa9L,EAAM8L,YAAYlS,IAAI2c,QAC9BA,KACCA,EAAEzV,MAAQ,CACZA,KAAM6W,GAAUpB,EAAEzV,KAAM8W,EAAO6E,WAIjCzc,EAAM0G,MAAQ,CAChBA,KAAMiR,GAAU3X,EAAM0G,KAAMkR,EAAO6E,OAEjCzc,EAAMmM,UAAY,CACpBA,SAAUwL,GAAU3X,EAAMmM,SAAUyL,EAAO6E,OAEzCzc,EAAMkM,OAAS,CACjBA,MAAOyL,GAAU3X,EAAMkM,MAAO0L,EAAO6E,KAWzC,OAAIzc,EAAMmM,UAAYnM,EAAMmM,SAASO,OAASyL,EAAWhM,WACvDgM,EAAWhM,SAASO,MAAQ1M,EAAMmM,SAASO,MAGvC1M,EAAMmM,SAASO,MAAM5L,OACvBqX,EAAWhM,SAASO,MAAM5L,KAAO6W,GAAU3X,EAAMmM,SAASO,MAAM5L,KAAM8W,EAAO6E,KAK7Ezc,EAAM0c,QACRvE,EAAWuE,MAAQ1c,EAAM0c,MAAM9iB,IAAImN,IACjC,MAAMjG,EAAO6I,GAAW5C,GAAMjG,KAE9B,OAAIA,IAGFiG,EAAKjG,KAAO6W,GAAU7W,EAAM8W,EAAO6E,IAG9B1V,KAIJoR,CACT,CA5NaqE,CAAeN,GAAK9B,EAAgBC,GAEtC6B,IAEX,CAsCA,MAAMb,GAA0B,IAAIsB,QA6NpC,MAAMC,GAAqB,CACzB,OACA,QACA,QACA,WACA,OACA,cACA,iBACA,sBC5WF,SAAShL,GAEP3R,EACA6E,GAGA,OAAO4Q,KAAgB9D,iBAAiB3R,EDmU1C,SAAS4c,GACP/X,GAEA,GAAKA,EAKL,OAaF,SAASgY,GACPhY,GAEA,OAAOA,aAAgB2I,IAAyB,mBAAT3I,CACzC,CAjBMgY,CAAsBhY,IA8B5B,SAASiY,GAAmBjY,GAC1B,OAAOhP,OAAO8E,KAAKkK,GAAM1I,KAAKpD,GAAO4jB,GAAmBngB,SAASzD,GACnE,CA5BM+jB,CAAmBjY,GAHd,CAAEyL,eAAgBzL,GASpBA,CACT,CCtVqD+X,CAA+B/X,GACpF,CA6BA,SAASkN,GAAahS,EAAO8E,GAE3B,OAAO4Q,KAAgB1D,aAAahS,EAAO8E,EAC7C,CAqBA,SAAS4L,GAAcC,EAAY7L,GAEjC4Q,KAAgBhF,cAAcC,EAAY7L,EAC5C,CAQA,SAASkL,GAAWxa,EAAM2P,GAExBuQ,KAAgB1F,WAAWxa,EAAM2P,EACnC,CA+QA,SAAS8F,KAEP,OAAOyK,KAAgBzK,WACzB,CAYA,SAASC,KAEP,OAAOwK,KAAgBvC,UACzB,CASA,SAASyB,GAAazP,GACpB,MAAMkF,EAASY,KACTqH,EAAiBoB,KACjBsJ,EAAe9R,MAEb9E,UAAS/S,cAAcuC,GAAyByU,GAAUA,EAAOE,cAAiB,CAAC,GAGnF/D,aAAcvR,EAAW4f,WAAa,CAAC,EAEzCxP,EAAUH,GAAY,CAC1BkB,UACA/S,cACAqT,KAAMsW,EAAanS,WAAayH,EAAezH,aAC3CrE,GAAa,CAAEA,gBAChBrB,IAIC2P,EAAiBxC,EAAejC,aACtC,OAAIyE,GAA4C,OAA1BA,EAAenP,QACnCc,GAAcqO,EAAgB,CAAEnP,OAAQ,WAG1C+O,KAGApC,EAAelC,WAAW/K,GAI1B2X,EAAa5M,WAAW/K,GAEjBA,CACT,CAKA,SAASqP,KACP,MAAMpC,EAAiBoB,KACjBsJ,EAAe9R,KAEf7F,EAAU2X,EAAa3M,cAAgBiC,EAAejC,aACxDhL,GACFwB,GAAaxB,GAEfsP,KAGArC,EAAelC,aAIf4M,EAAa5M,YACf,CAKA,SAASuE,KACP,MAAMrC,EAAiBoB,KACjBsJ,EAAe9R,KACfb,EAASY,KAGT5F,EAAU2X,EAAa3M,cAAgBiC,EAAejC,aACxDhL,GAAWgF,GAAUA,EAAOoK,gBAC9BpK,EAAOoK,eAAepP,EAE1B,CAQA,SAASoP,GAAewI,GAAM,GAExBA,EACFvI,KAKFC,IACF,CCndA,MAAMuI,GAAwB,GA+B9B,SAASC,GAAuBxlB,GAC9B,MAAMylB,EAAsBzlB,EAAQylB,qBAAuB,GACrDC,EAAmB1lB,EAAQ4iB,aAOjC,IAAIA,EAJJ6C,EAAoBvjB,QAAQua,IAC1BA,EAAYkJ,mBAAoB,IAMhC/C,EADEjiB,MAAMC,QAAQ8kB,GACD,IAAID,KAAwBC,GACN,mBAArBA,EACDpc,GAASoc,EAAiBD,IAE1BA,EAGjB,MAAMG,EAxCR,SAASC,GAAiBjD,GACxB,MAAMkD,EAAqB,CAAC,EAE5BlD,SAAa1gB,QAAQ6jB,IACnB,MAAQloB,QAASkoB,EAEXC,EAAmBF,EAAmBjoB,GAIxCmoB,IAAqBA,EAAiBL,mBAAqBI,EAAgBJ,oBAI/EG,EAAmBjoB,GAAQkoB,KAGtB5nB,OAAO8E,KAAK6iB,GAAoB7jB,IAAIgkB,GAAKH,EAAmBG,GACrE,CAsB4BJ,CAAiBjD,GAMrCsD,EA+ER,SAASC,GAAUC,EAAKvjB,GACtB,QAAStB,EAAI,EAAGA,EAAI6kB,EAAI5lB,OAAQe,IAC9B,IAAyB,IAArBsB,EAASujB,EAAI7kB,IACf,OAAOA,EAIX,OAAO,CACT,CAvFqB4kB,CAAUP,EAAmBnJ,GAAoC,UAArBA,EAAY5e,MAC3E,IAAmB,IAAfqoB,EAAmB,CACrB,MAAOG,GAAiBT,EAAkBpE,OAAO0E,EAAY,GAC7DN,EAAkB7kB,KAAKslB,EACzB,CAEA,OAAOT,CACT,CAsBA,SAASU,GAAiB5T,EAAQ+J,EAAa8J,GAC7C,GAAIA,EAAiB9J,EAAY5e,MAC/B2E,IAAeY,EAAOqC,IAAK,yDAAwDgX,EAAY5e,YADjG,CAkBA,GAdA0oB,EAAiB9J,EAAY5e,MAAQ4e,GAGmB,IAApD8I,GAAsBiB,QAAQ/J,EAAY5e,QAE5C4e,EAAYgK,UAAUzZ,GAAyB+Q,IAC/CwH,GAAsBxkB,KAAK0b,EAAY5e,OAIrC4e,EAAYiK,OAAsC,mBAAtBjK,EAAYiK,OAC1CjK,EAAYiK,MAAMhU,GAGhBA,EAAOiU,IAA6C,mBAAhClK,EAAYmK,gBAAgC,CAClE,MAAM/jB,EAAW4Z,EAAYmK,gBAAgBC,KAAKpK,GAClD/J,EAAOiU,GAAG,kBAAmB,CAACte,EAAO8E,IAAStK,EAASwF,EAAO8E,EAAMuF,GACtE,CAEA,GAAIA,EAAO4E,mBAAyD,mBAA7BmF,EAAYqK,aAA6B,CAC9E,MAAMjkB,EAAW4Z,EAAYqK,aAAaD,KAAKpK,GAEzCpP,EAAYlP,OAAO4oB,OAAO,CAAC1e,EAAO8E,IAAStK,EAASwF,EAAO8E,EAAMuF,GAAS,CAC9EtQ,GAAIqa,EAAY5e,OAGlB6U,EAAO4E,kBAAkBjK,EAC3B,CAEA7K,IAAeY,EAAOqC,IAAK,0BAAyBgX,EAAY5e,OA9BhE,CA+BF,CA+BA,SAASmpB,GACPnpB,EACAkiB,GAEA,OAAO5hB,OAAO4oB,OACZ,YAAiCrjB,GAC/B,OAAOqc,KAAMrc,EACf,EACA,CAAEtB,GAAIvE,GAEV,CCjKA,MAAMopB,GAAwB,CAAC,oBAAqB,iDAE9CC,GAA8B,CAClC,oBACA,gBACA,aACA,cACA,kBACA,eACA,iBAKIC,GAAmB,iBAcnBC,GAb8BC,CAACrnB,EAAU,CAAC,MAE5CnC,KAAMspB,GAENV,YAAa,EACbK,aAAaze,EAAOif,EAAO5U,GACzB,MAAM6U,EAAgB7U,EAAOE,aACvB4U,EAoBZ,SAASC,GACPC,EAAkB,CAAC,EACnBH,EAAgB,CAAC,GAEjB,MAAO,CACLI,UAAW,IAAKD,EAAgBC,WAAa,MAASJ,EAAcI,WAAa,IACjFC,SAAU,IAAKF,EAAgBE,UAAY,MAASL,EAAcK,UAAY,IAC9EC,aAAc,IACRH,EAAgBG,cAAgB,MAChCN,EAAcM,cAAgB,MAC9BH,EAAgBI,qBAAuB,GAAKb,IAElDc,mBAAoB,IACdL,EAAgBK,oBAAsB,MACtCR,EAAcQ,oBAAsB,MACpCL,EAAgBM,2BAA6B,GAAKd,IAExDe,oBAAmD5qB,IAAnCqqB,EAAgBO,gBAA+BP,EAAgBO,eAEnF,CAvC4BR,CAAcznB,EAASunB,GAC7C,OAwCN,SAASW,GAAiB7f,EAAOrI,GAC/B,OAAIA,EAAQioB,gBA4Gd,SAASE,GAAe9f,GACtB,IAGE,MAA0C,gBAAnCA,EAAMC,UAAUC,OAAO,GAAGrC,IACnC,OACE,CAEF,OAAO,CACT,CArHgCiiB,CAAe9f,IAC3C7F,IACEY,EAAOmN,KAAM,6DAA4D/H,GAAoBH,OACxF,GAqCX,SAAS+f,GAAgB/f,EAAOwf,GAE9B,QAAIxf,EAAMnC,OAAS2hB,IAAiBA,EAAarnB,SAkCnD,SAAS6nB,GAA0BhgB,GACjC,MAAMigB,EAAmB,GAMzB,IAAIC,EAJAlgB,EAAMvC,SACRwiB,EAAiBvnB,KAAKsH,EAAMvC,SAI9B,IAGEyiB,EAAgBlgB,EAAMC,UAAUC,OAAOF,EAAMC,UAAUC,OAAO/H,OAAS,EACzE,OACE,CAGF,OAAI+nB,GACEA,EAAcpkB,QAChBmkB,EAAiBvnB,KAAKwnB,EAAcpkB,OAChCokB,EAAcriB,MAChBoiB,EAAiBvnB,KAAM,GAAEwnB,EAAcriB,SAASqiB,EAAcpkB,UAKhE3B,IAA2C,IAA5B8lB,EAAiB9nB,QAClC4C,EAAOolB,MAAO,uCAAsChgB,GAAoBH,MAGnEigB,CACT,CA5DSD,CAA0BhgB,GAAO5D,KAAKqB,GAAWzB,GAAyByB,EAAS+hB,GAC5F,CA1CMO,CAAgB/f,EAAOrI,EAAQ6nB,eACjCrlB,IACEY,EAAOmN,KACJ,0EAAyE/H,GAAoBH,OAE3F,GAuCX,SAASogB,GAAsBpgB,EAAO0f,GACpC,GAAmB,gBAAf1f,EAAMnC,OAA2B6hB,IAAuBA,EAAmBvnB,OAC7E,OAAO,EAGT,MAAM3C,EAAOwK,EAAMgH,YACnB,QAAOxR,GAAOwG,GAAyBxG,EAAMkqB,EAC/C,CA5CMU,CAAsBpgB,EAAOrI,EAAQ+nB,qBACvCvlB,IACEY,EAAOmN,KACJ,gFAA+E/H,GAAoBH,OAEjG,GAyCX,SAASqgB,GAAargB,EAAOuf,GAE3B,IAAKA,IAAaA,EAASpnB,OACzB,OAAO,EAET,MAAMyiB,EAAM0F,GAAmBtgB,GAC/B,QAAQ4a,GAAc5e,GAAyB4e,EAAK2E,EACtD,CA9CMc,CAAargB,EAAOrI,EAAQ4nB,WAC9BplB,IACEY,EAAOmN,KACJ,sEAAqE/H,GACpEH,aACUsgB,GAAmBtgB,OAE5B,IAyCX,SAASugB,GAAcvgB,EAAOsf,GAE5B,IAAKA,IAAcA,EAAUnnB,OAC3B,OAAO,EAET,MAAMyiB,EAAM0F,GAAmBtgB,GAC/B,OAAQ4a,GAAa5e,GAAyB4e,EAAK0E,EACrD,CA9COiB,CAAcvgB,EAAOrI,EAAQ2nB,aAChCnlB,IACEY,EAAOmN,KACJ,2EAA0E/H,GACzEH,aACUsgB,GAAmBtgB,OAE5B,EAGX,CA/Ea6f,CAAiB7f,EAAOmf,GAAiB,KAAOnf,CACzD,IA2KJ,SAASsgB,GAAmBtgB,GAC1B,IACE,IAAI0W,EACJ,IAEEA,EAAS1W,EAAMC,UAAUC,OAAO,GAAGyb,WAAWjF,MAChD,OACE,CAEF,OAAOA,EArBX,SAAS8J,GAAiB9J,EAAS,IACjC,QAASxd,EAAIwd,EAAOve,OAAS,EAAGe,GAAK,EAAGA,IAAK,CAC3C,MAAM8d,EAAQN,EAAOxd,GAErB,GAAI8d,GAA4B,gBAAnBA,EAAMK,UAAiD,kBAAnBL,EAAMK,SACrD,OAAOL,EAAMK,UAAY,IAE7B,CAEA,OAAO,IACT,CAWoBmJ,CAAiB9J,GAAU,IAC7C,OACEvc,WAAeY,EAAOolB,MAAO,gCAA+BhgB,GAAoBH,MACzE,IACT,CACF,CCpNA,IAAIygB,GDsCmB9B,GACrBG,GACAC,ICtCF,MAAMD,GAAmB,mBAwBnB4B,GAtBgCC,MAElCnrB,KAAMspB,GACNV,YAEEqC,GAA2BG,SAAS7qB,UAAUC,SAI9C,IAEE4qB,SAAS7qB,UAAUC,SAAW,YAAcqF,GAC1C,MAAM8J,EAAU9H,GAAoB5L,OAASA,KAC7C,OAAOgvB,GAAyBpL,MAAMlQ,EAAS9J,EACjD,CACF,OACE,CAEJ,IAWqBsjB,GACvBG,GACA4B,IClCF,MAAMG,GAAY,kEAelB,SAASC,GAAYC,EAAKC,GAAe,GACvC,MAAQC,OAAMC,OAAMC,OAAMC,OAAMC,YAAWC,WAAU9W,aAAcuW,EACnE,MACG,GAAEO,OAAc9W,IAAYwW,GAAgBG,EAAQ,IAAGA,IAAS,MAC7DF,IAAOG,EAAQ,IAAGA,IAAS,MAAMF,GAAQ,GAAEA,OAAiBG,GAEpE,CAwCA,SAASE,GAAkBC,GACzB,MAAO,CACLF,SAAUE,EAAWF,SACrB9W,UAAWgX,EAAWhX,WAAa,GACnC2W,KAAMK,EAAWL,MAAQ,GACzBF,KAAMO,EAAWP,KACjBG,KAAMI,EAAWJ,MAAQ,GACzBF,KAAMM,EAAWN,MAAQ,GACzBG,UAAWG,EAAWH,UAE1B,CA4CA,SAASI,GAAQtK,GACf,MAAMqK,EAA6B,iBAATrK,EAvF5B,SAASuK,GAAcnmB,GACrB,MAAMub,EAAQ+J,GAAUc,KAAKpmB,GAE7B,IAAKub,EAMH,YAJAvc,GAAe,KAEbE,QAAQ0lB,MAAO,uBAAsB5kB,IAAK,GAK9C,MAAO+lB,EAAU9W,EAAW2W,EAAO,GAAIF,EAAMG,EAAO,GAAIQ,GAAY9K,EAAMrb,MAAM,GAChF,IAAIylB,EAAO,GACPG,EAAYO,EAEhB,MAAM5nB,EAAQqnB,EAAUrnB,MAAM,KAM9B,GALIA,EAAM7B,OAAS,IACjB+oB,EAAOlnB,EAAMyB,MAAM,GAAG,GAAI5C,KAAK,KAC/BwoB,EAAYrnB,EAAMsZ,OAGhB+N,EAAW,CACb,MAAMQ,EAAeR,EAAUvK,MAAM,QACjC+K,IACFR,EAAYQ,EAAa,GAE7B,CAEA,OAAON,GAAkB,CAAEN,OAAME,OAAMD,OAAMG,YAAWD,OAAME,SAAUA,EAAW9W,aACrF,CAyDgDkX,CAAcvK,GAAQoK,GAAkBpK,GACtF,GAAKqK,GA5CP,SAASM,GAAYf,GACnB,IAAK5mB,GACH,OAAO,EAGT,MAAQinB,OAAMC,YAAWC,YAAaP,EAWtC,QAT2B,CAAC,WAAY,YAAa,OAAQ,aACNgB,KAAKC,IACrDjB,EAAIiB,KACPjnB,EAAOolB,MAAO,uBAAsB6B,cAC7B,MASNX,EAAUvK,MAAM,SA3FvB,SAASmL,GAAgBX,GACvB,MAAoB,SAAbA,GAAoC,UAAbA,CAChC,CA8FOW,CAAgBX,GAKjBF,GAAQlqB,MAAMgrB,SAASd,EAAM,OAC/BrmB,EAAOolB,MAAO,oCAAmCiB,KAC1C,IANPrmB,EAAOolB,MAAO,wCAAuCmB,KAC9C,IANPvmB,EAAOolB,MAAO,yCAAwCkB,KAC/C,IAcX,CAQsBS,CAAYN,GAGhC,OAAOA,CACT,CC3HA,MAAMW,GAAqB,IAG3B,SAASC,GAAmBrB,GAG1B,MAAQ,GAFSA,EAAIO,SAAY,GAAEP,EAAIO,YAAc,OAE9BP,EAAIE,OADdF,EAAIK,KAAQ,IAAGL,EAAIK,OAAS,KACAL,EAAIG,KAAQ,IAAGH,EAAIG,OAAS,SACvE,CAuBA,SAASmB,GACPtB,EAGAuB,EAAkB,CAAC,GAMnB,MACMC,EACuB,iBAApBD,GAAiCA,EAAgBE,UAAwBF,EAAgBE,UAAUzH,SAAtC/lB,EAEtE,OAJ0C,iBAApBstB,EAA+BA,EAAkBA,EAAgBG,SAI7D,GAlC5B,SAASC,GAAmB3B,GAC1B,MAAQ,GAAEqB,GAAmBrB,KAAOA,EAAIM,qBAC1C,CAgC8BqB,CAAmB3B,MA7BjD,SAAS4B,GAAa5B,EAAKwB,GACzB,OzBoEF,SAASK,GAAUpb,GACjB,OAAO1R,OAAO8E,KAAK4M,GAChB5N,IAAIZ,GAAQ,GAAEgP,mBAAmBhP,MAAQgP,mBAAmBR,EAAOxO,OACnEH,KAAK,IACV,CyBxES+pB,CAAU,CAGfC,WAAY9B,EAAIvW,UAChBsY,eAAgBX,MACZI,GAAW,CAAEQ,cAAgB,GAAER,EAAQ/sB,QAAQ+sB,EAAQzP,YAE/D,CAqByD6P,CAAa5B,EAAKwB,IAC3E,CC1CA,MAAMhrB,GAASjC,KAwDf,SAAS0tB,KACP,KAAM,UAAWzrB,IACf,OAAO,EAGT,IACE,WAAI0rB,QACJ,IAAIC,QAAQ,0BACZ,IAAIC,UACG,CACT,OACE,OAAO,CACT,CACF,CAKA,SAASC,GAAc9lB,GACrB,OAAOA,GAAQ,mDAAmDd,KAAKc,EAAKtH,WAC9E,CC5EA,MAAMuB,EAASjC,KCAT+tB,EAAW,CAAC,EACZC,EAAe,CAAC,EAGtB,SAASC,EAAW1lB,EAAM4G,GACxB4e,EAASxlB,GAAQwlB,EAASxlB,IAAS,GAClCwlB,EAASxlB,GAAQnF,KAAK+L,EACzB,CAaA,SAAS+e,GAAgB3lB,EAAM4lB,GACxBH,EAAazlB,KAChB4lB,IACAH,EAAazlB,IAAQ,EAEzB,CAGA,SAAS6lB,GAAgB7lB,EAAMiD,GAC7B,MAAM6iB,EAAe9lB,GAAQwlB,EAASxlB,GACtC,GAAK8lB,EAIL,UAAWlf,KAAWkf,EACpB,IACElf,EAAQ3D,EACV,OAAS6C,GACPxJ,IACEY,EAAOolB,MACJ,0DAAyDtiB,YAAe4Z,GAAgBhT,aACzFd,EAEN,CAEJ,CC3CA,MAAMpM,GAAStC,EAEf,IAAI2uB,GAUJ,SAASC,GAAiCpf,GACxC,MAAM5G,EAAO,UACb0lB,EAAW1lB,EAAM4G,GACjB+e,GAAgB3lB,EAAMimB,GACxB,CAEA,SAASA,KACP,IFbF,SAASC,IAMP,MAAMC,EAAUzsB,EAASysB,OAKzB,QAJ4BA,GAAUA,EAAOC,KAAOD,EAAOC,IAAIC,WAEzC,YAAa3sB,KAAYA,EAAO4sB,QAAQC,YAAe7sB,EAAO4sB,QAAQE,aAG9F,CECON,GACH,OAGF,MAAMO,EAAgB/sB,GAAOgtB,WAoB7B,SAASC,EAA2BC,GAClC,OAAO,YAAcppB,GACnB,MAAMuf,EAAMvf,EAAKlD,OAAS,EAAIkD,EAAK,QAAKrG,EACxC,GAAI4lB,EAAK,CAEP,MAAMzD,EAAOyM,GACPc,EAAK3oB,OAAO6e,GAElBgJ,GAAWc,EAEXhB,GAAgB,UADI,CAAEvM,OAAMuN,MAE9B,CACA,OAAOD,EAAwBpP,MAAM5jB,KAAM4J,EAC7C,CACF,CAjCA9D,GAAOgtB,WAAa,YAAclpB,GAChC,MAAMqpB,EAAKntB,GAAOotB,SAASC,KAErBzN,EAAOyM,GAIb,GAHAA,GAAWc,EAEXhB,GAAgB,UADI,CAAEvM,OAAMuN,OAExBJ,EAIF,IACE,OAAOA,EAAcjP,MAAM5jB,KAAM4J,EACnC,OACE,CAGN,EAkBAqB,GAAKnF,GAAO4sB,QAAS,YAAaK,GAClC9nB,GAAKnF,GAAO4sB,QAAS,eAAgBK,EACvC,CC3DA,SAASK,GAAeC,EAASC,EAAQ,IACvC,MAAO,CAACD,EAASC,EACnB,CAOA,SAASC,GAAkBC,EAAUC,GACnC,MAAOJ,EAASC,GAASE,EACzB,MAAO,CAACH,EAAS,IAAIC,EAAOG,GAC9B,CAQA,SAASC,GACPF,EACAzqB,GAEA,MAAM4qB,EAAgBH,EAAS,GAE/B,UAAWI,KAAgBD,EAIzB,GAFe5qB,EAAS6qB,EADCA,EAAa,GAAGxnB,MAIvC,OAAO,EAIX,OAAO,CACT,CAYA,SAASynB,GAAW3pB,EAAO4pB,GAEzB,OADaA,GAAe,IAAIC,aACpBC,OAAO9pB,EACrB,CAKA,SAAS+pB,GAAkBT,EAAUM,GACnC,MAAOI,EAAYZ,GAASE,EAG5B,IAAIW,EAAQrN,KAAKC,UAAUmN,GAE3B,SAASE,EAAOC,GACO,iBAAVF,EACTA,EAAwB,iBAATE,EAAoBF,EAAQE,EAAO,CAACR,GAAWM,EAAOL,GAAcO,GAEnFF,EAAMltB,KAAqB,iBAATotB,EAAoBR,GAAWQ,EAAMP,GAAeO,EAE1E,CAEA,UAAW3mB,KAAQ4lB,EAAO,CACxB,MAAOgB,EAAaC,GAAW7mB,EAI/B,GAFA0mB,EAAQ,KAAItN,KAAKC,UAAUuN,QAEJ,iBAAZC,GAAwBA,aAAmBnmB,WACpDgmB,EAAOG,OACF,CACL,IAAIC,EACJ,IACEA,EAAqB1N,KAAKC,UAAUwN,EACtC,OAIEC,EAAqB1N,KAAKC,UAAUb,GAAUqO,GAChD,CACAH,EAAOI,EACT,CACF,CAEA,MAAwB,iBAAVL,EAAqBA,EAGrC,SAASM,GAAcC,GACrB,MAAMC,EAAcD,EAAQze,OAAO,CAACS,EAAKke,IAAQle,EAAMke,EAAIluB,OAAQ,GAE7DmuB,EAAS,IAAIzmB,WAAWumB,GAC9B,IAAIG,EAAS,EACb,UAAWC,KAAUL,EACnBG,EAAOpnB,IAAIsnB,EAAQD,GACnBA,GAAUC,EAAOruB,OAGnB,OAAOmuB,CACT,CAd6CJ,CAAcN,EAC3D,CA2DA,SAASa,GACPvV,EACAqU,GAEA,MAAMiB,EAAoC,iBAApBtV,EAAWpQ,KAAoBwkB,GAAWpU,EAAWpQ,KAAMykB,GAAerU,EAAWpQ,KAE3G,MAAO,CACLtC,GAAkB,CAChBX,KAAM,aACN1F,OAAQquB,EAAOruB,OACfkf,SAAUnG,EAAWmG,SACrBqP,aAAcxV,EAAWyV,YACzBC,gBAAiB1V,EAAW2V,iBAE9BL,EAEJ,CAEA,MAAMM,GAAiC,CACrCzhB,QAAS,UACT0hB,SAAU,UACV7V,WAAY,aACZlK,YAAa,cACbhH,MAAO,QACPgnB,cAAe,WACfC,YAAa,UACbC,QAAS,UACTC,aAAc,SACdC,iBAAkB,SAClBC,SAAU,UACVC,SAAU,WAEVC,OAAQ,WAMV,SAASC,GAA+B3pB,GACtC,OAAOipB,GAA+BjpB,EACxC,CAGA,SAAS4pB,GAAgCC,GACvC,IAAKA,IAAoBA,EAAgB3M,IACvC,OAEF,MAAQvlB,OAAMsd,WAAY4U,EAAgB3M,IAC1C,MAAO,CAAEvlB,OAAMsd,UACjB,CAMA,SAAS6U,GACP3nB,EACAuiB,EACAE,EACA1B,GAEA,MAAMzZ,EAAyBtH,EAAM+L,uBAAyB/L,EAAM+L,sBAAsBzE,uBAC1F,MAAO,CACLlH,SAAUJ,EAAMI,SAChBwnB,aAAavmB,MAAO2E,iBAChBuc,GAAW,CAAExH,IAAKwH,QAChBE,GAAU1B,GAAO,CAAEA,IAAKD,GAAYC,OACtCzZ,GAA0B,CAC5BoF,MAAOlO,GAAkB,IAAK8I,KAGpC,CCtOA,MAAMugB,WAAoBxxB,MAGvB7E,YAAaiM,EAASqqB,EAAW,QAChCC,MAAMtqB,GAAShM,KAAKgM,QAAUA,EAC9BhM,KAAK+D,gBAAkBO,UAAUvE,YAAYgE,KAI7CM,OAAOkyB,eAAev2B,gBAAiBsE,WACvCtE,KAAKq2B,SAAWA,CAClB,ECAF,MAAMG,GAAqB,8DAiC3B,MAAMC,GA0BH12B,YAAYmG,GAeX,GAdAlG,KAAK02B,SAAWxwB,EAChBlG,KAAK22B,cAAgB,CAAC,EACtB32B,KAAK42B,0BAA2B,EAChC52B,KAAK62B,eAAiB,EACtB72B,KAAK82B,UAAY,CAAC,EAClB92B,KAAK+2B,OAAS,CAAC,EACf/2B,KAAKmc,iBAAmB,GAEpBjW,EAAQopB,IACVtvB,KAAKg3B,KAAOhH,GAAQ9pB,EAAQopB,KAE5B5mB,IAAeY,EAAOmN,KAAK,iDAGzBzW,KAAKg3B,KAAM,CACb,MAAM7N,EAAMyH,GAAsC5wB,KAAKg3B,KAAM9wB,GAC7DlG,KAAKi3B,WAAa/wB,EAAQgxB,UAAU,CAClCC,mBAAoBn3B,KAAKm3B,mBAAmBpK,KAAK/sB,SAC9CkG,EAAQkxB,iBACXjO,OAEJ,CACF,CAMChJ,iBAAiB3R,EAAW6E,EAAMwF,GAEjC,GAAIvJ,GAAwBd,GAE1B,YADA9F,IAAeY,EAAOqC,IAAI6qB,KAI5B,IAAI5nB,EAAUyE,GAAQA,EAAK1E,SAE3B,OAAA3O,KAAKq3B,SACHr3B,KAAKs3B,mBAAmB9oB,EAAW6E,GAChC7N,KAAK+I,GAASvO,KAAKu3B,cAAchpB,EAAO8E,EAAMwF,IAC9CrT,KAAK6M,IACJzD,EAAUyD,KAITzD,CACT,CAKC0R,eACCtU,EAEA5C,EACAiK,EACAwF,GAEA,IAAIjK,EAAUyE,GAAQA,EAAK1E,SAE3B,MAAM6oB,EAAetyB,GAAsB8G,GAAWA,EAAU1B,OAAO0B,GAEjEyrB,EAAgBtyB,GAAY6G,GAC9BhM,KAAK03B,iBAAiBF,EAAcpuB,EAAOiK,GAC3CrT,KAAKs3B,mBAAmBtrB,EAASqH,GAErC,OAAArT,KAAKq3B,SACHI,EACGjyB,KAAK+I,GAASvO,KAAKu3B,cAAchpB,EAAO8E,EAAMwF,IAC9CrT,KAAK6M,IACJzD,EAAUyD,KAITzD,CACT,CAKC2R,aAAahS,EAAO8E,EAAMwF,GAEzB,GAAIxF,GAAQA,EAAKgN,mBAAqB/Q,GAAwB+D,EAAKgN,mBAEjE,YADA3X,IAAeY,EAAOqC,IAAI6qB,KAI5B,IAAI5nB,EAAUyE,GAAQA,EAAK1E,SAE3B,OAAA3O,KAAKq3B,SACHr3B,KAAKu3B,cAAchpB,EAAO8E,EAAMwF,GAAOrT,KAAK6M,IAC1CzD,EAAUyD,KAIPzD,CACT,CAKCoU,eAAepP,GACmB,iBAApBA,EAAQe,QACnBjM,IAAeY,EAAOmN,KAAK,+DAE3BzW,KAAK23B,YAAY/jB,GAEjBoB,GAAcpB,EAAS,CAAEE,MAAM,IAEnC,CAKCmF,SACC,OAAOjZ,KAAKg3B,IACd,CAKCle,aACC,OAAO9Y,KAAK02B,QACd,CAOCkB,iBACC,OAAO53B,KAAK02B,SAAS3F,SACvB,CAKC8G,eACC,OAAO73B,KAAKi3B,UACd,CAKCa,MAAMC,GACL,MAAMb,EAAYl3B,KAAKi3B,WACvB,OAAIC,GACEl3B,KAAKg4B,mBACPh4B,KAAKg4B,kBAAkBF,QAElB93B,KAAKi4B,wBAAwBF,GAASvyB,KAAK0yB,GACzChB,EAAUY,MAAMC,GAASvyB,KAAK2yB,GAAoBD,GAAkBC,KAGtEpnB,IAAoB,EAE/B,CAKCqnB,MAAML,GACL,OAAO/3B,KAAK83B,MAAMC,GAASvyB,KAAK6M,IAC9BrS,KAAK8Y,aAAatP,SAAU,EACxBxJ,KAAKg4B,mBACPh4B,KAAKg4B,kBAAkBI,QAElB/lB,GAEX,CAGCkY,qBACC,OAAOvqB,KAAKmc,gBACd,CAGCqB,kBAAkB6a,GACjBr4B,KAAKmc,iBAAiBlV,KAAKoxB,EAC7B,CAMC7W,kBAAkB8W,IACZA,IAAoBt4B,KAAK42B,0BAA8B52B,KAAKu4B,eAAiBv4B,KAAK42B,2BACrF52B,KAAKw4B,oBAET,CAGC1kB,OACK9T,KAAKu4B,cACPv4B,KAAKw4B,oBAET,CAQCC,mBAAmBC,GAClB,OAAO14B,KAAK24B,qBAAqBD,EACnC,CAOCC,qBAAqBC,GACpB,OAAO54B,KAAK22B,cAAciC,EAC5B,CAMClW,eAAeC,GACd,IACE,OAAQ3iB,KAAK22B,cAAchU,EAAYra,KAAS,IAClD,OACEI,WAAeY,EAAOmN,KAAM,+BAA8BkM,EAAYra,8BAC/D,IACT,CACF,CAKCuwB,eAAelW,GACd6J,GAAiBxsB,KAAM2iB,EAAa3iB,KAAK22B,cAC3C,CAKCmC,UAAUvqB,EAAO8E,EAAO,CAAC,GACxBrT,KAAKsZ,KAAK,kBAAmB/K,EAAO8E,GAEpC,IAAI0lB,EClRR,SAASC,GACPzqB,EACA+gB,EACAvV,EACAiX,GAEA,MAAMF,EAAUkF,GAAgCjc,GAS1Ckf,EAAY1qB,EAAMnC,MAAuB,iBAAfmC,EAAMnC,KAA0BmC,EAAMnC,KAAO,SAlD/E,SAAS8sB,GAAwB3qB,EAAOuiB,GACjCA,IAGLviB,EAAM+a,IAAM/a,EAAM+a,KAAO,CAAC,EAC1B/a,EAAM+a,IAAIvlB,KAAOwK,EAAM+a,IAAIvlB,MAAQ+sB,EAAQ/sB,KAC3CwK,EAAM+a,IAAIjI,QAAU9S,EAAM+a,IAAIjI,SAAWyP,EAAQzP,QACjD9S,EAAM+a,IAAIR,aAAe,IAAKva,EAAM+a,IAAIR,cAAgB,MAASgI,EAAQhI,cAAgB,IACzFva,EAAM+a,IAAI6P,SAAW,IAAK5qB,EAAM+a,IAAI6P,UAAY,MAASrI,EAAQqI,UAAY,IAE/E,CA0CED,CAAwB3qB,EAAOwL,GAAYA,EAASuP,KAEpD,MAAM8P,EAAkBlD,GAA2B3nB,EAAOuiB,EAASE,EAAQ1B,GAM3E,cAAO/gB,EAAM+L,sBAGN8Y,GAAegG,EAAiB,CADrB,CAAC,CAAEhtB,KAAM6sB,GAAa1qB,IAE1C,CDqPcyqB,CAAoBzqB,EAAOvO,KAAKg3B,KAAMh3B,KAAK02B,SAAS3F,UAAW/wB,KAAK02B,SAAS1F,QAEvF,UAAWvR,KAAcpM,EAAKsI,aAAe,GAC3Cod,EAAMxF,GACJwF,EACA/D,GACEvV,EACAzf,KAAK02B,SAASU,kBAAoBp3B,KAAK02B,SAASU,iBAAiBtD,cAKvE,MAAMuF,EAAUr5B,KAAKs5B,cAAcP,GAC/BM,GACFA,EAAQ7zB,KAAK+zB,GAAgBv5B,KAAKsZ,KAAK,iBAAkB/K,EAAOgrB,GAAe,KAEnF,CAKC5B,YAAY/jB,GACX,MAAMmlB,EC9TV,SAASS,GACP5lB,EACA0b,EACAvV,EACAiX,GAEA,MAAMF,EAAUkF,GAAgCjc,GAUhD,OAAOqZ,GATiB,CACtB+C,aAAavmB,MAAO2E,iBAChBuc,GAAW,CAAExH,IAAKwH,QAChBE,GAAU1B,GAAO,CAAEA,IAAKD,GAAYC,KAML,CAFrC,eAAgB1b,EAAU,CAAC,CAAExH,KAAM,YAAcwH,GAAW,CAAC,CAAExH,KAAM,WAAawH,EAAQS,WAG9F,CD6SgBmlB,CAAsB5lB,EAAS5T,KAAKg3B,KAAMh3B,KAAK02B,SAAS3F,UAAW/wB,KAAK02B,SAAS1F,QAI7FhxB,KAAKs5B,cAAcP,EACrB,CAKC5B,mBAAmBhmB,EAAQsoB,EAAUC,GAGpC,GAAI15B,KAAK02B,SAASiD,kBAAmB,CAOnC,MAAMpyB,EAAO,GAAE4J,KAAUsoB,IACzB/wB,IAAeY,EAAOqC,IAAK,oBAAmBpE,MAG9CvH,KAAK82B,UAAUvvB,GAAOvH,KAAK82B,UAAUvvB,GAAO,GAAK,CACnD,CACF,CAKCqyB,wBAAwBC,GACvBnxB,IAAeY,EAAOqC,IAAK,mDAAkDkuB,EAAkBnzB,UAC/F,MAAMozB,EE5WV,SAASC,GACPF,EACAvK,EACAvV,EACAiX,GAEA,MAAMqC,EAAU,CACd8C,aAAavmB,MAAO2E,eAGlBwF,GAAYA,EAASuP,MACvB+J,EAAQ/J,IAAM,CACZvlB,KAAMgW,EAASuP,IAAIvlB,KACnBsd,QAAStH,EAASuP,IAAIjI,UAIpB2P,GAAU1B,IACd+D,EAAQ/D,IAAMD,GAAYC,IAG5B,MAAM5hB,EAIR,SAASssB,GAAyBH,GAChC,MAAMtF,ECYR,SAAS0F,GAAuBJ,GAC9B,IAAIxzB,EAAM,GACV,UAAWqH,KAAQmsB,EAAmB,CACpC,MAAMK,EAAa71B,OAAO2R,QAAQtI,EAAKsK,MACjCmiB,EAAYD,EAAWxzB,OAAS,EAAK,KAAIwzB,EAAW/xB,IAAI,EAAEZ,EAAK8C,KAAY,GAAE9C,KAAO8C,KAASjD,KAAK,OAAS,GACjHf,GAAQ,GAAEqH,EAAK3J,QAAQ2J,EAAK0sB,QAAQ1sB,EAAK2sB,UAAU3sB,EAAK4sB,aAAaH,MAAczsB,EAAKqG,aAC1F,CACA,OAAO1N,CACT,CDpBkB4zB,CAAuBJ,GAKvC,MAAO,CAJe,CACpBztB,KAAM,SACN1F,OAAQ6tB,EAAQ7tB,QAEK6tB,EACzB,CAXeyF,CAAyBH,GACtC,OAAOzG,GAAeC,EAAS,CAAC3lB,GAClC,CFqV4BqsB,CACtBF,EACA75B,KAAKg3B,KACLh3B,KAAK02B,SAAS3F,UACd/wB,KAAK02B,SAAS1F,QAKhBhxB,KAAKs5B,cAAcQ,EACrB,CAQCjN,GAAG0N,EAAMxxB,GACH/I,KAAK+2B,OAAOwD,KACfv6B,KAAK+2B,OAAOwD,GAAQ,IAItBv6B,KAAK+2B,OAAOwD,GAAMtzB,KAAK8B,EACzB,CAKCuQ,KAAKihB,KAASC,GACTx6B,KAAK+2B,OAAOwD,IACdv6B,KAAK+2B,OAAOwD,GAAMnyB,QAAQW,GAAYA,KAAYyxB,GAEtD,CAKChC,qBACCx4B,KAAK22B,cX7UT,SAASnV,GAAkB5I,EAAQkQ,GACjC,MAAM2D,EAAmB,CAAC,EAE1B3D,SAAa1gB,QAAQua,IAEfA,GACF6J,GAAiB5T,EAAQ+J,EAAa8J,EAAgB,GAInDA,CACT,CWkUyBjL,CAAkBxhB,KAAMA,KAAK02B,SAAS5N,cAE3D9oB,KAAK42B,0BAA2B,CAClC,CAGC6D,wBAAwB7mB,EAASrF,GAChC,IAAImsB,GAAU,EACVC,GAAU,EACd,MAAMC,EAAarsB,EAAMC,WAAaD,EAAMC,UAAUC,OAEtD,GAAImsB,EAAY,CACdD,GAAU,EAEV,UAAWE,KAAMD,EAAY,CAC3B,MAAM1rB,EAAY2rB,EAAG3rB,UACrB,GAAIA,IAAmC,IAAtBA,EAAUC,QAAmB,CAC5CurB,GAAU,EACV,KACF,CACF,CACF,CAKA,MAAMI,EAAwC,OAAnBlnB,EAAQM,QACN4mB,GAAyC,IAAnBlnB,EAAQO,QAAkB2mB,GAAsBJ,KAGjG1lB,GAAcpB,EAAS,IACjB8mB,GAAW,CAAExmB,OAAQ,WACzBC,OAAQP,EAAQO,QAAU4mB,OAAOJ,GAAWD,KAE9C16B,KAAKgjB,eAAepP,GAExB,CAYCqkB,wBAAwBF,GACvB,OAAO,IAAI/mB,GAAYC,IACrB,IAAI+pB,EAAS,EACb,MAEMC,EAAWC,YAAY,KACA,GAAvBl7B,KAAK62B,gBACPsE,cAAcF,GACdhqB,GAAQ,KAER+pB,GAPS,EAQLjD,GAAWiD,GAAUjD,IACvBoD,cAAcF,GACdhqB,GAAQ,IAAK,EAVN,EAaN,EAEX,CAGCsnB,aACC,OAAqC,IAA9Bv4B,KAAK8Y,aAAatP,cAAyCjG,IAApBvD,KAAKi3B,UACrD,CAgBCmE,cACC7sB,EACA8E,EACAwF,EACAgI,EAAiBoB,MAEjB,MAAM/b,EAAUlG,KAAK8Y,aACfgQ,EAAezkB,OAAO8E,KAAKnJ,KAAK22B,eACtC,OAAKtjB,EAAKyV,cAAgBA,EAAapiB,OAAS,IAC9C2M,EAAKyV,aAAeA,GAGtB9oB,KAAKsZ,KAAK,kBAAmB/K,EAAO8E,GAE7BqV,GAAaxiB,EAASqI,EAAO8E,EAAMwF,EAAO7Y,KAAM6gB,GAAgBrb,KAAKilB,IAC1E,GAAY,OAARA,EACF,OAAOA,EAMT,MAAQlQ,sBAAuBkQ,EAAInQ,uBAAyB,CAAC,EAE7D,KADcmQ,EAAI/P,WAAY+P,EAAI/P,SAASO,QAC7BV,EAAoB,CAChC,MAAQnD,QAASQ,EAAUP,SAAQgkB,eAAchiB,QAAQkB,EACzDkQ,EAAI/P,SAAW,CACbO,MAAO,CACLrD,WACAD,QAASN,EACTU,eAAgBsjB,MAEf5Q,EAAI/P,UAGT,MAAM7E,GAAyBwD,IAAYV,GAAoCf,EAAU5X,KAAM6Y,GAE/F4R,EAAInQ,sBAAwB,CAC1BzE,6BACG4U,EAAInQ,sBAEX,CACA,OAAOmQ,GAEX,CAQC8M,cAAchpB,EAAO8E,EAAO,CAAC,EAAGwF,GAC/B,OAAO7Y,KAAKs7B,cAAc/sB,EAAO8E,EAAMwF,GAAOrT,KAC5C+1B,GACSA,EAAW5sB,SAEpBwC,IACE,GAAIzI,GAAa,CAGf,MAAM8yB,EAAcrqB,EACS,QAAzBqqB,EAAYnF,SACd/sB,EAAOqC,IAAI6vB,EAAYxvB,SAEvB1C,EAAOmN,KAAK+kB,EAEhB,GAIN,CAeCF,cAAc/sB,EAAO8E,EAAMwF,GAC1B,MAAM3S,EAAUlG,KAAK8Y,cACbe,cAAe3T,EAEjBu1B,EAAgBC,GAAmBntB,GACnC/J,EAAUO,GAAawJ,GACvB0qB,EAAY1qB,EAAMnC,MAAQ,QAC1BuvB,EAAmB,0BAAyB1C,MAKlD,GAAIz0B,GAAiC,iBAAfqV,GAA2BvW,KAAKyK,SAAW8L,EAC/D,OAAA7Z,KAAKm3B,mBAAmB,cAAe,QAAS5oB,GACzC2C,GACL,IAAIklB,GACD,oFAAmFvc,KACpF,QAKN,MAAM+hB,EAA6B,iBAAd3C,EAA+B,SAAWA,EAE/D,OAAOj5B,KAAKo7B,cAAc7sB,EAAO8E,EAAMwF,GACpCrT,KAAKqjB,IACJ,GAAiB,OAAbA,EACF,MAAA7oB,KAAKm3B,mBAAmB,kBAAmByE,EAAcrtB,GACnD,IAAI6nB,GAAY,2DAA4D,OAIpF,GAD4B/iB,EAAKhE,OAAoC,IAA3BgE,EAAKhE,KAAOwsB,WAEpD,OAAOhT,EAGT,MAAMxW,GAkId,SAASypB,GACP51B,EACAqI,EACA8E,GAEA,MAAQ0oB,aAAYC,yBAA0B91B,EAE9C,OAAInB,GAAawJ,IAAUwtB,EAClBA,EAAWxtB,EAAO8E,GAGvBqoB,GAAmBntB,IAAUytB,EACxBA,EAAsBztB,EAAO8E,GAG/B9E,CACT,CAlJuButB,CAAkB51B,EAAS2iB,EAAUxV,GACpD,OAuGR,SAAS4oB,GACPC,EACAP,GAEA,MAAMQ,EAAqB,GAAER,2CAC7B,GAAIp2B,GAAW22B,GACb,OAAOA,EAAiB12B,KACtB+I,IACE,IAAKnJ,GAAcmJ,IAAoB,OAAVA,EAC3B,MAAM,IAAI6nB,GAAY+F,GAExB,OAAO5tB,GAET2D,IACE,MAAM,IAAIkkB,GAAa,GAAEuF,mBAAiCzpB,IAAG,GAG5D,IAAK9M,GAAc82B,IAA0C,OAArBA,EAC7C,MAAM,IAAI9F,GAAY+F,GAExB,OAAOD,CACT,CA5HeD,CAA0B5pB,GAAQspB,EAAe,GAEzDn2B,KAAK42B,IACJ,GAAuB,OAAnBA,EACF,MAAAp8B,KAAKm3B,mBAAmB,cAAeyE,EAAcrtB,GAC/C,IAAI6nB,GAAa,GAAEuF,4CAA2D,OAGtF,MAAM/nB,EAAUiF,GAASA,EAAM+F,cAC1B6c,GAAiB7nB,GACpB5T,KAAKy6B,wBAAwB7mB,EAASwoB,GAMxC,MAAMC,GAAkBD,EAAeE,iBACvC,GAAIb,GAAiBY,IAAmBD,EAAe7mB,cAAgBhH,EAAMgH,YAAa,CACxF,MAAMrK,GAAS,SACfkxB,EAAeE,iBAAmB,IAC7BD,GACHnxB,UAEJ,CAEA,OAAAlL,KAAK84B,UAAUsD,EAAgB/oB,GACxB+oB,IAER52B,KAAK,KAAM2L,IACV,MAAIA,aAAkBilB,GACdjlB,GAGRnR,KAAKmgB,iBAAiBhP,EAAQ,CAC5B9B,KAAM,CACJwsB,YAAY,GAEdxb,kBAAmBlP,IAEf,IAAIilB,GACP,8HAA6HjlB,KAChI,EAEN,CAKCkmB,SAASgC,GACRr5B,KAAK62B,iBACAwC,EAAQ7zB,KACX6E,IACErK,KAAK62B,iBACExsB,GAET8G,IACEnR,KAAK62B,iBACE1lB,GAGb,CAKCmoB,cAAc9F,GAGb,GAFAxzB,KAAKsZ,KAAK,iBAAkBka,GAExBxzB,KAAKu4B,cAAgBv4B,KAAKi3B,WAC5B,OAAOj3B,KAAKi3B,WAAWsF,KAAK/I,GAAUhuB,KAAK,KAAM2L,IAC/CzI,IAAeY,EAAOolB,MAAM,6BAA8Bvd,EAAM,GAGlEzI,IAAeY,EAAOolB,MAAM,qBAEhC,CAKC8N,iBACC,MAAMC,EAAWz8B,KAAK82B,UACtB,OAAA92B,KAAK82B,UAAY,CAAC,EACXzyB,OAAO8E,KAAKszB,GAAUt0B,IAAIZ,IAC/B,MAAO4J,EAAQsoB,GAAYlyB,EAAIgB,MAAM,KACrC,MAAO,CACL4I,SACAsoB,WACAiD,SAAUD,EAASl1B,GACrB,EAEJ,EAwDF,SAASxC,GAAawJ,GACpB,YAAsBhL,IAAfgL,EAAMnC,IACf,CAEA,SAASsvB,GAAmBntB,GAC1B,MAAsB,gBAAfA,EAAMnC,IACf,CItvBA,SAASuwB,GAAiBz2B,EAASnC,EAAM64B,EAAQ,CAAC74B,GAAOmH,EAAS,OAChE,MAAM6O,EAAW7T,EAAQ6qB,WAAa,CAAC,EAElChX,EAASuP,MACZvP,EAASuP,IAAM,CACbvlB,KAAO,qBAAoBA,IAC3Bo1B,SAAUyD,EAAMz0B,IAAIpE,KAClBA,KAAO,GAAEmH,aAAkBnH,IAC3Bsd,QAASb,MAEXa,QAASb,KAIbta,EAAQ6qB,UAAYhX,CACtB,iBCzBA,MAAMrR,UAAsBC,iBAAqB,KAAeA,iBCChE,SAASk0B,GAAmB/W,EAAa+U,GAEvC,MAAM5V,EAAS6X,GAAiBhX,EAAa+U,GAEvCrsB,EAAY,CAChBpC,KAAMyuB,GAAMA,EAAG92B,KACfsG,MAAO0yB,GAAelC,IAGxB,OAAI5V,EAAOve,SACT8H,EAAU0b,WAAa,CAAEjF,gBAGJ1hB,IAAnBiL,EAAUpC,MAA0C,KAApBoC,EAAUnE,QAC5CmE,EAAUnE,MAAQ,8BAGbmE,CACT,CA0CA,SAASwuB,GAAelX,EAAa+U,GACnC,MAAO,CACLrsB,UAAW,CACTC,OAAQ,CAACouB,GAAmB/W,EAAa+U,KAG/C,CAGA,SAASiC,GACPhX,EACA+U,GAKA,MAAM3Q,EAAa2Q,EAAG3Q,YAAc2Q,EAAG5uB,OAAS,GAE1CgxB,EAcR,SAASC,GAAWrC,GAClB,GAAIA,EAAI,CACN,GAA8B,iBAAnBA,EAAGsC,YACZ,OAAOtC,EAAGsC,YAGZ,GAAIC,GAAoBryB,KAAK8vB,EAAG7uB,SAC9B,OAAO,CAEX,CAEA,OAAO,CACT,CA1BkBkxB,CAAWrC,GAE3B,IACE,OAAO/U,EAAYoE,EAAY+S,EACjC,OACE,CAGF,MAAO,EACT,CAGA,MAAMG,GAAsB,8BAqB5B,SAASL,GAAelC,GACtB,MAAM7uB,EAAU6uB,GAAMA,EAAG7uB,QACzB,OAAKA,EAGDA,EAAQ0iB,OAA0C,iBAA1B1iB,EAAQ0iB,MAAM1iB,QACjCA,EAAQ0iB,MAAM1iB,QAEhBA,EALE,kBAMX,CA8CA,SAASqxB,GACPvX,EACAtX,EACA4R,EACAkd,EACAC,GAEA,IAAIhvB,EAEJ,GAAIxJ,GAAayJ,IAAgBA,EAAYkgB,MAG3C,OAAOsO,GAAelX,EADHtX,EAC2BkgB,OAUhD,GAAI1pB,GAAWwJ,I3CtIjB,SAASgvB,GAAe/4B,GACtB,OAAOI,GAAUJ,EAAK,eACxB,C2CoI+B+4B,CAAehvB,GAAa,CACvD,MAAMivB,EAAejvB,EAErB,GAAI,UAAYA,EACdD,EAAQyuB,GAAelX,EAAatX,OAC/B,CACL,MAAMzK,EAAO05B,EAAa15B,OAASiB,GAAWy4B,GAAgB,WAAa,gBACrEzxB,EAAUyxB,EAAazxB,QAAW,GAAEjI,MAAS05B,EAAazxB,UAAYjI,EAC5EwK,EAAQmvB,GAAgB5X,EAAa9Z,EAASoU,EAAoBkd,GAClExuB,GAAsBP,EAAOvC,EAC/B,CACA,MAAI,SAAUyxB,IAEZlvB,EAAMyJ,KAAO,IAAKzJ,EAAMyJ,KAAM,oBAAsB,GAAEylB,EAAaE,SAG9DpvB,CACT,CACA,OAAI/J,GAAQgK,GAEHwuB,GAAelX,EAAatX,GAEjCpJ,GAAcoJ,IAAcnJ,GAAQmJ,IAKtCD,EAhMJ,SAASqvB,GACP9X,EACAtX,EACA4R,EACAmd,GAEA,MAAM3kB,EAASY,KACTmP,EAAiB/P,GAAUA,EAAOE,aAAa6P,eAE/Cpa,EAAQ,CACZC,UAAW,CACTC,OAAQ,CACN,CACErC,KAAM/G,GAAQmJ,GAAaA,EAAUzO,YAAYgE,KAAOw5B,EAAuB,qBAAuB,QACtGlzB,MAAOwzB,GAAgCrvB,EAAW,CAAE+uB,4BAI1D9iB,MAAO,CACLqjB,eAAgBtX,GAAgBhY,EAAWma,KAI/C,GAAIvI,EAAoB,CACtB,MAAM6E,EAAS6X,GAAiBhX,EAAa1F,GACzC6E,EAAOve,SAER6H,EAAMC,UAAYC,OAAO,GAAGyb,WAAa,CAAEjF,UAEhD,CAEA,OAAO1W,CACT,CAgKYqvB,CAAqB9X,EADLtX,EACmC4R,EAAoBmd,GAC/ExuB,GAAsBR,EAAO,CAC3BwvB,WAAW,IAENxvB,IAYTA,EAAQmvB,GAAgB5X,EAAatX,EAAY4R,EAAoBkd,GACrExuB,GAAsBP,EAAQ,GAAEC,SAAajL,GAC7CwL,GAAsBR,EAAO,CAC3BwvB,WAAW,IAGNxvB,EACT,CAKA,SAASmvB,GACP5X,EACA9Z,EACAoU,EACAkd,GAEA,MAAM/uB,EAAQ,CAAC,EAEf,GAAI+uB,GAAoBld,EAAoB,CAC1C,MAAM6E,EAAS6X,GAAiBhX,EAAa1F,GACzC6E,EAAOve,SACT6H,EAAMC,UAAY,CAChBC,OAAQ,CAAC,CAAEpE,MAAO2B,EAASke,WAAY,CAAEjF,aAG/C,CAEA,GAAI/f,GAAsB8G,GAAU,CAClC,MAAQgyB,6BAA4BC,8BAA+BjyB,EAEnEuC,SAAM2vB,SAAW,CACflyB,QAASgyB,EACTG,OAAQF,GAEH1vB,CACT,CAEAA,SAAMvC,QAAUA,EACTuC,CACT,CAEA,SAASsvB,GACPrvB,GACE+uB,yBAEF,MAAMp0B,EtC3HR,SAASi1B,GAA+B5vB,EAAW6vB,EAAY,IAC7D,MAAMl1B,EAAO9E,OAAO8E,KAAK4C,GAAqByC,IAG9C,GAFArF,EAAKyb,QAEAzb,EAAKzC,OACR,MAAO,uBAGT,GAAIyC,EAAK,GAAGzC,QAAU23B,EACpB,OAAOx0B,GAASV,EAAK,GAAIk1B,GAG3B,QAASC,EAAen1B,EAAKzC,OAAQ43B,EAAe,EAAGA,IAAgB,CACrE,MAAMC,EAAap1B,EAAKa,MAAM,EAAGs0B,GAAcl3B,KAAK,MACpD,KAAIm3B,EAAW73B,OAAS23B,GAGxB,OAAIC,IAAiBn1B,EAAKzC,OACjB63B,EAEF10B,GAAS00B,EAAYF,EAC9B,CAEA,MAAO,EACT,CsCmGeD,CAA+B5vB,GACtCgwB,EAAcjB,EAAuB,oBAAsB,YAIjE,OAAIx4B,GAAayJ,GACP,oCAAmCgwB,oBAA8BhwB,EAAUxC,YAGjF3G,GAAQmJ,GAEF,WAMZ,SAASiwB,GAAmBp7B,GAC1B,IACE,MAAMiB,EAAYD,OAAOgJ,eAAehK,GACxC,OAAOiB,EAAYA,EAAUvE,YAAYgE,UAAOR,CAClD,OACE,CAEJ,CAdsBk7B,CAAmBjwB,cACEA,EAAUpC,qBAAqBoyB,IAGhE,sBAAqBA,gBAA0Br1B,GACzD,CCxSA,MAAMrD,GAAStC,EAEf,IAAIk7B,GAAgB,EAKpB,SAASC,KACP,OAAOD,GAAgB,CACzB,CAsBA,SAASE,GACP3Y,EACA/f,EAEC,CAAC,EACF24B,GAUA,GAAkB,mBAAP5Y,EACT,OAAOA,EAGT,IAGE,MAAM6Y,EAAU7Y,EAAG8Y,mBACnB,GAAID,EACF,OAAOA,EAIT,GAAIlzB,GAAoBqa,GACtB,OAAOA,CAEX,OAIE,OAAOA,CACT,CAIA,MAAM+Y,EAAgB,WACpB,MAAMp1B,EAAO/C,MAAMvC,UAAU0F,MAAMtF,KAAKu6B,WAExC,IACMJ,GAA4B,mBAAXA,GACnBA,EAAOjb,MAAM5jB,KAAMi/B,WAIrB,MAAMC,EAAmBt1B,EAAKzB,IAAKg3B,GAAQP,GAAKO,EAAKj5B,IAMrD,OAAO+f,EAAGrC,MAAM5jB,KAAMk/B,EACxB,OAASrE,GACPuE,MA1EN,SAASA,KAEPV,KACAW,WAAW,KACTX,MAEJ,CAoEMU,GnBiEN,SAAStd,MACJ0Y,GAGH,MAAM3W,EAAMI,KAGZ,GAAoB,IAAhBuW,EAAK9zB,OAAc,CACrB,MAAOmS,EAAO9P,GAAYyxB,EAC1B,OAMO3W,EAAI/B,UANNjJ,EAMgB,KAEnBgL,EAAItC,cAAc1I,MAAQA,EACnB9P,EAAS8P,IAPK9P,EASzB,CAGA,OAAO8a,EAAI/B,UAAU0Y,EAAK,GAC5B,CmBvFM1Y,CAAUjJ,IACRA,EAAM2E,kBAAkBjP,IAClBrI,EAAQgJ,YACVJ,GAAsBP,OAAOhL,OAAWA,GACxCwL,GAAsBR,EAAOrI,EAAQgJ,YAGvCX,EAAMkM,MAAQ,IACTlM,EAAMkM,MACTwkB,UAAWr1B,GAGN2E,IAGT4R,GAAiB0a,EAAE,GAGfA,CACR,CACF,EAKA,IACE,UAAWhuB,KAAYoZ,EACjB5hB,OAAOC,UAAUwI,eAAepI,KAAKuhB,EAAIpZ,KAC3CmyB,EAAcnyB,GAAYoZ,EAAGpZ,GAGnC,OAAe,CAIfvB,GAAoB0zB,EAAe/Y,GAEnC1a,GAAyB0a,EAAI,qBAAsB+Y,GAGnD,IACqB36B,OAAOi7B,yBAAyBN,EAAe,QACnDtzB,cACbrH,OAAOmH,eAAewzB,EAAe,OAAQ,CAC3CzxB,QACS0Y,EAAGliB,MAKlB,OAAe,CAEf,OAAOi7B,CACT,CChIA,MAAMO,WAAsB9I,GAMzB12B,YAAYmG,GAEXy2B,GAAiBz2B,EAAS,UAAW,CAAC,WADpBJ,GAAO05B,sBAAqBC,SAG9CnJ,MAAMpwB,GAEFA,EAAQyzB,mBAAqB7zB,GAAOgiB,UACtChiB,GAAOgiB,SAAS4X,iBAAiB,mBAAoB,KACX,WAApC55B,GAAOgiB,SAAS6X,iBAClB3/B,KAAK4/B,gBAAe,EAI5B,CAKCtI,mBAAmB9oB,EAAW6E,GAC7B,OFyFJ,SAASikB,GACPxR,EACAtX,EACA6E,EACAiqB,GAEA,MACM/uB,EAAQ8uB,GAAsBvX,EAAatX,EADrB6E,GAAQA,EAAK+M,yBAAuB7c,EACgB+5B,GAChFvuB,UAAsBR,GACtBA,EAAMnF,MAAQ,QACViK,GAAQA,EAAK1E,WACfJ,EAAMI,SAAW0E,EAAK1E,UAEjBoC,GAAoBxC,EAC7B,CEvGW+oB,CAAmBt3B,KAAK02B,SAAS5Q,YAAatX,EAAW6E,EAAMrT,KAAK02B,SAAS4G,iBACtF,CAKC5F,iBACC1rB,EAEA5C,EAAQ,OACRiK,GAEA,OFiGJ,SAASqkB,GACP5R,EACA9Z,EAEA5C,EAAQ,OACRiK,EACAiqB,GAEA,MACM/uB,EAAQmvB,GAAgB5X,EAAa9Z,EADfqH,GAAQA,EAAK+M,yBAAuB7c,EACQ+5B,GACxE/uB,SAAMnF,MAAQA,EACViK,GAAQA,EAAK1E,WACfJ,EAAMI,SAAW0E,EAAK1E,UAEjBoC,GAAoBxC,EAC7B,CEhHWmpB,CAAiB13B,KAAK02B,SAAS5Q,YAAa9Z,EAAS5C,EAAOiK,EAAMrT,KAAK02B,SAAS4G,iBACzF,CAKCuC,oBAAoBhK,GACnB,IAAK71B,KAAKu4B,aAER,YADA7vB,IAAeY,EAAOmN,KAAK,qDAI7B,MAAM+c,EC9DV,SAASsM,GACPjK,GAEE9b,WACAiX,SACA1B,QAKF,MAAM+D,EAAU,CACd1kB,SAAUknB,EAASlnB,SACnBwnB,aAAavmB,MAAO2E,iBAChBwF,GACFA,EAASuP,KAAO,CACdA,IAAK,CACHvlB,KAAMgW,EAASuP,IAAIvlB,KACnBsd,QAAStH,EAASuP,IAAIjI,eAGtB2P,KAAY1B,GAAO,CAAEA,IAAKD,GAAYC,KAExC5hB,EAKR,SAASqyB,GAA+BlK,GAItC,MAAO,CAHiB,CACtBzpB,KAAM,eAEiBypB,EAC3B,CAVekK,CAA+BlK,GAE5C,OAAOzC,GAAeC,EAAS,CAAC3lB,GAClC,CDqCqBoyB,CAA2BjK,EAAU,CACpD9b,SAAU/Z,KAAK43B,iBACftI,IAAKtvB,KAAKiZ,SACV+X,OAAQhxB,KAAK8Y,aAAakY,SAK5BhxB,KAAKs5B,cAAc9F,EACrB,CAKC4H,cAAc7sB,EAAO8E,EAAMwF,GAC1BtK,SAAMyxB,SAAWzxB,EAAMyxB,UAAY,aAC5B1J,MAAM8E,cAAc7sB,EAAO8E,EAAMwF,EAC1C,CAKC+mB,iBACC,MAAMnD,EAAWz8B,KAAKw8B,iBAEtB,GAAwB,IAApBC,EAAS/1B,OAEX,YADAgC,IAAeY,EAAOqC,IAAI,wBAK5B,IAAK3L,KAAKg3B,KAER,YADAtuB,IAAeY,EAAOqC,IAAI,4CAI5BjD,IAAeY,EAAOqC,IAAI,oBAAqB8wB,GAE/C,MAAMjJ,EEjGV,SAASyM,GACPC,EACA5Q,EACAvb,GASA,OAAOqf,GAAe9D,EAAM,CAAEA,OAAQ,CAAC,EAAG,CAPjB,CACvB,CAAEljB,KAAM,iBACR,CACE2H,UAAWA,GAAapE,KACxBuwB,sBAIN,CFoFqBD,CAA2BxD,EAAUz8B,KAAK02B,SAAS1F,QAAU3B,GAAYrvB,KAAKg3B,OAI/Fh3B,KAAKs5B,cAAc9F,EACrB,EG7FF,SAAS2M,KACD,YAAA38B,GAINoF,GAAeR,QAAQ,SAAUgB,GACzBA,KAAS5F,EAAWwF,SAI1BiC,GAAKzH,EAAWwF,QAASI,EAAO,SAAUC,GACxCR,UAAuBO,GAASC,EAEzB,YAAaO,GAElBqoB,GAAgB,UADI,CAAEroB,OAAMR,UAG5B,MAAMuC,EAAM9C,GAAuBO,GACnCuC,GAAOA,EAAIiY,MAAMpgB,EAAWwF,QAASY,EACvC,CACF,EACF,EACF,CClCA,MAAM9D,GAAStC,EACT48B,GAAoB,IAE1B,IAAIC,GACAC,GACAC,GAQJ,SAASC,GAAuCxtB,GAE9C8e,EADa,MACI9e,GACjB+e,GAFa,MAES0O,GACxB,CAGA,SAASA,KACP,IAAK36B,GAAOgiB,SACV,OAMF,MAAM4Y,EAAoBzO,GAAgBlF,KAAK,KAAM,OAC/C4T,EAAwBC,EAAoBF,GAAmB,GACrE56B,GAAOgiB,SAAS4X,iBAAiB,QAASiB,GAAuB,GACjE76B,GAAOgiB,SAAS4X,iBAAiB,WAAYiB,GAAuB,GAOpE,CAAC,cAAe,QAAQv4B,QAASiE,IAE/B,MAAMw0B,EAAS/6B,GAASuG,IAAYvG,GAASuG,GAAQ/H,WAEhDu8B,IAAUA,EAAM/zB,iBAAmB+zB,EAAM/zB,eAAe,sBAI7D7B,GAAK41B,EAAO,mBAAoB,SAAUC,GACxC,OAAO,SAEL10B,EACA20B,EACA76B,GAEA,GAAa,UAATkG,GAA4B,YAARA,EACtB,IACE,MAAM/E,EAAKrH,KACL4xB,EAAYvqB,EAAG25B,oCAAsC35B,EAAG25B,qCAAuC,CAAC,EAChGC,EAAkBrP,EAASxlB,GAAQwlB,EAASxlB,IAAS,CAAE80B,SAAU,GAEvE,IAAKD,EAAejuB,QAAS,CAC3B,MAAMA,EAAU4tB,EAAoBF,GACpCO,EAAejuB,QAAUA,EACzB8tB,EAAyBp8B,KAAK1E,KAAMoM,EAAM4G,EAAS9M,EACrD,CAEA+6B,EAAeC,UACjB,OAEE,CAIJ,OAAOJ,EAAyBp8B,KAAK1E,KAAMoM,EAAM20B,EAAU76B,EAC7D,CACF,GAEA+E,GACE41B,EACA,sBACA,SAAUM,GACR,OAAO,SAEL/0B,EACA20B,EACA76B,GAEA,GAAa,UAATkG,GAA4B,YAARA,EACtB,IACE,MAAM/E,EAAKrH,KACL4xB,EAAWvqB,EAAG25B,qCAAuC,CAAC,EACtDC,EAAiBrP,EAASxlB,GAE5B60B,IACFA,EAAeC,WAEXD,EAAeC,UAAY,IAC7BC,EAA4Bz8B,KAAK1E,KAAMoM,EAAM60B,EAAejuB,QAAS9M,GACrE+6B,EAAejuB,aAAUzP,SAClBquB,EAASxlB,IAImB,IAAjC/H,OAAO8E,KAAKyoB,GAAUlrB,eACjBW,EAAG25B,oCAGhB,OAEE,CAIJ,OAAOG,EAA4Bz8B,KAAK1E,KAAMoM,EAAM20B,EAAU76B,EAChE,CACF,GACF,EAEJ,CAsDA,SAAS06B,EACP5tB,EACAouB,GAAiB,GAEjB,OAAQ7yB,IAIN,IAAKA,GAASA,EAAM8yB,gBAClB,OAGF,MAAMh1B,EAoCV,SAASi1B,EAAe/yB,GACtB,IACE,OAAOA,EAAMlC,MACf,OAGE,OAAO,IACT,CACF,CA5CmBi1B,CAAe/yB,GAG9B,GArCJ,SAASgzB,EAAmBtI,EAAW5sB,GAErC,QAAkB,aAAd4sB,GAIC5sB,GAAWA,EAAO3E,UAMA,UAAnB2E,EAAO3E,SAA0C,aAAnB2E,EAAO3E,SAA0B2E,EAAOm1B,mBAK5E,CAoBQD,CAAmBhzB,EAAMnC,KAAMC,GACjC,OAIFd,GAAyBgD,EAAO,mBAAmB,GAE/ClC,IAAWA,EAAOo1B,WAEpBl2B,GAAyBc,EAAQ,YAAasB,MAGhD,MAAM5J,EAAsB,aAAfwK,EAAMnC,KAAsB,QAAUmC,EAAMnC,MA5E7D,SAASs1B,EAA6BnzB,GAEpC,GAAIA,EAAMnC,OAASk0B,GACjB,OAAO,EAGT,IAGE,IAAK/xB,EAAMlC,QAAWkC,EAAMlC,OAASo1B,YAAclB,GACjD,OAAO,CAEX,OAEE,CAMF,OAAO,CACT,EA4DSmB,CAA6BnzB,KAEhCyE,EADoB,CAAEzE,QAAOxK,OAAMH,OAAQw9B,IAE3Cd,GAAwB/xB,EAAMnC,KAC9Bm0B,GAA4Bl0B,EAASA,EAAOo1B,eAAYl+B,GAI1Do+B,aAAatB,IACbA,GAAkBv6B,GAAOu5B,WAAW,KAClCkB,QAA4Bh9B,EAC5B+8B,QAAwB/8B,GACvB68B,GAAiB,CAExB,CCzNA,MAAMt6B,EAAStC,EAETo+B,EAAsB,oBAU5B,SAASC,EAA6B7uB,GAEpC8e,EADa,MACI9e,GACjB+e,GAFa,MAES+P,GACxB,CAGA,SAASA,KAEP,IAAMh8B,EAASi8B,eACb,OAGF,MAAMC,EAAWD,eAAez9B,UAEhC2G,GAAK+2B,EAAU,OAAQ,SAAUC,GAC/B,OAAO,YAAcr4B,GACnB,MAAMs4B,EAAiBtyB,KAAKC,MAItB2T,EAASve,GAAS2E,EAAK,IAAMA,EAAK,GAAGu4B,mBAAgB5+B,EACrD4lB,EAoGZ,SAASiZ,EAASjZ,GAChB,GAAIlkB,GAASkkB,GACX,OAAOA,EAGT,IAKE,OAAQA,EAAM5kB,UAChB,OAAc,CAGhB,CAlHkB69B,CAASx4B,EAAK,IAE1B,IAAK4Z,IAAW2F,EACd,OAAO8Y,EAAare,MAAM5jB,KAAM4J,GAGlC5J,KAAK4hC,GAAuB,CAC1Bpe,SACA2F,MACAkZ,gBAAiB,CAAC,GAIL,SAAX7e,GAAqB2F,EAAI9D,MAAM,gBACjCrlB,KAAKsiC,wBAAyB,GAGhC,MAAMC,EAA4BA,KAEhC,MAAMC,EAAUxiC,KAAK4hC,GAErB,GAAKY,GAImB,IAApBxiC,KAAKyiC,WAAkB,CACzB,IAGED,EAAQE,YAAc1iC,KAAKkU,MAC7B,OACE,CASF+d,GAAgB,MANI,CAClBroB,KAAM,CAAC4Z,EAAQ2F,GACfwZ,aAAc/yB,KAAKC,MACnBqyB,iBACAU,IAAK5iC,MAGT,GAGF,MAAI,uBAAwBA,MAA2C,mBAA5BA,KAAK6iC,mBAC9C53B,GAAKjL,KAAM,qBAAsB,SAAUoL,GACzC,OAAO,YAAc03B,GACnBP,WACOn3B,EAASwY,MAAM5jB,KAAM8iC,EAC9B,CACF,GAEA9iC,KAAK0/B,iBAAiB,mBAAoB6C,GAM5Ct3B,GAAKjL,KAAM,mBAAoB,SAAUoL,GACvC,OAAO,YAAc23B,GACnB,MAAOC,EAAQ34B,GAAS04B,EAElBP,EAAUxiC,KAAK4hC,GAErB,OAAIY,GAAWv9B,GAAS+9B,IAAW/9B,GAASoF,KAC1Cm4B,EAAQH,gBAAgBW,EAAOl7B,eAAiBuC,GAG3Ce,EAASwY,MAAM5jB,KAAM+iC,EAC9B,CACF,GAEOd,EAAare,MAAM5jB,KAAM4J,EAClC,CACF,GAEAqB,GAAK+2B,EAAU,OAAQ,SAAUiB,GAC/B,OAAO,YAAcr5B,GACnB,MAAMs5B,EAAgBljC,KAAK4hC,GAE3B,OAAKsB,QAIW3/B,IAAZqG,EAAK,KACPs5B,EAAcC,KAAOv5B,EAAK,IAQ5BqoB,GAAgB,MALI,CAClBroB,KAAM,CAACs5B,EAAc1f,OAAQ0f,EAAc/Z,KAC3C+Y,eAAgBtyB,KAAKC,MACrB+yB,IAAK5iC,OAIAijC,EAAarf,MAAM5jB,KAAM4J,IAdvBq5B,EAAarf,MAAM5jB,KAAM4J,EAepC,CACF,EACF,CC5HA,SAASw5B,GAA+BpwB,GACtC,MAAM5G,EAAO,QACb0lB,EAAW1lB,EAAM4G,GACjB+e,GAAgB3lB,EAAMi3B,GACxB,CAEA,SAASA,MpBsET,SAASC,KACP,GAA2B,iBAAhBC,YACT,OAAO,EAGT,IAAKhS,KACH,OAAO,EAKT,GAAII,GAAc7rB,GAAO09B,OACvB,OAAO,EAKT,IAAInxB,GAAS,EACb,MAAMoxB,EAAM39B,GAAOgiB,SAEnB,GAAI2b,GAAuC,mBAAxBA,EAAIC,cACrB,IACE,MAAMC,EAAUF,EAAIC,cAAc,UAClCC,EAAQC,QAAS,EACjBH,EAAII,KAAKC,YAAYH,GACjBA,EAAQI,eAAiBJ,EAAQI,cAAcP,QAEjDnxB,EAASsf,GAAcgS,EAAQI,cAAcP,QAE/CC,EAAII,KAAKG,YAAYL,EACvB,OAASrd,GACP5d,IACEY,EAAOmN,KAAK,kFAAmF6P,EACnG,CAGF,OAAOjU,CACT,EoB1GOixB,IAILr4B,GAAKzH,EAAY,QAAS,SAAUygC,GAClC,OAAO,YAAar6B,GAClB,MAAQ4Z,SAAQ2F,OAyEtB,SAAS+a,GAAeC,GACtB,GAAyB,IAArBA,EAAUz9B,OACZ,MAAO,CAAE8c,OAAQ,MAAO2F,IAAK,IAG/B,GAAyB,IAArBgb,EAAUz9B,OAAc,CAC1B,MAAOyiB,EAAKjjB,GAAWi+B,EAEvB,MAAO,CACLhb,IAAKib,GAAmBjb,GACxB3F,OAAQ6gB,GAAQn+B,EAAS,UAAYoE,OAAOpE,EAAQsd,QAAQ2e,cAAgB,MAEhF,CAEA,MAAMhD,EAAMgF,EAAU,GACtB,MAAO,CACLhb,IAAKib,GAAmBjF,GACxB3b,OAAQ6gB,GAAQlF,EAAK,UAAY70B,OAAO60B,EAAI3b,QAAQ2e,cAAgB,MAExE,CA5F8B+B,CAAet6B,GAEjC06B,EAAc,CAClB16B,OACA26B,UAAW,CACT/gB,SACA2F,OAEF+Y,eAAgBtyB,KAAKC,OAGvBoiB,UAAgB,QAAS,IACpBqS,IAIEL,EAAcrgB,MAAMpgB,EAAYoG,GAAMpE,KAC1Cg/B,IAOCvS,GAAgB,QANY,IACvBqS,EACH3B,aAAc/yB,KAAKC,MACnB20B,aAIKA,GAER9V,IAOCuD,SAAgB,QANW,IACtBqS,EACH3B,aAAc/yB,KAAKC,MACnB6e,UAOIA,GAGZ,CACF,EACF,CAEA,SAAS2V,GAAQhhC,EAAKwY,GACpB,QAASxY,GAAsB,iBAARA,KAAuBA,EAAMwY,EACtD,CAEA,SAASuoB,GAAmBK,GAC1B,MAAwB,iBAAbA,EACFA,EAGJA,EAIDJ,GAAQI,EAAU,OACbA,EAAStb,IAGdsb,EAASlgC,SACJkgC,EAASlgC,WAGX,GAXE,EAYX,CCnFA,MAAMmgC,GAAsB,CAAC,QAAS,QAAS,UAAW,MAAO,OAAQ,SAoBzE,SAASC,GAAwBv7B,GAC/B,MAAkB,SAAVA,EAAmB,UAAYs7B,GAAoB15B,SAAS5B,GAASA,EAAQ,KACvF,CCzBA,SAASg5B,GAASjZ,GAChB,IAAKA,EACH,MAAO,CAAC,EAGV,MAAM9D,EAAQ8D,EAAI9D,MAAM,gEAExB,IAAKA,EACH,MAAO,CAAC,EAIV,MAAMuf,EAAQvf,EAAM,IAAM,GACpBwf,EAAWxf,EAAM,IAAM,GAC7B,MAAO,CACLmK,KAAMnK,EAAM,GACZoK,KAAMpK,EAAM,GACZwK,SAAUxK,EAAM,GAChByf,OAAQF,EACRG,KAAMF,EACNG,SAAU3f,EAAM,GAAKuf,EAAQC,EAEjC,CCrBA,MAEMxX,GAAmB,cAwCnB4X,GAtC2BC,CAACh/B,EAAU,CAAC,KAC3C,MAAMwwB,EAAW,CACf1tB,SAAS,EACTm8B,KAAK,EACL3B,OAAO,EACP9Q,SAAS,EACTjP,QAAQ,EACRmf,KAAK,KACF18B,GAGL,MAAO,CACLnC,KAAMspB,GAENV,YAAa,EACbC,MAAMhU,GACA8d,EAAS1tB,SNjBnB,SAASo8B,GAAiCpyB,GACxC,MAAM5G,EAAO,UACb0lB,EAAW1lB,EAAM4G,GACjB+e,GAAgB3lB,EAAM+zB,GACxB,CMcQiF,CA0HR,SAASC,GAA6BzsB,GACpC,OAAO,SAA4B0rB,GACjC,GAAI9qB,OAAgBZ,EAClB,OAGF,MAAMsG,EAAa,CACjBua,SAAU,UACVpqB,KAAM,CACJ4vB,UAAWqF,EAAY16B,KACvBN,OAAQ,WAEVF,MAAOu7B,GAAwBL,EAAYl7B,OAC3C4C,QAAS/B,GAASq6B,EAAY16B,KAAM,MAGtC,GAA0B,WAAtB06B,EAAYl7B,MACd,KAA4B,IAAxBk7B,EAAY16B,KAAK,GAKnB,OAJAsV,EAAWlT,QAAW,qBAAoB/B,GAASq6B,EAAY16B,KAAKI,MAAM,GAAI,MAAQ,mBACtFkV,EAAW7P,KAAK4vB,UAAYqF,EAAY16B,KAAKI,MAAM,EAGnD,CAIJiV,GAAcC,EAAY,CACxBhV,MAAOo6B,EAAY16B,KACnBR,MAAOk7B,EAAYl7B,OAEvB,CACF,CAzJyCi8B,CAA6BzsB,IAE5D8d,EAASyO,KACX3E,GAyDR,SAAS8E,GACP1sB,EACAusB,GAEA,OAAO,SAA6Bb,GAClC,GAAI9qB,OAAgBZ,EAClB,OAGF,IAAIvM,EACAk5B,EACA3+B,EAA0B,iBAARu+B,EAAmBA,EAAIK,wBAAqBjiC,EAE9DwD,EACa,iBAARo+B,GAAmD,iBAAxBA,EAAIp+B,gBAA+Bo+B,EAAIp+B,qBAAkBxD,EACzFwD,GAAmBA,EAhGO,OAiG5B2B,IACEY,EAAOmN,KACJ,8DAAqF1P,mDAE1FA,EArG4B,MAwGN,iBAAbH,IACTA,EAAW,CAACA,IAId,IACE,MAAM2H,EAAQ+1B,EAAY/1B,MACpBk3B,EAmNZ,SAASC,GAASn3B,GAChB,QAASA,KAAYA,EAAQlC,MAC/B,CArNsBq5B,CAASn3B,GAASA,EAAMlC,OAASkC,EAEjDlC,EAASrG,GAAiBy/B,EAAS,CAAE7+B,WAAUG,oBAC/Cw+B,EAAgB98B,GAAiBg9B,EACnC,OACEp5B,EAAS,WACX,CAEA,GAAsB,IAAlBA,EAAO3F,OACT,OAGF,MAAMwY,EAAa,CACjBua,SAAW,MAAK6K,EAAYvgC,OAC5BiI,QAASK,GAGPk5B,IACFrmB,EAAW7P,KAAO,CAAE,oBAAqBk2B,IAG3CtmB,GAAcC,EAAY,CACxB3Q,MAAO+1B,EAAY/1B,MACnBxK,KAAMugC,EAAYvgC,KAClBH,OAAQ0gC,EAAY1gC,QAExB,CACF,CAlH+C0hC,CAAyB1sB,EAAQ8d,EAASyO,MAE/EzO,EAASkM,KACXf,EAwJR,SAAS8D,GAAyB/sB,GAChC,OAAO,SAAwB0rB,GAC7B,GAAI9qB,OAAgBZ,EAClB,OAGF,MAAQspB,iBAAgBS,gBAAiB2B,EAEnCpB,EAAgBoB,EAAY1B,IAAIhB,GAGtC,IAAKM,IAAmBS,IAAiBO,EACvC,OAGF,MAAQ1f,SAAQ2F,MAAKuZ,cAAaS,QAASD,EAe3CjkB,GACE,CACEwa,SAAU,MACVpqB,KAhBS,CACXmU,SACA2F,MACAuZ,eAcEt2B,KAAM,QAXG,CACXw2B,IAAK0B,EAAY1B,IACjB14B,MAAOi5B,EACPjB,iBACAS,gBAWJ,CACF,CA/LqCgD,CAAyB/sB,IAEpD8d,EAAS8M,OACXJ,GAiMR,SAASwC,GAA2BhtB,GAClC,OAAO,SAA0B0rB,GAC/B,GAAI9qB,OAAgBZ,EAClB,OAGF,MAAQspB,iBAAgBS,gBAAiB2B,EAGzC,GAAK3B,KAID2B,EAAYC,UAAUpb,IAAI9D,MAAM,eAAkD,SAAjCif,EAAYC,UAAU/gB,QAK3E,GAAI8gB,EAAY5V,MASdzP,GACE,CACEwa,SAAU,QACVpqB,KAXSi1B,EAAYC,UAYrBn7B,MAAO,QACPgD,KAAM,QAZG,CACXiD,KAAMi1B,EAAY5V,MAClBxkB,MAAOo6B,EAAY16B,KACnBs4B,iBACAS,qBAYG,CACL,MAAM6B,EAAWF,EAAYE,SAW7BvlB,GACE,CACEwa,SAAU,QACVpqB,KAbS,IACRi1B,EAAYC,UACf7B,YAAa8B,GAAYA,EAAStwB,QAYhC9H,KAAM,QAVG,CACXlC,MAAOo6B,EAAY16B,KACnB46B,WACAtC,iBACAS,gBAUJ,CACF,CACF,CA3PuCiD,CAA2BhtB,IAExD8d,EAAShE,SACXN,GA6PR,SAASyT,GAA6BjtB,GACpC,OAAO,SAA4B0rB,GACjC,GAAI9qB,OAAgBZ,EAClB,OAGF,IAAI8M,EAAO4e,EAAY5e,KACnBuN,EAAKqR,EAAYrR,GACrB,MAAM6S,EAAY1D,GAASt8B,GAAOotB,SAASC,MAC3C,IAAI4S,EAAargB,EAAO0c,GAAS1c,QAAQniB,EACzC,MAAMyiC,EAAW5D,GAASnP,KAGrB8S,IAAeA,EAAWtW,QAC7BsW,EAAaD,GAKXA,EAAUjW,WAAamW,EAASnW,UAAYiW,EAAUtW,OAASwW,EAASxW,OAC1EyD,EAAK+S,EAAShB,UAEZc,EAAUjW,WAAakW,EAAWlW,UAAYiW,EAAUtW,OAASuW,EAAWvW,OAC9E9J,EAAOqgB,EAAWf,UAGpB/lB,GAAc,CACZwa,SAAU,aACVpqB,KAAM,CACJqW,OACAuN,OAGN,CACF,CA/RyC4S,CAA6BjtB,IAE5D8d,EAASjT,QAAU7K,EAAOiU,IAC5BjU,EAAOiU,GAAG,kBAqBlB,SAASoZ,GAA4BrtB,GACnC,OAAO,SAA6BrK,GAC9BiL,OAAgBZ,GAIpBqG,GACE,CACEwa,SAAW,WAAwB,gBAAflrB,EAAMnC,KAAyB,cAAgB,SACnEuC,SAAUJ,EAAMI,SAChBvF,MAAOmF,EAAMnF,MACb4C,QAAS0C,GAAoBH,IAE/B,CACEA,SAGN,CACF,CAvCqC03B,CAA4BrtB,GAE7D,EACF,EAWkBsU,GAA4BG,GAAkB4X,ICtDlE,MA6BMiB,GA3BsBC,KAC1B,IAAIC,EAEJ,MAAO,CACLriC,KANqB,SAQrB4oB,YAAa,EACbK,aAAaqZ,GAGX,GAAIA,EAAaj6B,KACf,OAAOi6B,EAIT,IACE,GAsBR,SAASjY,GAAiBiY,EAAcD,GACtC,SAAKA,IAeP,SAASE,GAAoBD,EAAcD,GACzC,MAAMG,EAAiBF,EAAar6B,QAC9Bw6B,EAAkBJ,EAAcp6B,QAoBtC,SAjBKu6B,IAAmBC,GAKnBD,IAAmBC,IAAsBD,GAAkBC,GAI5DD,IAAmBC,IAIlBC,GAAmBJ,EAAcD,KAIjCM,GAAkBL,EAAcD,GAKvC,CAtCME,CAAoBD,EAAcD,KAwCxC,SAASO,GAAsBN,EAAcD,GAC3C,MAAMQ,EAAoBC,GAAuBT,GAC3CU,EAAmBD,GAAuBR,GAchD,SAZKO,GAAsBE,GAIvBF,EAAkBx6B,OAAS06B,EAAiB16B,MAAQw6B,EAAkBv8B,QAAUy8B,EAAiBz8B,OAIhGo8B,GAAmBJ,EAAcD,IAIjCM,GAAkBL,EAAcD,GAKvC,CAzDMO,CAAsBN,EAAcD,GAK1C,CApCYhY,CAAiBiY,EAAcD,GACjC19B,WAAeY,EAAOmN,KAAK,wEACpB,IAEX,OAAe,CAEf,OAAQ2vB,EAAgBC,CAC1B,EACF,EAkFF,SAASK,GAAkBL,EAAcD,GACvC,IAAIW,EAAgBC,GAAoBX,GACpCY,EAAiBD,GAAoBZ,GAGzC,IAAKW,IAAkBE,EACrB,OAAO,EAYT,GARKF,IAAkBE,IAAqBF,GAAiBE,GAQzDA,EAAevgC,SAAWqgC,EAAcrgC,OAC1C,OAAO,EAIT,QAASe,EAAI,EAAGA,EAAIw/B,EAAevgC,OAAQe,IAAK,CAC9C,MAAMy/B,EAASD,EAAex/B,GACxB0/B,EAASJ,EAAct/B,GAE7B,GACEy/B,EAAOthB,WAAauhB,EAAOvhB,UAC3BshB,EAAOE,SAAWD,EAAOC,QACzBF,EAAOG,QAAUF,EAAOE,OACxBH,EAAOvhB,WAAawhB,EAAOxhB,SAE3B,OAAO,CAEX,CAEA,OAAO,CACT,CAEA,SAAS8gB,GAAmBJ,EAAcD,GACxC,IAAIkB,EAAqBjB,EAAajsB,YAClCmtB,EAAsBnB,EAAchsB,YAGxC,IAAKktB,IAAuBC,EAC1B,OAAO,EAIT,GAAKD,IAAuBC,IAA0BD,GAAsBC,EAC1E,OAAO,EAOT,IACE,OAAUD,EAAmBlgC,KAAK,MAAQmgC,EAAoBngC,KAAK,GACrE,OACE,OAAO,CACT,CACF,CAEA,SAASy/B,GAAuBt4B,GAC9B,OAAOA,EAAMC,WAAaD,EAAMC,UAAUC,QAAUF,EAAMC,UAAUC,OAAO,EAC7E,CAEA,SAASu4B,GAAoBz4B,GAC3B,MAAMC,EAAYD,EAAMC,UAExB,GAAIA,EACF,IAEE,OAAOA,EAAUC,OAAO,GAAGyb,WAAWjF,MACxC,OACE,MACF,CAGJ,CAzJeiI,GApCU,SAoCoCgZ,ICrC7D,IAAIsB,GAAqB,KAQzB,SAASC,GAAqCz0B,GAC5C,MAAM5G,EAAO,QACb0lB,EAAW1lB,EAAM4G,GACjB+e,GAAgB3lB,EAAMs7B,GACxB,CAEA,SAASA,KACPF,GAAqBhkC,EAAWmkC,QAEhCnkC,EAAWmkC,QAAU,SACnBC,EACAze,EACAhE,EACA0iB,EACAnZ,GAWA,OAFAuD,GAAgB,QAPI,CAClB4V,SACAnZ,QACAvJ,OACAyiB,MACAze,WAIEqe,IAAuBA,GAAmBM,oBAErCN,GAAmB5jB,MAAM5jB,KAAMi/B,UAI1C,EAEAz7B,EAAWmkC,QAAQI,yBAA0B,CAC/C,CC1CA,IAAIC,GAAkC,KAQtC,SAASC,GACPj1B,GAEA,MAAM5G,EAAO,qBACb0lB,EAAW1lB,EAAM4G,GACjB+e,GAAgB3lB,EAAM87B,GACxB,CAEA,SAASA,KACPF,GAAkCxkC,EAAW2kC,qBAE7C3kC,EAAW2kC,qBAAuB,SAAUj2B,GAI1C,OAFA+f,GAAgB,qBADI/f,KAGhB81B,KAAoCA,GAAgCF,oBAE/DE,GAAgCpkB,MAAM5jB,KAAMi/B,UAIvD,EAEAz7B,EAAW2kC,qBAAqBJ,yBAA0B,CAC5D,CC3BA,MAAM1a,GAAmB,iBA2BnB+a,GAzB8BC,CAACniC,EAAU,CAAC,KAC9C,MAAMwwB,EAAW,CACfiR,SAAS,EACTQ,sBAAsB,KACnBjiC,GAGL,MAAO,CACLnC,KAAMspB,GACNV,YACE/nB,MAAM0jC,gBAAkB,EAC1B,EACA1b,MAAMhU,GACA8d,EAASiR,UA0BnB,SAASY,GAA6B3vB,GACpC6uB,GAAqCp4B,IACnC,MAAQyW,cAAawX,oBAAqBxkB,KAE1C,GAAIU,OAAgBZ,GAAU+lB,KAC5B,OAGF,MAAQiJ,MAAKze,MAAKhE,OAAM0iB,SAAQnZ,SAAUrf,EAEpCd,OACMhL,IAAVmrB,GAAuBzpB,GAAS2iC,GAoGtC,SAASY,GAA4BZ,EAAKze,EAAKhE,EAAM0iB,GAKnD,IAAI77B,EAAUjH,GAAa6iC,GAAOA,EAAI57B,QAAU47B,EAC5C7jC,EAAO,QAEX,MAAM0kC,EAASz8B,EAAQqZ,MANrB,4GAOF,OAAIojB,IACF1kC,EAAO0kC,EAAO,GACdz8B,EAAUy8B,EAAO,IAcZC,GAXO,CACZl6B,UAAW,CACTC,OAAQ,CACN,CACErC,KAAMrI,EACNsG,MAAO2B,MAM6Bmd,EAAKhE,EAAM0iB,EACzD,CA7HUW,CAA4BZ,EAAKze,EAAKhE,EAAM0iB,GAC5Ca,GACErL,GAAsBvX,EAAa4I,GAASkZ,OAAKrkC,EAAW+5B,GAAkB,GAC9EnU,EACAhE,EACA0iB,GAGRt5B,EAAMnF,MAAQ,QAEdmX,GAAahS,EAAO,CAClB8R,kBAAmBqO,EACnBxf,UAAW,CACTC,SAAS,EACT/C,KAAM,YAET,EAEL,CAvDQm8B,CAA6B3vB,GAC7B+vB,GAAiB,YAEfjS,EAASyR,uBAsDnB,SAASS,GAA0ChwB,GACjDqvB,GAAkD/1B,IAChD,MAAQ4T,cAAawX,oBAAqBxkB,KAE1C,GAAIU,OAAgBZ,GAAU+lB,KAC5B,OAGF,MAAMjQ,EAkBV,SAASma,GAA4Bna,GACnC,GAAIvpB,GAAYupB,GACd,OAAOA,EAIT,MAAMxc,EAAIwc,EAGV,IAGE,GAAI,WAAYxc,EACd,OAAOA,EAAEf,OAQN,GAAI,WAAYe,GAAK,WAAYA,EAAEzF,OACtC,OAAOyF,EAAEzF,OAAO0E,MAEpB,OAAc,CAEd,OAAOud,CACT,CA7CkBma,CAA4B32B,GAEpC3D,EAAQpJ,GAAYupB,GAmD9B,SAASoa,GAAiC33B,GACxC,MAAO,CACL3C,UAAW,CACTC,OAAQ,CACN,CACErC,KAAM,qBAEN/B,MAAQ,oDAAmDC,OAAO6G,QAK5E,CA9DQ23B,CAAiCpa,GACjC2O,GAAsBvX,EAAa4I,OAAOnrB,EAAW+5B,GAAkB,GAE3E/uB,EAAMnF,MAAQ,QAEdmX,GAAahS,EAAO,CAClB8R,kBAAmBqO,EACnBxf,UAAW,CACTC,SAAS,EACT/C,KAAM,yBAET,EAEL,CA7EQw8B,CAA0ChwB,GAC1C+vB,GAAiB,wBAErB,EACF,EA6JF,SAASD,GAA8Bn6B,EAAO4a,EAAKhE,EAAM0iB,GAEvD,MAAM31B,EAAK3D,EAAMC,UAAYD,EAAMC,WAAa,CAAC,EAE3Cu6B,EAAM72B,EAAEzD,OAASyD,EAAEzD,QAAU,GAE7Bu6B,EAAOD,EAAG,GAAKA,EAAG,IAAM,CAAC,EAEzBE,EAAQD,EAAI9e,WAAa8e,EAAI9e,YAAc,CAAC,EAE5Cgf,EAASD,EAAKhkB,OAASgkB,EAAKhkB,QAAU,GAEtCoiB,EAAQ5hC,MAAMgrB,SAASoX,EAAQ,UAAOtkC,EAAYskC,EAClDT,EAAS3hC,MAAMgrB,SAAStL,EAAM,UAAO5hB,EAAY4hB,EACjDS,EAAW3gB,GAASkkB,IAAQA,EAAIziB,OAAS,EAAIyiB,EzD1ErD,SAASggB,KACP,IACE,OAAOrjC,GAAOgiB,SAASoL,SAASC,IAClC,OACE,MAAO,EACT,CACF,CyDoE2DgW,GAGzD,OAAqB,IAAjBD,EAAMxiC,QACRwiC,EAAMjiC,KAAK,CACTogC,QACAzhB,WACAD,SAAU,IACVyjB,QAAQ,EACRhC,WAIG74B,CACT,CAEA,SAASo6B,GAAiBv8B,GACxB1D,IAAeY,EAAOqC,IAAK,4BAA2BS,IACxD,CAEA,SAAS0M,KACP,MAAMF,EAASY,KAKf,OAJiBZ,GAAUA,EAAOE,cAAiB,CACjDgN,YAAaA,IAAM,GACnBwX,kBAAkB,EAGtB,CA5LuBpQ,GACrBG,GACA+a,ICzCF,MAAM/a,GAAmB,cA8BnBgc,GA5B2BC,MAE7BvlC,KAAMspB,GAENV,YAAa,EACbG,gBAAgBve,GAEd,IAAKzI,GAAOsd,YAActd,GAAOotB,WAAaptB,GAAOgiB,SACnD,OAIF,MAAMqB,EAAO5a,EAAM2a,SAAW3a,EAAM2a,QAAQC,KAASrjB,GAAOotB,UAAYptB,GAAOotB,SAASC,MAChFoW,YAAazjC,GAAOgiB,UAAY,CAAC,GACjC/S,aAAcjP,GAAOsd,WAAa,CAAC,EAErCiQ,EAAU,IACV9kB,EAAM2a,SAAW3a,EAAM2a,QAAQmK,WAC/BkW,GAAY,CAAEC,QAASD,MACvBx0B,GAAa,CAAE,aAAcA,IAE7BmU,EAAU,IAAK3a,EAAM2a,WAAaC,GAAO,CAAEA,OAAQkK,WAEzD9kB,EAAM2a,QAAUA,CAClB,ICvBJ,SAASugB,GACPC,EACApkB,EACAqkB,EAAgB,IAChBpiC,EACAqiC,EACAr7B,EACA8E,GAEA,KAAK9E,EAAMC,WAAcD,EAAMC,UAAUC,QAAW4E,GAAS1O,GAAa0O,EAAKgN,kBAAmBzb,QAChG,OAIF,MAAMyb,EACJ9R,EAAMC,UAAUC,OAAO/H,OAAS,EAAI6H,EAAMC,UAAUC,OAAOF,EAAMC,UAAUC,OAAO/H,OAAS,QAAKnD,EAG9F8c,IACF9R,EAAMC,UAAUC,OA6GpB,SAASo7B,GAA4BjP,EAAY3R,GAC/C,OAAO2R,EAAWzyB,IAAIqG,IAChBA,EAAUnE,QACZmE,EAAUnE,MAAQR,GAAS2E,EAAUnE,MAAO4e,IAEvCza,GAEX,CApH6Bq7B,CACvBC,GACEJ,EACApkB,EACAskB,EACAv2B,EAAKgN,kBACL9Y,EACAgH,EAAMC,UAAUC,OAChB4R,EACA,GAEFspB,GAGN,CAEA,SAASG,GACPJ,EACApkB,EACAskB,EACAlb,EACAnnB,EACAwiC,EACAv7B,EACAw7B,GAEA,GAAID,EAAerjC,QAAUkjC,EAAQ,EACnC,OAAOG,EAGT,IAAIE,EAAgB,IAAIF,GAExB,GAAIplC,GAAa+pB,EAAMnnB,GAAM3C,OAAQ,CACnCslC,GAA4C17B,EAAWw7B,GACvD,MAAMG,EAAeT,EAAiCpkB,EAAQoJ,EAAMnnB,IAC9D6iC,EAAiBH,EAAcvjC,OACrC2jC,GAA2CF,EAAc5iC,EAAK6iC,EAAgBJ,GAC9EC,EAAgBH,GACdJ,EACApkB,EACAskB,EACAlb,EAAMnnB,GACNA,EACA,CAAC4iC,KAAiBF,GAClBE,EACAC,EAEJ,CAIA,OAAIvjC,MAAMC,QAAQ4nB,EAAMva,SACtBua,EAAMva,OAAO/L,QAAQ,CAACkiC,EAAY7iC,KAChC,GAAI9C,GAAa2lC,EAAY1lC,OAAQ,CACnCslC,GAA4C17B,EAAWw7B,GACvD,MAAMG,EAAeT,EAAiCpkB,EAAQglB,GACxDF,EAAiBH,EAAcvjC,OACrC2jC,GAA2CF,EAAe,UAAS1iC,KAAM2iC,EAAgBJ,GACzFC,EAAgBH,GACdJ,EACApkB,EACAskB,EACAU,EACA/iC,EACA,CAAC4iC,KAAiBF,GAClBE,EACAC,EAEJ,IAIGH,CACT,CAEA,SAASC,GAA4C17B,EAAWw7B,GAE9Dx7B,EAAUU,UAAYV,EAAUU,WAAa,CAAE9C,KAAM,UAAW+C,SAAS,GAEzEX,EAAUU,UAAY,IACjBV,EAAUU,UACbq7B,oBAAoB,EACpBC,aAAcR,EAElB,CAEA,SAASK,GACP77B,EACAtD,EACA8+B,EACAS,GAGAj8B,EAAUU,UAAYV,EAAUU,WAAa,CAAE9C,KAAM,UAAW+C,SAAS,GAEzEX,EAAUU,UAAY,IACjBV,EAAUU,UACb9C,KAAM,UACNlB,SACAs/B,aAAcR,EACdU,UAAWD,EAEf,CDvFoBvd,GAA4BG,GAAkBgc,IEpClE,MAGMhc,GAAmB,eA2BnBsd,GAzB4BC,CAAC1kC,EAAU,CAAC,KAC5C,MAAM0jC,EAAQ1jC,EAAQ0jC,OALF,EAMdriC,EAAMrB,EAAQqB,KAPF,QASlB,MAAO,CACLxD,KAAMspB,GAENV,YAAa,EACbG,gBAAgBve,EAAO8E,EAAMuF,GAC3B,MAAM1S,EAAU0S,EAAOE,aAEvB2wB,GAEE5M,GACA32B,EAAQ4f,YACR5f,EAAQ+iB,eACR1hB,EACAqiC,EACAr7B,EACA8E,EAEJ,EACF,EC3BIw3B,IDqCe3d,GAA4BG,GAAkBsd,ICrCtC,CAC3B,cACA,SACA,OACA,mBACA,iBACA,mBACA,oBACA,kBACA,cACA,aACA,qBACA,cACA,aACA,iBACA,eACA,kBACA,cACA,cACA,eACA,qBACA,SACA,eACA,YACA,eACA,gBACA,YACA,kBACA,SACA,iBACA,4BACA,yBAGItd,GAAmB,WA0CnByd,GAxCgCC,CAAC7kC,EAAU,CAAC,KAChD,MAAMwwB,EAAW,CACfqL,gBAAgB,EAChBiJ,aAAa,EACbC,uBAAuB,EACvB/P,aAAa,EACbmE,YAAY,KACTn5B,GAGL,MAAO,CACLnC,KAAMspB,GAGNV,YACM+J,EAAS2I,YACXp0B,GAAKnF,GAAQ,aAAcolC,IAGzBxU,EAASwE,aACXjwB,GAAKnF,GAAQ,cAAeolC,IAG1BxU,EAASuU,uBACXhgC,GAAKnF,GAAQ,wBAAyBqlC,IAGpCzU,EAASqL,gBAAkB,mBAAAqJ,IAC7BngC,GAAK82B,eAAez9B,UAAW,OAAQ+mC,IAGzC,MAAMC,EAAoB5U,EAASsU,YAC/BM,IACkBzkC,MAAMC,QAAQwkC,GAAqBA,EAAoBT,IAC/DziC,QAAQmjC,GAExB,EACF,EAiBF,SAASL,GAAkB9/B,GAEzB,OAAO,YAAcxB,GAEnBA,SAAK,GAAKg1B,GADeh1B,EAAK,GACG,CAC/BsF,UAAW,CACTG,KAAM,CAAEsW,SAAUK,GAAgB5a,IAClC+D,SAAS,EACT/C,KAAM,gBAGHhB,EAASwY,MAAM5jB,KAAM4J,EAC9B,CACF,CAGA,SAASuhC,GAAS//B,GAEhB,OAAO,SAAWrC,GAEhB,OAAOqC,EAASwY,MAAM5jB,KAAM,CAC1B4+B,GAAK71B,EAAU,CACbmG,UAAW,CACTG,KAAM,CACJsW,SAAU,wBACV3S,QAASgT,GAAgB5a,IAE3B+D,SAAS,EACT/C,KAAM,iBAId,CACF,CAEA,SAASi/B,GAASpI,GAEhB,OAAO,YAAcr5B,GAEnB,MAAMg5B,EAAM5iC,KAGZwrC,MAF4B,CAAC,SAAU,UAAW,aAAc,sBAE5CpjC,QAAQyT,IACtBA,KAAQ+mB,GAA4B,mBAAdA,EAAI/mB,IAE5B5Q,GAAK23B,EAAK/mB,EAAM,SAAUzQ,GACxB,MAAMqgC,EAAc,CAClBv8B,UAAW,CACTG,KAAM,CACJsW,SAAU9J,EACV7I,QAASgT,GAAgB5a,IAE3B+D,SAAS,EACT/C,KAAM,eAKJs/B,EAAmB9/B,GAAoBR,GAC7C,OAAIsgC,IACFD,EAAYv8B,UAAUG,KAAK2D,QAAUgT,GAAgB0lB,IAIhD9M,GAAKxzB,EAAUqgC,EACxB,EAAC,GAIExI,EAAarf,MAAM5jB,KAAM4J,EAClC,CACF,CAEA,SAAS2hC,GAAiBl/B,GAExB,MAEMw0B,EAFe/6B,GAEMuG,IAFNvG,GAE8BuG,GAAQ/H,WAGtDu8B,IAAUA,EAAM/zB,iBAAmB+zB,EAAM/zB,eAAe,sBAI7D7B,GAAK41B,EAAO,mBAAoB,SAAUz1B,GAGxC,OAAO,SAGLugC,EACA1lB,EACA/f,GAEA,IACgC,mBAAnB+f,EAAG2lB,cAOZ3lB,EAAG2lB,YAAchN,GAAK3Y,EAAG2lB,YAAa,CACpC18B,UAAW,CACTG,KAAM,CACJsW,SAAU,cACV3S,QAASgT,GAAgBC,GACzB5Z,UAEF8C,SAAS,EACT/C,KAAM,gBAId,OACE,CAGF,OAAOhB,EAASwY,MAAM5jB,KAAM,CAC1B2rC,EAEA/M,GAAK3Y,EAAK,CACR/W,UAAW,CACTG,KAAM,CACJsW,SAAU,mBACV3S,QAASgT,GAAgBC,GACzB5Z,UAEF8C,SAAS,EACT/C,KAAM,gBAGVlG,GAEJ,CACF,GAEA+E,GACE41B,EACA,sBACA,SACEM,GAGA,OAAO,SAGLwK,EACA1lB,EACA/f,GAmBA,MAAM2lC,EAAsB5lB,EAC5B,IACE,MAAM6lB,EAAuBD,GAAuBA,EAAoB9M,mBACpE+M,GACF3K,EAA4Bz8B,KAAK1E,KAAM2rC,EAAWG,EAAsB5lC,EAE5E,OACE,CAEF,OAAOi7B,EAA4Bz8B,KAAK1E,KAAM2rC,EAAWE,EAAqB3lC,EAChF,CACF,GAEJ,CCxQA,SAAS6lC,GAAYnmB,EAAU/Z,EAAMu7B,EAAQC,GAC3C,MAAM9hB,EAAQ,CACZK,WACAD,SAAU9Z,EACVu9B,QAAQ,GAGV,YAAe7lC,IAAX6jC,IACF7hB,EAAM6hB,OAASA,QAGH7jC,IAAV8jC,IACF9hB,EAAM8hB,MAAQA,GAGT9hB,CACT,CD4DiB2H,GACfG,GACAyd,IC3DF,MAAMkB,GACJ,6IACIC,GAAkB,gCA6BlBC,GAAwB,CAtDN,GA2BT/mB,IACb,MAAMgP,EAAQ6X,GAAY9b,KAAK/K,GAE/B,GAAIgP,EAAO,CAGT,GAFeA,EAAM,IAAmC,IAA7BA,EAAM,GAAGzH,QAAQ,QAEhC,CACV,MAAMyf,EAAWF,GAAgB/b,KAAKiE,EAAM,IAExCgY,IAEFhY,EAAM,GAAKgY,EAAS,GACpBhY,EAAM,GAAKgY,EAAS,GACpBhY,EAAM,GAAKgY,EAAS,GAExB,CAIA,MAAOtgC,EAAM+Z,GAAYwmB,GAA8BjY,EAAM,IAlDxC,IAkDgEA,EAAM,IAE3F,OAAO4X,GAAYnmB,EAAU/Z,EAAMsoB,EAAM,IAAMA,EAAM,QAAK5wB,EAAW4wB,EAAM,IAAMA,EAAM,QAAK5wB,EAC9F,IAUI8oC,GACJ,uIACIC,GAAiB,gDA6BjBC,GAAuB,CAxFN,GA6DTpnB,IACZ,MAAMgP,EAAQkY,GAAWnc,KAAK/K,GAE9B,GAAIgP,EAAO,CAET,GADeA,EAAM,IAAMA,EAAM,GAAGzH,QAAQ,YAAa,EAC7C,CACV,MAAMyf,EAAWG,GAAepc,KAAKiE,EAAM,IAEvCgY,IAEFhY,EAAM,GAAKA,EAAM,IAAM,OACvBA,EAAM,GAAKgY,EAAS,GACpBhY,EAAM,GAAKgY,EAAS,GACpBhY,EAAM,GAAK,GAEf,CAEA,IAAIvO,EAAWuO,EAAM,GACjBtoB,EAAOsoB,EAAM,IArFI,IAsFrB,OAACtoB,EAAM+Z,GAAYwmB,GAA8BvgC,EAAM+Z,GAEhDmmB,GAAYnmB,EAAU/Z,EAAMsoB,EAAM,IAAMA,EAAM,QAAK5wB,EAAW4wB,EAAM,IAAMA,EAAM,QAAK5wB,EAC9F,IAOIipC,GAAa,uFAUbC,GAAuB,CArGN,GA6FTtnB,IACZ,MAAMgP,EAAQqY,GAAWtc,KAAK/K,GAE9B,OAAOgP,EACH4X,GAAY5X,EAAM,GAAIA,EAAM,IAtGT,KAsGkCA,EAAM,GAAIA,EAAM,IAAMA,EAAM,QAAK5wB,QACtFA,IA0BAmpC,GAAqBjoB,GAFMynB,GAAuBK,GAAsBE,IAwBxEL,GAAgCA,CAACvgC,EAAM+Z,KAC3C,MAAM+mB,GAAyD,IAArC9gC,EAAK6gB,QAAQ,oBACjCkgB,GAAgE,IAAzC/gC,EAAK6gB,QAAQ,wBAE1C,OAAOigB,GAAqBC,EACxB,EACwB,IAAtB/gC,EAAK6gB,QAAQ,KAAc7gB,EAAKtD,MAAM,KAAK,GA7J1B,IA8JjBokC,EAAqB,oBAAmB/mB,IAAc,wBAAuBA,KAE/E,CAAC/Z,EAAM+Z,EAAQ,ECjKrB,MAAMinB,GAAsB,IAoC5B,SAASC,GAAcC,EAAQtT,EAAU5pB,EAAMD,KAAKC,OAClD,OARF,SAASm9B,GAAcD,EAAQtT,GAC7B,OAAOsT,EAAOtT,IAAasT,EAAOE,KAAO,CAC3C,CAMSD,CAAcD,EAAQtT,GAAY5pB,CAC3C,CAOA,SAASq9B,GACPH,GACEI,aAAY9Z,WACdxjB,EAAMD,KAAKC,OAEX,MAAMu9B,EAAoB,IACrBL,GAKCM,EAAkBha,GAAWA,EAAQ,wBACrCia,EAAmBja,GAAWA,EAAQ,eAE5C,GAAIga,EAaF,UAAWzD,KAASyD,EAAgBr2B,OAAOzO,MAAM,KAAM,CACrD,MAAOglC,EAAYC,GAAc5D,EAAMrhC,MAAM,IAAK,GAC5CklC,EAAchd,SAAS8c,EAAY,IACnCG,EAAmD,KAAzCjoC,MAAMgoC,GAA6B,GAAdA,GACrC,GAAKD,EAGH,UAAW/T,KAAY+T,EAAWjlC,MAAM,KACtC6kC,EAAkB3T,GAAY5pB,EAAM69B,OAHtCN,EAAkBH,IAAMp9B,EAAM69B,CAMlC,MACSJ,EACTF,EAAkBH,IAAMp9B,EA7E5B,SAAS89B,GAAsB3K,EAAQnzB,EAAMD,KAAKC,OAChD,MAAM49B,EAAchd,SAAU,GAAEuS,IAAU,IAC1C,IAAKv9B,MAAMgoC,GACT,OAAqB,IAAdA,EAGT,MAAMG,EAAah+B,KAAKi+B,MAAO,GAAE7K,KACjC,OAAKv9B,MAAMmoC,GAIJf,GAHEe,EAAa/9B,CAIxB,CAiEkC89B,CAAsBL,EAAkBz9B,GAC9C,MAAfs9B,IACTC,EAAkBH,IAAMp9B,EAAM,KAGhC,OAAOu9B,CACT,CC1FA,MAAMU,GAAgC,GAQtC,SAASC,GACP7nC,EACA8nC,EACAjZ,ECPF,SAASkZ,GAAkBrE,GACzB,MAAM7U,EAAS,GAYf,SAASmZ,EAAOC,GACd,OAAOpZ,EAAOrN,OAAOqN,EAAOrI,QAAQyhB,GAAO,GAAG,EAChD,CAuEA,MAAO,CACLC,EAAGrZ,EACHxN,IA7DF,SAASA,EAAI8mB,GACX,IAzBF,SAASC,IACP,YAAiB/qC,IAAVqmC,GAAuB7U,EAAOruB,OAASkjC,CAChD,CAuBO0E,GACH,OAAOp9B,GAAoB,IAAIklB,GAAY,yDAI7C,MAAM+X,EAAOE,IACb,OAA6B,IAAzBtZ,EAAOrI,QAAQyhB,IACjBpZ,EAAO9tB,KAAKknC,GAETA,EACF3oC,KAAK,IAAM0oC,EAAOC,IAIlB3oC,KAAK,KAAM,IACV0oC,EAAOC,GAAM3oC,KAAK,KAAM,SAIrB2oC,CACT,EAyCEI,MA9BF,SAASA,EAAMxW,GACb,OAAO,IAAI/mB,GAAY,CAACC,EAASI,KAC/B,IAAIm9B,EAAUzZ,EAAOruB,OAErB,IAAK8nC,EACH,OAAOv9B,GAAQ,GAIjB,MAAMw9B,EAAqBpP,WAAW,KAChCtH,GAAWA,EAAU,GACvB9mB,GAAQ,EAAK,EAEd8mB,GAGHhD,EAAO3sB,QAAQsF,IACRqD,GAAoBrD,GAAMlI,KAAK,OAC3BgpC,IACL7M,aAAa8M,GACbx9B,GAAQ,GAAI,EAEbI,EAAM,EACV,EAEL,EAOF,CDpFW48B,CACP/nC,EAAQwoC,YAAcZ,KAGxB,IAAIa,EAAa,CAAC,EAGlB,SAASpS,EAAK/I,GACZ,MAAMob,EAAwB,GAc9B,GAXAlb,GAAoBF,EAAU,CAAC9lB,EAAMtB,KACnC,MAAMyiC,GAA2B9Y,GAA+B3pB,GAChE,GAAI0gC,GAAc6B,EAAYE,IAA2B,CACvD,MAAMtgC,GAAQugC,GAAwBphC,EAAMtB,GAC5ClG,EAAQixB,mBAAmB,oBAAqB0X,GAA0BtgC,GAC5E,MACEqgC,EAAsB3nC,KAAKyG,EAAI,GAKE,IAAjCkhC,EAAsBloC,OACxB,OAAOqK,KAIT,MAAMg+B,EAAmB3b,GAAeI,EAAS,GAAIob,GAG/CI,EAAsB79B,IAC1BuiB,GAAoBqb,EAAkB,CAACrhC,EAAMtB,MAC3C,MAAMmC,GAAQugC,GAAwBphC,EAAMtB,IAC5ClG,EAAQixB,mBAAmBhmB,EAAQ4kB,GAA+B3pB,IAAOmC,GAAK,EAC/E,EAoBH,OAAOwmB,EAAOxN,IAjBM0nB,IAClBjB,EAAY,CAAE7K,KAAMlP,GAAkB8a,EAAkB7oC,EAAQ4tB,eAAgBtuB,KAC9Eg/B,SAE8BjhC,IAAxBihC,EAAS2I,aAA6B3I,EAAS2I,WAAa,KAAO3I,EAAS2I,YAAc,MAC5FzkC,IAAeY,EAAOmN,KAAM,qCAAoC+tB,EAAS2I,6BAG3EwB,EAAazB,GAAiByB,EAAYnK,GACnCA,GAET9V,IACEsgB,QAAmB,iBACbtgB,KAImBlpB,KAC7B6M,GAAUA,EACVqc,IACE,GAAIA,aAAiB0H,GACnB1tB,WAAeY,EAAOolB,MAAM,iDAC5BsgB,EAAmB,kBACZj+B,KAEP,MAAM2d,GAId,CAIA6N,SAAK2S,2BAA4B,EAE1B,CACL3S,OACAzE,MArEaC,GAAYhD,EAAOwZ,MAAMxW,GAuE1C,CAEA,SAAS+W,GAAwBphC,EAAMtB,GACrC,GAAa,UAATA,GAA6B,gBAATA,EAIxB,OAAOvF,MAAMC,QAAQ4G,GAASA,EAAO,QAAKnK,CAC5C,CE9FA,IAAI4rC,GCGJ,SAASC,GACPlpC,EACAmpC,EDmCF,SAASC,KACP,GAAIH,GACF,OAAOA,GAMT,GAAIxd,GAAc7rB,GAAO09B,OACvB,OAAQ2L,GAAkBrpC,GAAO09B,MAAMzW,KAAKjnB,IAG9C,MAAMgiB,EAAWhiB,GAAOgiB,SACxB,IAAIynB,EAAYzpC,GAAO09B,MAEvB,GAAI1b,GAA8C,mBAA3BA,EAAS4b,cAC9B,IACE,MAAMC,EAAU7b,EAAS4b,cAAc,UACvCC,EAAQC,QAAS,EACjB9b,EAAS+b,KAAKC,YAAYH,GAC1B,MAAMI,EAAgBJ,EAAQI,cAC1BA,GAAiBA,EAAcP,QACjC+L,EAAYxL,EAAcP,OAE5B1b,EAAS+b,KAAKG,YAAYL,EAC5B,OAASzxB,GACPxJ,IAAeY,EAAOmN,KAAK,kFAAmFvE,EAChH,CAGF,OAAQi9B,GAAkBI,EAAUxiB,KAAKjnB,GAE3C,CCnEgBwpC,IAEd,IAAIE,EAAkB,EAClBC,EAAe,EA+CnB,OAAO1B,GAAgB7nC,EA7CvB,SAAS8nC,EAAY9kB,GACnB,MAAMwmB,EAAcxmB,EAAQia,KAAKz8B,OACjC8oC,GAAmBE,EACnBD,IAEA,MAAME,EAAiB,CACrBxM,KAAMja,EAAQia,KACd3f,OAAQ,OACRosB,eAAgB,SAChBvc,QAASntB,EAAQmtB,QAYjBwc,UAAWL,GAAmB,KAASC,EAAe,MACnDvpC,EAAQ4pC,cAGb,IACE,OAAOT,EAAYnpC,EAAQijB,IAAKwmB,GAAgBnqC,KAAKg/B,IACnDgL,GAAmBE,EACnBD,IACO,CACLtC,WAAY3I,EAAStwB,OACrBmf,QAAS,CACP,uBAAwBmR,EAASnR,QAAQ9lB,IAAI,wBAC7C,cAAei3B,EAASnR,QAAQ9lB,IAAI,kBAI5C,OAAS2E,GACP69B,OD2BN,SAASA,KACPZ,QAAkB5rC,CACpB,CC7BMwsC,GACAP,GAAmBE,EACnBD,IACOv+B,GAAoBgB,EAC7B,CACF,EAGF,CCjDA,MAAM89B,GAAsB,EAK5B,SAASC,GAAiB/pC,GA+BxB,OAAO6nC,GAAgB7nC,EA9BvB,SAAS8nC,EAAY9kB,GACnB,OAAO,IAAIlY,GAAY,CAACC,EAASI,KAC/B,MAAMuxB,EAAM,IAAIb,eAEhBa,EAAI+E,QAAUt2B,EAEduxB,EAAIC,mBAAqB,KACnBD,EAAIH,aAAeuN,IACrB/+B,EAAQ,CACNk8B,WAAYvK,EAAI1uB,OAChBmf,QAAS,CACP,uBAAwBuP,EAAIsN,kBAAkB,wBAC9C,cAAetN,EAAIsN,kBAAkB,iBAExC,EAILtN,EAAIuN,KAAK,OAAQjqC,EAAQijB,KAEzB,UAAW6Z,KAAU98B,EAAQmtB,QACvBhvB,OAAOC,UAAUwI,eAAepI,KAAKwB,EAAQmtB,QAAS2P,IACxDJ,EAAIwN,iBAAiBpN,EAAQ98B,EAAQmtB,QAAQ2P,IAIjDJ,EAAIrG,KAAKrT,EAAQia,KAAI,EAEzB,EAGF,CChCA,MAAMxX,GAAsB,CAC1B2B,KACA2B,KACA6b,KACA7F,KACAmD,KACAuC,KACAzE,KACAmD,MAIF,SAASgH,GAAuB3Z,GAE9B,MAAO,IAEF/K,GAEP,CA+DA,SAAS7X,GAAK5N,EAAU,CAAC,QACa3C,IAAhC2C,EAAQylB,sBACVzlB,EAAQylB,oBAAsB0kB,WAER9sC,IAApB2C,EAAQyO,UAEwB,iBAAvB27B,qBACTpqC,EAAQyO,QAAU27B,oBAIhBxqC,GAAOyqC,gBAAkBzqC,GAAOyqC,eAAejoC,KACjDpC,EAAQyO,QAAU7O,GAAOyqC,eAAejoC,UAGR/E,IAAhC2C,EAAQsqC,sBACVtqC,EAAQsqC,qBAAsB,QAEEjtC,IAA9B2C,EAAQyzB,oBACVzzB,EAAQyzB,mBAAoB,GAG9B,MAAMlM,EAAgB,IACjBvnB,EACH4f,YAAaD,GAAkC3f,EAAQ4f,aAAe4mB,IACtE5jB,aAAc4C,GAAuBxlB,GACrCgxB,UAAWhxB,EAAQgxB,YAAc3F,KAAkB6d,GAAqBa,MC7G5E,SAASQ,GACPC,EACAxqC,IAEsB,IAAlBA,EAAQyqC,QACNjoC,GACFY,EAAOG,SAGPX,GAAe,KAEbE,QAAQyN,KAAK,+EAA8E,IAInFgD,KACRoF,OAAO3Y,EAAQ0qC,cAErB,MAAMh4B,EAAS,IAAI83B,EAAYxqC,IAQjC,SAAS2qC,GAAiBj4B,GAIxB,MAAM0I,EAFM2C,KAEI1C,cAChBD,EAAI1I,OAASA,EACb0I,EAAIzI,MAAMyE,UAAU1E,EACtB,EAdEi4B,CAAiBj4B,GAoBnB,SAASk4B,GAAiBl4B,GACpBA,EAAO9E,KACT8E,EAAO9E,OAGE8E,EAAO4I,mBAEhB5I,EAAO4I,mBAEX,CA5BEsvB,CAAiBl4B,EACnB,ED2FE63B,CAAYlR,GAAe9R,GAEvBvnB,EAAQsqC,qBA0Gd,SAASO,YACIjrC,GAAOgiB,SAAa,IAC7Bpf,IAAeY,EAAOmN,KAAK,uFAQ7B0M,GAAa,CAAE/O,gBAAgB,IAC/B4O,KAGAoP,GAAiC,EAAG1M,OAAMuN,cAE3B1vB,IAATmiB,GAAsBA,IAASuN,IACjC9P,GAAa,CAAE/O,gBAAgB,IAC/B4O,KAAe,GAGrB,CA9HI+tB,EAEJ,CAEA,MAAMC,GAAmBA,CAEvB9qC,EAAU,CAAC,EAEX2d,EAAMI,QAGN,IAAKne,GAAOgiB,SAEV,YADApf,IAAeY,EAAOolB,MAAM,yDAK9B,MAAQ9V,SAAQC,SAAUgL,EAAItC,cACxB+N,EAAMppB,EAAQopB,KAAQ1W,GAAUA,EAAOK,SAC7C,IAAKqW,EAEH,YADA5mB,IAAeY,EAAOolB,MAAM,iDAI1B7V,IACF3S,EAAQ+O,KAAO,IACV4D,EAAMO,aACNlT,EAAQ+O,OAMV/O,EAAQ0I,UAEX1I,EAAQ0I,QAAUiV,EAAI1B,eAGxB,MAAM8uB,EAASnrC,GAAOgiB,SAAS4b,cAAc,UAC7CuN,EAAOC,OAAQ,EACfD,EAAOE,YAAc,YACrBF,EAAOG,IxCxHT,SAASC,GACPC,EACAC,GAIA,MAAMjiB,EAAMU,GAAQshB,GACpB,IAAKhiB,EACH,MAAO,GAGT,MAAMkiB,EAAY,GAAE7gB,GAAmBrB,sBAEvC,IAAImiB,EAAkB,OAAMpiB,GAAYC,KACxC,UAAW/nB,KAAOgqC,EAChB,GAAY,QAARhqC,GAIQ,YAARA,EAIJ,GAAY,SAARA,EAAgB,CAClB,MAAM0N,EAAOs8B,EAAct8B,KAC3B,IAAKA,EACH,SAEEA,EAAKlR,OACP0tC,GAAmB,SAAQl7B,mBAAmBtB,EAAKlR,SAEjDkR,EAAKC,QACPu8B,GAAmB,UAASl7B,mBAAmBtB,EAAKC,SAExD,MACEu8B,GAAmB,IAAGl7B,mBAAmBhP,MAAQgP,mBAAmBg7B,EAAchqC,MAItF,MAAQ,GAAEiqC,KAAYC,GACxB,CwCgFeJ,CAAwB/hB,EAAKppB,GAEtCA,EAAQwrC,SACVT,EAAOU,OAASzrC,EAAQwrC,QAG1B,MAAQE,WAAY1rC,EACpB,GAAI0rC,EAAS,CACX,MAAMC,EAAoCtjC,IACxC,GAAmB,mCAAfA,EAAMc,KACR,IACEuiC,GACF,SACE9rC,GAAOgsC,oBAAoB,UAAWD,EACxC,GAGJ/rC,GAAO45B,iBAAiB,UAAWmS,EACrC,CAEA,MAAME,EAAiBjsC,GAAOgiB,SAAS+b,MAAQ/9B,GAAOgiB,SAASqb,KAC3D4O,EACFA,EAAejO,YAAYmN,GAE3BvoC,IAAeY,EAAOolB,MAAM,gEAA+D,kBE7L/F,MAAMsjB,GAAmC,gBAKnCC,GAAwC,qBAKxCC,GAA+B,YAK/BC,GAAmC,+ECEzC,MAAMC,UAAwBzpC,iBAAqB,KAAqBA,iBAuClE0pC,UAAyBC,KAAS,OAAiBA,KAAKC,QAI9D,SAASC,GAAkBzpC,GAUvB,OAAOspC,GAAkBC,KAAKG,KAAKlwB,IAAIxZ,GAAYA,GACvD,CA0BA,SAAS2pC,GAAyBroC,GAC9B,GAAIA,aAAiBzF,MACjB,OAAO,EAEX,GAAc,OAAVyF,GAAmC,iBAAVA,EACzB,OAAO,EAEX,MAAMsoC,EAAYtoC,EAClB,OAAQpF,GAAS0tC,EAAU5uC,OACvBkB,GAAS0tC,EAAU3mC,gBAClBzI,IAAcovC,EAAU1mC,OAAShH,GAAS0tC,EAAU1mC,OAC7D,CACA,IAwFI2mC,GACAC,GACAC,GAvFEC,GAAkB,MAAxB,MAAMA,EACFhzC,YAAYmG,GACRlG,KAAKgzC,kCAAmC,EACxChzC,KAAK02B,SAAWryB,OAAO4oB,OAAO,CAAEgmB,WAAW,GAAQ/sC,EACvD,CAIAgtC,YAAYxkB,GACR,MAAMykB,EAAiBnzC,KAAKozC,cAAc1kB,IAAU,wBAE9C9f,EAAU4jC,GAAkB,IAAMa,GAAwBF,EAAgB,CAC5EjkC,UAAW,CAAE9C,KAAM,UAAW+C,SAAS,MAQ3C,GALInP,KAAK02B,SAASuc,WAEdjqC,QAAQ0lB,MAAMykB,GAGdnzC,KAAK02B,SAAS4c,WAAY,CAC1B,MAAM16B,EAASy6B,KACXz6B,GAAUA,EAAOiU,KAAO7sB,KAAKgzC,kCAC7Bp6B,EAAOiU,GAAG,iBAAmBte,IACpBA,EAAMnC,MAEPinC,GAAwBhvC,OAAO4oB,OAAO5oB,OAAO4oB,OAAO,CAAC,EAAGjtB,KAAK02B,SAAS6a,eAAgB,CAAE3iC,QAASL,EAAMI,WAAW,GAI1H3O,KAAKgzC,kCAAmC,KAElCp6B,IAAWA,EAAOiU,KACxBwmB,GAAwBhvC,OAAO4oB,OAAO5oB,OAAO4oB,OAAO,CAAC,EAAGjtB,KAAK02B,SAAS6a,eAAgB,CAAE3iC,YAEhG,CACJ,CAIAwkC,cAAc1kB,GAEV,GAAI1uB,KAAK02B,SAAS6c,UAAW,CACzB,MAAMC,EAAmBxzC,KAAKyzC,kBAAkB1mB,KAAK/sB,MACrD,OAAOA,KAAK02B,SAAS6c,UAAU7kB,EAAO8kB,EAC1C,CACA,OAAOxzC,KAAKyzC,kBAAkB/kB,EAClC,CAIA+kB,kBAAkBC,GACd,MAAMhlB,EA1Fd,SAASilB,GAAuBjlB,GAG5B,OAAOA,GAASA,EAAMklB,gBAChBllB,EAAMklB,gBACNllB,CACV,CAoFsBilB,CAAuBD,GAErC,OAAIhlB,aAAiBmlB,MArF7B,SAASC,GAAuBplB,GAE5B,OAAIgkB,GAAyBhkB,EAAMA,OACxBA,EAAMA,MAGbA,EAAMA,iBAAiBqlB,YAAcrlB,EAAMA,MAAM1iB,QAC1C0iB,EAAMA,MAAM1iB,QAGI,iBAAhB0iB,EAAMA,MACL,wBAAuBA,EAAMxa,qBAAqBwa,EAAMA,SAG7DA,EAAM1iB,OACjB,CAuEmB8nC,CAAuBplB,GAGb,iBAAVA,GAAsBgkB,GAAyBhkB,GAC/CA,EAGJ,IACX,EAEJqkB,SAAmB/vC,UAAI,SAAA5C,GAAA,WAAAA,GAAyF2yC,GAAV9xC,OAA8C,uBAAqB,EACzK8xC,EAAmBiB,WADmF/yC,OAAE,CAAAgzC,MACYlB,EAAkBhwC,QAAlBgwC,EAAkB/vC,UAAAC,WAAc,SAlE9I8vC,CAAkB,KA6ExB,SAASmB,GAAmBC,GACxB,OAAO,IAAIpB,GAAmBoB,EAClC,CAiCA,SAASC,KAEL,OAAO36B,KAAkBiF,gBAC7B,CACA,IAIM21B,GAAY,MAAlB,MAAMA,EACFt0C,YAAYu0C,GACRt0C,KAAKs0C,QAAUA,EACft0C,KAAKu0C,UAAYv0C,KAAKs0C,QAAQE,OAAOC,QAAKzsC,MAAQuG,GAAUA,aAAiBmmC,QAAe,EAAGC,MAAIC,IAC/F,IAAKhC,GAGD,YAFAR,IACI9oC,EAAOolB,MAAM,uFAGrB,MAAMmmB,EpBjNlB,SAASC,GAAyBC,GAEhC,OAAOA,EAAQxsC,MAAM,QAAS,GAAG,EACnC,CoB8MgCusC,CAAyBF,EAAgBzrB,KAE7D,IAAI6rB,EAAoBZ,MACnBY,GAAqBlC,KACtBkC,EAAoBnC,GAAwB,CACxC9uC,KAAM8wC,EACN/8B,GAAI,aACJG,OAAQ,0BACRg9B,WAAY,CACRC,CAAClD,IAAmC,UAI5CgD,IACIh1C,KAAKm1C,cACLn1C,KAAKm1C,aAAa3pB,MAGtBxrB,KAAKm1C,aAAeH,EAAkBI,WAAW,CAC7Cl7B,YAAc,GAAE06B,EAAgBzrB,MAChCrR,GApEO,qBAqEPG,OAAQ,kBACRD,KAAM3T,OAAO4oB,OAAO,CAAE,0BAA2B,kBAAmB9D,IAAK0rB,GAAgBD,EAAgBS,mBAAqB,CAC1HA,kBAAmBT,EAAgBS,sBAE1C,IAWTr1C,KAAKs1C,QAAUt1C,KAAKs0C,QAAQE,OAAOC,QAAKzsC,MAAQuG,GAAUA,aAAiBgnC,QAAU,EAAGZ,MAAIpmC,IACxF,MAAMinC,EA8KlB,SAASC,GAAkCD,GACvC,MAAMrhB,EAAQ,GACd,IAAIuhB,EAAeF,GAASA,EAAMG,WAClC,KAAOD,GAAc,CACjB,MAAMjmB,EAAOimB,GAAgBA,EAAaE,aAAeF,EAAaE,YAAYnmB,KAClF,GAAa,MAATA,EACA,MAEJ0E,EAAMltB,KAAKwoB,GACXimB,EAAeA,EAAaC,UAChC,CACA,MAAME,EAAW1hB,EAAMnsB,OAAO8tC,GAAQA,GAAM1uC,KAAK,KACjD,OAAOyuC,EAAY,IAAGA,KAAc,GACxC,CA3L0BJ,CAAkClnC,EAAMsE,MAAM4/B,MAEtDl9B,EAAc6+B,KAEda,EAAc1/B,GAAe2C,GAAW3C,GAAalG,MAAS,CAAC,EACjEkG,GAAgE,QAAjD0/B,EAAWjD,MAC1Bz8B,EAAYwgC,WAAWP,GACvBjgC,EAAYygC,aAAahE,GAAkC,SAAO,IAG1EhyC,KAAKi2C,QAAUj2C,KAAKs0C,QAAQE,OAAOC,QAAKzsC,MAAOuG,GAASA,aAAiB2nC,OAAiB3nC,aAAiB4nC,OAAoB5nC,aAAiB6nC,QAAe,EAAGzB,MAAI,KAC9J30C,KAAKm1C,eACL3C,GAAkB,KAEdxyC,KAAKm1C,aAAa3pB,KAAI,GAE1BxrB,KAAKm1C,aAAe,SAG5Bn1C,KAAKm1C,aAAe,KACpBn1C,KAAKq2C,cAAgB,IAAIC,MACzBt2C,KAAKq2C,cAAc9uB,IAAIvnB,KAAKu0C,UAAUgC,aACtCv2C,KAAKq2C,cAAc9uB,IAAIvnB,KAAKs1C,QAAQiB,aACpCv2C,KAAKq2C,cAAc9uB,IAAIvnB,KAAKi2C,QAAQM,YACxC,CAKAC,cACIx2C,KAAKq2C,cAAcI,aACvB,EAEJpC,SAAarxC,UAAI,SAAA5C,GAAA,WAAAA,GAAyFi0C,GAtIJpzC,OAsIkCy1C,OAAS,EACjJrC,EAAaL,WAvIyF/yC,OAAE,CAAAgzC,MAuIMI,EAAYtxC,QAAZsxC,EAAYrxC,UAAAC,WAAc,SAhFlIoxC,CAAY,KCjOlB,MAAMsC,GAEH52C,YAAY62C,EAAS,KACpB52C,KAAK62C,QAAUD,EACf52C,KAAKirB,MAAQ,EACf,CAQC1D,IAAIjS,GACCtV,KAAKirB,MAAMvkB,OAAS1G,KAAK62C,QAE3BvhC,EAAKwhC,kBAAevzC,EAEpBvD,KAAKirB,MAAMhkB,KAAKqO,EAEpB,EAMF,MAAMyhC,GA8CHh3C,YAAY8X,EAAc,CAAC,GAC1B7X,KAAKg3C,SAAWn/B,EAAYT,SAAWzJ,KACvC3N,KAAKi3C,QAAUp/B,EAAYR,QAAU1J,KAAQ2J,UAAU,IACvDtX,KAAKk3C,WAAar/B,EAAYqqB,gBAAkBpyB,KAEhD9P,KAAKgY,KAAOH,EAAYG,KAAO,IAAKH,EAAYG,MAAS,CAAC,EAE1DhY,KAAKqP,KAAOwI,EAAYxI,KAAO,IAAKwI,EAAYxI,MAAS,CAAC,EAC1DrP,KAAKm3C,YAAct/B,EAAYo9B,WAAa,IAAKp9B,EAAYo9B,YAAe,CAAC,EAE7Ej1C,KAAKo3C,aAAev/B,EAAYu/B,cAAgB,SAEhDp3C,KAAKg2C,aAAa7D,GAAkCt6B,EAAYI,QAAU,UAG1EjY,KAAKq3C,MAAQx/B,EAAY9T,MAAQ8T,EAAYqC,YAEzCrC,EAAYwjB,eACdr7B,KAAKs3C,cAAgBz/B,EAAYwjB,cAG/B,YAAaxjB,IACf7X,KAAKu3C,SAAW1/B,EAAYN,SAE1BM,EAAYC,IACd9X,KAAKg2C,aAAa9D,GAA8Br6B,EAAYC,IAE1DD,EAAY3D,SACdlU,KAAKw3C,QAAU3/B,EAAY3D,QAEzB2D,EAAY8qB,eACd3iC,KAAKy3C,SAAW5/B,EAAY8qB,aAEhC,CASC,QAAI5+B,GACH,OAAO/D,KAAKq3C,OAAS,EACvB,CAMC,QAAItzC,CAAKA,GACR/D,KAAK+1C,WAAWhyC,EAClB,CAMC,eAAImW,GACH,OAAOla,KAAKq3C,KACd,CAMC,eAAIn9B,CAAYA,GACfla,KAAKq3C,MAAQn9B,CACf,CAMC,WAAI9C,GACH,OAAOpX,KAAKg3C,QACd,CAMC,WAAI5/B,CAAQA,GACXpX,KAAKg3C,SAAW5/B,CAClB,CAMC,UAAIC,GACH,OAAOrX,KAAKi3C,OACd,CAMC,UAAI5/B,CAAOA,GACVrX,KAAKi3C,QAAU5/B,CACjB,CAOC,gBAAIgkB,CAAaqc,GAChB13C,KAAKs3C,cAAgBI,CACvB,CAOC,gBAAIrc,GACH,OAAOr7B,KAAKs3C,aACd,CAMC,WAAI//B,GACH,OAAOvX,KAAKu3C,QACd,CAMC,WAAIhgC,CAAQA,GACXvX,KAAKu3C,SAAWhgC,CAClB,CAMC,cAAI09B,GACH,OAAOj1C,KAAKm3C,WACd,CAMC,cAAIlC,CAAWA,GACdj1C,KAAKm3C,YAAclC,CACrB,CAMC,kBAAI/S,GACH,OAAOliC,KAAKk3C,UACd,CAMC,kBAAIhV,CAAeyV,GAClB33C,KAAKk3C,WAAaS,CACpB,CAMC,gBAAIhV,GACH,OAAO3iC,KAAKy3C,QACd,CAMC,gBAAI9U,CAAaiV,GAChB53C,KAAKy3C,SAAWG,CAClB,CAOC,UAAI1jC,GACH,OAAOlU,KAAKw3C,OACd,CAOC,UAAItjC,CAAOA,GACVlU,KAAKw3C,QAAUtjC,CACjB,CAOC,MAAI4D,GACH,OAAO9X,KAAKm3C,YAAYjF,GAC1B,CAQC,MAAIp6B,CAAGA,GACN9X,KAAKg2C,aAAa9D,GAA8Bp6B,EAClD,CAOC,UAAIG,GACH,OAAOjY,KAAKm3C,YAAYhF,GAC1B,CAOC,UAAIl6B,CAAOA,GACVjY,KAAKg2C,aAAa7D,GAAkCl6B,EACtD,CAKCJ,cACC,MAAQo/B,QAAS5/B,EAAQ2/B,SAAU5/B,EAASmgC,SAAUhgC,GAAYvX,KAClE,MAAO,CACLqX,SACAD,UACAsB,WAAYnB,EAAUE,G3DxUJ,E2D0UtB,CAQC29B,WACCv9B,GAEA,MAAMggC,EAAY,IAAId,GAAK,IACtBl/B,EACHwjB,aAAcr7B,KAAKi3C,QACnB1/B,QAASvX,KAAKu3C,SACdngC,QAASpX,KAAKg3C,WAIhBa,EAAUf,aAAe92C,KAAK82C,aAE1Be,EAAUf,cAEZe,EAAUf,aAAavvB,IAAIswB,GAG7B,MAAM38B,EAAW7F,EAAYrV,MAM7B,GAFA63C,EAAUtiC,YAAc2F,EAEpBxS,IAAewS,EAAU,CAC3B,MAIM48B,EAAc,uBAJLjgC,GAAeA,EAAYC,IAAO,0CACjCI,GAAW2/B,GAAW39B,aAAe,wBACvCgB,EAASrD,cAAcR,WAGrC/N,EAAOqC,IAAImsC,GACX93C,KAAK+3C,YAAcD,CACrB,CAEA,OAAOD,CACT,CAWC95B,OAAOxW,EAAK8C,GAEX,OAAArK,KAAKgY,KAAO,IAAKhY,KAAKgY,KAAMgG,CAACzW,GAAM8C,GAC5BrK,IACT,CASCg4C,QAAQzwC,EAAK8C,GAEZ,OAAArK,KAAKqP,KAAO,IAAKrP,KAAKqP,KAAM2O,CAACzW,GAAM8C,GAC5BrK,IACT,CAGCg2C,aAAazuC,EAAK8C,QACH9G,IAAV8G,SAEKrK,KAAKm3C,YAAY5vC,GAExBvH,KAAKm3C,YAAY5vC,GAAO8C,CAE5B,CAGC4tC,cAAchD,GACb5wC,OAAO8E,KAAK8rC,GAAY7sC,QAAQb,GAAOvH,KAAKg2C,aAAazuC,EAAK0tC,EAAW1tC,IAC3E,CAKC2wC,UAAU7tC,GACT,OAAArK,KAAKw3C,QAAUntC,EACRrK,IACT,CAKCm4C,cAAcC,GAEbp4C,KAAK+d,OAAO,mBAAoBzT,OAAO8tC,IAEvCp4C,KAAKg4C,QAAQ,4BAA6BI,GAC1C,MAAMC,EA2MV,SAASC,GAAuBF,GAC9B,GAAIA,EAAa,KAAOA,GAAc,IACpC,MAAO,KAGT,GAAIA,GAAc,KAAOA,EAAa,IACpC,OAAQA,GACN,KAAK,IACH,MAAO,kBACT,KAAK,IACH,MAAO,oBACT,KAAK,IACH,MAAO,YACT,KAAK,IACH,MAAO,iBACT,KAAK,IACH,MAAO,sBACT,KAAK,IACH,MAAO,qBACT,QACE,MAAO,mBAIb,GAAIA,GAAc,KAAOA,EAAa,IACpC,OAAQA,GACN,KAAK,IACH,MAAO,gBACT,KAAK,IACH,MAAO,cACT,KAAK,IACH,MAAO,oBACT,QACE,MAAO,iBAIb,MAAO,eACT,CAjPuBE,CAAuBF,GAC1C,MAAmB,kBAAfC,GACFr4C,KAAKk4C,UAAUG,GAEVr4C,IACT,CAOCu4C,QAAQx0C,GACP/D,KAAK+1C,WAAWhyC,EAClB,CAKCgyC,WAAWhyC,GACV,OAAA/D,KAAKq3C,MAAQtzC,EACN/D,IACT,CAOCw4C,YACC,MAAwB,OAAjBx4C,KAAKw3C,OACd,CAOCiB,OAAO9V,GACN,OAAO3iC,KAAKwrB,IAAImX,EAClB,CAGCnX,IAAImX,GAEH,GAAI3iC,KAAKy3C,SACP,OAEF,MAAMv8B,EAAW7F,EAAYrV,MAC7B,GACE0I,IAEAwS,GACAA,EAASrD,cAAcR,SAAWrX,KAAKi3C,QACvC,CACA,MAAMa,EAAa93C,KAAK+3C,YACpBD,GACFxuC,EAAOqC,IAAKmsC,EAAa7pC,QAAQ,WAAY,aAEjD,CAEAjO,KAAKy3C,SAAWp/B,GAAuBsqB,EACzC,CAOC+V,gBACC,OAAOvgC,GAAkBnY,KAC3B,CAOC24C,YACC,OAAO5rC,GAAkB,CACvBsC,KAAMrP,KAAK44C,WACX1+B,YAAala,KAAKq3C,MAClB1U,aAAc3iC,KAAKy3C,SAEnB3/B,GAAI9X,KAAK8X,GACTujB,aAAcr7B,KAAKs3C,cACnB//B,QAASvX,KAAKu3C,SACdlgC,OAAQrX,KAAKi3C,QACb/U,eAAgBliC,KAAKk3C,WACrBhjC,OAAQlU,KAAKw3C,QAEbx/B,KAAMhY,KAAKgY,KACXZ,QAASpX,KAAKg3C,UAElB,CAOC6B,kBAAkBhhC,GAEjB,OAAA7X,KAAKqP,KAAOwI,EAAYxI,MAAQ,CAAC,EAEjCrP,KAAKq3C,MAAQx/B,EAAY9T,MAAQ8T,EAAYqC,YAC7Cla,KAAKy3C,SAAW5/B,EAAY8qB,aAE5B3iC,KAAK8X,GAAKD,EAAYC,GACtB9X,KAAKs3C,cAAgBz/B,EAAYwjB,aACjCr7B,KAAKu3C,SAAW1/B,EAAYN,QAC5BvX,KAAKi3C,QAAUp/B,EAAYR,QAAUrX,KAAKi3C,QAC1Cj3C,KAAKk3C,WAAar/B,EAAYqqB,gBAAkBliC,KAAKk3C,WACrDl3C,KAAKw3C,QAAU3/B,EAAY3D,OAE3BlU,KAAKgY,KAAOH,EAAYG,MAAQ,CAAC,EACjChY,KAAKg3C,SAAWn/B,EAAYT,SAAWpX,KAAKg3C,SAErCh3C,IACT,CAOC84C,kBACC,OAAOphC,GAAmB1X,KAC5B,CAUCyY,cACC,OAAO1L,GAAkB,CACvBsC,KAAMrP,KAAK44C,WACX1+B,YAAala,KAAKq3C,MAClBv/B,GAAI9X,KAAKm3C,YAAYjF,IACrBn6B,eAAgB/X,KAAKs3C,cACrB3/B,QAAS3X,KAAKi3C,QACd8B,gBAAiB/4C,KAAKk3C,WACtBhjC,OAAQlU,KAAKw3C,QAEbx/B,KAAM3T,OAAO8E,KAAKnJ,KAAKgY,MAAMtR,OAAS,EAAI1G,KAAKgY,UAAOzU,EACtDwQ,UAAW/T,KAAKy3C,SAChB7/B,SAAU5X,KAAKg3C,SACf/+B,OAAQjY,KAAKm3C,YAAYhF,KAE7B,CAGC6G,cACC,OAAQh5C,KAAKy3C,YAAcz3C,KAAKu3C,QAClC,CAMCljC,SACC,OAAOrU,KAAKyY,aACd,CAOCmgC,WAIC,MAAQvpC,OAAM8nC,YAAalC,GAAej1C,KAEpCi5C,EAAU50C,OAAO8E,KAAKkG,GAAM3I,OAAS,EACrCwyC,EAAgB70C,OAAO8E,KAAK8rC,GAAYvuC,OAAS,EAEvD,GAAKuyC,GAAYC,EAIjB,OAAID,GAAWC,EACN,IACF7pC,KACA4lC,GAIAgE,EAAU5pC,EAAO4lC,CAC1B,EC9mBF,MAAMkE,WAAoBpC,GAgBvBh3C,YAAYq5C,EAAoBv1B,GAC/ByS,MAAM8iB,GACNp5C,KAAKq5C,cAAgB,CAAC,EACtBr5C,KAAKyc,UAAY,CAAC,EAGlBzc,KAAKs5C,KAAOz1B,GAAOI,KAEnBjkB,KAAKq3C,MAAQ+B,EAAmBr1C,MAAQ,GAExC/D,KAAK+wB,UAAY,IAEZqoB,EAAmBr/B,UAGxB/Z,KAAKu5C,SAAWH,EAAmBI,QAKnCx5C,KAAKuV,YAAcvV,KAInB,MAAMy5C,EAAiCz5C,KAAK+wB,UAAUlb,uBAClD4jC,IAEFz5C,KAAK4Z,8BAAgC,IAAK6/B,GAE9C,CASC,QAAI11C,GACH,OAAO/D,KAAKq3C,KACd,CAMC,QAAItzC,CAAK21C,GAER15C,KAAKu4C,QAAQmB,EACf,CAMC,YAAI3/B,GAEH,MAAO,CAGL7O,OAAQ,SACRyuC,aAAc,CAAC,KAGZ35C,KAAK+wB,aAGJ/wB,KAAKm3C,YAAYnF,KAAqC,CACxD9mC,OAAQlL,KAAKm3C,YAAYnF,QAEvBhyC,KAAKm3C,YAAYlF,KAA0C,CAC7Dp4B,WAAY7Z,KAAKm3C,YAAYlF,KAGnC,CAMC,YAAIl4B,CAASA,GACZ/Z,KAAK+wB,UAAYhX,CACnB,CASCw+B,QAAQx0C,EAAMmH,EAAS,UACtBlL,KAAKq3C,MAAQtzC,EACb/D,KAAKg2C,aAAahE,GAAkC9mC,EACtD,CAGC6qC,WAAWhyC,GACV,OAAA/D,KAAKq3C,MAAQtzC,EACN/D,IACT,CAMC45C,iBAAiBhD,EAAS,KAEpB52C,KAAK82C,eAER92C,KAAK82C,aAAe,IAAIH,GAAaC,IAGvC52C,KAAK82C,aAAavvB,IAAIvnB,KACxB,CAMCue,WAAWhX,EAAKmM,GACC,OAAZA,SAEK1T,KAAKyc,UAAUlV,GAEtBvH,KAAKyc,UAAUlV,GAAOmM,CAE1B,CAOCmmC,eAAe91C,EAAMsG,EAAO+vB,EAAO,IAClCp6B,KAAKq5C,cAAct1C,GAAQ,CAAEsG,QAAO+vB,OACtC,CAMC0f,YAAYC,GACX/5C,KAAK+wB,UAAY,IAAK/wB,KAAK+wB,aAAcgpB,EAC3C,CAKCvuB,IAAImX,GACH,MAAMqX,EAAe3hC,GAAuBsqB,GACtCptB,EAAcvV,KAAKi6C,mBAAmBD,GAC5C,GAAKzkC,EAIL,OAAOvV,KAAKs5C,KAAK/4B,aAAahL,EAChC,CAKCojC,YAIC,OAAO5rC,GAAkB,IAFLupB,MAAMqiB,YAIxB50C,KAAM/D,KAAKq3C,MACXmC,QAASx5C,KAAKu5C,UAElB,CAKCV,kBAAkBO,GAEjB,OAAA9iB,MAAMuiB,kBAAkBO,GAExBp5C,KAAKq3C,MAAQ+B,EAAmBr1C,MAAQ,GACxC/D,KAAKu5C,SAAWH,EAAmBI,QAE5Bx5C,IACT,CASCk6C,4BACC,OAAO3gC,GAAkCvZ,KAC3C,CAQCm6C,OAAOt2B,GACN7jB,KAAKs5C,KAAOz1B,CACd,CAKCo2B,mBAAmBtX,GAElB,QAAsBp/B,IAAlBvD,KAAKy3C,SACP,OAGGz3C,KAAKq3C,QACR3uC,IAAeY,EAAOmN,KAAK,uEAC3BzW,KAAKq3C,MAAQ,2BAIf/gB,MAAM9K,IAAImX,GAGV,MAAM/pB,EAAS5Y,KAAKs5C,KAAK9/B,YAKzB,GAJIZ,GAAUA,EAAOU,MACnBV,EAAOU,KAAK,oBAAqBtZ,OAGb,IAAlBA,KAAKu3C,SAQP,OANA7uC,IAAeY,EAAOqC,IAAI,yFAEtBiN,GACFA,EAAOue,mBAAmB,cAAe,gBAO7C,MAAMijB,EAAgBp6C,KAAK82C,aAEvB92C,KAAK82C,aAAa7rB,MAAMjjB,OAAOsN,GAAQA,IAAStV,MAAQkY,GAAW5C,GAAMvB,WACzE,GAEJ,GAAI/T,KAAKu5C,UAAYa,EAAc1zC,OAAS,EAAG,CAC7C,MAAM2zC,EAAWD,EAAcjyC,IAAImN,GAAQ4C,GAAW5C,GAAMvB,WAAW/L,OAAOsyC,SAC9Et6C,KAAKy3C,SAAW4C,EAASpkC,OAAO,CAACskC,EAAMhI,IAC9BgI,EAAOhI,EAAUgI,EAAOhI,EAEnC,CAGA,MAAQx4B,YAAa/Z,MAEbkL,UAAW6O,EAEbxE,EAAc,CAClBmF,SAAU,IACL1a,KAAKyc,UAERxB,MAAOvD,GAAmB1X,OAG5BirB,MAAOmvB,EACPrB,gBAAiB/4C,KAAKk3C,WAEtBl/B,KAAMhY,KAAKgY,KACXjE,UAAW/T,KAAKy3C,SAChBliC,YAAavV,KAAKq3C,MAClBjrC,KAAM,cACNkO,sBAAuB,IAClBP,EACHlE,uBAAwB0D,GAAkCvZ,UAExDkL,GAAU,CACZoxB,iBAAkB,CAChBpxB,YAON,OAFwB7G,OAAO8E,KAAKnJ,KAAKq5C,eAAe3yC,OAAS,IAG/DgC,IACEY,EAAOqC,IACL,oDACAmb,KAAKC,UAAU/mB,KAAKq5C,mBAAe91C,EAAW,IAElDgS,EAAYilC,aAAex6C,KAAKq5C,eAIlC3wC,IAAeY,EAAOqC,IAAK,uBAAsB3L,KAAK8X,mBAAmB9X,KAAKq3C,UAEvE9hC,CACT,EC9TF,MAAMklC,GAAmB,CACvBC,YAAa,IACbC,aAAc,IACdC,kBAAmB,KAKfC,GAAkC,CACtC,kBACA,cACA,iBACA,eACA,iBACA,aAMF,MAAMC,WAAoCnE,GACvC52C,YACGg7C,EACAC,EACDC,EACDrE,GAEAtgB,MAAMsgB,GAAQ52C,KAAK+6C,cAAgBA,EAAc/6C,KAAKg7C,aAAeA,EAAah7C,KAAKi7C,kBAAoBA,CAAoB,CAKhI1zB,IAAIjS,GAGH,GAAIA,EAAKuC,cAAcR,SAAWrX,KAAKi7C,kBAAmB,CAGxD,MAAMC,EAAc5lC,EAAKkW,IACzBlW,EAAKkW,IAAM,IAAIgP,KACbx6B,KAAKg7C,aAAa1lC,EAAKuC,cAAcR,QAC9B6jC,EAAYt3B,MAAMtO,EAAMklB,SAIEj3B,IAA/B2U,GAAW5C,GAAMvB,WACnB/T,KAAK+6C,cAAczlC,EAAKuC,cAAcR,OAE1C,CAEAif,MAAM/O,IAAIjS,EACZ,EAQF,MAAM6lC,WAAwBhC,GAkB3Bp5C,YACCq5C,EACEgC,EAKAC,EAAeZ,GAAiBC,YAIhCY,EAAgBb,GAAiBE,aACjCY,EAAqBd,GAAiBG,kBAEtCY,GAAW,EASbC,GAA6B,GAE7BnlB,MAAM8iB,EAAoBgC,GAAUp7C,KAAKo7C,SAAWA,EAASp7C,KAAKq7C,aAAeA,EAAar7C,KAAKs7C,cAAgBA,EAAct7C,KAAKu7C,mBAAqBA,EAAmBv7C,KAAKw7C,SAAWA,EAC9Lx7C,KAAK07C,WAAa,CAAC,EACnB17C,KAAK27C,kBAAoB,EACzB37C,KAAK47C,WAAY,EACjB57C,KAAK67C,iCAAkC,EACvC77C,KAAK87C,uBAAyB,GAC9B97C,KAAK+7C,cAAgBlB,GAAgC,GACrD76C,KAAKg8C,oBAAsBP,EAEvBD,IAGF9yC,IAAeY,EAAOqC,IAAK,+CAA8C3L,KAAK6X,cAAcR,UAE5F+jC,EAAS15B,WAAWlD,QAAQxe,OAGzBy7C,GACHz7C,KAAKi8C,sBAGP5c,WAAW,KACJr/B,KAAK47C,YACR57C,KAAKk4C,UAAU,qBACfl4C,KAAK+7C,cAAgBlB,GAAgC,GACrD76C,KAAKwrB,MAAI,EAEVxrB,KAAKs7C,cACV,CAGC9vB,IAAImX,GACH,MAAMuZ,EAAkB7jC,GAAuBsqB,GAW/C,GATA3iC,KAAK47C,WAAY,EACjB57C,KAAK07C,WAAa,CAAC,EAGH,oBAAZ17C,KAAK8X,IACP9X,KAAKg2C,aAvIe,eAuIiBh2C,KAAK+7C,eAIxC/7C,KAAK82C,aAAc,CACrBpuC,IAEEY,EAAOqC,IAAI,sCAAuC,IAAIiE,KAAuB,IAAlBssC,GAAwB3nC,cAAevU,KAAK8X,IAEzG,UAAW/O,KAAY/I,KAAK87C,uBAC1B/yC,EAAS/I,KAAMk8C,GAIjBl8C,KAAK82C,aAAa7rB,MAAQjrB,KAAK82C,aAAa7rB,MAAMjjB,OAAQsN,IAExD,GAAIA,EAAKuC,cAAcR,SAAWrX,KAAK6X,cAAcR,OACnD,OAAO,EAIJa,GAAW5C,GAAMvB,YACpBuB,EAAK4iC,UAAU,aACf5iC,EAAKkW,IAAI0wB,GACTxzC,IACEY,EAAOqC,IAAI,0DAA2Dmb,KAAKC,UAAUzR,OAAM/R,EAAW,KAG1G,MAAQw1C,gBAAiBpB,EAAW5jC,UAAW6jC,GAAY1/B,GAAW5C,GAChE6mC,EAAqCxE,GAAaA,EAAYuE,EAI9DE,EAA8BxE,GAAWD,GAAaC,EAAUD,GADpC33C,KAAKs7C,cAAgBt7C,KAAKq7C,cAAgB,IAG5E,GAAI3yC,GAAa,CACf,MAAM2zC,EAAkBv1B,KAAKC,UAAUzR,OAAM/R,EAAW,GACnD44C,EAEOC,GACV9yC,EAAOqC,IAAI,8EAA+E0wC,GAF1F/yC,EAAOqC,IAAI,6EAA8E0wC,EAI7F,CAEA,OAAOF,GAAsCC,IAG/C1zC,IAAeY,EAAOqC,IAAI,qCAC5B,MACEjD,IAAeY,EAAOqC,IAAI,uCAI5B,GAAI3L,KAAKw7C,SAAU,CAEjB,MAAM3iC,EAAQ7Y,KAAKo7C,SAAS15B,WAExB7I,EAAM6F,mBAAqB1e,MAE7B6Y,EAAM2F,aAAQjb,EAElB,CAEA,OAAO+yB,MAAM9K,IAAImX,EACnB,CASC2Z,6BAA6BvzC,GAC5B/I,KAAK87C,uBAAuB70C,KAAK8B,EACnC,CAKC6wC,iBAAiBhD,GAEX52C,KAAK82C,eAeR92C,KAAK82C,aAAe,IAAIgE,GAdFxyC,IAChBtI,KAAK47C,WAGT57C,KAAK+6C,cAAczyC,EAAE,EAEFA,IACftI,KAAK47C,WAGT57C,KAAKg7C,aAAa1yC,EAAE,EAIyDtI,KAAK6X,cAAcR,OAAQu/B,GAG1GluC,IAAeY,EAAOqC,IAAI,sBAC1B3L,KAAKu8C,kBAGPv8C,KAAK82C,aAAavvB,IAAIvnB,KACxB,CAQCw8C,kBACC7Z,GAEE8Z,4BAGH,CACGA,0BAA0B,IAG5Bz8C,KAAK67C,iCAA+D,IAA7BY,EACnCz8C,KAAK08C,iBACP/a,aAAa3hC,KAAK08C,gBAClB18C,KAAK08C,oBAAiBn5C,EAEsB,IAAxCc,OAAO8E,KAAKnJ,KAAK07C,YAAYh1C,QAAgB1G,KAAK67C,kCACpD77C,KAAK+7C,cAAgBlB,GAAgC,GACrD76C,KAAKwrB,IAAImX,IAGf,CAWCga,gBAAgBxrC,GACfnR,KAAK+7C,cAAgB5qC,CACvB,CAKCyrC,uBACM58C,KAAKg8C,qBACRtzC,IAAeY,EAAOqC,IAAI,0DAC1B3L,KAAKi8C,sBACLj8C,KAAKg8C,oBAAqB,EAE9B,CAKCC,oBAAoBtZ,GACnB3iC,KAAKw8C,oBACLx8C,KAAK08C,eAAiBrd,WAAW,MAC1Br/B,KAAK47C,WAAqD,IAAxCv3C,OAAO8E,KAAKnJ,KAAK07C,YAAYh1C,SAClD1G,KAAK+7C,cAAgBlB,GAAgC,GACrD76C,KAAKwrB,IAAImX,GAAY,EAEtB3iC,KAAKq7C,aACV,CAMCN,cAAc1jC,GACbrX,KAAKw8C,uBAAkBj5C,EAAW,CAAEk5C,0BAA2Bz8C,KAAK67C,kCACpEnzC,IAAeY,EAAOqC,IAAK,2BAA0B0L,KACrDrX,KAAK07C,WAAWrkC,IAAU,EAC1B3O,IAAeY,EAAOqC,IAAI,iCAAkCtH,OAAO8E,KAAKnJ,KAAK07C,YAAYh1C,OAC3F,CAMCs0C,aAAa3jC,GAQZ,GAPIrX,KAAK07C,WAAWrkC,KAClB3O,IAAeY,EAAOqC,IAAK,yBAAwB0L,YAE5CrX,KAAK07C,WAAWrkC,GACvB3O,IAAeY,EAAOqC,IAAI,iCAAkCtH,OAAO8E,KAAKnJ,KAAK07C,YAAYh1C,SAG/C,IAAxCrC,OAAO8E,KAAKnJ,KAAK07C,YAAYh1C,OAAc,CAC7C,MAAMi8B,EAAe7yB,KACjB9P,KAAK67C,gCACH77C,KAAKg8C,qBACPh8C,KAAK+7C,cAAgBlB,GAAgC,GACrD76C,KAAKwrB,IAAImX,IAKX3iC,KAAKi8C,oBAAoBtZ,EAAe3iC,KAAKq7C,aAAe,IAEhE,CACF,CAMCwB,QAEC,GAAI78C,KAAK47C,UACP,OAGF,MAAMkB,EAAkBz4C,OAAO8E,KAAKnJ,KAAK07C,YAAYt0C,KAAK,IAEtD01C,IAAoB98C,KAAK+8C,qBAC3B/8C,KAAK27C,oBAEL37C,KAAK27C,kBAAoB,EAG3B37C,KAAK+8C,qBAAuBD,EAExB98C,KAAK27C,mBAAqB,EACxB37C,KAAKg8C,qBACPtzC,IAAeY,EAAOqC,IAAI,yEAC1B3L,KAAKk4C,UAAU,qBACfl4C,KAAK+7C,cAAgBlB,GAAgC,GACrD76C,KAAKwrB,OAGPxrB,KAAKu8C,gBAET,CAKCA,iBACC7zC,IAAeY,EAAOqC,IAAK,yCAAwC3L,KAAK27C,qBACxEtc,WAAW,KACTr/B,KAAK68C,OAAM,EACV78C,KAAKu7C,mBACV,ECpYF,SAASnH,GAAqB4I,GAM5B,OAJYA,GAAY/4B,MAENvC,WAELhD,gBACf,CCZA,IAAIu+B,IAAqB,EAkBzB,SAASC,KAEP,MAAMlI,EAAoBZ,KAC1B,GAAIY,EAAmB,CACrB,MAAM9gC,EAAS,iBACfxL,IAAeY,EAAOqC,IAAK,0BAAyBuI,6BACpD8gC,EAAkBkD,UAAUhkC,EAC9B,CACF,CCrBA,SAASipC,GACPC,GAEA,GAAkC,kBAAvBC,qBAAqCA,mBAC9C,OAAO,EAGT,MAAMzkC,EAASY,KACTtT,EAAUk3C,GAAiBxkC,GAAUA,EAAOE,aAClD,QAAS5S,IAAYA,EAAQo3C,eAAiB,qBAAsBp3C,GAAW,kBAAmBA,EACpG,CCJA,SAASq3C,GACPhoC,EACArP,EACAs3C,GAGA,IAAKL,GAAkBj3C,GAErBqP,SAAYgC,SAAU,EACfhC,EAKT,QAA4BhS,IAAxBgS,EAAYgC,QAEdhC,SAAYygC,aAAa/D,GAAuClX,OAAOxlB,EAAYgC,UAC5EhC,EAKT,IAAIsE,EAiBJ,MAhBqC,mBAA1B3T,EAAQu3C,eACjB5jC,EAAa3T,EAAQu3C,cAAcD,GACnCjoC,EAAYygC,aAAa/D,GAAuClX,OAAOlhB,UAC5BtW,IAAlCi6C,EAAgBE,cACzB7jC,EAAa2jC,EAAgBE,qBACbx3C,EAAQy3C,iBAAqB,KAC7C9jC,EAAa3T,EAAQy3C,iBACrBpoC,EAAYygC,aAAa/D,GAAuClX,OAAOlhB,MAGvEA,EAAa,EACbtE,EAAYygC,aAAa/D,GAAuCp4B,IAqDpE,SAAS+jC,GAAkBC,GAGzB,OAAIp4C,GAAMo4C,IAA2B,iBAATA,GAAqC,kBAATA,GACtDn1C,IACEY,EAAOmN,KACJ,0GAAyGqQ,KAAKC,UAC7G82B,cACW/2B,KAAKC,iBAAiB82B,QAEhC,KAILA,EAAO,GAAKA,EAAO,KACrBn1C,IACEY,EAAOmN,KAAM,oFAAmFonC,OAC3F,EAGX,CApEOD,CAAkB/jC,GAQlBA,GAiBLtE,EAAYgC,QAAUjU,KAAKyK,SAAY8L,EAIlCtE,EAAYgC,SAUjB7O,IAEEY,EAAOqC,IAAK,sBAAqB4J,EAAYuC,oBAAoBI,GAAW3C,GAAa2E,eACpF3E,IAZL7M,IACEY,EAAOqC,IACJ,oGAAmGovB,OAClGlhB,OAGCtE,KA3BP7M,IACEY,EAAOqC,IACJ,6CACkC,mBAA1BzF,EAAQu3C,cACX,oCACA,+EAIVloC,EAAYgC,SAAU,EACfhC,IAlBP7M,IAAeY,EAAOmN,KAAK,oEAE3BlB,EAAYgC,SAAU,EACfhC,EAuCX,CCvFA,SAASwN,KAIP,MAAMzN,EAFQtV,KAAK0hB,WAEAjD,UAEnB,OAAOnJ,EACH,CACE,eAAgB6C,GAAkB7C,IAEpC,CAAC,CACP,CAiBA,SAASwoC,GAEP1E,EACAv2B,GAGA,MAAMjK,EAAS5Y,KAAKwZ,YACdtT,EAAW0S,GAAUA,EAAOE,cAAiB,CAAC,EAE9CilC,EAAqB73C,EAAQkxC,cAAgB,SAC7C4G,EAA0B5E,EAAmBhC,cAAgB,SAE/D2G,IAAuBC,IACzBt1C,IACEY,EAAOolB,MACJ,iDAAgDsvB,6CAAmED,0EACtEA,4CAIlD3E,EAAmB7hC,SAAU,GAI/B,IAAIhC,EAAc,IAAI4jC,GAAYC,EAAoBp5C,MACtDuV,SAAcgoC,GAAkBhoC,EAAarP,EAAS,CACpDw3C,cAAetE,EAAmBsE,cAClCtE,wBACGv2B,IAEDtN,EAAYyjC,eACdzjC,EAAYqkC,iBAAiB1zC,EAAQ+3C,cAAiB/3C,EAAQ+3C,aAAaC,UAEzEtlC,GAAUA,EAAOU,MACnBV,EAAOU,KAAK,mBAAoB/D,GAE3BA,CACT,CAKA,SAAS4oC,GACPt6B,EACAu1B,EACAsB,EACAC,EACAyD,EACAv7B,EACA+3B,EACAa,GAA6B,GAG7B,MAAM7iC,EAASiL,EAAIrK,YACbtT,EAAW0S,GAAUA,EAAOE,cAAiB,CAAC,EAGpD,IAAIvD,EAAc,IAAI4lC,GACpB/B,EACAv1B,EACA62B,EACAC,EACAC,EACAwD,EACA3C,GAEFlmC,SAAcgoC,GAAkBhoC,EAAarP,EAAS,CACpDw3C,cAAetE,EAAmBsE,cAClCtE,wBACGv2B,IAEDtN,EAAYyjC,eACdzjC,EAAYqkC,iBAAiB1zC,EAAQ+3C,cAAiB/3C,EAAQ+3C,aAAaC,UAEzEtlC,GAAUA,EAAOU,MACnBV,EAAOU,KAAK,mBAAoB/D,GAE3BA,CACT,CHlFA2nC,GAAcmB,IAAM,8BI7BpB,MAAM31C,UAAsBC,iBAAqB,KAAeA,iBCH1D7C,GAAStC,ECFT86C,GAAeA,CACnBv1C,EACAsxB,EACAkkB,KAEA,IAAIC,EACAC,EACJ,OAAQC,IACFrkB,EAAOhwB,OAAS,IACdq0C,GAAeH,KACjBE,EAAQpkB,EAAOhwB,OAASm0C,GAAa,IAMjCC,QAAuBl7C,IAAdi7C,KACXA,EAAYnkB,EAAOhwB,MACnBgwB,EAAOokB,MAAQA,EACf11C,EAASsxB,IAAM,CAIvB,ECgBIskB,GAAqBA,IACrB74C,GAAO84C,wBAEP94C,GAAOkK,cACLA,YAAY6uC,kBAAoB7uC,YAAY6uC,iBAAiB,cAAc,IAzBnCC,MAE9C,MAAMluC,EAAS9K,GAAOkK,YAAYY,OAE5BxE,EAAOtG,GAAOkK,YAAY+uC,WAAW3yC,KAErC4yC,EAAkB,CACtBC,UAAW,aACXtH,UAAW,EACXvrC,KAAc,GAARA,EAAY,eAA0B,IAATA,EAAa,SAAW,YAG7D,UAAW7E,KAAOqJ,EACJ,oBAARrJ,GAAqC,WAARA,IAE/By3C,EAAgBz3C,GAAOjE,KAAKyG,IAAK6G,EAAOrJ,GAAUqJ,EAAOD,gBAAiB,IAG9E,OAAOquC,GAQDF,IAGGh5C,GAAOkK,aAAeA,YAAY6uC,kBAAoB7uC,YAAY6uC,iBAAiB,cAAc,GC7BtGK,GAAqBA,KACzB,MAAMC,EAAWR,KACjB,OAAQQ,GAAYA,EAASC,iBAAoB,GCC7CC,GAAaA,CAACt7C,EAAMsG,KACxB,MAAM80C,EAAWR,KACjB,IAAIW,EAAiB,WAErB,OAAIH,IAEAG,EADEx5C,GAAOgiB,SAASy3B,cAAgBL,KAAuB,EACxC,YAEAC,EAAS/yC,KAAK6B,QAAQ,KAAM,MAI1C,CACLlK,OACAsG,aAAcA,EAAU,KAAc,EAAKA,EAC3Cm1C,OAAQ,OACRf,MAAO,EACPzoC,QAAS,GACT1N,GCjBM,MAAKsH,KAAKC,SAASvM,KAAKm8C,MAAkB,cAAZn8C,KAAKyK,UAAyB,ODkBlEuxC,iBACF,EEjCII,GAAUA,CACdtzC,EACArD,EACA42C,KAEA,IACE,GAAIC,oBAAoBC,oBAAoB70C,SAASoB,GAAO,CAC1D,MAAM0zC,EAAK,IAAIF,oBAAoBG,IACjCh3C,EAASg3C,EAAKC,aAAa,GAE7BF,SAAGJ,QACDr7C,OAAO4oB,OACL,CACE7gB,OACA6zC,UAAU,GAEZN,GAAQ,CAAC,IAGNG,CACT,CACF,OACE,GCZEI,GAAWA,CAACC,EAAIC,KACpB,MAAMC,EAAsB9xC,KACP,aAAfA,EAAMnC,MAA2D,WAApCtG,GAAOgiB,SAAS6X,mBAC/CwgB,EAAG5xC,GACC6xC,IACFtO,oBAAoB,mBAAoBuO,GAAoB,GAC5DvO,oBAAoB,WAAYuO,GAAoB,IAAI,EAI9D3gB,iBAAiB,mBAAoB2gB,GAAoB,GAGzD3gB,iBAAiB,WAAY2gB,GAAoB,EAAI,ECWjDC,GAASC,IACb,MAAMlmB,EAASglB,GAAW,MAAO,GACjC,IAAImB,EAEAC,EAAe,EACfC,EAAiB,GAGrB,MAAMC,EAAiB3qC,IACrBA,EAAQ5N,QAAQw4C,IAETA,EAAMC,iBAQPJ,GAC0B,IAA1BC,EAAeh6C,QACfk6C,EAAMjJ,UARiB+I,EAAeA,EAAeh6C,OAAS,GAQ3BixC,UAAY,KAC/CiJ,EAAMjJ,UAVkB+I,EAAe,GAUH/I,UAAY,KAEhD8I,GAAgBG,EAAMv2C,MACtBq2C,EAAez5C,KAAK25C,KAEpBH,EAAeG,EAAMv2C,MACrBq2C,EAAiB,CAACE,IAKhBH,EAAepmB,EAAOhwB,QACxBgwB,EAAOhwB,MAAQo2C,EACfpmB,EAAOrkB,QAAU0qC,EACbF,GACFA,KAGN,EACD,EAGGV,EAAKJ,GAAQ,eAAgBiB,GACnC,GAAIb,EAAI,CACNU,EAASlC,GAAaiC,EAAUlmB,GAEhC,MAAMymB,EAAgBA,KACpBH,EAAcb,EAAGiB,eACjBP,GAAO,EAAI,EAGbN,UAASY,GAEFA,CACT,GC/EF,IAAIE,IAAkB,EAEtB,MAaMC,GAAuBA,KAGvBD,GAAkB,IAKpBA,GAlByC,WAApCl7C,GAAOgiB,SAAS6X,iBAAiC75B,GAAOgiB,SAASy3B,aAAmB2B,IAAJ,EAKvFhB,GAAS,EAAGiB,gBACVH,GAAkBG,IACjB,IAcI,CACL,mBAAIH,GACF,OAAOA,EACT,ICjBEI,GAASb,IACb,MAAMc,EAAoBJ,KACpB5mB,EAASglB,GAAW,OAE1B,IAAImB,EAEJ,MAAMc,EAAeV,IAEfA,EAAMjJ,UAAY0J,EAAkBL,kBACtC3mB,EAAOhwB,MAAQu2C,EAAMW,gBAAkBX,EAAMjJ,UAC7Ctd,EAAOrkB,QAAQ/O,KAAK25C,GACpBJ,GAAO,GAAI,EAITG,EAAiB3qC,IACpBA,EAAU5N,QAAQk5C,EAAW,EAG1BxB,EAAKJ,GAAQ,cAAeiB,GAClCH,EAASlC,GAAaiC,EAAUlmB,GAE5BylB,GACFI,GAAS,KACPS,EAAcb,EAAGiB,eACjBjB,EAAG0B,YAAW,GACb,EAAI,EClCLC,GAAoB,CAAC,EAQrBC,GAASnB,IACb,MAAMc,EAAoBJ,KACpB5mB,EAASglB,GAAW,OAC1B,IAAImB,EAEJ,MAAMG,EAAiB3qC,IACrB,MAAM2rC,EAAY3rC,EAAQA,EAAQtP,OAAS,GAC3C,GAAIi7C,EAAW,CAKb,MAAMt3C,EAAQ/G,KAAKyG,IAAI43C,EAAUhK,UAAYuH,KAAsB,GAG/D70C,EAAQg3C,EAAkBL,kBAC5B3mB,EAAOhwB,MAAQA,EACfgwB,EAAOrkB,QAAU,CAAC2rC,GAClBnB,IAEJ,GAGIV,EAAKJ,GAAQ,2BAA4BiB,GAE/C,GAAIb,EAAI,CACNU,EAASlC,GAAaiC,EAAUlmB,GAEhC,MAAMymB,EAAgBA,KACfW,GAAkBpnB,EAAO/xB,MAC5Bq4C,EAAcb,EAAGiB,eACjBjB,EAAG0B,aACHC,GAAkBpnB,EAAO/xB,KAAM,EAC/Bk4C,GAAO,GAAI,EAOf,OAAC,UAAW,SAASp4C,QAAQgE,IAC3BszB,iBAAiBtzB,EAAM00C,EAAe,CAAEV,MAAM,EAAMwB,SAAS,GAAM,GAGrE1B,GAASY,GAAe,GAEjBA,CACT,GCvEIlvB,GAAW,CAAC,EACZC,GAAe,CAAC,EAEtB,IAAIgwB,GACAC,GACAC,GAuBJ,SAASC,GACPj5C,EACAk5C,GAAiB,GAEjB,OAAOC,GAAkB,MAAOn5C,EAAUo5C,GAAeJ,GAAcE,EACzE,CAeA,SAASG,GACPh2C,EACArD,GAEA+oB,UAAW1lB,EAAMrD,GAEZ8oB,GAAazlB,KA+EpB,SAASi2C,GAA8Bj2C,GACrC,MAAMlG,EAAU,CAAC,EAGJ,UAATkG,IACFlG,EAAQo8C,kBAAoB,GAG9B5C,GACEtzC,EACA4J,IACEic,GAAgB7lB,EAAM,CAAE4J,WAAS,EAEnC9P,EAEJ,CA7FIm8C,CAA8Bj2C,GAC9BylB,GAAazlB,IAAQ,GAGhBm2C,GAAmBn2C,EAAMrD,EAClC,CAGA,SAASkpB,GAAgB7lB,EAAMiD,GAC7B,MAAM6iB,EAAeN,GAASxlB,GAE9B,GAAK8lB,GAAiBA,EAAaxrB,OAInC,UAAWsM,KAAWkf,EACpB,IACElf,EAAQ3D,EACV,OAAS6C,GACPxJ,IACEY,EAAOolB,MACJ,0DAAyDtiB,YAAe4Z,GAAgBhT,aACzFd,EAEN,CAEJ,CAEA,SAASswC,KACP,OAAOlC,GAAMjmB,IACXpI,GAAgB,MAAO,CACrBoI,WAEFwnB,GAAexnB,GAEnB,CAEA,SAASooB,KACP,OAAOrB,GAAM/mB,IACXpI,GAAgB,MAAO,CACrBoI,WAEFynB,GAAeznB,GAEnB,CAEA,SAAS8nB,KACP,OAAOT,GAAMrnB,IACXpI,GAAgB,MAAO,CACrBoI,WAEF0nB,GAAe1nB,GAEnB,CAEA,SAAS6nB,GACP91C,EACArD,EACAipB,EACA0wB,EACAT,GAAiB,GAIjB,IAAInB,EAEJ,OAJAhvB,GAAW1lB,EAAMrD,GAIZ8oB,GAAazlB,KAChB00C,EAAgB9uB,IAChBH,GAAazlB,IAAQ,GAGnBs2C,GACF35C,EAAS,CAAEsxB,OAAQqoB,IAGdH,GAAmBn2C,EAAMrD,EAAUk5C,EAAiBnB,OAAgBv9C,EAC7E,CAmBA,SAASuuB,GAAW1lB,EAAM4G,GACxB4e,GAASxlB,GAAQwlB,GAASxlB,IAAS,GAClCwlB,GAASxlB,GAAQnF,KAAK+L,EACzB,CAGA,SAASuvC,GACPn2C,EACArD,EACA+3C,GAEA,MAAO,KACDA,GACFA,IAGF,MAAM5uB,EAAeN,GAASxlB,GAE9B,IAAK8lB,EACH,OAGF,MAAM5e,EAAQ4e,EAAaxF,QAAQ3jB,IACrB,IAAVuK,GACF4e,EAAaxK,OAAOpU,EAAO,EAAC,CAGlC,CCrLA,SAASqvC,GAAmBt4C,GAC1B,MAAwB,iBAAVA,GAAsBu4C,SAASv4C,EAC/C,CAUA,SAASw4C,GAAYttC,GAAe2sB,oBAAmBlhC,IAErD,OAAIkhC,GAAkB3sB,EAAY2sB,eAAiBA,IAEjD3sB,EAAY2sB,eAAiBA,GAIxB3sB,EAAY6/B,WAAW,CAC5BlT,oBACGlhC,GAEP,CCnBA,MAAM8hD,GAAmB,WAMzB,SAASC,GAAQC,GACf,OAAOA,EAAO,GAChB,CAEA,SAASC,KAEP,OAAOn9C,IAAUA,GAAO45B,kBAAoB55B,GAAOkK,WACrD,CAEA,IAGIkzC,GACAC,GAJAC,GAAqB,EAErB/J,GAAgB,CAAC,EAuSrB,SAASgK,GACP9tC,EAEAqrC,EACAryC,EACA2B,EACAgK,EACAopC,GAEA,MAAM93B,EAAM83B,EAAY1C,EAAM0C,GAAe1C,EAAO,GAAEryC,QAChDg1C,EAAQ3C,EAAO,GAAEryC,WAClBg1C,IAAU/3B,GAGfq3B,GAAYttC,EAAa,CACvBuC,GAAI,UACJG,OAAQ,+BACRiC,YAAaA,GAAe3L,EAC5B2zB,eAAgBhyB,EAAa6yC,GAAQQ,GACrC5gB,aAAczyB,EAAa6yC,GAAQv3B,IAEvC,CAiKA,SAASg4B,GACPn0C,EACAuxC,EACAr5C,EACAk8C,GAEA,MAAMC,EAAW9C,EAAMr5C,GACP,MAAZm8C,GAAoBA,EAAWZ,KACjCzzC,EAAKo0C,GAAWC,EAEpB,CClWA,SAASC,GAAkBjwC,GACzB,IAAKypC,KACH,OAGF,MAAMn8C,EAuFR,SAAS4iD,GAAiBlwC,GACxB,GAAIA,EAAQikC,UAAW,CACrB,MAAM32C,EAAM,IAAK0S,GACjB1S,SAAIkhC,eAAiB7pB,GAAuB3E,EAAQikC,kBAC7C32C,EAAI22C,UACJ32C,CACT,CAEA,OAAO0S,CACT,CAhGckwC,CAAiBlwC,GAEvBmQ,EAAMI,KACN4/B,EAAanwC,EAAQmF,MAEvBnF,EAAQmF,MAAM4F,UAYpB,SAASqlC,KAEP,OAAOrqC,KAAkBgF,SAC3B,CAdMqlC,GACJ,OAAOD,EAEHA,EAAWzO,WAAWp0C,GAEtB6iB,EAAIjB,iBAAiB5hB,EAC3B,CCxKA,MAAM+iD,GAAoC,CAAC,YAAa,aAIlDC,GAAuC,CAC3CC,YAAY,EACZC,UAAU,EACVC,mBAAmB,EAEnBC,eAAgBL,GAChBM,wBAAyBN,IAI3B,SAASO,GAA2B5tB,GAClC,MACEutB,aACAC,WAEAG,0BAEAD,iBACAG,6BACAJ,qBACE,CACFF,WAAYD,GAAqCC,WACjDC,SAAUF,GAAqCE,YAC5CxtB,GAGC8tB,EACkC,mBAA/BD,EAA4CA,EAA8BnzC,IAAM,EAKnFqzC,EAAkCt7B,GA4H1C,SAASu7B,GAAoBv7B,EAAKk7B,GAChC,OAAO95C,GAAyB4e,EAAKk7B,GAA2BN,GAClE,CA7HIW,CAAoBv7B,EAAKk7B,GAA2BD,GAEhDn5B,EAAQ,CAAC,EAEXg5B,GACF7gB,GAA+BkB,IAC7B,MAAMqgB,EC1CZ,SAASC,GACPtgB,EACAkgB,EACAE,EACAz5B,EACA45B,EAAa,qBAEb,IAAK1H,OAAwB7Y,EAAYC,UACvC,OAGF,MAAMugB,EAAyBN,EAAiBlgB,EAAYC,UAAUpb,KAEtE,GAAImb,EAAY3B,cAAgBmiB,EAAwB,CACtD,MAAMztC,EAASitB,EAAYC,UAAUwgB,OACrC,IAAK1tC,EAAQ,OAEb,MAAM/B,EAAO2V,EAAM5T,GACnB,GAAI/B,EAAM,CACR,GAAIgvB,EAAYE,SAAU,CACxBlvB,EAAK6iC,cAAc7T,EAAYE,SAAStwB,QAExC,MAAM8wC,GACJ1gB,EAAYE,UAAYF,EAAYE,SAASnR,SAAWiR,EAAYE,SAASnR,QAAQ9lB,IAAI,kBAE3F,GAAIy3C,GAAe,CACjB,MAAMC,GAAmBx0B,SAASu0B,IAC9BC,GAAmB,GACrB3vC,EAAK0gC,aAAa,+BAAgCiP,GAEtD,CACF,MAAW3gB,EAAY5V,OACrBpZ,EAAK4iC,UAAU,kBAEjB5iC,EAAKkW,aAGEP,EAAM5T,EACf,CACA,MACF,CAEA,MAAMwB,EAAQY,KACRb,EAASY,MAEPgK,SAAQ2F,OAAQmb,EAAYC,UAE9BjvB,EAAOwvC,EACTnB,GAAkB,CAChB1O,WAAY,CACV9rB,MACA/c,KAAM,QACN,cAAeoX,GAEjBzf,KAAO,GAAEyf,KAAU2F,IACnBrR,GAAI,cACJG,OAAQ4sC,SAEVthD,EAOJ,GALI+R,IACFgvB,EAAYC,UAAUwgB,OAASzvC,EAAKuC,cAAcR,OAClD4T,EAAM3V,EAAKuC,cAAcR,QAAU/B,GAGjCovC,EAAoBpgB,EAAYC,UAAUpb,MAAQvQ,EAAQ,CAC5D,MAAMsQ,EAAUob,EAAY16B,KAAK,GAGjC06B,EAAY16B,KAAK,GAAK06B,EAAY16B,KAAK,IAAM,CAAC,EAG9C,MAAM1D,EAAUo+B,EAAY16B,KAAK,GAGjC1D,EAAQmtB,QASZ,SAAS6xB,GACPh8B,EACAtQ,EACAC,EACA3S,EAGAi/C,GAGA,MAAM7vC,EAAO6vC,GAAetsC,EAAM4F,UAE5BlJ,EAAcD,GAAQD,EAAYC,IAEhC8B,UAASG,UAAS8B,OAAQR,EAAMqH,wBAElCklC,EAAoB9vC,EAAO6C,GAAkB7C,GAAQ6B,EAA0BC,OAAS7T,EAAWgU,GAOnG8tC,EAAsBzvC,GANGL,EAC3BgE,GAAkChE,GAClC8D,GAEEV,GAAoCvB,EAASwB,EAAQC,IAIrDwa,GACJntB,EAAQmtB,iBACA5B,QAAY,KAAe9sB,GAAaukB,EAASuI,SAAYvI,EAAUmK,aAAU9vB,GAE3F,GAAK8vB,GAEE,WAAW7B,QAAY,KAAe7sB,GAAa0uB,GAAS7B,SAAU,CAC3E,MAAM8zB,GAAa,IAAI9zB,QAAQ6B,IAE/BiyB,UAAWlxB,OAAO,eAAgBgxB,GAE9BC,GAGFC,GAAWlxB,OAAO5e,EAAqB6vC,GAGlCC,EACT,IAAWz+C,MAAMC,QAAQusB,IAAU,CACjC,MAAMiyB,GAAa,IAAIjyB,GAAS,CAAC,eAAgB+xB,IAEjD,OAAIC,GAGFC,GAAWr+C,KAAK,CAACuO,EAAqB6vC,IAGjCC,EACT,CAAO,CACL,MAAMC,GAAwB,YAAalyB,GAAUA,GAAQmyB,aAAUjiD,EACjEkiD,GAAoB,GAE1B,OAAI5+C,MAAMC,QAAQy+C,IAChBE,GAAkBx+C,QAAQs+C,IACjBA,IACTE,GAAkBx+C,KAAKs+C,IAGrBF,GACFI,GAAkBx+C,KAAKo+C,GAGlB,IACDhyB,GACJ,eAAgB+xB,EAChBI,QAASC,GAAkB/+C,OAAS,EAAI++C,GAAkBr+C,KAAK,UAAO7D,EAE1E,EA1CE,MAAO,CAAE,eAAgB6hD,EAAmBI,QAASH,EA2CzD,CAlFsBH,CAAgCh8B,EAAStQ,EAAQC,EAAO3S,EAASoP,EACrF,CAEA,OAAOA,CACT,CDrC0BsvC,CAAuBtgB,EAAakgB,EAAkBC,EAAgCx5B,GACtGk5B,GAAqBQ,GACvBe,GAAef,EAAW,GAK5BT,GACFriB,EAA6ByC,IAC3B,MAAMqgB,EAsHZ,SAASgB,GACPrhB,EACAkgB,EACAE,EACAz5B,GAEA,MAAM2X,EAAM0B,EAAY1B,IAClBM,EAAgBN,GAAOA,EAAIhB,GAEjC,IAAKub,OAAwBva,GAAOA,EAAIN,yBAA2BY,EACjE,OAGF,MAAM4hB,EAAyBN,EAAiBthB,EAAc/Z,KAG9D,GAAImb,EAAY3B,cAAgBmiB,EAAwB,CACtD,MAAMztC,EAASurB,EAAIgjB,uBACnB,IAAKvuC,EAAQ,OAEb,MAAM/B,EAAO2V,EAAM5T,GAQnB,YAPI/B,QAAsC/R,IAA9B2/B,EAAcR,cACxBptB,EAAK6iC,cAAcjV,EAAcR,aACjCptB,EAAKkW,aAGEP,EAAM5T,IAGjB,CAEA,MAAMwB,EAAQY,KAERnE,EAAOwvC,EACTnB,GAAkB,CAChB1O,WAAY,CACV7oC,KAAM,MACN,cAAe82B,EAAc1f,OAC7B2F,IAAK+Z,EAAc/Z,KAErBplB,KAAO,GAAEm/B,EAAc1f,UAAU0f,EAAc/Z,MAC/CrR,GAAI,cACJG,OAAQ,2BAEV1U,EAOJ,GALI+R,IACFstB,EAAIgjB,uBAAyBtwC,EAAKuC,cAAcR,OAChD4T,EAAM2X,EAAIgjB,wBAA0BtwC,GAGlCstB,EAAIwN,kBAAoBsU,EAAoBxhB,EAAc/Z,KAC5D,GAAI7T,EAAM,CACR,MAAMC,EAAcD,GAAQD,EAAYC,GAElC+vC,EAAsBzvC,GADGL,GAAegE,GAAkChE,IAEhFswC,GAAejjB,EAAKzqB,GAAkB7C,GAAO+vC,EAC/C,KAAO,CACL,MAAMzsC,EAASY,MACPpC,UAASG,UAAS8B,OAAQR,EAAMqH,wBAKxC2lC,GAAejjB,EAJWzrB,EAA0BC,OAAS7T,EAAWgU,GAG5C3B,GAD1ByD,IAAQT,EAASD,GAAoCvB,EAASwB,EAAQC,QAAStV,IAGnF,CAGF,OAAO+R,CACT,CA3L0BqwC,CAAYrhB,EAAakgB,EAAkBC,EAAgCx5B,GAC3Fk5B,GAAqBQ,GACvBe,GAAef,EAAW,EAIlC,CAiBA,SAASe,GAAepwC,GACtB,MAAQ6T,OAAQjR,GAAW5C,GAAMjG,MAAQ,CAAC,EAE1C,IAAK8Z,GAAsB,iBAARA,EACjB,OAGF,MAAM28B,EAAU1D,GAAqC,WAAY,EAAGpsC,cAClEA,EAAQ5N,QAAQw4C,KAvBpB,SAASmF,GAA4BnF,GACnC,MACsB,aAApBA,EAAM3B,WACN,kBAAmB2B,GACiB,iBAA5BA,EAAQoF,kBACS,UAAxBpF,EAAMqF,eAAqD,mBAAxBrF,EAAMqF,cAE9C,EAiBUF,CAA4BnF,IAAUA,EAAM78C,KAAKmiD,SAAS/8B,KA8CpE,SAASg9B,GAA8BC,GACrC,MAAQriD,OAAMsd,WA9BhB,SAASglC,GAAuBL,GAC9B,IAAIjiD,EAAO,UACPsd,EAAU,UACVg2B,EAAQ,GACZ,UAAWiP,KAAQN,EAAiB,CAElC,GAAa,MAATM,EAAc,EACfviD,EAAMsd,GAAW2kC,EAAgBz9C,MAAM,KACxC,KACF,CAEA,IAAK9C,MAAMs1B,OAAOurB,IAAQ,CACxBviD,EAAiB,MAAVszC,EAAgB,OAASA,EAChCh2B,EAAU2kC,EAAgBz9C,MAAM8uC,GAAO,GACvC,KACF,CACAA,GAASiP,CACX,CACA,OAAIjP,IAAU2O,IAEZjiD,EAAOszC,GAEF,CAAEtzC,OAAMsd,UACjB,CAO4BglC,CAAuBD,EAAeJ,iBAE1DO,EAAiB,GAIvB,OAFAA,EAAet/C,KAAK,CAAC,2BAA4Boa,GAAU,CAAC,wBAAyBtd,IAEhFqM,GAGE,IACFm2C,EACH,CAAC,8BAA+BC,GAAgBJ,EAAeK,gBAC/D,CAAC,2BAA4BD,GAAgBJ,EAAeM,aAC5D,CAAC,mCAAoCF,GAAgBJ,EAAeO,oBACpE,CAAC,iCAAkCH,GAAgBJ,EAAeQ,kBAClE,CAAC,6BAA8BJ,GAAgBJ,EAAeS,eAC9D,CAAC,uCAAwCL,GAAgBJ,EAAeU,wBACxE,CAAC,8BAA+BN,GAAgBJ,EAAeW,aAC/D,CAAC,6BAA8BP,GAAgBJ,EAAeY,eAC9D,CAAC,8BAA+BR,GAAgBJ,EAAea,gBAC/D,CAAC,4BAA6BT,GAAgBJ,EAAec,eAbtDX,CAeX,CApEyBJ,CAA8BvF,GACtCx4C,QAAQiH,GAAQiG,EAAK0gC,gBAAgB3mC,IAG9CgwB,WAAWymB,GAAO,EAErB,EAEL,CAiCA,SAASU,GAAgBxD,EAAO,GAC9B,QAAS5yC,IAAgCJ,YAAYE,YAAc8yC,GAAQ,GAC7E,CAiHA,SAAS6C,GACPjjB,EACAwiB,EACAC,GAEA,IAEEziB,EAAIwN,iBAAiB,eAAgBgV,GACjCC,GAKFziB,EAAIwN,iBAAiB56B,EAAqB6vC,EAE9C,OACE,CAEJ,CEjQA,MAIM8B,GAAkC,IACnC1M,GACH2M,4BAA4B,EAC5BC,uBCTF,SAASC,GACPC,EACAC,GAA6B,EAC7BC,GAAmC,GAEnC,IAAK3hD,KAAWA,GAAOotB,SAErB,YADAxqB,IAAeY,EAAOmN,KAAK,yEAI7B,IAEIu+B,EAFA0S,EAAc5hD,GAAOotB,SAASC,KAG9Bq0B,IACFxS,EAAoBuS,EAAuB,CACzCxjD,KAAM+B,GAAOotB,SAASy0B,SAEtBzlB,eAAgB9xB,GAA+BA,GAA+B,SAAO7M,EACrFuU,GAAI,WACJG,OAAQ,wBACR8B,SAAU,CAAE7O,OAAQ,UAIpBu8C,GACFr1B,GAAiC,EAAGa,KAAIvN,gBAUzBniB,IAATmiB,GAAsBgiC,IAA2C,IAA5BA,EAAYh7B,QAAQuG,GAC3Dy0B,OAAcnkD,EAIZmiB,IAASuN,IACXy0B,OAAcnkD,EACVyxC,IACFtsC,IAAeY,EAAOqC,IAAK,oDAAmDqpC,EAAkBl9B,MAEhGk9B,EAAkBxpB,OAEpBwpB,EAAoBuS,EAAuB,CACzCxjD,KAAM+B,GAAOotB,SAASy0B,SACtB7vC,GAAI,aACJG,OAAQ,0BACR8B,SAAU,CAAE7O,OAAQ,SACrB,EAIT,ED9CEu8C,kCAAkC,EAClCD,4BAA4B,EAC5BI,gBAAgB,EAChB3J,aAAc,CAAC,KACZ+F,IAyTL,SAAS6D,GAAeC,GAItB,MAAMC,EpGxLR,SAASC,GAAcC,GACrB,OAAIniD,GAAOgiB,UAAYhiB,GAAOgiB,SAASogC,cAC9BpiD,GAAOgiB,SAASogC,cAAcD,GAEhC,IACT,CoGmLkBD,CAAe,aAAYF,MAE3C,OAAOC,EAAUA,EAAQ7/C,aAAa,gBAAa3E,CACrD,iBE3UA,SAAS4kD,GAAeC,GACtB,IAAIC,EACAh+C,EAAQ+9C,EAAI,GACZ3gD,EAAI,EACR,KAAOA,EAAI2gD,EAAI1hD,QAAQ,CACrB,MAAMoR,EAAKswC,EAAI3gD,GACTwe,EAAKmiC,EAAI3gD,EAAI,GAGnB,GAFAA,GAAK,GAEO,mBAAPqQ,GAAkC,iBAAPA,IAAmC,MAATzN,EAExD,OAES,WAAPyN,GAA0B,mBAAPA,GACrBuwC,EAAgBh+C,EAChBA,EAAQ4b,EAAG5b,KACK,SAAPyN,GAAwB,iBAAPA,KAC1BzN,EAAQ4b,EAAG,IAAIrc,IAAUS,EAAQ3F,KAAK2jD,KAAkBz+C,IACxDy+C,OAAgB9kD,EAEpB,CACA,OAAO8G,CACT,CCFA,SAASi+C,GAAoBx+C,GAC3B,MAA+B,MAAxBA,EAAIA,EAAIpD,OAAS,GAAaoD,EAAIE,MAAM,GAAG,GAAMF,CAC1D,iBC1BA,SAASy+C,KAEP,cAAc7kD,OAAW,QAAgB,EAAC8kD,UAI5C,SAASC,KACP,YAE4BllD,IAAzBC,EAAaklD,SAA2D,aAAhCllD,EAAaklD,QAAUt8C,IAEpE,CAT2Dq8C,GAC3D,CCAA,MAAM3iD,GAAStC,EAETmlD,GAAqB,sBACrBC,GAAoB,eACpBC,GAAwB,wBAiBxBC,GAAsB,IACtBC,GAAkB,EAGlBC,GAAwB,KAWxBC,GAA+B,IAUgE,SAASC,GAAiBd,GAAO,IAAIC,EAA+Bh+C,EAAQ+9C,EAAI,GAAQ3gD,EAAI,EAAG,KAAOA,EAAI2gD,EAAI1hD,QAAQ,CAAE,MAAMoR,EAAKswC,EAAI3gD,GAAUwe,EAAKmiC,EAAI3gD,EAAI,GAAY,GAARA,GAAK,GAAe,mBAAPqQ,GAAkC,iBAAPA,IAAmC,MAATzN,EAAiB,OAA+B,WAAPyN,GAA0B,mBAAPA,GAA2BuwC,EAAgBh+C,EAAOA,EAAQ4b,EAAG5b,KAA0B,SAAPyN,GAAwB,iBAAPA,KAAyBzN,EAAQ4b,EAAG,IAAIrc,IAASS,EAAM3F,KAAK2jD,KAAkBz+C,IAAQy+C,OAAgB9kD,EAAa,CAAE,OAAO8G,CAAO,CAAC,IAAI8+C,GAC7mB,SAAUC,GACPA,SAASA,EAASC,SAAc,GAAK,WACrCD,EAASA,EAASE,aAAkB,GAAK,eACzCF,EAASA,EAASz8C,QAAa,GAAK,UACpCy8C,EAASA,EAASG,KAAU,GAAK,OACjCH,EAASA,EAASI,MAAW,GAAK,QAClCJ,EAASA,EAASK,QAAa,GAAK,UAN7BL,CAOX,CAPC,CAOED,IAA4B,CAAC,GAKhC,SAASO,GAAaC,GAClB,MAAMn6B,EAAO05B,GAAiB,CAACS,EAAG,iBAAkBv4C,GAAKA,EAAEoe,OAC3D,OAAe05B,GAAiB,CAAC15B,EAAM,iBAAkBo6B,GAAMA,EAAGC,eAAiBF,CACvF,CACA,SAASG,GAAkBD,GACvB,MAAsD,wBAA/CxlD,OAAOC,UAAUC,SAASG,KAAKmlD,EAC1C,CA2BA,SAASE,GAAoBC,GACzB,IACI,MAAMC,EAAQD,EAAEC,OAASD,EAAEE,SAC3B,OAAOD,EA7Bf,SAASE,GAAmCC,GACxC,OAAIA,EAAQp/C,SAAS,6BAChBo/C,EAAQp/C,SAAS,qCAClBo/C,EAAUA,EAAQn8C,QAAQ,0BAA2B,2DAElDm8C,CACX,CAwBcD,CAAmCtjD,MAAM6e,KAAKukC,EAAOI,IAAejjD,KAAK,KACzE,IACV,OAEI,OAAO,IACX,CACJ,CACA,SAASijD,GAAcC,GACnB,IAAIC,EACJ,GAkBJ,SAASC,GAAgBF,GACrB,MAAO,eAAgBA,CAC3B,CApBQE,CAAgBF,GAChB,IACIC,EACIR,GAAoBO,EAAKG,aAnCzC,SAASC,GAAsBJ,GAC3B,MAAQF,WAAYE,EACpB,GAAIF,EAAQ7hD,MAAM,KAAK7B,OAAS,EAC5B,OAAO0jD,EACX,MAAMO,EAAY,CAAC,UAAY,OAAM7jC,KAAKC,UAAUujC,EAAKn3B,UACzD,MAAuB,KAAnBm3B,EAAKM,UACLD,EAAU1jD,KAAM,SAEXqjD,EAAKM,WACVD,EAAU1jD,KAAM,SAAQqjD,EAAKM,cAE7BN,EAAKO,cACLF,EAAU1jD,KAAM,YAAWqjD,EAAKO,iBAEhCP,EAAKQ,MAAMpkD,QACXikD,EAAU1jD,KAAKqjD,EAAKQ,MAAMC,WAEvBJ,EAAUvjD,KAAK,KAAO,GACjC,CAkBoBsjD,CAAsBJ,EAClC,OAEA,SAcR,SAASU,GAAeV,GACpB,MAAO,iBAAkBA,CAC7B,CAdaU,CAAeV,IAASA,EAAKW,aAAajgD,SAAS,KACxD,OAIR,SAASkgD,GAAgBC,GAErB,OAAOA,EAAel9C,QADR,uCACuB,SACzC,CAPei9C,CAAgBZ,EAAKF,SAEhC,OAAOG,GAAqBD,EAAKF,OACrC,CAWA,MAAMgB,GACFrrD,cACIC,KAAKqrD,UAAY,IAAIn+C,IACrBlN,KAAKsrD,YAAc,IAAIpgC,OAC3B,CACAqgC,MAAM5B,GACF,OAAKA,EAzFb,SAAS6B,GAAmBC,EAAKC,GAAS,OAAID,GAA2CC,GAAW,CA4FrFF,CADItC,GAAiB,CAAClpD,KAAM,SAAU2rD,GAAMA,EAAGC,QAAS,OAAQC,GAAMA,EAAGlC,GAAI,iBAAkBmC,GAAMA,EAAGxjD,KACjF,KAAQ,IAF3B,CAGf,CACAyjD,QAAQzjD,GACJ,OAAOtI,KAAKqrD,UAAU99C,IAAIjF,IAAO,IACrC,CACA0jD,SACI,OAAOnlD,MAAM6e,KAAK1lB,KAAKqrD,UAAUliD,OACrC,CACAyiD,QAAQjC,GACJ,OAAO3pD,KAAKsrD,YAAY/9C,IAAIo8C,IAAM,IACtC,CACAsC,kBAAkBtC,GACd,MAAMrhD,EAAKtI,KAAKurD,MAAM5B,GACtB3pD,KAAKqrD,UAAU5jC,OAAOnf,GAClBqhD,EAAEuC,YACFvC,EAAEuC,WAAW9jD,QAAS+jD,GAAcnsD,KAAKisD,kBAAkBE,GAEnE,CACA7kC,IAAIhf,GACA,OAAOtI,KAAKqrD,UAAU/jC,IAAIhf,EAC9B,CACA8jD,QAAQC,GACJ,OAAOrsD,KAAKsrD,YAAYhkC,IAAI+kC,EAChC,CACA9kC,IAAIoiC,EAAG2C,GAEHtsD,KAAKqrD,UAAU59C,IADJ6+C,EAAKhkD,GACOqhD,GACvB3pD,KAAKsrD,YAAY79C,IAAIk8C,EAAG2C,EAC5B,CACAr+C,QAAQ3F,EAAIqhD,GACR,MAAM4C,EAAUvsD,KAAK+rD,QAAQzjD,GAC7B,GAAIikD,EAAS,CACT,MAAMD,EAAOtsD,KAAKsrD,YAAY/9C,IAAIg/C,GAC9BD,GACAtsD,KAAKsrD,YAAY79C,IAAIk8C,EAAG2C,EAChC,CACAtsD,KAAKqrD,UAAU59C,IAAInF,EAAIqhD,EAC3B,CACA6C,QACIxsD,KAAKqrD,UAAY,IAAIn+C,IACrBlN,KAAKsrD,YAAc,IAAIpgC,OAC3B,EAKJ,SAASuhC,IAAkBC,mBAAkBhlD,UAAS0E,SAClD,MAAgB,WAAZ1E,IACAA,EAAU,aAECglD,EAAiBhlD,EAAQI,gBACnCsE,GAAQsgD,EAAiBtgD,IACjB,aAATA,GACa,UAAZ1E,IAAwB0E,GAAQsgD,EAAiBC,KAC1D,CACA,SAASC,IAAiBC,WAAUpnB,UAASp7B,QAAOyiD,gBAChD,IAAIH,EAAOtiD,GAAS,GACpB,OAAKwiD,GAGDC,IACAH,EAAOG,EAAYH,EAAMlnB,IAEtB,IAAIsnB,OAAOJ,EAAKjmD,SALZimD,CAMf,CACA,SAAS7kD,GAAYgC,GACjB,OAAOA,EAAIhC,aACf,CACA,SAASq6B,GAAYr4B,GACjB,OAAOA,EAAIq4B,aACf,CACA,MAAM6qB,GAA0B,qBAmBhC,SAASC,GAAaxnB,GAClB,MAAMr5B,EAAOq5B,EAAQr5B,KACrB,OAAOq5B,EAAQynB,aAAa,uBACtB,WACA9gD,EAEMtE,GAAYsE,GACd,IACd,CACA,SAAS+gD,GAAc9lD,EAAIK,EAAS0E,GAChC,MAAgB,UAAZ1E,GAAiC,UAAT0E,GAA6B,aAATA,EAGzC/E,EAAGgD,MAFChD,EAAGa,aAAa,UAAY,EAG3C,CAEA,IAAIklD,GAAM,EACV,MAAMC,GAAe,IAAIn2C,OAAO,gBAC1Bo2C,IAAe,EACrB,SAASC,KACL,OAAOH,IACX,CAsBA,IAAII,GACAC,GACJ,MAAMC,GAAiB,6CACjBC,GAAqB,sBACrBC,GAAgB,YAChBC,GAAW,wBACjB,SAASC,GAAqB1D,EAASj3B,GACnC,OAAQi3B,GAAW,IAAIn8C,QAAQy/C,GAAgB,CAACz1C,EAAQ81C,EAAQC,EAAOC,EAAQC,EAAOC,KAClF,MAAMC,EAAWJ,GAASE,GAASC,EAC7BE,EAAaN,GAAUE,GAAU,GACvC,IAAKG,EACD,OAAOn2C,EAEX,GAAI01C,GAAmB5iD,KAAKqjD,IAAaR,GAAc7iD,KAAKqjD,GACxD,MAAQ,OAAMC,IAAaD,IAAWC,KAE1C,GAAIR,GAAS9iD,KAAKqjD,GACd,MAAQ,OAAMC,IAAaD,IAAWC,KAE1C,GAAoB,MAAhBD,EAAS,GACT,MAAQ,OAAMC,IA/B1B,SAASC,GAAcnlC,GACnB,IAAIlR,EAAS,GACb,OACIA,EADAkR,EAAIuD,QAAQ,OAAQ,EACXvD,EAAI5gB,MAAM,KAAKyB,MAAM,EAAG,GAAG5C,KAAK,KAGhC+hB,EAAI5gB,MAAM,KAAK,GAE5B0P,EAASA,EAAO1P,MAAM,KAAK,GACpB0P,CACX,CAqBuCq2C,CAAcn7B,GAAQi7B,IAAWC,KAEhE,MAAMpiD,EAAQknB,EAAK5qB,MAAM,KACnB4rB,EAAQi6B,EAAS7lD,MAAM,KAC7B0D,EAAM4V,MACN,UAAWi0B,KAAQ3hB,EACF,MAAT2hB,IAGc,OAATA,EACL7pC,EAAM4V,MAGN5V,EAAMhF,KAAK6uC,IAGnB,MAAQ,OAAMuY,IAAapiD,EAAM7E,KAAK,OAAOinD,IAAW,EAEhE,CACA,MAAME,GAAoB,qBACpBC,GAA0B,qBA2DhC,SAASC,GAAchrB,EAAKirB,GACxB,IAAKA,GAA4C,KAA1BA,EAAe13C,OAClC,OAAO03C,EAEX,MAAM7pC,EAAI4e,EAAIC,cAAc,KAC5B7e,SAAEsO,KAAOu7B,EACF7pC,EAAEsO,IACb,CACA,SAASw7B,GAAatnD,GAClB,QAA8B,QAAfA,EAAGK,UAAqBL,EAAGunD,gBAC9C,CACA,SAASC,KACL,MAAMhqC,EAAIiD,SAAS4b,cAAc,KACjC7e,SAAEsO,KAAO,GACFtO,EAAEsO,IACb,CACA,SAAS27B,GAAmBrrB,EAAK/7B,EAAS3D,EAAMsG,EAAOo7B,EAASspB,GAC5D,OAAK1kD,IAGQ,QAATtG,GACU,SAATA,IAAiC,QAAZ2D,GAAkC,MAAb2C,EAAM,KAGnC,eAATtG,GAAsC,MAAbsG,EAAM,IAGtB,eAATtG,IACQ,UAAZ2D,GAAmC,OAAZA,GAAgC,OAAZA,GANrC+mD,GAAchrB,EAAKp5B,GASZ,WAATtG,EAzFb,SAASirD,GAAwBvrB,EAAKirB,GAClC,GAA8B,KAA1BA,EAAe13C,OACf,OAAO03C,EAEX,IAAIO,EAAM,EACV,SAASC,EAAkBC,GACvB,IAAIC,EACJ,MAAM/pC,EAAQ8pC,EAAMj/B,KAAKw+B,EAAep3C,UAAU23C,IAClD,OAAI5pC,GACA+pC,EAAQ/pC,EAAM,GACd4pC,GAAOG,EAAM1oD,OACN0oD,GAEJ,EACX,CACA,MAAMhlD,EAAS,GACf,KACI8kD,EAAkBV,MACdS,GAAOP,EAAehoD,SAFjB,CAKT,IAAIyiB,EAAM+lC,EAAkBX,IAC5B,GAAsB,MAAlBplC,EAAInf,OAAM,GACVmf,EAAMslC,GAAchrB,EAAKta,EAAI7R,UAAU,EAAG6R,EAAIziB,OAAS,IACvD0D,EAAOnD,KAAKkiB,OAEX,CACD,IAAIkmC,EAAiB,GACrBlmC,EAAMslC,GAAchrB,EAAKta,GACzB,IAAImmC,GAAW,EACf,OAAa,CACT,MAAMjhD,EAAIqgD,EAAea,OAAON,GAChC,GAAU,KAAN5gD,EAAU,CACVjE,EAAOnD,MAAMkiB,EAAMkmC,GAAgBr4C,QACnC,KACJ,IACUs4C,EAWI,MAANjhD,IACAihD,GAAW,WAXL,MAANjhD,EAAW,CACX4gD,GAAO,EACP7kD,EAAOnD,MAAMkiB,EAAMkmC,GAAgBr4C,QACnC,KACJ,CACe,MAAN3I,IACLihD,GAAW,GAQnBD,GAAkBhhD,EAClB4gD,GAAO,CACX,CACJ,CACJ,CACA,OAAO7kD,EAAOhD,KAAK,KACvB,CAiCe4nD,CAAwBvrB,EAAKp5B,GAEtB,UAATtG,EACE+pD,GAAqBzjD,EAAOwkD,MAElB,WAAZnnD,GAAiC,SAAT3D,EACtB0qD,GAAchrB,EAAKp5B,GAEC,mBAApB0kD,EACAA,EAAgBhrD,EAAMsG,EAAOo7B,GAEjCp7B,EACX,CACA,SAASmlD,GAAgB9nD,EAAS3D,EAAM+O,GACpC,OAAoB,UAAZpL,GAAmC,UAAZA,IAAiC,aAAT3D,CAC3D,CAoCA,SAAS0rD,GAAgBpD,EAAMqD,EAAgB9lB,EAAQsX,IAAUyO,EAAW,GAKxE,OAJKtD,GAEDA,EAAKuD,WAAavD,EAAKwD,cAEvBF,EAAW/lB,GACJ,EACP8lB,EAAerD,GACRsD,EACJF,GAAgBpD,EAAKnlD,WAAYwoD,EAAgB9lB,EAAO+lB,EAAW,EAC9E,CACA,SAASG,GAAqBhrD,EAAWmjD,GACrC,OAAQoE,IACJ,MAAMhlD,EAAKglD,EACX,GAAW,OAAPhlD,EACA,OAAO,EACX,IACI,GAAIvC,EACA,GAAyB,iBAAdA,GACP,GAAIuC,EAAG0oD,QAAS,IAAGjrD,KACf,OAAO,UA7B/B,SAASkrD,GAAyB3oD,EAAI4oD,GAClC,QAASC,EAAS7oD,EAAG8oD,UAAUzpD,OAAQwpD,KAEnC,GAAID,EAAMllD,KADQ1D,EAAG8oD,UAAUD,IAE3B,OAAO,EAGf,OAAO,CACX,CAuByBF,CAAyB3oD,EAAIvC,GAClC,OAAO,EAGf,SAAImjD,IAAY5gD,EAAG0oD,QAAQ9H,GAG/B,OAEI,OAAO,CACX,EAER,CACA,SAASmI,GAAgB/D,EAAMgE,EAAeC,EAAkBC,EAAiBC,EAAoBC,GACjG,IACI,MAAMppD,EAAKglD,EAAKuD,WAAavD,EAAKwD,aAC5BxD,EACAA,EAAKqE,cACX,GAAW,OAAPrpD,EACA,OAAO,EACX,IAAIspD,GAAe,EACfC,GAAiB,EACrB,GAAIH,EAAa,CAEb,GADAG,EAAiBnB,GAAgBpoD,EAAIyoD,GAAqBS,EAAiBC,IACvEI,EAAiB,EACjB,OAAO,EAEXD,EAAelB,GAAgBpoD,EAAIyoD,GAAqBO,EAAeC,GAAmBM,GAAkB,EAAIA,EAAiB1P,IACrI,KACK,CAED,GADAyP,EAAelB,GAAgBpoD,EAAIyoD,GAAqBO,EAAeC,IACnEK,EAAe,EACf,OAAO,EAEXC,EAAiBnB,GAAgBpoD,EAAIyoD,GAAqBS,EAAiBC,GAAqBG,GAAgB,EAAIA,EAAezP,IACvI,CACA,OAAOyP,GAAgB,IACjBC,GAAkB,IACdD,GAAgBC,IAEpBA,GAAkB,IAEZH,EAChB,OAEA,CACA,QAASA,CACb,CAkWA,SAASI,GAAcC,GACnB,OAA6C,MAAdA,EACpB,GAGAA,EAAUhpD,aAEzB,CAyEA,SAASipD,GAAoBpH,EAAGzjD,GAC5B,MAAQu9B,MAAKutB,SAAQC,aAAYC,gBAAeC,kBAAiBV,cAAaJ,gBAAeE,kBAAiBD,mBAAkBE,qBAAoBY,aAAY,EAAOC,qBAAmB,EAAM3E,oBAAmB,CAAC,EAAGqC,mBAAiBuC,cAAYxE,eAAayE,kBAAgBC,kBAAiB,CAAC,EAAGC,iBAAe,EAAOC,iBAAe,EAAOC,eAAaC,gBAAcC,qBAAoB,IAAMC,oBAAkBC,yBAAwB,IAAMC,mBAAkBA,MAAM,GAAOC,sBAAoB,GAAW/rD,EACrf,IAAMgsD,uBAAqB,GAAShsD,EACpC,MAAMisD,GAzXV,SAASC,GAAczI,EAAGzjD,GACtB,MAAQu9B,MAAKutB,SAAQC,aAAYC,gBAAeC,kBAAiBV,cAAa1B,kBAAiBsB,gBAAeE,kBAAiBD,mBAAkBE,qBAAoBa,oBAAkB3E,oBAAmB,CAAC,EAAG4E,cAAYxE,eAAa0E,kBAAiB,CAAC,EAAGC,gBAAcC,gBAAcM,mBAAiBC,sBAAoB,GAAW/rD,EAClUmsD,GA0EV,SAASC,GAAU7uB,EAAKutB,GACpB,IAAKA,EAAO5E,QAAQ3oB,GAChB,OACJ,MAAM8uB,EAAQvB,EAAOzF,MAAM9nB,GAC3B,OAAiB,IAAV8uB,OAAchvD,EAAYgvD,CACrC,CA/EmBD,CAAU7uB,EAAKutB,GAC9B,OAAQrH,EAAEiG,UACN,KAAKjG,EAAE6I,cACH,MAAqB,eAAjB7I,EAAE8I,WACK,CACHrmD,KAAM+8C,GAAWE,SACjB6C,WAAY,GACZuG,WAAY9I,EAAE8I,YAIX,CACHrmD,KAAM+8C,GAAWE,SACjB6C,WAAY,IAGxB,KAAKvC,EAAE+I,mBACH,MAAO,CACHtmD,KAAM+8C,GAAWG,aACjBvlD,KAAM4lD,EAAE5lD,KACR4uD,SAAUhJ,EAAEgJ,SACZC,SAAUjJ,EAAEiJ,SACZP,WAER,KAAK1I,EAAEkG,aACH,OA6GZ,SAASgD,GAAqBlJ,EAAGzjD,GAC7B,MAAQu9B,MAAKwtB,aAAYC,gBAAeC,kBAAiBE,mBAAkB3E,mBAAmB,CAAC,EAAGqC,kBAAiBjC,cAAa0E,iBAAiB,CAAC,EAAGC,eAAcC,eAAcM,mBAAiBC,sBAAoB,EAAOI,UAAqBhC,iBAAeE,mBAAiBD,oBAAkBE,uBAAwBtqD,EACtT4sD,GA9SV,SAASC,GAAkBttB,EAASwrB,EAAYC,EAAeC,GAC3D,IACI,GAAIA,GAAmB1rB,EAAQsqB,QAAQoB,GACnC,OAAO,EAEX,GAA0B,iBAAfF,GACP,GAAIxrB,EAAQ0qB,UAAU6C,SAAS/B,GAC3B,OAAO,OAIX,QAASf,EAASzqB,EAAQ0qB,UAAUzpD,OAAQwpD,KAExC,GAAIe,EAAWlmD,KADG06B,EAAQ0qB,UAAUD,IAEhC,OAAO,EAInB,GAAIgB,EACA,OAAOzrB,EAAQsqB,QAAQmB,EAE/B,OAEA,CACA,OAAO,CACX,CAqRsB6B,CAAkBpJ,EAAGsH,EAAYC,EAAeC,GAC5DzpD,GAvdV,SAASurD,GAAgBxtB,GACrB,GAAIA,aAAmBytB,gBACnB,MAAO,OAEX,MAAMC,EAAmBrrD,GAAY29B,EAAQ/9B,SAC7C,OAAI2lD,GAAatiD,KAAKooD,GACX,MAEJA,CACX,CA8coBF,CAAgBtJ,GAChC,IAAI1U,GAAa,CAAC,EAClB,MAAM1uC,GAAMojD,EAAE1U,WAAWvuC,OACzB,QAASe,GAAI,EAAGA,GAAIlB,GAAKkB,KAAK,CAC1B,MAAMD,GAAOmiD,EAAE1U,WAAWxtC,IACrB+nD,GAAgB9nD,GAASF,GAAKzD,QAC/BkxC,GAAWztC,GAAKzD,MAAQ+qD,GAAmBrrB,EAAK/7B,GAASI,GAAYN,GAAKzD,MAAOyD,GAAK6C,MAAOs/C,EAAGoF,GAExG,CACA,GAAgB,SAAZrnD,IAAsB2pD,EAAkB,CACxC,MAAM+B,GAAavsD,MAAM6e,KAAK+d,EAAI4vB,aAAa/iC,KAAM05B,IAC1CA,GAAE72B,OAASw2B,EAAEx2B,MAExB,IAAIi3B,GAAU,KACVgJ,KACAhJ,GAAUL,GAAoBqJ,KAE9BhJ,YACOnV,GAAWqe,WACXre,GAAW9hB,KAClB8hB,GAAWse,SAAWzF,GAAqB1D,GAASgJ,GAAWjgC,MAEvE,CACA,GAAgB,UAAZzrB,IACAiiD,EAAE6J,SACA7J,EAAE8J,WAAa9J,EAAE+J,aAAe,IAAI18C,OAAOtQ,OAAQ,CACrD,MAAM0jD,GAAUL,GAAoBJ,EAAE6J,OAClCpJ,KACAnV,GAAWse,SAAWzF,GAAqB1D,GAASyE,MAE5D,CACA,GAAgB,UAAZnnD,IACY,aAAZA,IACY,WAAZA,IACY,WAAZA,GAAsB,CACtB,MAAML,GAAKsiD,EACLv9C,GAAO6gD,GAAa5lD,IACpBgD,GAAQ8iD,GAAc9lD,GAAI86B,GAAYz6B,IAAU0E,IAChDunD,GAAUtsD,GAAGssD,QACnB,GAAa,WAATvnD,IAA8B,WAATA,IAAqB/B,GAAO,CACjD,MAAMupD,GAAYxD,GAAgB/oD,GAAIgpD,GAAeC,GAAkBC,GAAiBC,GAAoB/D,GAAgB,CACxHrgD,QACA1E,QAASy6B,GAAYz6B,IACrBglD,sBAEJzX,GAAW5qC,MAAQuiD,GAAe,CAC9BC,SAAU+G,GACVnuB,QAASp+B,GACTgD,SACAyiD,eAER,CACI6G,KACA1e,GAAW0e,QAAUA,GAE7B,CASA,GARgB,WAAZjsD,KACIiiD,EAAEkK,WAAanH,EAAiBoH,OAChC7e,GAAW4e,UAAW,SAGf5e,GAAW4e,UAGV,WAAZnsD,IAAwBgqD,EACxB,GAAoB,OAAhB/H,EAAEoK,WAhkBd,SAASC,GAAgBC,GACrB,MAAMjzD,EAAMizD,EAAOC,WAAW,MAC9B,IAAKlzD,EACD,OAAO,EAEX,QAASmzD,EAAI,EAAGA,EAAIF,EAAOG,MAAOD,GADhB,GAEd,QAASE,EAAI,EAAGA,EAAIJ,EAAO3tD,OAAQ+tD,GAFrB,GAEqC,CAC/C,MAAMC,EAAetzD,EAAIszD,aAKzB,GADoB,IAAIC,aAHKvH,MAA2BsH,EAClDA,EAAatH,IACbsH,GACmD5vD,KAAK1D,EAAKmzD,EAAGE,EAAG/wD,KAAKkxD,IAPpE,GAOmFP,EAAOG,MAAQD,GAAI7wD,KAAKkxD,IAP3G,GAO0HP,EAAO3tD,OAAS+tD,IAAIhlD,KAAK0lB,QAC7IpqB,KAAM8pD,GAAoB,IAAVA,GAC5B,OAAO,CACf,CAEJ,OAAO,CACX,EAgjBiBT,CAAgBrK,KACjB1U,GAAWyf,WAAa/K,EAAEgL,UAAUnD,EAAeplD,KAAMolD,EAAeoD,eAAO,KAG5E,cAAejL,GAAI,CAC1B,MAAMkL,GAAgBlL,EAAEgL,UAAUnD,EAAeplD,KAAMolD,EAAeoD,SAChEE,GAAchtC,SAAS4b,cAAc,UAC3CoxB,GAAYV,MAAQzK,EAAEyK,MACtBU,GAAYxuD,OAASqjD,EAAErjD,OAEnBuuD,KADuBC,GAAYH,UAAUnD,EAAeplD,KAAMolD,EAAeoD,WAEjF3f,GAAWyf,WAAaG,GAEhC,CAEJ,GAAgB,QAAZntD,IAAqB+pD,EAAc,CAC9BjE,KACDA,GAAgB/pB,EAAIC,cAAc,UAClC+pB,GAAYD,GAAc0G,WAAW,OAEzC,MAAMa,GAAQpL,EACRqL,GAAWD,GAAM5jB,YACvB4jB,GAAM5jB,YAAc,YACpB,MAAM8jB,GAAoBA,KACtBF,GAAMjjB,oBAAoB,OAAQmjB,IAClC,IACIzH,GAAc4G,MAAQW,GAAMG,aAC5B1H,GAAclnD,OAASyuD,GAAMI,cAC7B1H,GAAU2H,UAAUL,GAAO,EAAG,GAC9B9f,GAAWyf,WAAalH,GAAcmH,UAAUnD,EAAeplD,KAAMolD,EAAeoD,QACxF,OACOtuC,IACHtd,QAAQyN,KAAM,yBAAwBs+C,GAAMM,sBAAsB/uC,KACtE,CACA0uC,GACO/f,GAAW9D,YAAc6jB,GAC1BD,GAAMO,gBAAgB,cAAa,EAEzCP,GAAMQ,UAAmC,IAAvBR,GAAMG,aACxBD,KAEAF,GAAMr1B,iBAAiB,OAAQu1B,GACvC,CAeA,IAdgB,UAAZvtD,IAAmC,UAAZA,MACvButC,GAAWugB,cAAgB7L,EAAE8L,OACvB,SACA,SACNxgB,GAAWygB,oBAAsB/L,EAAEgM,aAElC1D,KACGtI,EAAEiM,aACF3gB,GAAW4gB,cAAgBlM,EAAEiM,YAE7BjM,EAAEmM,YACF7gB,GAAW8gB,aAAepM,EAAEmM,YAGhChD,GAAW,CACX,MAAQsB,SAAO9tD,WAAWqjD,EAAEqM,wBAC5B/gB,GAAa,CACTghB,MAAOhhB,GAAWghB,MAClBC,SAAW,GAAE9B,OACb+B,UAAY,GAAE7vD,OAEtB,CAOA,IAAI8vD,GANY,WAAZ1uD,KAAyBsqD,GAAgB/c,GAAW7D,OAC/CuY,EAAE0M,kBACHphB,GAAWqhB,OAASrhB,GAAW7D,YAE5B6D,GAAW7D,KAGtB,IACQmlB,eAAehpD,IAAI7F,MACnB0uD,IAAkB,EAC1B,OAEA,CACA,MAAO,CACHhqD,KAAM+8C,GAAWx8C,QACjBjF,WACAutC,cACAiX,WAAY,GACZsK,MAAO7H,GAAahF,SAAMpmD,EAC1BuvD,aACAT,UACAoE,SAAUL,GAElB,CA1QmBvD,CAAqBlJ,EAAG,CAC3BlmB,MACAwtB,aACAC,gBACAC,kBACAE,oBACAtC,kBACArC,oBACAI,eACA0E,kBACAC,gBACAC,gBACAM,mBACAC,qBACAI,UACA5B,cACAJ,gBACAE,kBACAD,mBACAE,uBAER,KAAK7G,EAAE+M,UACH,OAiCZ,SAASC,GAAkBhN,EAAGzjD,GAC1B,MAAQuqD,cAAaJ,gBAAeE,kBAAiBD,mBAAkBE,qBAAoBc,aAAY5E,mBAAkBI,cAAauF,UAAYnsD,EAC5I0wD,EAAgBjN,EAAEziD,YAAcyiD,EAAEziD,WAAWQ,QACnD,IAAIgsD,EAAc/J,EAAE+J,YACpB,MAAMmD,GAA4B,UAAlBD,QAAmCrzD,EAC7CuzD,GAA6B,WAAlBF,QAAoCrzD,EAC/CwzD,GAA+B,aAAlBH,QAAsCrzD,EACzD,GAAIszD,IAAWnD,EAAa,CACxB,IACQ/J,EAAEqN,aAAerN,EAAEsN,iBAEd/N,GAAiB,CAACS,EAAG,SAAUuN,IAAMA,GAAGhwD,WAAY,SAAUiwD,IAAMA,GAAG3D,MAAO,iBAAkB4D,IAAMA,GAAGlN,aAC9GwJ,EAAc3J,GAAoBJ,EAAEziD,WAAWssD,OAEvD,OACOltC,IACHtd,QAAQyN,KAAM,wDAAuD6P,KAAOqjC,EAChF,CACA+J,EAAc5F,GAAqB4F,EAAa7E,KACpD,CACIiI,KACApD,EAAc,sBAElB,MAAME,GAAYxD,GAAgBzG,EAAG0G,EAAeC,EAAkBC,EAAiBC,EAAoBC,GAwB3G,OAvBKoG,KAAYC,KAAaC,IAAcrD,GAAeE,KACvDF,EAAcpC,EACRA,EAAWoC,GACXA,EAAYzlD,QAAQ,QAAS,MAEnC8oD,IAAcrD,IAAgBhH,EAAiB2K,UAAYzD,MAC3DF,EAAc5G,EACRA,EAAY4G,EAAa/J,EAAEziD,YAC3BwsD,EAAYzlD,QAAQ,QAAS,MAEjB,WAAlB2oD,GAA8BlD,IAM9BA,EAAc9G,GAAe,CACzBC,SAAUuD,GAAgBzG,EAAG0G,EAAeC,EAAkBC,EAAiBC,EAN7D/D,GAAgB,CAClCrgD,KAAM,KACN1E,QAASkvD,EACTlK,sBAIAjnB,QAASkkB,EACTt/C,MAAOqpD,EACP5G,iBAGD,CACH1gD,KAAM+8C,GAAWI,KACjBmK,YAAaA,GAAe,GAC5BmD,WACAxE,SAER,CAtFmBsE,CAAkBhN,EAAG,CACxB8G,cACAJ,gBACAE,kBACAD,mBACAE,qBACAc,cACA5E,oBACAI,eACAuF,YAER,KAAK1I,EAAE2N,mBACH,MAAO,CACHlrD,KAAM+8C,GAAWK,MACjBkK,YAAa,GACbrB,WAER,KAAK1I,EAAE4N,aACH,MAAO,CACHnrD,KAAM+8C,GAAWM,QACjBiK,YAAa/J,EAAE+J,aAAe,GAC9BrB,WAER,QACI,OAAO,EAEnB,CA8S4BD,CAAczI,EAAG,CACrClmB,MACAutB,SACAC,aACAC,gBACAT,cACAU,kBACAd,gBACAE,kBACAD,mBACAE,qBACAa,oBACA3E,oBACAqC,mBACAuC,cACAxE,eACA0E,kBACAC,gBACAC,gBACAM,mBACAC,uBAEJ,IAAKE,GACDnpD,eAAQyN,KAAKkzC,EAAG,kBACT,KAEX,IAAIrhD,GAEAA,GADA0oD,EAAO5E,QAAQzC,GACVqH,EAAOzF,MAAM5B,GAvG1B,SAAS6N,GAAgBC,EAAIlG,GACzB,GAAIA,EAAemG,SAAWD,EAAGrrD,OAAS+8C,GAAWM,QACjD,OAAO,EAEN,GAAIgO,EAAGrrD,OAAS+8C,GAAWx8C,QAAS,CACrC,GAAI4kD,EAAetgB,SACC,WAAfwmB,EAAG/vD,SACgB,SAAf+vD,EAAG/vD,UACuB,YAAtB+vD,EAAGxiB,WAAWqe,KACW,kBAAtBmE,EAAGxiB,WAAWqe,MACG,WAArBmE,EAAGxiB,WAAW0iB,IACF,SAAfF,EAAG/vD,SACsB,aAAtB+vD,EAAGxiB,WAAWqe,KACgB,iBAAvBmE,EAAGxiB,WAAW9hB,MACrBskC,EAAGxiB,WAAW9hB,KAAK+yB,SAAS,QACpC,OAAO,EAEN,GAAIqL,EAAeqG,cACH,SAAfH,EAAG/vD,SAA4C,kBAAtB+vD,EAAGxiB,WAAWqe,KACrB,SAAfmE,EAAG/vD,UACCmpD,GAAc4G,EAAGxiB,WAAWlxC,MAAMshB,MAAM,sCACC,qBAAtCwrC,GAAc4G,EAAGxiB,WAAWlxC,OACS,SAArC8sD,GAAc4G,EAAGxiB,WAAWqe,MACS,qBAArCzC,GAAc4G,EAAGxiB,WAAWqe,MACS,kBAArCzC,GAAc4G,EAAGxiB,WAAWqe,OACxC,OAAO,EAEN,GAAmB,SAAfmE,EAAG/vD,QAAoB,CAC5B,GAAI6pD,EAAesG,sBACfhH,GAAc4G,EAAGxiB,WAAWlxC,MAAMshB,MAAM,0BACxC,OAAO,EAEN,GAAIksC,EAAeuG,iBACnBjH,GAAc4G,EAAGxiB,WAAWpoC,UAAUwY,MAAM,sBACzCwrC,GAAc4G,EAAGxiB,WAAWlxC,MAAMshB,MAAM,mBACF,cAAtCwrC,GAAc4G,EAAGxiB,WAAWlxC,OAChC,OAAO,EAEN,GAAIwtD,EAAewG,iBACmB,WAAtClH,GAAc4G,EAAGxiB,WAAWlxC,OACa,cAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,YAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OAChC,OAAO,EAEN,GAAIwtD,EAAeyG,wBACYz0D,IAAhCk0D,EAAGxiB,WAAW,cACd,OAAO,EAEN,GAAIsc,EAAe0G,qBACmB,WAAtCpH,GAAc4G,EAAGxiB,WAAWlxC,OACa,cAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,cAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,cAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,WAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OAC5B8sD,GAAc4G,EAAGxiB,WAAWpoC,UAAUwY,MAAM,cAC5CwrC,GAAc4G,EAAGxiB,WAAWpoC,UAAUwY,MAAM,cAChD,OAAO,EAEN,GAAIksC,EAAe2G,uBACmB,6BAAtCrH,GAAc4G,EAAGxiB,WAAWlxC,OACa,wBAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,eAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,oBAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,cAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,iBAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OACU,+BAAtC8sD,GAAc4G,EAAGxiB,WAAWlxC,OAChC,OAAO,CAEf,CACJ,CACA,OAAO,CACX,CAkCayzD,CAAgBrF,GAAiBZ,MACpCW,IACEC,GAAgB/lD,OAAS+8C,GAAWI,OACnC4I,GAAgB0E,UAChB1E,GAAgBuB,YAAYzlD,QAAQ,cAAe,IAAIvH,OACvD4mD,GAGAC,KAET,MAAM4K,GAAiB9zD,OAAO4oB,OAAOklC,GAAiB,CAAE7pD,QAExD,GADA0oD,EAAOzpC,IAAIoiC,EAAGwO,IACV7vD,KAAOglD,GACP,OAAO,KAEPqE,IACAA,GAAYhI,GAEhB,IAAIyO,IAAehH,EACnB,GAAI+G,GAAe/rD,OAAS+8C,GAAWx8C,QAAS,CAC5CyrD,GAAcA,KAAgBD,GAAerF,iBACtCqF,GAAerF,UACtB,MAAMjJ,GAAaF,EAAEE,WACjBA,IAAcC,GAAkBD,MAChCsO,GAAeE,cAAe,EACtC,CACA,IAAKF,GAAe/rD,OAAS+8C,GAAWE,UACpC8O,GAAe/rD,OAAS+8C,GAAWx8C,UACnCyrD,GAAa,CACT7G,GAAe+G,gBACfH,GAAe/rD,OAAS+8C,GAAWx8C,SACR,SAA3BwrD,GAAezwD,UACfwqD,IAAqB,GAEzB,MAAMqG,GAAgB,CAClB90B,MACAutB,SACAC,aACAC,gBACAT,cACAU,kBACAd,gBACAE,kBACAD,mBACAE,qBACAY,YACAC,oBACA3E,oBACAqC,mBACAuC,cACAxE,eACAyE,kBACAC,kBACAC,gBACAC,gBACAQ,sBACAP,eACAC,gBACAC,qBACAC,oBACAC,yBACAC,oBAEJ,UAAWwG,MAAU3xD,MAAM6e,KAAKikC,EAAEuC,YAAa,CAC3C,MAAMuM,GAAsB1H,GAAoByH,GAAQD,IACpDE,IACAN,GAAejM,WAAWjlD,KAAKwxD,GAEvC,CACA,GA1+BR,SAASC,GAAY/O,GACjB,OAAOA,EAAEiG,WAAajG,EAAEkG,YAC5B,CAw+BY6I,CAAY/O,IAAMA,EAAEE,WACpB,UAAW2O,MAAU3xD,MAAM6e,KAAKikC,EAAEE,WAAWqC,YAAa,CACtD,MAAMuM,GAAsB1H,GAAoByH,GAAQD,IACpDE,KACA3O,GAAkBH,EAAEE,cACf4O,GAAoBE,UAAW,GACpCR,GAAejM,WAAWjlD,KAAKwxD,IAEvC,CAER,CACA,OAAI9O,EAAEziD,YACFwiD,GAAaC,EAAEziD,aACf4iD,GAAkBH,EAAEziD,cACpBixD,GAAeQ,UAAW,GAE1BR,GAAe/rD,OAAS+8C,GAAWx8C,SACR,WAA3BwrD,GAAezwD,SAxiBvB,SAASkxD,GAAiBC,EAAU93B,EAAU8wB,GAC1C,MAAMiH,EAAMD,EAAS90B,cACrB,IAAK+0B,EACD,OAEJ,IACIr2B,EADAs2B,GAAQ,EAEZ,IACIt2B,EAAaq2B,EAAIhxC,SAAS2a,UAC9B,OAEI,MACJ,CACA,GAAmB,aAAfA,EAA2B,CAC3B,MAAMu2B,EAAQ35B,WAAW,KAChB05B,IACDh4B,IACAg4B,GAAQ,IAEblH,GAMH,YALAgH,EAASn5B,iBAAiB,OAAQ,KAC9BiC,aAAaq3B,GACbD,GAAQ,EACRh4B,GAAS,EAGjB,CACA,MAAMk4B,EAAW,cACjB,GAAIH,EAAI5lC,SAASC,OAAS8lC,GACtBJ,EAASznB,MAAQ6nB,GACA,KAAjBJ,EAASznB,IACT/R,kBAAW0B,EAAU,GACd83B,EAASn5B,iBAAiB,OAAQqB,GAE7C83B,EAASn5B,iBAAiB,OAAQqB,EACtC,CAsgBQ63B,CAAiBjP,EAAG,KAChB,MAAMuP,GAAYvP,EAAE0M,gBACpB,GAAI6C,IAAatH,GAAc,CAC3B,MAAMuH,GAAuBpI,GAAoBmI,GAAW,CACxDz1B,IAAKy1B,GACLlI,SACAC,aACAC,gBACAC,kBACAV,cACAJ,gBACAE,kBACAD,mBACAE,qBACAY,WAAW,EACXC,oBACA3E,oBACAqC,mBACAuC,cACAxE,eACAyE,kBACAC,kBACAC,gBACAC,gBACAQ,sBACAP,eACAC,gBACAC,qBACAC,oBACAC,yBACAC,qBAEAmH,IACAvH,GAAajI,EAAGwP,GAExB,GACDtH,IAEHsG,GAAe/rD,OAAS+8C,GAAWx8C,SACR,SAA3BwrD,GAAezwD,SACmB,eAAlCywD,GAAeljB,WAAWqe,KA7iBlC,SAAS8F,GAAqBC,EAAMt4B,EAAUu4B,GAC1C,IACIC,EADAR,GAAQ,EAEZ,IACIQ,EAAmBF,EAAK7F,KAC5B,OAEI,MACJ,CACA,GAAI+F,EACA,OACJ,MAAMP,EAAQ35B,WAAW,KAChB05B,IACDh4B,IACAg4B,GAAQ,IAEbO,GACHD,EAAK35B,iBAAiB,OAAQ,KAC1BiC,aAAaq3B,GACbD,GAAQ,EACRh4B,GAAS,EAEjB,CAwhBQq4B,CAAqBzP,EAAG,KACpB,GAAImI,GAAkB,CAClB,MAAM0H,GAAqBzI,GAAoBpH,EAAG,CAC9ClmB,MACAutB,SACAC,aACAC,gBACAC,kBACAV,cACAJ,gBACAE,kBACAD,mBACAE,qBACAY,WAAW,EACXC,oBACA3E,oBACAqC,mBACAuC,cACAxE,eACAyE,kBACAC,kBACAC,gBACAC,gBACAQ,sBACAP,eACAC,gBACAC,qBACAC,oBACAC,yBACAC,qBAEAwH,IACA1H,GAAiBnI,EAAG6P,GAE5B,GACDzH,IAEAoG,EACX,CAyEA,SAASsB,GAAiBrR,GAAO,IAAIC,EAA+Bh+C,EAAQ+9C,EAAI,GAAQ3gD,EAAI,EAAG,KAAOA,EAAI2gD,EAAI1hD,QAAQ,CAAE,MAAMoR,EAAKswC,EAAI3gD,GAAUwe,EAAKmiC,EAAI3gD,EAAI,GAAY,GAARA,GAAK,GAAe,mBAAPqQ,GAAkC,iBAAPA,IAAmC,MAATzN,EAAiB,OAA+B,WAAPyN,GAA0B,mBAAPA,GAA2BuwC,EAAgBh+C,EAAOA,EAAQ4b,EAAG5b,KAA0B,SAAPyN,GAAwB,iBAAPA,KAAyBzN,EAAQ4b,EAAG,IAAIrc,IAASS,EAAM3F,KAAK2jD,KAAkBz+C,IAAQy+C,OAAgB9kD,EAAa,CAAE,OAAO8G,CAAO,CACpgB,SAASwiB,GAAGzgB,EAAM6Z,EAAI5Z,EAASyb,UAC3B,MAAM5hB,EAAU,CAAE07C,SAAS,EAAM8X,SAAS,GAC1CrtD,SAAOqzB,iBAAiBtzB,EAAM6Z,EAAI/f,GAC3B,IAAMmG,EAAOylC,oBAAoB1lC,EAAM6Z,EAAI/f,EACtD,CACA,MAAMyzD,GAAiC,4NAKvC,IAAIC,GAAU,CACVzxD,IAAK,CAAC,EACNojD,WACIviD,QAAQ0lB,MAAMirC,KACP,GAEX5N,aACI/iD,QAAQ0lB,MAAMirC,IACP,MAEX1N,oBACIjjD,QAAQ0lB,MAAMirC,GAClB,EACAryC,SACIte,QAAQ0lB,MAAMirC,KACP,GAEXnN,QACIxjD,QAAQ0lB,MAAMirC,GAClB,GAYJ,SAASE,GAAWhuD,EAAMiuD,EAAM5zD,EAAU,CAAC,GACvC,IAAI6xB,EAAU,KACVgiC,EAAW,EACf,OAAO,YAAanwD,GAChB,MAAMiG,EAAMD,KAAKC,OACZkqD,IAAgC,IAApB7zD,EAAQ8zD,UACrBD,EAAWlqD,GAEf,MAAMoqD,EAAYH,GAAQjqD,EAAMkqD,GAC1BrmD,EAAU1T,KACZi6D,GAAa,GAAKA,EAAYH,GAC1B/hC,IACA4J,aAAa5J,GACbA,EAAU,MAEdgiC,EAAWlqD,EACXhE,EAAK+X,MAAMlQ,EAAS9J,KAEdmuB,IAAgC,IAArB7xB,EAAQg0D,WACzBniC,EAAUsH,WAAW,KACjB06B,GAA+B,IAApB7zD,EAAQ8zD,QAAoB,EAAIpqD,KAAKC,MAChDkoB,EAAU,KACVlsB,EAAK+X,MAAMlQ,EAAS9J,EAAI,EACzBqwD,GAEX,CACJ,CACA,SAASE,GAAW9tD,EAAQ9E,EAAK6yD,EAAGC,EAAWvB,EAAMp1D,QACjD,MAAM0H,EAAW0tD,EAAIz0D,OAAOi7B,yBAAyBjzB,EAAQ9E,GAC7DuxD,SAAIz0D,OAAOmH,eAAea,EAAQ9E,EAAK8yD,EACjCD,EACA,CACE3sD,IAAIpD,GACAg1B,WAAW,KACP+6B,EAAE3sD,IAAI/I,KAAK1E,KAAMqK,EAAK,EACvB,GACCe,GAAYA,EAASqC,KACrBrC,EAASqC,IAAI/I,KAAK1E,KAAMqK,EAEhC,IAED,IAAM8vD,GAAW9tD,EAAQ9E,EAAK6D,GAAY,CAAC,GAAG,EACzD,CACA,SAASkvD,GAAMpvD,EAAQnH,EAAMw2D,GACzB,IACI,KAAMx2D,KAAQmH,GACV,MAAO,OAGX,MAAME,EAAWF,EAAOnH,GAClBsH,EAAUkvD,EAAYnvD,GAC5B,MAAuB,mBAAZC,IACPA,EAAQ/G,UAAY+G,EAAQ/G,WAAa,CAAC,EAC1CD,OAAOm2D,iBAAiBnvD,EAAS,CAC7BovD,mBAAoB,CAChBC,YAAY,EACZrwD,MAAOe,MAInBF,EAAOnH,GAAQsH,EACR,KACHH,EAAOnH,GAAQqH,EAEvB,OAEI,MAAO,MAEX,CACJ,QA/EW1H,OAAW,KAAeA,OAAOi3D,OAASj3D,OAAOk3D,UACxDhB,GAAU,IAAIe,MAAMf,GAAS,CACzBrsD,KAAIlB,EAAQwP,EAAMg/C,KACD,QAATh/C,GACA7S,QAAQ0lB,MAAMirC,IAEXiB,QAAQrtD,IAAIlB,EAAQwP,EAAMg/C,OA0E7C,IA6LIC,GA7LAC,GAAenrD,KAAKC,IAIxB,SAASmrD,GAAgBlC,GACrB,MAAMr1B,EAAMq1B,EAAIhxC,SAChB,MAAO,CACHmzC,KAAMx3B,EAAIy3B,iBACJz3B,EAAIy3B,iBAAiBtF,gBACDryD,IAApBu1D,EAAIqC,YACArC,EAAIqC,YACJ1B,GAAiB,CAACh2B,EAAK,iBAAkBryB,GAAKA,EAAEgqD,gBAAiB,SAAUxR,GAAMA,EAAGgM,cAClF6D,GAAiB,CAACh2B,EAAK,iBAAkBkoB,GAAMA,EAAGxoB,KAAM,iBAAkB0oB,GAAMA,EAAG6E,cAAe,iBAAkB5E,GAAMA,EAAG8J,cAC7H6D,GAAiB,CAACh2B,EAAK,iBAAkByzB,GAAMA,EAAG/zB,KAAM,iBAAkBg0B,GAAMA,EAAGvB,cACnF,EACZt0C,IAAKmiB,EAAIy3B,iBACHz3B,EAAIy3B,iBAAiBpF,eACDvyD,IAApBu1D,EAAIuC,YACAvC,EAAIuC,YACJ5B,GAAiB,CAACh2B,EAAK,iBAAkB2zB,GAAMA,EAAGgE,gBAAiB,SAAUE,GAAMA,EAAGxF,aACpF2D,GAAiB,CAACh2B,EAAK,iBAAkB83B,GAAOA,EAAIp4B,KAAM,iBAAkBq4B,GAAOA,EAAI9K,cAAe,iBAAkB+K,GAAOA,EAAI3F,aACnI2D,GAAiB,CAACh2B,EAAK,iBAAkBi4B,GAAOA,EAAIv4B,KAAM,iBAAkBw4B,GAAOA,EAAI7F,aACvF,EAEpB,CACA,SAAS8F,KACL,OAAQl4D,OAAOm4D,aACV/zC,SAASszC,iBAAmBtzC,SAASszC,gBAAgBU,cACrDh0C,SAASqb,MAAQrb,SAASqb,KAAK24B,YACxC,CACA,SAASC,KACL,OAAQr4D,OAAOs4D,YACVl0C,SAASszC,iBAAmBtzC,SAASszC,gBAAgBa,aACrDn0C,SAASqb,MAAQrb,SAASqb,KAAK84B,WACxC,CACA,SAASC,GAAU7P,EAAM4E,EAAYC,EAAeC,EAAiBgL,GACjE,IAAK9P,EACD,OAAO,EAEX,MAAMhlD,EAAKglD,EAAKuD,WAAavD,EAAKwD,aAC5BxD,EACAA,EAAKqE,cACX,IAAKrpD,EACD,OAAO,EACX,MAAM+0D,EAAmBtM,GAAqBmB,EAAYC,GAC1D,IAAKiL,EAAgB,CACjB,MAAME,EAAclL,GAAmB9pD,EAAG0oD,QAAQoB,GAClD,OAAOiL,EAAiB/0D,KAAQg1D,CACpC,CACA,MAAMC,EAAgB7M,GAAgBpoD,EAAI+0D,GAC1C,IAAIG,GAAkB,EACtB,QAAID,EAAgB,KAGhBnL,IACAoL,EAAkB9M,GAAgBpoD,EAAIyoD,GAAqB,KAAMqB,KAEjEmL,GAAgB,GAAMC,EAAkB,GAGrCD,EAAgBC,EAC3B,CAIA,SAASC,GAAU7S,EAAGqH,GAClB,OAAOA,EAAOzF,MAAM5B,KAAO2D,EAC/B,CACA,SAASmP,GAAkBpwD,EAAQ2kD,GAC/B,GAAItH,GAAar9C,GACb,OAAO,EAEX,MAAM/D,EAAK0oD,EAAOzF,MAAMl/C,GACxB,OAAK2kD,EAAO1pC,IAAIhf,MAGZ+D,EAAOnF,YACPmF,EAAOnF,WAAW0oD,WAAavjD,EAAOmmD,kBAGrCnmD,EAAOnF,YAGLu1D,GAAkBpwD,EAAOnF,WAAY8pD,GAChD,CACA,SAAS0L,GAAoBnuD,GACzB,QAAeA,EAAMouD,cACzB,CAyBA,SAASC,GAAmBjT,EAAGqH,GAC3B,QAA8B,WAAfrH,EAAEkT,WAAyB7L,EAAOpF,QAAQjC,GAC7D,CACA,SAASmT,GAAuBnT,EAAGqH,GAC/B,QAA8B,SAAfrH,EAAEkT,UACblT,EAAEiG,WAAajG,EAAEkG,eACjBlG,EAAEzhD,cACwB,eAA1ByhD,EAAEzhD,aAAa,SACf8oD,EAAOpF,QAAQjC,GACvB,CACA,SAASoT,GAAcpT,GACnB,QAAe8P,GAAiB,CAAC9P,EAAG,iBAAkBqT,GAAOA,EAAInT,YACrE,CA3HM,iBAAiB9+C,KAAK6E,KAAKC,MAAMtL,cACnCw2D,GAAeA,SAAUnrD,MAAO2I,WA2HpC,MAAM0kD,GACFl9D,cACIC,KAAKsI,GAAK,EACVtI,KAAKk9D,WAAa,IAAIhyC,QACtBlrB,KAAKm9D,WAAa,IAAIjwD,GAC1B,CACAq+C,MAAM6H,GACF,OCr6CR,SAASgK,GAAiB3R,EAAKC,GAE7B,OAAOD,GAAoBC,GAC7B,CDk6Ce0R,CAAiBp9D,KAAKk9D,WAAW3vD,IAAI6lD,GAAa,KAAQ,EACrE,CACA9rC,IAAI8rC,GACA,OAAOpzD,KAAKk9D,WAAW51C,IAAI8rC,EAC/B,CACA7rC,IAAI6rC,EAAY9qD,GACZ,GAAItI,KAAKsnB,IAAI8rC,GACT,OAAOpzD,KAAKurD,MAAM6H,GACtB,IAAIiK,EACJ,OACIA,OADO95D,IAAP+E,EACQtI,KAAKsI,KAGLA,EACZtI,KAAKk9D,WAAWzvD,IAAI2lD,EAAYiK,GAChCr9D,KAAKm9D,WAAW1vD,IAAI4vD,EAAOjK,GACpBiK,CACX,CACAC,SAASh1D,GACL,OAAOtI,KAAKm9D,WAAW5vD,IAAIjF,IAAO,IACtC,CACAkkD,QACIxsD,KAAKk9D,WAAa,IAAIhyC,QACtBlrB,KAAKm9D,WAAa,IAAIjwD,IACtBlN,KAAKsI,GAAK,CACd,CACAi1D,aACI,OAAOv9D,KAAKsI,IAChB,EAEJ,SAASk1D,GAAc7T,GACnB,IAAI8T,EAAa,KACjB,OAAIhE,GAAiB,CAAC9P,EAAG,SAAU+T,GAAOA,EAAIC,YAAa,eAAgBC,GAAOA,IAAO,iBAAkBC,GAAOA,EAAIjO,aAAekO,KAAKC,wBACtIpU,EAAEgU,cAAcnuC,OAChBiuC,EAAa9T,EAAEgU,cAAcnuC,MAC1BiuC,CACX,CAeA,SAASO,GAAMrU,GACX,MAAMlmB,EAAMkmB,EAAEsU,cACd,QAAKx6B,IAEEA,EAAIuvB,SAASrJ,IAXxB,SAASuU,GAAgBvU,GACrB,MAAMlmB,EAAMkmB,EAAEsU,cACd,IAAKx6B,EACD,OAAO,EACX,MAAMg6B,EAXV,SAASU,GAAkBxU,GACvB,IACI8T,EADAW,EAAiBzU,EAErB,KAAQ8T,EAAaD,GAAcY,IAC/BA,EAAiBX,EACrB,OAAOW,CACX,CAKuBD,CAAkBxU,GACrC,OAAOlmB,EAAIuvB,SAASyK,EACxB,CAK8BS,CAAgBvU,GAC9C,CA8BA,IAAI0U,GAA8BC,KAChCA,EAAWA,EAAWC,iBAAsB,GAAK,mBACjDD,EAAWA,EAAWE,KAAU,GAAK,OACrCF,EAAWA,EAAWG,aAAkB,GAAK,eAC7CH,EAAWA,EAAWI,oBAAyB,GAAK,sBACpDJ,EAAWA,EAAWK,KAAU,GAAK,OACrCL,EAAWA,EAAWM,OAAY,GAAK,SACvCN,EAAWA,EAAWO,OAAY,GAAK,SAChCP,GARyBA,CAS/BD,IAAa,CAAC,GACbS,GAAsCC,KACxCA,EAAmBA,EAAmBC,SAAc,GAAK,WACzDD,EAAmBA,EAAmBE,UAAe,GAAK,YAC1DF,EAAmBA,EAAmBG,iBAAsB,GAAK,mBACjEH,EAAmBA,EAAmBI,OAAY,GAAK,SACvDJ,EAAmBA,EAAmBK,eAAoB,GAAK,iBAC/DL,EAAmBA,EAAmBM,MAAW,GAAK,QACtDN,EAAmBA,EAAmBO,UAAe,GAAK,YAC1DP,EAAmBA,EAAmBQ,iBAAsB,GAAK,mBACjER,EAAmBA,EAAmBS,eAAoB,GAAK,iBAC/DT,EAAmBA,EAAmBU,eAAoB,GAAK,iBAC/DV,EAAmBA,EAAmBW,KAAU,IAAM,OACtDX,EAAmBA,EAAmBY,IAAS,IAAM,MACrDZ,EAAmBA,EAAmBa,KAAU,IAAM,OACtDb,EAAmBA,EAAmBc,iBAAsB,IAAM,mBAClEd,EAAmBA,EAAmBe,UAAe,IAAM,YAC3Df,EAAmBA,EAAmBgB,kBAAuB,IAAM,oBACnEhB,EAAmBA,EAAmBiB,cAAmB,IAAM,gBACxDjB,GAlBiCA,CAmBvCD,IAAqB,CAAC,GACrBmB,GAAsCC,KACxCA,EAAmBA,EAAmBC,QAAa,GAAK,UACxDD,EAAmBA,EAAmBE,UAAe,GAAK,YAC1DF,EAAmBA,EAAmBG,MAAW,GAAK,QACtDH,EAAmBA,EAAmBI,YAAiB,GAAK,cAC5DJ,EAAmBA,EAAmBK,SAAc,GAAK,WACzDL,EAAmBA,EAAmBM,MAAW,GAAK,QACtDN,EAAmBA,EAAmBO,KAAU,GAAK,OACrDP,EAAmBA,EAAmBQ,WAAgB,GAAK,aAC3DR,EAAmBA,EAAmBS,mBAAwB,GAAK,qBACnET,EAAmBA,EAAmBU,SAAc,GAAK,WACzDV,EAAmBA,EAAmBW,YAAiB,IAAM,cACtDX,GAZiCA,CAavCD,IAAqB,CAAC,GACrBa,GAAiCC,KACnCA,EAAcA,EAAcC,MAAW,GAAK,QAC5CD,EAAcA,EAAcE,IAAS,GAAK,MAC1CF,EAAcA,EAAcG,MAAW,GAAK,QACrCH,GAJ4BA,CAKlCD,IAAgB,CAAC,GAEpB,SAASK,GAAiB/Y,GAAO,IAAIC,EAA+Bh+C,EAAQ+9C,EAAI,GAAQ3gD,EAAI,EAAG,KAAOA,EAAI2gD,EAAI1hD,QAAQ,CAAE,MAAMoR,EAAKswC,EAAI3gD,GAAUwe,EAAKmiC,EAAI3gD,EAAI,GAAY,GAARA,GAAK,GAAe,mBAAPqQ,GAAkC,iBAAPA,IAAmC,MAATzN,EAAiB,OAA+B,WAAPyN,GAA0B,mBAAPA,GAA2BuwC,EAAgBh+C,EAAOA,EAAQ4b,EAAG5b,KAA0B,SAAPyN,GAAwB,iBAAPA,KAAyBzN,EAAQ4b,EAAG,IAAIrc,IAASS,EAAM3F,KAAK2jD,KAAkBz+C,IAAQy+C,OAAgB9kD,EAAa,CAAE,OAAO8G,CAAO,CACpgB,SAAS+2D,GAAmBzX,GACxB,MAAO,SAAUA,CACrB,CACA,MAAM0X,GACFthE,cACIC,KAAK0G,OAAS,EACd1G,KAAK6jC,KAAO,KACZ7jC,KAAKshE,KAAO,IAChB,CACA/zD,IAAIg0D,GACA,GAAIA,GAAYvhE,KAAK0G,OACjB,MAAM,IAAI9B,MAAM,kCAEpB,IAAI2tC,EAAUvyC,KAAK6jC,KACnB,QAASvwB,EAAQ,EAAGA,EAAQiuD,EAAUjuD,IAClCi/B,EAAU4uB,GAAiB,CAAC5uB,EAAS,iBAAkBnhC,GAAKA,EAAEijB,QAAU,KAE5E,OAAOke,CACX,CACAivB,QAAQ7X,GACJ,MAAM0C,EAAO,CACThiD,MAAOs/C,EACPoQ,SAAU,KACV1lC,KAAM,MAGV,GADAs1B,EAAE8X,KAAOpV,EACL1C,EAAEsN,iBAAmBmK,GAAmBzX,EAAEsN,iBAAkB,CAC5D,MAAM1kB,EAAUoX,EAAEsN,gBAAgBwK,KAAKptC,KACvCg4B,EAAKh4B,KAAOke,EACZ8Z,EAAK0N,SAAWpQ,EAAEsN,gBAAgBwK,KAClC9X,EAAEsN,gBAAgBwK,KAAKptC,KAAOg4B,EAC1B9Z,IACAA,EAAQwnB,SAAW1N,EAE3B,SACS1C,EAAEqN,aACPoK,GAAmBzX,EAAEqN,cACrBrN,EAAEqN,YAAYyK,KAAK1H,SAAU,CAC7B,MAAMxnB,EAAUoX,EAAEqN,YAAYyK,KAAK1H,SACnC1N,EAAK0N,SAAWxnB,EAChB8Z,EAAKh4B,KAAOs1B,EAAEqN,YAAYyK,KAC1B9X,EAAEqN,YAAYyK,KAAK1H,SAAW1N,EAC1B9Z,IACAA,EAAQle,KAAOg4B,EAEvB,MAEQrsD,KAAK6jC,OACL7jC,KAAK6jC,KAAKk2B,SAAW1N,GAEzBA,EAAKh4B,KAAOr0B,KAAK6jC,KACjB7jC,KAAK6jC,KAAOwoB,EAEE,OAAdA,EAAKh4B,OACLr0B,KAAKshE,KAAOjV,GAEhBrsD,KAAK0G,QACT,CACAg7D,WAAW/X,GACP,MAAMpX,EAAUoX,EAAE8X,KACbzhE,KAAK6jC,OAGL0O,EAAQwnB,UAUTxnB,EAAQwnB,SAAS1lC,KAAOke,EAAQle,KAC5Bke,EAAQle,KACRke,EAAQle,KAAK0lC,SAAWxnB,EAAQwnB,SAGhC/5D,KAAKshE,KAAO/uB,EAAQwnB,WAdxB/5D,KAAK6jC,KAAO0O,EAAQle,KAChBr0B,KAAK6jC,KACL7jC,KAAK6jC,KAAKk2B,SAAW,KAGrB/5D,KAAKshE,KAAO,MAYhB3X,EAAE8X,aACK9X,EAAE8X,KAEbzhE,KAAK0G,SACT,EAEJ,MAAMi7D,GAAUA,CAACr5D,EAAImiC,IAAc,GAAEniC,KAAMmiC,IAC3C,MAAMm3B,GACF7hE,cACIC,KAAK6hE,QAAS,EACd7hE,KAAK8hE,QAAS,EACd9hE,KAAK+hE,MAAQ,GACb/hE,KAAKi1C,WAAa,GAClBj1C,KAAKgiE,QAAU,GACfhiE,KAAKiiE,WAAa,GAClBjiE,KAAKkiE,SAAW,CAAC,EACjBliE,KAAKmiE,SAAW,IAAIC,IACpBpiE,KAAKqiE,SAAW,IAAID,IACpBpiE,KAAKsiE,WAAa,IAAIF,IACtBpiE,KAAKuiE,iBAAoBC,IACrBA,EAAUp6D,QAAQpI,KAAKyiE,iBACvBziE,KAAKsZ,MAAK,EAEdtZ,KAAKsZ,KAAO,KACR,GAAItZ,KAAK6hE,QAAU7hE,KAAK8hE,OACpB,OAEJ,MAAMY,EAAO,GACPC,EAAW,IAAIP,IACfQ,EAAU,IAAIvB,GACdwB,EAAalZ,IACf,IAAImZ,EAAKnZ,EACLoZ,EAASzV,GACb,KAAOyV,IAAWzV,IACdwV,EAAKA,GAAMA,EAAG9L,YACd+L,EAASD,GAAM9iE,KAAKgxD,OAAOzF,MAAMuX,GAErC,OAAOC,GAELC,EAAWrZ,IACb,IAAKA,EAAEziD,aAAe82D,GAAMrU,GACxB,OAEJ,MAAMlf,EAAWif,GAAaC,EAAEziD,YAC1BlH,KAAKgxD,OAAOzF,MAAMiS,GAAc7T,IAChC3pD,KAAKgxD,OAAOzF,MAAM5B,EAAEziD,YACpB67D,EAASF,EAAUlZ,GACzB,IAAiB,IAAblf,IAA8B,IAAXs4B,EACnB,OAAOH,EAAQpB,QAAQ7X,GAE3B,MAAM8N,EAAK1G,GAAoBpH,EAAG,CAC9BlmB,IAAKzjC,KAAKyjC,IACVutB,OAAQhxD,KAAKgxD,OACbC,WAAYjxD,KAAKixD,WACjBC,cAAelxD,KAAKkxD,cACpBT,YAAazwD,KAAKywD,YAClBU,gBAAiBnxD,KAAKmxD,gBACtBd,cAAerwD,KAAKqwD,cACpBE,gBAAiBvwD,KAAKuwD,gBACtBD,iBAAkBtwD,KAAKswD,iBACvBE,mBAAoBxwD,KAAKwwD,mBACzBY,WAAW,EACXa,mBAAmB,EACnBZ,iBAAkBrxD,KAAKqxD,iBACvB3E,iBAAkB1sD,KAAK0sD,iBACvBqC,gBAAiB/uD,KAAK+uD,gBACtBuC,WAAYtxD,KAAKsxD,WACjBxE,YAAa9sD,KAAK8sD,YAClByE,eAAgBvxD,KAAKuxD,eACrBC,eAAgBxxD,KAAKwxD,eACrBE,aAAc1xD,KAAK0xD,aACnBD,aAAczxD,KAAKyxD,aACnBE,YAAcsR,IACNrG,GAAmBqG,EAAUjjE,KAAKgxD,SAClChxD,KAAKkjE,cAAcC,UAAUF,GAE7BnG,GAAuBmG,EAAUjjE,KAAKgxD,SACtChxD,KAAKojE,kBAAkBC,iBAAiBJ,GAExClG,GAAcpT,IACd3pD,KAAKsjE,iBAAiBC,cAAc5Z,EAAEE,WAAY7pD,KAAKyjC,IAAG,EAGlEmuB,aAAcA,CAAC4R,EAAQC,MACnBzjE,KAAKkjE,cAAcQ,aAAaF,EAAQC,IACxCzjE,KAAKsjE,iBAAiBK,oBAAoBH,EAAM,EAEpD1R,iBAAkBA,CAACuH,EAAMoK,MACrBzjE,KAAKojE,kBAAkBQ,kBAAkBvK,EAAMoK,GAAO,IAG1DhM,IACAiL,EAAKz7D,KAAK,CACNwjC,WACAs4B,SACA1W,KAAMoL,IAEVkL,EAASp7C,IAAIkwC,EAAGnvD,IAAE,EAG1B,KAAOtI,KAAKiiE,WAAWv7D,QACnB1G,KAAKgxD,OAAO/E,kBAAkBjsD,KAAKiiE,WAAW4B,SAElD,UAAWla,KAAK3pD,KAAKqiE,SACbyB,GAAgB9jE,KAAKgiE,QAASrY,EAAG3pD,KAAKgxD,UACrChxD,KAAKqiE,SAAS/6C,IAAIqiC,EAAEziD,aAGzB87D,EAAQrZ,GAEZ,UAAWA,KAAK3pD,KAAKmiE,UACZ4B,GAAgB/jE,KAAKsiE,WAAY3Y,KACjCma,GAAgB9jE,KAAKgiE,QAASrY,EAAG3pD,KAAKgxD,SAGlC+S,GAAgB/jE,KAAKqiE,SAAU1Y,GAFpCqZ,EAAQrZ,GAMR3pD,KAAKsiE,WAAW/6C,IAAIoiC,GAG5B,IAAIhX,EAAY,KAChB,KAAOiwB,EAAQl8D,QAAQ,CACnB,IAAI2lD,EAAO,KACX,GAAI1Z,EAAW,CACX,MAAMlI,EAAWzqC,KAAKgxD,OAAOzF,MAAM5Y,EAAUtoC,MAAMnD,YAC7C67D,EAASF,EAAUlwB,EAAUtoC,QAClB,IAAbogC,IAA8B,IAAXs4B,IACnB1W,EAAO1Z,EAEf,CACA,IAAK0Z,EAAM,CACP,IAAI2X,EAAWpB,EAAQtB,KACvB,KAAO0C,GAAU,CACb,MAAMC,EAAQD,EAEd,GADAA,EAAWA,EAASjK,SAChBkK,EAAO,CACP,MAAMx5B,EAAWzqC,KAAKgxD,OAAOzF,MAAM0Y,EAAM55D,MAAMnD,YAE/C,IAAe,IADA27D,EAAUoB,EAAM55D,OAE3B,SACC,IAAiB,IAAbogC,EAAiB,CACtB4hB,EAAO4X,EACP,KACJ,CACK,CACD,MAAMC,GAAgBD,EAAM55D,MAC5B,GAAI65D,GAAch9D,YACdg9D,GAAch9D,WAAW0oD,WACrBkO,KAAKC,yBAIQ,IADA/9D,KAAKgxD,OAAOzF,MAFV2Y,GAAch9D,WAC5BsoB,MAEgB,CACjB68B,EAAO4X,EACP,KACJ,CAER,CACJ,CACJ,CACJ,CACA,IAAK5X,EAAM,CACP,KAAOuW,EAAQ/+B,MACX++B,EAAQlB,WAAWkB,EAAQ/+B,KAAKx5B,OAEpC,KACJ,CACAsoC,EAAY0Z,EAAK0N,SACjB6I,EAAQlB,WAAWrV,EAAKhiD,OACxB24D,EAAQ3W,EAAKhiD,MACjB,CACA,MAAMkqB,EAAU,CACZwtC,MAAO/hE,KAAK+hE,MACP55D,IAAKwkD,KACNrkD,GAAItI,KAAKgxD,OAAOzF,MAAMoB,EAAKN,MAC3BhiD,MAAOsiD,EAAKtiD,SAEXrC,OAAQ2kD,IAAUgW,EAASr7C,IAAIqlC,EAAKrkD,KACpCN,OAAQ2kD,GAAS3sD,KAAKgxD,OAAO1pC,IAAIqlC,EAAKrkD,KAC3C2sC,WAAYj1C,KAAKi1C,WACZ9sC,IAAKg8D,IACN,MAAQlvB,cAAekvB,EACvB,GAAgC,iBAArBlvB,EAAWmvB,MAAoB,CACtC,MAAMC,EAAYv9C,KAAKC,UAAUo9C,EAAUG,WACrCC,EAAiBz9C,KAAKC,UAAUo9C,EAAUK,kBAC5CH,EAAU39D,OAASuuC,EAAWmvB,MAAM19D,SAC/B29D,EAAYE,GAAgBh8D,MAAM,QAAQ7B,SAC3CuuC,EAAWmvB,MAAM77D,MAAM,QAAQ7B,SAC/BuuC,EAAWmvB,MAAQD,EAAUG,UAGzC,CACA,MAAO,CACHh8D,GAAItI,KAAKgxD,OAAOzF,MAAM4Y,EAAU9X,MAChCpX,WAAYA,EAChB,GAECjtC,OAAQm8D,IAAexB,EAASr7C,IAAI68C,EAAU77D,KAC9CN,OAAQm8D,GAAcnkE,KAAKgxD,OAAO1pC,IAAI68C,EAAU77D,KACrD05D,QAAShiE,KAAKgiE,QACdU,SAECnuC,EAAQwtC,MAAMr7D,SACd6tB,EAAQ0gB,WAAWvuC,SACnB6tB,EAAQytC,QAAQt7D,SAChB6tB,EAAQmuC,KAAKh8D,SAGlB1G,KAAK+hE,MAAQ,GACb/hE,KAAKi1C,WAAa,GAClBj1C,KAAKgiE,QAAU,GACfhiE,KAAKmiE,SAAW,IAAIC,IACpBpiE,KAAKqiE,SAAW,IAAID,IACpBpiE,KAAKsiE,WAAa,IAAIF,IACtBpiE,KAAKkiE,SAAW,CAAC,EACjBliE,KAAKykE,WAAWlwC,GAAO,EAE3Bv0B,KAAKyiE,gBAAmBiC,IACpB,GAAIlI,GAAUkI,EAAEr4D,OAAQrM,KAAKgxD,QACzB,OAEJ,IAAI2T,EACJ,IACIA,EAAgB78C,SAAS88C,eAAeC,oBAC5C,OAEIF,EAAgB3kE,KAAKyjC,GACzB,CACA,OAAQihC,EAAEt4D,MACN,IAAK,gBAAiB,CAClB,MAAM/B,EAAQq6D,EAAEr4D,OAAOqnD,aAClBwI,GAAUwI,EAAEr4D,OAAQrM,KAAKixD,WAAYjxD,KAAKkxD,cAAelxD,KAAKmxD,iBAAiB,IAChF9mD,IAAUq6D,EAAE1P,UACZh1D,KAAK+hE,MAAM96D,KAAK,CACZoD,MAAO+lD,GAAgBsU,EAAEr4D,OAAQrM,KAAKqwD,cAAerwD,KAAKswD,iBAAkBtwD,KAAKuwD,gBAAiBvwD,KAAKwwD,mBAAoBxwD,KAAKywD,cAAgBpmD,EAC1IrK,KAAKsxD,WACDtxD,KAAKsxD,WAAWjnD,GAChBA,EAAM4D,QAAQ,QAAS,KAC3B5D,EACNgiD,KAAMqY,EAAEr4D,SAGhB,KACJ,CACA,IAAK,aAAc,CACf,MAAMA,EAASq4D,EAAEr4D,OACjB,IAAIy4D,EAAgBJ,EAAEI,cAClBz6D,EAAQq6D,EAAEr4D,OAAOnE,aAAa48D,GAClC,GAAsB,UAAlBA,EAA2B,CAC3B,MAAM14D,EAAO6gD,GAAa5gD,GACpB3E,EAAU2E,EAAO3E,QACvB2C,EAAQ8iD,GAAc9gD,EAAQ3E,EAAS0E,GACvC,MAAM24D,EAAgBtY,GAAgB,CAClCC,iBAAkB1sD,KAAK0sD,iBACvBhlD,UACA0E,SAGJ/B,EAAQuiD,GAAe,CACnBC,SAFcuD,GAAgBsU,EAAEr4D,OAAQrM,KAAKqwD,cAAerwD,KAAKswD,iBAAkBtwD,KAAKuwD,gBAAiBvwD,KAAKwwD,mBAAoBuU,GAGlIt/B,QAASp5B,EACThC,QACAyiD,YAAa9sD,KAAK8sD,aAE1B,CACA,GAAIoP,GAAUwI,EAAEr4D,OAAQrM,KAAKixD,WAAYjxD,KAAKkxD,cAAelxD,KAAKmxD,iBAAiB,IAC/E9mD,IAAUq6D,EAAE1P,SACZ,OAEJ,IAAItnD,EAAO1N,KAAKi1C,WAAW3kB,KAAMzL,GAAMA,EAAEwnC,OAASqY,EAAEr4D,QACpD,GAAuB,WAAnBA,EAAO3E,SACW,QAAlBo9D,IACC9kE,KAAKgyD,gBAAgB3nD,GACtB,IAAKgC,EAAOgqD,gBAIR,OAHAyO,EAAgB,QAGhB,CAiBR,GAdKp3D,IACDA,EAAO,CACH2+C,KAAMqY,EAAEr4D,OACR4oC,WAAY,CAAC,EACbqvB,UAAW,CAAC,EACZE,iBAAkB,CAAC,GAEvBxkE,KAAKi1C,WAAWhuC,KAAKyG,IAEH,SAAlBo3D,GACmB,UAAnBz4D,EAAO3E,SAC8B,cAApCg9D,EAAE1P,UAAY,IAAIltD,eACnBuE,EAAO2pC,aAAa,sBAAuB,SAE1CwZ,GAAgBnjD,EAAO3E,QAASo9D,KACjCp3D,EAAKunC,WAAW6vB,GAAiBhW,GAAmB9uD,KAAKyjC,IAAK37B,GAAYuE,EAAO3E,SAAUI,GAAYg9D,GAAgBz6D,EAAOgC,EAAQrM,KAAK+uD,iBACrH,UAAlB+V,GAA2B,CAC3B,MAAME,EAAML,EAAcjhC,cAAc,QACpCghC,EAAE1P,UACFgQ,EAAIhvB,aAAa,QAAS0uB,EAAE1P,UAEhC,UAAWiQ,KAASp+D,MAAM6e,KAAKrZ,EAAO+3D,OAAQ,CAC1C,MAAMc,EAAW74D,EAAO+3D,MAAMe,iBAAiBF,GACzCG,EAAc/4D,EAAO+3D,MAAMiB,oBAAoBJ,GACjDC,IAAaF,EAAIZ,MAAMe,iBAAiBF,IACxCG,IAAgBJ,EAAIZ,MAAMiB,oBAAoBJ,GAE1Cv3D,EAAK42D,UAAUW,GADC,KAAhBG,EACwBF,EAGA,CAACA,EAAUE,GAIvC13D,EAAK82D,iBAAiBS,GAAS,CAACC,EAAUE,EAElD,CACA,UAAWH,KAASp+D,MAAM6e,KAAKs/C,EAAIZ,OACc,KAAzC/3D,EAAO+3D,MAAMe,iBAAiBF,KAC9Bv3D,EAAK42D,UAAUW,IAAS,EAGpC,CAEJ,KACJ,CACA,IAAK,YACD,GAAI/I,GAAUwI,EAAEr4D,OAAQrM,KAAKixD,WAAYjxD,KAAKkxD,cAAelxD,KAAKmxD,iBAAiB,GAC/E,OAEJuT,EAAEY,WAAWl9D,QAASuhD,GAAM3pD,KAAKulE,QAAQ5b,EAAG+a,EAAEr4D,SAC9Cq4D,EAAEc,aAAap9D,QAASuhD,IACpB,MAAM8b,EAASzlE,KAAKgxD,OAAOzF,MAAM5B,GAC3Blf,EAAWif,GAAagb,EAAEr4D,QAC1BrM,KAAKgxD,OAAOzF,MAAMmZ,EAAEr4D,OAAOmjB,MAC3BxvB,KAAKgxD,OAAOzF,MAAMmZ,EAAEr4D,QACtB6vD,GAAUwI,EAAEr4D,OAAQrM,KAAKixD,WAAYjxD,KAAKkxD,cAAelxD,KAAKmxD,iBAAiB,IAC/EqL,GAAU7S,EAAG3pD,KAAKgxD,UApnB9C,SAAS0U,GAAa/b,EAAGqH,GACrB,OAA2B,IAApBA,EAAOzF,MAAM5B,EACxB,CAmnB6B+b,CAAa/b,EAAG3pD,KAAKgxD,UAGtBhxD,KAAKmiE,SAAS76C,IAAIqiC,IAClBgc,GAAW3lE,KAAKmiE,SAAUxY,GAC1B3pD,KAAKsiE,WAAW/6C,IAAIoiC,IAEf3pD,KAAKmiE,SAAS76C,IAAIo9C,EAAEr4D,UAAsB,IAAXo5D,GAC/BhJ,GAAkBiI,EAAEr4D,OAAQrM,KAAKgxD,UACjChxD,KAAKqiE,SAAS/6C,IAAIqiC,IACvB3pD,KAAKkiE,SAASP,GAAQ8D,EAAQh7B,IAC9Bk7B,GAAW3lE,KAAKqiE,SAAU1Y,GAG1B3pD,KAAKgiE,QAAQ/6D,KAAK,CACdwjC,WACAniC,GAAIm9D,EACJ9M,YAAUjP,GAAagb,EAAEr4D,UAAWy9C,GAAkB4a,EAAEr4D,eAElD9I,KAGdvD,KAAKiiE,WAAWh7D,KAAK0iD,GAAC,GAIlC,EAEJ3pD,KAAKulE,QAAU,CAAC5b,EAAGt9C,KACf,IAAIrM,KAAK4lE,qBAAqBC,cAAclc,EAAG3pD,QAE3CA,KAAKmiE,SAAS76C,IAAIqiC,KAAM3pD,KAAKqiE,SAAS/6C,IAAIqiC,GAE9C,IAAI3pD,KAAKgxD,OAAO5E,QAAQzC,GAAI,CACxB,GAAI6S,GAAU7S,EAAG3pD,KAAKgxD,QAClB,OAEJhxD,KAAKqiE,SAAS96C,IAAIoiC,GAClB,IAAImc,EAAW,KACXz5D,GAAUrM,KAAKgxD,OAAO5E,QAAQ//C,KAC9By5D,EAAW9lE,KAAKgxD,OAAOzF,MAAMl/C,IAE7By5D,IAAyB,IAAbA,IACZ9lE,KAAKkiE,SAASP,GAAQ3hE,KAAKgxD,OAAOzF,MAAM5B,GAAImc,KAAa,EAEjE,MAEI9lE,KAAKmiE,SAAS56C,IAAIoiC,GAClB3pD,KAAKsiE,WAAW76C,OAAOkiC,GAEtBuS,GAAUvS,EAAG3pD,KAAKixD,WAAYjxD,KAAKkxD,cAAelxD,KAAKmxD,iBAAiB,KACzExH,EAAEuC,WAAW9jD,QAASowD,GAAWx4D,KAAKulE,QAAQ/M,IAC1CuE,GAAcpT,IACdA,EAAEE,WAAWqC,WAAW9jD,QAASowD,IAC7Bx4D,KAAK4lE,qBAAqBr+C,IAAIixC,EAAQx4D,MACtCA,KAAKulE,QAAQ/M,EAAQ7O,EAAC,GACzB,EAIjB,CACA71C,KAAK5N,GACD,CACI,aACA,aACA,gBACA,kBACA,cACA,gBACA,kBACA,mBACA,qBACA,mBACA,mBACA,kBACA,aACA,cACA,kBACA,eACA,eACA,iBACA,iBACA,MACA,SACA,gBACA,oBACA,mBACA,gBACA,wBACFkC,QAASb,IACPvH,KAAKuH,GAAOrB,EAAQqB,EAAG,EAE/B,CACAw+D,SACI/lE,KAAK6hE,QAAS,EACd7hE,KAAKgmE,cAAcD,QACvB,CACAE,WACIjmE,KAAK6hE,QAAS,EACd7hE,KAAKgmE,cAAcC,WACnBjmE,KAAKsZ,MACT,CACA4sD,WACI,OAAOlmE,KAAK6hE,MAChB,CACAsE,OACInmE,KAAK8hE,QAAS,EACd9hE,KAAKgmE,cAAcG,MACvB,CACAC,SACIpmE,KAAK8hE,QAAS,EACd9hE,KAAKgmE,cAAcI,SACnBpmE,KAAKsZ,MACT,CACAkzC,QACIxsD,KAAKsjE,iBAAiB9W,QACtBxsD,KAAKgmE,cAAcxZ,OACvB,EAEJ,SAASmZ,GAAWU,EAAS1c,GACzB0c,EAAQ5+C,OAAOkiC,GACfA,EAAEuC,WAAW9jD,QAASowD,GAAWmN,GAAWU,EAAS7N,GACzD,CACA,SAASsL,GAAgB9B,EAASrY,EAAGqH,GACjC,OAAuB,IAAnBgR,EAAQt7D,QAEL4/D,GAAiBtE,EAASrY,EAAGqH,EACxC,CACA,SAASsV,GAAiBtE,EAASrY,EAAGqH,GAClC,MAAQ9pD,cAAeyiD,EACvB,IAAKziD,EACD,OAAO,EAEX,MAAMujC,EAAWumB,EAAOzF,MAAMrkD,GAC9B,QAAI86D,EAAQr3D,KAAM47D,GAAMA,EAAEj+D,KAAOmiC,IAG1B67B,GAAiBtE,EAAS96D,EAAY8pD,EACjD,CACA,SAAS+S,GAAgBt2D,EAAKk8C,GAC1B,OAAiB,IAAbl8C,EAAI+4D,MAEDC,GAAiBh5D,EAAKk8C,EACjC,CACA,SAAS8c,GAAiBh5D,EAAKk8C,GAC3B,MAAQziD,cAAeyiD,EACvB,QAAKziD,MAGDuG,EAAI6Z,IAAIpgB,IAGLu/D,GAAiBh5D,EAAKvG,GACjC,CAEA,IAAIw/D,GAOJ,MAAMC,GAAmBxmB,GAChBumB,GAGiBE,IAAIpsC,KACtB,IACI,OAAO2lB,KAAM3lB,EACjB,OACO9L,GACH,GAAIg4C,KAAwC,IAAxBA,GAAah4C,GAC7B,MAAO,OAGX,MAAMA,CACV,GAZOyxB,EAiBf,SAAS0mB,GAAiBze,GAAO,IAAIC,EAA+Bh+C,EAAQ+9C,EAAI,GAAQ3gD,EAAI,EAAG,KAAOA,EAAI2gD,EAAI1hD,QAAQ,CAAE,MAAMoR,EAAKswC,EAAI3gD,GAAUwe,EAAKmiC,EAAI3gD,EAAI,GAAY,GAARA,GAAK,GAAe,mBAAPqQ,GAAkC,iBAAPA,IAAmC,MAATzN,EAAiB,OAA+B,WAAPyN,GAA0B,mBAAPA,GAA2BuwC,EAAgBh+C,EAAOA,EAAQ4b,EAAG5b,KAA0B,SAAPyN,GAAwB,iBAAPA,KAAyBzN,EAAQ4b,EAAG,IAAIrc,IAASS,EAAM3F,KAAK2jD,KAAkBz+C,IAAQy+C,OAAgB9kD,EAAa,CAAE,OAAO8G,CAAO,CACpgB,MAAMy8D,GAAkB,GACxB,SAASxlC,GAAe/yB,GACpB,IACI,GAAI,iBAAkBA,EAAO,CACzB,MAAMkhB,EAAOlhB,EAAMw4D,eACnB,GAAIt3C,EAAK/oB,OACL,OAAO+oB,EAAK,EAEpB,SACS,SAAUlhB,GAASA,EAAMkhB,KAAK/oB,OACnC,OAAO6H,EAAMkhB,KAAK,EAE1B,OAEA,CACA,OAAOlhB,GAASA,EAAMlC,MAC1B,CACA,SAAS26D,GAAqB9gE,EAAS+gE,GACnC,MAAMC,EAAiB,IAAItF,GAC3BkF,GAAgB7/D,KAAKigE,GACrBA,EAAepzD,KAAK5N,GACpB,IAAIihE,EAAuBzjE,OAAO0jE,kBAC9B1jE,OAAO2jE,qBACX,MAAMC,EAAoBT,GAAiB,CAACnjE,OAAQ,iBAAkB0N,GAAKA,EAAEkhC,KAAM,iBAAkBsX,GAAMA,EAAG2d,WAAY,eAAgB5b,GAAMA,EAAG,sBAC/I2b,GACA5jE,OAAO4jE,KACPH,EAAuBzjE,OAAO4jE,IAElC,MAAME,EAAW,IAAIL,EAAqBR,GAAiBnE,IACnDt8D,EAAQuhE,aAAgD,IAAlCvhE,EAAQuhE,WAAWjF,IAG7C0E,EAAe3E,iBAAiBx1C,KAAKm6C,EAArCA,CAAqD1E,EAAS,IAElEgF,SAAS9nB,QAAQunB,EAAQ,CACrBhyB,YAAY,EACZyyB,mBAAmB,EACnBC,eAAe,EACfC,uBAAuB,EACvBC,WAAW,EACXC,SAAS,IAENN,CACX,CAoJA,SAASO,IAAqBC,WAAUvkC,MAAKutB,SAAQC,aAAYC,gBAAeC,kBAAiB8W,aAwB7F,OAAOp7C,GAAG,SAvBa85C,GAAgB9M,GAAW8M,GAAiBl8C,IAC/D,MAAMpe,EAASi1B,GAAe7W,GAC9B,IAAKpe,GACD6vD,GAAU7vD,EAAQ4kD,EAAYC,EAAeC,GAAiB,GAC9D,OAEJ,MAAM7oD,EAAK0oD,EAAOzF,MAAMl/C,GACxB,GAAIA,IAAWo3B,GAAOA,EAAIykC,YAAa,CACnC,MAAMC,EAAgBnN,GAAgBv3B,EAAIykC,aAC1CF,EAAS,CACL1/D,KACA6rD,EAAGgU,EAAclN,KACjB5G,EAAG8T,EAAc7mD,KAEzB,MAEI0mD,EAAS,CACL1/D,KACA6rD,EAAG9nD,EAAOupD,WACVvB,EAAGhoD,EAAOypD,WACb,GAELmS,EAASG,QAAU,MACa3kC,EACxC,CAkBA,MAAM4kC,GAAa,CAAC,QAAS,WAAY,UACnCC,GAAoB,IAAIp9C,QAC9B,SAASq9C,IAAoBC,UAAS/kC,MAAKutB,SAAQC,aAAYC,gBAAeC,kBAAiBsX,cAAaC,iBAAgBhc,mBAAkBI,cAAamb,WAAUU,uBAAsBtY,gBAAeE,mBAAiBD,oBAAkBE,wBACzO,SAASoY,GAAar6D,IAClB,IAAIlC,GAASi1B,GAAe/yB,IAC5B,MAAMs6D,GAAgBt6D,GAAMu6D,UACtBphE,GAAU2E,IAAU81B,GAAY91B,GAAO3E,SAG7C,GAFgB,WAAZA,KACA2E,GAASA,GAAOqkD,gBACfrkD,KACA3E,IACD2gE,GAAW37C,QAAQhlB,IAAW,GAC9Bw0D,GAAU7vD,GAAQ4kD,EAAYC,EAAeC,GAAiB,GAC9D,OAEJ,MAAM9pD,GAAKgF,GACX,GAAIhF,GAAG8oD,UAAU6C,SAASyV,IACrBC,GAAkBrhE,GAAG0oD,QAAQ2Y,GAC9B,OAEJ,MAAMt8D,GAAO6gD,GAAa5gD,IAC1B,IAAIsgD,GAAOQ,GAAc9lD,GAAIK,GAAS0E,IAClC28D,IAAY,EAChB,MAAMhE,GAAgBtY,GAAgB,CAClCC,mBACAhlD,WACA0E,UAEEwnD,GAAYxD,GAAgB/jD,GAAQgkD,EAAeC,GAAkBC,GAAiBC,GAAoBuU,KACnG,UAAT34D,IAA6B,aAATA,MACpB28D,GAAY18D,GAAOsnD,SAEvBhH,GAAOC,GAAe,CAClBC,SAAU+G,GACVnuB,QAASp5B,GACThC,MAAOsiD,GACPG,gBAEJkc,GAAY38D,GAAQs8D,EACd,CAAEhc,QAAMoc,aAAWF,kBACnB,CAAElc,QAAMoc,eACd,MAAMhlE,GAAOsI,GAAOtI,KACP,UAATqI,IAAoBrI,IAAQglE,IAC5BtlC,EACKwlC,iBAAkB,6BAA4BllE,QAC9CqE,QAASf,KACV,GAAIA,KAAOgF,GAAQ,CACf,MAAMsgD,GAAOC,GAAe,CACxBC,SAAU+G,GACVnuB,QAASp+B,GACTgD,MAAO8iD,GAAc9lD,GAAIK,GAAS0E,IAClC0gD,gBAEJkc,GAAY3hE,GAAIshE,EACV,CAAEhc,QAAMoc,WAAYA,GAAWF,eAAe,GAC9C,CAAElc,QAAMoc,WAAYA,IAC9B,GAGZ,CACA,SAASC,GAAY38D,GAAQ68D,IACzB,MAAMC,GAAiBb,GAAkB/6D,IAAIlB,IAC7C,IAAK88D,IACDA,GAAexc,OAASuc,GAAEvc,MAC1Bwc,GAAeJ,YAAcG,GAAEH,UAAW,CAC1CT,GAAkB76D,IAAIpB,GAAQ68D,IAC9B,MAAM5gE,GAAK0oD,EAAOzF,MAAMl/C,IACxBs6D,GAAgB6B,EAAhB7B,CAAyB,IAClBuC,GACH5gE,OAER,CACJ,CAEA,MAAMspB,IAD4B,SAAnBq2C,EAAS/9D,MAAmB,CAAC,UAAY,CAAC,QAAS,WAC1C/B,IAAKwjC,IAAc9e,GAAG8e,GAAWg7B,GAAgBiC,IAAenlC,IAClF2lC,GAAgB3lC,EAAIykC,YAC1B,IAAKkB,GACD,MAAO,KACHx3C,GAASxpB,QAASihE,IAAMA,KAAG,EAGnC,MAAMC,GAAqBF,GAAc/kE,OAAOi7B,yBAAyB8pC,GAAcG,iBAAiBjlE,UAAW,SASnH,OAAIglE,IAAsBA,GAAmB77D,KACzCmkB,GAAS3qB,QATU,CACnB,CAACmiE,GAAcG,iBAAiBjlE,UAAW,SAC3C,CAAC8kE,GAAcG,iBAAiBjlE,UAAW,WAC3C,CAAC8kE,GAAcI,kBAAkBllE,UAAW,SAC5C,CAAC8kE,GAAcK,oBAAoBnlE,UAAW,SAC9C,CAAC8kE,GAAcI,kBAAkBllE,UAAW,iBAC5C,CAAC8kE,GAAcM,kBAAkBplE,UAAW,aAGZ6D,IAAK4c,IAAMo1C,GAAWp1C,GAAE,GAAIA,GAAE,GAAI,CAC9DtX,MACIk5D,GAAgBiC,GAAhBjC,CAA8B,CAC1Bt6D,OAAQrM,KACR8oE,WAAW,GAEnB,IACD,EAAOM,MAEPzC,GAAgB,KACnB/0C,GAASxpB,QAASihE,IAAMA,KAAG,EAEnC,CACA,SAASM,GAA0Brf,GAsB/B,OApBA,SAASsf,EAAQC,EAAW5a,GACxB,GAAK6a,GAAiB,oBAClBD,EAAUE,sBAAsBC,iBAC/BF,GAAiB,iBACdD,EAAUE,sBAAsBE,cACnCH,GAAiB,oBACdD,EAAUE,sBAAsBG,iBACnCJ,GAAiB,qBACdD,EAAUE,sBAAsBI,iBAAmB,CAEvD,MAAM72D,EADQzM,MAAM6e,KAAKmkD,EAAUE,WAAW7f,UAC1Bx9B,QAAQm9C,GAC5B5a,EAAImb,QAAQ92D,EAChB,SACSu2D,EAAUQ,iBAAkB,CAEjC,MAAM/2D,EADQzM,MAAM6e,KAAKmkD,EAAUQ,iBAAiBngB,UAChCx9B,QAAQm9C,GAC5B5a,EAAImb,QAAQ92D,EAChB,CACA,OAAO27C,CACX,CACO2a,CAAQtf,EArBG,GAsBtB,CACA,SAASggB,GAAgB9W,EAAOxC,EAAQuZ,GACpC,IAAIjiE,EAAIkiE,EACR,OAAKhX,GAEDA,EAAMiX,UACNniE,EAAK0oD,EAAOzF,MAAMiI,EAAMiX,WAExBD,EAAUD,EAAYhf,MAAMiI,GACzB,CACHgX,UACAliE,OAPO,CAAC,CAShB,CA+IA,SAASoiE,IAAgC1Z,SAAQoS,qBAAsB5zC,GACnE,IAAIm7C,EAAS,KAETA,EAAS3Z,EAAOzF,MADE,cAAlB/7B,EAAKqtC,SACiBrtC,EAEAA,EAAKA,MAC/B,MAAMo7C,EACA/D,GADgC,cAAlBr3C,EAAKqtC,SACF,CAACrtC,EAAM,SAAUq8B,GAAMA,EAAGqc,YAAa,iBAAkBpc,GAAMA,EAAGzC,UAClE,CAAC75B,EAAM,SAAU0nC,GAAMA,EAAG+G,cAAe,iBAAkB9G,GAAMA,EAAG+Q,YAAa,iBAAkB9Q,GAAMA,EAAGyT,aAC7HC,EAA6BjE,GAAiB,CAAC+D,EAAa,iBAAkBtP,GAAMA,EAAGh3D,YACvFD,OAAOi7B,yBAAyBunC,GAAiB,CAAC+D,EAAa,iBAAkBrP,GAAOA,EAAIj3D,YAAa,2BACzGf,EACN,OAAe,OAAXonE,IACW,IAAXA,GACCC,GACAE,GAGLzmE,OAAOmH,eAAegkB,EAAM,qBAAsB,CAC9C9jB,aAAco/D,EAA2Bp/D,aACzCgvD,WAAYoQ,EAA2BpQ,WACvCntD,MACI,OAAOs5D,GAAiB,CAACiE,EAA4B,SAAUtP,GAAOA,EAAIjuD,IAAK,iBAAkBkuD,GAAOA,EAAI/2D,KAAM,OAAQg3D,GAAOA,EAAI17D,OACzI,EACAyN,IAAIs9D,GACA,MAAM14D,EAASw0D,GAAiB,CAACiE,EAA4B,SAAUnP,GAAOA,EAAIluD,IAAK,iBAAkBu9D,GAAOA,EAAItmE,KAAM,OAAQumE,GAAOA,EAAIjrE,KAAM+qE,KACnJ,GAAe,OAAXJ,IAA8B,IAAXA,EACnB,IACIvH,EAAkB8H,iBAAiBH,EAAQJ,EAC/C,OAEA,CAEJ,OAAOt4D,CACX,IAEGs0D,GAAgB,KACnBtiE,OAAOmH,eAAegkB,EAAM,qBAAsB,CAC9C9jB,aAAco/D,EAA2Bp/D,aACzCgvD,WAAYoQ,EAA2BpQ,WACvCntD,IAAKu9D,EAA2Bv9D,IAChCE,IAAKq9D,EAA2Br9D,KACnC,IA1BM,MA4Bf,CA2KA,SAAS09D,GAAcntD,EAAG+Y,EAAS,CAAC,GAChC,MAAMqyC,EAAgBprD,EAAEylB,IAAIykC,YAC5B,IAAKkB,EACD,MAAO,OAGX,MAAMgC,EAAmBpE,GAAqBhpD,EAAGA,EAAEylB,KAC7C4nC,EAvrBV,SAASC,IAAmBC,cAAatD,WAAUxkC,MAAKutB,WACpD,IAA2B,IAAvBiX,EAASuD,UACT,MAAO,OAGX,MAAMn7D,EAA0C,iBAAvB43D,EAASuD,UAAyBvD,EAASuD,UAAY,GAC1EC,EAA0D,iBAA/BxD,EAASyD,kBACpCzD,EAASyD,kBACT,IACN,IACIC,EADAC,EAAY,GAEhB,MAAMC,EAAYhS,GAAW8M,GAAiBz7D,IAC1C,MAAM4gE,EAAcl8D,KAAKC,MAAQ87D,EACjCJ,EAAYK,EAAUzjE,IAAK4c,KACvBA,GAAEgnD,YAAcD,EACT/mD,KACP7Z,GACJ0gE,EAAY,GACZD,EAAe,OACfF,GACEO,EAAiBrF,GAAgB9M,GAAW8M,GAAiBl8C,IAC/D,MAAMpe,EAASi1B,GAAe7W,IACtBwhD,WAASC,YAAYxP,GAAoBjyC,GAC3CA,EAAIkyC,eAAe,GACnBlyC,EACDkhD,IACDA,EAAe5Q,MAEnB6Q,EAAU3kE,KAAK,CACXktD,EAAG8X,GACH5X,EAAG6X,GACH5jE,GAAI0oD,EAAOzF,MAAMl/C,GACjB0/D,WAAYhR,KAAiB4Q,IAEjCE,SAAiBM,UAAc,KAAe1hD,aAAe0hD,UACvDrN,GAAkBc,KAClBn1C,aAAe2hD,WACXtN,GAAkBG,UAClBH,GAAkBQ,UAAS,GACrCjvD,EAAW,CACX6pD,UAAU,KAERtoC,EAAW,CACb/E,GAAG,YAAam/C,EAAgBvoC,GAChC5W,GAAG,YAAam/C,EAAgBvoC,GAChC5W,GAAG,OAAQm/C,EAAgBvoC,IAE/B,OAAOkjC,GAAgB,KACnB/0C,EAASxpB,QAASihE,GAAMA,IAAG,EAEnC,CAqoB6BiC,CAAiBttD,GACpCquD,EAroBV,SAASC,IAA+BC,qBAAoB9oC,MAAKutB,SAAQC,aAAYC,gBAAeC,kBAAiB8W,aACjH,IAAkC,IAA9BA,EAASuE,iBACT,MAAO,OAGX,MAAMC,GAA2C,IAA9BxE,EAASuE,uBACMjpE,IAA9B0kE,EAASuE,iBACP,CAAC,EACDvE,EAASuE,iBACT56C,EAAW,GACjB,IAAI86C,EAAqB,KA8DzBroE,cAAO8E,KAAK82D,IACPj4D,OAAQT,GAAQwzB,OAAOt1B,MAAMs1B,OAAOxzB,MACpCA,EAAI2+C,SAAS,eACM,IAApBumB,EAAWllE,IACVa,QAASukE,IACV,IAAIhhC,EAAY7jC,GAAY6kE,GAC5B,MAAM35D,GAnEU25D,IACRp+D,IACJ,MAAMlC,GAASi1B,GAAe/yB,GAC9B,GAAI2tD,GAAU7vD,GAAQ4kD,EAAYC,EAAeC,GAAiB,GAC9D,OAEJ,IAAIyb,GAAc,KACdC,GAAeF,EACnB,GAAI,gBAAiBp+D,EAAO,CACxB,OAAQA,EAAMq+D,aACV,IAAK,QACDA,GAAc9L,GAAaE,MAC3B,MACJ,IAAK,QACD4L,GAAc9L,GAAaI,MAC3B,MACJ,IAAK,MACD0L,GAAc9L,GAAaG,IAG/B2L,KAAgB9L,GAAaI,QACzBjB,GAAkB0M,KAAc1M,GAAkBG,UAClDyM,GAAe,aAEV5M,GAAkB0M,KAAc1M,GAAkBE,UACvD0M,GAAe,YAI3B,MACSnQ,GAAoBnuD,KACzBq+D,GAAc9L,GAAaI,OAEX,OAAhB0L,IACAF,EAAqBE,IAChBC,GAAa3kD,WAAW,UACzB0kD,KAAgB9L,GAAaI,OAC5B2L,GAAa3kD,WAAW,UACrB0kD,KAAgB9L,GAAaE,SACjC4L,GAAc,OAGb3M,GAAkB0M,KAAc1M,GAAkBI,QACvDuM,GAAcF,EACdA,EAAqB,MAEzB,MAAMx6D,GAAIwqD,GAAoBnuD,GAASA,EAAMouD,eAAe,GAAKpuD,EACjE,IAAK2D,GACD,OAEJ,MAAM5J,GAAK0oD,EAAOzF,MAAMl/C,KAChB4/D,WAASC,YAAYh6D,GAC7By0D,GAAgB4F,EAAhB5F,CAAoC,CAChCv6D,KAAM6zD,GAAkB4M,IACxBvkE,MACA6rD,EAAG8X,GACH5X,EAAG6X,MACiB,OAAhBU,IAAwB,CAAEA,iBACjC,EASWE,CAAWH,GAC3B,GAAIjpE,OAAOqpE,aACP,OAAQ9M,GAAkB0M,IACtB,KAAK1M,GAAkBG,UACvB,KAAKH,GAAkBE,QACnBx0B,EAAYA,EAAU19B,QAAQ,QAAS,WACvC,MACJ,KAAKgyD,GAAkBS,WACvB,KAAKT,GAAkBW,SACnB,OAGZhvC,EAAS3qB,KAAK4lB,GAAG8e,EAAW34B,GAASywB,GAAI,GAEtCkjC,GAAgB,KACnB/0C,EAASxpB,QAASihE,GAAMA,IAAG,EAEnC,CAsiBoCiD,CAA6BtuD,GACvDgvD,EAAgBjF,GAAmB/pD,GACnCivD,EA7gBV,SAASC,IAA6BC,qBAAsBrU,QACxD,IAAIsU,GAAQ,EACRC,GAAQ,EAaZ,OAAOxgD,GAAG,SAZc85C,GAAgB9M,GAAW8M,GAAgB,KAC/D,MAAMrgE,EAASs1D,KACTxH,EAAQ2H,MACVqR,IAAU9mE,GAAU+mE,IAAUjZ,KAC9B+Y,EAAiB,CACb/Y,MAAOr5B,OAAOq5B,GACd9tD,OAAQy0B,OAAOz0B,KAEnB8mE,EAAQ9mE,EACR+mE,EAAQjZ,KAEZ,MACiC0E,EACzC,CA6fkCoU,CAA2BlvD,EAAG,CACxD86C,IAAKsQ,IAEHkE,EAAe/E,GAAkBvqD,GACjCuvD,EAtIV,SAASC,IAA+BC,qBAAoBxc,aAAYC,gBAAeC,kBAAiBH,SAAQiX,WAAUxkC,QACtH,MAAMzwB,EAAU2zD,GAAiBv6D,GAASytD,GAAW8M,GAAiBp4D,IAClE,MAAMlC,EAASi1B,GAAe/yB,GAC9B,IAAKlC,GACD6vD,GAAU7vD,EAAQ4kD,EAAYC,EAAeC,GAAiB,GAC9D,OAEJ,MAAQwE,cAAa+X,UAAQC,SAAOC,iBAAiBvhE,EACrDohE,EAAmB,CACfrhE,OACA9D,GAAI0oD,EAAOzF,MAAMl/C,GACjBspD,cACA+X,UACAC,SACAC,iBACH,GACD3F,EAASnd,OAAS,MAChBl5B,EAAW,CACb/E,GAAG,OAAQ7Z,EAAQ,GAAIywB,GACvB5W,GAAG,QAAS7Z,EAAQ,GAAIywB,GACxB5W,GAAG,SAAU7Z,EAAQ,GAAIywB,GACzB5W,GAAG,eAAgB7Z,EAAQ,GAAIywB,GAC/B5W,GAAG,aAAc7Z,EAAQ,GAAIywB,IAEjC,OAAOkjC,GAAgB,KACnB/0C,EAASxpB,QAASihE,GAAMA,IAAG,EAEnC,CA2GoCmE,CAA6BxvD,GACvD6vD,EApXV,SAASC,IAAyBC,mBAAkB/c,SAAQoS,sBAAuBtK,QAC/E,IAAKA,EAAIkV,gBAAkBlV,EAAIkV,cAAc1pE,UACzC,MAAO,OAGX,MAAM2pE,EAAanV,EAAIkV,cAAc1pE,UAAU2pE,WAC/CnV,EAAIkV,cAAc1pE,UAAU2pE,WAAa,IAAItT,MAAMsT,EAAY,CAC3DrqD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,EAASC,KACrC,MAAO7jB,GAAMh3C,IAAS66D,GACd7lE,MAAIkiE,YAAYF,GAAgB4D,EAASld,EAAQoS,EAAkBmH,aAC3E,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCuD,EAAiB,CACbzlE,MACAkiE,WACA9H,KAAM,CAAC,CAAEpY,QAAMh3C,aAGhBjH,EAAOuX,MAAMsqD,EAASC,EAAa,KAGlD,MAAMC,EAAatV,EAAIkV,cAAc1pE,UAAU8pE,WAe/C,IAAIngE,EAkBAogE,EAhCJvV,EAAIkV,cAAc1pE,UAAU8pE,WAAa,IAAIzT,MAAMyT,EAAY,CAC3DxqD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,EAASC,KACrC,MAAO76D,IAAS66D,GACR7lE,MAAIkiE,YAAYF,GAAgB4D,EAASld,EAAQoS,EAAkBmH,aAC3E,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCuD,EAAiB,CACbzlE,MACAkiE,WACAxI,QAAS,CAAC,CAAE1uD,aAGbjH,EAAOuX,MAAMsqD,EAASC,EAAa,KAI9CrV,EAAIkV,cAAc1pE,UAAU2J,UAC5BA,EAAU6qD,EAAIkV,cAAc1pE,UAAU2J,QACtC6qD,EAAIkV,cAAc1pE,UAAU2J,QAAU,IAAI0sD,MAAM1sD,EAAS,CACrD2V,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,EAASC,KACrC,MAAOxhB,IAAQwhB,GACP7lE,MAAIkiE,YAAYF,GAAgB4D,EAASld,EAAQoS,EAAkBmH,aAC3E,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCuD,EAAiB,CACbzlE,MACAkiE,WACAv8D,QAAS0+C,KAGVtgD,EAAOuX,MAAMsqD,EAASC,EAAa,MAKlDrV,EAAIkV,cAAc1pE,UAAU+pE,cAC5BA,EAAcvV,EAAIkV,cAAc1pE,UAAU+pE,YAC1CvV,EAAIkV,cAAc1pE,UAAU+pE,YAAc,IAAI1T,MAAM0T,EAAa,CAC7DzqD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,EAASC,KACrC,MAAOxhB,IAAQwhB,GACP7lE,MAAIkiE,YAAYF,GAAgB4D,EAASld,EAAQoS,EAAkBmH,aAC3E,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCuD,EAAiB,CACbzlE,MACAkiE,WACA6D,YAAa1hB,KAGdtgD,EAAOuX,MAAMsqD,EAASC,EAAa,MAItD,MAAMG,EAA8B,CAAC,EACjCC,GAA4B,mBAC5BD,EAA4BtE,gBAAkBlR,EAAIkR,iBAG9CuE,GAA4B,kBAC5BD,EAA4BrE,aAAenR,EAAImR,cAE/CsE,GAA4B,sBAC5BD,EAA4BnE,iBAAmBrR,EAAIqR,kBAEnDoE,GAA4B,qBAC5BD,EAA4BpE,gBAAkBpR,EAAIoR,kBAG1D,MAAMsE,EAAsB,CAAC,EAC7BnqE,cAAO2R,QAAQs4D,GAA6BlmE,QAAQ,EAAEqmE,EAASriE,MAC3DoiE,EAAoBC,GAAW,CAC3BR,WAAY7hE,EAAK9H,UAAU2pE,WAC3BG,WAAYhiE,EAAK9H,UAAU8pE,YAE/BhiE,EAAK9H,UAAU2pE,WAAa,IAAItT,MAAM6T,EAAoBC,GAASR,WAAY,CAC3ErqD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,GAASC,MACrC,MAAO7jB,GAAMh3C,IAAS66D,IACd7lE,MAAIkiE,YAAYF,GAAgB4D,GAAQ7D,iBAAkBrZ,EAAQoS,EAAkBmH,aAC5F,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCuD,EAAiB,CACbzlE,MACAkiE,WACA9H,KAAM,CACF,CACIpY,QACAh3C,MAAO,IACAq2D,GAA0BuE,IAC7B56D,IAAS,OAMtBjH,EAAOuX,MAAMsqD,GAASC,GAAa,KAGlD/hE,EAAK9H,UAAU8pE,WAAa,IAAIzT,MAAM6T,EAAoBC,GAASL,WAAY,CAC3ExqD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,GAASC,MACrC,MAAO76D,IAAS66D,IACR7lE,MAAIkiE,YAAYF,GAAgB4D,GAAQ7D,iBAAkBrZ,EAAQoS,EAAkBmH,aAC5F,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCuD,EAAiB,CACbzlE,MACAkiE,WACAxI,QAAS,CACL,CAAE1uD,MAAO,IAAIq2D,GAA0BuE,IAAU56D,QAItDjH,EAAOuX,MAAMsqD,GAASC,GAAa,IAEjD,GAEExH,GAAgB,KACnB7N,EAAIkV,cAAc1pE,UAAU2pE,WAAaA,EACzCnV,EAAIkV,cAAc1pE,UAAU8pE,WAAaA,EACzCngE,IAAY6qD,EAAIkV,cAAc1pE,UAAU2J,QAAUA,GAClDogE,IAAgBvV,EAAIkV,cAAc1pE,UAAU+pE,YAAcA,GAC1DhqE,OAAO2R,QAAQs4D,GAA6BlmE,QAAQ,EAAEqmE,EAASriE,MAC3DA,EAAK9H,UAAU2pE,WAAaO,EAAoBC,GAASR,WACzD7hE,EAAK9H,UAAU8pE,WAAaI,EAAoBC,GAASL,YAC5D,EAET,CAuO+BN,CAAuB9vD,EAAG,CAAE86C,IAAKsQ,IACtDsF,EAA4BhE,GAA8B1sD,EAAGA,EAAEylB,KAC/DkrC,EA3LV,SAASC,IAA+BC,qBAAoB7d,SAAQ8d,sBAAqB1L,sBAAwBtK,QAC7G,MAAMiW,EAAcjW,EAAIkW,oBAAoB1qE,UAAUyqE,YACtDjW,EAAIkW,oBAAoB1qE,UAAUyqE,YAAc,IAAIpU,MAAMoU,EAAa,CACnEnrD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,EAASC,KACrC,MAAOthE,EAAUxC,EAAO4kE,GAAYd,EACpC,GAAIW,EAAoBxnD,IAAIza,GACxB,OAAOkiE,EAAYnrD,MAAMsqD,EAAS,CAACrhE,EAAUxC,EAAO4kE,IAExD,MAAQ3mE,MAAIkiE,YAAYF,GAAgBzD,GAAiB,CAACqH,EAAS,SAAUgB,IAAOA,GAAInF,WAAY,iBAAkB/M,IAAOA,GAAIqN,mBAAoBrZ,EAAQoS,EAAkBmH,aAC/K,OAAKjiE,KAAa,IAAPA,IAAekiE,KAAuB,IAAZA,KACjCqE,EAAmB,CACfvmE,MACAkiE,WACA/8D,IAAK,CACDZ,WACAxC,QACA4kE,YAEJ37D,MAAOq2D,GAA0BuE,EAAQnE,cAG1C19D,EAAOuX,MAAMsqD,EAASC,EAAa,KAGlD,MAAMgB,EAAiBrW,EAAIkW,oBAAoB1qE,UAAU6qE,eACzDrW,SAAIkW,oBAAoB1qE,UAAU6qE,eAAiB,IAAIxU,MAAMwU,EAAgB,CACzEvrD,MAAO+iD,GAAgB,CAACt6D,EAAQ6hE,EAASC,KACrC,MAAOthE,GAAYshE,EACnB,GAAIW,EAAoBxnD,IAAIza,GACxB,OAAOsiE,EAAevrD,MAAMsqD,EAAS,CAACrhE,IAE1C,MAAQvE,KAAIkiE,WAAYF,GAAgBzD,GAAiB,CAACqH,EAAS,SAAUxQ,IAAOA,GAAIqM,WAAY,iBAAkBnM,IAAOA,GAAIyM,mBAAoBrZ,EAAQoS,EAAkBmH,aAC/K,OAAKjiE,IAAa,IAAPA,GAAekiE,IAAuB,IAAZA,IACjCqE,EAAmB,CACfvmE,KACAkiE,UACAt8B,OAAQ,CACJrhC,YAEJyG,MAAOq2D,GAA0BuE,EAAQnE,cAG1C19D,EAAOuX,MAAMsqD,EAASC,EAAa,KAG3CxH,GAAgB,KACnB7N,EAAIkW,oBAAoB1qE,UAAUyqE,YAAcA,EAChDjW,EAAIkW,oBAAoB1qE,UAAU6qE,eAAiBA,GAE3D,CA0IqCP,CAA6B5wD,EAAG,CAC7D86C,IAAKsQ,IAEHgG,GAAepxD,EAAEqxD,aAhH3B,SAASC,IAAmBC,SAAQ9rC,QAChC,MAAMq1B,EAAMr1B,EAAIykC,YAChB,IAAKpP,EACD,MAAO,OAGX,MAAMlnC,EAAW,GACX49C,EAAU,IAAItkD,QACdukD,EAAmB3W,EAAI4W,SAC7B5W,EAAI4W,SAAW,SAAkBC,EAAQzkE,EAAQ0kE,GAC7C,MAAMC,EAAW,IAAIJ,EAAiBE,EAAQzkE,EAAQ0kE,GACtDJ,SAAQ/hE,IAAIoiE,EAAU,CAClBF,SACA56C,OAA0B,iBAAX7pB,EACf0kE,cACAE,WAA8B,iBAAX5kE,EACbA,EACA4b,KAAKC,UAAUlgB,MAAM6e,KAAK,IAAItX,WAAWlD,OAE5C2kE,CACX,EACA,MAAME,EAAiBzV,GAAM72B,EAAIusC,MAAO,MAAO,SAAU5kE,GACrD,OAAO,SAAUykE,GACbxwC,kBAAWsnC,GAAgB,KACvB,MAAM5hD,EAAIyqD,EAAQjiE,IAAIsiE,GAClB9qD,IACAwqD,EAAOxqD,GACPyqD,EAAQ/nD,OAAOooD,GAAQ,GAE3B,GACGzkE,EAASwY,MAAM5jB,KAAM,CAAC6vE,GACjC,CACJ,GACAj+C,SAAS3qB,KAAK,KACV6xD,EAAI4W,SAAWD,IAEnB79C,EAAS3qB,KAAK8oE,GACPpJ,GAAgB,KACnB/0C,EAASxpB,QAASihE,GAAMA,IAAG,EAEnC,CAyEUiG,CAAiBtxD,GACjB,OAEAiyD,GA3EV,SAASC,GAAsBC,GAC3B,MAAQ1sC,MAAKutB,SAAQC,aAAYC,gBAAeC,kBAAiBif,eAAiBD,EAClF,IAAIE,GAAY,EAChB,MAAMC,EAAkB3J,GAAgB,KACpC,MAAM4J,EAAY9sC,EAAI+sC,eACtB,IAAKD,GAAcF,GAAaxJ,GAAiB,CAAC0J,EAAW,iBAAkB1S,GAAOA,EAAI4S,cACtF,OACJJ,EAAYE,EAAUE,cAAe,EACrC,MAAMC,EAAS,GACTC,EAAQJ,EAAUK,YAAc,EACtC,QAASnpE,EAAI,EAAGA,EAAIkpE,EAAOlpE,IAAK,CAC5B,MAAMopE,GAAQN,EAAUO,WAAWrpE,IAC3BspE,kBAAgBC,eAAaC,gBAAcC,cAAcL,GACjD3U,GAAU6U,GAAgB9f,EAAYC,EAAeC,GAAiB,IAClF+K,GAAU+U,GAAchgB,EAAYC,EAAeC,GAAiB,IAGxEuf,EAAOzpE,KAAK,CACRs8C,MAAOyN,EAAOzF,MAAMwlB,IACpBC,eACAxlD,IAAKwlC,EAAOzF,MAAM0lB,IAClBC,cAER,CACAd,EAAY,CAAEM,UAAQ,GAE1BJ,WACOzjD,GAAG,kBAAmByjD,EACjC,CA+C8BJ,CAAsBlyD,GAC1CmzD,GA/CV,SAASC,IAA4B3tC,MAAK4tC,oBACtC,MAAMvY,EAAMr1B,EAAIykC,YAChB,OAAKpP,GAAQA,EAAIvC,eAIM+D,GAAMxB,EAAIvC,eAAgB,SAAU,SAAUnrD,GACjE,OAAO,SAAUrH,EAAMhE,EAAamG,GAChC,IACImrE,EAAgB,CACZC,OAAQ,CACJvtE,SAGZ,OAEA,CACA,OAAOqH,EAASwY,MAAM5jB,KAAM,CAAC+D,EAAMhE,EAAamG,GACpD,CACJ,GAhBW,MAkBf,CA0BkCkrE,CAA0BpzD,GAClDuzD,GAAiB,GACvB,UAAWC,MAAUxzD,EAAEyzD,QACnBF,GAAetqE,KAAKuqE,GAAOhK,SAASgK,GAAOzoE,SAAUqgE,EAAeoI,GAAOtrE,UAE/E,OAAOygE,GAAgB,KACnBG,GAAgB1+D,QAAS0c,IAAMA,GAAE0nC,SACjC4e,EAAiB5pB,aACjB6pB,IACAgB,IACAW,IACAC,IACAK,IACAC,IACAM,IACAa,IACAC,IACAS,KACAa,KACAkB,KACAI,GAAenpE,QAASihE,IAAMA,KAAG,EAEzC,CACA,SAASS,GAAiBjuD,GACtB,cAAcnY,OAAOmY,GAAU,GACnC,CACA,SAAS0yD,GAA4B1yD,GACjC,gBAAsBnY,OAAOmY,GAAU,KACnCnY,OAAOmY,GAAMvX,WACb,eAAgBZ,OAAOmY,GAAMvX,WAC7B,eAAgBZ,OAAOmY,GAAMvX,UACrC,CAEA,MAAMotE,GACF3xE,YAAY4xE,GACR3xE,KAAK2xE,aAAeA,EACpB3xE,KAAK4xE,sBAAwB,IAAI1mD,QACjClrB,KAAK6xE,sBAAwB,IAAI3mD,OACrC,CACAqgC,MAAMiY,EAAQsO,EAAUC,EAAeC,GACnC,MAAMC,EAAkBF,GAAiB/xE,KAAKkyE,mBAAmB1O,GAC3D2O,EAAkBH,GAAiBhyE,KAAKoyE,mBAAmB5O,GACjE,IAAIl7D,EAAK2pE,EAAgB1kE,IAAIukE,GAC7B,OAAKxpE,IACDA,EAAKtI,KAAK2xE,eACVM,EAAgBxkE,IAAIqkE,EAAUxpE,GAC9B6pE,EAAgB1kE,IAAInF,EAAIwpE,IAErBxpE,CACX,CACA0jD,OAAOwX,EAAQsO,GACX,MAAMG,EAAkBjyE,KAAKkyE,mBAAmB1O,GAC1C2O,EAAkBnyE,KAAKoyE,mBAAmB5O,GAChD,OAAOsO,EAAS3pE,IAAKG,GAAOtI,KAAKurD,MAAMiY,EAAQl7D,EAAI2pE,EAAiBE,GACxE,CACAE,YAAY7O,EAAQl7D,EAAIH,GACpB,MAAMgqE,EAAkBhqE,GAAOnI,KAAKoyE,mBAAmB5O,GACvD,MAAkB,iBAAPl7D,EACAA,EACM6pE,EAAgB5kE,IAAIjF,KAE1B,CAEf,CACAgqE,aAAa9O,EAAQ+O,GACjB,MAAMJ,EAAkBnyE,KAAKoyE,mBAAmB5O,GAChD,OAAO+O,EAAIpqE,IAAKG,GAAOtI,KAAKqyE,YAAY7O,EAAQl7D,EAAI6pE,GACxD,CACA3lB,MAAMgX,GACF,IAAKA,EAGD,OAFAxjE,KAAK4xE,sBAAwB,IAAI1mD,aACjClrB,KAAK6xE,sBAAwB,IAAI3mD,SAGrClrB,KAAK4xE,sBAAsBnqD,OAAO+7C,GAClCxjE,KAAK6xE,sBAAsBpqD,OAAO+7C,EACtC,CACA0O,mBAAmB1O,GACf,IAAIyO,EAAkBjyE,KAAK4xE,sBAAsBrkE,IAAIi2D,GACrD,OAAKyO,IACDA,EAAkB,IAAI/kE,IACtBlN,KAAK4xE,sBAAsBnkE,IAAI+1D,EAAQyO,IAEpCA,CACX,CACAG,mBAAmB5O,GACf,IAAI2O,EAAkBnyE,KAAK6xE,sBAAsBtkE,IAAIi2D,GACrD,OAAK2O,IACDA,EAAkB,IAAIjlE,IACtBlN,KAAK6xE,sBAAsBpkE,IAAI+1D,EAAQ2O,IAEpCA,CACX,EAGJ,SAASK,GAAiBpqB,GAAO,IAAIC,EAA+Bh+C,EAAQ+9C,EAAI,GAAQ3gD,EAAI,EAAG,KAAOA,EAAI2gD,EAAI1hD,QAAQ,CAAE,MAAMoR,EAAKswC,EAAI3gD,GAAUwe,EAAKmiC,EAAI3gD,EAAI,GAAY,GAARA,GAAK,GAAe,mBAAPqQ,GAAkC,iBAAPA,IAAmC,MAATzN,EAAiB,OAA+B,WAAPyN,GAA0B,mBAAPA,GAA2BuwC,EAAgBh+C,EAAOA,EAAQ4b,EAAG5b,KAA0B,SAAPyN,GAAwB,iBAAPA,KAAyBzN,EAAQ4b,EAAG,IAAIrc,IAASS,EAAM3F,KAAK2jD,KAAkBz+C,IAAQy+C,OAAgB9kD,EAAa,CAAE,OAAO8G,CAAO,CACpgB,MAAMooE,GACF1yE,cACIC,KAAK0yE,wBAA0B,IAAIhB,GAAwBnkB,IAC3DvtD,KAAK2yE,2BAA6B,IAAIznD,OAC1C,CACAi4C,YACA,CACAyP,kBACA,CACAlP,eACA,EAEJ,MAAMmP,GACF9yE,YAAYmG,GACRlG,KAAK8yE,QAAU,IAAI5nD,QACnBlrB,KAAK+yE,qBAAuB,IAAI7nD,QAChClrB,KAAK0yE,wBAA0B,IAAIhB,GAAwBnkB,IAC3DvtD,KAAK2yE,2BAA6B,IAAIznD,QACtClrB,KAAKykE,WAAav+D,EAAQu+D,WAC1BzkE,KAAKgzE,YAAc9sE,EAAQ8sE,YAC3BhzE,KAAKojE,kBAAoBl9D,EAAQk9D,kBACjCpjE,KAAKizE,yBAA2B/sE,EAAQ+sE,yBACxCjzE,KAAKkzE,6BAA+B,IAAIxB,GAAwB1xE,KAAKojE,kBAAkBmH,YAAYhN,WAAWxwC,KAAK/sB,KAAKojE,kBAAkBmH,cAC1IvqE,KAAKgxD,OAAS9qD,EAAQ8qD,OAClBhxD,KAAKizE,0BACLvvE,OAAOg8B,iBAAiB,UAAW1/B,KAAKmzE,cAAcpmD,KAAK/sB,MAEnE,CACAmjE,UAAUtK,GACN74D,KAAK8yE,QAAQrlE,IAAIorD,GAAU,GACvBA,EAAS90B,eACT/jC,KAAK+yE,qBAAqBtlE,IAAIorD,EAAS90B,cAAe80B,EAC9D,CACA+Z,gBAAgBzyB,GACZngD,KAAKozE,aAAejzB,CACxB,CACAujB,aAAa7K,EAAU4K,GACnBzjE,KAAKykE,WAAW,CACZ/B,KAAM,CACF,CACIj4B,SAAUzqC,KAAKgxD,OAAOzF,MAAMsN,GAC5BkK,OAAQ,KACR1W,KAAMoX,IAGdzB,QAAS,GACTD,MAAO,GACP9sB,WAAY,GACZo+B,gBAAgB,IAEpBb,GAAiB,CAACxyE,KAAM,SAAUoR,GAAKA,EAAEgiE,aAAc,eAAgBxpB,GAAMA,EAAGiP,KAC5EA,EAASxC,iBACTwC,EAASxC,gBAAgBid,oBACzBza,EAASxC,gBAAgBid,mBAAmB5sE,OAAS,GACrD1G,KAAKojE,kBAAkB8H,iBAAiBrS,EAASxC,gBAAgBid,mBAAoBtzE,KAAKgxD,OAAOzF,MAAMsN,EAASxC,iBACxH,CACA8c,cAAcnnE,GACV,MAAMunE,EAA0BvnE,EAKhC,GAJ0C,UAAtCunE,EAAwBlkE,KAAKjD,MAC7BmnE,EAAwBt7D,SAAWs7D,EAAwBlkE,KAAK4I,SAEzCjM,EAAQd,OAE/B,OACJ,MAAM2tD,EAAW74D,KAAK+yE,qBAAqBxlE,IAAIvB,EAAQd,QACvD,IAAK2tD,EACD,OACJ,MAAM2a,EAAmBxzE,KAAKyzE,0BAA0B5a,EAAU0a,EAAwBlkE,KAAKd,OAC3FilE,GACAxzE,KAAKgzE,YAAYQ,EAAkBD,EAAwBlkE,KAAKqkE,WACxE,CACAD,0BAA0B5a,EAAU3mD,GAChC,OAAQA,EAAE9F,MACN,KAAKiyD,GAAUI,aAAc,CACzBz+D,KAAK0yE,wBAAwBlmB,MAAMqM,GACnC74D,KAAKkzE,6BAA6B1mB,MAAMqM,GACxC74D,KAAK2zE,gBAAgBzhE,EAAE7C,KAAKg9C,KAAMwM,GAClC,MAAMxG,EAASngD,EAAE7C,KAAKg9C,KAAK/jD,GAC3B,OAAAtI,KAAK2yE,2BAA2BllE,IAAIorD,EAAUxG,GAC9CryD,KAAK4zE,kBAAkB1hE,EAAE7C,KAAKg9C,KAAMgG,GAC7B,CACHt+C,UAAW7B,EAAE6B,UACb3H,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBE,SAC1B0D,KAAM,CACF,CACIj4B,SAAUzqC,KAAKgxD,OAAOzF,MAAMsN,GAC5BkK,OAAQ,KACR1W,KAAMn6C,EAAE7C,KAAKg9C,OAGrB2V,QAAS,GACTD,MAAO,GACP9sB,WAAY,GACZo+B,gBAAgB,GAG5B,CACA,KAAKhV,GAAUM,KACf,KAAKN,GAAUG,KACf,KAAKH,GAAUE,iBACX,OAAO,EAEX,KAAKF,GAAUQ,OACX,OAAO3sD,EAEX,KAAKmsD,GAAUO,OACX,OAAA5+D,KAAK6zE,WAAW3hE,EAAE7C,KAAKklB,QAASskC,EAAU,CAAC,KAAM,WAAY,aAAc,WACpE3mD,EAEX,KAAKmsD,GAAUK,oBACX,OAAQxsD,EAAE7C,KAAKnE,QACX,KAAK4zD,GAAkBE,SACnB9sD,SAAE7C,KAAKqzD,KAAKt6D,QAASuhD,IACjB3pD,KAAK6zE,WAAWlqB,EAAGkP,EAAU,CACzB,WACA,SACA,eAEJ74D,KAAK2zE,gBAAgBhqB,EAAE0C,KAAMwM,GAC7B,MAAMxG,EAASryD,KAAK2yE,2BAA2BplE,IAAIsrD,GACnDxG,GAAUryD,KAAK4zE,kBAAkBjqB,EAAE0C,KAAMgG,EAAM,GAEnDngD,EAAE7C,KAAK2yD,QAAQ55D,QAASuhD,IACpB3pD,KAAK6zE,WAAWlqB,EAAGkP,EAAU,CAAC,WAAY,MAAK,GAEnD3mD,EAAE7C,KAAK4lC,WAAW7sC,QAASuhD,IACvB3pD,KAAK6zE,WAAWlqB,EAAGkP,EAAU,CAAC,MAAK,GAEvC3mD,EAAE7C,KAAK0yD,MAAM35D,QAASuhD,IAClB3pD,KAAK6zE,WAAWlqB,EAAGkP,EAAU,CAAC,MAAK,GAEhC3mD,EAEX,KAAK4sD,GAAkBc,KACvB,KAAKd,GAAkBQ,UACvB,KAAKR,GAAkBG,UACnB/sD,SAAE7C,KAAKu8D,UAAUxjE,QAAS2c,IACtB/kB,KAAK6zE,WAAW9uD,EAAG8zC,EAAU,CAAC,MAAK,GAEhC3mD,EAEX,KAAK4sD,GAAkBM,eACnB,OAAO,EAEX,KAAKN,GAAkBS,iBACvB,KAAKT,GAAkBI,iBACvB,KAAKJ,GAAkBK,OACvB,KAAKL,GAAkBW,eACvB,KAAKX,GAAkBO,MACnB,OAAAr/D,KAAK6zE,WAAW3hE,EAAE7C,KAAMwpD,EAAU,CAAC,OAC5B3mD,EAEX,KAAK4sD,GAAkBU,eACvB,KAAKV,GAAkBe,iBACnB,OAAA7/D,KAAK6zE,WAAW3hE,EAAE7C,KAAMwpD,EAAU,CAAC,OACnC74D,KAAK8zE,gBAAgB5hE,EAAE7C,KAAMwpD,EAAU,CAAC,YACjC3mD,EAEX,KAAK4sD,GAAkBY,KACnB,OAAOxtD,EAEX,KAAK4sD,GAAkBgB,UACnB5tD,SAAE7C,KAAKqhE,OAAOtoE,QAASyoE,IACnB7wE,KAAK6zE,WAAWhD,EAAOhY,EAAU,CAAC,QAAS,OAAM,GAE9C3mD,EAEX,KAAK4sD,GAAkBiB,kBACnB,OAAA//D,KAAK6zE,WAAW3hE,EAAE7C,KAAMwpD,EAAU,CAAC,OACnC74D,KAAK8zE,gBAAgB5hE,EAAE7C,KAAMwpD,EAAU,CAAC,aACxC2Z,GAAiB,CAACtgE,EAAG,SAAUy5C,GAAMA,EAAGt8C,KAAM,SAAUw8C,GAAMA,EAAGkoB,OAAQ,iBAAkBjoB,GAAMA,EAAG1jD,QAAS,OAAQ8uD,GAAMA,EAAIkN,IAC3HpkE,KAAK8zE,gBAAgB1P,EAAOvL,EAAU,CAAC,WAAU,KAE9C3mD,GAKvB,OAAO,CACX,CACAjE,QAAQ+lE,EAAc3wE,EAAKw1D,EAAU1vD,GACjC,UAAW5B,KAAO4B,GACTtC,MAAMC,QAAQzD,EAAIkE,KAA6B,iBAAblE,EAAIkE,KAGvClE,EAAIkE,GADJV,MAAMC,QAAQzD,EAAIkE,IACPysE,EAAahoB,OAAO6M,EAAUx1D,EAAIkE,IAGlCysE,EAAazoB,MAAMsN,EAAUx1D,EAAIkE,KAGpD,OAAOlE,CACX,CACAwwE,WAAWxwE,EAAKw1D,EAAU1vD,GACtB,OAAOnJ,KAAKiO,QAAQjO,KAAK0yE,wBAAyBrvE,EAAKw1D,EAAU1vD,EACrE,CACA2qE,gBAAgBzwE,EAAKw1D,EAAU1vD,GAC3B,OAAOnJ,KAAKiO,QAAQjO,KAAKkzE,6BAA8B7vE,EAAKw1D,EAAU1vD,EAC1E,CACAwqE,gBAAgBtnB,EAAMwM,GAClB74D,KAAK6zE,WAAWxnB,EAAMwM,EAAU,CAAC,KAAM,WACnC,eAAgBxM,GAChBA,EAAKH,WAAW9jD,QAAS6rE,IACrBj0E,KAAK2zE,gBAAgBM,EAAOpb,EAAQ,EAGhD,CACA+a,kBAAkBvnB,EAAMgG,GAChBhG,EAAKjgD,OAAS+8C,GAAWE,WAAagD,EAAKgG,SAC3ChG,EAAKgG,OAASA,GACd,eAAgBhG,GAChBA,EAAKH,WAAW9jD,QAAS6rE,IACrBj0E,KAAK4zE,kBAAkBK,EAAO5hB,EAAM,EAGhD,EAGJ,MAAM6hB,GACFpgE,OACA,CACAyvD,gBACA,CACAI,sBACA,CACAnX,QACA,EAEJ,MAAM2nB,GACFp0E,YAAYmG,GACRlG,KAAKo0E,WAAa,IAAIjtD,QACtBnnB,KAAKq0E,gBAAkB,GACvBr0E,KAAKykE,WAAav+D,EAAQu+D,WAC1BzkE,KAAKgoE,SAAW9hE,EAAQ8hE,SACxBhoE,KAAKu4D,cAAgBryD,EAAQqyD,cAC7Bv4D,KAAKgxD,OAAS9qD,EAAQ8qD,OACtBhxD,KAAK8T,MACT,CACAA,OACI9T,KAAKwsD,QACLxsD,KAAKs0E,kBAAkB3nE,QAASmb,SACpC,CACAy7C,cAAc1Z,EAAYpmB,GAGtB,IAFKqmB,GAAkBD,IAEnB7pD,KAAKo0E,WAAW9sD,IAAIuiC,GACpB,OACJ7pD,KAAKo0E,WAAW7sD,IAAIsiC,GACpB,MAAM2d,EAAWR,GAAqB,IAC/BhnE,KAAKu4D,cACR90B,MACAghC,WAAYzkE,KAAKykE,WACjBzT,OAAQhxD,KAAKgxD,OACbsS,iBAAkBtjE,MACnB6pD,GACH7pD,KAAKq0E,gBAAgBptE,KAAK,IAAMugE,EAAShmB,cACzCxhD,KAAKq0E,gBAAgBptE,KAAK8gE,GAAmB,IACtC/nE,KAAKu4D,cACRyP,SAAUhoE,KAAKgoE,SACfvkC,IAAKomB,EACLmH,OAAQhxD,KAAKgxD,UAEjB3xB,WAAW,KACHwqB,EAAWypB,oBACXzpB,EAAWypB,mBAAmB5sE,OAAS,GACvC1G,KAAKu4D,cAAc6K,kBAAkB8H,iBAAiBrhB,EAAWypB,mBAAoBtzE,KAAKgxD,OAAOzF,MAAM1B,EAAWr6B,OACtHxvB,KAAKq0E,gBAAgBptE,KAAKyjE,GAA8B,CACpD1Z,OAAQhxD,KAAKgxD,OACboS,kBAAmBpjE,KAAKu4D,cAAc6K,mBACvCvZ,GAAW,EACf,EACP,CACA8Z,oBAAoB4Q,IACXA,EAAcxwC,gBAAkBwwC,EAAcle,iBAEnDr2D,KAAKs0E,kBAAkBC,EAAcxwC,cAAcp3B,QAAS4nE,EAAcle,gBAC9E,CACAie,kBAAkB7uC,EAAShC,GACvB,MAAM+wC,EAAUx0E,KAChBA,KAAKq0E,gBAAgBptE,KAAKqzD,GAAM70B,EAAQnhC,UAAW,eAAgB,SAAU8G,GACzE,OAAO,SAAUqpE,GACb,MAAM5qB,EAAaz+C,EAAS1G,KAAK1E,KAAMy0E,GACvC,OAAIz0E,KAAK6pD,YAAcmU,GAAMh+D,OACzBw0E,EAAQjR,cAAcvjE,KAAK6pD,WAAYpmB,GACpComB,CACX,CACJ,GACJ,CACA2C,QACIxsD,KAAKq0E,gBAAgBjsE,QAAS4K,IAC1B,IACIA,GACJ,OAEA,IAEJhT,KAAKq0E,gBAAkB,GACvBr0E,KAAKo0E,WAAa,IAAIjtD,OAC1B,EAGJ,MAAMutD,GACFloB,QACA,CACAuZ,SACA,CACAE,WACA,CACAE,OACA,CACAC,SACA,CACAuO,WACA,EAGJ,MAAMC,GACF70E,YAAYmG,GACRlG,KAAK60E,oBAAsB,IAAI1tD,QAC/BnnB,KAAKuqE,YAAc,IAAItN,GACvBj9D,KAAKykE,WAAav+D,EAAQu+D,WAC1BzkE,KAAK80E,oBAAsB5uE,EAAQ4uE,mBACvC,CACAlR,kBAAkBmR,EAAQtR,GAClB,aAAcA,EAAQxuB,YACtBj1C,KAAKykE,WAAW,CACZ/B,KAAM,GACNV,QAAS,GACTD,MAAO,GACP9sB,WAAY,CACR,CACI3sC,GAAIm7D,EAAQn7D,GACZ2sC,WAAYwuB,EACPxuB,eAIrBj1C,KAAKqjE,iBAAiB0R,EAC1B,CACA1R,iBAAiB0R,GACT/0E,KAAK60E,oBAAoBvtD,IAAIytD,KAEjC/0E,KAAK60E,oBAAoBttD,IAAIwtD,GAC7B/0E,KAAKg1E,6BAA6BD,GACtC,CACA7J,iBAAiBH,EAAQJ,GACrB,GAAsB,IAAlBI,EAAOrkE,OACP,OACJ,MAAMuuE,EAAwB,CAC1B3sE,GAAIqiE,EACJuK,SAAU,IAERnB,EAAS,GACf,UAAWvgB,KAASuX,EAAQ,CACxB,IAAIP,EACCxqE,KAAKuqE,YAAYjjD,IAAIksC,GAWtBgX,EAAUxqE,KAAKuqE,YAAYhf,MAAMiI,IAVjCgX,EAAUxqE,KAAKuqE,YAAYhjD,IAAIisC,GAC/BugB,EAAO9sE,KAAK,CACRujE,UACAvgB,MAAOpjD,MAAM6e,KAAK8tC,EAAMvJ,OAASkrB,QAAS,CAAC5O,EAAGjzD,MAC1Cg3C,KAAMD,GAAckc,GACpBjzD,cAMZ2hE,EAAsBC,SAASjuE,KAAKujE,EACxC,CACIuJ,EAAOrtE,OAAS,IAChBuuE,EAAsBlB,OAASA,GACnC/zE,KAAK80E,oBAAoBG,EAC7B,CACAzoB,QACIxsD,KAAKuqE,YAAY/d,QACjBxsD,KAAK60E,oBAAsB,IAAI1tD,OACnC,CACA6tD,6BAA6BD,GAC7B,EAGJ,MAAMK,GACFr1E,cACIC,KAAKq1E,QAAU,IAAInqD,QACnBlrB,KAAKs1E,MAAO,EACZt1E,KAAKu1E,mBACT,CACAA,qBA72DJ,SAASC,MAA2Bh7C,GAChC,OAzBJ,SAASi7C,KACL,GAAI3a,GACA,OAAOA,GAEX,MAAMhzC,EAAWpkB,OAAOokB,SACxB,IAAI4tD,EAAsChyE,OAAOunC,sBACjD,GAAInjB,GAA8C,mBAA3BA,EAAS4b,cAC5B,IACI,MAAMC,EAAU7b,EAAS4b,cAAc,UACvCC,EAAQC,QAAS,EACjB9b,EAAS+b,KAAKC,YAAYH,GAC1B,MAAMI,EAAgBJ,EAAQI,cAC1BA,GAAiBA,EAAckH,wBAC/ByqC,EACI3xC,EAAckH,uBAEtBnjB,EAAS+b,KAAKG,YAAYL,EAC9B,OAEA,CAEJ,OAAQm3B,GACJ4a,EAAoC3oD,KAAKrpB,OACjD,CAEW+xE,MAA4Cj7C,EACvD,CA42DQg7C,CAAwB,KACpBx1E,KAAKgf,QACDhf,KAAKs1E,MACLt1E,KAAKu1E,mBAAkB,EAEnC,CACA1P,cAAcxZ,EAAMspB,GAChB,MAAMjhD,EAAU10B,KAAKq1E,QAAQ9nE,IAAI8+C,GACjC,OAAQ33B,GAAW7tB,MAAM6e,KAAKgP,GAAS/pB,KAAMoqB,GAAWA,IAAW4gD,EACvE,CACApuD,IAAI8kC,EAAMt3B,GACN/0B,KAAKq1E,QAAQ5nE,IAAI4+C,GAAOrsD,KAAKq1E,QAAQ9nE,IAAI8+C,IAAS,IAAI+V,KAAO76C,IAAIwN,GACrE,CACA/V,QACIhf,KAAKq1E,QAAU,IAAInqD,OACvB,CACA0qD,UACI51E,KAAKs1E,MAAO,CAChB,EAGJ,SAASO,GAAU3jE,GACf,MAAM4jE,EAAY5jE,EAClB4jE,SAAU/hE,UAAYgnD,KACf+a,CACX,CACA,IAAIC,GACJ,MAAM/kB,GAtuGN,SAASglB,KACL,OAAO,IAAI5qB,EACf,CAouGe4qB,GACf,SAASC,GAAO/vE,EAAU,CAAC,GACvB,MAAQoT,OAAM48D,mBAAkBC,mBAAkBllB,aAAa,WAAYC,gBAAgB,KAAMC,kBAAkB,KAAMsX,cAAc,YAAaC,iBAAiB,KAAMjY,eAAc,EAAOJ,gBAAgB,UAAWE,kBAAkB,KAAMD,mBAAmB,KAAME,sBAAqB,KAAMa,qBAAmB,EAAM+kB,iBAAe1pB,iBAAkB2pB,GAAmB9kB,eAAgB+kB,GAAiBvnB,mBAAiBjC,eAAawE,cAAYilB,UAAQtO,YAAW,CAAC,EAAGzW,kBAAiB,CAAC,EAAGglB,iBAAe9kB,iBAAe,EAAOuhB,6BAA2B,EAAOwD,gBAAsC,qBAAxBvwE,EAAQuwE,YAClkBvwE,EAAQuwE,YACR,QAAQ9N,yBAAuB,EAAO0G,iBAAe,EAAO5d,iBAAe,EAAOggB,WAASzf,mBAAkBA,MAAM,GAAO8c,uBAAsB,IAAI1M,IAAI,IAAKsE,gBAAce,cAAYiP,qBAAsBxwE,GApxCvN,SAASywE,GAAqB3jE,GAC1B0zD,GAAe1zD,CACnB,CAmxCI2jE,CAAqBjQ,IACrB,MAAMkQ,IAAkB3D,IAClBvvE,OAAOmzE,SAAWnzE,OAExB,IAAIozE,IAAoB,EACxB,IAAKF,GACD,IACQlzE,OAAOmzE,OAAO/uD,WACdgvD,IAAoB,EAE5B,OAEIA,IAAoB,CACxB,CAEJ,GAAIF,KAAoBt9D,EACpB,MAAM,IAAI1U,MAAM,kCAEErB,IAAlBizE,SAAsDjzE,IAAvB0kE,GAASuD,YACxCvD,GAASuD,UAAYgL,IAEzBxlB,GAAOxE,QACP,MAAME,IAAqC,IAAlB0pB,GACnB,CACEW,OAAO,EACPC,MAAM,EACN,kBAAkB,EAClB9hE,OAAO,EACP+hE,OAAO,EACPC,QAAQ,EACRrG,OAAO,EACP/rC,QAAQ,EACRqyC,KAAK,EACLxqB,MAAM,EACN3J,MAAM,EACN75B,KAAK,EACLiuD,MAAM,EACN/f,UAAU,EACVvD,QAAQ,EACRujB,OAAO,EACPC,UAAU,QAEU/zE,IAAtB8yE,GACIA,GACA,CAAC,EACL9kB,IAAqC,IAApB+kB,IAAgD,QAApBA,GAC7C,CACErlC,QAAQ,EACRymB,SAAS,EACTE,aAAa,EACbU,gBAAgB,EAChBR,gBAAgB,EAChBC,gBAAgB,EAChBC,mBAAmB,EACnBE,sBAAsB,EACtBD,mBAAwC,QAApBqe,GACpBze,qBAA0C,QAApBye,IAExBA,IAEI,CAAC,GAxkEf,SAASiB,GAASze,EAAMp1D,QAChB,aAAco1D,IAAQA,EAAI0e,SAASlzE,UAAU8D,UAC7C0wD,EAAI0e,SAASlzE,UAAU8D,QAAUvB,MAAMvC,UAClC8D,SAEL,iBAAkB0wD,IAAQA,EAAI2e,aAAanzE,UAAU8D,UACrD0wD,EAAI2e,aAAanzE,UAAU8D,QAAUvB,MAAMvC,UACtC8D,SAEJ01D,KAAKx5D,UAAU0uD,WAChB8K,KAAKx5D,UAAU0uD,SAAW,IAAIppD,KAC1B,IAAIyiD,EAAOziD,EAAK,GAChB,KAAM,KAAKA,GACP,MAAM,IAAI8tE,UAAU,0BAExB,MACQ13E,OAASqsD,EACT,OAAO,QAELA,EAAOA,GAAQA,EAAKnlD,YAC9B,OAAO,GAGnB,CAkjEIqwE,GACA,IAAII,GACAC,GAA2B,EAC/B,MAAMv/C,GAAkBnmB,KACpB,UAAWs/D,MAAUC,IAAW,GACxBD,GAAOn5C,iBACPnmB,GAAIs/D,GAAOn5C,eAAenmB,KAGlC,OAAIqkE,KACCO,KACD5kE,GAAIqkE,GAAOrkE,KAERA,IAEL8gE,GAAcA,CAAC9gE,GAAGwhE,MAOpB,GANIvrB,GAAe,CAAC2e,GAAiB,SAAU11D,IAAKA,GAAE,GAAI,iBAAkBw4C,IAAMA,GAAGsc,SAAU,OAAQva,IAAMA,QACzGz5C,GAAE9F,OAASiyD,GAAUI,gBACnBvsD,GAAE9F,OAASiyD,GAAUK,qBACnBxsD,GAAE7C,KAAKnE,SAAW4zD,GAAkBE,WACxC8H,GAAgB1+D,QAASwsB,IAAQA,GAAIqxC,YAErC2Q,GACAzuB,GAAe,CAAC7uC,EAAM,eAAgBuyC,IAAMA,GAAGxzB,GAAenmB,IAAIwhE,WAAY,GAEzEoD,GAAmB,CACxB,MAAM9qE,GAAU,CACZI,KAAM,QACNmC,MAAO8pB,GAAenmB,IACtB+F,OAAQvU,OAAOwvB,SAASjb,OACxBy7D,eAEJhwE,OAAOmzE,OAAOgB,YAAY7rE,GAAS,IACvC,CACA,GAAIkG,GAAE9F,OAASiyD,GAAUI,aACrBkZ,GAAwBzlE,GACxB0lE,GAA2B,UAEtB1lE,GAAE9F,OAASiyD,GAAUK,oBAAqB,CAC/C,GAAIxsD,GAAE7C,KAAKnE,SAAW4zD,GAAkBE,UACpC9sD,GAAE7C,KAAKgkE,eACP,OAEJuE,MACoBzB,GAAoByB,IAA4BzB,GACjDD,GACfhkE,GAAE6B,UAAY4jE,GAAsB5jE,UAAYmiE,IAEhD4B,IAAiB,EAEzB,GAEEC,GAAuBrT,KACzBsO,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBE,YACvB0F,MAET,EAEAsT,GAAqBjzD,IAAMiuD,GAAY6C,GAAU,CACnDzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBK,UACvBp6C,OAGLkzD,GAA6BlzD,IAAMiuD,GAAY6C,GAAU,CAC3DzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBW,kBACvB16C,OAULq+C,GAAoB,IAAIwR,GAAkB,CAC5CnQ,WAAYsT,GACZjD,oBATkCjwD,IAAMmuD,GAAY6C,GAAU,CAC9DzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBiB,qBACvBl7C,SAOLq+C,GAAoD,kBAA7BgV,0BAA0CA,yBACjE,IAAIzF,GACJ,IAAII,GAAc,CAChB7hB,UACAyT,WAAYsT,GACZ3U,kBAAmBA,GACnB6P,4BACAD,iBAER,UAAWxB,MAAUC,IAAW,GACxBD,GAAO2G,WACP3G,GAAO2G,UAAU,CACbC,WAAYpnB,GACZ0hB,wBAAyBxP,GAAcwP,wBACvCQ,6BAA8BhQ,GAAcgQ,+BAGxD,MAAMtN,GAAuB,IAAIwP,GAC3BpP,GA0SV,SAASqS,GAAkBC,EAAoBpyE,GAC3C,IACI,OAAOoyE,EACDA,EAAmBpyE,GACnB,IAAIwuE,EACd,OAEI1rE,eAAQyN,KAAK,sCACN,IAAIi+D,EACf,CACJ,CApT0B2D,CAAkB3B,GAAkB,CACtD1lB,UACA8H,IAAKp1D,OACL+gE,WAAa1/C,IAAMiuD,GAAY6C,GAAU,CACrCzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBW,kBACvB16C,OAGX2sC,gBACAT,aACAC,gBACAC,kBACA8W,SAAUA,GAAShU,OACnBzC,oBAEE8R,GAA2D,kBAAjCiV,8BAC5BA,6BACE,IAAIrE,GACJ,IAAIC,GAAiB,CACnB1P,WAAYsT,GACZ/P,SAAUgQ,GACVzf,cAAe,CACXkP,cACAxW,aACAC,gBACAC,kBACAV,cACAJ,gBACAE,kBACAD,mBACAE,sBACAa,oBACA3E,oBACA8E,kBACAzC,mBACAuC,cACAxE,eACA4E,gBACAD,gBACAwW,YACA1W,kBACA2R,iBACAE,qBACA4C,iBACAhU,mBACA4T,yBAEJ5U,YAEF8mB,GAAmBA,CAACpE,IAAa,KACnCV,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUM,KAChBtvD,KAAM,CACF8jB,KAAMzvB,OAAOwvB,SAASC,KACtBihC,MAAO2H,KACPz1D,OAAQs1D,QAEZ8X,IACJtQ,GAAkB5W,QAClB8W,GAAiBxvD,OACjBgzD,GAAgB1+D,QAASwsB,IAAQA,GAAIuxC,QACrC,MAAM9Z,GAhgFd,SAASsoB,GAAShrB,EAAGzjD,GACjB,MAAQ8qD,SAAS,IAAI5F,GAAU6F,aAAa,WAAYC,gBAAgB,KAAMC,kBAAkB,KAAMV,eAAc,EAAOJ,gBAAgB,UAAWE,kBAAkB,KAAMD,mBAAmB,KAAME,qBAAqB,KAAMa,oBAAmB,EAAMI,gBAAe,EAAOC,iBAAe,EAAO0kB,kBAAgB,EAAOrnB,mBAAiBuC,cAAYxE,eAAa0rB,YAAU,EAAOhnB,kBAAgBU,sBAAoBP,eAAaC,gBAAcC,qBAAmBC,oBAAkBC,yBAAuBC,mBAAkBA,MAAM,IAAW9rD,GAAW,CAAC,EAuCniB,OAAO6qD,GAAoBpH,EAAG,CAC1BlmB,IAAKkmB,EACLqH,SACAC,aACAC,gBACAC,kBACAV,cACAJ,gBACAE,kBACAD,mBACAE,qBACAY,WAAW,EACXC,mBACA3E,kBAnDuC,IAAlB0pB,GACnB,CACEW,OAAO,EACPC,MAAM,EACN,kBAAkB,EAClB9hE,OAAO,EACP+hE,OAAO,EACPC,QAAQ,EACRrG,OAAO,EACP/rC,QAAQ,EACRqyC,KAAK,EACLxqB,MAAM,EACN3J,MAAM,EACN75B,KAAK,EACLiuD,MAAM,EACN/f,UAAU,EACVvD,QAAQ,IAEQ,IAAlBsiB,GACI,CAAC,EACDA,GAgCNrnB,mBACAuC,cACAxE,eACAyE,gBAlC+B,IAAZinB,IAAgC,QAAZA,GAEnC,CACIvnC,QAAQ,EACRymB,SAAS,EACTE,aAAa,EACbU,gBAAgB,EAChBT,qBAAkC,QAAZ2gB,GACtB1gB,gBAAgB,EAChBC,gBAAgB,EAChBC,mBAAmB,EACnBC,oBAAoB,EACpBC,sBAAsB,IAEhB,IAAZsgB,GACI,CAAC,EACDA,GAmBNhnB,kBACAC,eACAC,gBACAQ,sBACAP,eACAC,gBACAC,qBACAC,oBACAC,yBACAC,mBACAC,mBAAmB,GAE3B,CA07EqB0iB,CAAS7sD,SAAU,CAC5BkpC,UACAC,aACAC,gBACAC,kBACAV,cACAJ,gBACAE,kBACAD,mBACAE,sBACAa,oBACA+kB,cAAe1pB,GACfqC,mBACAjC,eACAwE,cACAknB,QAASjnB,GACTC,kBACAE,gBACAD,gBACAE,YAAchI,KACNiT,GAAmBjT,GAAGqH,KACtBkS,GAAcC,UAAUxZ,IAExBmT,GAAuBnT,GAAGqH,KAC1BoS,GAAkBC,iBAAiB1Z,IAEnCoT,GAAcpT,KACd2Z,GAAiBC,cAAc5Z,GAAEE,WAAY/hC,SAAQ,EAG7D8pC,aAAcA,CAAC4R,GAAQC,MACnBP,GAAcQ,aAAaF,GAAQC,IACnCH,GAAiBK,oBAAoBH,GAAM,EAE/C1R,iBAAkBA,CAACijB,GAAQtR,MACvBL,GAAkBQ,kBAAkBmR,GAAQtR,GAAO,EAEvDzR,qBAEJ,IAAK3F,GACD,OAAOrjD,QAAQyN,KAAK,mCAExBu8D,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUI,aAChBpvD,KAAM,CACFg9C,QACAosB,cAAezd,GAAgBt3D,YAGvCojE,GAAgB1+D,QAASwsB,IAAQA,GAAIwxC,UACjCt+C,SAASwrD,oBAAsBxrD,SAASwrD,mBAAmB5sE,OAAS,GACpE08D,GAAkB8H,iBAAiBpjD,SAASwrD,mBAAoBtiB,GAAOzF,MAAMzjC,UAAS,EAE9FiuD,GAAoB+B,GACpB,IACI,MAAMlmD,GAAW,GACX8tB,GAAWjc,IACNkjC,GAAgBwE,GAAhBxE,CAA+B,CAClCc,cACAhD,WAAYsT,GACZxM,YAAaA,CAACK,GAAW1gE,KAAW8nE,GAAY6C,GAAU,CACtDzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,UACA0gE,iBAGRW,mBAAqBnS,IAAM4Y,GAAY6C,GAAU,CAC7CzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBI,oBACvB9E,OAGX4N,SAAUgQ,GACV7K,iBAAmB/S,IAAM4Y,GAAY6C,GAAU,CAC3CzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBM,kBACvBhF,OAGXoO,QAAUU,IAAM8J,GAAY6C,GAAU,CAClCzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBO,SACvB6J,OAGXuE,mBAAqB1oD,IAAMiuD,GAAY6C,GAAU,CAC7CzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBS,oBACvBx6C,OAGXgpD,iBAAmBxH,IAAMyM,GAAY6C,GAAU,CAC3CzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBU,kBACvB+G,OAGXsI,mBAAqBtI,IAAMyM,GAAY6C,GAAU,CAC7CzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBe,oBACvB0G,OAGXmS,iBAAkBT,GAClB1I,OAASxqD,IAAMiuD,GAAY6C,GAAU,CACjCzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBY,QACvB36C,OAGXqrD,YAAcrrD,KACViuD,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBgB,aACvB/6C,MAET,EAENssD,gBAAkBhjE,KACd2kE,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUK,oBAChBrvD,KAAM,CACFnE,OAAQ4zD,GAAkBkB,iBACvB3xD,MAET,EAEN4iD,aACAwX,cACAC,iBACAjY,cACAJ,gBACAE,kBACAD,mBACAE,sBACA9D,oBACA2E,oBACA4W,YACAvW,gBACAD,gBACAkX,wBACA0G,gBACA5rC,OACAsrB,mBACAjC,eACAwE,cACAU,mBACAd,gBACAC,kBACAI,kBACAC,kBACAR,UACAkS,iBACAE,qBACAE,oBACAsC,wBACAI,iBACA8I,uBACA2C,QAAStpB,GAAe,CAACspB,GACvC,iBAAkB3lB,IAAMA,GAAG9jD,OAAQ,OAAQkvD,IAAMA,GAAInyC,IAAMA,GAAEyiD,UAC7D,iBAAkBrQ,IAAMA,GAAGhvD,IAAK,OAAQivD,IAAMA,GAAIryC,MAChCyiD,SAAUziD,GAAEyiD,SACZthE,QAAS6e,GAAE7e,QACX6C,SAAWwrB,IAAYy+C,GAAY6C,GAAU,CACzCzpE,KAAMiyD,GAAUQ,OAChBxvD,KAAM,CACFmiE,OAAQzsD,GAAEhhB,KACVwwB,qBAGH,IACV,CAAC,GAER2uC,GAAc0P,gBAAiB/Z,KAC3B,IACIjnC,GAAS3qB,KAAKy4C,GAAQmZ,GAASxC,iBACnC,OACO3nC,IACH1lB,QAAQyN,KAAKiY,GACjB,IAEJ,MAAM5a,GAAOA,KACTgkE,KACAlmD,GAAS3qB,KAAKy4C,GAAQ53B,UAAS,EAEnC,MAA4B,gBAAxBA,SAAS2a,YACe,aAAxB3a,SAAS2a,WACT3uB,MAGA8d,GAAS3qB,KAAK4lB,GAAG,mBAAoB,KACjCmmD,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUE,iBAChBlvD,KAAM,CAAC,KAES,qBAAhBonE,IACA3iE,IAAK,IAEb8d,GAAS3qB,KAAK4lB,GAAG,OAAQ,KACrBmmD,GAAY6C,GAAU,CAClBzpE,KAAMiyD,GAAUG,KAChBnvD,KAAM,CAAC,KAES,SAAhBonE,IACA3iE,IAAK,EACVpQ,UAEA,KACHkuB,GAASxpB,QAASihE,IAAMA,MACxBzD,GAAqBgQ,UACrBG,QAAoBxyE,EAjtDhC,SAASo1E,KACLjS,QAAenjE,CACnB,CAgtDYo1E,EAAuB,CAE/B,OACOjqD,IACH1lB,QAAQyN,KAAKiY,GACjB,CACJ,CAOAunD,GAAOjlB,OAASA,GAChBilB,GAAO6B,iBAPP,SAASA,GAAiBpE,GACtB,IAAKqC,GACD,MAAM,IAAInxE,MAAM,mDAEpBmxE,GAAkBrC,EACtB,EAeA,MAAMkF,GAAqC,EAM3C,SAASC,GAAc9kE,GAErB,OADaA,EAAY,WACXA,EAAwB,IAAZA,CAC5B,CAKA,SAAS+kE,GAAa/kE,GAEpB,OADaA,EAAY,WACXA,EAAY,IAAOA,CACnC,CAKA,SAASglE,GAAmBC,EAAQ95D,GACN,uBAAxBA,EAAWua,WAIX,CAAC,WAAY,YAAYzuB,SAASkU,EAAWua,UAC/Cu/C,EAAOC,sBAEPD,EAAOE,+BAGTF,EAAOG,UAAU,KAGfH,EAAOI,kBAAkB,CACvBhtE,KAAMiyD,GAAUO,OAGhB7qD,UAAyC,KAA7BmL,EAAWnL,WAAa,GACpC1E,KAAM,CACJgvC,IAAK,aAEL9pB,QAASrO,GAAUhH,EAAY,GAAI,QAKR,YAAxBA,EAAWua,WAEtB,CAEA,MAAM4/C,GAAuB,WAG7B,SAASC,GAAsB7zC,GAE7B,OAD2BA,EAAQ8zC,QAAQF,KACd5zC,CAC/B,CAQA,SAAS+zC,GAAmBjrE,GAC1B,MAAMlC,EAASotE,GAAclrE,GAE7B,OAAKlC,GAAYA,aAAkBM,QAI5B2sE,GAAsBjtE,GAHpBA,CAIX,CAGA,SAASotE,GAAclrE,GACrB,OAOF,SAASmrE,GAAkBnrE,GACzB,MAAwB,iBAAVA,KAAwBA,GAAS,WAAYA,CAC7D,CATMmrE,CAAkBnrE,GACbA,EAAMlC,OAGRkC,CACT,CAMA,IAAIqjB,GA6CJ,MAAM+nD,GAGH55E,YACCi5E,EACAY,EAEAC,EAAsBd,IAEtB/4E,KAAK85E,cAAgB,EACrB95E,KAAK+5E,YAAc,EACnB/5E,KAAKg6E,QAAU,GAGfh6E,KAAKi6E,SAAWL,EAAgB7hD,QAAU,IAC1C/3B,KAAKk6E,WAAaN,EAAgBvpE,UAAY,IAC9CrQ,KAAKm6E,cAAgBP,EAAgBQ,cAAgB,IACrDp6E,KAAKq6E,QAAUrB,EACfh5E,KAAKs6E,gBAAkBV,EAAgBlR,eACvC1oE,KAAK65E,oBAAsBA,CAC7B,CAGCU,eACC,MAAMC,EA/DV,SAASC,GAAat6B,GAEpB,OAAKvuB,KACHA,GAAW,GAcf,SAAS8oD,KACPzvE,GAAKnF,GAAQ,OAAQ,SAAU60E,GAC7B,OAAO,YAAa/wE,GAClB,GAAIgoB,GACF,IACEA,GAASxpB,QAAQ4K,GAAWA,IAC9B,OACE,CAIJ,OAAO2nE,EAAmB/2D,MAAM9d,GAAQ8D,EAC1C,CACF,EACF,CA3BI8wE,IAGF9oD,GAAS3qB,KAAKk5C,GAEP,KACL,MAAM8O,EAAMr9B,GAAWA,GAASlF,QAAQyzB,IAAM,EAC1C8O,GAAM,GACPr9B,GAAWlK,OAAOunC,EAAK,EAAC,CAG/B,CAgD8BwrB,CAAa,KAErCz6E,KAAK85E,cAAgBc,IAAa,GAGpC56E,KAAK66E,UAAY,KACfL,IAEAx6E,KAAKg6E,QAAU,GACfh6E,KAAK85E,cAAgB,EACrB95E,KAAK+5E,YAAc,EAEvB,CAGCe,kBACK96E,KAAK66E,WACP76E,KAAK66E,YAGH76E,KAAK+6E,oBACPp5C,aAAa3hC,KAAK+6E,mBAEtB,CAGCC,YAAY97D,EAAYmtC,GACvB,GAiKJ,SAAS4uB,GAAc5uB,EAAMqc,GAoB3B,UAnBKwS,GAAgBlwE,SAASqhD,EAAK3kD,UAKd,UAAjB2kD,EAAK3kD,UAAwB,CAAC,SAAU,UAAUsD,SAASqhD,EAAKnkD,aAAa,SAAW,KAQzE,MAAjBmkD,EAAK3kD,UACJ2kD,EAAKa,aAAa,aAAgBb,EAAKa,aAAa,WAA6C,UAAhCb,EAAKnkD,aAAa,YAKlFwgE,GAAkBrc,EAAK0D,QAAQ2Y,GAKrC,CA1LQuS,CAAc5uB,EAAMrsD,KAAKs6E,mBA4LjC,SAASa,GAAkBj8D,GACzB,SAAUA,EAAW7P,MAA0C,iBAA3B6P,EAAW7P,KAAKo2D,SAAuBvmD,EAAWnL,UACxF,CA9LsDonE,CAAkBj8D,GAClE,OAGF,MAAMk8D,EAAW,CACfrnE,UAAW+kE,GAAa55D,EAAWnL,WACnCsnE,gBAAiBn8D,EAEjBo8D,WAAY,EACZjvB,QAKArsD,KAAKg6E,QAAQrvE,KAAK4wE,GAASA,EAAMlvB,OAAS+uB,EAAS/uB,MAAQ/oD,KAAKmN,IAAI8qE,EAAMxnE,UAAYqnE,EAASrnE,WAAa,KAK9G/T,KAAKg6E,QAAQ/yE,KAAKm0E,GAGU,IAAxBp7E,KAAKg6E,QAAQtzE,QACf1G,KAAKw7E,uBAET,CAGCC,iBAAiB1nE,EAAYnE,KAAKC,OACjC7P,KAAK85E,cAAgBhB,GAAa/kE,EACpC,CAGC2nE,eAAe3nE,EAAYnE,KAAKC,OAC/B7P,KAAK+5E,YAAcjB,GAAa/kE,EAClC,CAGC4nE,cAAcl2C,GACb,MAAM4mB,EAAOitB,GAAsB7zC,GACnCzlC,KAAK47E,kBAAkBvvB,EACzB,CAGCuvB,kBAAkBvvB,GACjBrsD,KAAK67E,WAAWxvB,GAAMjkD,QAAQmzE,IAC5BA,EAAMD,cAEV,CAGCO,WAAWxvB,GACV,OAAOrsD,KAAKg6E,QAAQhyE,OAAOuzE,GAASA,EAAMlvB,OAASA,EACrD,CAGCyvB,eACC,MAAMC,EAAiB,GAEjBlsE,EAAM+qE,KAEZ56E,KAAKg6E,QAAQ5xE,QAAQmzE,KACdA,EAAMS,eAAiBh8E,KAAK85E,gBAC/ByB,EAAMS,cAAgBT,EAAMxnE,WAAa/T,KAAK85E,cAAgB95E,KAAK85E,cAAgByB,EAAMxnE,eAAYxQ,IAElGg4E,EAAMU,aAAej8E,KAAK+5E,cAC7BwB,EAAMU,YAAcV,EAAMxnE,WAAa/T,KAAK+5E,YAAc/5E,KAAK+5E,YAAcwB,EAAMxnE,eAAYxQ,GAI7Fg4E,EAAMxnE,UAAY/T,KAAKi6E,UAAYpqE,GACrCksE,EAAe90E,KAAKs0E,EAAK,GAK7B,UAAWA,KAASQ,EAAgB,CAClC,MAAM9sB,EAAMjvD,KAAKg6E,QAAQttD,QAAQ6uD,GAE7BtsB,GAAM,IACRjvD,KAAKk8E,qBAAqBX,GAC1Bv7E,KAAKg6E,QAAQtyD,OAAOunC,EAAK,GAE7B,CAGIjvD,KAAKg6E,QAAQtzE,QACf1G,KAAKw7E,sBAET,CAGCU,qBAAqBX,GACpB,MAAMvC,EAASh5E,KAAKq6E,QAId8B,IAHYZ,EAAMU,aAAeV,EAAMU,aAAej8E,KAAKm6E,eAC7CoB,EAAMS,eAAiBT,EAAMS,eAAiBh8E,KAAKk6E,aAG/DoB,aAAYD,mBAAoBE,EAGxC,GAAIY,EAAJ,CAGE,MAAMC,EAAmF,IAAhE94E,KAAKkxD,IAAI+mB,EAAMS,eAAiBh8E,KAAKi6E,SAAUj6E,KAAKi6E,UACvEoC,EAAYD,EAAmC,IAAhBp8E,KAAKi6E,SAAkB,WAAa,UAEnE/6D,EAAa,CACjB9S,KAAM,UACNJ,QAASqvE,EAAgBrvE,QACzB+H,UAAWsnE,EAAgBtnE,UAC3B0lB,SAAU,uBACVpqB,KAAM,IACDgsE,EAAgBhsE,KACnB8Z,IAAKrjB,GAAOotB,SAASC,KACrBqiB,MAAOwjC,EAAOsD,kBACdF,mBACAC,YAGAf,WAAYA,GAAc,IAI9Bt7E,KAAK65E,oBAAoBb,EAAQ95D,EAEnC,MAGA,GAAIo8D,EAAa,EAAG,CAClB,MAAMp8D,EAAa,CACjB9S,KAAM,UACNJ,QAASqvE,EAAgBrvE,QACzB+H,UAAWsnE,EAAgBtnE,UAC3B0lB,SAAU,gBACVpqB,KAAM,IACDgsE,EAAgBhsE,KACnB8Z,IAAKrjB,GAAOotB,SAASC,KACrBqiB,MAAOwjC,EAAOsD,kBACdhB,aACAjhD,QAAQ,IAIZr6B,KAAK65E,oBAAoBb,EAAQ95D,EACnC,CACF,CAGCs8D,uBACKx7E,KAAK+6E,oBACPp5C,aAAa3hC,KAAK+6E,oBAGpB/6E,KAAK+6E,mBAAqB17C,WAAW,IAAMr/B,KAAK87E,eAAgB,IAClE,EAGF,MAAMZ,GAAkB,CAAC,IAAK,SAAU,SAmCxC,SAASN,KACP,OAAOhrE,KAAKC,MAAQ,GACtB,CAoDA,SAAS0sE,GACPr9D,GAEA,MAAO,CACLnL,UAAWnE,KAAKC,MAAQ,IACxBzD,KAAM,aACH8S,EAEP,CAEA,IAAIkqC,GACH,SAAUA,GACPA,SAASA,EAASC,SAAc,GAAK,WACrCD,EAASA,EAASE,aAAkB,GAAK,eACzCF,EAASA,EAASz8C,QAAa,GAAK,UACpCy8C,EAASA,EAASG,KAAU,GAAK,OACjCH,EAASA,EAASI,MAAW,GAAK,QAClCJ,EAASA,EAASK,QAAa,GAAK,UAN7BL,CAOX,CAPC,CAOEA,IAAwB,CAAC,GAI5B,MAAMozB,GAAuB,IAAIpa,IAAI,CACnC,KACA,QACA,aACA,OACA,OACA,MACA,QACA,eACA,cACA,WACA,gBACA,0BAMF,SAASqa,GAAsBxnC,GAC7B,MAAM5xC,EAAM,CAAC,EACb,UAAWkE,KAAO0tC,EAChB,GAAIunC,GAAqBl1D,IAAI/f,GAAM,CACjC,IAAIm1E,EAAgBn1E,GAER,gBAARA,GAAiC,iBAARA,KAC3Bm1E,EAAgB,UAGlBr5E,EAAIq5E,GAAiBznC,EAAW1tC,EAClC,CAGF,OAAOlE,CACT,CAyCA,SAASs5E,GAAqBtwE,EAAQL,GACpC,MAAMy5D,EAASwQ,GAAOjlB,OAAOzF,MAAMl/C,GAC7BggD,EAAOoZ,GAAUwQ,GAAOjlB,OAAOjF,QAAQ0Z,GACvCnZ,EAAOD,GAAQ4pB,GAAOjlB,OAAOpF,QAAQS,GACrC5mB,EAAU6mB,GAoDlB,SAAS5/C,GAAU2/C,GACjB,OAAOA,EAAKjgD,OAASg9C,GAASz8C,OAChC,CAtD0BD,CAAU4/C,GAAQA,EAAO,KAEjD,MAAO,CACLtgD,UACAqD,KAAMo2B,EACF,CACEggC,SACApZ,KAAM,CACJ/jD,GAAIm9D,EACJ/9D,QAAS+9B,EAAQ/9B,QACjBgsD,YAAa7sD,MAAM6e,KAAK+f,EAAQymB,YAC7B/jD,IAAKkkD,GAASA,EAAKjgD,OAASg9C,GAASG,MAAQ8C,EAAKqH,aAClD1rD,OAAOsyC,SACPnyC,IAAIwkD,GAASA,EAAO31C,QACpB5P,KAAK,IACR6tC,WAAYwnC,GAAsBh3C,EAAQwP,cAG9C,CAAC,EAET,CAiGA,MAAM2nC,GAEH,CAEDn4C,SAuFF,SAASo4C,GACPj8B,GAEA,MACE3B,YACAgH,gBACAliD,OACAmjD,cACAvP,YACAmlC,kBACAC,kBACAC,iBACAC,gBACEr8B,EAGJ,MAAI,CAAC,QAAS,kBAAkB51C,SAASi7C,GAChC,KAGF,CACL75C,KAAO,GAAE6yC,KAAagH,IACtB1C,MAAOiD,GAAgB7O,GACvBnsB,IAAKg7B,GAAgBU,GACrBnjD,OACAsL,KAAM,CACJm3D,KAAMyW,EACN9vC,WAAY6vC,EACZF,kBACAC,mBAGN,EAtHEG,MA4BF,SAASC,GAAiBv8B,GACxB,MAAQ3sC,WAAUgrC,YAAWl7C,OAAM4zC,aAAciJ,EAE3C2C,EAAQiD,GAAgB7O,GAC9B,MAAO,CACLvrC,KAAM6yC,EACNl7C,OACAw/C,QACA/3B,IAAK+3B,EAAQtvC,EACb5E,UAAM9L,EAEV,EArCEw7C,WAuCF,SAASq+B,GAAsBx8B,GAC7B,MACE3B,YACAl7C,OACA+4E,kBACA7oE,WACAopE,cACAN,kBACAO,6BACAC,2BACAC,iBACAC,iBACAC,eACAC,gBACAhmC,aACAslC,gBACA7wE,SACEw0C,EAGJ,OAAiB,IAAb3sC,EACK,KAGF,CACL7H,KAAO,GAAE6yC,KAAa7yC,KACtBm3C,MAAOiD,GAAgB7O,IACvBnsB,IAAKg7B,GAAgB62B,GACrBt5E,OACAsL,KAAM,CACJm3D,KAAMyW,GACNH,kBACAC,kBACA9oE,WACAupE,iBACAF,6BACAC,2BACAE,iBACAC,eACAL,cACAM,iBAGN,GAtEA,SAASC,GAAuBh9B,GAC9B,OAAKg8B,GAAYh8B,EAAM3B,WAIhB29B,GAAYh8B,EAAM3B,WAAW2B,GAH3B,IAIX,CAEA,SAAS4F,GAAgBxD,GAGvB,QAAS5yC,IAAgCtK,GAAOkK,YAAYE,YAAc8yC,GAAQ,GACpF,CAkKA,MAAMt6C,UAAsBC,iBAAqB,KAAeA,iBAShE,SAASk1E,GAAQ7xE,EAAS8xE,GACnBp1E,KAILY,EAAOy0E,KAAK/xE,GAER8xE,GACFE,GAAiBhyE,GAErB,CAMA,SAASiyE,GAAgBjyE,EAAS8xE,GAC3Bp1E,KAILY,EAAOy0E,KAAK/xE,GAER8xE,GAGFz+C,WAAW,KACT2+C,GAAiBhyE,EAAO,EACvB,GAEP,CAEA,SAASgyE,GAAiBhyE,GACxBiT,GACE,CACEwa,SAAU,UACVpqB,KAAM,CACJ/F,OAAQ,UAEVF,MAAO,OACP4C,WAEF,CAAE5C,MAAO,QAEb,CAGA,MAAM80E,WAAqCt5E,MACxC7E,cACCu2B,MAAO,yCAAwC2yB,MACjD,EAOF,MAAMk1B,GAKHp+E,cACCC,KAAKw0C,OAAS,GACdx0C,KAAKo+E,WAAa,EAClBp+E,KAAKq+E,aAAc,CACrB,CAGC,aAAIC,GACH,OAAOt+E,KAAKw0C,OAAO9tC,OAAS,CAC9B,CAGC,QAAI0F,GACH,MAAO,MACT,CAGCwpE,UACC51E,KAAKw0C,OAAS,EAChB,CAGO+pC,SAAShwE,GAAO,IAAAiwE,EAAAx+E,KAAA,SAAAy+E,MAAA,YACrB,MAAMC,EAAY53D,KAAKC,UAAUxY,GAAO7H,OAExC,GADA83E,EAAKJ,YAAcM,EACfF,EAAKJ,WAAan1B,GACpB,MAAM,IAAIi1B,GAGZM,EAAKhqC,OAAOvtC,KAAKsH,EAAO,EAPH,EAQvB,CAGCkqC,SACC,OAAO,IAAIkmC,QAAQ1tE,IAIjB,MAAM2tE,EAAY5+E,KAAKw0C,OACvBx0C,KAAKgf,QACL/N,EAAQ6V,KAAKC,UAAU63D,GAAU,EAErC,CAGC5/D,QACChf,KAAKw0C,OAAS,GACdx0C,KAAKo+E,WAAa,EAClBp+E,KAAKq+E,aAAc,CACrB,CAGCQ,uBACC,MAAM9qE,EAAY/T,KAAKw0C,OAAOrsC,IAAIoG,GAASA,EAAMwF,WAAW6Q,OAAO,GAEnE,OAAK7Q,EAIE8kE,GAAc9kE,GAHZ,IAIX,EAOF,MAAM+qE,GAEH/+E,YAAYg/E,GACX/+E,KAAKg/E,QAAUD,EACf/+E,KAAKotD,IAAM,CACb,CAMC6xB,cAEC,OAAIj/E,KAAKk/E,sBAITl/E,KAAKk/E,oBAAsB,IAAIP,QAAQ,CAAC1tE,EAASI,KAC/CrR,KAAKg/E,QAAQt/C,iBACX,UACA,EAAGrwB,WACIA,EAAO8vE,QACVluE,IAEAI,GAAO,EAGX,CAAE+uC,MAAM,IAGVpgD,KAAKg/E,QAAQt/C,iBACX,QACAhR,IACErd,EAAOqd,EAAK,EAEd,CAAE0xB,MAAM,GACV,IAtBOpgD,KAAKk/E,mBA0BhB,CAKCtJ,UACCiI,GAAQ,0CACR79E,KAAKg/E,QAAQI,WACf,CAKCvH,YAAYr0D,EAAQ2b,GACnB,MAAM72B,EAAKtI,KAAKq/E,qBAEhB,OAAO,IAAIV,QAAQ,CAAC1tE,EAASI,KAC3B,MAAM0vB,EAAWA,EAAG1xB,WAClB,MAAMm1B,EAAWn1B,EACjB,GAAIm1B,EAAShhB,SAAWA,GAMpBghB,EAASl8B,KAAOA,EAOpB,IAFAtI,KAAKg/E,QAAQltC,oBAAoB,UAAW/Q,IAEvCyD,EAAS26C,QAKZ,OAHAz2E,IAAeY,EAAOolB,MAAM,WAAY8V,EAASA,eAEjDnzB,EAAO,IAAIzM,MAAM,gCAInBqM,EAAQuzB,EAASA,SAAS,GAK5BxkC,KAAKg/E,QAAQt/C,iBAAiB,UAAWqB,GACzC/gC,KAAKg/E,QAAQnH,YAAY,CAAEvvE,KAAIkb,SAAQ2b,OAAK,EAEhD,CAGCkgD,qBACC,OAAOr/E,KAAKotD,KACd,EAOF,MAAMkyB,GAGHv/E,YAAYg/E,GACX/+E,KAAKg/E,QAAU,IAAIF,GAAcC,GACjC/+E,KAAKu/E,mBAAqB,KAC1Bv/E,KAAKo+E,WAAa,EAClBp+E,KAAKq+E,aAAc,CACrB,CAGC,aAAIC,GACH,QAASt+E,KAAKu/E,kBAChB,CAGC,QAAInzE,GACH,MAAO,QACT,CAMC6yE,cACC,OAAOj/E,KAAKg/E,QAAQC,aACtB,CAKCrJ,UACC51E,KAAKg/E,QAAQpJ,SACf,CAOC2I,SAAShwE,GACR,MAAMwF,EAAY8kE,GAActqE,EAAMwF,aACjC/T,KAAKu/E,oBAAsBxrE,EAAY/T,KAAKu/E,sBAC/Cv/E,KAAKu/E,mBAAqBxrE,GAG5B,MAAM1E,EAAOyX,KAAKC,UAAUxY,GAG5B,OAFAvO,KAAKo+E,YAAc/uE,EAAK3I,OAEpB1G,KAAKo+E,WAAan1B,GACb01B,QAAQttE,OAAO,IAAI6sE,IAGrBl+E,KAAKw/E,mBAAmBnwE,EACjC,CAKCopC,SACC,OAAOz4C,KAAKy/E,gBACd,CAGCzgE,QACChf,KAAKu/E,mBAAqB,KAC1Bv/E,KAAKo+E,WAAa,EAClBp+E,KAAKq+E,aAAc,EAGnBr+E,KAAKg/E,QAAQnH,YAAY,SAASryE,KAAK,KAAM0M,IAC3CxJ,IAAeY,EAAOmN,KAAK,oDAAqDvE,EAAC,EAErF,CAGC2sE,uBACC,OAAO7+E,KAAKu/E,kBACd,CAKCC,mBAAmBnwE,GAClB,OAAOrP,KAAKg/E,QAAQnH,YAAY,WAAYxoE,EAC9C,CAKOowE,iBAAiB,IAAAC,EAAA1/E,KAAA,SAAAy+E,MAAA,YACtB,MAAMj6C,QAAiBk7C,EAAKV,QAAQnH,YAAY,UAEhD6H,SAAKH,mBAAqB,KAC1BG,EAAKtB,WAAa,EAEX55C,CAAS,EANM,EAOxB,EAQF,MAAMm7C,GAEH5/E,YAAYg/E,GACX/+E,KAAK4/E,UAAY,IAAIzB,GACrBn+E,KAAK6/E,aAAe,IAAIP,GAA6BP,GACrD/+E,KAAK8/E,MAAQ9/E,KAAK4/E,UAElB5/E,KAAK+/E,6BAA+B//E,KAAKggF,uBAC3C,CAGC,QAAI5zE,GACH,OAAOpM,KAAK8/E,MAAM1zE,IACpB,CAGC,aAAIkyE,GACH,OAAOt+E,KAAK8/E,MAAMxB,SACpB,CAGC,eAAID,GACH,OAAOr+E,KAAK8/E,MAAMzB,WACpB,CAEC,eAAIA,CAAYh0E,GACfrK,KAAK8/E,MAAMzB,YAAch0E,CAC3B,CAGCurE,UACC51E,KAAK4/E,UAAUhK,UACf51E,KAAK6/E,aAAajK,SACpB,CAGC52D,QACC,OAAOhf,KAAK8/E,MAAM9gE,OACpB,CAGC6/D,uBACC,OAAO7+E,KAAK8/E,MAAMjB,sBACpB,CAOCN,SAAShwE,GACR,OAAOvO,KAAK8/E,MAAMvB,SAAShwE,EAC7B,CAGOkqC,SAAS,IAAAwnC,EAAAjgF,KAAA,SAAAy+E,MAAA,YAEd,aAAMwB,EAAKC,uBAEJD,EAAKH,MAAMrnC,QAAS,EAJb,EAKhB,CAGCynC,uBACC,OAAOlgF,KAAK+/E,4BACd,CAGOC,wBAAwB,IAAAG,EAAAngF,KAAA,SAAAy+E,MAAA,YAC7B,UACQ0B,EAAKN,aAAaZ,aAC1B,OAIE,YADApB,GAAQ,gFAEV,OAGMsC,EAAKC,4BAA6B,EAXX,EAY/B,CAGOA,6BAA6B,IAAAC,EAAArgF,KAAA,SAAAy+E,MAAA,YAClC,MAAQjqC,SAAQ6pC,eAAgBgC,EAAKT,UAE/BU,EAAmB,GACzB,UAAW/xE,KAASimC,EAClB8rC,EAAiBr5E,KAAKo5E,EAAKR,aAAatB,SAAShwE,IAGnD8xE,EAAKR,aAAaxB,YAAcA,EAIhCgC,EAAKP,MAAQO,EAAKR,aAGlB,UACQlB,QAAQ1xC,IAAIqzC,EACpB,OAAS5xD,GACPhmB,IAAeY,EAAOmN,KAAK,wDAAyDiY,EACtF,CAAC,EAnBiC,EAoBpC,EAoDF,SAAS6xD,KACP,IAEE,MAAO,mBAAoBz6E,MAAYA,GAAO06E,cAChD,OACE,OAAO,CACT,CACF,CA+BA,SAASC,GAAU5mE,GACjB,YAAmBtW,IAAfsW,GAKGvW,KAAKyK,SAAW8L,CACzB,CAKA,SAASpG,GAAYG,GACnB,MAAM/D,EAAMD,KAAKC,MASjB,MAAO,CACLvH,GATSsL,EAAQtL,IAAMqF,KAUvBqG,QARcJ,EAAQI,SAAWnE,EASjC6wE,aARmB9sE,EAAQ8sE,cAAgB7wE,EAS3C8wE,UARgB/sE,EAAQ+sE,WAAa,EASrCppE,QARc3D,EAAQ2D,QAStBqpE,kBARwBhtE,EAAQgtE,kBAUpC,CAKA,SAASC,GAAYjtE,GACnB,GAAK2sE,KAIL,IACEz6E,GAAO06E,eAAeM,QAAQn4B,GAAoB7hC,KAAKC,UAAUnT,GACnE,OACE,CAEJ,CAcA,SAASmtE,IACLC,oBAAmBC,iBAAgBC,iBAAgB,IACnDN,qBAAsB,CAAC,GAEzB,MAAMrpE,EAbR,SAAS4pE,GAAqBH,EAAmBC,GAC/C,OAAOR,GAAUO,GAAqB,YAAYC,GAAiB,QACrE,CAWkBE,CAAqBH,EAAmBC,GAClDrtE,EAAUH,GAAY,CAC1B8D,UACAqpE,sBAGF,OAAIM,GACFL,GAAYjtE,GAGPA,CACT,CAgCA,SAASwtE,GACPC,EACAC,EACAC,GAAc,IAAI3xE,MAGlB,OAAoB,OAAhByxE,QAAmC99E,IAAX+9E,GAAwBA,EAAS,GAK9C,IAAXA,GAIGD,EAAcC,GAAUC,CACjC,CAKA,SAASC,GACP5tE,GAEE6tE,oBACAC,oBACAH,aAAa3xE,KAAKC,QAGpB,OAEEuxE,GAAUxtE,EAAQI,QAASytE,EAAmBF,IAG9CH,GAAUxtE,EAAQ8sE,aAAcgB,EAAmBH,EAEvD,CAGA,SAASI,GACP/tE,GACE8tE,oBAAmBD,sBAQrB,SALKD,GAAiB5tE,EAAS,CAAE8tE,oBAAmBD,uBAK5B,WAApB7tE,EAAQ2D,SAA8C,IAAtB3D,EAAQ+sE,UAK9C,CAMA,SAASiB,IAELC,iBACAH,oBACAD,oBACAb,qBAIFkB,GAEA,MAAMC,EAAkBD,EAAeZ,eAlGzC,SAASc,GAAaH,GACpB,IAAKtB,KACH,OAAO,KAGT,IAEE,MAAM0B,EAA2Bn8E,GAAO06E,eAAe0B,QAAQv5B,IAE/D,IAAKs5B,EACH,OAAO,KAGT,MAAME,EAAar7D,KAAK+mB,MAAMo0C,GAE9BhE,UAAgB,oCAAqC4D,GAE9CpuE,GAAY0uE,EACrB,OACE,OAAO,IACT,CACF,CA6E0DH,CAAaH,GAGrE,OAAKE,EAKAJ,GAAqBI,EAAiB,CAAEL,oBAAmBD,uBAIhExD,GAAgB,sEACT8C,GAAce,EAAgB,CAAElB,kBAAmBmB,EAAgBz5E,MAJjEy5E,GALP9D,GAAgB,gCAAiC4D,GAC1Cd,GAAce,EAAgB,CAAElB,sBAS3C,CAcA,SAASwB,GAAapJ,EAAQzqE,EAAOmlE,GACnC,QAAK2O,GAAerJ,EAAQzqE,KAM5B+zE,GAAUtJ,EAAQzqE,EAAOmlE,IAElB,EACT,CAkBC,SAEc4O,GAASC,EAAAC,EAAAC,GAAA,OAAAC,GAAA9+D,MAAA5jB,KAAAi/B,UAAA,CAyCxB,SAAAyjD,kBAAAjE,MAzCA,UACEzF,EACAzqE,EACAmlE,GAEA,IAAKsF,EAAO2J,YACV,OAAO,KAGT,IACMjP,GAAuC,WAAzBsF,EAAO4J,eACvB5J,EAAO2J,YAAY3jE,QAGjB00D,IACFsF,EAAO2J,YAAYtE,aAAc,GAGnC,MAEMwE,EAiDV,SAASC,GACPv0E,EACAxF,GAEA,IACE,GAAwB,mBAAbA,GApHf,SAASg6E,GAAcx0E,GACrB,OAAOA,EAAMnC,OAASiyD,GAAUO,MAClC,CAkH0CmkB,CAAcx0E,GAClD,OAAOxF,EAASwF,EAEpB,OAASmgB,GACPhmB,WACEY,EAAOolB,MAAM,6FAA8FA,GACtG,IACT,CAEA,OAAOngB,CACT,CAhEuCu0E,CAAmBv0E,EAFhCyqE,EAAOlgE,aAE8CkqE,yBAE3E,OAAKH,QAIQ7J,EAAO2J,YAAYpE,SAASsE,QAHvC,CAIJ,OAASn0D,GACP,MAAMvd,EAASud,GAASA,aAAiBwvD,GAA+B,uBAAyB,WAEjGx1E,IAAeY,EAAOolB,MAAMA,SACtBsqD,EAAOiK,KAAK,CAAE9xE,WAEpB,MAAMyH,EAASY,KAEXZ,GACFA,EAAOue,mBAAmB,qBAAsB,SAEpD,CACF,IAACvT,MAAA5jB,KAAAi/B,UAAA,CAGD,SAASojD,GAAerJ,EAAQzqE,GAC9B,IAAKyqE,EAAO2J,aAAe3J,EAAOkK,aAAelK,EAAOrvE,YACtD,OAAO,EAGT,MAAMw5E,EAAgBtK,GAActqE,EAAMwF,WAM1C,QAAIovE,EAAgBnK,EAAOoK,SAASC,iBAAmBzzE,KAAKC,OAKxDszE,EAAgBnK,EAAO9kB,aAAaovB,iBAAmBtK,EAAOlgE,aAAa2oE,oBAC7E5D,GACG,0CAAyCsF,0CAC1CnK,EAAOlgE,aAAamlC,aAAa4jC,gBAE5B,GAIX,CAoBA,SAAS98E,GAAawJ,GACpB,OAAQA,EAAMnC,IAChB,CAGA,SAASsvB,GAAmBntB,GAC1B,MAAsB,gBAAfA,EAAMnC,IACf,CAQA,SAASm3E,GAAgBh1E,GACvB,MAAsB,aAAfA,EAAMnC,IACf,CAKA,SAASo3E,GAAqBxK,GAG5B,MAAMyK,EAoER,SAASC,KACP,MAAM9qE,EAASY,KACf,IAAKZ,EACH,OAAO,EAGT,MAAMse,EAAYte,EAAOif,eACzB,OAAKX,GAKFA,EAAUqF,KAAO2S,4BAA6B,CAEnD,CAlF4Bw0C,GAE1B,MAAO,CAACn1E,EAAOgrB,KACb,IAAKy/C,EAAOrvE,cAAiB5E,GAAawJ,KAAWmtB,GAAmBntB,GACtE,OAGF,MAAM4+B,EAAa5T,GAAgBA,EAAa4T,WAKhD,IAAIs2C,MAAuBt2C,GAAcA,EAAa,KAAOA,GAAc,KAI3E,IAAIzR,GAAmBntB,GAErB,YAON,SAASo1E,GAAuB3K,EAAQzqE,GACtC,MAAMq1E,EAAgB5K,EAAO9kB,aAKzB3lD,EAAMmM,UAAYnM,EAAMmM,SAASO,OAAS1M,EAAMmM,SAASO,MAAMrD,UAAYgsE,EAAcC,SAASrd,KAAO,KAC3God,EAAcC,SAASt8D,IAAIhZ,EAAMmM,SAASO,MAAMrD,SAEpD,CAjBM+rE,CAAuB3K,EAAQzqE,IAmBrC,SAASu1E,GAAiB9K,EAAQzqE,GAChC,MAAMq1E,EAAgB5K,EAAO9kB,aAc7B,GANI3lD,EAAMI,UAAYi1E,EAAcG,SAASvd,KAAO,KAClDod,EAAcG,SAASx8D,IAAIhZ,EAAMI,UAKN,WAAzBqqE,EAAO4J,gBAA+Br0E,EAAMyJ,OAASzJ,EAAMyJ,KAAKgsE,SAClE,OAGF,MAAQC,uBAAwBjL,EAAOlgE,aACJ,mBAAxBmrE,IAAuCA,EAAoB11E,IAItE8wB,WAAW,KAIT25C,EAAOkL,2BAA0B,EAErC,CA7CIJ,CAAiB9K,EAAQzqE,EAAK,EAElC,CAyPA,SAAS41E,GACPnL,EACAhjE,GAEA,OAAOA,EAAQ7N,IAAI,EAAGiE,OAAMm3C,QAAO/3B,MAAKznB,OAAMsL,WAC5C,MAAMm1B,EAAWw0C,EAAOI,kBAAkB,CACxChtE,KAAMiyD,GAAUO,OAChB7qD,UAAWwvC,EACXl0C,KAAM,CACJgvC,IAAK,kBACL9pB,QAAS,CACPzc,GAAI1L,EACJ8N,YAAanW,EACbm+B,eAAgBqhB,EAChB5gB,aAAcnX,EACdnc,WAMN,MAA2B,iBAAbm1B,EAAwBm6C,QAAQ1tE,QAAQ,MAAQuzB,GAElE,CA2DA,SAAS4/C,GACPpL,EACA3mE,GAEK2mE,EAAOrvE,aAIG,OAAX0I,IAlBN,SAASgyE,GAAoBrL,EAAQ7vD,GAEnC,QAAIzgB,KAAeswE,EAAOlgE,aAAamlC,aAAa4jC,iBFt5LtD,SAASyC,GAAmBn7D,EAAKo7D,GAC/B,MAAM3rE,EACJ2rE,GA0BJ,SAASC,GAAMD,GAEb,YAAoChhF,IAA5BghF,EAAc/qE,SACxB,CA7BmBgrE,CAAMD,GAEjBA,EAAY/qE,YACZ+qE,EACAj1D,EAAM1W,GAAUA,EAAOK,SACvB+X,EAASpY,GAAUA,EAAOE,aAAakY,OAE7C,OAWF,SAASyzD,GAASt7D,EAAKmG,GACrB,QAAOA,GAAMnG,EAAIne,SAASskB,EAAIE,KAChC,CAbSi1D,CAASt7D,EAAKmG,IAGvB,SAASo1D,GAAYv7D,EAAK6H,GACxB,QAAKA,GAIEs3B,GAAoBn/B,KAASm/B,GAAoBt3B,EAC1D,CAT+B0zD,CAAYv7D,EAAK6H,EAChD,CEg5LSszD,CAAmBn7D,EAAK3P,KACjC,CAeM6qE,CAAoBrL,EAAQ3mE,EAAOtO,OAIvCi1E,EAAOG,UAAU,KACfgL,GAAuBnL,EAAQ,CAAC3mE,KAIzB,IAEX,CAqFA,SAASsyE,GACPxhD,EACArP,GAEA,GAAKqP,EAIL,IACE,GAAoB,iBAATA,EACT,OAAOrP,EAAYE,OAAOmP,GAAMz8B,OAGlC,GAAIy8B,aAAgByhD,gBAClB,OAAO9wD,EAAYE,OAAOmP,EAAK5+B,YAAYmC,OAG7C,GAAIy8B,aAAgB0hD,SAAU,CAC5B,MAAMC,EAAcC,GAAmB5hD,GACvC,OAAOrP,EAAYE,OAAO8wD,GAAap+E,MACzC,CAEA,GAAIy8B,aAAgB6hD,KAClB,OAAO7hD,EAAKqjC,KAGd,GAAIrjC,aAAgB8hD,YAClB,OAAO9hD,EAAK+hD,UAIhB,OACE,CAIJ,CAGA,SAASC,GAAyBniD,GAChC,IAAKA,EACH,OAGF,MAAMwjC,EAAO/1C,SAASuS,EAAQ,IAC9B,OAAOv9B,MAAM+gE,QAAQjjE,EAAYijE,CACnC,CAGA,SAAS4e,GAAcjiD,GACrB,IACE,GAAoB,iBAATA,EACT,MAAO,CAACA,GAGV,GAAIA,aAAgByhD,gBAClB,MAAO,CAACzhD,EAAK5+B,YAGf,GAAI4+B,aAAgB0hD,SAClB,MAAO,CAACE,GAAmB5hD,IAG7B,IAAKA,EACH,MAAO,MAAC5/B,EAEZ,OACEmF,WAAeY,EAAOmN,KAAK,oCAAqC0sB,GACzD,MAAC5/B,EAAW,mBACrB,CAEAmF,WAAeY,EAAOy0E,KAAK,sDAAuD56C,GAE3E,MAAC5/B,EAAW,wBACrB,CAGA,SAAS8hF,GACPtH,EACAuH,GAEA,IAAKvH,EACH,MAAO,CACL1qD,QAAS,CAAC,EACVmzC,UAAMjjE,EACNgiF,MAAO,CACLC,SAAU,CAACF,KAKjB,MAAMG,EAAU,IAAK1H,EAAKwH,OAE1BE,SAAQD,SAAW,IADMC,EAAQD,UAAY,GACJF,GAEzCvH,EAAKwH,MAAQE,EACN1H,CACT,CAGA,SAAS2H,GACPt5E,EACAiD,GAEA,IAAKA,EACH,OAAO,KAGT,MAAQ6yB,iBAAgBS,eAAcxZ,MAAK3F,SAAQ2pB,aAAYjkB,UAASsb,YAAan1B,EAerF,MAbe,CACbjD,OACAm3C,MAAOrhB,EAAiB,IACxB1W,IAAKmX,EAAe,IACpB5+B,KAAMolB,EACN9Z,KAAMtC,GAAkB,CACtByW,SACA2pB,aACAjkB,UACAsb,aAKN,CAGA,SAASmhD,GAAqCC,GAC5C,MAAO,CACLvyD,QAAS,CAAC,EACVmzC,KAAMof,EACNL,MAAO,CACLC,SAAU,CAAC,gBAGjB,CAGA,SAASK,GACPxyD,EACAuyD,EACAziD,GAEA,IAAKyiD,GAA4C,IAAhCvhF,OAAO8E,KAAKkqB,GAAS3sB,OACpC,OAGF,IAAKk/E,EACH,MAAO,CACLvyD,WAIJ,IAAK8P,EACH,MAAO,CACL9P,UACAmzC,KAAMof,GAIV,MAAM7H,EAAO,CACX1qD,UACAmzC,KAAMof,IAGAziD,KAAM2iD,EAAgBN,YA8BhC,SAASO,GAAqB5iD,GAG5B,IAAKA,GAAwB,iBAATA,EAClB,MAAO,CACLA,QAIJ,MAAM6iD,EAAmB7iD,EAAKz8B,OAASsiD,GACjCi9B,EAkCR,SAASC,GAAmBp8E,GAC1B,MAAMq8E,EAAQr8E,EAAI,GACZs8E,EAAOt8E,EAAIA,EAAIpD,OAAS,GAG9B,MAAkB,MAAVy/E,GAA0B,MAATC,GAA4B,MAAVD,GAA0B,MAATC,CAC9D,CAxCyBF,CAAmB/iD,GAE1C,GAAI6iD,EAAkB,CACpB,MAAMK,EAAgBljD,EAAKn5B,MAAM,EAAGg/C,IAEpC,OAAIi9B,EACK,CACL9iD,KAAMkjD,EACNb,SAAU,CAAC,yBAIR,CACLriD,KAAO,GAAEkjD,UACTb,SAAU,CAAC,kBAEf,CAEA,GAAIS,EACF,IAEE,MAAO,CACL9iD,KAFerc,KAAK+mB,MAAM1K,GAI9B,OACE,CAIJ,MAAO,CACLA,OAEJ,CAxE6C4iD,CAAqB5iD,GAChE46C,SAAK56C,KAAO2iD,EACRN,GAAYA,EAAS9+E,OAAS,IAChCq3E,EAAKwH,MAAQ,CACXC,aAIGzH,CACT,CAGA,SAASuI,GAAkBjzD,EAASkzD,GAClC,OAAOliF,OAAO8E,KAAKkqB,GAASpd,OAAO,CAACuwE,EAAiBj/E,KACnD,MAAMm1E,EAAgBn1E,EAAIO,cAE1B,OAAIy+E,EAAev7E,SAAS0xE,IAAkBrpD,EAAQ9rB,KACpDi/E,EAAgB9J,GAAiBrpD,EAAQ9rB,IAEpCi/E,GACN,CAAC,EACN,CAEA,SAASzB,GAAmB0B,GAI1B,OAAO,IAAI7B,gBAAgB6B,GAAUliF,UACvC,CAuDA,SAASmiF,GAAWv9D,EAAKw9D,GACvB,MAAMC,EAMR,SAASC,GAAW19D,EAAK29D,EAAUhhF,GAAOgiB,SAASg/D,SAEjD,GAAI39D,EAAIjB,WAAW,YAAciB,EAAIjB,WAAW,aAAeiB,EAAIjB,WAAWpiB,GAAOotB,SAASjb,QAC5F,OAAOkR,EAET,MAAM49D,EAAW,IAAIC,IAAI79D,EAAK29D,GAG9B,GAAIC,EAAS9uE,SAAW,IAAI+uE,IAAIF,GAAS7uE,OACvC,OAAOkR,EAGT,MAAMy9D,EAAUG,EAAS5zD,KAGzB,OAAKhK,EAAI+8B,SAAS,MAAQ0gC,EAAQ1gC,SAAS,KAClC0gC,EAAQ58E,MAAM,GAAG,GAGnB48E,CACT,CA1BkBC,CAAW19D,GAE3B,OAAO5e,GAAyBq8E,EAASD,EAC3C,CA+CA,SAAAM,kBAAAxI,MAlBA,UACEv/D,EACA7L,EACAnN,GAIA,IACE,MAAMmJ,QAiCT,SAEc63E,GAAiBC,EAAAC,EAAAC,GAAA,OAAAC,GAAA1jE,MAAA5jB,KAAAi/B,UAAA,CAnCTioD,CAAkBhoE,EAAY7L,EAAMnN,GAGjDmM,EAASqzE,GAA4B,iBAAkBr2E,GAC7D+0E,GAAqBl+E,EAAQ8yE,OAAQ3mE,EACvC,OAASqc,GACPhmB,IAAeY,EAAOolB,MAAM,8CAA+CA,EAC7E,CACF,GAACu4D,GAAArjE,MAAA5jB,KAAAi/B,UAAA,CA2B+B,SAAAqoD,kBAAA7I,MAAhC,UACEv/D,EACA7L,EACAnN,GAIA,MAAM2J,EAAMD,KAAKC,OACTqyB,iBAAiBryB,EAAK8yB,eAAe9yB,GAAQwD,GAGnD8V,MACA3F,SACAkf,YAAayK,EAAa,EAC1Bo6C,kBAAmBC,EACnBC,mBAAoBC,GAClBxoE,EAAW7P,KAETs4E,EACJjB,GAAWv9D,EAAKjjB,EAAQ0hF,0BAA4BlB,GAAWv9D,EAAKjjB,EAAQ2hF,uBAExE3+D,EAAUy+D,EAgBlB,SAASG,IACLC,uBAAsBC,yBACxB99E,EACAs9E,GAEA,MAAMn0D,EAAUnpB,EAgIlB,SAAS+9E,GAAkB9jD,EAAWoiD,GACpC,OAAyB,IAArBpiD,EAAUz9B,QAAwC,iBAAjBy9B,EAAU,GACtC+jD,GAAsB/jD,EAAU,GAAKoiD,GAGrB,IAArBpiD,EAAUz9B,OACLwhF,GAAsB/jD,EAAU,GAAKoiD,GAGvC,CAAC,CACV,CA1I0B0B,CAAkB/9E,EAAO89E,GAAyB,CAAC,EAE3E,IAAKD,EACH,OAAOlC,GAA8BxyD,EAASm0D,OAAiBjkF,GAIjE,MAAM4kF,EAAcC,GAAwBl+E,IACrCm+E,EAAS/C,GAAWF,GAAc+C,GACnC94E,EAAOw2E,GAA8BxyD,EAASm0D,EAAiBa,GAErE,OAAI/C,EACKD,GAAah2E,EAAMi2E,GAGrBj2E,CACT,CApCMy4E,CAAgB5hF,EAASmN,EAAKnJ,MAAOs9E,GACrC7B,GAAqC6B,GACnChjD,SAoCR,SACe8jD,GAAgBC,EAAAC,EAAAC,EAAAC,GAAA,OAAAC,GAAA/kE,MAAA5jB,KAAAi/B,UAAA,CArCNqpD,CAAiBX,EAAgBzhF,EAASmN,EAAKmxB,SAAUkjD,GAEhF,MAAO,CACLxlD,iBACAS,eACAxZ,MACA3F,SACA2pB,aACAjkB,UACAsb,YAEJ,GAAC8iD,GAAA1jE,MAAA5jB,KAAAi/B,UAAA,CA0B8B,SAAA0pD,kBAAAlK,MAA/B,UACEkJ,GAEEI,uBACAj0D,cACA80D,0BAIFpkD,EACAkjD,GAEA,IAAKC,QAAuCpkF,IAArBmkF,EACrB,OAAO/B,GAAqC+B,GAG9C,MAAMr0D,EAAUmR,EAAWqkD,GAAcrkD,EAASnR,QAASu1D,GAA0B,CAAC,EAEtF,IAAKpkD,IAAcujD,QAA6CxkF,IAArBmkF,EACzC,OAAO7B,GAA8BxyD,EAASq0D,OAAkBnkF,GAGlE,MAAOulF,EAAUxD,SAgDlB,SAEcyD,GAAuBC,GAAA,OAAAC,GAAArlE,MAAA5jB,KAAAi/B,UAAA,CAlDF8pD,CAAwBvkD,GACpDnyB,EAeR,SAAS62E,GACPJ,GAEEf,uBACAj0D,cACA4zD,mBACAC,iBACAt0D,YAKF,IACE,MAAMmzC,EACJsiB,GAAYA,EAASpiF,aAA+BnD,IAArBmkF,EAC3B/C,GAAYmE,EAAUh1D,GACtB4zD,EAEN,OAAKC,EAKI9B,GAA8BxyD,EAASmzC,EAD5CuhB,EACkDe,OAGFvlF,GAP3CoiF,GAAqCnf,EAQhD,OAAS93C,GACPhmB,WAAeY,EAAOmN,KAAK,6CAA8CiY,GAElEm3D,GAA8BxyD,EAASq0D,OAAkBnkF,EAClE,CACF,CA/CiB2lF,CAAgBJ,EAAU,CACvCf,uBACAj0D,cACA4zD,mBACAC,iBACAt0D,YAGF,OAAIiyD,EACKD,GAAahzE,EAAQizE,GAGvBjzE,CACT,GAACs2E,GAAA/kE,MAAA5jB,KAAAi/B,UAAA,CAoCqC,SAAAgqD,kBAAAxK,MAAtC,UAAuCj6C,GACrC,MAAMxiB,EA0ER,SAASmnE,GAAkB3kD,GACzB,IAEE,OAAOA,EAAS3nB,OAClB,OAAS6R,GAEPhmB,IAAeY,EAAOmN,KAAK,yCAA0CiY,EACvE,CACF,CAlFcy6D,CAAkB3kD,GAE9B,IAAKxiB,EACH,MAAO,MAACze,EAAW,oBAGrB,IAEE,MAAO,OADY6lF,GAAoBpnE,GAEzC,OAAS0M,GACPhmB,WAAeY,EAAOmN,KAAK,iDAAkDiY,GACtE,MAACnrB,EAAW,mBACrB,CACF,IAACqgB,MAAA5jB,KAAAi/B,UAAA,CAED,SAASmpD,GAAwBjkD,EAAY,IAE3C,GAAyB,IAArBA,EAAUz9B,QAAwC,iBAAjBy9B,EAAU,GAI/C,OAAQA,EAAU,GAAKhB,IACzB,CAEA,SAAS0lD,GAAcx1D,EAASkzD,GAC9B,MAAM8C,EAAa,CAAC,EAEpB9C,SAAen+E,QAAQ46B,IACjB3P,EAAQ9lB,IAAIy1B,KACdqmD,EAAWrmD,GAAU3P,EAAQ9lB,IAAIy1B,GAAM,GAIpCqmD,CACT,CAcA,SAASnB,GACPh+E,EACAq8E,GAEA,IAAKr8E,EACH,MAAO,CAAC,EAGV,MAAMmpB,EAAUnpB,EAAMmpB,QAEtB,OAAKA,EAIDA,aAAmB7B,QACdq3D,GAAcx1D,EAASkzD,GAI5B1/E,MAAMC,QAAQusB,GACT,CAAC,EAGHizD,GAAkBjzD,EAASkzD,GAZzB,CAAC,CAaZ,CAiBA,SAAS6C,GAAoB5kD,GAC3B,OAAO,IAAIm6C,QAAQ,CAAC1tE,EAASI,KAC3B,MAAM0mB,EAAUsH,WAAW,IAAMhuB,EAAO,IAAIzM,MAAM,+CAAgD,MASrG,SAEc0kF,GAAgBC,GAAA,OAAAC,GAAA5lE,MAAA5jB,KAAAi/B,UAAA,EAT3BqqD,CAAiB9kD,GACdh/B,KACCikF,GAAOx4E,EAAQw4E,GACft4E,GAAUE,EAAOF,IAElBsB,QAAQ,IAAMkvB,aAAa5J,GAAQ,EAE1C,CAQA,SAAAyxD,kBAAA/K,MANA,UAAgCj6C,GAG9B,aAAaA,EAASmoB,MACxB,IAAC/oC,MAAA5jB,KAAAi/B,UAAA,CAsBD,SAAAyqD,kBAAAjL,MAhBA,UACEv/D,EACA7L,EACAnN,GAEA,IACE,MAAMmJ,EAuCV,SAASs6E,GACPzqE,EACA7L,EACAnN,GAEA,MAAM2J,EAAMD,KAAKC,OACTqyB,iBAAiBryB,EAAK8yB,eAAe9yB,EAAK3F,QAAO04B,OAAQvvB,GAG/D8V,MACA3F,SACAkf,YAAayK,EAAa,EAC1Bo6C,kBAAmBC,EACnBC,mBAAoBC,GAClBxoE,EAAW7P,KAEf,IAAK8Z,EACH,OAAO,KAGT,IAAKyZ,IAAQ8jD,GAAWv9D,EAAKjjB,EAAQ0hF,yBAA2BlB,GAAWv9D,EAAKjjB,EAAQ2hF,uBAGtF,MAAO,CACL3lD,iBACAS,eACAxZ,MACA3F,SACA2pB,aACAjkB,QARcy8D,GAAqC6B,GASnDhjD,SARemhD,GAAqC+B,IAYxD,MAAMllD,GAAUI,EAAIhB,GACdomD,GAAwBxlD,GAC1B8jD,GAAkB9jD,GAAQH,gBAAiBn8B,EAAQ8hF,uBACnD,CAAC,EACCY,GAAyBtC,GAmBjC,SAASsD,GAAmBhnD,GAC1B,MAAMvP,EAAUuP,EAAIinD,wBAEpB,OAAKx2D,EAIEA,EAAQ9qB,MAAM,QAAQ0N,OAAO,CAACS,EAAKyO,KACxC,MAAO5d,EAAK8C,GAAS8a,EAAK5c,MAAM,MAChCmO,SAAInP,EAAIO,eAAiBuC,EAClBqM,GACN,CAAC,GAPK,CAAC,CAQZ,CA/BmDkzE,CAAmBhnD,GAAM18B,EAAQ0iF,yBAE3ET,GAAa2B,IAAkB5jF,EAAQ6hF,qBAAuB3C,GAAcl7E,GAAS,MAAC3G,IACtFwmF,GAAcC,IAAmB9jF,EAAQ6hF,qBA8BlD,SAASkC,GAAoBrnD,GAE3B,MAAMzuB,EAAS,GAEf,IACE,MAAO,CAACyuB,EAAIsnD,aACd,OAASh4E,GACPiC,EAAOlN,KAAKiL,EACd,CAGA,IACE,OAqBJ,SAASi4E,GACPhnD,EACAinD,GAEA,IACE,GAAoB,iBAATjnD,EACT,MAAO,CAACA,GAGV,GAAIA,aAAgBkmB,SAClB,MAAO,CAAClmB,EAAKA,KAAKknD,WAGpB,GAAqB,SAAjBD,GAA2BjnD,GAAwB,iBAATA,EAC5C,MAAO,CAACrc,KAAKC,UAAUoc,IAGzB,IAAKA,EACH,MAAO,MAAC5/B,EAEZ,OACEmF,WAAeY,EAAOmN,KAAK,oCAAqC0sB,GACzD,MAAC5/B,EAAW,mBACrB,CAEAmF,WAAeY,EAAOy0E,KAAK,sDAAuD56C,GAE3E,MAAC5/B,EAAW,wBACrB,CAjDW4mF,CAAkBvnD,EAAI4B,SAAU5B,EAAIwnD,aAC7C,OAASl4E,GACPiC,EAAOlN,KAAKiL,EACd,CAEAxJ,WAAeY,EAAOmN,KAAK,8CAA+CtC,GAEnE,MAAC5Q,EACV,CAlDyE0mF,CAAoBrnD,GAAO,MAACr/B,GAE7F2lB,GAAU28D,GAA8BmC,GAAuBR,EAAiBW,IAChF3jD,GAAWqhD,GAA8B+C,GAAwBlB,EAAkBqC,IAEzF,MAAO,CACL7nD,iBACAS,eACAxZ,MACA3F,SACA2pB,aACAjkB,QAAS4gE,GAAiBzE,GAAan8D,GAAS4gE,IAAkB5gE,GAClEsb,SAAUwlD,GAAkB3E,GAAa7gD,GAAUwlD,IAAmBxlD,GAE1E,CA9FiBmlD,CAAgBzqE,EAAY7L,EAAMnN,GAGzCmM,EAASqzE,GAA4B,eAAgBr2E,GAC3D+0E,GAAqBl+E,EAAQ8yE,OAAQ3mE,EACvC,OAASqc,GACPhmB,IAAeY,EAAOolB,MAAM,4CAA6CA,EAC3E,CACF,IAAC9K,MAAA5jB,KAAAi/B,UAAA,CAwLD,SAASqrD,GAAyBtR,GAChC,MAAMpgE,EAASY,KAEf,IACE,MAAMsa,EAAc,IAAIC,aAGtB6zD,yBACAC,wBACAE,uBACAC,wBACAY,0BACE5P,EAAOlgE,aAEL5S,EAAU,CACd8yE,SACAllD,cACA8zD,yBACAC,wBACAE,uBACAC,wBACAY,0BAGEhwE,GAAUA,EAAOiU,GACnBjU,EAAOiU,GAAG,sBAAuB,CAAC3N,EAAY7L,IAYpD,SAASk3E,GACPrkF,EACAgZ,EACA7L,GAEA,GAAK6L,EAAW7P,KAIhB,KA2BF,SAASm7E,GAAiBtrE,GACxB,MAA+B,QAAxBA,EAAWua,QACpB,EA5BQ+wD,CAAiBtrE,IAkCzB,SAASurE,GAAWp3E,GAClB,OAAOA,GAAQA,EAAKuvB,GACtB,CApCwC6nD,CAAWp3E,KAhOnD,SAASq3E,GACPxrE,EACA7L,EACAnN,GAEA,MAAQ08B,MAAK14B,SAAUmJ,EAEvB,IAAKuvB,EACH,OAGF,MAAM+nD,EAAUhG,GAAYz6E,EAAOhE,EAAQ4tB,aACrC82D,EAAUhoD,EAAIsN,kBAAkB,kBAClCi1C,GAAyBviD,EAAIsN,kBAAkB,mBAiJrD,SAAS26C,GACP1nD,EACAinD,EACAt2D,GAEA,IAEE,OAAO6wD,GAD0B,SAAjByF,GAA2BjnD,GAAwB,iBAATA,EAAoBrc,KAAKC,UAAUoc,GAAQA,EACzErP,EAC9B,OACE,MACF,CACF,CA3JM+2D,CAAajoD,EAAI4B,SAAU5B,EAAIwnD,aAAclkF,EAAQ4tB,kBAEzCvwB,IAAZonF,IACFzrE,EAAW7P,KAAKk4E,kBAAoBoD,QAEtBpnF,IAAZqnF,IACF1rE,EAAW7P,KAAKo4E,mBAAqBmD,EAEzC,CA8MMF,CAAoBxrE,EAAY7L,EAAMnN,GA/P3C,SAMc4kF,GAA4BC,EAAAC,EAAAC,GAAAvB,GAAA9lE,MAAA5jB,KAAAi/B,UAAA,CA6PrC6rD,CAA6B5rE,EAAY7L,EAAMnN,IAsBrD,SAASglF,GAAmBhsE,GAC1B,MAA+B,UAAxBA,EAAWua,QACpB,CArBQyxD,CAAmBhsE,IA2B3B,SAASisE,GAAa93E,GACpB,OAAOA,GAAQA,EAAKmxB,QACtB,CA7B0C2mD,CAAa93E,KA1gBvD,SAAS+3E,GACPlsE,EACA7L,EACAnN,GAEA,MAAQgE,QAAOs6B,YAAanxB,EAGtBs3E,EAAUhG,GADHz6E,EAAQk+E,GAAwBl+E,QAAS3G,EACpB2C,EAAQ4tB,aAEpC82D,EAAUpmD,EAAW2gD,GAAyB3gD,EAASnR,QAAQ9lB,IAAI,wBAAqBhK,OAE9EA,IAAZonF,IACFzrE,EAAW7P,KAAKk4E,kBAAoBoD,QAEtBpnF,IAAZqnF,IACF1rE,EAAW7P,KAAKo4E,mBAAqBmD,EAEzC,CA4fMQ,CAAsBlsE,EAAY7L,EAAMnN,GAziB9C,SAIemlF,GAA8BC,EAAAC,EAAAC,GAAAvE,GAAArjE,MAAA5jB,KAAAi/B,UAAA,CAyiBvCosD,CAA+BnsE,EAAY7L,EAAMnN,GAErD,OACEwC,IAAeY,EAAOmN,KAAK,0CAC7B,CACF,CA9C6D8zE,CAA2BrkF,EAASgZ,EAAY7L,KAGvG+vB,GAr1BN,SAASqoD,GAAwBzS,GAC/B,OAAQ10C,IACN,IAAK00C,EAAOrvE,YACV,OAGF,MAAM0I,EA/BV,SAASq5E,GAAYpnD,GACnB,MAAQpC,iBAAgBS,eAAc4B,YAAWC,YAAaF,EAE9D,IAAK3B,EACH,OAAO,KAIT,MAAQnf,SAAQ2F,OAAQob,EAExB,MAAO,CACLn4B,KAAM,iBACNm3C,MAAOrhB,EAAiB,IACxB1W,IAAKmX,EAAe,IACpB5+B,KAAMolB,EACN9Z,KAAM,CACJmU,SACA2pB,WAAY3I,EAAYA,EAAWtwB,YAAS3Q,GAGlD,CAWmBmoF,CAAYpnD,GAE3B8/C,GAAqBpL,EAAQ3mE,EAAM,CAEvC,CA20BqCo5E,CAAwBzS,IACvDn3C,EA1yBN,SAAS8pD,GAAsB3S,GAC7B,OAAQ10C,IACN,IAAK00C,EAAOrvE,YACV,OAGF,MAAM0I,EArCV,SAASu5E,GAAUtnD,GACjB,MAAQpC,iBAAgBS,eAAcC,OAAQ0B,EAExCpB,EAAgBN,EAAIhB,GAE1B,IAAKM,IAAmBS,IAAiBO,EACvC,OAAO,KAIT,MAAQ1f,SAAQ2F,MAAKuZ,YAAayK,GAAejK,EAEjD,YAAY3/B,IAAR4lB,EACK,KAGF,CACL/c,KAAM,eACNrI,KAAMolB,EACNo6B,MAAOrhB,EAAiB,IACxB1W,IAAKmX,EAAe,IACpBtzB,KAAM,CACJmU,SACA2pB,cAGN,CAWmBy+C,CAAUtnD,GAEzB8/C,GAAqBpL,EAAQ3mE,EAAM,CAEvC,CAgyBmCs5E,CAAsB3S,IAEvD,OACE,CAEJ,CAuDA,IAAI6S,GAAmB,KA+GvB,SAASC,GAAmB9S,GAE1B,MAAMngE,EAAQY,KACRb,EAASY,KAEfX,EAAM0E,iBA7GLy7D,IACAngE,IACC,IAAKmgE,EAAOrvE,YACV,OAGF,MAAM0I,EAYV,SAAS05E,GAAYlzE,GAKnB,MAAMmzE,EAAgBnzE,EAAMyG,mBAAqBzG,EAAMyG,oBAUvD,OANIusE,KAAqBG,IAAkBA,IAI3CH,GAAmBG,GApCrB,SAASC,GAAyB/sE,GAChC,QAASA,EAAWua,QACtB,CAqCKwyD,CAAyBD,IAC1B,CAAC,QAAS,MAAO,eAAgB,sBAAsBhhF,SAASghF,EAAcvyD,WAC9EuyD,EAAcvyD,SAASvR,WAAW,QAE3B,KAGsB,YAA3B8jE,EAAcvyD,SAQpB,SAASyyD,GACPhtE,GAEA,MAAMtV,EAAOsV,EAAW7P,MAAQ6P,EAAW7P,KAAK4vB,UAEhD,IAAKp4B,MAAMC,QAAQ8C,IAAyB,IAAhBA,EAAKlD,OAC/B,OAAO61E,GAAiBr9D,GAG1B,IAAIitE,GAAc,EAGlB,MAAMC,EAAiBxiF,EAAKzB,IAAIg3B,IAC9B,IAAKA,EACH,OAAOA,EAET,GAAmB,iBAARA,EACT,OAAIA,EAAIz4B,OA74Ne,KA84NrBylF,GAAc,EACN,GAAEhtD,EAAIn1B,MAAM,EA/4NC,cAk5NhBm1B,EAET,GAAmB,iBAARA,EACT,IACE,MAAMktD,EAAgBnmE,GAAUiZ,EAAK,GAErC,OADoBrY,KAAKC,UAAUslE,GACnB3lF,OAx5NK,KAy5NnBylF,GAAc,EAEN,GAAErlE,KAAKC,UAAUslE,EAAe,KAAM,GAAGriF,MAAM,EA35NpC,cA65NdqiF,CACT,OACE,CAIJ,OAAOltD,IAGT,OAAOo9C,GAAiB,IACnBr9D,EACH7P,KAAM,IACD6P,EAAW7P,KACd4vB,UAAWmtD,KACPD,EAAc,CAAE5G,MAAO,CAAEC,SAAU,CAAC,2BAA+B,CAAC,IAG9E,CAzDW0G,CAA2BF,GAG7BzP,GAAiByP,EAC1B,CAxCmBD,CAAYlzE,GAEtBxG,GAIL0mE,GAAmBC,EAAQ3mE,EAAM,EAiGZi6E,CAAoBtT,IAC3Cx4C,GA/mFAw4C,IAEQ10C,IACN,IAAK00C,EAAOrvE,YACV,OAGF,MAAM0I,EA6DV,SAASk6E,GAAUjoD,GACjB,MAAQj4B,SAAQL,WAQlB,SAASwgF,GAAaloD,GACpB,MAAMmoD,EAA+B,UAArBnoD,EAAYvgC,KAE5B,IAAIiI,EACAK,EAAS,KAGb,IACEA,EAASogF,EAAUjT,GAAmBl1C,EAAY/1B,OAAUkrE,GAAcn1C,EAAY/1B,OACtFvC,EAAUhG,GAAiBqG,EAAQ,CAAEtF,gBAAiB,OAAU,WAClE,OACEiF,EAAU,WACZ,CAEA,MAAO,CAAEK,SAAQL,UACnB,CAvB8BwgF,CAAaloD,GAEzC,OAAOi4C,GAAiB,CACtB9iD,SAAW,MAAK6K,EAAYvgC,UACzB44E,GAAqBtwE,EAAQL,IAEpC,CApEmBugF,CAAUjoD,GAEzB,IAAKjyB,EACH,OAGF,MAAMo6E,EAA+B,UAArBnoD,EAAYvgC,KACtBwK,EAAQk+E,EAAWnoD,EAAY/1B,WAAUhL,EAG7CkpF,GACAzT,EAAO0T,eACPn+E,GACAA,EAAMlC,SACLkC,EAAMo+E,SACNp+E,EAAMq+E,UACNr+E,EAAMs+E,UACNt+E,EAAMu+E,UAjYb,SAAS9R,GAAY0R,EAAerR,EAAiBhvB,GACnDqgC,EAAc1R,YAAYK,EAAiBhvB,EAC7C,CAiYM2uB,CACEhC,EAAO0T,cACPr6E,EACAmnE,GAAmBl1C,EAAY/1B,QAInCwqE,GAAmBC,EAAQ3mE,EAAM,EA8kFI06E,CAAkB/T,IACzD5mD,GAjmCF,SAAS46D,GAA0BhU,GACjC,OAAQ10C,IACN,IAAK00C,EAAOrvE,YACV,OAGF,MAAM0I,EAzBV,SAAS46E,GAAc3oD,GACrB,MAAQ5e,OAAMuN,MAAOqR,EAEfz0B,EAAMD,KAAKC,MAAQ,IAEzB,MAAO,CACLzD,KAAM,kBACNm3C,MAAO1zC,EACP2b,IAAK3b,EACL9L,KAAMkvB,EACN5jB,KAAM,CACJ0qD,SAAUr0C,GAGhB,CAWmBunE,CAAc3oD,GAEd,OAAXjyB,IAKJ2mE,EAAO9kB,aAAayyB,KAAK1/E,KAAKoL,EAAOtO,MACrCi1E,EAAOC,sBAEPD,EAAOG,UAAU,KACfgL,GAAuBnL,EAAQ,CAAC3mE,KAEzB,IACR,CAEL,CA2kCmC26E,CAA0BhU,IAC3DsR,GAAyBtR,GAIzB,MAAM3gD,EA/tCR,SAAS60D,GACPlU,EACAmU,GAAgC,GAEhC,MAAMC,EAAmBD,EAAgC3J,GAAqBxK,QAAUz1E,EAExF,OAAOc,OAAO4oB,OACZ,CAAC1e,EAAO8E,IAED2lE,EAAOrvE,YA3NlB,SAAS0jF,GAAc9+E,GACrB,MAAsB,iBAAfA,EAAMnC,IACf,CA6NUihF,CAAc9+E,WAGTA,EAAM8L,YACN9L,IAIJxJ,GAAawJ,IAAWmtB,GAAmBntB,IAAWg1E,GAAgBh1E,KAKnDyqE,EAAOE,+BAK3BqK,GAAgBh1E,IAGlByqE,EAAOlhD,QACPvpB,EAAMmM,SAASmb,SAASy3D,UAAYtU,EAAOuU,eA5FnD,SAASC,GAAsBxU,EAAQzqE,GACrCyqE,EAAOC,sBACPD,EAAOG,UAAU,KACV5qE,EAAMwF,YAQXilE,EAAOI,kBAAkB,CACvBhtE,KAAMiyD,GAAUO,OAChB7qD,UAA6B,IAAlBxF,EAAMwF,UACjB1E,KAAM,CACJ0E,UAAWxF,EAAMwF,UACjBsqC,IAAK,aACL9pB,QAAS,CACPkF,SAAU,kBACVpqB,KAAM,CACJo+E,WAAYl/E,EAAMI,eAMnB,GAEX,CAkEQ6+E,CAAsBxU,EAAQzqE,GACvBA,GA/Gf,SAASm/E,GAAan/E,EAAO8E,GAC3B,QAAI9E,EAAMnC,OAASmC,EAAMC,YAAcD,EAAMC,UAAUC,SAAWF,EAAMC,UAAUC,OAAO/H,SAKrF2M,EAAKgN,oBAAqBhN,EAAKgN,kBAAkBstE,UAKvD,CAyGUD,CAAan/E,EAAO8E,KAAU2lE,EAAOlgE,aAAamlC,aAAa2vC,mBACjEllF,IAAeY,EAAOqC,IAAI,+CAAgD4C,GACnE,QAnEf,SAASs/E,GAA2B7U,EAAQzqE,GAY1C,QAX6B,WAAzByqE,EAAO4J,eAMPr0E,EAAMvC,UAAY68C,KAKjBt6C,EAAMC,WAAaD,EAAMnC,OAIvBq0E,GAAUzH,EAAOlgE,aAAag1E,gBACvC,CAwDkCD,CAA2B7U,EAAQzqE,IAIW,YAAzByqE,EAAO4J,iBAGtDr0E,EAAMyJ,KAAO,IAAKzJ,EAAMyJ,KAAMgsE,SAAUhL,EAAOuU,iBAK7CH,GAEFA,EAAiB7+E,EAAO,CAAE4+B,WAAY,MAGjC5+B,GAxCEA,EAlBAA,EA4DX,CAAEjG,GAAI,UAEV,CAupCyB4kF,CAA0BlU,GAAS+U,GAASn1E,IAC/DA,GAAUA,EAAO4E,kBACnB5E,EAAO4E,kBAAkB6a,GrE3tM7B,SAAS7a,GAAkBzU,GACzB,MAAM6P,EAASY,MAEVZ,IAAWA,EAAO4E,mBAIvB5E,EAAO4E,kBAAkBzU,EAC3B,CqEqtMIyU,CAAkB6a,GAIhB01D,GAASn1E,KACXA,EAAOiU,GAAG,kBAp1Cd,SAASmhE,GAAsBhV,GAC7B,OAAQzqE,KACDyqE,EAAOrvE,cAAgB5E,GAAawJ,IAQ7C,SAAS0/E,GAAqBjV,EAAQzqE,GACpC,MAAM2/E,EAAiB3/E,EAAMC,WAAaD,EAAMC,UAAUC,QAAUF,EAAMC,UAAUC,OAAO,GAAGpE,MAChE,iBAAnB6jF,IAOTA,EAAe7oE,MAAM,6EAIrB6oE,EAAe7oE,MAAM,qEAKrB0zD,GAAmBC,EAHAuD,GAAiB,CAClC9iD,SAAU,yBAIhB,CAxBIw0D,CAAqBjV,EAAQzqE,EAAK,CAEtC,CA40CiCy/E,CAAsBhV,IACnDpgE,EAAOiU,GAAG,iBAAkB22D,GAAqBxK,IACjDpgE,EAAOiU,GAAG,YAAcxT,IACtB,MAAM2qE,EAAWhL,EAAOuU,eAEpBvJ,GAAYhL,EAAOrvE,aAAwC,YAAzBqvE,EAAO4J,eAEnB5J,EAAOE,iCAE7B7/D,EAAIi0E,UAAYtJ,KAKtBprE,EAAOiU,GAAG,mBAAoBtX,IAC5ByjE,EAAOmV,gBAAkB54E,IAK3BqD,EAAOiU,GAAG,oBAAqBtX,IAC7ByjE,EAAOmV,gBAAkB54E,IAI3BqD,EAAOiU,GAAG,qBAAsB,CAACuhE,EAAeloF,KAC9C,MAAM89E,EAAWhL,EAAOuU,eACpBrnF,GAAWA,EAAQmoF,eAAiBrV,EAAOrvE,aAAeq6E,IAG5DhL,EAAOlhD,QACHs2D,EAAc1zE,UAAY0zE,EAAc1zE,SAASmb,WACnDu4D,EAAc1zE,SAASmb,SAASy3D,UAAYtJ,MAKtD,CAGA,SAAS+J,GAASn1E,GAChB,SAAUA,IAAUA,EAAOiU,GAC7B,CAM6B,SAAAyhE,kBAAA7P,MAA7B,UAA8BzF,GAE5B,IACE,OAAO2F,QAAQ1xC,IACbk3C,GAAuBnL,EAAQ,CAE7BuV,GAAkBzoF,GAAOkK,YAAYw+E,UAG3C,OAEE,MAAO,EACT,CACF,IAAC5qE,MAAA5jB,KAAAi/B,UAAA,CAED,SAASsvD,GAAkBE,GACzB,MAAQC,kBAAiBC,kBAAiBC,kBAAmBH,EAGvDzrC,EAAOpzC,KAAKC,MAAQ,IAC1B,MAAO,CACLzD,KAAM,SACNrI,KAAM,SACNw/C,MAAOP,EACPx3B,IAAKw3B,EACL3zC,KAAM,CACJm/E,OAAQ,CACNE,kBACAC,kBACAC,mBAIR,CAsEA,SAASC,GAAuB7V,GAC9B,IAAI8V,GAAgB,EAEpB,MAAO,CAACvgF,EAAOwgF,KAEb,IAAK/V,EAAOE,+BAGV,YAFAxwE,IAAeY,EAAOmN,KAAK,0DAO7B,MAAMi9D,EAAaqb,IAAgBD,EACnCA,GAAgB,EAEZ9V,EAAO0T,eAh5Ff,SAASsC,GAAqCtC,EAAen+E,GAC3D,IASE,IA0BJ,SAAS0gF,GAAmB1gF,GAC1B,OAAOA,EAAMnC,OAASwsE,EACxB,CA5BSqW,CAAmB1gF,GACtB,OAGF,MAAQrD,UAAWqD,EAAMc,KASzB,GARInE,IAAW4zD,GAAkBE,UAC/B0tB,EAAcjR,iBAAiBltE,EAAMwF,WAGnC7I,IAAW4zD,GAAkBK,QAC/ButB,EAAchR,eAAentE,EAAMwF,WAoBzC,SAASm7E,GACP3gF,GAEA,OAAOA,EAAMc,KAAKnE,SAAW4zD,GAAkBI,gBACjD,CArBQgwB,CAA8B3gF,GAAQ,CACxC,MAAQnC,OAAM9D,MAAOiG,EAAMc,KACrBg9C,EAAO4pB,GAAOjlB,OAAOjF,QAAQzjD,GAE/B+jD,aAAgB1kD,aAAeyE,IAAS6zD,GAAkBI,OAC5DqsB,EAAc/Q,cAActvB,EAEhC,CACF,OACE,CAEJ,CA+2FM2iC,CAAqChW,EAAO0T,cAAen+E,GAI7DyqE,EAAOG,UAAU,KAYf,GAN6B,WAAzBH,EAAO4J,eAA8BlP,GACvCsF,EAAOmW,mBAKJ/M,GAAapJ,EAAQzqE,EAAOmlE,GAE/B,OAAO,EAKT,IAAKA,EACH,OAAO,EAiBT,GAsEN,SAAS0b,GAAiBpW,EAAQtF,IAE3BA,IAAesF,EAAOplE,SAAwC,IAA7BolE,EAAOplE,QAAQ+sE,WAIrDyB,GAAapJ,EAnCf,SAASqW,GAAmBrW,GAC1B,MAAM9yE,EAAU8yE,EAAOlgE,aACvB,MAAO,CACL1M,KAAMiyD,GAAUO,OAChB7qD,UAAWnE,KAAKC,MAChBR,KAAM,CACJgvC,IAAK,UACL9pB,QAAS,CACP+6D,mBAAoBtW,EAAOuW,oBAC3BvO,kBAAmB96E,EAAQ86E,kBAC3B8M,gBAAiB5nF,EAAQ4nF,gBACzB0B,qBAAsBtpF,EAAQupF,eAC9BC,cAAexpF,EAAQwpF,cACvBj/B,YAAavqD,EAAQuqD,YACrB2lB,cAAelwE,EAAQkwE,cACvBqZ,iBAAgBzW,EAAO2J,aAA0C,WAA5B3J,EAAO2J,YAAYv2E,KACxDujF,qBAAsBzpF,EAAQ0hF,uBAAuBlhF,OAAS,EAC9DqhF,qBAAsB7hF,EAAQ6hF,qBAC9B6H,yBAA0B1pF,EAAQ8hF,sBAAsBthF,OAAS,EACjEmpF,0BAA2B3pF,EAAQ0iF,uBAAuBliF,OAAS,IAI3E,CAYuB2oF,CAAmBrW,IAAS,EACnD,CArFMoW,CAAiBpW,EAAQtF,GAQrBsF,EAAOplE,SAAWolE,EAAOplE,QAAQgtE,kBACnC,OAAO,EAKT,GAA6B,WAAzB5H,EAAO4J,eAA8B5J,EAAOplE,SAAWolE,EAAO2J,YAAa,CAC7E,MAAMmN,EAAgB9W,EAAO2J,YAAY9D,uBACrCiR,IACFjS,GACG,uEAAsE,IAAIjuE,KAAKkgF,KAChF9W,EAAOlgE,aAAamlC,aAAa4jC,gBAGnC7I,EAAOplE,QAAQI,QAAU87E,EAErB9W,EAAOlgE,aAAaooE,eACtBL,GAAY7H,EAAOplE,SAGzB,CAEA,MAA6B,YAAzBolE,EAAO4J,eAQJ5J,EAAOlhD,SAGP,GACR,CAEL,CA4JA,SAAAi4D,kBAAAtR,MAnDA,WACE7lE,SACAC,QACAmrE,SAAUr1E,EACVJ,UAIA,MAKMyhF,EAAY,CAAErhF,WAAUma,aAJI,iBAAzBlQ,EAAO+d,eAAuD,OAAzB/d,EAAO+d,eAA2B9vB,MAAMC,QAAQ8R,EAAO+d,oBAE/FpzB,EADAc,OAAO8E,KAAKyP,EAAO+d,gBAKrB/d,EAAOU,MACTV,EAAOU,KAAK,kBAAmB/K,EAAOyhF,GAGxC,MAAMC,QAAuBvnE,GAC3B9P,EAAOE,aACPvK,EACAyhF,EACAn3E,EACAD,EACAqJ,MAIF,IAAKguE,EACH,OAAO,KAMTA,EAAcjwD,SAAWiwD,EAAcjwD,UAAY,aAGnD,MAAMjmB,EAAWnB,EAAOgf,gBAAkBhf,EAAOgf,kBACzC7zB,OAAMsd,WAAatH,GAAYA,EAASuP,KAAQ,CAAC,EAEzD2mE,SAAc3mE,IAAM,IACf2mE,EAAc3mE,IACjBvlB,KAAMA,GAAQ,4BACdsd,QAASA,GAAW,SAGf4uE,CACT,IAACrsE,MAAA5jB,KAAAi/B,UAAA,CAiID,SAAAixD,kBAAAzR,MA5HA,WACE0R,gBACAnM,WACArD,UAAWyP,EACXC,eACAt8E,YACAH,YAEA,MAAM08E,EA5FR,SAASC,IACPJ,gBACA98D,YAIA,IAAIm9D,EAGJ,MAAMC,EAAiB,GAAE3pE,KAAKC,UAAUsM,OAGxC,GAA6B,iBAAlB88D,EACTK,EAAuB,GAAEC,IAAgBN,QACpC,CAGL,MAAMO,GAFM,IAAI38D,aAEKC,OAAOy8D,GAE5BD,EAAsB,IAAIpiF,WAAWsiF,EAAShqF,OAASypF,EAAczpF,QACrE8pF,EAAoB/iF,IAAIijF,GACxBF,EAAoB/iF,IAAI0iF,EAAeO,EAAShqF,OAClD,CAEA,OAAO8pF,CACT,CAmEgCD,CAAqB,CACjDJ,gBACA98D,QAAS,CACP+8D,iBAIIzJ,OAAM5C,WAAUF,WAAUP,oBAAqB+M,EAEjDz3E,EAASY,KACTX,EAAQY,KACRyd,GAAYte,GAAUA,EAAOif,eAC7BvI,GAAM1W,GAAUA,EAAOK,SAE7B,KAAKL,GAAWse,IAAc5H,IAAQ1b,EAAQ2D,SAC5C,OAGF,MAAMo5E,GAAY,CAChBvkF,KAAMw8C,GACNgoC,uBAAwBtN,EAAmB,IAC3CvvE,UAAWA,EAAY,IACvB88E,UAAW9M,EACX+M,UAAWjN,EACX8C,OACA2G,UAAWtJ,EACXoM,aACAW,YAAan9E,EAAQ2D,SAGjBy5E,SA/FR,SAGeC,GAAkBC,GAAA,OAAAnB,GAAAnsE,MAAA5jB,KAAAi/B,UAAA,CA4FLgyD,CAAmB,CAAEp4E,QAAOD,SAAQorE,WAAUz1E,MAAOoiF,KAE/E,IAAKK,GAIH,OAFAp4E,EAAOue,mBAAmB,kBAAmB,SAAUw5D,SACvD9S,GAAQ,mEA0CHmT,GAAY12E,sBAEnB,MAAMkZ,GAvMR,SAAS29D,GACPH,EACAb,EACA7gE,EACA0B,GAEA,OAAOoC,GACL8C,GAA2B86D,EAAah7D,GAAgCg7D,GAAchgE,EAAQ1B,GAC9F,CACE,CAAC,CAAEljB,KAAM,gBAAkB4kF,GAC3B,CACE,CACE5kF,KAAM,mBAIN1F,OAC2B,iBAAlBypF,GAA6B,IAAIp8D,aAAcC,OAAOm8D,GAAezpF,OAASypF,EAAczpF,QAEvGypF,IAIR,CAgLmBgB,CAAqBH,GAAaV,EAAuBhhE,GAAK1W,EAAOE,aAAakY,QAEnG,IAAIwT,GAEJ,IACEA,SAAiBtN,GAAUqF,KAAK/I,GAClC,OAASlN,IACP,MAAMoI,GAAQ,IAAI9pB,MAAMikD,IAExB,IAGEn6B,GAAM0iE,MAAQ9qE,EAChB,OACE,CAEF,MAAMoI,EACR,CAGA,IAAK8V,GACH,OAAOA,GAIT,GAAmC,iBAAxBA,GAAS2I,aAA4B3I,GAAS2I,WAAa,KAAO3I,GAAS2I,YAAc,KAClG,MAAM,IAAIkkD,GAAyB7sD,GAAS2I,YAG9C,MAAMwB,GAAazB,GAAiB,CAAC,EAAG1I,IACxC,GAAIsI,GAAc6B,GAAY,UAC5B,MAAM,IAAI2iD,GAAe3iD,IAG3B,OAAOnK,EACT,GAAC0rD,GAAAtsE,MAAA5jB,KAAAi/B,UAAA,CAKD,MAAMoyD,WAAiCzsF,MACpC7E,YAAYotC,GACX7W,MAAO,kCAAiC6W,IAC1C,EAMF,MAAMmkD,WAAuB1sF,MAE1B7E,YAAY4uC,GACXrY,MAAM,kBACNt2B,KAAK2uC,WAAaA,CACpB,EAGF,SAGe4iD,GAAUC,GAAA,OAAAC,GAAA7tE,MAAA5jB,KAAAi/B,UAAA,UAAAwyD,kBAAAhT,MAAzB,UACEiT,EACAC,EAAc,CACZhhB,MAAO,EACP11C,SAAU6tB,KAGZ,MAAQqnC,gBAAejqF,WAAYwrF,EAGnC,GAAKvB,EAAczpF,OAInB,IACE,aAvKH,SAKckrF,GAAiBC,GAAA,OAAA3B,GAAAtsE,MAAA5jB,KAAAi/B,UAAA,CAkKtB2yD,CAAkBF,IACjB,CACT,OAASprE,GACP,GAAIA,aAAe+qE,IAA4B/qE,aAAegrE,GAC5D,MAAMhrE,EAcR,GAVA/H,GAAW,UAAW,CACpBuzE,YAAaH,EAAYhhB,QAGvBjoE,IAAexC,EAAQ+3C,cAAgB/3C,EAAQ+3C,aAAa2vC,mBAC9DztE,GAAiBmG,GAKfqrE,EAAYhhB,OAAS5nB,GAAiB,CACxC,MAAMr6B,EAAQ,IAAI9pB,MAAO,GAAEikD,6BAE3B,IAGEn6B,EAAM0iE,MAAQ9qE,CAChB,OACE,CAGF,MAAMoI,CACR,CAGAijE,SAAY12D,YAAc02D,EAAYhhB,MAE/B,IAAIgO,QAAQ,CAAC1tE,EAASI,KAC3BguB,YAAUo/C,QAAC,YACT,UACQ8S,GAAWG,EAAYC,GAC7B1gF,GAAQ,EACV,OAASqV,GACPjV,EAAOiV,EACT,CACF,GAAGqrE,EAAY12D,SAAQ,EAE3B,CACF,GAACw2D,GAAA7tE,MAAA5jB,KAAAi/B,UAAA,CAED,MAAM8yD,GAAY,cA6DlB,MAAMC,GAmDHjyF,aACCmG,UACA+rF,qBAGDD,GAAgB1tF,UAAUoN,OAAOhN,KAAK1E,MAAMgyF,GAAgB1tF,UAAUqN,QAAQjN,KAAK1E,MAAMgyF,GAAgB1tF,UAAUsN,QAAQlN,KAAK1E,MAAMgyF,GAAgB1tF,UAAUuN,QAAQnN,KAAK1E,MAAMgyF,GAAgB1tF,UAAU4tF,QAAQxtF,KAAK1E,MAAMgyF,GAAgB1tF,UAAU6tF,QAAQztF,KAAK1E,MACtQA,KAAK2iF,YAAc,KACnB3iF,KAAKoyF,mBAAqB,GAC1BpyF,KAAKqyF,yBAA2B,GAChCryF,KAAK4iF,cAAgB,UACrB5iF,KAAKojF,SAAW,CACdC,iBA9rP8B,IA+rP9B3B,kBA5rP+B,KA8rPjC1hF,KAAKsyF,cAAgB1iF,KAAKC,MAC1B7P,KAAKu4B,YAAa,EAClBv4B,KAAKuyF,WAAY,EACjBvyF,KAAKwyF,8BAA+B,EACpCxyF,KAAKyyF,SAAW,CACd1O,SAAU,IAAI3hB,IACdyhB,SAAU,IAAIzhB,IACdukB,KAAM,GACNrD,iBAAkB1zE,KAAKC,MACvB6iF,WAAY,IAGd1yF,KAAK2yF,kBAAoBV,EACzBjyF,KAAK02B,SAAWxwB,EAEhBlG,KAAK4yF,gBA9oBT,SAASC,GAAShnF,EAAMiuD,EAAM5zD,GAC5B,IAAI4sF,EAEAC,EACAC,EAEJ,MAAMC,EAAU/sF,GAAWA,EAAQ+sF,QAAU3vF,KAAKyG,IAAI7D,EAAQ+sF,QAASn5B,GAAQ,EAE/E,SAASo5B,IACPC,WACAL,EAAsBjnF,IACfinF,CACT,CAEA,SAASK,SACK5vF,IAAZwvF,GAAyBpxD,aAAaoxD,QACvBxvF,IAAfyvF,GAA4BrxD,aAAaqxD,GACzCD,EAAUC,OAAazvF,CACzB,CASA,SAAS6vF,IACP,OAAIL,GACFpxD,aAAaoxD,GAEfA,EAAU1zD,WAAW6zD,EAAYp5B,GAE7Bm5B,QAA0B1vF,IAAfyvF,IACbA,EAAa3zD,WAAW6zD,EAAYD,IAG/BH,CACT,CAEAM,SAAUC,OAASF,EACnBC,EAAUt7D,MArBV,SAASA,IACP,YAAgBv0B,IAAZwvF,QAAwCxvF,IAAfyvF,EACpBE,IAEFJ,CACT,EAiBOM,CACT,CAmmB2BP,CAAS,IAAM7yF,KAAKszF,SAAUtzF,KAAK02B,SAAS68D,cAAe,CAChFN,QAASjzF,KAAK02B,SAAS88D,gBAGzBxzF,KAAKyzF,mBArIT,SAASC,GACPztE,EACA0tE,EACAC,GAEA,MAAMplD,EAAU,IAAIthC,IAepB,IAAI2mF,GAAc,EAElB,MAAO,IAAIr5D,KAET,MAAM3qB,EAAMvM,KAAKm8C,MAAM7vC,KAAKC,MAAQ,KAMpC,GAvBgBA,KAChB,MAAMQ,EAAYR,EAAM+jF,EACxBplD,EAAQpmC,QAAQ,CAAC0K,EAAQvL,KACnBA,EAAM8I,GACRm+B,EAAQ/mB,OAAOlgB,EAAG,EAErB,EAcDusF,CAASjkF,GAVF,IAAI2+B,EAAQ//B,UAAUwH,OAAO,CAAC4O,EAAGC,IAAMD,EAAIC,EAAG,IAa7B6uE,EAAU,CAChC,MAAMI,EAAeF,EACrBA,UAAc,EACPE,EA5CG,YA4CsBhC,EAClC,CAEA8B,GAAc,EACd,MAAMljB,EAAQniC,EAAQjhC,IAAIsC,IAAQ,EAClC2+B,SAAQ/gC,IAAIoC,EAAK8gE,EAAQ,GAElB1qD,KAAMuU,EAAI,CAErB,CA2F8Bk5D,CACxB,CAACnlF,EAAOmlE,IA/xEd,SAAS6K,GACPvF,EACAzqE,EACAmlE,GAEA,OAAK2O,GAAerJ,EAAQzqE,GAIrB+zE,GAAUtJ,EAAQzqE,EAAOmlE,GAHvBiL,QAAQ1tE,QAAQ,KAI3B,CAqxE6BstE,CAASv+E,KAAMuO,EAAOmlE,GAE7C,IAEA,GAGF,MAAQsgB,mBAAkBC,4BAA6Bj0F,KAAK8Y,aAEtD8gE,EAAkBoa,EACpB,CACE3jF,UAAW/M,KAAKkxD,IAxsPG,IAwsPuBw/B,GAC1Cj8D,QAASi8D,EACT5Z,cAxsPwB,IAysPxB1R,eAAgBurB,EAA2BA,EAAyB7sF,KAAK,KAAO,SAElF7D,EAEAq2E,IACF55E,KAAK0sF,cAAgB,IAAI/S,GAAc35E,KAAM45E,GAEjD,CAGC1lB,aACC,OAAOl0D,KAAKyyF,QACd,CAGC9oF,YACC,OAAO3J,KAAKu4B,UACd,CAGC2qD,WACC,OAAOljF,KAAKuyF,SACd,CAKChD,oBACC,QAAevvF,KAAKk0F,OACtB,CAGCp7E,aACC,OAAO9Y,KAAK02B,QACd,CAMCy9D,mBAAmBvT,GAClB,MAAQkN,kBAAiB9M,qBAAsBhhF,KAAK02B,SAIpD,KAAIo3D,GAAmB,GAAK9M,GAAqB,GAQjD,IAFAhhF,KAAKo0F,8BAA8BxT,IAE9B5gF,KAAK4T,QAGR,YADA5T,KAAKq0F,iBAAiB,IAAIzvF,MAAM,6CAIL,IAAzB5E,KAAK4T,QAAQ2D,UAQjBvX,KAAK4iF,cAAyC,WAAzB5iF,KAAK4T,QAAQ2D,SAAmD,IAA3BvX,KAAK4T,QAAQ+sE,UAAkB,SAAW,UAEpG1C,GACG,+BAA8Bj+E,KAAK4iF,qBACpC5iF,KAAK02B,SAASunB,aAAa4jC,gBAG7B7hF,KAAKs0F,uBAAqB,CAC5B,CASC/wC,QACC,GAAIvjD,KAAKu4B,YAAqC,YAAvBv4B,KAAK4iF,cAC1B,MAAM,IAAIh+E,MAAM,2CAGlB,GAAI5E,KAAKu4B,YAAqC,WAAvBv4B,KAAK4iF,cAC1B,MAAM,IAAIh+E,MAAM,sEAGlBq5E,GAAgB,2CAA4Cj+E,KAAK02B,SAASunB,aAAa4jC,gBAEvF,MAAMjuE,EAAUguE,GACd,CACEH,kBAAmBzhF,KAAK02B,SAAS+qD,kBACjCC,kBAAmB1hF,KAAKojF,SAAS1B,kBACjCG,eAAgB7hF,KAAK02B,SAASunB,aAAa4jC,gBAE7C,CACEX,cAAelhF,KAAK02B,SAASwqD,cAE7BF,kBAAmB,EACnBC,gBAAgB,IAIpBjhF,KAAK4T,QAAUA,EAEf5T,KAAKs0F,sBACP,CAMCC,iBACC,GAAIv0F,KAAKu4B,WACP,MAAM,IAAI3zB,MAAM,2CAGlBq5E,GAAgB,0CAA2Cj+E,KAAK02B,SAASunB,aAAa4jC,gBAEtF,MAAMjuE,EAAUguE,GACd,CACEF,kBAAmB1hF,KAAKojF,SAAS1B,kBACjCD,kBAAmBzhF,KAAK02B,SAAS+qD,kBACjCI,eAAgB7hF,KAAK02B,SAASunB,aAAa4jC,gBAE7C,CACEX,cAAelhF,KAAK02B,SAASwqD,cAC7BF,kBAAmB,EACnBC,gBAAgB,IAIpBjhF,KAAK4T,QAAUA,EAEf5T,KAAK4iF,cAAgB,SACrB5iF,KAAKs0F,sBACP,CAOCE,iBACC,IACE,MAAMC,EAAgBz0F,KAAKk0F,QAE3Bl0F,KAAK00F,eAAiBze,GAAO,IACxBj2E,KAAK2yF,qBAImB,WAAvB3yF,KAAK4iF,eAA8B,CAAE1M,iBAr3PpB,KAs3PrB58D,KAAMu1E,GAAuB7uF,MAC7BynE,WAAYznE,KAAK20F,sBACbF,EACA,CACE/iC,aAAc+iC,EAAc/iC,aAC5BglB,iBAAkB+d,EAAc/d,iBAChCzO,SAAUwsB,EAAcxsB,SACxBzW,eAAgBijC,EAAcjjC,gBAEhC,CAAC,GAET,OAASlrC,GACPtmB,KAAKq0F,iBAAiB/tE,EACxB,CACF,CAQCsuE,gBACC,IACE,OAAI50F,KAAK00F,iBACP10F,KAAK00F,iBACL10F,KAAK00F,oBAAiBnxF,IAGjB,CACT,OAAS+iB,GACP,OAAAtmB,KAAKq0F,iBAAiB/tE,IACf,CACT,CACF,CAMO28D,MAAO4R,cAAa,EAAO1jF,UAAW,CAAC,GAAG,IAAA2jF,EAAA90F,KAAA,SAAAy+E,MAAA,YAC/C,GAAKqW,EAAKv8D,WAMVu8D,GAAKv8D,YAAa,EAElB,IACEslD,GACG,4BAA0B1sE,EAAU,iBAAgBA,IAAW,IAChE2jF,EAAKp+D,SAASunB,aAAa4jC,gBAG7BiT,EAAKC,mBACLD,EAAKF,gBAELE,EAAKlC,gBAAgBS,SAGjBwB,UACIC,EAAKxB,OAAO,CAAE0B,OAAO,KAI7BF,EAAKnS,aAAemS,EAAKnS,YAAY/M,UACrCkf,EAAKnS,YAAc,KAxwFzB,SAASsS,GAAajc,IAQtB,SAASkc,KACP,GAAK3U,KAIL,IACEz6E,GAAO06E,eAAe2U,WAAWxsC,GACnC,OACE,CAEJ,EAjBEusC,GACAlc,EAAOplE,aAAUrQ,CACnB,CAywFM0xF,CAAaH,EACf,OAASxuE,GACPwuE,EAAKT,iBAAiB/tE,EACxB,EAAC,EAlC8C,EAmCjD,CAOC8uE,QACKp1F,KAAKuyF,YAITvyF,KAAKuyF,WAAY,EACjBvyF,KAAK40F,gBAEL/W,GAAQ,0BAA2B79E,KAAK02B,SAASunB,aAAa4jC,gBAChE,CAQCwT,UACMr1F,KAAKuyF,YAAcvyF,KAAKs1F,kBAI7Bt1F,KAAKuyF,WAAY,EACjBvyF,KAAKw0F,iBAEL3W,GAAQ,2BAA4B79E,KAAK02B,SAASunB,aAAa4jC,gBACjE,CASOqC,2BAA4BqR,qBAAoB,GAAS,CAAC,GAAG,IAAAC,EAAAx1F,KAAA,SAAAy+E,MAAA,YAClE,GAA2B,YAAvB+W,EAAK5S,cACP,OAAO4S,EAAKC,iBAGd,MAAMC,EAAe9lF,KAAKC,MAE1BguE,GAAQ,wCAAyC2X,EAAK9+D,SAASunB,aAAa4jC,sBAMtE2T,EAAKC,iBAEX,MAAME,EAAsBH,EAAKZ,iBAE5BW,IAAsBI,GAKG,YAAzBH,EAAK5S,gBAKV4S,EAAK5S,cAAgB,UAGjB4S,EAAK5hF,UACP4hF,EAAKI,oBAAoBF,GACzBF,EAAKK,uBAAuBH,GAC5BF,EAAKM,qBAGPN,EAAKhB,iBAAiB,EApC4C,EAqCpE,CAUCrb,UAAUh5B,GAET,MAAM41C,EAAW51C,IAIU,WAAvBngD,KAAK4iF,gBAMQ,IAAbmT,GAMJ/1F,KAAK4yF,iBACP,CAOC3Z,sBAKC,GAJAj5E,KAAK41F,sBAIA51F,KAAK00F,eAaV10F,KAAKk5E,+BAELl5E,KAAK61F,6BAfL,CAGE,IAAK71F,KAAKs1F,gBACR,OAIFt1F,KAAKq1F,QAEP,CAMF,CASCW,qBACCh2F,KAAK41F,sBACL51F,KAAK61F,wBACP,CAKCI,mBACC,MAA2B,WAAvBj2F,KAAK4iF,cACAjE,QAAQ1tE,UAGVjR,KAAKy1F,gBACd,CAKC39D,QACC,OAAO93B,KAAK4yF,iBACd,CAOC6C,iBACC,OAAAz1F,KAAK4yF,kBAEE5yF,KAAK4yF,gBAAgB96D,OAC9B,CAKCo+D,cACCl2F,KAAK4yF,gBAAgBS,QACvB,CAGC9F,eACC,OAAOvtF,KAAK4T,SAAW5T,KAAK4T,QAAQtL,EACtC,CAUC4wE,+BAKC,KACEl5E,KAAKsyF,eACLlR,GAAUphF,KAAKsyF,cAAetyF,KAAKojF,SAASC,mBAC5CrjF,KAAK4T,SACoB,YAAzB5T,KAAK4T,QAAQ2D,SAYf,QAAKvX,KAAKs1F,gBANRt1F,KAAKo1F,OAYT,CAOCjG,kBACC,MACMhmE,EAAO,GAAErjB,GAAOotB,SAASjb,SADZnS,GAAOotB,SAASy0B,WAAW7hD,GAAOotB,SAAS6R,OAAOj/B,GAAOotB,SAAS4R,SAGrF9kC,KAAKoyF,mBAAqB,GAC1BpyF,KAAKqyF,yBAA2B,GAGhCryF,KAAKm2F,gBAELn2F,KAAKyyF,SAASC,WAAavpE,EAC3BnpB,KAAKyyF,SAASnP,iBAAmB1zE,KAAKC,MACtC7P,KAAKyyF,SAAS9L,KAAK1/E,KAAKkiB,EAC1B,CAMCiwD,kBACC7qE,EACAmlE,GAEA,MAAM1xD,EAAMhiB,KAAKyzF,mBAAmBllF,EAAOmlE,GAI3C,GAAI1xD,IAAQ+vE,GAAW,CACrB,MAAM7yE,EAAaq9D,GAAiB,CAClC9iD,SAAU,qBAGZz5B,KAAKm5E,UAAU,KAELiJ,GAAapiF,KAAM,CACzBoM,KAp2IoB,EAq2IpB2H,UAAWmL,EAAWnL,WAAa,EACnC1E,KAAM,CACJgvC,IAAK,aACL9pB,QAASrV,EACTmb,QAAQ,KAIhB,CAEA,OAAOrY,CACT,CAMCs6D,kBAEC,MAAM6R,EAAkBnuF,KAAKmuF,iBAAmB10E,KAAkBiF,iBAG5DxT,GADcijF,GAAmBj2E,GAAWi2E,GAAiB9+E,MAAS,CAAC,GACnD2iC,IAC1B,GAAKm8C,GAAoBjjF,GAAW,CAAC,QAAS,UAAUF,SAASE,GAIjE,OAAOgN,GAAWi2E,GAAiBj0E,WACrC,CAMCo6E,uBACCt0F,KAAKmvF,kBAILnvF,KAAK61F,yBAEL71F,KAAK2iF,YAhoGT,SAASyT,IACP3G,iBACA4G,UAAWC,IAEX,GACE7G,GAEA/rF,OAAO6yF,OACP,CACA,MAAMxX,EAWV,SAASyX,GAAYF,GACnB,IACE,MAAMD,EAAYC,GAetB,SAASG,KACP,cAAWC,iCAAqC,MAAgBA,iCAtelE,SAASxkF,KAAI,MAAMA,EAAE,IAAI8yE,KAAK,CAFnB,kjUAEwB,OAAOgC,IAAI2P,gBAAgBzkF,EAAE,CAuerDA,GAGF,EACT,CArByCukF,GAErC,IAAKJ,EACH,OAGFxY,GAAS,qCAAmCyY,EAAmB,SAAQA,IAAoB,KAC3F,MAAMvX,EAAS,IAAIwX,OAAOF,GAC1B,OAAO,IAAI1W,GAAiBZ,EAC9B,OACElB,GAAQ,+CAEV,CACF,CA1BmB2Y,CAAYF,GAE3B,GAAIvX,EACF,OAAOA,CAEX,CAEAlB,UAAQ,gCACD,IAAIM,EACb,CA8mGuBiY,CAAkB,CACnC3G,eAAgBzvF,KAAK02B,SAAS+4D,eAC9B4G,UAAWr2F,KAAK02B,SAAS2/D,YAG3Br2F,KAAK+0F,mBACL/0F,KAAK42F,gBAGL52F,KAAKu4B,YAAa,EAClBv4B,KAAKuyF,WAAY,EAEjBvyF,KAAKw0F,gBACP,CAGCH,iBAAiB3lE,GAChBhmB,IAAeY,EAAOolB,MAAM,WAAYA,GAEpChmB,IAAe1I,KAAK02B,SAASunB,cAAgBj+C,KAAK02B,SAASunB,aAAa2vC,mBAC1EztE,GAAiBuO,EAErB,CAKC0lE,8BAA8BxT,GAG7B,MAEMhtE,EAAUguE,GACd,CACEF,kBAAmB1hF,KAAKojF,SAAS1B,kBACjCD,kBAAmBzhF,KAAK02B,SAAS+qD,kBACjCI,eAAgB7hF,KAAK02B,SAASunB,aAAa4jC,eAC3CjB,qBAEF,CACEM,cAAelhF,KAAK02B,SAASwqD,cAC7BF,kBAAmBhhF,KAAK02B,SAASsqD,kBACjCC,eAZmBjhF,KAAK02B,SAASo3D,gBAAkB,IAgBvD9tF,KAAK4T,QAAUA,CACjB,CAMC0hF,gBAGC,IAAKt1F,KAAK4T,QACR,OAAO,EAGT,MAAMyP,EAAiBrjB,KAAK4T,QAE5B,OACE+tE,GAAqBt+D,EAAgB,CACnCq+D,kBAAmB1hF,KAAKojF,SAAS1B,kBACjCD,kBAAmBzhF,KAAK02B,SAAS+qD,sBAKnCzhF,KAAK62F,gBAAgBxzE,IACd,EAIX,CAOOwzE,gBAAgBjjF,GAAS,IAAAkjF,EAAA92F,KAAA,SAAAy+E,MAAA,YACzBqY,EAAKv+D,mBAGJu+D,EAAK7T,KAAK,CAAE9xE,OAAQ,oBAC1B2lF,EAAK3C,mBAAmBvgF,EAAQtL,IAAI,EALN,EAMhC,CAKCsuF,gBACC,IACE9wF,GAAOgiB,SAAS4X,iBAAiB,mBAAoB1/B,KAAK+2F,yBAC1DjxF,GAAO45B,iBAAiB,OAAQ1/B,KAAKg3F,mBACrClxF,GAAO45B,iBAAiB,QAAS1/B,KAAKi3F,oBACtCnxF,GAAO45B,iBAAiB,UAAW1/B,KAAKk3F,sBAEpCl3F,KAAK0sF,eACP1sF,KAAK0sF,cAAcnS,eAIhBv6E,KAAKwyF,+BACR1G,GAAmB9rF,MAEnBA,KAAKwyF,8BAA+B,EAExC,OAASlsE,GACPtmB,KAAKq0F,iBAAiB/tE,EACxB,CAEAtmB,KAAKm3F,4BAztHT,SAASC,GAAyBpe,GAChC,SAASqe,EAAoBz2C,GAEtBo4B,EAAOoZ,mBAAmBpnF,SAAS41C,IACtCo4B,EAAOoZ,mBAAmBnrF,KAAK25C,EAEnC,CAEA,SAAS02C,GAAYthF,YACnBA,EAAQ5N,QAAQivF,EAClB,CAEA,MAAME,EAAiB,GAEtB,OAAC,aAAc,QAAS,YAAcnvF,QAAQgE,IAC7CmrF,EAAetwF,KAAKm7C,GAAqCh2C,EAAMkrF,GAAU,GAG3EC,EAAetwF,KACb+6C,GAA6B,EAAG3nB,aAC9B2+C,EAAOqZ,yBAAyBprF,KAlDtC,SAASuwF,GAA0Bn9D,GAGjC,MAAMrkB,EAAUqkB,EAAOrkB,QACjB2rC,EAAY3rC,EAAQA,EAAQtP,OAAS,GACrC++B,EAAUkc,EAAYA,EAAUlc,aAAUliC,EAE1C8G,EAAQgwB,EAAOhwB,MAEfmhB,EAAMg7B,GAAgBn8C,GAc5B,MAZa,CACX+B,KAAM,2BACNrI,KAAM,2BACNw/C,MAAO/3B,EACPA,MACAnc,KAAM,CACJhF,QACAm8D,KAAMn8D,EACNo7D,OAAQhgC,EAAUwwC,GAAOjlB,OAAOzF,MAAM9lB,QAAWliC,GAKvD,CA0B2Ci0F,CAA0Bn9D,GAAO,IAKnE,KACLk9D,EAAenvF,QAAQqvF,GAAiBA,IAAe,CAE3D,CA6rHuCL,CAAyBp3F,KAC9D,CAKC+0F,mBACC,IACEjvF,GAAOgiB,SAASgqB,oBAAoB,mBAAoB9xC,KAAK+2F,yBAE7DjxF,GAAOgsC,oBAAoB,OAAQ9xC,KAAKg3F,mBACxClxF,GAAOgsC,oBAAoB,QAAS9xC,KAAKi3F,oBACzCnxF,GAAOgsC,oBAAoB,UAAW9xC,KAAKk3F,sBAEvCl3F,KAAK0sF,eACP1sF,KAAK0sF,cAAc5R,kBAGjB96E,KAAKm3F,6BACPn3F,KAAKm3F,6BAET,OAAS7wE,GACPtmB,KAAKq0F,iBAAiB/tE,EACxB,CACF,CAQC5U,SAAU1R,KAAK+2F,wBAA0B,KACA,YAApCjxF,GAAOgiB,SAAS6X,gBAClB3/B,KAAK03F,6BAEL13F,KAAK23F,4BAA2B,CAElC,CAKDhmF,UAAW3R,KAAKg3F,kBAAoB,KACnC,MAAM93E,EAAaq9D,GAAiB,CAClC9iD,SAAU,YAKZz5B,KAAK23F,2BAA2Bz4E,EAAU,CAC1C,CAKDtN,UAAW5R,KAAKi3F,mBAAqB,KACpC,MAAM/3E,EAAaq9D,GAAiB,CAClC9iD,SAAU,aAKZz5B,KAAK03F,2BAA2Bx4E,EAAU,CAC1C,CAGDrN,UAAW7R,KAAKk3F,qBAAwB3oF,KAt/H3C,SAASqpF,GAAoB5e,EAAQzqE,GACnC,IAAKyqE,EAAOrvE,YACV,OAMFqvE,EAAOgd,qBAEP,MAAM92E,EAUR,SAAS24E,GAAsBtpF,GAC7B,MAAQq+E,UAASE,WAAUD,UAASF,SAAQplF,MAAK8E,UAAWkC,EAG5D,IAAKlC,GA+BP,SAASyrF,GAAezrF,GACtB,MAA0B,UAAnBA,EAAO3E,SAA0C,aAAnB2E,EAAO3E,SAA0B2E,EAAOm1B,iBAC/E,CAjCiBs2D,CAAezrF,KAAa9E,EACzC,OAAO,KAST,KALuBqlF,GAAWC,GAAWF,IACP,IAAfplF,EAAIb,OAKzB,OAAO,KAGT,MAAMsF,EAAUhG,GAAiBqG,EAAQ,CAAEtF,gBAAiB,OAAU,YAGtE,OAAOw1E,GAAiB,CACtB9iD,SAAU,aACVztB,UACAqD,KAAM,IALestE,GAAqBtwE,EAASL,GAM/BqD,KAClBu9E,UACAE,WACAD,UACAF,SACAplF,QAGN,CA3CqBswF,CAAsBtpF,GAEpC2Q,GAIL65D,GAAmBC,EAAQ95D,EAC7B,CAs+HI04E,CAAoB53F,KAAMuO,EAAK,CAC/B,CAKDopF,2BAA2Bz4E,IACrBlf,KAAK4T,SAIM4tE,GAAiBxhF,KAAK4T,QAAS,CAC7C6tE,kBAAmBzhF,KAAK02B,SAAS+qD,kBACjCC,kBAAmB1hF,KAAKojF,SAAS1B,sBAO/BxiE,GACFlf,KAAK+3F,wBAAwB74E,GAQ1Blf,KAAKi2F,mBACZ,CAKCyB,2BAA2Bx4E,GACrBlf,KAAK4T,UAIc5T,KAAKk5E,+BAUzBh6D,GACFlf,KAAK+3F,wBAAwB74E,GAL7B2+D,GAAQ,gEAOZ,CAKC+X,oBAAoBtD,EAAgB1iF,KAAKC,OACxC7P,KAAKsyF,cAAgBA,CACvB,CAKCuD,uBAAuBvD,EAAgB1iF,KAAKC,OACvC7P,KAAK4T,UACP5T,KAAK4T,QAAQ8sE,aAAe4R,EAC5BtyF,KAAK81F,oBAET,CAKCiC,wBAAwB74E,GACvBlf,KAAKm5E,UAAU,KAGbn5E,KAAKo5E,kBAAkB,CACrBhtE,KAAMiyD,GAAUO,OAChB7qD,UAAWmL,EAAWnL,WAAa,EACnC1E,KAAM,CACJgvC,IAAK,aACL9pB,QAASrV,IAEZ,EAEL,CAMC84E,yBACC,MAAM5F,EA7gIV,SAAS6F,GACPjiF,GAEA,OAAOA,EAAQ7N,IAAIy1E,IAAwB51E,OAAOsyC,QACpD,CAygI+B29C,CAAyBj4F,KAAKoyF,oBAAoBh3E,OAAOpb,KAAKqyF,0BAEzF,OAAAryF,KAAKoyF,mBAAqB,GAC1BpyF,KAAKqyF,yBAA2B,GAEzB1T,QAAQ1xC,IAAIk3C,GAAuBnkF,KAAMoyF,GAClD,CAKC+D,gBAECn2F,KAAKyyF,SAAS1O,SAAS/kE,QACvBhf,KAAKyyF,SAAS5O,SAAS7kE,QACvBhf,KAAKyyF,SAAS9L,KAAO,EACvB,CAGCuR,yCACC,MAAQtkF,UAAS+uE,eAAgB3iF,KAMjC,IALK4T,IAAY+uE,GAKb/uE,EAAQ+sE,UACV,OAGF,MAAMmP,EAAgBnN,EAAY9D,uBAC9BiR,GAAiBA,EAAgB9vF,KAAKyyF,SAASnP,mBACjDtjF,KAAKyyF,SAASnP,iBAAmBwM,EAErC,CAKCqI,mBACC,MAAM1F,EAAW,CACfnP,iBAAkBtjF,KAAKyyF,SAASnP,iBAChCoP,WAAY1yF,KAAKyyF,SAASC,WAC1B3O,SAAUl9E,MAAM6e,KAAK1lB,KAAKyyF,SAAS1O,UACnCF,SAAUh9E,MAAM6e,KAAK1lB,KAAKyyF,SAAS5O,UACnC8C,KAAM3mF,KAAKyyF,SAAS9L,MAGtB,OAAA3mF,KAAKm2F,gBAEE1D,CACT,CAUO2F,YAAY,IAAAC,EAAAr4F,KAAA,SAAAy+E,MAAA,YACjB,MAAMuF,EAAWqU,EAAK9K,eAEtB,GAAK8K,EAAKzkF,SAAYykF,EAAK1V,aAAgBqB,GAQ3C,SAHMqU,EAAKL,yBAGNK,EAAK1V,aAAgB0V,EAAK1V,YAAYrE,kBAvlD/C,SAIega,GAAcC,GAAA,OAAAjK,GAAA1qE,MAAA5jB,KAAAi/B,UAAA,CAwlDnBq5D,CAAeD,GAGhBA,EAAK1V,aAKNqB,IAAaqU,EAAK9K,gBAItB,IAEE8K,EAAKH,yCAEL,MAAMnkF,EAAYnE,KAAKC,MAKvB,GAAIkE,EAAYskF,EAAK5F,SAASnP,iBAAmB+U,EAAK3hE,SAAS+qD,kBAAoB,IACjF,MAAM,IAAI78E,MAAM,2CAGlB,MAAMyrF,EAAegI,EAAKF,mBAEpBxX,EAAY0X,EAAKzkF,QAAQ+sE,YAC/B0X,EAAKvC,oBAGL,MAAM3F,QAAsBkI,EAAK1V,YAAYlqC,eAEvC84C,GAAW,CACfvN,WACAmM,gBACAxP,YACA0P,eACAz8E,QAASykF,EAAKzkF,QACd1N,QAASmyF,EAAKv/E,aACd/E,aAEJ,OAASuS,GACP+xE,EAAKhE,iBAAiB/tE,GAOtB+xE,EAAKpV,KAAK,CAAE9xE,OAAQ,eAEpB,MAAMyH,EAASY,KAEXZ,GACFA,EAAOue,mBAAmB,aAAc,SAE5C,OArEEzuB,IAAeY,EAAOolB,MAAM,qDAqE7B,EAzEgB,EA0EnB,CAMCwjE,UAAU,IAAAsG,EAAAx4F,KAACA,KAAKszF,QAAM7U,QAAG,WACxBuW,SAAQ,GAGT,CAAC,GACA,IAAKwD,EAAKjgE,aAAey8D,EAEvB,OAGF,IAAKwD,EAAKtf,+BAER,YADAxwE,IAAeY,EAAOolB,MAAM,sEAI9B,IAAK8pE,EAAK5kF,QAER,OAGF,MAAM2vC,EAAQi1C,EAAK5kF,QAAQI,QAErBC,EADMrE,KAAKC,MACM0zC,EAGvBi1C,EAAK5F,gBAAgBS,SAIrB,MAAMoF,EAAWxkF,EAAWukF,EAAK9hE,SAASgiE,kBAE1C,GAAID,GADYxkF,EAAWukF,EAAK9hE,SAAS+qD,kBAAoB,IAY3D,OAVA5D,GACG,8BAA6Bv6E,KAAKm8C,MAAMxrC,EAAW,iBAClDwkF,EAAW,QAAU,8BAEvBD,EAAK9hE,SAASunB,aAAa4jC,qBAGzB4W,GACFD,EAAK5F,mBAKT,MAAMjQ,EAAc6V,EAAK7V,YAQzB,GAPIA,GAA0C,IAA3B6V,EAAK5kF,QAAQ+sE,YAAoBgC,EAAYtE,aAC9DR,GAAQ,sDAAuD2a,EAAK9hE,SAASunB,aAAa4jC,iBAMvF2W,EAAKG,WAIR,OAHAH,EAAKG,WAAaH,EAAKJ,kBACjBI,EAAKG,gBACXH,EAAKG,gBAAap1F,GAUpB,UACQi1F,EAAKG,UACb,OAASryE,GACP5d,IAAeY,EAAOolB,MAAMpI,EAC9B,SACEkyE,EAAK5F,iBACP,CACF,EAAE,CAGDkD,oBACK91F,KAAK4T,SAAW5T,KAAK02B,SAASwqD,eAChCL,GAAY7gF,KAAK4T,QAErB,CAGCu+E,UAAWnyF,KAAK20F,mBAAsBnyB,IACrC,MAAMmO,EAAQnO,EAAU97D,OAElBkyF,EAAgB54F,KAAK02B,SAASkiE,cAE9BC,EAAoBD,GAAiBjoB,EAAQioB,EAInD,GAAIjoB,EAL4B3wE,KAAK02B,SAASoiE,yBAKPD,EAAmB,CACxD,MAAM35E,EAAaq9D,GAAiB,CAClC9iD,SAAU,mBACVpqB,KAAM,CACJshE,QACA/mC,MAAOivD,KAGX74F,KAAK+3F,wBAAwB74E,EAC/B,CAGA,OAAI25E,IAGF74F,KAAKijF,KAAK,CAAE9xE,OAAQ,gBAAiB0jF,WAAmC,YAAvB70F,KAAK4iF,iBAC/C,EAIF,CACP,EAGJ,SAASmW,GACPx4F,EACAy4F,EACAC,EACAC,GAEA,MAEMC,EAAe,IAChB54F,KAH2D,iBAA7B24F,EAAwCA,EAAyB3wF,MAAM,KAAO,MAQ5GywF,GAIL,cAAWC,EAA0B,MAEE,iBAA1BA,GACTE,EAAalyF,KAAM,IAAGgyF,KAGxBnwF,GAAe,KAEbE,QAAQyN,KACN,0IACF,IAIG0iF,EAAa/xF,KAAK,IAC3B,CAuFA,MAAMgyF,GACJ,mGAEIC,GAA0B,CAAC,iBAAkB,eAAgB,UAEnE,IAAIC,IAAe,EAWnB,MAAMC,GAIH,mBAAOC,GAAgBx5F,KAAKsI,GAAK,QAAS,CAkB1CvI,aACCwzF,gBAl7R4B,IAm7R5BC,gBAh7R4B,KAi7R5BkF,oBA15RwB,KA25RxBjX,oBAt5RwB,KAu5RxBP,iBAAgB,EAChBuO,kBAAiB,EACjB4G,YACAp4C,eAAe,CAAC,EAChB+iC,oBACA8M,kBACAr9B,eAAc,EACd2lB,iBAAgB,EAChBsZ,kBAAgB,EAEhBoJ,2BAA0B,IAC1BF,iBAAgB,IAEhB5E,oBAAmB,IACnBC,4BAA2B,GAE3BrM,0BAAyB,GACzBC,yBAAwB,GACxBE,yBAAuB,EACvBC,yBAAwB,GACxBY,0BAAyB,GAEzB6Q,QAAO,GACPC,kBAAiB,CAAC,QAAS,eAC3BC,UAAS,GACTC,SAAQ,GACRC,WAAU,GACVC,UAAS,GACTC,UAEA/W,2BACAiB,uBAGAhzB,cAEAC,iBAEAxE,oBAEA2D,iBAEAC,oBAEAmY,gBACE,CAAC,GAEHzoE,KAAK+D,KAAOw1F,GAAOjxF,GAEnB,MAAM0xF,GA9KV,SAASC,IACPR,OACAE,SACAC,QACAC,UACAC,SAGA7oC,aAEAC,gBAEAb,gBAEAC,mBAEAmY,gBAEA,MAKMviE,GAAU,CAEdoqD,iBALmByoC,GAAUU,EAAM,CAAC,eAAgB,sBAAuBppC,EAAeC,GAM1FE,mBALqBuoC,GAAUY,EAAQ,CAAC,iBAAkB,yBAO1DzoC,cAAe6nC,GACba,EACA,CAAC,gBAAiB,sBAZU,kBAa5B3oC,EACAC,GAEFC,gBAAiB4nC,GAAUc,EAAS,CAAC,kBAAmB,0BACxDnxB,eAAgBqwB,GAAUe,EAAQ,CAAC,iBAAkB,uBAAwB,sBAAuBrxB,IAGtG,OAAIxX,aAAsB/5C,SACxBhR,GAAQ+qD,WAAaA,GAGnBZ,aAAyBn5C,SAC3BhR,GAAQmqD,cAAgBA,GAGnBnqD,EACT,CA+H2B+zF,CAAkB,CACvCR,QACAE,UACAC,SACAC,WACAC,UACA7oC,cACAC,iBACAb,iBACAC,oBACAmY,iBAmGF,GAhGAzoE,KAAK2yF,kBAAoB,CACvBvc,gBACA3lB,cACA/D,iBAAkB,IAAMA,IAAoB,CAAC,EAAIwtC,UAAU,GAC3D5oC,WAAYyoC,GACZjtC,YAAaitC,GACbhrC,gBAAiBA,CAACxnD,GAAK8C,GAAOhD,KA7IpC,SAAS8yF,IACP9yF,KACAE,MACAmyF,iBACAjpC,cACAupC,iBACA3vF,UAQA,OALKomD,GAKDupC,EAAexpC,oBAAsBnpD,EAAG0oD,QAAQiqC,EAAexpC,oBAC1DnmD,EAIPqvF,EAAe1uF,SAASzD,IAGf,UAARA,GAAkC,UAAfF,EAAGK,SAAuB,CAAC,SAAU,UAAUsD,SAAS3D,EAAGa,aAAa,SAAW,IAEhGmC,EAAM4D,QAAQ,QAAS,KAGzB5D,CACT,CAkHQ8vF,CAAc,CACZT,kBACAjpC,cACAupC,kBACAzyF,OACA8C,SACAhD,WAGD2yF,GAGHzoC,eAAgB,MAChBF,kBAAkB,EAElBI,cAAc,EAGd4d,cAAc,EACd3I,aAAepgD,KACb,IACEA,GAAIqnE,WAAY,CAClB,OAEE,IAKN3tF,KAAKo6F,gBAAkB,CACrB7G,gBACAC,gBACAkF,kBAAmBp1F,KAAKkxD,IAAIkkC,EA//RA,MAggS5BjX,kBAAmBn+E,KAAKkxD,IAAIitB,EA7/RN,MA8/RtBP,gBACAF,oBACA8M,kBACA2B,iBACA4G,YACA3G,iBACAtZ,gBACA3lB,cACAqoC,2BACAF,iBACA5E,oBACAC,4BACArM,0BACAC,yBACAE,wBACAC,sBAAuBqS,GAAyBrS,IAChDY,uBAAwByR,GAAyBzR,IACjD5F,2BACAiB,uBAEAhmC,gBAG+B,iBAAtB+iC,IAETh4E,QAAQyN,KACL,oQAGiCuqE,QAGpChhF,KAAKo6F,gBAAgBpZ,kBAAoBA,GAGZ,iBAApB8M,IAET9kF,QAAQyN,KACL,kQAGiCq3E,QAGpC9tF,KAAKo6F,gBAAgBtM,gBAAkBA,GAGrC9tF,KAAKo6F,gBAAgB1K,gBAGvB1vF,KAAK2yF,kBAAkBzhC,cAAiBlxD,KAAK2yF,kBAAkBzhC,cAE1D,GAAElxD,KAAK2yF,kBAAkBzhC,iBAAiBkoC,KAD3CA,IAIFp5F,KAAKs6F,gBAAkB/xC,KACzB,MAAM,IAAI3jD,MAAM,8DAGlB5E,KAAKs6F,gBAAiB,CACxB,CAGC,kBAAIA,GACH,OAAOhB,EACT,CAGC,kBAAIgB,CAAejwF,GAClBivF,GAAejvF,CACjB,CAKCsiB,YACM47B,OAILvoD,KAAKu6F,SAULl7D,WAAW,IAAMr/B,KAAKw6F,eACxB,CASCj3C,QACMvjD,KAAKq6E,SAIVr6E,KAAKq6E,QAAQ92B,OACf,CAMCgxC,iBACMv0F,KAAKq6E,SAIVr6E,KAAKq6E,QAAQka,gBACf,CAMCtR,OACC,OAAKjjF,KAAKq6E,QAIHr6E,KAAKq6E,QAAQ4I,KAAK,CAAE4R,WAA2C,YAA/B70F,KAAKq6E,QAAQuI,gBAH3CjE,QAAQ1tE,SAInB,CASC6mB,MAAM5xB,GACL,OAAKlG,KAAKq6E,SAAYr6E,KAAKq6E,QAAQ1wE,YAI5B3J,KAAKq6E,QAAQ6J,0BAA0Bh+E,GAHrCy4E,QAAQ1tE,SAInB,CAKCwpF,cACC,GAAKz6F,KAAKq6E,SAAYr6E,KAAKq6E,QAAQ1wE,YAInC,OAAO3J,KAAKq6E,QAAQkT,cACtB,CAKCiN,cACMx6F,KAAKq6E,UAQVr6E,KAAK06F,wCAEL16F,KAAKq6E,QAAQ8Z,qBACf,CAGCoG,SAEC,MAAMI,EA+BV,SAASC,GAA4BC,GACnC,MAAMjiF,EAASY,KACTshF,EAAMliF,GAAWA,EAAOE,aAExB6hF,EAAe,CAAE3Z,kBAAmB,EAAG8M,gBAAiB,KAAM/gF,GAAkB8tF,IAEtF,OAAKC,GASiC,MAApCD,EAAe7Z,mBACmB,MAAlC6Z,EAAe/M,iBACiB,MAAhCgN,EAAIC,0BAC4B,MAAhCD,EAAIE,0BAEJlyF,GAAe,KAEbE,QAAQyN,KACN,wGACF,GAIwC,iBAAjCqkF,EAAIC,2BACbJ,EAAa3Z,kBAAoB8Z,EAAIC,0BAGK,iBAAjCD,EAAIE,2BACbL,EAAa7M,gBAAkBgN,EAAIE,0BAG9BL,IA7BL7xF,GAAe,KAEbE,QAAQyN,KAAK,+BAA8B,GAEtCkkF,EA0BX,CApEyBC,CAA4B56F,KAAKo6F,iBAEtDp6F,KAAKq6E,QAAU,IAAI2X,GAAgB,CACjC9rF,QAASy0F,EACT1I,iBAAkBjyF,KAAK2yF,mBAE3B,CAGC+H,wCAIC,IAEE,MAAMO,EADSzhF,KACkBmf,qBAAqB,gBAGtD,IAAKsiE,EACH,OAGFj7F,KAAKq6E,QAAQ6Z,QAAa+G,EAAkBniF,YAC9C,OACE,CAGJ,EA2CF,SAASuhF,GAAyBhnE,GAChC,MAAO,IAAIgmE,MAA4BhmE,EAAQlrB,IAAI66B,GAAUA,EAAOl7B,eACtE,CA5CCyxF,GAAOC,2FE1vSD,IAAM0B,GAA0B,MAAjC,MAAOA,EALbn7F,cAMEC,KAAAm7F,YAAa,EAEbC,aACEp7F,KAAKm7F,YAAcn7F,KAAKm7F,UAC1B,CAEAE,YACEr7F,KAAKm7F,YAAa,CACpB,CAACh7F,SAAAH,KAAA,mBAAAI,iBATU86F,EAA0B,EAAA/6F,SAAAH,KAAA,UAAAs7F,GAAAh7F,IAAA,MAA1B46F,EAA0B36F,UAAA,6BAAAI,MAAA,GAAAC,KAAA,EAAAC,OAAA,kgBAAAC,SAAA,SAAAC,EAAAC,GAAA,EAAAD,ICPvCE,OAAA,UAAAA,CAA0F,SACjCA,OAAA,0BAASD,EAAAq6F,WAAW,GACrEp6F,OAAA,kDACJA,SACAA,OAAA,SAAwDA,OAAA,0BAASD,EAAAq6F,WAAW,GACxEp6F,OAAA,oEACJA,SACAA,OAAA,SAA8DA,OAAA,0BAASD,EAAAq6F,WAAW,GAC9Ep6F,OAAA,8DACJA,SACAA,OAAA,SAAuDA,OAAA,0BAASD,EAAAq6F,WAAW,GACvEp6F,OAAA,cACJA,SACAA,OAAA,SAAsDA,OAAA,0BAASD,EAAAq6F,WAAW,GACtEp6F,OAAA,gEACJA,WAGJA,OAAA,eAA6EA,OAAA,0BAASD,EAAAo6F,YAAY,GAAEn6F,gBAlB3CA,OAAA,UAAAA,OAAA,EAAAP,GAAAM,EAAAm6F,aAkBbl6F,OAAA,IAAAA,OAAA,UAAAA,OAAA,EAAAP,GAAAM,EAAAm6F,w2DDX/BD,CAA0B,KEA1BK,GAAe,MAAtB,MAAOA,EAAep7F,SAAAH,KAAA,mBAAAI,iBAAfm7F,EAAe,EAAAp7F,SAAAH,KAAA,UAAAs7F,GAAAh7F,IAAA,MAAfi7F,EAAeh7F,UAAA,iBAAAI,MAAA,EAAAC,KAAA,EAAAC,OAAA,wFAAAC,SAAA,SAAAC,EAAAC,GAAA,EAAAD,ICP5BE,OAAA,aAAAA,CAAgD,WAExCA,OAAA,aAAAA,CAAqB,uBAArBA,CAAqB,4BAGzBA,mlBDESs6F,CAAe,KEAfC,GAAe,MAAtB,MAAOA,EAAer7F,SAAAH,KAAA,mBAAAI,iBAAfo7F,EAAe,EAAAr7F,SAAAH,KAAA,UAAAs7F,GAAAh7F,IAAA,MAAfk7F,EAAej7F,UAAA,iBAAAI,MAAA,GAAAC,KAAA,EAAAC,OAAA,0uBAAAC,SAAA,SAAAC,EAAAC,GAAA,EAAAD,ICP5BE,OAAA,aAAAA,CAAgD,UAAhDA,CAAgD,UAAhDA,CAAgD,WAIhCA,OAAA,WACAA,OAAA,UAAAA,CAAsB,SACIA,OAAA,2IAAuBA,SAC7CA,OAAA,SAAoCA,OAAA,4WAA+DA,SACnGA,OAAA,UAA6BA,OAAA,idAAmFA,SAChHA,OAAA,QAAGA,OAAA,kOAA4CA,iBAK/DA,OAAA,YACIA,OAAA,yBACAA,OAAA,WACIA,OAAA,iBACJA,ujCDXKu6F,CAAe,oBEArB,IAAMC,GAA4B,MAAnC,MAAOA,EAA4Bt7F,SAAAH,KAAA,mBAAAI,iBAA5Bq7F,EAA4B,EAAAt7F,SAAAH,KAAA,UAAAs7F,GAAAh7F,IAAA,MAA5Bm7F,EAA4Bl7F,UAAA,+BAAAE,mBAAAC,GAAAC,MAAA,GAAAC,KAAA,EAAAC,OAAA,yOAAAC,SAAA,SAAAC,EAAAC,GAAA,EAAAD,aCPzCE,OAAA,UAAAA,CAA4F,UAA5FA,CAA4F,UAA5FA,CAA4F,UAA5FA,CAA4F,OAKxEA,OAAA,69BACJA,SACAA,OAAA,OACIA,OAAA,+UACJA,WAEJA,OAAA,WACIA,OAAA,GACJA,kVDNCw6F,CAA4B,+CEHzCx6F,OAAA,YAAAA,CAA8B,6BAA9BA,CAA8B,cAElBA,OAAA,mBAAAA,OAAAy6F,GAAA,MAAAC,EAAA16F,SAAA,OAASA,OAAA06F,EAAAC,cAAa,GAAuB36F,OAAA,4DAASA,cCC3D,IAAM46F,GAAY,MAAnB,MAAOA,EAIX97F,cAHAC,KAAA87F,MAAQ,eAER97F,KAAA+7F,aAAuB,CACP,CAEhBC,WAGIh8F,KAAK+7F,cAFSE,aAAa/Z,QAAQ,gBAMvC,CAEA0Z,cACEK,aAAanb,QAAQ,gBAAiB,aACtC9gF,KAAK+7F,aAAc,CACrB,CAAC57F,SAAAH,KAAA,mBAAAI,iBAlBUy7F,EAAY,EAAA17F,SAAAH,KAAA,UAAAs7F,GAAAh7F,IAAA,MAAZu7F,EAAYt7F,UAAA,eAAAI,MAAA,EAAAC,KAAA,EAAAC,OAAA,4CAAAC,SAAA,SAAAC,EAAAC,GAAA,EAAAD,IDPzBE,OAAA,gBACAA,OAAA,UACIA,OAAA,mBACJA,SACAA,OAAA,EAAAi7F,GAAA,iBAKAj7F,OAAA,uBALUA,OAAA,GAAAA,OAAA,QAAAD,EAAA+6F,4LCGGF,CAAY,KCHzB,MAAMM,GAAiB,CAErB,CAAE1sE,KAAM,OAAQ2sE,aAAcA,IAAMzd,QAAA1xC,IAAA,CAAAovD,EAAAnqF,EAAA,MAAAmqF,EAAAnqF,EAAA,MAAAmqF,EAAAnqF,EAAA,OAAA1M,KAAA62F,EAAAtvE,KAAAsvE,EAAA,QAAmC72F,KAAKk/D,GAAKA,EAAE43B,aACnF,CAAE7sE,KAAM,QAAS2sE,aAAcA,IAAMzd,QAAA1xC,IAAA,CAAAovD,EAAAnqF,EAAA,MAAAmqF,EAAAnqF,EAAA,QAAA1M,KAAA62F,EAAAtvE,KAAAsvE,EAAA,OAAqC72F,KAAKk/D,GAAKA,EAAE63B,cACtF,CAAE9sE,KAAM,SAAU2sE,aAAcA,IAAMzd,QAAA1xC,IAAA,CAAAovD,EAAAnqF,EAAA,MAAAmqF,EAAAnqF,EAAA,OAAA1M,KAAA62F,EAAAtvE,KAAAsvE,EAAA,QAAuC72F,KAAKk/D,GAAKA,EAAE83B,eACzF,CAAE/sE,KAAM,UAAW2sE,aAAcA,IAAMzd,QAAA1xC,IAAA,CAAAovD,EAAAnqF,EAAA,MAAAmqF,EAAAnqF,EAAA,QAAA1M,KAAA62F,EAAAtvE,KAAAsvE,EAAA,QAAyC72F,KAAKk/D,GAAKA,EAAE+3B,gBAC5F,CAAEhtE,KAAM,gBAAiB2sE,aAAcA,IAAMzd,QAAA1xC,IAAA,CAAAovD,EAAAnqF,EAAA,MAAAmqF,EAAAnqF,EAAA,QAAA1M,KAAA62F,EAAAtvE,KAAAsvE,EAAA,QAAqD72F,KAAKk/D,GAAKA,EAAEg4B,qBAC9G,CAAEjtE,KAAM,GAAIktE,WAAY,OAAQC,UAAW,QAC3C,CAAEntE,KAAM,KAAMktE,WAAY,SAOrB,IAAME,GAAgB,MAAvB,MAAOA,EAAgB18F,SAAAH,KAAA,mBAAAI,iBAAhBy8F,EAAgB,EAAA18F,SAAAH,KAAA,UAAAs7F,GAAAn6F,IAAA,MAAhB07F,IAAgB18F,SAAAH,KAAA,UAAAs7F,GAAAl6F,IAAA,UAHjB07F,MAAaC,QAAQZ,GAAO,CAAEa,0BAA2B,UAAWC,gBAAiB,YACrFH,gBAECD,CAAgB,iCCHtB,IAAMK,GAAgB,MAAvB,MAAOA,EAAgB/8F,SAAAH,KAAA,mBAAAI,iBAAhB88F,EAAgB,EAAA/8F,SAAAH,KAAA,UAAAs7F,GAAAn6F,IAAA,MAAhB+7F,IAAgB/8F,SAAAH,KAAA,UAAAs7F,GAAAl6F,IAAA,UALzBC,MACAw7F,aAISK,CAAgB,KCEhBC,GAAY,MAAnB,MAAOA,EAAYh9F,SAAAH,KAAA,mBAAAI,iBAAZ+8F,EAAY,EAAAh9F,SAAAH,KAAA,UAAAs7F,GAAAn6F,IAAA,MAAZg8F,IAAYh9F,SAAAH,KAAA,UAAAs7F,GAAAl6F,IAAA,UAPrBC,MACAI,KACAP,KACAg8F,aAISC,CAAY,KCJZC,GAAY,MAAnB,MAAOA,EAAYj9F,SAAAH,KAAA,mBAAAI,iBAAZg9F,EAAY,EAAAj9F,SAAAH,KAAA,UAAAs7F,GAAAn6F,IAAA,MAAZi8F,IAAYj9F,SAAAH,KAAA,UAAAs7F,GAAAl6F,IAAA,UALrBC,MACAH,eAISk8F,CAAY,qBCHlB,IAAMC,GAAiB,MAAxB,MAAOA,EAEXt9F,YAAoBo0C,GAAAn0C,KAAAm0C,QAAyB,CAE7CmpD,UAAUp0E,EAA+BmL,GAEvC,MAAMkpE,EAAkBr0E,EAAQrM,MAAM,CACpCwW,QAASnK,EAAQmK,QAAQ5lB,IAAI,YAAazN,KAAKm0C,OAAOvxC,UAGxD,OAAOyxB,EAAKmpE,OAAOD,EACrB,CAACp9F,SAAAH,KAAA,mBAAAI,iBAXUi9F,GAAiBp8F,OAAAy1C,MAAA,EAAAv2C,SAAAH,KAAA,WAAAs7F,GAAAx4F,IAAA,OAAjBu6F,EAAiBt6F,QAAjBs6F,EAAiBr6F,mBAAjBq6F,CAAiB,KCNjBI,GAAoB,MAA3B,MAAOA,UAA4BC,OAEvC39F,cACEu2B,OACF,CAES4c,YAAYxkB,GACnB,CACDvuB,SAAAH,KAAA,mBAAAI,iBARUq9F,EAAmB,EAAAt9F,SAAAH,KAAA,WAAAs7F,GAAAx4F,IAAA,OAAnB26F,EAAmB16F,QAAnB06F,EAAmBz6F,UAAAC,WAFlB,gBAEDw6F,CAAoB,KCUpBE,GAAyB,MAAhC,MAAOA,EAAyBx9F,SAAAH,KAAA,mBAAAI,iBAAzBu9F,EAAyB,EAAAx9F,SAAAH,KAAA,UAAAs7F,GAAAn6F,IAAA,MAAzBw8F,IAAyBx9F,SAAAH,KAAA,UAAAs7F,GAAAl6F,IAAA,UAJlCC,gBAISs8F,CAAyB,KCsCzBC,GAAS,MAAhB,MAAOA,EAASz9F,SAAAH,KAAA,mBAAAI,iBAATw9F,EAAS,EAAAz9F,SAAAH,KAAA,UAAAs7F,GAAAn6F,IAAA,MAATy8F,EAASC,UAAA,CAFRhC,MAAY17F,SAAAH,KAAA,UAAAs7F,GAAAl6F,IAAA,WAnBb,CACT,CAAE08F,QAASC,MAAmBC,SAAUX,GAAmBY,OAAO,GAClE,CACEH,QAASJ,OACTM,SAAUP,GACVS,SAAU7qD,GAA0B,CAClCC,YAAY,KAEb,CACDwqD,QAASzqD,GACT8qD,KAAM,CAACC,QAET,CACEN,QAASO,OACTC,WAAYA,IAAM,OAClBH,KAAM,CAAC9qD,IACP4qD,OAAO,IAEVM,QAAA,CA3BCC,KACA3B,GACA4B,MACA3B,MACAz7F,MACA87F,GACAC,GACAO,aAuBSC,CAAS,SnBm3RM13F,WoBn6RxBtE,EAAYuB,erDsBhB,SAAS2Q,GAAK5N,GACV,MAAMy5C,EAAOt7C,OAAO4oB,OAAO,CAOvBtB,oBAAqB0kB,KAAgCroC,OAAO2a,GAC5B,aAArBA,EAAY5e,OACjBmC,GACVy2B,GAAiBgjB,EAAM,eAI3B,SAAS++C,KAEL,MAAMC,EAAiBC,QAAWA,OAAQC,MAAQpuE,SAASmuE,OAAQC,MAAO,SAAMt7F,EAC5Eo7F,IACIA,EAAiBG,IACjB1sD,IACI9oC,EAAOmN,KAAM,uDAAsDkoF,KAAoB,+CAAuE,0EAA2E,8DAEjPpgF,GAAW,UAAW,CAAE8C,QAASs9E,IAEzC,CAbID,GACAK,GAAOp/C,EACX,CqDnCEtM,CAAY,CACV/jB,IAAK,+FACL3a,QAAS,MACTmU,aAAc,CACZ,IzBqBN,MAAMk2E,GAYHj/F,YAAY22B,GACX12B,KAAK+D,KAnC8B,iBAoCnC/D,KAAKi/F,gCAAiC,EpB4E1C,SAASC,KACP,MAAM76E,EAAUX,KACXW,EAAQngB,aAGbmgB,EAAQngB,WAAWyf,WAAaU,EAAQngB,WAAWyf,YAAc,CAAC,EAC7DU,EAAQngB,WAAWyf,WAAWf,mBACjCyB,EAAQngB,WAAWyf,WAAWf,iBAAmBk7B,IAE9Cz5B,EAAQngB,WAAWyf,WAAWZ,eACjCsB,EAAQngB,WAAWyf,WAAWZ,aAAeA,IH1HjD,SAASo8E,KACHliD,KAIJA,IAAqB,EACrBxV,GAAqCyV,IACrCjV,GAAkDiV,IACpD,CGqHEiiD,GACF,CoBxFID,GAEIx2F,KACF1I,KAAKi/F,kCACHvoE,IAECA,EAAS2tB,0BAA2B3tB,EAAS0tB,iBAIlDpkD,KAAKkG,QAAU,IACVihD,MACAzwB,QAK4CnzB,IAA7CvD,KAAKkG,QAAQ+3C,aAAa2J,iBAC5B5nD,KAAKkG,QAAQ0hD,eAAiB5nD,KAAKkG,QAAQ+3C,aAAa2J,gBAOtDlxB,IAAaA,EAAS2tB,yBAA2B3tB,EAAS0tB,iBAE5DpkD,KAAKkG,QAAQm+C,wBAA0B3tB,EAAS0tB,gBAGlDpkD,KAAKo/F,kBJ1CT,SAASC,KACP,MAAMrvF,EAAcizC,KACpB,GAAIjzC,GAAeI,GAA8B,CAE3CJ,EAAYsvF,MACdx5F,GAAOkK,YAAYsvF,KAAK,uBAE1B,MAAMC,EAyGV,SAASC,KACP,OFtGF,SAASC,GAA6B12F,GACpC,OAAOm5C,GAAkB,MAAOn5C,EAAU05C,GAAeX,GAC3D,CEoGS29C,CAA6B,EAAGplE,aACrC,MAAMumB,EAAQvmB,EAAOrkB,QAAQqkB,EAAOrkB,QAAQtP,OAAS,GACrD,IAAKk6C,EACH,OAGF,MAAM1wC,EAAa6yC,GAAQ3yC,IACrBunC,EAAYoL,GAAQnC,EAAMjJ,WAChCjvC,IAAeY,EAAOqC,IAAI,6BAC1B0tC,GAAcqmD,IAAS,CAAEr1F,MAAOgwB,EAAOhwB,MAAO+vB,KAAM,eACpDif,GAAc,YAAc,CAAEhvC,MAAO6F,EAAaynC,EAAWvd,KAAM,SAAS,EAEhF,CAtHwBolE,GACdG,EA4EV,SAASC,KACP,OFnGF,SAASC,GACP92F,EACAk5C,GAAiB,GAEjB,OAAOC,GAAkB,MAAOn5C,EAAUy5C,GAAeX,GAAcI,EACzE,CE8FS49C,CAA6B,EAAGxlE,aACrC,MAAMumB,EAAQvmB,EAAOrkB,QAAQqkB,EAAOrkB,QAAQtP,OAAS,GAChDk6C,IAILl4C,IAAeY,EAAOqC,IAAI,6BAC1B0tC,GAAcymD,IAAS,CAAEz1F,MAAOgwB,EAAOhwB,MAAO+vB,KAAM,IACpD+oB,GAAYvC,KACX,EACL,CAvFwBg/C,GACdG,EAyFV,SAASC,KACP,OAAOh+C,GAA6B,EAAG3nB,aACrC,MAAMumB,EAAQvmB,EAAOrkB,QAAQqkB,EAAOrkB,QAAQtP,OAAS,GAChDk6C,IAILl4C,IAAeY,EAAOqC,IAAI,6BAC1B0tC,GAAc4mD,IAAS,CAAE51F,MAAOgwB,EAAOhwB,MAAO+vB,KAAM,eACpD8oB,GAAYtC,KACX,EACL,CApGwBo/C,GAEpB,MAAO,KACLT,IACAI,IACAI,GAAY,CAEhB,CAEA,MAAO,MACT,CIuB6BV,GACrBr/F,KAAKkG,QAAQ0hD,gBJnBrB,SAASs4C,KACP99C,GAAqC,WAAY,EAAGpsC,cAClD,UAAW4qC,KAAS5qC,EAAS,CAE3B,MAAMT,EAAc6+B,KACpB,IAAK7+B,EACH,OAEF,MAAMoiC,EAAYoL,GAAS3yC,GAAiCwwC,EAAMjJ,WAC5D1jC,EAAW8uC,GAAQnC,EAAM3sC,UAG/BsB,EAAY6/B,WAAW,CACrBl7B,YAAa,yBACbpC,GAAI,eACJG,OAAQ,0BACRiqB,eAAgByV,EAChBhV,aAAcgV,EAAY1jC,GAE9B,GAEJ,CIDMisF,GAEElgG,KAAKkG,QAAQ+3C,aAAakiD,oBJIlC,SAASC,KACPh+C,GAAqC,QAAS,EAAGpsC,cAC/C,UAAW4qC,KAAS5qC,EAAS,CAE3B,MAAMT,EAAc6+B,KACpB,IAAK7+B,EACH,OAGF,GAAmB,UAAfqrC,EAAM78C,KAAkB,CAC1B,MAAM4zC,EAAYoL,GAAS3yC,GAAiCwwC,EAAMjJ,WAC5D1jC,EAAW8uC,GAAQnC,EAAM3sC,UAEzBqB,EAAO,CACX4E,YAAalU,GAAiB46C,EAAMv0C,QACpCyL,GAAK,kBAAiB8oC,EAAM78C,OAC5BkU,OAAQ,0BACRiqB,eAAgByV,EAChBhV,aAAcgV,EAAY1jC,GAGtBsxB,EAAgB98B,GAAiBm4C,EAAMv0C,QACzCk5B,IACFjwB,EAAK2/B,WAAa,CAAE,oBAAqB1P,IAI3ChwB,EAAY6/B,WAAW9/B,EACzB,CACF,GAEJ,CIlCM8qF,EAEJ,CAKCzzE,UAAUvb,EAAG6S,GACZjkB,KAAKqgG,eAAiBp8E,EAGtB,MAAMrL,EAFMqL,IAEOzK,YACbiU,EAAgB7U,GAAUA,EAAOE,cAGrCuuC,uBAAwBi5C,EACxB74C,mCACAD,6BACAJ,6BACAnD,aACAC,WACAK,6BACAJ,qBACAlG,iBACEj+C,KAAKkG,QAEHq6F,GAAuC9yE,GAAiBA,EAAc42B,wBAYtEA,GAA0Bk8C,IAAwCvgG,KAAKkG,QAAQm+C,wBACjF37C,IAAe1I,KAAKi/F,gCAAkCsB,IACxDj3F,EAAOmN,KACL,0KAIJ6pF,EACG5sF,KACC,MAAM6B,GAAcvV,KAAKwgG,wBAAwB9sF,IAEjD,OAAA1T,KAAKkG,QAAQ+3C,aAAawiD,yBACxBzgG,KAAKkG,QAAQ+3C,aAAawiD,wBAAwBlrF,GAAa7B,GAASuQ,GAEnE1O,IAETiyC,EACAC,GAGEL,G0BnIR,SAASs5C,KACH56F,IAAUA,GAAOgiB,SACnBhiB,GAAOgiB,SAAS4X,iBAAiB,mBAAoB,KAEnD,MAAMsV,EAAoBZ,KAC1B,GAAItuC,GAAOgiB,SAAS8b,QAAUoR,EAAmB,CAC/C,MAAM2rD,EAAa,aAEX7oF,KAAI5D,UAAWgE,GAAW88B,GAElCtsC,IACEY,EAAOqC,IAAK,0BAAyBg1F,+CAAwD7oF,KAG1F5D,GACH8gC,EAAkBkD,UAAUyoD,GAI9B3rD,EAAkBj3B,OAAO,mBAAoB,mBAC7Ci3B,EAAkBxpB,KACpB,IAGF9iB,IAAeY,EAAOmN,KAAK,qFAE/B,C1B0GMiqF,GAGEziD,GAAakiD,oBACfngG,KAAK4gG,+BAGPt8C,GAA2B,CACzBL,aACAC,WACAG,2BACAE,6BACAJ,sBAEJ,CAGCq8C,wBAAwB9sF,GACvB,IAAK1T,KAAKqgG,eAGR,YAFA33F,IACEY,EAAOmN,KAAM,4BAA2B/C,EAAQoE,sDAIpD,MAAM+L,EAAM7jB,KAAKqgG,kBAETQ,iBAAgBnmD,cAAaC,eAAcC,qBAAsB56C,KAAKkG,QAExE46F,EAAuC,aAAfptF,EAAQoE,GAEhCipF,EAAcD,EAAwBj5C,GAAe,gBAAkB,GACvErC,EAAUs7C,EAAwBj5C,GAAe,WAAa,IAC5Dm5C,kBAAiBnrF,yBAAwB0E,sBvF/HrD,SAAS0mF,EACPF,EACAv7C,GAIA,MAAMw7C,EAjCR,SAASE,EAAuBC,GAC9B,IAAKA,EACH,OAGF,MAAMpxC,EAAUoxC,EAAY97E,MAAMpO,IAClC,IAAK84C,EACH,OAGF,IAAIrS,EACJ,MAAmB,MAAfqS,EAAQ,GACVrS,GAAgB,EACQ,MAAfqS,EAAQ,KACjBrS,GAAgB,GAGX,CACLtmC,QAAS24C,EAAQ,GACjBrS,gBACAriB,aAAc00B,EAAQ,GAE1B,CAW0BmxC,CAAuBH,GACzClrF,ED7BR,SAASurF,GAEPlrF,GAEA,IAAKjR,GAASiR,KAAmBrP,MAAMC,QAAQoP,GAC7C,OAKF,IAAImrF,EAAgB,CAAC,EAErB,GAAIx6F,MAAMC,QAAQoP,GAEhBmrF,EAAgBnrF,EAAcD,OAAO,CAACS,EAAK4qF,KACzC,MAAMC,EAAoB1qF,GAAsByqF,GAChD,UAAW/5F,KAAOlD,OAAO8E,KAAKo4F,GAC5B7qF,EAAInP,GAAOg6F,EAAkBh6F,GAE/B,OAAOmP,GACN,CAAC,OACC,CAGL,IAAKR,EACH,OAGFmrF,EAAgBxqF,GAAsBX,EACxC,CAGA,MAAML,EAAyBxR,OAAO2R,QAAQqrF,GAAeprF,OAAO,CAACS,GAAMnP,EAAK8C,MAC1E9C,EAAI8d,MAAM3P,MAEZgB,EADuBnP,EAAIyC,MAAMyL,GAA0B/O,SACrC2D,GAEjBqM,GACN,CAAC,GAIJ,OAAIrS,OAAO8E,KAAK0M,GAAwBnP,OAAS,EACxCmP,OADT,CAKF,CClBiCurF,CAAsC57C,IAE7DpuC,UAASikB,eAAcqiB,iBAAkBsjD,GAAmB,CAAC,EAE/DzmF,EAAqB,CACzBnD,QAASA,GAAWzJ,KACpB0J,OAAQ1J,KAAQ2J,UAAU,IAC1BC,QAASmmC,GAGX,OAAIriB,IACF9gB,EAAmB8gB,aAAeA,GAGhCxlB,IACF0E,EAAmBlB,IAAMxD,GAGpB,CACLmrF,kBACAnrF,yBACA0E,qBAEJ,CuFiG4E0mF,CACtEF,EACAv7C,GAGIg8C,GAAkB,IACnB9tF,KACAstF,EACHjnF,SAAU,IAELrG,EAAQqG,SACXlE,uBAAwBmrF,IAAoBnrF,EAAyB,CAAC,EAAIA,GAE5E2jC,SAAS,GAGLioD,GAA4C,mBAAnBZ,EAAgCA,EAAeW,IAAmBA,GAI3FE,QAAmCn+F,IAApBk+F,GAAgC,IAAKD,GAAiBjqF,SAAS,GAAUkqF,GAI9FC,GAAa3nF,SACX2nF,GAAa39F,OAASy9F,GAAgBz9F,SAE7B29F,GAAa3nF,SAAU7O,OAAQ,UAEpCw2F,GAAa3nF,SAEnB/Z,KAAK2hG,iBAAmBD,GAAa39F,KAOrC/D,KAAK4hG,mBAJkBluF,EAAQrE,MAAQqE,EAAQrE,KAAK2iC,KAEzB0vD,GAAa3nF,UAAY2nF,GAAa3nF,SAAS7O,QAK7C,IAAzBw2F,GAAanqF,SACf7O,IAAeY,EAAOqC,IAAK,2BAA0B+1F,GAAa5pF,6CAGpEpP,IAAeY,EAAOqC,IAAK,sBAAqB+1F,GAAa5pF,2BAE7D,MAAQob,aAAaptB,GAEf+7F,GAAkB1jD,GACtBt6B,EACA69E,GACAhnD,EACAC,GACA,EACA,CAAEznB,aACF0nB,EACAkmD,GAGEA,IACFh7F,GAAOgiB,SAAS4X,iBAAiB,mBAAoB,KAC/C,CAAC,cAAe,YAAY10B,SAASlF,GAAOgiB,SAAS2a,aACvDo/D,GAAgBjlD,sBAAqB,GAIrC,CAAC,cAAe,YAAY5xC,SAASlF,GAAOgiB,SAAS2a,aACvDo/D,GAAgBjlD,wBASpB,OAJc/4B,EAAInC,WAKVzB,sBADJ6gF,GAAyBE,EACCzmF,EAIA,CAC1BnD,QAASyqF,GAAgBhqF,cAAcT,QACvCC,OAAQwqF,GAAgBhqF,cAAcR,OACtCgkB,aAAcnjB,GAAW2pF,IAAiB9pF,eAC1CR,QAASa,GAAcypF,MAI3BA,GAAgBvlD,6BAA6B/mC,KAC3CvV,KAAKo/F,oBJrGX,SAAS0C,GAAsBvsF,GAC7B,MAAMvF,EAAcizC,KACpB,IAAKjzC,IAAgBlK,GAAOkK,YAAYgwC,aAAe5vC,GAErD,OAGF1H,IAAeY,EAAOqC,IAAI,4DAC1B,MAAMuE,EAAa6yC,GAAQ3yC,IAErBgiF,EAAqBpiF,EAAYgwC,aAEvC,IAAI+hD,EACAC,EAEJ,MAAQlqF,KAAIihC,gBAAiBkpD,GAAyB/pF,GAAW3C,GAoDjE,GAjDA68E,EAAmBpoF,MAAMo5C,IAAoBh7C,QAASw4C,IACpD,MAAMjJ,EAAYoL,GAAQnC,EAAMjJ,WAC1B1jC,EAAW8uC,GAAQnC,EAAM3sC,UAG/B,KAAuB,eAAnBsB,EAAYuC,IAAuBmqF,GAAwB/xF,EAAaynC,EAAYsqD,GAIxF,OAAQrhD,EAAM3B,WACZ,IAAK,cAsHX,SAASijD,GAAoB3sF,EAAaqrC,EAAO1wC,GAC/C,CAAC,cAAe,WAAY,wBAAyB,YAAa,WAAW9H,QAAQmG,IACnF80C,GAAgC9tC,EAAaqrC,EAAOryC,EAAO2B,EAAU,GAEvEmzC,GAAgC9tC,EAAaqrC,EAAO,mBAAoB1wC,EAAY,UAAW,cAC/FmzC,GAAgC9tC,EAAaqrC,EAAO,QAAS1wC,EAAY,QAAS,qBAClFmzC,GAAgC9tC,EAAaqrC,EAAO,eAAgB1wC,EAAY,OA8BlF,SAASiyF,GAAY5sF,EAAaqrC,EAAO1wC,GACnC0wC,EAAMsG,cAKRrE,GAAYttC,EAAa,CACvBuC,GAAI,UACJG,OAAQ,+BACRiC,YAAa,UACbgoB,eAAgBhyB,EAAa6yC,GAAQnC,EAAMoG,cAC3CrkB,aAAczyB,EAAa6yC,GAAQnC,EAAMsG,eAG3CrE,GAAYttC,EAAa,CACvBuC,GAAI,UACJG,OAAQ,+BACRiC,YAAa,WACbgoB,eAAgBhyB,EAAa6yC,GAAQnC,EAAMqG,eAC3CtkB,aAAczyB,EAAa6yC,GAAQnC,EAAMsG,eAG/C,CAnDEi7C,CAAY5sF,EAAaqrC,EAAO1wC,EAClC,EA7HQgyF,CAAoB3sF,EAAaqrC,EAAO1wC,GACxC6xF,EAAyB7xF,EAAa6yC,GAAQnC,EAAMqG,eACpD+6C,EAAwB9xF,EAAa6yC,GAAQnC,EAAMoG,cACnD,MAEF,IAAK,OACL,IAAK,QACL,IAAK,UAAW,EAsFtB,SAASo7C,GACP7sF,EAEAqrC,EACAjJ,EACA1jC,EACA/D,GAEA,MAAMmyF,EAAwBnyF,EAAaynC,EAG3CkL,GAAYttC,EAAa,CACvB2E,YAAa0mC,EAAM78C,KACnB4+B,aAJ0B0/D,EAAwBpuF,EAKlD6D,GAAI8oC,EAAM3B,UACVhnC,OAAQ,gCACRiqB,eAAgBmgE,GAIpB,CAzGQD,CAAiB7sF,EAAaqrC,EAAOjJ,EAAW1jC,EAAU/D,GAG1D,MAAMoyF,EAAcrhD,KAEdshD,EAAe3hD,EAAMjJ,UAAY2qD,EAAYthD,gBAEhC,gBAAfJ,EAAM78C,MAA0Bw+F,IAClC75F,IAAeY,EAAOqC,IAAI,4BAC1B0tC,GAAcmpD,GAAQ,CAAEn4F,MAAOu2C,EAAMjJ,UAAWvd,KAAM,gBAErC,2BAAfwmB,EAAM78C,MAAqCw+F,IAC7C75F,IAAeY,EAAOqC,IAAI,6BAC1B0tC,GAAcopD,IAAS,CAAEp4F,MAAOu2C,EAAMjJ,UAAWvd,KAAM,gBAEzD,KACF,CACA,IAAK,YAyJX,SAASsoE,GACPntF,EACAqrC,EACA+hD,EACAhrD,EACA1jC,EACA/D,GAIA,GAA4B,mBAAxB0wC,EAAMqF,eAA8D,UAAxBrF,EAAMqF,cACpD,OAGF,MAAM28C,EAAYxgE,GAASugE,GAGrBtzF,EAAO,CAAC,EACdm0C,GAAyBn0C,EAAMuxC,EAAO,eAAgB,+BACtD4C,GAAyBn0C,EAAMuxC,EAAO,kBAAmB,gCACzD4C,GAAyBn0C,EAAMuxC,EAAO,kBAAmB,wCAErD,yBAA0BA,IAC5BvxC,EAAK,mCAAqCuxC,EAAMiiD,sBAE9CD,EAAU/yE,WACZxgB,EAAK,cAAgBuzF,EAAU/yE,SAAStnB,MAAM,KAAKsZ,OAGjD+gF,EAAUpzE,OACZngB,EAAK,kBAAoBuzF,EAAUpzE,MAGrCngB,EAAK,mBAAqBszF,EAAY33F,SAASlF,GAAOotB,SAASjb,QAE/D,MAAMiqB,EAAiBhyB,EAAaynC,EAC9BhV,EAAeT,EAAiBjuB,EAEtC4uC,GAAYttC,EAAa,CACvB2E,YAAayoF,EAAY10F,QAAQnI,GAAOotB,SAASjb,OAAQ,IACzD0qB,eACA7qB,GAAI8oC,EAAMqF,cAAiB,YAAWrF,EAAMqF,gBAAkB,iBAC9DhuC,OAAQ,gCACRiqB,iBACA7yB,QAEJ,CAtMQqzF,CAAkBntF,EAAaqrC,EAAOA,EAAM78C,KAAO4zC,EAAW1jC,EAAU/D,GAI5E,GAGFkzC,GAAqB9/C,KAAKyG,IAAIqoF,EAAmB1rF,OAAS,EAAG,GAoM/D,SAASo8F,GAAgBvtF,GACvB,MAAM6N,EAAYtd,GAAOsd,UACzB,IAAKA,EACH,OAIF,MAAM2/E,EAAa3/E,EAAU2/E,WACzBA,IACEA,EAAWC,eAGbztF,EAAYwI,OAAO,0BAA2BglF,EAAWC,eAGvDD,EAAW32F,MAGbmJ,EAAYwI,OAAO,iBAAkBglF,EAAW32F,MAG9Cu2C,GAAmBogD,EAAWE,OAChC5pD,GAAc,kBAAoB,CAAEhvC,MAAO04F,EAAWE,IAAK7oE,KAAM,iBAIjEuoB,GAAmBv/B,EAAU8/E,eAG/B3tF,EAAYwI,OAAO,eAAiB,GAAEqF,EAAU8/E,mBAG9CvgD,GAAmBv/B,EAAU+/E,sBAG/B5tF,EAAYwI,OAAO,sBAAuBzT,OAAO8Y,EAAU+/E,qBAE/D,CAvOEL,CAAgBvtF,GAGL,aAAPuC,EAAmB,EAiSzB,SAASsrF,GACP/pD,EACA0oD,EACAC,EACAC,GAIsC,iBAA3BF,GAAuCE,IAChDv5F,IAAeY,EAAOqC,IAAI,8BAC1B0tC,EAAcgqD,KAAU,CAQtBh5F,MAAoE,IAA7D/G,KAAKyG,IAAIg4F,EAAyBE,EAAsB,GAC/D7nE,KAAM,eAG6B,iBAA1B4nE,GAAsCA,GAAyBD,IAGxE1oD,EAAc,oBAAsB,CAClChvC,MAA0D,KAAlD03F,EAAyBC,GACjC5nE,KAAM,gBAId,EA/TIgpE,CAAuB/pD,GAAe0oD,EAAwBC,EAAuBC,GAErF,CAAC,MAAO,KAAM,OAAO75F,QAAQrE,IAC3B,IAAKs1C,GAAct1C,KAAUk+F,GAAwB/xF,GAAc+xF,EACjE,OAKF,MAAMjtC,EAAW3b,GAAct1C,GAAMsG,MAC/Bi5F,EAAuBpzF,EAAa6yC,GAAQiS,GAG5CuuC,EAAkBjgG,KAAKmN,IAAoD,KAA/C6yF,EAAuBrB,IAGzDv5F,IAAeY,EAAOqC,IAAK,6BAA4B5H,UAAaixD,QAAeuuC,MAFrEA,EAAkBvuC,MAGhC3b,GAAct1C,GAAMsG,MAAQk5F,IAG9B,MAAMC,EAAUnqD,GAAc,YAC1BmqD,GAAWnqD,GAAcqmD,MAE3B78C,GAAYttC,EAAa,CACvB2E,YAAa,oBACbyoB,aAAc6gE,EAAQn5F,MAAQ04C,GAAQ1J,GAAcqmD,IAAOr1F,OAC3DyN,GAAI,YACJG,OAAQ,0BACRiqB,eAAgBshE,EAAQn5F,eAInBgvC,GAAc,aAKjB,QAASA,WACNA,GAAcymD,IAGvBz7F,OAAO8E,KAAKkwC,IAAejxC,QAAQq7F,K+B3QvC,SAAS5pD,GAAe91C,EAAMsG,EAAO+vB,GAEnC,MAAM7kB,EAAc6+B,KAChB7+B,GAEFA,EAAYskC,eAAe91C,EAAMsG,EAAO+vB,EAE5C,C/BqQMyf,CAAe4pD,EAAiBpqD,GAAcoqD,GAAiBp5F,MAAOgvC,GAAcoqD,GAAiBrpE,KAAI,GA4L/G,SAASspE,GAAenuF,GAClB2tC,KACFx6C,IAAeY,EAAOqC,IAAI,kCAItBu3C,GAAUzd,SAGZlwB,EAAYwI,OAAO,cAAe/X,GAAiBk9C,GAAUzd,UAG3Dyd,GAAU56C,IAGZiN,EAAYwI,OAAO,SAAUmlC,GAAU56C,IAGrC46C,GAAU/5B,KAIZ5T,EAAYwI,OAAO,UAAWmlC,GAAU/5B,IAAInS,OAAOhN,MAAM,EAAG,MAK9DuL,EAAYwI,OAAO,WAAYmlC,GAAUsjB,OAIvCrjB,IAAaA,GAAUwgD,UACzBj7F,IAAeY,EAAOqC,IAAI,kCAC1Bw3C,GAAUwgD,QAAQv7F,QAAQ,CAAC8C,EAAQoI,IAGjCiC,EAAYwI,OAAQ,cAAazK,EAAQ,IAAKtN,GAAiBkF,EAAOmhD,QAG5E,CAhOIq3C,CAAenuF,EACjB,CAEA2tC,QAAY3/C,EACZ4/C,QAAY5/C,EACZ81C,GAAgB,CAAC,CACnB,CIjBMyoD,CAAsBvsF,GAAW,GAG5BssF,EACT,CAGCjB,+BACC,IAAIgD,EACJ,MAAMC,EAAiCA,KACrC,MAAQnpD,cAAaC,eAAcC,qBAAsB56C,KAAKkG,QACxD4R,EAAK,kBAGLgsF,EAAqB1vD,KAC3B,GAAI0vD,GAAsBA,EAAmBhsF,IAAM,CAAC,aAAc,YAAY9M,SAAS84F,EAAmBhsF,IAKxG,YAJApP,IACEY,EAAOmN,KACJ,4BAA2BqB,+EAWlC,GANI8rF,IACFA,EAA+BjnD,gBAAgB,0BAC/CinD,EAA+Bp4E,MAC/Bo4E,OAAiCrgG,IAG9BvD,KAAKqgG,eAER,YADA33F,IAAeY,EAAOmN,KAAM,4BAA2BqB,qDAIzD,IAAK9X,KAAK2hG,iBAER,YADAj5F,IAAeY,EAAOmN,KAAM,4BAA2BqB,uDAIzD,MAAM+L,EAAM7jB,KAAKqgG,kBACTntE,YAAaptB,GAWrB89F,EAAiCzlD,GAC/Bt6B,EAVc,CACd9f,KAAM/D,KAAK2hG,iBACX7pF,KACA0hC,SAAS,EACTnqC,KAAM,CACJ6lC,CAAClD,IAAmChyC,KAAK4hG,oBAAsB,QAOjElnD,EACAC,GACA,EACA,CAAEznB,YACF0nB,EACF,EAGF,CAAC,SAASxyC,QAAQgE,IAChBszB,iBAAiBtzB,EAAMy3F,EAAgC,CAAEzjD,MAAM,EAAOwB,SAAS,GAAM,EAEzF,GyBhU8B,CACxByF,uBrDqMR,SAASA,GAAuBE,EAAwBC,GAA6B,EAAMC,GAAmC,GAC1H7U,IAA6B,EAC7BC,GAA0B0U,EAC1BzU,GAA0C2U,EACtCD,GAA8B1hD,IAAUA,GAAOotB,UAC/Cq0B,EAAuB,CACnBxjD,KAAM+B,GAAOotB,SAASy0B,SACtB7vC,GAAI,WACJG,OAAQ,wBACRg9B,WAAY,CACRC,CAAClD,IAAmC,QAIpD,KiC0sR4B9rC,EoB35RG,CACvBuqD,aAAa,EACbi/B,eAAe,GpB25Rd,IAAI6J,GAAOrzF,KoBv5RhBy3C,iBAAkB,EAElB0G,wBAAyB,CAAC,0CAE1B02C,yBAA0B,GAC1BC,yBAA0B,IrGsG9B,SAASj9E,GAAOxW,EAAK8C,GAEnB4Z,KAAgBlG,OAAOxW,EAAK8C,EAC9B,CqGvGEgpC,CAAc,cAAe,eAG/B0wD,OACGC,gBAAgBpG,IAChBp4F,KAAM25E,GAAYn2E,QAAQ2C,IAAI,mBAC9B4G,MAAO+T,GAAQtd,QAAQ0lB,MAAMpI,uBGZhC,SAAS29E,IACP,cAAcC,0BAA8B,OAAiBA,yBAC/D,CAKA,SAASzkE,IAEP,MAAO,KACT,gFClBA,SAAS+oB,IAGP,QACE,EAACy7C,QACgF,qBAAjF5/F,OAAOC,UAAUC,SAASG,YAAYgkD,QAAY,IAAcA,QAAU,EAE9E,kEClBO,MAAMy7C,UAAwBC,IACjCrkG,YAAY+S,IACRwjB,QACAt2B,KAAK8S,OAASA,EAClB,CACA,SAAIzI,GACA,OAAOrK,KAAKqkG,UAChB,CACAC,WAAWC,IACP,MAAMC,GAAeluE,MAAMguE,WAAWC,IACtC,OAACC,GAAaC,QAAUF,GAAWlwE,KAAKr0B,KAAK8S,QACtC0xF,EACX,CACAH,WACI,MAAQK,YAAUC,eAAa7xF,UAAW9S,KAC1C,GAAI0kG,GACA,MAAMC,GAEV,OAAA3kG,KAAK4kG,iBACE9xF,CACX,CACAuhB,KAAKhqB,IACDisB,MAAMjC,KAAMr0B,KAAK8S,OAASzI,GAC9B,4HCjBG,IAAMw6F,GAAU,MAAhB,MAAMA,GACT9kG,YAAYw2C,IACJA,KACAv2C,KAAKskG,WAAa/tD,GAE1B,CACAuuD,KAAKC,IACD,MAAMC,GAAa,IAAIH,GACvBG,UAAW95F,OAASlL,KACpBglG,GAAWD,SAAWA,GACfC,EACX,CACAzuD,UAAU0uD,GAAgBv2E,GAAO6mC,IAC7B,MAAMgvC,GAqEd,SAASW,GAAa76F,IAClB,OAAQA,IAASA,cAAiB86F,MAJtC,SAASC,GAAW/6F,IAChB,OAAOA,OAASg7F,KAAWh7F,GAAMgqB,QAAI,EAAKgxE,KAAWh7F,GAAMqkB,SAAK,EAAK22E,KAAWh7F,GAAMkrD,SAC1F,CAEsD6vC,CAAW/6F,MAAK,EAAKi7F,MAAej7F,GAC1F,CAvE2B66F,CAAaD,IAAkBA,GAAiB,IAAIM,KAAeN,GAAgBv2E,GAAO6mC,IAC7GiwC,eAAa,KACT,MAAQT,YAAU75F,WAAWlL,KAC7BukG,GAAWh9E,IAAIw9E,GAEPA,GAASrgG,KAAK6/F,GAAYr5F,IAC5BA,GAEMlL,KAAKskG,WAAWC,IAEhBvkG,KAAKylG,cAAclB,IAAW,GAEvCA,EACX,CACAkB,cAAcC,IACV,IACI,OAAO1lG,KAAKskG,WAAWoB,GAC3B,OACOp/E,IACHo/E,GAAKh3E,MAAMpI,GACf,CACJ,CACAle,QAAQisB,GAAMsxE,IACVA,OACO,IADPA,GAAcC,GAAeD,KACN,CAAC10F,GAASI,MAC7B,MAAMkzF,GAAa,IAAIgB,KAAe,CAClClxE,KAAOhqB,KACH,IACIgqB,GAAKhqB,GACT,OACOic,IACHjV,GAAOiV,IACPi+E,GAAW9tD,aACf,GAEJ/nB,MAAOrd,GACPkkD,SAAUtkD,KAEdjR,KAAKu2C,UAAUguD,GAAU,EAEjC,CACAD,WAAWC,IACP,IAAIsB,GACJ,OAA8B,QAAtBA,GAAK7lG,KAAKkL,cAA2B,IAAP26F,QAAgB,EAASA,GAAGtvD,UAAUguD,GAChF,CACA,CAACuB,OACG,OAAO9lG,IACX,CACAy0C,QAAQsxD,IACJ,SAAOC,MAAcD,GAArB,CAAiC/lG,KACrC,CACAimG,UAAUN,IACNA,OACO,IADPA,GAAcC,GAAeD,KACN,CAAC10F,GAASI,MAC7B,IAAIhH,GACJrK,KAAKu2C,UAAW4d,IAAO9pD,GAAQ8pD,GAAK7tC,IAAQjV,GAAOiV,IAAM,IAAMrV,GAAQ5G,IAAM,EAErF,EAEJw6F,UAAWqB,OAAU3vD,IACV,IAAIsuD,GAAWtuD,IAzEbsuD,EAAU,KA2EvB,SAASe,GAAeD,IACpB,IAAIE,GACJ,OAAgG,QAAxFA,GAAKF,IAA+DxxD,UAAOwqC,eAA4B,IAAPknB,GAAgBA,GAAKlnB,OACjI,iECpFO,MAAMwnB,eAA0BC,GAAkBC,IAAW,WAChEA,GAAOrmG,MACPA,KAAK+D,KAAO,0BACZ/D,KAAKgM,QAAU,qBACnB,8BCAO,IAAMo4F,GAAO,MAAb,MAAMA,WAAgBS,IACzB9kG,cACIu2B,QACAt2B,KAAKykG,QAAS,EACdzkG,KAAKsmG,iBAAmB,KACxBtmG,KAAKumG,UAAY,GACjBvmG,KAAKwmG,WAAY,EACjBxmG,KAAK0kG,UAAW,EAChB1kG,KAAK2kG,YAAc,IACvB,CACAG,KAAKC,IACD,MAAM0B,GAAU,IAAIC,GAAiB1mG,KAAMA,MAC3CymG,UAAQ1B,SAAWA,GACZ0B,EACX,CACA7B,iBACI,GAAI5kG,KAAKykG,OACL,MAAM,IAAI0B,EAElB,CACA9xE,KAAKhqB,KACDm7F,OAAa,KAET,GADAxlG,KAAK4kG,kBACA5kG,KAAKwmG,UAAW,CACZxmG,KAAKsmG,mBACNtmG,KAAKsmG,iBAAmBz/F,MAAM6e,KAAK1lB,KAAKumG,YAE5C,UAAW/+B,MAAYxnE,KAAKsmG,iBACxB9+B,GAASnzC,KAAKhqB,GAEtB,GAER,CACAqkB,MAAMpI,KACFk/E,OAAa,KAET,GADAxlG,KAAK4kG,kBACA5kG,KAAKwmG,UAAW,CACjBxmG,KAAK0kG,SAAW1kG,KAAKwmG,WAAY,EACjCxmG,KAAK2kG,YAAcr+E,GACnB,MAAQigF,cAAcvmG,KACtB,KAAOumG,GAAU7/F,QACb6/F,GAAU1iC,QAAQn1C,MAAMpI,GAEhC,GAER,CACAivC,YACIiwC,OAAa,KAET,GADAxlG,KAAK4kG,kBACA5kG,KAAKwmG,UAAW,CACjBxmG,KAAKwmG,WAAY,EACjB,MAAQD,cAAcvmG,KACtB,KAAOumG,GAAU7/F,QACb6/F,GAAU1iC,QAAQtO,UAE1B,GAER,CACA9e,cACIz2C,KAAKwmG,UAAYxmG,KAAKykG,QAAS,EAC/BzkG,KAAKumG,UAAYvmG,KAAKsmG,iBAAmB,IAC7C,CACA,YAAIK,GACA,IAAId,GACJ,OAAkC,QAAzBA,GAAK7lG,KAAKumG,iBAA8B,IAAPV,QAAgB,EAASA,GAAGn/F,QAAU,CACpF,CACA++F,cAAclB,IACV,OAAAvkG,KAAK4kG,iBACEtuE,MAAMmvE,cAAclB,GAC/B,CACAD,WAAWC,IACP,OAAAvkG,KAAK4kG,iBACL5kG,KAAK4mG,wBAAwBrC,IACtBvkG,KAAK6mG,gBAAgBtC,GAChC,CACAsC,gBAAgBtC,IACZ,MAAQG,YAAU8B,aAAWD,cAAcvmG,KAC3C,OAAI0kG,IAAY8B,GACLM,MAEX9mG,KAAKsmG,iBAAmB,KACxBC,GAAUt/F,KAAKs9F,IACR,IAAIjuD,KAAa,KACpBt2C,KAAKsmG,iBAAmB,QACxBS,MAAUR,GAAWhC,GAAU,GAEvC,CACAqC,wBAAwBrC,IACpB,MAAQG,YAAUC,eAAa6B,cAAcxmG,KACzC0kG,GACAH,GAAW71E,MAAMi2E,IAEZ6B,IACLjC,GAAWhvC,UAEnB,CACAyxC,eACI,MAAMhC,GAAa,IAAIH,IACvBG,UAAW95F,OAASlL,KACbglG,EACX,EAEJZ,UAAQ8B,OAAS,CAACe,GAAa/7F,KACpB,IAAIw7F,GAAiBO,GAAa/7F,IAvGhCk5F,EAAO,KAyGb,MAAMsC,WAAyBtC,GAClCrkG,YAAYknG,GAAa/7F,IACrBorB,QACAt2B,KAAKinG,YAAcA,GACnBjnG,KAAKkL,OAASA,EAClB,CACAmpB,KAAKhqB,IACD,IAAIw7F,GAAIqB,GACwE,QAA/EA,GAAiC,QAA3BrB,GAAK7lG,KAAKinG,mBAAgC,IAAPpB,QAAgB,EAASA,GAAGxxE,YAAyB,IAAP6yE,IAAyBA,GAAGxiG,KAAKmhG,GAAIx7F,GACjI,CACAqkB,MAAMpI,IACF,IAAIu/E,GAAIqB,GACyE,QAAhFA,GAAiC,QAA3BrB,GAAK7lG,KAAKinG,mBAAgC,IAAPpB,QAAgB,EAASA,GAAGn3E,aAA0B,IAAPw4E,IAAyBA,GAAGxiG,KAAKmhG,GAAIv/E,GAClI,CACAivC,WACI,IAAIswC,GAAIqB,GAC4E,QAAnFA,GAAiC,QAA3BrB,GAAK7lG,KAAKinG,mBAAgC,IAAPpB,QAAgB,EAASA,GAAGtwC,gBAA6B,IAAP2xC,IAAyBA,GAAGxiG,KAAKmhG,GACjI,CACAvB,WAAWC,IACP,IAAIsB,GAAIqB,GACR,OAAmG,QAA3FA,GAA4B,QAAtBrB,GAAK7lG,KAAKkL,cAA2B,IAAP26F,QAAgB,EAASA,GAAGtvD,UAAUguD,WAAgC,IAAP2C,GAAgBA,GAAKJ,IACpI,gHCnIG,MAAMK,EAA+BC,GAAmB,SAAK7jG,OAAWA,GAOxE,SAAS6jG,GAAmBC,GAAMh9F,GAAOqkB,IAC5C,MAAO,CACH24E,QACAh9F,SACAqkB,SAER,6BCLO,MAAMy2E,WAAmB7uD,KAC5Bv2C,YAAYknG,IACR3wE,QACAt2B,KAAKwmG,WAAY,EACbS,IACAjnG,KAAKinG,YAAcA,MACf3B,MAAe2B,KACfA,GAAY1/E,IAAIvnB,OAIpBA,KAAKinG,YAAcK,EAE3B,CACA,aAAOpB,CAAO7xE,GAAM3F,GAAO6mC,IACvB,OAAO,IAAIgwC,GAAelxE,GAAM3F,GAAO6mC,GAC3C,CACAlhC,KAAKhqB,IACGrK,KAAKwmG,UACLe,GDvBL,SAASC,GAAiBn9F,IAC7B,OAAO+8F,GAAmB,IAAK/8F,QAAO9G,EAC1C,CCqBsCikG,CAAiBn9F,IAAQrK,MAGnDA,KAAKynG,MAAMp9F,GAEnB,CACAqkB,MAAMpI,IACEtmB,KAAKwmG,UACLe,GDlCL,SAASG,GAAkBh5E,IAC9B,OAAO04E,GAAmB,SAAK7jG,EAAWmrB,GAC9C,CCgCsCg5E,CAAkBphF,IAAMtmB,OAGlDA,KAAKwmG,WAAY,EACjBxmG,KAAK2nG,OAAOrhF,IAEpB,CACAivC,WACQv1D,KAAKwmG,UACLe,GAA0BJ,EAAuBnnG,OAGjDA,KAAKwmG,WAAY,EACjBxmG,KAAK4nG,YAEb,CACAnxD,cACSz2C,KAAKykG,SACNzkG,KAAKwmG,WAAY,EACjBlwE,MAAMmgB,cACNz2C,KAAKinG,YAAc,KAE3B,CACAQ,MAAMp9F,IACFrK,KAAKinG,YAAY5yE,KAAKhqB,GAC1B,CACAs9F,OAAOrhF,IACH,IACItmB,KAAKinG,YAAYv4E,MAAMpI,GAC3B,SAEItmB,KAAKy2C,aACT,CACJ,CACAmxD,YACI,IACI5nG,KAAKinG,YAAY1xC,UACrB,SAEIv1D,KAAKy2C,aACT,CACJ,EAEJ,MAAMoxD,GAAQ14E,SAAS7qB,UAAUyoB,KACjC,SAASA,GAAK9G,GAAIioD,IACd,OAAO25B,GAAMnjG,KAAKuhB,GAAIioD,GAC1B,CACA,MAAM45B,GACF/nG,YAAYgoG,IACR/nG,KAAK+nG,gBAAkBA,EAC3B,CACA1zE,KAAKhqB,IACD,MAAQ09F,oBAAoB/nG,KAC5B,GAAI+nG,GAAgB1zE,KAChB,IACI0zE,GAAgB1zE,KAAKhqB,GACzB,OACOqkB,IACHs5E,GAAqBt5E,GACzB,CAER,CACAA,MAAMpI,IACF,MAAQyhF,oBAAoB/nG,KAC5B,GAAI+nG,GAAgBr5E,MAChB,IACIq5E,GAAgBr5E,MAAMpI,GAC1B,OACOoI,IACHs5E,GAAqBt5E,GACzB,MAGAs5E,GAAqB1hF,GAE7B,CACAivC,WACI,MAAQwyC,oBAAoB/nG,KAC5B,GAAI+nG,GAAgBxyC,SAChB,IACIwyC,GAAgBxyC,UACpB,OACO7mC,IACHs5E,GAAqBt5E,GACzB,CAER,EAEG,MAAM62E,WAAuBJ,GAChCplG,YAAYklG,GAAgBv2E,GAAO6mC,IAE/B,IAAIwyC,GACJ,GAFAzxE,SAEA,EAAI+uE,KAAWJ,MAAoBA,GAC/B8C,GAAkB,CACd1zE,KAAO4wE,SAAwE1hG,EAC/EmrB,MAAOA,SAA6CnrB,EACpDgyD,SAAUA,SAAsDhyD,OAGnE,CACD,IAAImQ,GACA1T,MAAQm0C,SAAO8zD,0BACfv0F,GAAUrP,OAAO6hG,OAAOjB,IACxBvxF,GAAQ+iC,YAAc,IAAMz2C,KAAKy2C,cACjCsxD,GAAkB,CACd1zE,KAAM4wE,GAAe5wE,MAAQtH,GAAKk4E,GAAe5wE,KAAM3gB,IACvDgb,MAAOu2E,GAAev2E,OAAS3B,GAAKk4E,GAAev2E,MAAOhb,IAC1D6hD,SAAU0vC,GAAe1vC,UAAYxoC,GAAKk4E,GAAe1vC,SAAU7hD,MAIvEq0F,GAAkB9C,EAE1B,CACAjlG,KAAKinG,YAAc,IAAIa,GAAiBC,GAC5C,EAEJ,SAASC,GAAqBt5E,IACtBylB,SAAO+zD,yCACPC,MAAaz5E,KAAK,EAGlB05E,MAAqB15E,GAE7B,CAIA,SAAS64E,GAA0Bc,GAAc9D,IAC7C,MAAQ+D,0BAA0Bn0D,SAClCm0D,IAAyBC,KAAgBlpE,WAAW,IAAMipE,GAAsBD,GAAc9D,IAClG,CACO,MAAM+C,GAAiB,CAC1B7C,QAAQ,EACRpwE,KAAMm0E,KACN95E,MAVJ,SAAS+5E,GAAoBniF,IACzB,MAAMA,EACV,EASIivC,SAAUizC,8EC1KP,MAAME,cAAsBtC,GAAkBC,IAAW,SAAiClyF,IAC7FkyF,GAAOrmG,MACPA,KAAKgM,QAAUmI,GACR,GAAEA,GAAOzN,kDAClByN,GAAOhM,IAAI,CAACme,GAAK7e,KAAO,GAAEA,GAAI,MAAM6e,GAAI/hB,cAAc6C,KAAK,UACnD,GACNpH,KAAK+D,KAAO,sBACZ/D,KAAKmU,OAASA,EAClB,mBCNO,MAAMmiC,GACTv2C,YAAY4oG,IACR3oG,KAAK2oG,gBAAkBA,GACvB3oG,KAAKykG,QAAS,EACdzkG,KAAK4oG,WAAa,KAClB5oG,KAAK6oG,YAAc,IACvB,CACApyD,cACI,IAAItiC,GACJ,IAAKnU,KAAKykG,OAAQ,CACdzkG,KAAKykG,QAAS,EACd,MAAQmE,eAAe5oG,KACvB,GAAI4oG,GAEA,GADA5oG,KAAK4oG,WAAa,KACd/hG,MAAMC,QAAQ8hG,IACd,UAAW/xB,MAAU+xB,GACjB/xB,GAAO3oC,OAAOluC,WAIlB4oG,GAAW16D,OAAOluC,MAG1B,MAAQ2oG,gBAAiBG,IAAqB9oG,KAC9C,MAAIqlG,KAAWyD,IACX,IACIA,IACJ,OACO52F,IACHiC,GAASjC,cAAaw2F,EAAsBx2F,GAAEiC,OAAS,CAACjC,GAC5D,CAEJ,MAAQ22F,gBAAgB7oG,KACxB,GAAI6oG,GAAa,CACb7oG,KAAK6oG,YAAc,KACnB,UAAWE,MAAaF,GACpB,IACIG,GAAcD,GAClB,OACOziF,IACHnS,GAASA,IAAgD,GACrDmS,cAAeoiF,EACfv0F,GAAS,IAAIA,MAAWmS,GAAInS,QAG5BA,GAAOlN,KAAKqf,GAEpB,CAER,CACA,GAAInS,GACA,MAAM,IAAIu0F,EAAoBv0F,GAEtC,CACJ,CACAoT,IAAI0hF,IACA,IAAIpD,GACJ,GAAIoD,IAAYA,KAAajpG,KACzB,GAAIA,KAAKykG,OACLuE,GAAcC,QAEb,CACD,GAAIA,cAAoB3yD,GAAc,CAClC,GAAI2yD,GAASxE,QAAUwE,GAASC,WAAWlpG,MACvC,OAEJipG,GAASE,WAAWnpG,KACxB,EACCA,KAAK6oG,YAA0C,QAA3BhD,GAAK7lG,KAAK6oG,mBAAgC,IAAPhD,GAAgBA,GAAK,IAAI5+F,KAAKgiG,GAC1F,CAER,CACAC,WAAWryB,IACP,MAAQ+xB,eAAe5oG,KACvB,OAAO4oG,KAAe/xB,IAAWhwE,MAAMC,QAAQ8hG,KAAeA,GAAW59F,SAAS6rE,GACtF,CACAsyB,WAAWtyB,IACP,MAAQ+xB,eAAe5oG,KACvBA,KAAK4oG,WAAa/hG,MAAMC,QAAQ8hG,KAAeA,GAAW3hG,KAAK4vE,IAAS+xB,IAAcA,GAAa,CAACA,GAAY/xB,IAAUA,EAC9H,CACAuyB,cAAcvyB,IACV,MAAQ+xB,eAAe5oG,KACnB4oG,KAAe/xB,GACf72E,KAAK4oG,WAAa,KAEb/hG,MAAMC,QAAQ8hG,MAAU,EAC7B7B,MAAU6B,GAAY/xB,GAE9B,CACA3oC,OAAO+6D,IACH,MAAQJ,gBAAgB7oG,KACxB6oG,OAAe9B,MAAU8B,GAAaI,IAClCA,cAAoB3yD,IACpB2yD,GAASG,cAAcppG,KAE/B,EAEJs2C,GAAa+yD,YACT,MAAMC,GAAQ,IAAIhzD,GAClBgzD,UAAM7E,QAAS,EACR6E,EACX,EAJaD,GAKN,MAAMvC,EAAqBxwD,GAAa+yD,MACxC,SAAS/D,GAAej7F,IAC3B,OAAQA,cAAiBisC,IACpBjsC,IAAS,WAAYA,OAASg7F,KAAWh7F,GAAM6jC,UAAM,EAAKm3D,KAAWh7F,GAAMkd,OAAG,EAAK89E,KAAWh7F,GAAMosC,YAC7G,CACA,SAASuyD,GAAcD,KACnB,EAAI1D,KAAW0D,IACXA,KAGAA,GAAUtyD,aAElB,4CCrHO,MAAMtC,EAAS,CAClBo1D,iBAAkB,KAClBjB,sBAAuB,KACvB3pB,aAASp7E,EACT2kG,uCAAuC,EACvCD,0BAA0B,oJCIvB,SAASuB,MAAiB5/F,IAC7B,MAAM6/F,MAAYC,MAAa9/F,IACzB+/F,MAAiBC,MAAkBhgG,KACjCA,KAAMigG,GAAa1gG,UAAK,EAAI2gG,KAAqBlgG,IACzD,GAA2B,IAAvBigG,GAAYnjG,OACZ,SAAOgf,KAAK,GAAI+jF,IAEpB,MAAMp3F,GAAS,IAAIwyF,IAOhB,SAASkF,GAAkBF,GAAaJ,GAAWO,GAAiBC,MACvE,OAAQ1F,KACJ2F,GAAcT,GAAW,KACrB,MAAQ/iG,WAAWmjG,GACbp7F,GAAS,IAAI5H,MAAMH,IACzB,IAAIyjG,GAASzjG,GACT0jG,GAAuB1jG,GAC3B,QAASe,GAAI,EAAGA,GAAIf,GAAQe,KACxByiG,GAAcT,GAAW,KACrB,MAAMv+F,MAASwa,KAAKmkF,GAAYpiG,IAAIgiG,IACpC,IAAIY,IAAgB,EACpBn/F,GAAOqrC,aAAU+zD,MAAyB/F,GAAal6F,KACnDoE,GAAOhH,IAAK4C,GACPggG,KACDA,IAAgB,EAChBD,MAECA,IACD7F,GAAWlwE,KAAK21E,GAAev7F,GAAOzE,SAAQ,EAEnD,OACQmgG,IACH5F,GAAWhvC,UAAS,GAE1B,EACHgvC,GAAU,EAElBA,GAAU,CAErB,CApCkCwF,CAAkBF,GAAaJ,GAAWtgG,GAE/DsF,OAAW87F,MAAaphG,GAAMsF,IAE/Bw7F,OACR,OAAON,GAAiBt3F,GAAOoiC,QAAK+1D,MAAiBb,KAAmBt3F,EAC5E,CA+BA,SAAS63F,GAAcT,GAAWgB,GAASjG,IACnCiF,MACAiB,MAAgBlG,GAAciF,GAAWgB,IAGzCA,IAER,uCC3DO,MAAMpB,EAAQ,aAAIxE,GAAYN,IAAeA,GAAWhvC,mGCExD,SAASo1C,GAAUlB,GAAW/7D,GAAQ,GACzC,SAAOk9D,KAAQ,CAAC1/F,GAAQq5F,MACpBr5F,GAAOqrC,aAAU+zD,MAAyB/F,GAAal6F,OAAUqgG,KAAgBnG,GAAYkF,GAAW,IAAMlF,GAAWlwE,KAAKhqB,IAAQqjC,IAAQ,OAAMg9D,KAAgBnG,GAAYkF,GAAW,IAAMlF,GAAWhvC,WAAY7nB,IAASpnB,OAAQokF,KAAgBnG,GAAYkF,GAAW,IAAMlF,GAAW71E,MAAMpI,IAAMonB,KAAO,EAE5T,CCNO,SAASm9D,EAAYpB,GAAW/7D,GAAQ,GAC3C,SAAOk9D,KAAQ,CAAC1/F,GAAQq5F,MACpBA,GAAWh9E,IAAIkiF,GAAUqB,SAAS,IAAM5/F,GAAOqrC,UAAUguD,IAAa72D,IAAM,EAEpF,yCCHO,SAASq9D,GAAsB7gG,GAAOu/F,IACzC,IAAKv/F,GACD,MAAM,IAAItF,MAAM,2BAEpB,OAAO,IAAIigG,KAAYN,MACnBmG,OAAgBnG,GAAYkF,GAAW,KACnC,MAAMuB,GAAW9gG,GAAM+gG,OAAOC,kBAC9BR,OAAgBnG,GAAYkF,GAAW,KACnCuB,GAAS32E,OAAO7uB,KAAM6M,KACdA,GAAO84F,KACP5G,GAAWhvC,WAGXgvC,GAAWlwE,KAAKhiB,GAAOhI,MAAK,EAEnC,EACF,GAAG,EAAI,EACb,EAET,yFCnBO,SAASqb,GAAKxb,GAAOu/F,IACxB,OAAOA,GCUJ,SAAS2B,GAAUlhG,GAAOu/F,IAC7B,GAAa,MAATv/F,GAAe,CACf,MAAImhG,MAAoBnhG,IACpB,OCbL,SAASohG,GAAmBphG,GAAOu/F,IACtC,SAAO8B,MAAUrhG,IAAOuqC,KAAKo2D,EAAYpB,IAAYkB,GAAUlB,IACnE,CDWmB6B,CAAmBphG,GAAOu/F,IAErC,MAAI+B,MAAYthG,IACZ,OElBL,SAASuhG,GAAcvhG,GAAOu/F,IACjC,OAAO,IAAI5E,KAAYN,KACnB,IAAI98F,GAAI,EACR,OAAOgiG,GAAUqB,SAAS,WAClBrjG,KAAMyC,GAAMxD,OACZ69F,GAAWhvC,YAGXgvC,GAAWlwE,KAAKnqB,GAAMzC,OACjB88F,GAAWE,QACZzkG,KAAK8qG,WAGjB,EAAC,EAET,CFGmBW,CAAcvhG,GAAOu/F,IAEhC,MAAIiC,MAAUxhG,IACV,OGnBL,SAASyhG,GAAgBzhG,GAAOu/F,IACnC,SAAO8B,MAAUrhG,IAAOuqC,KAAKo2D,EAAYpB,IAAYkB,GAAUlB,IACnE,CHiBmBkC,CAAgBzhG,GAAOu/F,IAElC,MAAImC,MAAgB1hG,IAChB,OAAO6gG,GAAsB7gG,GAAOu/F,IAExC,MAAIoC,MAAW3hG,IACX,OIxBL,SAAS4hG,GAAiB5hG,GAAOu/F,IACpC,OAAO,IAAI5E,KAAYN,KACnB,IAAIyG,GACJN,cAAgBnG,GAAYkF,GAAW,KACnCuB,GAAW9gG,GAAM6hG,SAAiB,EAClCrB,KAAgBnG,GAAYkF,GAAW,KACnC,IAAIp/F,GACA8gG,GACJ,MACO9gG,SAAO8gG,SAASH,GAAS32E,OAChC,OACO/N,IAEH,YADAi+E,GAAW71E,MAAMpI,GAErB,CACI6kF,GACA5G,GAAWhvC,WAGXgvC,GAAWlwE,KAAKhqB,GAAK,EAE1B,GAAG,EAAI,GAEP,OAAMg7F,MAA+D2F,IAASgB,SAAWhB,GAASgB,QAAO,EAExH,CJDmBF,CAAiB5hG,GAAOu/F,IAEnC,MAAIwC,MAAqB/hG,IACrB,OK7BL,SAASgiG,GAA2BhiG,GAAOu/F,IAC9C,OAAOsB,MAAsBoB,MAAmCjiG,IAAQu/F,GAC5E,CL2BmByC,CAA2BhiG,GAAOu/F,GAEjD,CACA,QAAM2C,MAAiCliG,GAC3C,CDhCuBkhG,CAAUlhG,GAAOu/F,KAAS,EAAI8B,MAAUrhG,GAC/D,yLOQO,SAASqhG,GAAUrhG,IACtB,GAAIA,cAAiB26F,KACjB,OAAO36F,GAEX,GAAa,MAATA,GAAe,CACf,MAAImhG,MAAoBnhG,IACpB,OAoBL,SAASmiG,GAAsBhpG,IAClC,OAAO,IAAIwhG,KAAYN,KACnB,MAAM+H,GAAMjpG,GAAIyiG,QAChB,MAAIT,MAAWiH,GAAI/1D,WACf,OAAO+1D,GAAI/1D,UAAUguD,IAEzB,MAAM,IAAI7sB,UAAU,iEAAgE,EAE5F,CA5BmB20B,CAAsBniG,IAEjC,MAAIshG,KAAYthG,IACZ,OA0BL,SAASqiG,GAAcC,IAC1B,OAAO,IAAI3H,KAAYN,KACnB,QAAS98F,GAAI,EAAGA,GAAI+kG,GAAM9lG,SAAW69F,GAAWE,OAAQh9F,KACpD88F,GAAWlwE,KAAKm4E,GAAM/kG,KAE1B88F,GAAWhvC,UAAS,EAE5B,CAjCmBg3C,CAAcriG,IAEzB,MAAIwhG,KAAUxhG,IACV,OA+BL,SAASuiG,GAAYpzE,IACxB,OAAO,IAAIwrE,KAAYN,KACnBlrE,GACK7zB,KAAM6E,KACFk6F,GAAWE,SACZF,GAAWlwE,KAAKhqB,IAChBk6F,GAAWhvC,WAAS,EAExBjvC,IAAQi+E,GAAW71E,MAAMpI,KACxB9gB,KAAK,KAAM4iG,KAAoB,EAE5C,CA1CmBqE,CAAYviG,IAEvB,MAAI0hG,KAAgB1hG,IAChB,OAAOwiG,GAAkBxiG,IAE7B,MAAI2hG,MAAW3hG,IACX,OAqCL,SAASyiG,GAAaC,IACzB,OAAO,IAAI/H,KAAYN,KACnB,UAAWl6F,MAASuiG,GAEhB,GADArI,GAAWlwE,KAAKhqB,IACZk6F,GAAWE,OACX,OAGRF,GAAWhvC,UAAS,EAE5B,CA/CmBo3C,CAAaziG,IAExB,MAAI+hG,MAAqB/hG,IACrB,OAkDL,SAAS2iG,GAAuBC,IACnC,OAAOJ,MAAkBP,MAAmCW,IAChE,CApDmBD,CAAuB3iG,GAEtC,CACA,QAAMkiG,MAAiCliG,GAC3C,CAyCO,SAASwiG,GAAkBK,IAC9B,OAAO,IAAIlI,KAAYN,MAO3B,SAAS77C,GAAQqkD,GAAexI,IAC5B,IAAIyI,GAAiBC,GACjBC,GAAKrH,GACT,SAAOsH,MAAUntG,UAAM,OAAQ,EAAQ,YACnC,IACI,IAAKgtG,MAAkBI,MAAcL,MAAgBE,SAA0BD,GAAgB34E,QAA2B82E,MAGtH,GADA5G,GAAWlwE,KADG44E,GAAkB5iG,OAE5Bk6F,GAAWE,OACX,MAGZ,OACO4I,IAASH,GAAM,CAAEx+E,MAAO2+E,GAAS,SAEpC,IACQJ,KAAsBA,GAAkB9B,OAAStF,GAAKmH,GAAgBhB,gBAAenG,GAAGnhG,KAAKsoG,IACrG,SACU,GAAIE,GAAK,MAAMA,GAAIx+E,KAAO,CACxC,CACA61E,GAAWhvC,UACf,EACJ,EA5BQ7M,CAAQqkD,GAAexI,IAAYhyF,MAAO+T,IAAQi+E,GAAW71E,MAAMpI,IAAI,EAE/E,iEChFO,SAASgnF,KAAM1jG,IAClB,MAAM6/F,MAAYC,MAAa9/F,IAC/B,SAAO8b,KAAK9b,GAAM6/F,GACtB,iECHO,SAAS8D,EAAWC,GAAqB/D,IAC5C,MAAMgE,KAAepI,KAAWmI,IAAuBA,GAAsB,IAAMA,GAC7E15F,GAAQywF,IAAeA,GAAW71E,MAAM++E,KAC9C,OAAO,IAAI5I,IAAW4E,GAAalF,IAAekF,GAAUqB,SAASh3F,GAAM,EAAGywF,IAAczwF,GAChG,sDCLO,SAASw2F,EAAyBrD,GAAayG,GAAQC,EAAYC,GAASC,IAC/E,OAAO,IAAIC,EAAmB7G,GAAayG,GAAQC,EAAYC,GAASC,GAC5E,CACO,MAAMC,UAA2B3I,KACpCplG,YAAYknG,GAAayG,EAAQC,GAAYC,GAASC,GAAYE,IAC9Dz3E,MAAM2wE,IACNjnG,KAAK6tG,WAAaA,GAClB7tG,KAAK+tG,kBAAoBA,GACzB/tG,KAAKynG,MAAQiG,EACP,SAAUrjG,IACR,IACIqjG,EAAOrjG,GACX,OACOic,IACH2gF,GAAYv4E,MAAMpI,GACtB,CACJ,EACEgQ,MAAMmxE,MACZznG,KAAK2nG,OAASiG,GACR,SAAUtnF,IACR,IACIsnF,GAAQtnF,GACZ,OACOA,IACH2gF,GAAYv4E,MAAMpI,GACtB,SAEItmB,KAAKy2C,aACT,CACJ,EACEngB,MAAMqxE,OACZ3nG,KAAK4nG,UAAY+F,GACX,WACE,IACIA,IACJ,OACOrnF,IACH2gF,GAAYv4E,MAAMpI,GACtB,SAEItmB,KAAKy2C,aACT,CACJ,EACEngB,MAAMsxE,SAChB,CACAnxD,cACI,IAAIovD,GACJ,IAAK7lG,KAAK+tG,mBAAqB/tG,KAAK+tG,oBAAqB,CACrD,MAAQtJ,UAAWzkG,KACnBs2B,MAAMmgB,eACLguD,IAAsC,QAA1BoB,GAAK7lG,KAAK6tG,kBAA+B,IAAPhI,IAAyBA,GAAGnhG,KAAK1E,MACpF,CACJ,6EClDG,SAASguG,GAAW/lD,IACvB,SAAO2iD,KAAQ,CAAC1/F,EAAQq5F,MACpB,IAEI0J,GAFAC,GAAW,KACXC,IAAY,EAEhBD,GAAWhjG,EAAOqrC,aAAU+zD,KAAyB/F,QAAYhhG,OAAWA,EAAY+iB,KACpF2nF,MAAgB1C,MAAUtjD,GAAS3hC,GAAK0nF,GAAW/lD,GAAX+lD,CAAqB9iG,KACzDgjG,IACAA,GAASz3D,cACTy3D,GAAW,KACXD,GAAc13D,UAAUguD,KAGxB4J,IAAY,KAGhBA,KACAD,GAASz3D,cACTy3D,GAAW,KACXD,GAAc13D,UAAUguD,IAAU,EAG9C,iECvBO,SAAS6J,EAAUC,GAAS1E,IAC/B,SAAOtE,KAAWsE,KAAc,EAAI2E,KAASD,GAAS1E,GAAgB,IAAC,EAAI2E,KAASD,GAAS,EACjG,6ECDO,SAASE,GAAqBC,EAAYC,GAAcxE,KAC3DuE,SAAaA,GAA4DE,MAClE9D,KAAQ,CAAC1/F,GAAQq5F,MACpB,IAAIoK,GACAxoB,IAAQ,EACZj7E,GAAOqrC,aAAU+zD,KAAyB/F,GAAal6F,KACnD,MAAMukG,GAAaH,GAAYpkG,KAC3B87E,KAAUqoB,EAAWG,GAAaC,OAClCzoB,IAAQ,EACRwoB,GAAcC,GACdrK,GAAWlwE,KAAKhqB,IAAK,GAE3B,EAEV,CACA,SAASqkG,GAAe7pF,EAAGC,IACvB,OAAOD,IAAMC,EACjB,iEClBO,SAAS9c,EAAO6mG,GAAW3gC,IAC9B,SAAO08B,KAAQ,CAAC1/F,EAAQq5F,MACpB,IAAIjxF,GAAQ,EACZpI,EAAOqrC,aAAU+zD,KAAyB/F,GAAal6F,IAAUwkG,GAAUnqG,KAAKwpE,GAAS7jE,GAAOiJ,OAAYixF,GAAWlwE,KAAKhqB,KAAO,EAE3I,sDCNO,SAASykG,EAAS/lG,GACrB,SAAO6hG,KAAQ,CAAC1/F,GAAQq5F,MACpB,IACIr5F,GAAOqrC,UAAUguD,GACrB,SAEIA,GAAWh9E,IAAIxe,EACnB,GAER,iECRO,SAASZ,EAAIkmG,GAASngC,IACzB,SAAO08B,KAAQ,CAAC1/F,EAAQq5F,MACpB,IAAIjxF,GAAQ,EACZpI,EAAOqrC,aAAU+zD,KAAyB/F,GAAal6F,KACnDk6F,GAAWlwE,KAAKg6E,GAAQ3pG,KAAKwpE,GAAS7jE,GAAOiJ,MAAQ,GACvD,EAEV,iECPO,SAASy7F,EAASC,GAAa9tD,KAClC,SAAOotD,KAASrE,IAAU+E,GAC9B,iHCCO,SAASV,GAASD,GAAS1E,GAAgBqF,GAAa9tD,KAC3D,SAAImkD,MAAWsE,IACJ2E,GAAS,CAACzpF,GAAGpd,QAAMU,KAAI,CAAC2c,GAAGmqF,KAAOtF,GAAe9kF,GAAGC,GAAGrd,GAAGwnG,IAA7CxnG,EAAgD,EAAE8jG,MAAU8C,GAAQxpF,GAAGpd,MAAMunG,KAElE,iBAAnBrF,KACZqF,GAAarF,OAEViB,KAAQ,CAAC1/F,GAAQq5F,KCTrB,SAAS2K,EAAehkG,GAAQq5F,GAAY8J,GAASW,GAAYG,GAAcC,GAAQC,GAAmBC,IAC7G,MAAMv6E,GAAS,GACf,IAAIo1E,GAAS,EACT72F,GAAQ,EACRi8F,IAAa,EACjB,MAAMC,GAAgBA,KACdD,KAAex6E,GAAOruB,SAAWyjG,IACjC5F,GAAWhvC,UAAS,EAGtBk6C,GAAaplG,IAAW8/F,GAAS6E,GAAaU,GAAWrlG,IAAS0qB,GAAO9tB,KAAKoD,IAC9EqlG,GAAcrlG,KAChB+kG,IAAU7K,GAAWlwE,KAAKhqB,IAC1B8/F,KACA,IAAIwF,IAAgB,GACpBpE,QAAU8C,GAAQhkG,GAAOiJ,OAAUijC,aAAU+zD,MAAyB/F,GAAaqL,KACnBT,KAAaS,IACrER,GACAK,GAAUG,IAGVrL,GAAWlwE,KAAKu7E,GAAU,EAE/B,KACCD,IAAgB,QACjBpsG,EAAW,KACV,GAAIosG,GACA,IAEI,IADAxF,KACOp1E,GAAOruB,QAAUyjG,GAAS6E,IAAY,CACzC,MAAMa,GAAgB96E,GAAO8uC,QACzBwrC,MACA3E,MAAgBnG,GAAY8K,GAAmB,IAAMK,GAAWG,KAGhEH,GAAWG,GAEnB,CACAL,IACJ,OACOlpF,IACHi+E,GAAW71E,MAAMpI,GACrB,IAEN,EAENpb,UAAOqrC,aAAU+zD,MAAyB/F,GAAYkL,GAAW,KAC7DF,IAAa,EACbC,IAAc,IAEX,KACuEF,MAAoB,CAEtG,CD5C2CJ,CAAehkG,GAAQq5F,GAAY8J,GAASW,KACvF,6EEVO,SAASc,GAAUzB,GAAS1E,GAC/B,SAAOiB,KAAQ,CAAC1/F,GAAQq5F,MACpB,IAAIwL,GAAkB,KAClBz8F,GAAQ,EACRi8F,IAAa,EACjB,MAAMC,GAAgBA,IAAMD,KAAeQ,IAAmBxL,GAAWhvC,WACzErqD,GAAOqrC,aAAU+zD,KAAyB/F,GAAal6F,KACe0lG,IAAgBt5D,cAClF,IAAIu5D,GAAa,EACjB,MAAMC,GAAa38F,MACnBi4F,QAAU8C,GAAQhkG,GAAO4lG,KAAa15D,UAAWw5D,MAAkBzF,KAAyB/F,GAAaqL,IAAerL,GAAWlwE,KAAKs1E,EAAiBA,EAAet/F,GAAOulG,GAAYK,GAAYD,MAAgBJ,IAAa,KAChOG,GAAkB,KAClBP,IAAc,GACf,EACJ,KACCD,IAAa,EACbC,IAAc,GAChB,EAEV,yFClBO,SAAS76D,GAAIswD,EAAgBv2E,GAAO6mC,IACvC,MAAM26C,MAAc7K,KAAWJ,IAAmBv2E,IAAS6mC,GAEnD,CAAElhC,KAAM4wE,EAAgBv2E,SAAO6mC,aACjC0vC,EACN,OAAOiL,MACDtF,KAAQ,CAAC1/F,GAAQq5F,MACf,IAAIsB,GAC6B,QAAhCA,GAAKqK,GAAY35D,iBAA8B,IAAPsvD,IAAyBA,GAAGnhG,KAAKwrG,IAC1E,IAAIC,IAAU,EACdjlG,GAAOqrC,aAAU+zD,KAAyB/F,GAAal6F,KACnD,IAAIw7F,GACwB,QAA3BA,GAAKqK,GAAY77E,YAAyB,IAAPwxE,IAAyBA,GAAGnhG,KAAKwrG,GAAa7lG,IAClFk6F,GAAWlwE,KAAKhqB,GAAK,EACtB,KACC,IAAIw7F,GACJsK,IAAU,EACsB,QAA/BtK,GAAKqK,GAAY36C,gBAA6B,IAAPswC,IAAyBA,GAAGnhG,KAAKwrG,IACzE3L,GAAWhvC,UAAS,EACpBjvC,KACA,IAAIu/E,GACJsK,IAAU,EACmB,QAA5BtK,GAAKqK,GAAYxhF,aAA0B,IAAPm3E,IAAyBA,GAAGnhG,KAAKwrG,GAAa5pF,IACnFi+E,GAAW71E,MAAMpI,GAAG,EACrB,KACC,IAAIu/E,GAAIqB,GACJiJ,KACmC,QAAlCtK,GAAKqK,GAAYz5D,mBAAgC,IAAPovD,IAAyBA,GAAGnhG,KAAKwrG,KAEhD,QAA/BhJ,GAAKgJ,GAAYpB,gBAA6B,IAAP5H,IAAyBA,GAAGxiG,KAAKwrG,GAAW,GACtF,GAGFjG,IACZ,uCCtCO,MAAM1B,EAAkB,CAC3BlpE,WAAWrsB,EAAS+kB,KAAYnuB,IAC5B,MAAQwmG,aAAa7H,EACrB,OAAwD6H,IAAS/wE,WACtD+wE,GAAS/wE,WAAWrsB,EAAS+kB,KAAYnuB,IAE7Cy1B,WAAWrsB,EAAS+kB,KAAYnuB,GAC3C,EACA+3B,aAAa67D,GACT,MAAQ4S,YAAa7H,EACrB,OAA6D6H,GAASzuE,cAAiBA,cAAc67D,EACzG,EACA4S,cAAU7sG,wCCNP,MAAMynG,EANN,SAASqF,IACZ,MAAsB,mBAAXpF,QAA0BA,OAAOD,SAGrCC,OAAOD,SAFH,YAGf,CACwBqF,wCCNjB,MAAMrL,EAAuC,mBAAXiG,QAAyBA,OAAOjG,YAAe,uFCExF,SAAS5e,EAAK95D,IACV,OAAOA,GAAIA,GAAI5lB,OAAS,EAC5B,CACO,SAASkjG,GAAkBhgG,IAC9B,SAAOy7F,KAAWjf,EAAKx8E,KAASA,GAAKiY,WAAQte,CACjD,CACO,SAASmmG,GAAa9/F,IACzB,OCRG,SAAS0mG,EAAYjmG,IACxB,OAAOA,OAASg7F,KAAWh7F,GAAMygG,SACrC,CDMWwF,CAAYlqB,EAAKx8E,KAASA,GAAKiY,WAAQte,CAClD,CACO,SAASgtG,EAAU3mG,GAAM4mG,IAC5B,MAA6B,iBAAfpqB,EAAKx8E,IAAqBA,GAAKiY,MAAQ2uF,EACzD,wCEbA,MAAQ1pG,WAAYD,OACZwG,iBAAgB/I,UAAWmsG,EAAatnG,KAAMunG,IAAYrsG,OAC3D,SAASylG,GAAqBlgG,IACjC,GAAoB,IAAhBA,GAAKlD,OAAc,CACnB,MAAMy/E,GAAQv8E,GAAK,GACnB,GAAI9C,EAAQq/E,IACR,MAAO,CAAEv8E,KAAMu8E,GAAOh9E,KAAM,MAEhC,GAUR,SAASwnG,EAAOttG,IACZ,OAAOA,IAAsB,iBAARA,IAAoBgK,EAAehK,MAASotG,CACrE,CAZYE,CAAOxqB,IAAQ,CACf,MAAMh9E,GAAOunG,GAAQvqB,IACrB,MAAO,CACHv8E,KAAMT,GAAKhB,IAAKZ,IAAQ4+E,GAAM5+E,KAC9B4B,QAER,CACJ,CACA,MAAO,CAAES,KAAMA,GAAMT,KAAM,KAC/B,qBCjBO,SAAS49F,EAAUz6E,EAAK5e,GAC3B,GAAI4e,EAAK,CACL,MAAMhZ,GAAQgZ,EAAII,QAAQhf,GAC1B,GAAK4F,IAASgZ,EAAI5E,OAAOpU,GAAO,EACpC,CACJ,sCCLO,SAAS8yF,EAAiBwK,GAK7B,MAAMC,GAAWD,EAJDE,KACZlsG,MAAMF,KAAKosG,IACXA,GAAS7kG,OAAQ,IAAIrH,OAAQqH,QAGjC4kG,UAASvsG,UAAYD,OAAO6hG,OAAOthG,MAAMN,WACzCusG,GAASvsG,UAAUvE,YAAc8wG,GAC1BA,EACX,sCCTO,SAAStG,EAAaphG,EAAMsF,GAC/B,OAAOtF,EAAK8M,OAAO,CAAC5D,GAAQ9K,GAAKE,KAAQ4K,GAAO9K,IAAOkH,EAAOhH,GAAK4K,IAAS,CAAC,EACjF,gFCDA,IAAIqB,EAAU,KACP,SAAS8xF,EAAarlD,IACzB,GAAIhM,SAAO+zD,sCAAuC,CAC9C,MAAM6I,GAAUr9F,EAKhB,GAJIq9F,IACAr9F,EAAU,CAAEs9F,aAAa,EAAOtiF,MAAO,OAE3CyxB,KACI4wD,EAAQ,CACR,MAAQC,eAAatiF,UAAUhb,EAE/B,GADAA,EAAU,KACNs9F,GACA,MAAMtiF,EAEd,CACJ,MAEIyxB,IAER,CACO,SAASgoD,GAAa7hF,IACrB6tB,SAAO+zD,uCAAyCx0F,IAChDA,EAAQs9F,aAAc,EACtBt9F,EAAQgb,MAAQpI,GAExB,qBC1BO,SAASokF,EAAgBuG,EAAoBxH,EAAWyH,GAAMxjE,GAAQ,EAAGqf,GAAS,GACrF,MAAMokD,GAAuB1H,EAAUqB,SAAS,WAC5CoG,KACInkD,EACAkkD,EAAmB1pF,IAAIvnB,KAAK8qG,SAAS,KAAMp9D,KAG3C1tC,KAAKy2C,aAEb,EAAG/I,IAEH,GADAujE,EAAmB1pF,IAAI4pF,KAClBpkD,EACD,OAAOokD,EAEf,sCCdO,SAASlH,EAAS91C,GACrB,OAAOA,CACX,wDCFO,MAAMq3C,EAAgBr3C,GAAMA,GAAyB,iBAAbA,EAAEztD,QAAoC,mBAANytD,sDCCxE,SAASy3C,EAAgBvoG,GAC5B,OAAO4nG,OAAOC,kBAAiB7F,KAAqDhiG,IAAI4nG,OAAOC,eACnG,qBCHO,SAAS7F,EAAWh7F,GACvB,MAAwB,mBAAVA,CAClB,kFCAO,SAASghG,EAAoBnhG,IAChC,SAAOm7F,KAAWn7F,GAAM47F,KAC5B,iECFO,SAAS+F,EAAW3hG,IACvB,SAAOm7F,KAAyDn7F,KAAM6hG,KAC1E,sDCHO,SAASL,EAAUrhG,GACtB,SAAOg7F,KAAyDh7F,GAAM7E,KAC1E,0ECDO,SAAS2mG,EAAmCW,IAC/C,SAAOsE,MAAiBpxG,KAAMi/B,UAAW,YACrC,MAAMoyE,GAASvE,GAAewE,YAC9B,IACI,OAAa,CACT,MAAQjnG,SAAO8gG,eAAS,EAAMoG,MAAQF,GAAOG,QAC7C,GAAIrG,GACA,aAAO,EAAMoG,WAAQ,eAEnB,EAAMA,MAAQlnG,GACxB,CACJ,SAEIgnG,GAAOI,aACX,CACJ,EACJ,CACO,SAASxF,GAAqB5oG,IACjC,SAAOgiG,KAAqDhiG,IAAIiuG,UACpE,8DCpBO,SAASI,EAAQxmG,IACpB,SAAOm6F,KAA2Dn6F,IAAO45F,KAC7E,CACO,SAAS8F,EAAQ92F,IACpB,OAAQ5I,KACJ,GAAIwmG,EAAQxmG,IACR,OAAOA,GAAO45F,KAAK,SAAU6M,GACzB,IACI,OAAO79F,GAAK69F,EAAc3xG,KAC9B,OACOsmB,IACHtmB,KAAK0uB,MAAMpI,GACf,CACJ,GAEJ,MAAM,IAAIoxD,UAAU,yCAAwC,CAEpE,uDCjBA,MAAQ5wE,WAAYD,MAIb,SAAS2jG,GAAiBvkF,IAC7B,SAAO9d,KAAIyB,GAJf,SAASgoG,EAAY3rF,GAAIrc,GACrB,OAAO9C,EAAQ8C,GAAQqc,MAAMrc,GAAQqc,GAAGrc,EAC5C,CAEuBgoG,CAAY3rF,GAAIrc,GACvC,qBCPO,SAAS4+F,IAAS,+ECClB,SAAS/zD,KAAQo9D,IACpB,OAAO7L,EAAc6L,GACzB,CACO,SAAS7L,EAAc6L,IAC1B,OAAmB,IAAfA,GAAInrG,OACGujG,IAEQ,IAAf4H,GAAInrG,OACGmrG,GAAI,GAER,SAAe3nG,GAClB,OAAO2nG,GAAI57F,OAAO,CAACskC,GAAMt0B,KAAOA,GAAGs0B,IAAOrwC,EAC9C,CACJ,iECZO,SAASk+F,EAAqB9hF,IACjCiiF,IAAgBlpE,WAAW,KACvB,MAAQkqE,qBAAqBp1D,SAC7B,IAAIo1D,GAIA,MAAMjjF,GAHNijF,GAAiBjjF,GAGXA,EAGlB,qBCZO,SAAS8lF,EAAiCliG,GAC7C,OAAO,IAAIwtE,UAAW,gBAAyB,OAAVxtE,GAAmC,iBAAVA,EAAqB,oBAAuB,IAAGA,+HACjH,0PCOA,IAAI4nG,EAAO,KACX,SAASC,IACL,OAAOD,CACX,CACA,SAASE,GAAkBC,GAClBH,IACDA,EAAOG,EAEf,CAQA,MAAMC,IAUN,MAAMC,EAAW,IAAIC,MAAe,iBAEpC,IAsBMC,GAAgB,MAAtB,MAAMA,EACFC,UAAUC,GACN,MAAM,IAAI3tG,MAAM,kBACpB,CAACzE,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFiyG,EAAgB,EAAoDlyG,SACtKH,KAAKg0C,WADmF/yC,MAAE,CAAAgzC,MACYo+D,EAAgBtvG,QAAA,kBAAsC,EAAMyvG,OAAOC,GAAwB,EAAAxvG,WAA7D,aAChJ,OANKovG,CAAgB,KAiBtB,MAAMK,GAAuB,IAAIN,MAAe,wBAChD,IAOMK,GAAuB,MAA7B,MAAMA,UAAgCJ,GAClCtyG,cACIu2B,QACAt2B,KAAK2yG,QAAOH,OAAOL,GACnBnyG,KAAK4yG,UAAYlvG,OAAOwvB,SACxBlzB,KAAK6yG,SAAWnvG,OAAOgvB,OAC3B,CACAogF,qBACI,OAAOf,IAASgB,YAAY/yG,KAAK2yG,KACrC,CACAK,WAAW/sF,GACP,MAAMviB,EAASquG,IAASkB,qBAAqBjzG,KAAK2yG,KAAM,UACxDjvG,SAAOg8B,iBAAiB,WAAYzZ,GAAI,GACjC,IAAMviB,EAAOouC,oBAAoB,WAAY7rB,EACxD,CACAitF,aAAajtF,GACT,MAAMviB,EAASquG,IAASkB,qBAAqBjzG,KAAK2yG,KAAM,UACxDjvG,SAAOg8B,iBAAiB,aAAczZ,GAAI,GACnC,IAAMviB,EAAOouC,oBAAoB,aAAc7rB,EAC1D,CACA,QAAIkN,GACA,OAAOnzB,KAAK4yG,UAAUz/E,IAC1B,CACA,YAAItD,GACA,OAAO7vB,KAAK4yG,UAAU/iF,QAC1B,CACA,YAAIsjF,GACA,OAAOnzG,KAAK4yG,UAAUO,QAC1B,CACA,QAAIxjF,GACA,OAAO3vB,KAAK4yG,UAAUjjF,IAC1B,CACA,YAAIg4B,GACA,OAAO3nD,KAAK4yG,UAAUjrD,QAC1B,CACA,UAAI7iB,GACA,OAAO9kC,KAAK4yG,UAAU9tE,MAC1B,CACA,QAAIC,GACA,OAAO/kC,KAAK4yG,UAAU7tE,IAC1B,CACA,YAAI4iB,CAASyrD,GACTpzG,KAAK4yG,UAAUjrD,SAAWyrD,CAC9B,CACAzgF,UAAU9f,EAAOipF,EAAO3yE,GACpBnpB,KAAK6yG,SAASlgF,UAAU9f,EAAOipF,EAAO3yE,EAC1C,CACAyJ,aAAa/f,EAAOipF,EAAO3yE,GACvBnpB,KAAK6yG,SAASjgF,aAAa/f,EAAOipF,EAAO3yE,EAC7C,CACAkqF,UACIrzG,KAAK6yG,SAASQ,SAClB,CACAC,OACItzG,KAAK6yG,SAASS,MAClB,CACAhB,UAAUC,EAAmB,GACzBvyG,KAAK6yG,SAASU,GAAGhB,EACrB,CACAiB,WACI,OAAOxzG,KAAK6yG,SAAShgG,KACzB,CAAC1S,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFqyG,EAAuB,EAAoDtyG,SAC7KH,KAAKg0C,WApFmF/yC,MAAE,CAAAgzC,MAoFYw+D,EAAuB1vG,QAAA,kBAA4C,IAAI0vG,CAAyB,EAAAxvG,WAA3D,aACvJ,OAhEKwvG,CAAuB,KAkF7B,SAASgB,GAAclwD,EAAO/3B,GAC1B,GAAoB,GAAhB+3B,EAAM78C,OACN,OAAO8kB,EAEX,GAAkB,GAAdA,EAAI9kB,OACJ,OAAO68C,EAEX,IAAImwD,EAAU,EAOd,OANInwD,EAAM2C,SAAS,MACfwtD,IAEAloF,EAAItD,WAAW,MACfwrF,IAEW,GAAXA,EACOnwD,EAAQ/3B,EAAIlU,UAAU,GAElB,GAAXo8F,EACOnwD,EAAQ/3B,EAEZ+3B,EAAQ,IAAM/3B,CACzB,CAUA,SAASmoF,GAAmBxqF,GACxB,MAAM9D,EAAQ8D,EAAI9D,MAAM,UAClBuuF,EAAavuF,GAASA,EAAM/R,OAAS6V,EAAIziB,OAE/C,OAAOyiB,EAAInf,MAAM,EADO4pG,GAAsC,MAAxBzqF,EAAIyqF,EAAa,GAAa,EAAI,IACjCzqF,EAAInf,MAAM4pG,EACrD,CAQA,SAASC,GAAqB11E,GAC1B,OAAOA,GAAwB,MAAdA,EAAO,GAAa,IAAMA,EAASA,CACxD,CAEA,IAiBM21E,GAAgB,MAAtB,MAAMA,EACFxB,UAAUC,GACN,MAAM,IAAI3tG,MAAM,kBACpB,CAACzE,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF0zG,EAAgB,EAAoD3zG,SACtKH,KAAKg0C,WA7KmF/yC,MAAE,CAAAgzC,MA6KY6/D,EAAgB/wG,QAAA,kBAAkC,EAAMyvG,OAAOuB,GAAqB,EAAA9wG,WAAtD,SAChJ,OANK6wG,CAAgB,KAkCtB,MAAME,GAAgB,IAAI5B,MAAe,eACzC,IA+BM2B,GAAoB,MAA1B,MAAMA,UAA6BD,GAC/B/zG,YAAYk0G,EAAmB9gF,GAC3BmD,QACAt2B,KAAKi0G,kBAAoBA,EACzBj0G,KAAKk0G,mBAAqB,GAC1Bl0G,KAAKm0G,UAAYhhF,GAAQnzB,KAAKi0G,kBAAkBnB,uBAAmB,EAC/DN,OAAOL,GAAUj/E,UAAUjb,QAAU,EAC7C,CAEAu+B,cACI,KAAOx2C,KAAKk0G,mBAAmBxtG,QAC3B1G,KAAKk0G,mBAAmBryF,KAAxB7hB,EAER,CACAgzG,WAAW/sF,GACPjmB,KAAKk0G,mBAAmBjtG,KAAKjH,KAAKi0G,kBAAkBjB,WAAW/sF,GAAKjmB,KAAKi0G,kBAAkBf,aAAajtF,GAC5G,CACA8sF,cACI,OAAO/yG,KAAKm0G,SAChB,CACAC,mBAAmBC,GACf,OAAOZ,GAAczzG,KAAKm0G,UAAWE,EACzC,CACA5kF,KAAK6kF,GAAc,GACf,MAAM3sD,EAAW3nD,KAAKi0G,kBAAkBtsD,SAAWksD,GAAqB7zG,KAAKi0G,kBAAkBnvE,QACzFC,EAAO/kC,KAAKi0G,kBAAkBlvE,KACpC,OAAOA,GAAQuvE,EAAe,GAAE3sD,IAAW5iB,IAAS4iB,CACxD,CACAh1B,UAAU9f,EAAOipF,EAAO3yE,EAAKorF,GACzB,MAAMC,GAAcx0G,KAAKo0G,mBAAmBjrF,EAAM0qF,GAAqBU,IACvEv0G,KAAKi0G,kBAAkBthF,UAAU9f,EAAOipF,EAAO0Y,GACnD,CACA5hF,aAAa/f,EAAOipF,EAAO3yE,EAAKorF,GAC5B,MAAMC,GAAcx0G,KAAKo0G,mBAAmBjrF,EAAM0qF,GAAqBU,IACvEv0G,KAAKi0G,kBAAkBrhF,aAAa/f,EAAOipF,EAAO0Y,GACtD,CACAnB,UACIrzG,KAAKi0G,kBAAkBZ,SAC3B,CACAC,OACItzG,KAAKi0G,kBAAkBX,MAC3B,CACAE,WACI,OAAOxzG,KAAKi0G,kBAAkBT,UAClC,CACAlB,UAAUC,EAAmB,GACzBvyG,KAAKi0G,kBAAkB3B,YAAYC,EACvC,CAACpyG,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF2zG,GA1RV9yG,MA0RgDoxG,IA1RhDpxG,MA0R6E+yG,GAAa,KAA6D7zG,SAC/OH,KAAKg0C,WA3RmF/yC,MAAE,CAAAgzC,MA2RY8/D,EAAoBhxG,QAApBgxG,EAAoB/wG,UAAAC,WAAc,SACpJ,OAlDK8wG,CAAoB,KA+EpBU,GAAoB,MAA1B,MAAMA,UAA6BX,GAC/B/zG,YAAYk0G,EAAmBE,GAC3B79E,QACAt2B,KAAKi0G,kBAAoBA,EACzBj0G,KAAKm0G,UAAY,GACjBn0G,KAAKk0G,mBAAqB,GACT,MAAbC,IACAn0G,KAAKm0G,UAAYA,EAEzB,CAEA39D,cACI,KAAOx2C,KAAKk0G,mBAAmBxtG,QAC3B1G,KAAKk0G,mBAAmBryF,KAAxB7hB,EAER,CACAgzG,WAAW/sF,GACPjmB,KAAKk0G,mBAAmBjtG,KAAKjH,KAAKi0G,kBAAkBjB,WAAW/sF,GAAKjmB,KAAKi0G,kBAAkBf,aAAajtF,GAC5G,CACA8sF,cACI,OAAO/yG,KAAKm0G,SAChB,CACA1kF,KAAK6kF,GAAc,GAGf,IAAI7kF,EAAOzvB,KAAKi0G,kBAAkBlvE,KAClC,OAAY,MAARtV,IACAA,EAAO,KACJA,EAAK/oB,OAAS,EAAI+oB,EAAKnY,UAAU,GAAKmY,CACjD,CACA2kF,mBAAmBC,GACf,MAAMlrF,EAAMsqF,GAAczzG,KAAKm0G,UAAWE,GAC1C,OAAOlrF,EAAIziB,OAAS,EAAK,IAAMyiB,EAAOA,CAC1C,CACAwJ,UAAU9f,EAAOipF,EAAOrsE,EAAM8kF,GAC1B,IAAIprF,GAAMnpB,KAAKo0G,mBAAmB3kF,EAAOokF,GAAqBU,IAC5C,GAAdprF,GAAIziB,SACJyiB,GAAMnpB,KAAKi0G,kBAAkBtsD,UAEjC3nD,KAAKi0G,kBAAkBthF,UAAU9f,EAAOipF,EAAO3yE,GACnD,CACAyJ,aAAa/f,EAAOipF,EAAOrsE,EAAM8kF,GAC7B,IAAIprF,GAAMnpB,KAAKo0G,mBAAmB3kF,EAAOokF,GAAqBU,IAC5C,GAAdprF,GAAIziB,SACJyiB,GAAMnpB,KAAKi0G,kBAAkBtsD,UAEjC3nD,KAAKi0G,kBAAkBrhF,aAAa/f,EAAOipF,EAAO3yE,GACtD,CACAkqF,UACIrzG,KAAKi0G,kBAAkBZ,SAC3B,CACAC,OACItzG,KAAKi0G,kBAAkBX,MAC3B,CACAE,WACI,OAAOxzG,KAAKi0G,kBAAkBT,UAClC,CACAlB,UAAUC,EAAmB,GACzBvyG,KAAKi0G,kBAAkB3B,YAAYC,EACvC,CAACpyG,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFq0G,GArXVxzG,MAqXgDoxG,IArXhDpxG,MAqX6E+yG,GAAa,KAA6D7zG,SAC/OH,KAAKg0C,WAtXmF/yC,MAAE,CAAAgzC,MAsXYwgE,EAAoB1xG,QAApB0xG,EAAoBzxG,YACtI,OA9DKyxG,CAAoB,KAoGpBC,GAAQ,MAAd,MAAMA,EACF30G,YAAY40G,GAER30G,KAAK40G,SAAW,IAAIC,MAEpB70G,KAAK80G,oBAAsB,GAE3B90G,KAAK+0G,uBAAyB,KAC9B/0G,KAAKg1G,kBAAoBL,EACzB,MAAMM,EAAWj1G,KAAKg1G,kBAAkBjC,cAOxC/yG,KAAKk1G,UA+Nb,SAASC,GAAaF,GAOlB,GADuB,IAAI/9F,OAAO,iBAAkBnM,KAAKkqG,GACtC,CACf,MAAM,CAAGttD,GAAYstD,EAAS1sG,MAAM,cACpC,OAAOo/C,CACX,CACA,OAAOstD,CACX,CA3OyBE,CAAaxB,GAAmByB,GAAgBH,KACjEj1G,KAAKg1G,kBAAkBhC,WAAYjqE,IAC/B/oC,KAAK40G,SAASt7F,KAAK,CACf6P,IAAOnpB,KAAKyvB,MAAK,GACjB5N,KAAO,EACPhP,MAASk2B,EAAGl2B,MACZzG,KAAQ28B,EAAG38B,MACd,EAET,CAEAoqC,cACIx2C,KAAK+0G,wBAAwBt+D,cAC7Bz2C,KAAK80G,oBAAsB,EAC/B,CAUArlF,KAAK6kF,GAAc,GACf,OAAOt0G,KAAKkmB,UAAUlmB,KAAKg1G,kBAAkBvlF,KAAK6kF,GACtD,CAKAd,WACI,OAAOxzG,KAAKg1G,kBAAkBxB,UAClC,CAUA6B,qBAAqB5lF,EAAMmV,EAAQ,IAC/B,OAAO5kC,KAAKyvB,QAAUzvB,KAAKkmB,UAAUuJ,EAAOokF,GAAqBjvE,GACrE,CAQA1e,UAAUiD,GACN,OAAOurF,EAASf,mBA4JxB,SAAS2B,GAAeC,EAAUpsF,GAC9B,IAAKosF,IAAapsF,EAAIjB,WAAWqtF,GAC7B,OAAOpsF,EAEX,MAAM0rB,EAAc1rB,EAAI7R,UAAUi+F,EAAS7uG,QAC3C,MAAoB,KAAhBmuC,GAAsB,CAAC,IAAK,IAAK,IAAK,KAAK7pC,SAAS6pC,EAAY,IACzDA,EAEJ1rB,CACX,CArK2CmsF,CAAet1G,KAAKk1G,UAAWE,GAAgBjsF,IACtF,CAWAirF,mBAAmBjrF,GACf,OAAIA,GAAkB,MAAXA,EAAI,KACXA,EAAM,IAAMA,GAETnpB,KAAKg1G,kBAAkBZ,mBAAmBjrF,EACrD,CAWAoqF,GAAG9jF,EAAMmV,EAAQ,GAAI/xB,EAAQ,MACzB7S,KAAKg1G,kBAAkBriF,UAAU9f,EAAO,GAAI4c,EAAMmV,GAClD5kC,KAAKw1G,0BAA0Bx1G,KAAKo0G,mBAAmB3kF,EAAOokF,GAAqBjvE,IAAS/xB,EAChG,CASA+f,aAAanD,EAAMmV,EAAQ,GAAI/xB,EAAQ,MACnC7S,KAAKg1G,kBAAkBpiF,aAAa/f,EAAO,GAAI4c,EAAMmV,GACrD5kC,KAAKw1G,0BAA0Bx1G,KAAKo0G,mBAAmB3kF,EAAOokF,GAAqBjvE,IAAS/xB,EAChG,CAIAwgG,UACIrzG,KAAKg1G,kBAAkB3B,SAC3B,CAIAC,OACItzG,KAAKg1G,kBAAkB1B,MAC3B,CAaAhB,UAAUC,EAAmB,GACzBvyG,KAAKg1G,kBAAkB1C,YAAYC,EACvC,CAQAkD,YAAYxvF,GACR,OAAAjmB,KAAK80G,oBAAoB7tG,KAAKgf,GACzBjmB,KAAK+0G,yBACN/0G,KAAK+0G,uBAAyB/0G,KAAKu2C,UAAU2yB,IACzClpE,KAAKw1G,0BAA0BtsC,EAAE//C,IAAK+/C,EAAEr2D,MAAK,IAG9C,KACH,MAAM6iG,EAAU11G,KAAK80G,oBAAoBpoF,QAAQzG,GACjDjmB,KAAK80G,oBAAoBptF,OAAOguF,EAAS,GACD,IAApC11G,KAAK80G,oBAAoBpuG,SACzB1G,KAAK+0G,wBAAwBt+D,cAC7Bz2C,KAAK+0G,uBAAyB,MAG1C,CAEAS,0BAA0BrsF,EAAM,GAAItW,GAChC7S,KAAK80G,oBAAoB1sG,QAAQ6d,GAAMA,EAAGkD,EAAKtW,GACnD,CAcA0jC,UAAUm3D,EAAQiI,EAASC,GACvB,OAAO51G,KAAK40G,SAASr+D,UAAU,CAAEliB,KAAMq5E,EAAQh/E,MAAOinF,EAASpgD,SAAUqgD,GAC7E,CACAz1G,SAOSH,KAAK6zG,qBAAuBA,GACrC1zG,SASSH,KAAKyzG,cAAgBA,GAC9BtzG,SASSH,KAAK2zG,mBAAqBA,GAAkBxzG,SAC5CH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFs0G,GAjnBVzzG,MAinBoC6yG,IAAgB,EAA6C3zG,SACzLH,KAAKg0C,WAlnBmF/yC,MAAE,CAAAgzC,MAknBYygE,EAAQ3xG,QAAA,kBAU3H,SAAS8yG,KACL,OAAO,IAAInB,MAASoB,OAAShC,IACjC,CAZ6J+B,EAAc,EAAA5yG,WAAlC,SACxI,OAtNKyxG,CAAQ,KA4Od,SAASU,GAAgBjsF,GACrB,OAAOA,EAAIlb,QAAQ,gBAAiB,GACxC,CAyzDA,SAAS8nG,GAAiBC,EAAWjyG,GACjCA,EAAOwS,mBAAmBxS,GAC1B,UAAWkyG,KAAUD,EAAUztG,MAAM,KAAM,CACvC,MAAM2tG,EAAUD,EAAOvpF,QAAQ,MACxBypF,EAAYC,IAA0B,GAAXF,EAAgB,CAACD,EAAQ,IAAM,CAACA,EAAOjsG,MAAM,EAAGksG,GAAUD,EAAOjsG,MAAMksG,EAAU,IACnH,GAAIC,EAAWn/F,SAAWjT,EACtB,OAAOgT,mBAAmBq/F,EAElC,CACA,OAAO,IACX,CAEA,MAAMC,GAAY,MACZC,GAAc,GACpB,IA4BMC,GAAO,MAAb,MAAMA,EACFx2G,YAEAy2G,EAAkBC,EAAkBC,EAAOC,GACvC32G,KAAKw2G,iBAAmBA,EACxBx2G,KAAKy2G,iBAAmBA,EACxBz2G,KAAK02G,MAAQA,EACb12G,KAAK22G,UAAYA,EACjB32G,KAAK42G,eAAiBN,GACtBt2G,KAAK62G,SAAW,IAAI3pG,GACxB,CACA,SAAI4pG,CAAMzsG,GACNrK,KAAK42G,eAA0B,MAATvsG,EAAgBA,EAAM2M,OAAOzO,MAAM8tG,IAAaC,EAC1E,CACA,WAAIS,CAAQ1sG,GACRrK,KAAKg3G,SAA4B,iBAAV3sG,EAAqBA,EAAM2M,OAAOzO,MAAM8tG,IAAahsG,CAChF,CA0BA4sG,YAEI,UAAWH,KAAS92G,KAAK42G,eACrB52G,KAAKk3G,aAAaJ,GAAO,GAG7B,MAAME,EAAWh3G,KAAKg3G,SACtB,GAAInwG,MAAMC,QAAQkwG,IAAaA,aAAoB50C,IAC/C,UAAW00C,KAASE,EAChBh3G,KAAKk3G,aAAaJ,GAAO,QAAI,GAGhB,MAAZE,EACL,UAAWF,KAASzyG,OAAO8E,KAAK6tG,GAC5Bh3G,KAAKk3G,aAAaJ,IAAeE,EAASF,IAGlD92G,KAAKm3G,iBACT,CACAD,aAAaJ,EAAOM,GAChB,MAAMvkG,EAAQ7S,KAAK62G,SAAStpG,IAAIupG,QAClBvzG,IAAVsP,GACIA,EAAMrJ,UAAY4tG,IAClBvkG,EAAMwkG,SAAU,EAChBxkG,EAAMrJ,QAAU4tG,GAEpBvkG,EAAMykG,SAAU,GAGhBt3G,KAAK62G,SAASppG,IAAIqpG,EAAO,CAAEttG,QAAS4tG,EAAaC,SAAS,EAAMC,SAAS,GAEjF,CACAH,kBACI,UAAWI,KAAcv3G,KAAK62G,SAAU,CACpC,MAAMC,EAAQS,EAAW,GACnB1kG,EAAQ0kG,EAAW,GACrB1kG,EAAMwkG,SACNr3G,KAAKw3G,aAAaV,EAAOjkG,EAAMrJ,SAC/BqJ,EAAMwkG,SAAU,GAEVxkG,EAAMykG,UAGRzkG,EAAMrJ,SACNxJ,KAAKw3G,aAAaV,GAAO,GAE7B92G,KAAK62G,SAASpvF,OAAOqvF,IAEzBjkG,EAAMykG,SAAU,CACpB,CACJ,CACAE,aAAaV,EAAOttG,IAMhBstG,EAAQA,EAAM9/F,QACJtQ,OAAS,GACfowG,EAAMvuG,MAAM8tG,IAAWjuG,QAAQ0uG,IACvBttG,EACAxJ,KAAK22G,UAAUc,SAASz3G,KAAK02G,MAAMgB,cAAeZ,GAGlD92G,KAAK22G,UAAUgB,YAAY33G,KAAK02G,MAAMgB,cAAeZ,EAAK,EAI1E,CAAC32G,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFm2G,GA7lFVt1G,MA6lFmCA,OA7lFnCA,MA6lFkEA,OA7lFlEA,MA6lFiGA,OA7lFjGA,MA6lF2HA,OAAY,EAA4Cd,SAC3QH,KAAK43G,UA9lFmF32G,MAAE,CAAAmL,KA8lFJmqG,EAAOh2G,UAAA,oBAAAC,OAAA,CAAAs2G,MAAA,kBAAAC,QAAA,WAAAc,YAAA,IACzG,OAjHKtB,CAAO,KA0Tb,MAAMuB,GACF/3G,YAAYg4G,EAAWC,EAAS1kG,EAAOq9D,GACnC3wE,KAAK+3G,UAAYA,EACjB/3G,KAAKg4G,QAAUA,EACfh4G,KAAKsT,MAAQA,EACbtT,KAAK2wE,MAAQA,CACjB,CACA,SAAIwV,GACA,OAAsB,IAAfnmF,KAAKsT,KAChB,CACA,QAAI8yE,GACA,OAAOpmF,KAAKsT,QAAUtT,KAAK2wE,MAAQ,CACvC,CACA,QAAIsnC,GACA,OAAOj4G,KAAKsT,MAAQ,GAAM,CAC9B,CACA,OAAI4kG,GACA,OAAQl4G,KAAKi4G,IACjB,EAEJ,IAkGME,GAAO,MAAb,MAAMA,EAKF,WAAIH,CAAQA,GACRh4G,KAAKo4G,SAAWJ,EAChBh4G,KAAKq4G,eAAgB,CACzB,CAmBA,gBAAIC,CAAaryF,GAKbjmB,KAAKu4G,WAAatyF,CACtB,CACA,gBAAIqyF,GACA,OAAOt4G,KAAKu4G,UAChB,CACAx4G,YAAYy4G,EAAgBC,EAAWC,GACnC14G,KAAKw4G,eAAiBA,EACtBx4G,KAAKy4G,UAAYA,EACjBz4G,KAAK04G,SAAWA,EAChB14G,KAAKo4G,SAAW,KAChBp4G,KAAKq4G,eAAgB,EACrBr4G,KAAK24G,QAAU,IACnB,CAKA,iBAAIC,CAAcvuG,GAIVA,IACArK,KAAKy4G,UAAYpuG,EAEzB,CAKA4sG,YACI,GAAIj3G,KAAKq4G,cAAe,CACpBr4G,KAAKq4G,eAAgB,EAErB,MAAMhuG,EAAQrK,KAAKo4G,UACdp4G,KAAK24G,SAAWtuG,IAmBbrK,KAAK24G,QAAU34G,KAAK04G,SAASpoF,KAAKjmB,GAAO67F,OAAOlmG,KAAKs4G,cAGjE,CACA,GAAIt4G,KAAK24G,QAAS,CACd,MAAME,EAAU74G,KAAK24G,QAAQG,KAAK94G,KAAKo4G,UACnCS,GACA74G,KAAK+4G,cAAcF,EAC3B,CACJ,CACAE,cAAcF,GACV,MAAMG,EAAgBh5G,KAAKw4G,eAC3BK,EAAQI,iBAAiB,CAACvrG,EAAMwrG,EAAuB7iG,MACnD,GAA0B,MAAtB3I,EAAKyrG,cAILH,EAAcI,mBAAmBp5G,KAAKy4G,UAAW,IAAIX,GAAepqG,EAAKA,KAAM1N,KAAKo4G,UAAU,GAAI,GAAsB,OAAjB/hG,QAAwB9S,EAAY8S,SAAY,GAElI,MAAhBA,GACL2iG,EAAc9qE,OAAiC,OAA1BgrE,OAAiC31G,EAAY21G,QAAqB,GAExD,OAA1BA,EAAgC,CACrC,MAAMG,GAAOL,EAAczrG,IAAI2rG,GAC/BF,EAAcM,KAAKD,GAAMhjG,IACzBkjG,GAAgBF,GAAM3rG,EAC1B,IAEJ,QAASjG,EAAI,EAAG+xG,EAAOR,EAActyG,OAAQe,EAAI+xG,EAAM/xG,IAAK,CAExD,MAAMiM,GADUslG,EAAczrG,IAAI9F,GACViM,QACxBA,GAAQJ,MAAQ7L,EAChBiM,GAAQi9D,MAAQ6oC,EAChB9lG,GAAQskG,QAAUh4G,KAAKo4G,QAC3B,CACAS,EAAQY,sBAAuBxjC,IAE3BsjC,GADgBP,EAAczrG,IAAI0oE,EAAO5/D,cAChB4/D,EAAM,EAEvC,CAOA,6BAAOyjC,CAAuBC,EAAK34G,GAC/B,OAAO,CACX,CAACb,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF+3G,GApiGVl3G,MAoiGmCA,OApiGnCA,MAoiGmEA,OApiGnEA,MAoiG8FA,OAAkB,EAA4Cd,SACpPH,KAAK43G,UAriGmF32G,MAAE,CAAAmL,KAqiGJ+rG,EAAO53G,UAAA,+BAAAC,OAAA,CAAAw3G,QAAA,UAAAM,aAAA,eAAAM,cAAA,iBAAAf,YAAA,IACzG,OAxIKM,CAAO,KAsJb,SAASoB,GAAgBF,EAAMpjC,GAC3BojC,EAAK3lG,QAAQqkG,UAAY9hC,EAAOvoE,IACpC,CAKA,IA2IMksG,GAAI,MAAV,MAAMA,EACF75G,YAAYy4G,EAAgBqB,GACxB75G,KAAKw4G,eAAiBA,EACtBx4G,KAAKyyF,SAAW,IAAIqnB,GACpB95G,KAAK+5G,iBAAmB,KACxB/5G,KAAKg6G,iBAAmB,KACxBh6G,KAAKi6G,aAAe,KACpBj6G,KAAKk6G,aAAe,KACpBl6G,KAAK+5G,iBAAmBF,CAC5B,CAIA,QAAIM,CAAKC,GACLp6G,KAAKyyF,SAASslB,UAAY/3G,KAAKyyF,SAAS0nB,KAAOC,EAC/Cp6G,KAAKq6G,aACT,CAIA,YAAIC,CAAST,GACTU,GAAe,WAAYV,GAC3B75G,KAAK+5G,iBAAmBF,EACxB75G,KAAKi6G,aAAe,KACpBj6G,KAAKq6G,aACT,CAIA,YAAIG,CAASX,GACTU,GAAe,WAAYV,GAC3B75G,KAAKg6G,iBAAmBH,EACxB75G,KAAKk6G,aAAe,KACpBl6G,KAAKq6G,aACT,CACAA,cACQr6G,KAAKyyF,SAASslB,UACT/3G,KAAKi6G,eACNj6G,KAAKw4G,eAAex5F,QACpBhf,KAAKk6G,aAAe,KAChBl6G,KAAK+5G,mBACL/5G,KAAKi6G,aACDj6G,KAAKw4G,eAAeY,mBAAmBp5G,KAAK+5G,iBAAkB/5G,KAAKyyF,YAK1EzyF,KAAKk6G,eACNl6G,KAAKw4G,eAAex5F,QACpBhf,KAAKi6G,aAAe,KAChBj6G,KAAKg6G,mBACLh6G,KAAKk6G,aACDl6G,KAAKw4G,eAAeY,mBAAmBp5G,KAAKg6G,iBAAkBh6G,KAAKyyF,WAIvF,CAOA,6BAAOinB,CAAuBC,EAAK34G,GAC/B,OAAO,CACX,CAACb,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFw5G,GAxwGV34G,MAwwGgCA,OAxwGhCA,MAwwGgEA,OAAc,EAA4Cd,SAClNH,KAAK43G,UAzwGmF32G,MAAE,CAAAmL,KAywGJwtG,EAAIr5G,UAAA,iBAAAC,OAAA,CAAA25G,KAAA,OAAAG,SAAA,WAAAE,SAAA,YAAA3C,YAAA,IACtG,OApEK+B,CAAI,KAqFV,MAAME,GACF/5G,cACIC,KAAK+3G,UAAY,KACjB/3G,KAAKm6G,KAAO,IAChB,EAEJ,SAASI,GAAe1tG,EAAUgtG,GAE9B,GADgCA,IAAeA,EAAYT,mBAEvD,MAAM,IAAIx0G,MAAO,GAAEiI,2CAAS,EAAwC4tG,OAAWZ,OAEvF,CA2PA,IA+NMa,GAAgB,MAAtB,MAAMA,EACF36G,YAAY46G,GACR36G,KAAK26G,kBAAoBA,EACzB36G,KAAK46G,SAAW,KAOhB56G,KAAK66G,wBAA0B,KAI/B76G,KAAK86G,iBAAmB,KAExB96G,KAAK+6G,yBAA2B,IACpC,CAEAC,YAAYnC,GACR,GAAIA,EAAQiC,kBAAuBjC,EAAQkC,yBAA6B,CACpE,MAAME,EAAmBj7G,KAAK26G,kBAI9B,GAHI36G,KAAK46G,UACLK,EAAiB/sE,OAAO+sE,EAAiBvuF,QAAQ1sB,KAAK46G,WAEtD56G,KAAK86G,iBAAkB,CACvB,MAAQA,iBAAkBh6G,EAAU+5G,wBAAyBnnG,EAASqnG,yBAA0BG,IAAcl7G,KAC9GA,KAAK46G,SACDK,EAAiB7B,mBAAmBt4G,EAAU4S,EAASwnG,GAAW,CAAEA,kBAAa33G,EACzF,MAEIvD,KAAK46G,SAAW,IAExB,MACS56G,KAAK46G,UAAY/B,EAAQgC,yBAA8B76G,KAAK66G,0BACjE76G,KAAK46G,SAASlnG,QAAU1T,KAAK66G,wBAErC,CAAC16G,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFs6G,GAtyHVz5G,MAsyH4CA,OAAmB,EAA4Cd,SACnMH,KAAK43G,UAvyHmF32G,MAAE,CAAAmL,KAuyHJsuG,EAAgBn6G,UAAA,6BAAAC,OAAA,CAAAq6G,wBAAA,0BAAAC,iBAAA,mBAAAC,yBAAA,4BAAAlD,YAAA,EAAAsD,SAAA,CAvyHdl6G,SAwyHpG,OAxCKy5G,CAAgB,KA6oChBr5G,GAAY,MAAlB,MAAMA,EAAalB,SACNH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFiB,EAAY,EAAkDlB,SAChKH,KAAKo7G,UA/4JmFn6G,MAAE,CAAAmL,KA+4JS/K,IAA6oBlB,SAChvBH,KAAKq7G,UAh5JmFp6G,MAAE,IAi5JtG,OAJKI,CAAY,KAalB,MAAMi6G,GAAsB,UACtBC,GAAqB,SAc3B,SAASC,GAAiBC,GACtB,OAAOA,IAAeF,EAC1B,CA8BA,IAKMG,GAAgB,MAAtB,MAAMA,EAGFv7G,SACSH,KAAKg0C,cAAQ2nE,OAAmB,CACrC1nE,MAAOynE,EACPz4G,WAAY,OACZF,QAASA,IAAM,IAAI64G,MAAwB9F,OAAS3D,GAAWzuG,UAEtE,OATKg4G,CAAgB,KAatB,MAAME,GACF77G,YAAY+nB,EAAUpkB,GAClB1D,KAAK8nB,SAAWA,EAChB9nB,KAAK0D,OAASA,EACd1D,KAAK80B,OAAS,IAAM,CAAC,EAAG,EAC5B,CAOA+mF,UAAU/mF,GAEF90B,KAAK80B,OADLjuB,MAAMC,QAAQguB,GACA,IAAMA,EAGNA,CAEtB,CAKAgnF,oBACI,OAAI97G,KAAK+7G,oBACE,CAAC/7G,KAAK0D,OAAOy3D,YAAan7D,KAAK0D,OAAO23D,aAGtC,CAAC,EAAG,EAEnB,CAKA2gD,iBAAiBz6C,GACTvhE,KAAK+7G,qBACL/7G,KAAK0D,OAAOu4G,SAAS16C,EAAS,GAAIA,EAAS,GAEnD,CAYA26C,eAAe7vG,GACX,IAAKrM,KAAK+7G,oBACN,OAEJ,MAAMI,EA0Cd,SAASC,GAAuBt0F,EAAUzb,GACtC,MAAMgwG,EAAiBv0F,EAASw0F,eAAejwG,IAAWyb,EAASy0F,kBAAkBlwG,GAAQ,GAC7F,GAAIgwG,EACA,OAAOA,EAIX,GAAyC,mBAA9Bv0F,EAAS00F,kBAAmC10F,EAASqb,MACtB,mBAA/Brb,EAASqb,KAAKs5E,aAA6B,CAClD,MAAMC,EAAa50F,EAAS00F,iBAAiB10F,EAASqb,KAAMw5E,WAAWC,cACvE,IAAIC,EAAcH,EAAWG,YAC7B,KAAOA,GAAa,CAChB,MAAMhzD,EAAagzD,EAAYhzD,WAC/B,GAAIA,EAAY,CAGZ,MAAMx3C,GAASw3C,EAAWyyD,eAAejwG,IAAWw9C,EAAW3B,cAAe,UAAS77C,OACvF,GAAIgG,GACA,OAAOA,EAEf,CACAwqG,EAAcH,EAAWI,UAC7B,CACJ,CACA,OAAO,IACX,CAnE2BV,CAAuBp8G,KAAK8nB,SAAUzb,GACrD8vG,IACAn8G,KAAK+8G,gBAAgBZ,GAOrBA,EAAWa,QAEnB,CAIAC,4BAA4BC,GACpBl9G,KAAK+7G,sBACL/7G,KAAK0D,OAAOgvB,QAAQwqF,kBAAoBA,EAEhD,CAOAH,gBAAgB11G,GACZ,MAAM81G,EAAO91G,EAAG2uD,wBACViF,EAAOkiD,EAAKliD,KAAOj7D,KAAK0D,OAAOy3D,YAC/B75C,EAAM67F,EAAK77F,IAAMthB,KAAK0D,OAAO23D,YAC7BvmC,EAAS90B,KAAK80B,SACpB90B,KAAK0D,OAAOu4G,SAAShhD,EAAOnmC,EAAO,GAAIxT,EAAMwT,EAAO,GACxD,CACAinF,oBACI,IACI,QAAS/7G,KAAK0D,UAAY1D,KAAK0D,OAAOu4G,UAAY,gBAAiBj8G,KAAK0D,MAC5E,OAEI,OAAO,CACX,CACJ,EA6DJ,MAAM05G,iMC9pKN,MAAMC,IAYN,MAAMC,IAUN,MAAMC,GAEFx9G,YAAYszB,GAKRrzB,KAAKw9G,gBAAkB,IAAItwG,IAI3BlN,KAAKy9G,WAAa,KACbpqF,EAGuB,iBAAZA,EACZrzB,KAAK09G,SAAW,KACZ19G,KAAKqzB,QAAU,IAAInmB,IACnBmmB,EAAQ9qB,MAAM,MAAMH,QAAQ+c,IACxB,MAAM7R,GAAQ6R,EAAKuH,QAAQ,KAC3B,GAAIpZ,GAAQ,EAAG,CACX,MAAMvP,GAAOohB,EAAKnb,MAAM,EAAGsJ,IACrB/L,GAAMxD,GAAK+D,cACXuC,GAAQ8a,EAAKnb,MAAMsJ,GAAQ,GAAG0D,OACpChX,KAAK29G,uBAAuB55G,GAAMwD,IAC9BvH,KAAKqzB,QAAQ/L,IAAI/f,IACjBvH,KAAKqzB,QAAQ9lB,IAAIhG,IAAKN,KAAKoD,IAG3BrK,KAAKqzB,QAAQ5lB,IAAIlG,GAAK,CAAC8C,IAE/B,GACH,SAGOmnB,QAAY,KAAe6B,aAAmB7B,SAC1DxxB,KAAKqzB,QAAU,IAAInmB,IACnBmmB,EAAQjrB,QAAQ,CAACqG,EAAQ1K,MACrB/D,KAAK49G,iBAAiB75G,GAAM0K,EAAM,IAItCzO,KAAK09G,SAAW,KAIZ19G,KAAKqzB,QAAU,IAAInmB,IACnB7I,OAAO2R,QAAQqd,GAASjrB,QAAQ,EAAErE,EAAM0K,OACpCzO,KAAK49G,iBAAiB75G,EAAM0K,GAAM,EACrC,EApCLzO,KAAKqzB,QAAU,IAAInmB,GAuC3B,CAQAoa,IAAIvjB,GACA,OAAA/D,KAAK8T,OACE9T,KAAKqzB,QAAQ/L,IAAIvjB,EAAK+D,cACjC,CAQAyF,IAAIxJ,GACA/D,KAAK8T,OACL,MAAMrF,EAASzO,KAAKqzB,QAAQ9lB,IAAIxJ,EAAK+D,eACrC,OAAO2G,GAAUA,EAAO/H,OAAS,EAAI+H,EAAO,GAAK,IACrD,CAMAtF,OACI,OAAAnJ,KAAK8T,OACEjN,MAAM6e,KAAK1lB,KAAKw9G,gBAAgB/uG,SAC3C,CAQAovG,OAAO95G,GACH,OAAA/D,KAAK8T,OACE9T,KAAKqzB,QAAQ9lB,IAAIxJ,EAAK+D,gBAAkB,IACnD,CAUAssB,OAAOrwB,EAAMsG,GACT,OAAOrK,KAAK6c,MAAM,CAAE9Y,OAAMsG,QAAOyN,GAAI,KACzC,CAWArK,IAAI1J,EAAMsG,GACN,OAAOrK,KAAK6c,MAAM,CAAE9Y,OAAMsG,QAAOyN,GAAI,KACzC,CASA2P,OAAO1jB,EAAMsG,GACT,OAAOrK,KAAK6c,MAAM,CAAE9Y,OAAMsG,QAAOyN,GAAI,KACzC,CACA6lG,uBAAuB55G,EAAM+5G,GACpB99G,KAAKw9G,gBAAgBl2F,IAAIw2F,IAC1B99G,KAAKw9G,gBAAgB/vG,IAAIqwG,EAAQ/5G,EAEzC,CACA+P,OACU9T,KAAK09G,WACH19G,KAAK09G,oBAAoBH,GACzBv9G,KAAK+9G,SAAS/9G,KAAK09G,UAGnB19G,KAAK09G,WAET19G,KAAK09G,SAAW,KACV19G,KAAKy9G,aACPz9G,KAAKy9G,WAAWr1G,QAAQyW,GAAU7e,KAAKg+G,YAAYn/F,IACnD7e,KAAKy9G,WAAa,MAG9B,CACAM,SAASE,GACLA,EAAMnqG,OACNjN,MAAM6e,KAAKu4F,EAAM5qF,QAAQlqB,QAAQf,QAAQb,IACrCvH,KAAKqzB,QAAQ5lB,IAAIlG,EAAK02G,EAAM5qF,QAAQ9lB,IAAIhG,IACxCvH,KAAKw9G,gBAAgB/vG,IAAIlG,EAAK02G,EAAMT,gBAAgBjwG,IAAIhG,GAAI,EAEpE,CACAsV,MAAMgC,GACF,MAAMhC,EAAQ,IAAI0gG,GAClB1gG,SAAM6gG,SACC19G,KAAK09G,UAAY19G,KAAK09G,oBAAoBH,GAAev9G,KAAK09G,SAAW19G,KAChF6c,EAAM4gG,YAAcz9G,KAAKy9G,YAAc,IAAIriG,OAAO,CAACyD,IAC5ChC,CACX,CACAmhG,YAAYn/F,GACR,MAAMtX,EAAMsX,EAAO9a,KAAK+D,cACxB,OAAQ+W,EAAO/G,IACX,IAAK,IACL,IAAK,IACD,IAAIzN,GAAQwU,EAAOxU,MAInB,GAHqB,iBAAVA,KACPA,GAAQ,CAACA,KAEQ,IAAjBA,GAAM3D,OACN,OAEJ1G,KAAK29G,uBAAuB9+F,EAAO9a,KAAMwD,GACzC,MAAM7B,IAAsB,MAAdmZ,EAAO/G,GAAa9X,KAAKqzB,QAAQ9lB,IAAIhG,QAAOhE,IAAc,GACxEmC,GAAKuB,QAAQoD,IACbrK,KAAKqzB,QAAQ5lB,IAAIlG,EAAK7B,IACtB,MACJ,IAAK,IACD,MAAMw4G,GAAWr/F,EAAOxU,MACxB,GAAK6zG,GAIA,CACD,IAAIC,GAAWn+G,KAAKqzB,QAAQ9lB,IAAIhG,GAChC,IAAK42G,GACD,OAEJA,GAAWA,GAASn2G,OAAOqC,KAAqC,IAA5B6zG,GAASxxF,QAAQriB,KAC7B,IAApB8zG,GAASz3G,QACT1G,KAAKqzB,QAAQ5L,OAAOlgB,GACpBvH,KAAKw9G,gBAAgB/1F,OAAOlgB,IAG5BvH,KAAKqzB,QAAQ5lB,IAAIlG,EAAK42G,GAE9B,MAhBIn+G,KAAKqzB,QAAQ5L,OAAOlgB,GACpBvH,KAAKw9G,gBAAgB/1F,OAAOlgB,GAkB5C,CACAq2G,iBAAiB75G,EAAM0K,GACnB,MAAM2vG,IAAgBv3G,MAAMC,QAAQ2H,GAAUA,EAAS,CAACA,IAAStG,IAAKkC,IAAUA,GAAM9F,YAChFgD,GAAMxD,EAAK+D,cACjB9H,KAAKqzB,QAAQ5lB,IAAIlG,GAAK62G,IACtBp+G,KAAK29G,uBAAuB55G,EAAMwD,GACtC,CAIAa,QAAQ6d,GACJjmB,KAAK8T,OACLjN,MAAM6e,KAAK1lB,KAAKw9G,gBAAgBr0G,QAC3Bf,QAAQb,GAAO0e,EAAGjmB,KAAKw9G,gBAAgBjwG,IAAIhG,GAAMvH,KAAKqzB,QAAQ9lB,IAAIhG,IAC3E,EA0BJ,MAAM82G,GAMFC,UAAU/2G,GACN,OAAOg3G,GAAiBh3G,EAC5B,CAMAi3G,YAAYn0G,GACR,OAAOk0G,GAAiBl0G,EAC5B,CAMAo0G,UAAUl3G,GACN,OAAOwP,mBAAmBxP,EAC9B,CAMAm3G,YAAYr0G,GACR,OAAO0M,mBAAmB1M,EAC9B,EAwBJ,MAAMs0G,GAA0B,kBAC1BC,GAAiC,CACnC,GAAM,IACN,KAAM,IACN,GAAM,IACN,KAAM,IACN,KAAM,IACN,KAAM,IACN,KAAM,IACN,KAAM,KAEV,SAASL,GAAiBr1C,GACtB,OAAO3yD,mBAAmB2yD,GAAGj7D,QAAQ0wG,GAAyB,CAAC30D,EAAG5pD,IAAMw+G,GAA+Bx+G,IAAM4pD,EACjH,CACA,SAAS60D,GAAcx0G,GACnB,MAAQ,GAAEA,GACd,CASA,MAAMy0G,GACF/+G,YAAYmG,EAAU,CAAC,GAInB,GAHAlG,KAAK++G,QAAU,KACf/+G,KAAKg/G,UAAY,KACjBh/G,KAAKi/G,QAAU/4G,EAAQ+4G,SAAW,IAAIZ,GAChCn4G,EAAQg5G,WAAY,CACtB,GAAMh5G,EAAQi5G,WACV,MAAM,IAAIv6G,MAAO,kDAErB5E,KAAKmI,IAxDjB,SAASi3G,GAAYC,EAAWC,GAC5B,MAAMn3G,EAAM,IAAI+E,IAChB,OAAImyG,EAAU34G,OAAS,GAIJ24G,EAAUpxG,QAAQ,MAAO,IAAI1F,MAAM,KAC3CH,QAAS+nE,KACZ,MAAMovC,GAAQpvC,GAAMzjD,QAAQ,MACrBnlB,GAAKiL,KAAgB,GAAT+sG,GACf,CAACD,EAAMb,UAAUtuC,IAAQ,IACzB,CAACmvC,EAAMb,UAAUtuC,GAAMnmE,MAAM,EAAGu1G,KAASD,EAAMZ,YAAYvuC,GAAMnmE,MAAMu1G,GAAQ,KAC7Ex/D,GAAO53C,EAAIoF,IAAIhG,KAAQ,GAC7Bw4C,GAAK94C,KAAKuL,IACVrK,EAAIsF,IAAIlG,GAAKw4C,GAAI,GAGlB53C,CACX,CAsCuBi3G,CAAYl5G,EAAQg5G,WAAYl/G,KAAKi/G,QACpD,MACW/4G,EAAQi5G,YACfn/G,KAAKmI,IAAM,IAAI+E,IACf7I,OAAO8E,KAAKjD,EAAQi5G,YAAY/2G,QAAQb,IACpC,MAAM8C,GAAQnE,EAAQi5G,WAAW53G,GAE3BkH,GAAS5H,MAAMC,QAAQuD,IAASA,GAAMlC,IAAI02G,IAAiB,CAACA,GAAcx0G,KAChFrK,KAAKmI,IAAIsF,IAAIlG,EAAKkH,GAAM,IAI5BzO,KAAKmI,IAAM,IAEnB,CAOAmf,IAAI6oD,GACA,OAAAnwE,KAAK8T,OACE9T,KAAKmI,IAAImf,IAAI6oD,EACxB,CAOA5iE,IAAI4iE,GACAnwE,KAAK8T,OACL,MAAMkO,EAAMhiB,KAAKmI,IAAIoF,IAAI4iE,GACzB,OAASnuD,EAAMA,EAAI,GAAK,IAC5B,CAOA67F,OAAO1tC,GACH,OAAAnwE,KAAK8T,OACE9T,KAAKmI,IAAIoF,IAAI4iE,IAAU,IAClC,CAKAhnE,OACI,OAAAnJ,KAAK8T,OACEjN,MAAM6e,KAAK1lB,KAAKmI,IAAIgB,OAC/B,CAOAirB,OAAO+7C,EAAO9lE,GACV,OAAOrK,KAAK6c,MAAM,CAAEszD,QAAO9lE,QAAOyN,GAAI,KAC1C,CAMA0nG,UAAUrhF,GACN,MAAM4gF,EAAU,GAChB16G,cAAO8E,KAAKg1B,GAAQ/1B,QAAQ+nE,KACxB,MAAM9lE,GAAQ8zB,EAAOgyC,IACjBtpE,MAAMC,QAAQuD,IACdA,GAAMjC,QAAQ0K,KACVisG,EAAQ93G,KAAK,CAAEkpE,SAAO9lE,MAAOyI,GAAQgF,GAAI,KAAK,GAIlDinG,EAAQ93G,KAAK,CAAEkpE,SAAO9lE,MAAOA,GAAOyN,GAAI,KAAK,GAG9C9X,KAAK6c,MAAMkiG,EACtB,CAOAtxG,IAAI0iE,EAAO9lE,GACP,OAAOrK,KAAK6c,MAAM,CAAEszD,QAAO9lE,QAAOyN,GAAI,KAC1C,CAQA2P,OAAO0oD,EAAO9lE,GACV,OAAOrK,KAAK6c,MAAM,CAAEszD,QAAO9lE,QAAOyN,GAAI,KAC1C,CAKAvT,WACI,OAAAvE,KAAK8T,OACE9T,KAAKmJ,OACPhB,IAAIZ,IACL,MAAMk4G,EAAOz/G,KAAKi/G,QAAQX,UAAU/2G,GAIpC,OAAOvH,KAAKmI,IAAIoF,IAAIhG,GAAKY,IAAIkC,IAASo1G,EAAO,IAAMz/G,KAAKi/G,QAAQT,YAAYn0G,KACvEjD,KAAK,IAAG,GAIZY,OAAOmoE,GAAmB,KAAVA,GAChB/oE,KAAK,IACd,CACAyV,MAAMgC,GACF,MAAMhC,EAAQ,IAAIiiG,GAAW,CAAEG,QAASj/G,KAAKi/G,UAC7CpiG,SAAMmiG,UAAYh/G,KAAKg/G,WAAah/G,KACpC6c,EAAMkiG,SAAW/+G,KAAK++G,SAAW,IAAI3jG,OAAOyD,GACrChC,CACX,CACA/I,OACqB,OAAb9T,KAAKmI,MACLnI,KAAKmI,IAAM,IAAI+E,KAEI,OAAnBlN,KAAKg/G,YACLh/G,KAAKg/G,UAAUlrG,OACf9T,KAAKg/G,UAAU71G,OAAOf,QAAQb,GAAOvH,KAAKmI,IAAIsF,IAAIlG,EAAKvH,KAAKg/G,UAAU72G,IAAIoF,IAAIhG,KAC9EvH,KAAK++G,QAAQ32G,QAAQyW,IACjB,OAAQA,EAAO/G,IACX,IAAK,IACL,IAAK,IACD,MAAMpS,GAAsB,MAAdmZ,EAAO/G,GAAa9X,KAAKmI,IAAIoF,IAAIsR,EAAOsxD,YAAS5sE,IAAc,GAC7EmC,EAAKuB,KAAK43G,GAAchgG,EAAOxU,QAC/BrK,KAAKmI,IAAIsF,IAAIoR,EAAOsxD,MAAOzqE,GAC3B,MACJ,IAAK,IACD,QAAqBnC,IAAjBsb,EAAOxU,MAaN,CACDrK,KAAKmI,IAAIsf,OAAO5I,EAAOsxD,OACvB,KACJ,CAhBgC,CAC5B,IAAIzqE,GAAO1F,KAAKmI,IAAIoF,IAAIsR,EAAOsxD,QAAU,GACzC,MAAMuvC,GAAMh6G,GAAKgnB,QAAQmyF,GAAchgG,EAAOxU,SAClC,IAARq1G,IACAh6G,GAAKgiB,OAAOg4F,GAAK,GAEjBh6G,GAAKgB,OAAS,EACd1G,KAAKmI,IAAIsF,IAAIoR,EAAOsxD,MAAOzqE,IAG3B1F,KAAKmI,IAAIsf,OAAO5I,EAAOsxD,MAE/B,EAKR,GAEJnwE,KAAKg/G,UAAYh/G,KAAK++G,QAAU,KAExC,EA8CJ,MAAMY,GACF5/G,cACIC,KAAKmI,IAAM,IAAI+E,GACnB,CASAO,IAAIwmC,EAAO5pC,GACP,OAAArK,KAAKmI,IAAIsF,IAAIwmC,EAAO5pC,GACbrK,IACX,CAQAuN,IAAI0mC,GACA,OAAKj0C,KAAKmI,IAAImf,IAAI2sB,IACdj0C,KAAKmI,IAAIsF,IAAIwmC,EAAOA,EAAMu8D,gBAEvBxwG,KAAKmI,IAAIoF,IAAI0mC,EACxB,CAQAxsB,OAAOwsB,GACH,OAAAj0C,KAAKmI,IAAIsf,OAAOwsB,GACTj0C,IACX,CAQAsnB,IAAI2sB,GACA,OAAOj0C,KAAKmI,IAAImf,IAAI2sB,EACxB,CAIA9qC,OACI,OAAOnJ,KAAKmI,IAAIgB,MACpB,EAuBJ,SAASy2G,GAAcv1G,GACnB,cAAc46E,YAAgB,KAAe56E,aAAiB46E,WAClE,CAMA,SAAS46B,GAAOx1G,GACZ,cAAc26E,KAAS,KAAe36E,aAAiB26E,IAC3D,CAMA,SAAS86B,GAAWz1G,GAChB,cAAcw6E,SAAa,KAAex6E,aAAiBw6E,QAC/D,CAmBA,MAAMk7B,GACFhgH,YAAYyjB,EAAQ2F,EAAK62F,GAAOC,IAiC5B,IAAI/5G,GAyCJ,GAzEAlG,KAAKmpB,IAAMA,EAQXnpB,KAAKmjC,KAAO,KASZnjC,KAAKkgH,gBAAiB,EAItBlgH,KAAKmgH,iBAAkB,EAOvBngH,KAAKoqF,aAAe,OACpBpqF,KAAKwjB,OAASA,EAAO2e,cArF7B,SAASi+E,GAAc58F,GACnB,OAAQA,GACJ,IAAK,SACL,IAAK,MACL,IAAK,OACL,IAAK,UACL,IAAK,QACD,OAAO,EACX,QACI,OAAO,EAEnB,CAgFY48F,CAAcpgH,KAAKwjB,SAAay8F,IAEhCjgH,KAAKmjC,UAAkB5/B,IAAVy8G,GAAuBA,GAAQ,KAC5C95G,GAAU+5G,IAIV/5G,GAAU85G,GAGV95G,KAEAlG,KAAKkgH,iBAAmBh6G,GAAQg6G,eAChClgH,KAAKmgH,kBAAoBj6G,GAAQi6G,gBAE3Bj6G,GAAQkkF,eACVpqF,KAAKoqF,aAAelkF,GAAQkkF,cAG1BlkF,GAAQmtB,UACVrzB,KAAKqzB,QAAUntB,GAAQmtB,SAErBntB,GAAQwN,UACV1T,KAAK0T,QAAUxN,GAAQwN,SAErBxN,GAAQi4B,SACVn+B,KAAKm+B,OAASj4B,GAAQi4B,SAIzBn+B,KAAKqzB,UACNrzB,KAAKqzB,QAAU,IAAIkqF,IAGlBv9G,KAAK0T,UACN1T,KAAK0T,QAAU,IAAIisG,IAGlB3/G,KAAKm+B,OAIL,CAED,MAAMA,GAASn+B,KAAKm+B,OAAO55B,WAC3B,GAAsB,IAAlB45B,GAAOz3B,OAEP1G,KAAKqgH,cAAgBl3F,MAEpB,CAED,MAAMm3F,GAAOn3F,EAAIuD,QAAQ,KASzB1sB,KAAKqgH,cAAgBl3F,IADA,IAATm3F,GAAc,IAAOA,GAAOn3F,EAAIziB,OAAS,EAAI,IAAM,IAC9By3B,EACrC,CACJ,MAvBIn+B,KAAKm+B,OAAS,IAAI2gF,GAClB9+G,KAAKqgH,cAAgBl3F,CAuB7B,CAKAo3F,gBAEI,OAAkB,OAAdvgH,KAAKmjC,KACE,KAIPy8E,GAAc5/G,KAAKmjC,OAAS08E,GAAO7/G,KAAKmjC,OAAS28E,GAAW9/G,KAAKmjC,OA7H7E,SAASq9E,GAAkBn2G,GACvB,cAAcu6E,gBAAoB,KAAev6E,aAAiBu6E,eACtE,CA4HY47B,CAAkBxgH,KAAKmjC,OAA8B,iBAAdnjC,KAAKmjC,KACrCnjC,KAAKmjC,KAGZnjC,KAAKmjC,gBAAgB27E,GACd9+G,KAAKmjC,KAAK5+B,WAGI,iBAAdvE,KAAKmjC,MAA0C,kBAAdnjC,KAAKmjC,MAC7Ct8B,MAAMC,QAAQ9G,KAAKmjC,MACZrc,KAAKC,UAAU/mB,KAAKmjC,MAGxBnjC,KAAKmjC,KAAK5+B,UACrB,CAOAk8G,0BAMI,OAJkB,OAAdzgH,KAAKmjC,MAIL28E,GAAW9/G,KAAKmjC,MACT,KAIP08E,GAAO7/G,KAAKmjC,MACLnjC,KAAKmjC,KAAK/2B,MAAQ,KAGzBwzG,GAAc5/G,KAAKmjC,MACZ,KAIc,iBAAdnjC,KAAKmjC,KACL,aAGPnjC,KAAKmjC,gBAAgB27E,GACd,kDAGc,iBAAd9+G,KAAKmjC,MAA0C,iBAAdnjC,KAAKmjC,MACxB,kBAAdnjC,KAAKmjC,KACL,mBAGJ,IACX,CACAtmB,MAAMgC,EAAS,CAAC,GAGZ,MAAM2E,EAAS3E,EAAO2E,QAAUxjB,KAAKwjB,OAC/B2F,GAAMtK,EAAOsK,KAAOnpB,KAAKmpB,IACzBihE,GAAevrE,EAAOurE,cAAgBpqF,KAAKoqF,aAK3CjnD,QAAwB5/B,IAAhBsb,EAAOskB,KAAsBtkB,EAAOskB,KAAOnjC,KAAKmjC,KAGxDg9E,QAA8C58G,IAA3Bsb,EAAOshG,gBAAiCthG,EAAOshG,gBAAkBngH,KAAKmgH,gBACzFD,QAA4C38G,IAA1Bsb,EAAOqhG,eAAgCrhG,EAAOqhG,eAAiBlgH,KAAKkgH,eAG5F,IAAI7sF,GAAUxU,EAAOwU,SAAWrzB,KAAKqzB,QACjC8K,GAAStf,EAAOsf,QAAUn+B,KAAKm+B,OAEnC,MAAMzqB,GAAUmL,EAAOnL,SAAW1T,KAAK0T,QAEvC,YAA0BnQ,IAAtBsb,EAAO6hG,aAEPrtF,GACIhvB,OAAO8E,KAAK0V,EAAO6hG,YACdzqG,OAAO,CAACod,GAAStvB,KAASsvB,GAAQ5lB,IAAI1J,GAAM8a,EAAO6hG,WAAW38G,KAAQsvB,KAG/ExU,EAAO8hG,YAEPxiF,GAAS95B,OAAO8E,KAAK0V,EAAO8hG,WACvB1qG,OAAO,CAACkoB,GAAQgyC,KAAUhyC,GAAO1wB,IAAI0iE,GAAOtxD,EAAO8hG,UAAUxwC,KAAShyC,KAGxE,IAAI4hF,GAAYv8F,EAAQ2F,GAAKga,GAAM,CACtChF,UACA9K,WACA3f,WACAwsG,kBACA91B,gBACA+1B,oBAER,EAQJ,IAAIS,GACH,SAAUA,GAIPA,SAAcA,EAAcC,KAAU,GAAK,OAM3CD,EAAcA,EAAcE,eAAoB,GAAK,iBAIrDF,EAAcA,EAAcG,eAAoB,GAAK,iBAIrDH,EAAcA,EAAcI,iBAAsB,GAAK,mBAIvDJ,EAAcA,EAAclvF,SAAc,GAAK,WAI/CkvF,EAAcA,EAAcK,KAAU,GAAK,OA1BpCL,CA2BX,CA3BC,CA2BEA,IAAkC,CAAC,GAMtC,MAAMM,GAOFnhH,YAAY+T,EAAMqtG,EAAgB,IAA6BC,GAAoB,MAG/EphH,KAAKqzB,QAAUvf,EAAKuf,SAAW,IAAIkqF,GACnCv9G,KAAKkU,YAAyB3Q,IAAhBuQ,EAAKI,OAAuBJ,EAAKI,OAASitG,EACxDnhH,KAAKqhH,WAAavtG,EAAKutG,YAAcD,GACrCphH,KAAKmpB,IAAMrV,EAAKqV,KAAO,KAEvBnpB,KAAKshH,GAAKthH,KAAKkU,QAAU,KAAOlU,KAAKkU,OAAS,GAClD,EAWJ,MAAMqtG,WAA2BL,GAI7BnhH,YAAY+T,EAAO,CAAC,GAChBwiB,MAAMxiB,GACN9T,KAAKoM,KAAOw0G,GAAcG,cAC9B,CAKAlkG,MAAMgC,EAAS,CAAC,GAGZ,OAAO,IAAI0iG,GAAmB,CAC1BluF,QAASxU,EAAOwU,SAAWrzB,KAAKqzB,QAChCnf,YAA0B3Q,IAAlBsb,EAAO3K,OAAuB2K,EAAO3K,OAASlU,KAAKkU,OAC3DmtG,WAAYxiG,EAAOwiG,YAAcrhH,KAAKqhH,WACtCl4F,IAAKtK,EAAOsK,KAAOnpB,KAAKmpB,UAAO5lB,GAEvC,EAWJ,MAAMi+G,WAAqBN,GAIvBnhH,YAAY+T,EAAO,CAAC,GAChBwiB,MAAMxiB,GACN9T,KAAKoM,KAAOw0G,GAAclvF,SAC1B1xB,KAAKmjC,UAAqB5/B,IAAduQ,EAAKqvB,KAAqBrvB,EAAKqvB,KAAO,IACtD,CACAtmB,MAAMgC,EAAS,CAAC,GACZ,OAAO,IAAI2iG,GAAa,CACpBr+E,UAAuB5/B,IAAhBsb,EAAOskB,KAAsBtkB,EAAOskB,KAAOnjC,KAAKmjC,KACvD9P,QAASxU,EAAOwU,SAAWrzB,KAAKqzB,QAChCnf,YAA2B3Q,IAAlBsb,EAAO3K,OAAwB2K,EAAO3K,OAASlU,KAAKkU,OAC7DmtG,WAAYxiG,EAAOwiG,YAAcrhH,KAAKqhH,WACtCl4F,IAAKtK,EAAOsK,KAAOnpB,KAAKmpB,UAAO5lB,GAEvC,EAeJ,MAAMswC,WAA0BqtE,GAC5BnhH,YAAY+T,GAERwiB,MAAMxiB,EAAM,EAAG,iBACf9T,KAAK+D,KAAO,oBAIZ/D,KAAKshH,IAAK,EAKNthH,KAAKgM,QADLhM,KAAKkU,QAAU,KAAOlU,KAAKkU,OAAS,IACpB,mCAAkCJ,EAAKqV,KAAO,kBAG9C,6BAA4BrV,EAAKqV,KAAO,oBAAoBrV,EAAKI,UAAUJ,EAAKutG,aAEpGrhH,KAAK0uB,MAAQ5a,EAAK4a,OAAS,IAC/B,EAaJ,SAAS+yF,GAAQv7G,EAASi9B,GACtB,MAAO,CACHA,OACA9P,QAASntB,EAAQmtB,QACjB3f,QAASxN,EAAQwN,QACjBgsC,QAASx5C,EAAQw5C,QACjBvhB,OAAQj4B,EAAQi4B,OAChB+hF,eAAgBh6G,EAAQg6G,eACxB91B,aAAclkF,EAAQkkF,aACtB+1B,gBAAiBj6G,EAAQi6G,gBAEjC,CACA,IAuDMuB,GAAU,MAAhB,MAAMA,EACF3hH,YAAYiT,GACRhT,KAAKgT,QAAUA,CACnB,CA2BAkW,QAAQi9D,EAAOh9D,GAAKjjB,GAAU,CAAC,GAC3B,IAAIy7G,GAEJ,GAAIx7B,aAAiB45B,GAGjB4B,GAAMx7B,MAEL,CAKD,IAAI9yD,GAQA8K,GANA9K,GADAntB,GAAQmtB,mBAAmBkqF,GACjBr3G,GAAQmtB,QAGR,IAAIkqF,GAAYr3G,GAAQmtB,SAIhCntB,GAAQi4B,SAENA,GADAj4B,GAAQi4B,kBAAkB2gF,GACjB54G,GAAQi4B,OAGR,IAAI2gF,GAAW,CAAEK,WAAYj5G,GAAQi4B,UAItDwjF,GAAM,IAAI5B,GAAY55B,EAAOh9D,QAAuB5lB,IAAjB2C,GAAQi9B,KAAqBj9B,GAAQi9B,KAAO,KAAO,CAClF9P,WACA3f,QAASxN,GAAQwN,QACjByqB,UACA+hF,eAAgBh6G,GAAQg6G,eAExB91B,aAAclkF,GAAQkkF,cAAgB,OACtC+1B,gBAAiBj6G,GAAQi6G,iBAEjC,CAKA,MAAMyB,MAAUtU,MAAGqU,IAAKltE,QAAK25D,MAAWuT,IAAQ3hH,KAAKgT,QAAQwqF,OAAOmkB,MAIpE,GAAIx7B,aAAiB45B,IAAmC,WAApB75G,GAAQw5C,QACxC,OAAOkiE,GAKX,MAAMC,GAAOD,GAAQntE,QAAKzsC,KAAQuG,IAAUA,cAAiBizG,KAE7D,OAAQt7G,GAAQw5C,SAAW,QACvB,IAAK,OAMD,OAAQiiE,GAAIv3B,cACR,IAAK,cACD,OAAOy3B,GAAKptE,QAAKtsC,MAAK6Z,KAElB,GAAiB,OAAbA,GAAImhB,QAAmBnhB,GAAImhB,gBAAgB8hD,aAC3C,MAAM,IAAIrgF,MAAM,mCAEpB,OAAOod,GAAImhB,QAEnB,IAAK,OACD,OAAO0+E,GAAKptE,QAAKtsC,MAAK6Z,KAElB,GAAiB,OAAbA,GAAImhB,QAAmBnhB,GAAImhB,gBAAgB6hD,MAC3C,MAAM,IAAIpgF,MAAM,2BAEpB,OAAOod,GAAImhB,QAEnB,IAAK,OACD,OAAO0+E,GAAKptE,QAAKtsC,MAAK6Z,KAElB,GAAiB,OAAbA,GAAImhB,MAAqC,iBAAbnhB,GAAImhB,KAChC,MAAM,IAAIv+B,MAAM,6BAEpB,OAAOod,GAAImhB,QAGnB,QAEI,OAAO0+E,GAAKptE,QAAKtsC,MAAK6Z,IAAQA,GAAImhB,OAE9C,IAAK,WAED,OAAO0+E,GACX,QAEI,MAAM,IAAIj9G,MAAO,uCAAsCsB,GAAQw5C,YAE3E,CAUAj4B,OAAO0B,EAAKjjB,GAAU,CAAC,GACnB,OAAOlG,KAAKkpB,QAAQ,SAAUC,EAAKjjB,GACvC,CAMAqH,IAAI4b,EAAKjjB,GAAU,CAAC,GAChB,OAAOlG,KAAKkpB,QAAQ,MAAOC,EAAKjjB,GACpC,CAQA29B,KAAK1a,EAAKjjB,GAAU,CAAC,GACjB,OAAOlG,KAAKkpB,QAAQ,OAAQC,EAAKjjB,GACrC,CAmBA47G,MAAM34F,EAAK44F,IACP,OAAO/hH,KAAKkpB,QAAQ,QAASC,EAAK,CAC9BgV,QAAQ,IAAI2gF,IAAa1qF,OAAO2tF,GAAe,kBAC/CriE,QAAS,OACT0qC,aAAc,QAEtB,CAQAlkF,QAAQijB,EAAKjjB,GAAU,CAAC,GACpB,OAAOlG,KAAKkpB,QAAQ,UAAWC,EAAKjjB,GACxC,CAMAo0D,MAAMnxC,EAAKga,GAAMj9B,GAAU,CAAC,GACxB,OAAOlG,KAAKkpB,QAAQ,QAASC,EAAKs4F,GAAQv7G,GAASi9B,IACvD,CAOA6+E,KAAK74F,EAAKga,GAAMj9B,GAAU,CAAC,GACvB,OAAOlG,KAAKkpB,QAAQ,OAAQC,EAAKs4F,GAAQv7G,GAASi9B,IACtD,CAOA8+E,IAAI94F,EAAKga,GAAMj9B,GAAU,CAAC,GACtB,OAAOlG,KAAKkpB,QAAQ,MAAOC,EAAKs4F,GAAQv7G,GAASi9B,IACrD,CAAChjC,SACQH,KAAKgD,UAAI,SAAA5C,IAAA,WAAAA,IAAyFshH,GAAVzgH,MAAsCo8G,IAAW,EAA6Cl9G,SACtLH,KAAKg0C,WADmF/yC,MAAE,CAAAgzC,MACYytE,EAAU3+G,QAAV2+G,EAAU1+G,YAC5H,OAjOK0+G,CAAU,KAqchB,SAASQ,GAAsBP,EAAKQ,GAChC,OAAOA,EAAeR,EAC1B,CAKA,SAASS,GAA8BC,EAAaC,GAChD,MAAO,CAACC,EAAgBJ,KAAmBG,EAAYhlB,UAAUilB,EAAgB,CAC7E/kB,OAASglB,IAAsBH,EAAYG,GAAmBL,KAEtE,CAgBA,MAAMpkB,GAAoB,IAAIqU,MAAiD,IAIzEqQ,GAAuB,IAAIrQ,MAAoD,IAI/EsQ,GAA4B,IAAItQ,MAAyD,IAK/F,SAASuQ,KACL,IAAIC,EAAQ,KACZ,MAAO,CAACjB,EAAK3uG,KACK,OAAV4vG,IAMAA,MALqBpQ,OAAOzU,GAAmB,CAAE8kB,UAAU,KAAW,IAKjDC,YAAYV,GAA+BF,KAEpE,MAAMa,MAAevQ,OAAOwQ,OACtBC,GAASF,GAAax7F,MAC5B,OAAOq7F,EAAMjB,EAAK3uG,GAASyhC,QAAKq6D,MAAS,IAAMiU,GAAa70E,OAAO+0E,KAAQ,CAEnF,CAAC,IACKC,GAAsB,MAA5B,MAAMA,UAA+B7F,GACjCt9G,YAAYojH,EAASjI,IACjB5kF,QACAt2B,KAAKmjH,QAAUA,EACfnjH,KAAKk7G,SAAWA,GAChBl7G,KAAK4iH,MAAQ,KACb5iH,KAAK+iH,gBAAevQ,OAAOwQ,MAC/B,CACAxlB,OAAO+kB,GACH,GAAmB,OAAfviH,KAAK4iH,MAAgB,CACrB,MAAMQ,GAAwBv8G,MAAM6e,KAAK,IAAI08C,IAAI,IAC1CpiE,KAAKk7G,SAAS3tG,IAAIk1G,OAClBziH,KAAKk7G,SAAS3tG,IAAIm1G,GAA2B,OAMpD1iH,KAAK4iH,MAAQQ,GAAsBN,YAAY,CAACO,GAAiBC,KA1D7E,SAASC,GAAqBlB,EAAaiB,EAAepI,GAEtD,MAAO,CAACqH,GAAgBJ,KAAmBjH,EAASsI,aAAa,IAAMF,EAAcf,GAAgBC,IAAqBH,EAAYG,GAAmBL,KAE7J,CAsD+FoB,CAAqBF,GAAiBC,GAAetjH,KAAKk7G,UAAWgH,GAC5J,CACA,MAAMe,GAASjjH,KAAK+iH,aAAax7F,MACjC,OAAOvnB,KAAK4iH,MAAML,EAAgBC,IAAqBxiH,KAAKmjH,QAAQ3lB,OAAOglB,KACtE/tE,QAAKq6D,MAAS,IAAM9uG,KAAK+iH,aAAa70E,OAAO+0E,KACtD,CAAC9iH,SACQH,KAAKgD,UAAI,SAAA5C,IAAA,WAAAA,IAAyF8iH,GAtTVjiH,MAsTkDq8G,IAtTlDr8G,MAsT0EA,OAAsB,EAA6Cd,SACrOH,KAAKg0C,WAvTmF/yC,MAAE,CAAAgzC,MAuTYivE,EAAsBngH,QAAtBmgH,EAAsBlgH,YACxI,OA1BKkgH,CAAsB,KAqR5B,MAAMO,GAAc,eAcpB,IAOMC,GAAc,MAApB,MAAMA,EACF3jH,YAAY4jH,GACR3jH,KAAK2jH,WAAaA,CACtB,CAMAnmB,OAAOmkB,GAGH,GAAmB,UAAfA,EAAIn+F,OACJ,MAAM,IAAIogG,OAAc,MAAwFC,GAMpH,MAAMF,GAAa3jH,KAAK2jH,WAExB,OADeA,GAAWG,kBAAYp+F,KAAKi+F,GAAWG,mBAAW,EAAIxW,MAAG,OAC1D74D,QAAKq7D,MAAU,IAElB,IAAIjL,KAAYr9B,KAGnB,MAAM5kC,GAAM+gF,GAAWI,QAYvB,GAXAnhF,GAAIuN,KAAKwxE,EAAIn+F,OAAQm+F,EAAItB,eACrBsB,EAAIxB,kBACJv9E,GAAIu9E,iBAAkB,GAG1BwB,EAAItuF,QAAQjrB,QAAQ,CAACrE,GAAM0K,KAAWm0B,GAAIwN,iBAAiBrsC,GAAM0K,GAAOrH,KAAK,OAExEu6G,EAAItuF,QAAQ/L,IAAI,WACjBsb,GAAIwN,iBAAiB,SAAU,sCAG9BuxE,EAAItuF,QAAQ/L,IAAI,gBAAiB,CAClC,MAAM08F,GAAerC,EAAIlB,0BAEJ,OAAjBuD,IACAphF,GAAIwN,iBAAiB,eAAgB4zE,GAE7C,CAEA,GAAIrC,EAAIv3B,aAAc,CAClB,MAAMA,GAAeu3B,EAAIv3B,aAAatiF,cAMtC86B,GAAIwnD,aAAkC,SAAjBA,GAA2BA,GAAe,MACnE,CAEA,MAAM65B,GAAUtC,EAAIpB,gBAOpB,IAAI2D,GAAiB,KAGrB,MAAMC,GAAiBA,KACnB,GAAuB,OAAnBD,GACA,OAAOA,GAEX,MAAM7C,GAAaz+E,GAAIy+E,YAAc,KAE/BhuF,GAAU,IAAIkqF,GAAY36E,GAAIinD,yBAG9B1gE,GA3F1B,SAASi7F,GAAexhF,GACpB,MAAI,gBAAiBA,GAAOA,EAAIyhF,YACrBzhF,EAAIyhF,YAEX,mBAAmBt5G,KAAK63B,EAAIinD,yBACrBjnD,EAAIsN,kBAAkB,iBAE1B,IACX,CAmFgCk0E,CAAexhF,KAAQ++E,EAAIx4F,IAEvC+6F,UACI,IAAI3C,GAAmB,CAAEluF,WAASnf,OAAQ0uB,GAAI1uB,OAAQmtG,cAAYl4F,SAC/D+6F,IAKLxyE,GAASA,KAEX,IAAMre,WAASnf,UAAQmtG,cAAYl4F,QAAQg7F,KAEvChhF,GAAO,KACI,MAAXjvB,KAEAivB,UAAeP,GAAI4B,SAAa,IAAe5B,GAAIsnD,aAAetnD,GAAI4B,UAG3D,IAAXtwB,KACAA,GAAWivB,GAAO,IAA8B,GAMpD,IAAIm+E,GAAKptG,IAAU,KAAOA,GAAS,IAGnC,GAAyB,SAArBytG,EAAIv3B,cAA2C,iBAATjnD,GAAmB,CAEzD,MAAMmhF,GAAenhF,GACrBA,GAAOA,GAAKl1B,QAAQw1G,GAAa,IACjC,IAGItgF,GAAgB,KAATA,GAAcrc,KAAK+mB,MAAM1K,IAAQ,IAC5C,OACOzU,IAIHyU,GAAOmhF,GAGHhD,KAEAA,IAAK,EAELn+E,GAAO,CAAEzU,SAAOi+B,KAAMxpB,IAE9B,CACJ,CACIm+E,IAEA95C,GAASnzC,KAAK,IAAImtF,GAAa,CAC3Br+E,QACA9P,WACAnf,UACAmtG,cACAl4F,IAAKA,SAAO5lB,KAIhBikE,GAASjS,YAITiS,GAAS94C,MAAM,IAAImlB,GAAkB,CAEjCnlB,MAAOyU,GACP9P,WACAnf,UACAmtG,cACAl4F,IAAKA,SAAO5lB,IACd,EAMJqqG,GAAWl/E,KACb,MAAQvF,QAAQg7F,KACVniG,GAAM,IAAI6xB,GAAkB,CAC9BnlB,SACAxa,OAAQ0uB,GAAI1uB,QAAU,EACtBmtG,WAAYz+E,GAAIy+E,YAAc,gBAC9Bl4F,IAAKA,SAAO5lB,IAEhBikE,GAAS94C,MAAM1M,GAAG,EAMtB,IAAIuiG,IAAc,EAGlB,MAAMC,GAAkBj2G,KAEfg2G,KACD/8C,GAASnzC,KAAK8vF,MACdI,IAAc,GAIlB,IAAIE,GAAgB,CAChBr4G,KAAMw0G,GAAcI,iBACpB0D,OAAQn2G,GAAMm2G,QAGdn2G,GAAMo2G,mBACNF,GAAcG,MAAQr2G,GAAMq2G,OAKP,SAArBjD,EAAIv3B,cAA6BxnD,GAAIsnD,eACrCu6B,GAAcI,YAAcjiF,GAAIsnD,cAGpC1iB,GAASnzC,KAAKowF,GAAa,EAIzBK,GAAgBv2G,KAGlB,IAAIw2G,GAAW,CACX34G,KAAMw0G,GAAcE,eACpB4D,OAAQn2G,GAAMm2G,QAIdn2G,GAAMo2G,mBACNI,GAASH,MAAQr2G,GAAMq2G,OAG3Bp9C,GAASnzC,KAAK0wF,GAAQ,EAG1BniF,UAAIlD,iBAAiB,OAAQgS,IAC7B9O,GAAIlD,iBAAiB,QAASkuE,IAC9BhrE,GAAIlD,iBAAiB,UAAWkuE,IAChChrE,GAAIlD,iBAAiB,QAASkuE,IAE1B+T,EAAIzB,iBAEJt9E,GAAIlD,iBAAiB,WAAY8kF,IAEjB,OAAZP,IAAoBrhF,GAAIoiF,QACxBpiF,GAAIoiF,OAAOtlF,iBAAiB,WAAYolF,KAIhDliF,GAAIrG,KAAK0nF,IACTz8C,GAASnzC,KAAK,CAAEjoB,KAAMw0G,GAAcC,OAG7B,KAEHj+E,GAAIkP,oBAAoB,QAAS87D,IACjChrE,GAAIkP,oBAAoB,QAAS87D,IACjChrE,GAAIkP,oBAAoB,OAAQJ,IAChC9O,GAAIkP,oBAAoB,UAAW87D,IAC/B+T,EAAIzB,iBACJt9E,GAAIkP,oBAAoB,WAAY0yE,IACpB,OAAZP,IAAoBrhF,GAAIoiF,QACxBpiF,GAAIoiF,OAAOlzE,oBAAoB,WAAYgzE,KAI/CliF,GAAIH,aAAeG,GAAIqiF,MACvBriF,GAAIsiF,OAAM,CAElB,IAGZ,CAAC/kH,SACQH,KAAKgD,UAAI,SAAA5C,IAAA,WAAAA,IAAyFsjH,GAt0BVziH,MAs0B0Cy1C,OAAa,EAA6Cv2C,SAC5LH,KAAKg0C,WAv0BmF/yC,MAAE,CAAAgzC,MAu0BYyvE,EAAc3gH,QAAd2gH,EAAc1gH,YAChI,OAhQK0gH,CAAc,KAqQpB,MAAMyB,GAAe,IAAI/S,MAAe,gBAElCgT,GAAmB,IAAIhT,MAAe,mBAAoB,CAC5DnvG,WAAY,OACZF,QAASA,IAHoB,eAM3BsiH,GAAmB,IAAIjT,MAAe,mBAAoB,CAC5DnvG,WAAY,OACZF,QAASA,IAHoB,iBAUjC,MAAMuiH,IAEN,IAGMC,GAAuB,MAA7B,MAAMA,EACFxlH,YAAY0jC,EAAKzD,GAAUm2E,IACvBn2G,KAAKyjC,IAAMA,EACXzjC,KAAKggC,SAAWA,GAChBhgC,KAAKm2G,WAAaA,GAClBn2G,KAAKwlH,iBAAmB,GACxBxlH,KAAKylH,UAAY,KAIjBzlH,KAAK0lH,WAAa,CACtB,CACAC,WACI,GAAsB,WAAlB3lH,KAAKggC,SACL,OAAO,KAEX,MAAM4lF,EAAe5lH,KAAKyjC,IAAIwyE,QAAU,GACxC,OAAI2P,IAAiB5lH,KAAKwlH,mBACtBxlH,KAAK0lH,aACL1lH,KAAKylH,aAAYI,OAAkBD,EAAc5lH,KAAKm2G,YACtDn2G,KAAKwlH,iBAAmBI,GAErB5lH,KAAKylH,SAChB,CAACtlH,SACQH,KAAKgD,UAAI,SAAA5C,IAAA,WAAAA,IAAyFmlH,GA13BVtkH,MA03BmDkxG,OA13BnDlxG,MA03BwE6kH,OA13BxE7kH,MA03BgGmkH,IAAgB,EAA6CjlH,SACrPH,KAAKg0C,WA33BmF/yC,MAAE,CAAAgzC,MA23BYsxE,EAAuBxiH,QAAvBwiH,EAAuBviH,YACzI,OA1BKuiH,CAAuB,KAuC7B,SAASQ,GAAkBpE,EAAKttF,GAC5B,MAAM2xF,EAAQrE,EAAIx4F,IAAIrhB,cAKtB,KAAI,EAAC0qG,OAAO2S,KAAgC,QAAfxD,EAAIn+F,QAAmC,SAAfm+F,EAAIn+F,QACrDwiG,EAAM99F,WAAW,YAAc89F,EAAM99F,WAAW,YAChD,OAAOmM,EAAKstF,GAEhB,MAAM1tE,MAAQu+D,OAAO8S,IAAwBK,WACvCM,MAAazT,OAAO6S,IAE1B,OAAa,MAATpxE,KAAkB0tE,EAAItuF,QAAQ/L,IAAI2+F,MAClCtE,EAAMA,EAAI9kG,MAAM,CAAEwW,QAASsuF,EAAItuF,QAAQ5lB,IAAIw4G,GAAYhyE,OAEpD5f,EAAKstF,EAChB,CAuBA,IAAIuE,GACH,SAAUA,GACPA,SAAgBA,EAAgBC,aAAkB,GAAK,eACvDD,EAAgBA,EAAgBE,mBAAwB,GAAK,qBAC7DF,EAAgBA,EAAgBG,wBAA6B,GAAK,0BAClEH,EAAgBA,EAAgBI,iBAAsB,GAAK,mBAC3DJ,EAAgBA,EAAgBK,aAAkB,GAAK,eACvDL,EAAgBA,EAAgBM,sBAA2B,GAAK,wBAChEN,EAAgBA,EAAgBO,MAAW,GAAK,QAPzCP,CAQX,CARC,CAQEA,IAAsC,CAAC,GAuB1C,SAASQ,MAAqBvL,GAU1B,MAAMwL,EAAY,CACdjF,GACAgC,GACAR,GACA,CAAEplB,QAASuf,GAAauJ,YAAa1D,IACrC,CAAEplB,QAASwf,GAAasJ,YAAalD,IACrC,CACI5lB,QAAS2kB,GACTvkB,SAAU6nB,GACV9nB,OAAO,GAEX,CAAEH,QAASqnB,GAAcjnB,UAAU,GACnC,CAAEJ,QAASwnB,GAAwBtnB,SAAUunB,KAEjD,UAAWsB,KAAW1L,EAClBwL,EAAU1/G,QAAQ4/G,EAAQC,iBAE9B,SAAOC,OAAyBJ,EACpC,CAkBA,MAAMK,GAAwB,IAAI5U,MAAe,yBAYjD,SAAS6U,KAML,OAtFJ,SAASC,GAAgB7f,EAAMsf,GAC3B,MAAO,CACHQ,WAAO9f,EACPyf,gBAAYH,EAEpB,CAiFWO,CAAgBhB,GAAgBE,mBAAoB,CACvD,CACItoB,QAASkpB,GACT1oB,WAAYqkB,IAEhB,CACI7kB,QAAS2kB,GACTmE,YAAaI,GACb/oB,OAAO,IAGnB,CAuGA,IA2EMQ,EAAgB,MAAtB,MAAMA,EAAiBt+F,SACVH,KAAKgD,UAAI,SAAA5C,IAAA,WAAAA,IAAyFq+F,EAAgB,EAAkDt+F,SACpKH,KAAKo7G,UAhtCmFn6G,MAAE,CAAAmL,KAgtCSqyF,IAAmBt+F,SACtHH,KAAKq7G,UAjtCmFp6G,MAAE,CAAA0lH,UAitCsC,CACjID,GAAkBO,SAE7B,OANKxoB,CAAgB,8kDCziFf,SAAS2oB,GAAMlhH,EAAU,CAAC,GAC7B,MAAQmhH,YAAYA,KAAM,IAAIjjB,KAAWkjB,gBAAe,EAAMC,mBAAkB,EAAMC,uBAAsB,GAASthH,EACrH,OAAQuhH,IACJ,IAAI1kB,EACA2kB,EACAjhB,EACAvlE,EAAW,EACXymF,GAAe,EACfC,GAAa,EACjB,MAAMC,EAAcA,KACkDH,GAAgBjxE,cAClFixE,OAAkBnkH,GAEhBipD,EAAQA,KACVq7D,IACA9kB,EAAa0D,OAAUljG,EACvBokH,EAAeC,GAAa,GAE1BE,GAAsBA,KACxB,MAAMC,GAAOhlB,EACbv2C,IAC4Cu7D,IAAKtxE,aAAY,EAEjE,SAAOm0D,MAAQ,CAAC1/F,GAAQq5F,MACpBrjE,KACK0mF,IAAeD,GAChBE,IAEJ,MAAMG,GAAQvhB,EAAUA,GAAmD4gB,IAC3E9iB,GAAWh9E,IAAI,KACX2Z,IACiB,IAAbA,IAAmB0mF,IAAeD,IAClCD,EAAkBO,GAAYH,GAAqBN,GAAmB,GAG9EQ,GAAKzxE,UAAUguD,KACVxB,GACD7hE,EAAW,IACX6hE,EAAa,IAAIwC,MAAe,CAC5BlxE,KAAOhqB,IAAU29G,GAAK3zF,KAAKhqB,IAC3BqkB,MAAQpI,KACJshG,GAAa,EACbC,IACAH,EAAkBO,GAAYz7D,EAAO86D,EAAchhG,IACnD0hG,GAAKt5F,MAAMpI,GAAG,EAElBivC,SAAUA,KACNoyD,GAAe,EACfE,IACAH,EAAkBO,GAAYz7D,EAAO+6D,GACrCS,GAAKzyD,UAAS,KAErB,EACDg2C,OAAUrgG,IAAQqrC,UAAUwsD,GAAU,EA9B9C,CAgCG0kB,EAAa,CAExB,CACA,SAASQ,GAAYz7D,EAAO3/B,KAAOjjB,GAC/B,IAAW,IAAPijB,EAEA,YADA2/B,IAGJ,IAAW,IAAP3/B,EACA,OAEJ,MAAMq7F,EAAe,IAAI3iB,MAAe,CACpClxE,KAAMA,KACF6zF,EAAazxE,cACb+V,GAAM,IAGd,SAAO++C,OAAU1+E,KAAMjjB,IAAO2sC,UAAU2xE,EAC5C,6BCpEA,SAASC,GAAuBC,GAC5B,QAAS7gH,KAAO6gH,EACZ,GAAIA,EAAyB7gH,KAAS4gH,GAClC,OAAO5gH,EAGf,MAAM3C,MAAM,oDAChB,CAOA,SAASyjH,GAAeh8G,EAAQnB,GAC5B,UAAW3D,KAAO2D,EACVA,EAAO4B,eAAevF,KAAS8E,EAAOS,eAAevF,KACrD8E,EAAO9E,GAAO2D,EAAO3D,GAGjC,CAEA,SAASwf,GAAUktB,GACf,GAAqB,iBAAVA,EACP,OAAOA,EAEX,GAAIptC,MAAMC,QAAQmtC,GACd,MAAO,IAAMA,EAAM9rC,IAAI4e,IAAW3f,KAAK,MAAQ,IAEnD,GAAa,MAAT6sC,EACA,MAAO,GAAKA,EAEhB,GAAIA,EAAMq0E,eACN,MAAQ,GAAEr0E,EAAMq0E,iBAEpB,GAAIr0E,EAAMlwC,KACN,MAAQ,GAAEkwC,EAAMlwC,OAEpB,MAAMie,EAAMiyB,EAAM1vC,WAClB,GAAW,MAAPyd,EACA,MAAO,GAAKA,EAEhB,MAAMumG,EAAevmG,EAAI0K,QAAQ,MACjC,OAAwB,IAAjB67F,EAAsBvmG,EAAMA,EAAI1K,UAAU,EAAGixG,EACxD,CASA,SAASC,GAAuB3pF,EAAQ4pF,GACpC,OAAkB,MAAV5pF,GAA6B,KAAXA,EACX,OAAV4pF,EAAiB,GAAKA,EACZ,MAATA,GAA2B,KAAVA,EAAgB5pF,EAASA,EAAS,IAAM4pF,CACnE,CAEA,MAAMC,GAAkBP,GAAuB,CAAEO,gBAAiBP,KAwClE,SAASQ,GAAWC,GAChBA,SAAaF,gBAAkBC,GAC/BC,EAAarkH,SAAW,WACpB,OAAOwiB,GAAU/mB,OACrB,EACO4oH,CACX,CAcA,SAASC,GAAkBz8G,GACvB,OAAO08G,GAAa18G,GAAQA,IAASA,CACzC,CAEA,SAAS08G,GAAa7iG,GAClB,MAAqB,mBAAPA,GAAqBA,EAAGnZ,eAAe47G,KACjDziG,EAAGyiG,kBAAoBC,EAC/B,CAEA,SAASI,GAAuB1+G,GAC5B,OAAOA,KAAWA,EAAMy8G,eAC5B,CASA,MAIMkC,GAAmB,+BAkBzB,MAAMC,WAAqBrkH,MACvB7E,YAAY49B,EAAM3xB,GACdsqB,MAQR,SAAS4yF,GAAmBvrF,EAAM3xB,GAY9B,MAPoB,MADG1I,KAAKmN,IAAIktB,KACC3xB,EAAU,KAAOA,EAAU,IAQhE,CArBck9G,CAAmBvrF,EAAM3xB,IAC/BhM,KAAK29B,KAAOA,CAChB,EA2BJ,SAASwrF,GAAgB9+G,GACrB,MAAqB,iBAAVA,EACAA,EACE,MAATA,EACO,GAGJC,OAAOD,EAClB,CAyCA,SAAS++G,GAA2Bn1E,EAAOo1E,GAEvC,MAAM,IAAIJ,IAAa,KAAgDpF,EAC3E,CAoEA,SAASyF,GAAcC,EAAQ3hF,GACb,MAAV2hF,GAIR,SAAShc,GAAW3lE,EAAK2hF,EAAQC,EAAUC,GACvC,MAAM,IAAI7kH,MAAO,oBAAmBgjC,KACjB,MAAd6hF,EAAqB,GAAM,gBAAeD,KAAYC,KAAcF,eAC7E,CANQhc,CAAW3lE,EAAK2hF,EAAQ,KAAM,KAEtC,CAyCA,SAAS5N,GAAmBh8D,GACxB,MAAO,CACH1L,MAAO0L,EAAK1L,MACZhxC,WAAY08C,EAAK18C,YAAc,KAC/BF,QAAS48C,EAAK58C,QACdsH,WAAO9G,EAEf,CAwBA,SAASmmH,GAAiBxjH,GACtB,MAAO,CAAEygH,UAAWzgH,EAAQygH,WAAa,GAAIpoB,QAASr4F,EAAQq4F,SAAW,GAC7E,CAOA,SAASorB,GAAiBv9G,GACtB,OAAOw9G,GAAiBx9G,EAAMy9G,KAAgBD,GAAiBx9G,EAAM09G,GACzE,CACA,SAASC,GAAa39G,GAClB,OAAkC,OAA3Bu9G,GAAiBv9G,EAC5B,CAKA,SAASw9G,GAAiBx9G,EAAM49G,GAC5B,OAAO59G,EAAKU,eAAek9G,GAAS59G,EAAK49G,GAAS,IACtD,CA0BA,SAASC,GAAe79G,GACpB,OAAOA,IAASA,EAAKU,eAAeo9G,KAAe99G,EAAKU,eAAeq9G,KACnE/9G,EAAK89G,IACL,IACR,CACA,MAAML,GAAc1B,GAAuB,CAAEn0E,WAAOm0E,KAC9C+B,GAAa/B,GAAuB,CAAE9M,UAAM8M,KAE5C2B,GAAoB3B,GAAuB,CAAEiC,gBAAiBjC,KAC9DgC,GAAkBhC,GAAuB,CAAEkC,cAAelC,KAQhE,IAAImC,GACH,SAAUA,GAIPA,SAAYA,EAAYC,QAAa,GAAK,UAK1CD,EAAYA,EAAYE,KAAU,GAAK,OAEvCF,EAAYA,EAAYG,KAAU,GAAK,OAEvCH,EAAYA,EAAYI,SAAc,GAAK,WAE3CJ,EAAYA,EAAYK,SAAc,GAAK,WAfpCL,CAgBX,CAhBC,CAgBEA,IAA8B,CAAC,GAWlC,IAAIM,GAOJ,SAASC,GAAwBC,GAC7B,MAAM/wD,EAAW6wD,GACjBA,UAAwBE,EACjB/wD,CACX,CAQA,SAASgxD,GAAmB92E,EAAO+2E,EAAeC,GAC9C,MAAMC,EAAgBvB,GAAiB11E,GACvC,OAAIi3E,GAA6C,QAA5BA,EAAcjoH,gBACAM,IAAxB2nH,EAAc7gH,MAAsB6gH,EAAc7gH,MAAQ6gH,EAAcnoH,UAC3EmoH,EAAc7gH,MAElB4gH,EAAQX,GAAYK,SACb,UACWpnH,IAAlBynH,EACOA,OACX5B,GAA2BriG,GAAUktB,GACzC,CAaA,MAAMk3E,GAAU1nH,WA2HhB,MAAM2uG,GAOFryG,YAAYqrH,EAAOllH,GACflG,KAAKorH,MAAQA,EAEbprH,KAAKqrH,eAAiB,iBACtBrrH,KAAKg0C,gBAAQzwC,EACS,iBAAX2C,EAKPlG,KAAKsrH,kBAAoBplH,OAER3C,IAAZ2C,IACLlG,KAAKg0C,WAAQ2nE,GAAmB,CAC5B1nE,MAAOj0C,KACPiD,WAAYiD,EAAQjD,YAAc,OAClCF,QAASmD,EAAQnD,UAG7B,CAIA,SAAIk7F,GACA,OAAOj+F,IACX,CACAuE,WACI,MAAQ,kBAAiBvE,KAAKorH,OAClC,EAmHJ,MAAMG,GADsB,CAAC,EAOvBC,GAAoB,iBACpBC,GAAqB,kBAErBC,GAAW,OAEXC,GAAS,WAOf,IAAIC,GAIJ,SAASC,EAAmB3Q,GACxB,MAAM4Q,EAASF,GACfA,UAAmB1Q,EACZ4Q,CACX,CACA,SAASC,EAAmB93E,EAAOg3E,EAAQX,GAAYC,SACnD,QAAyBhnH,IAArBqoH,GACA,MAAM,IAAI3C,IAAa,KAAuDpF,GAG7E,OAAyB,OAArB+H,GACEb,GAAmB92E,OAAO1wC,EAAW0nH,GAG9BW,GAAiBr+G,IAAI0mC,EAAOg3E,EAAQX,GAAYK,SAAW,UAAOpnH,EAAW0nH,EAInG,CACA,SAASnV,GAAS7hE,EAAOg3E,EAAQX,GAAYC,SACzC,OArWJ,SAASyB,KACL,OAAOpB,EACX,CAmWYoB,IAA6BD,GAAoBlD,GAAkB50E,GAAQg3E,EACvF,CAkFA,SAASzY,GAAOv+D,EAAOg3E,EAAQX,GAAYC,SACvC,OAAOzU,GAAS7hE,EAAOg4E,GAAkBhB,GAC7C,CAEA,SAASgB,GAAkBhB,GACvB,cAAWA,EAAU,KAAgC,iBAAVA,EAChCA,EAKH,GACHA,EAAMpI,UAAY,IAClBoI,EAAMz7F,MAAQ,IACdy7F,EAAMtnH,MAAQ,IACdsnH,EAAMiB,UAAY,EAC3B,CACA,SAASC,GAAWC,GAChB,MAAMxiH,EAAO,GACb,QAASnC,EAAI,EAAGA,EAAI2kH,EAAM1lH,OAAQe,IAAK,CACnC,MAAM03B,EAAM0pF,GAAkBuD,EAAM3kH,IACpC,GAAIZ,MAAMC,QAAQq4B,GAAM,CACpB,GAAmB,IAAfA,EAAIz4B,OACJ,MAAM,IAAIuiH,GAAa,KAAiDpF,GAE5E,IAAIz3G,EACA6+G,EAAQX,GAAYC,QACxB,QAAS8B,EAAI,EAAGA,EAAIltF,EAAIz4B,OAAQ2lH,IAAK,CACjC,MAAM//D,EAAOntB,EAAIktF,GACXC,EAAOC,GAAcjgE,GACP,iBAATggE,GAEM,IAATA,EACAlgH,EAAOkgD,EAAKrY,MAGZg3E,GAASqB,EAIblgH,EAAOkgD,CAEf,CACA1iD,EAAK3C,KAAK6uG,GAAS1pG,EAAM6+G,GAC7B,MAEIrhH,EAAK3C,KAAK6uG,GAAS32E,GAE3B,CACA,OAAOv1B,CACX,CAWA,SAAS4iH,GAAiBC,EAAWH,GACjCG,SAAUjB,IAAqBc,EAC/BG,EAAUnoH,UAAUknH,IAAqBc,EAClCG,CACX,CAMA,SAASF,GAAct4E,GACnB,OAAOA,EAAMu3E,GACjB,CAuCA,SAASkB,GAAczmG,GACnB,MAAO,CAAE1hB,SAAU0hB,GAAK1hB,UAC5B,CAUA,IAAIooH,GACH,SAAUA,GAOPA,SAAwBA,EAAwBC,OAAY,GAAK,SAKjED,EAAwBA,EAAwBpC,QAAa,GAAK,UAZ3DoC,CAaX,CAbC,CAaEA,IAAsD,CAAC,GAetDE,GACH,SAAUC,GAUPA,SAAkBA,EAAkBC,SAAc,GAAK,WAOvDD,EAAkBA,EAAkBE,KAAU,GAAK,OAMnDF,EAAkBA,EAAkBG,UAAe,GAAK,YAvBjDH,CAwBX,CAxBC,CAwBED,IAA8C,CAAC,GAQlD,MAAMK,GAAY,CAAC,EACb5W,GAAc,GAWd6W,GAAchF,GAAuB,CAAEiF,UAAMjF,KAC7CkF,GAAalF,GAAuB,CAAEvQ,UAAMuQ,KAC5CmF,GAAcnF,GAAuB,CAAEoF,WAAOpF,KAC9CqF,GAAarF,GAAuB,CAAE/M,UAAM+M,KAC5CsF,GAAiBtF,GAAuB,CAAEnlH,UAAMmlH,KAOhDuF,GAAgBvF,GAAuB,CAAEmD,kBAAmBnD,KAS5DwF,GAAYxF,GAAuB,CAAEyF,cAAezF,KAY1D,SAAS0F,GAAa/oH,EAAWgpH,EAAeC,GAE5C,IAAIviG,EAAM1mB,EAAU4B,OACpB,OAAa,CACT,MAAMsnH,EAAalpH,EAAU4nB,QAAQohG,EAAeC,GACpD,IAAmB,IAAfC,EACA,OAAOA,EACX,GAAmB,IAAfA,GAAoBlpH,EAAUmpH,WAAWD,EAAa,IAAM,GAAyB,CAErF,MAAMtnH,EAASonH,EAAcpnH,OAC7B,GAAIsnH,EAAatnH,IAAW8kB,GACxB1mB,EAAUmpH,WAAWD,EAAatnH,IAAW,GAE7C,OAAOsnH,CAEf,CAEAD,EAAgBC,EAAa,CACjC,CACJ,CA6BA,SAASE,GAAgBC,EAAUC,EAAQ15G,GACvC,IAAIjN,EAAI,EACR,KAAOA,EAAIiN,EAAMhO,QAAQ,CACrB,MAAM2D,EAAQqK,EAAMjN,GACpB,GAAqB,iBAAV4C,EAAoB,CAG3B,GAAc,IAAVA,EACA,MAIJ5C,IACA,MAAM4mH,EAAe35G,EAAMjN,KACrB6mH,EAAW55G,EAAMjN,KACjB8mH,EAAU75G,EAAMjN,KAEtB0mH,EAASn4E,aAAao4E,EAAQE,EAAUC,EAASF,EACrD,KACK,CAED,MAAMC,EAAWjkH,EACXkkH,EAAU75G,IAAQjN,GAGpB+mH,GAAgBF,GAChBH,EAASp/C,YAAYq/C,EAAQE,EAAUC,GAGvCJ,EAASn4E,aAAao4E,EAAQE,EAAUC,GAE5C9mH,GACJ,CACJ,CAKA,OAAOA,CACX,CAQA,SAASgnH,GAA0BC,GAC/B,OAAkB,IAAXA,GAA0D,IAAXA,GACvC,IAAXA,CACR,CACA,SAASF,GAAgBzqH,GAIrB,OAA8B,KAAvBA,EAAKkqH,WAAW,EAC3B,CASA,SAASU,GAAeC,EAAKx9E,GACzB,GAAY,OAARA,GAA+B,IAAfA,EAAI1qC,OAGnB,GAAY,OAARkoH,GAA+B,IAAfA,EAAIloH,OAEzBkoH,EAAMx9E,EAAIpnC,YAET,CACD,IAAI6kH,GAAY,EAChB,QAASpnH,EAAI,EAAGA,EAAI2pC,EAAI1qC,OAAQe,IAAK,CACjC,MAAMiG,EAAO0jC,EAAI3pC,GACG,iBAATiG,EACPmhH,EAAYnhH,EAGM,IAAdmhH,GAMAC,GAAmBF,EAAKC,EAAWnhH,EAAM,MAHtB,IAAdmhH,GACS,IAAdA,EAE+Cz9E,IAAM3pC,GAIN,KAG3D,CACJ,CACA,OAAOmnH,CACX,CAUA,SAASE,GAAmBF,EAAKF,EAAQK,EAAMC,EAAM3kH,GACjD,IAAI5C,EAAI,EAEJwnH,EAAuBL,EAAIloH,OAE/B,IAAe,IAAXgoH,EACAO,GAAuB,OAGvB,KAAOxnH,EAAImnH,EAAIloH,QAAQ,CACnB,MAAMwoH,EAAWN,EAAInnH,KACrB,GAAwB,iBAAbynH,EAAa,CACpB,GAAIA,IAAaR,EAAQ,CACrBO,GAAuB,EACvB,KACJ,IACSC,EAAWR,EAAQ,CAExBO,EAAuBxnH,EAAI,EAC3B,KACJ,EAER,CAGJ,KAAOA,EAAImnH,EAAIloH,QAAQ,CACnB,MAAMgH,EAAOkhH,EAAInnH,GACjB,GAAoB,iBAATiG,EAGP,MAEC,GAAIA,IAASqhH,GAEd,GAAa,OAATC,EAIA,YAHc,OAAV3kH,IACAukH,EAAInnH,EAAI,GAAK4C,IAGrB,GACS2kH,IAASJ,EAAInnH,EAAI,GAEtB,YADAmnH,EAAInnH,EAAI,GAAK4C,EAEjB,CAGJ5C,IACa,OAATunH,GACAvnH,IACU,OAAV4C,GACA5C,GACR,EAE6B,IAAzBwnH,IACAL,EAAIlnG,OAAOunG,EAAsB,EAAGP,GACpCjnH,EAAIwnH,EAAuB,GAE/BL,EAAIlnG,OAAOjgB,IAAK,EAAGsnH,GACN,OAATC,GACAJ,EAAIlnG,OAAOjgB,IAAK,EAAGunH,GAET,OAAV3kH,GACAukH,EAAIlnG,OAAOjgB,IAAK,EAAG4C,EAE3B,CAEA,MAAM8kH,GAAuB,cAS7B,SAASC,GAAmB16G,EAAO26G,EAAiBC,GAOhD,IAAI7nH,EAAI,EAGJ8nH,GAAyB,EAC7B,KAAO9nH,EAAIiN,EAAMhO,QAAQ,CACrB,IAAIgH,EAAOgH,EAAMjN,KACjB,GAAoB,iBAATiG,GAAqB6hH,EAAwB,CACpD,MAAMllH,EAAQqK,EAAMjN,KACpB,GAAI6nH,GAA6B,UAAT5hH,IAG0C,IAA1DmgH,GAAaxjH,EAAMvC,cAAeunH,EAAiB,GACnD,OAAO,CAGnB,SACkB,IAAT3hH,EAA0C,CAE/C,KAAOjG,EAAIiN,EAAMhO,QAAwC,iBAAtBgH,EAAOgH,EAAMjN,OAE5C,GAAIiG,EAAK5F,gBAAkBunH,EACvB,OAAO,EAEf,OAAO,CACX,CACyB,iBAAT3hH,IAGZ6hH,GAAyB,GAEjC,CACA,OAAO,CACX,CAMA,SAASC,GAAiBC,GACtB,OAAsB,IAAfA,EAAMrjH,MAAwCqjH,EAAMplH,QAAU8kH,EACzE,CAYA,SAASO,GAAmBD,EAAOE,EAAiBL,GAEhD,OAAOK,KADiC,IAAfF,EAAMrjH,MAAyCkjH,EAA0CG,EAAMplH,MAA7B8kH,GAE/F,CAUA,SAASS,GAAuBH,EAAOxnE,EAAUqnE,GAE7C,IAAIO,EAAO,EACX,MAAMC,EAAYL,EAAM/6G,OAAS,GAE3Bq7G,EA0KV,SAASC,GAAuBF,GAC5B,QAASroH,EAAI,EAAGA,EAAIqoH,EAAUppH,OAAQe,IAElC,GAAIgnH,GADaqB,EAAUroH,IAEvB,OAAOA,EAGf,OAAOqoH,EAAUppH,MACrB,CAlL8BspH,CAAuBF,GAGjD,IAAIG,GAAqB,EACzB,QAASxoH,EAAI,EAAGA,EAAIwgD,EAASvhD,OAAQe,IAAK,CACtC,MAAM8qC,EAAU0V,EAASxgD,GACzB,GAAuB,iBAAZ8qC,GAaX,IAAI09E,EAEJ,GAAW,EAAPJ,GAEA,GADAA,EAAO,EAAyC,EAAPA,EACzB,KAAZt9E,IAAmBm9E,GAAmBD,EAAOl9E,EAAS+8E,IAC1C,KAAZ/8E,GAAsC,IAApB0V,EAASvhD,OAAc,CACzC,GAAIwpH,GAAWL,GACX,OAAO,EACXI,GAAqB,CACzB,MAEC,CACD,MAAME,EAA2B,EAAPN,EAAqCt9E,EAAU0V,IAAWxgD,GAGpF,GAAY,EAAPooH,GAAuD,OAAhBJ,EAAM/6G,MAAgB,CAC9D,IAAK06G,GAAmBK,EAAM/6G,MAAOy7G,EAAmBb,GAAmB,CACvE,GAAIY,GAAWL,GACX,OAAO,EACXI,GAAqB,CACzB,CACA,QACJ,CACA,MACMG,EAAkBC,GADC,EAAPR,EAAsC,QAAUt9E,EACZu9E,EAAWN,GAAiBC,GAAQH,GAC1F,IAAwB,IAApBc,EAAwB,CACxB,GAAIF,GAAWL,GACX,OAAO,EACXI,GAAqB,EACrB,QACJ,CACA,GAA0B,KAAtBE,EAA0B,CAC1B,IAAIG,EAEAA,EADAF,EAAkBL,EACF,GAQAD,EAAUM,EAAkB,GAAGtoH,cAEnD,MAAMyoH,EAAiC,EAAPV,EAAqCS,EAAgB,KACrF,GAAIC,IACgE,IAAhE1C,GAAa0C,EAAyBJ,EAAmB,IAClD,EAAPN,GAA0CM,IAAsBG,EAAe,CAC/E,GAAIJ,GAAWL,GACX,OAAO,EACXI,GAAqB,CACzB,CACJ,CACJ,MAlEA,CAEI,IAAKA,IAAuBC,GAAWL,KAAUK,GAAW39E,GACxD,OAAO,EAIX,GAAI09E,GAAsBC,GAAW39E,GACjC,SACJ09E,GAAqB,EACrBJ,EAAOt9E,EAAkB,EAAPs9E,CAEtB,CAuDJ,CACA,OAAOK,GAAWL,IAASI,CAC/B,CACA,SAASC,GAAWL,GAChB,OAA8C,IAA/B,EAAPA,EACZ,CA8BA,SAASQ,GAAoBtsH,EAAM2Q,EAAO86G,EAAkBF,GACxD,GAAc,OAAV56G,EACA,OAAO,EACX,IAAIjN,EAAI,EACR,GAAI6nH,IAAqBE,EAAkB,CACvC,IAAIgB,GAAe,EACnB,KAAO/oH,EAAIiN,EAAMhO,QAAQ,CACrB,MAAM+pH,EAAgB/7G,EAAMjN,GAC5B,GAAIgpH,IAAkB1sH,EAClB,OAAO0D,EAEN,GAAsB,IAAlBgpH,GAAwE,IAAlBA,EAC3DD,GAAe,UAEQ,IAAlBC,GAAuE,IAAlBA,EAAkD,CAC5G,IAAIpmH,EAAQqK,IAAQjN,GAGpB,KAAwB,iBAAV4C,GACVA,EAAQqK,IAAQjN,GAEpB,QACJ,CACK,GAAsB,IAAlBgpH,EAEL,MAEC,GAAsB,IAAlBA,EAAwD,CAE7DhpH,GAAK,EACL,QACJ,EAEAA,GAAK+oH,EAAe,EAAI,CAC5B,CAEA,OAAO,CACX,CAEI,OAgCR,SAASE,GAAuBh8G,EAAO3Q,GACnC,IAAI0D,EAAIiN,EAAMgY,QAAQ,GACtB,GAAIjlB,GAAI,EAEJ,IADAA,IACOA,EAAIiN,EAAMhO,QAAQ,CACrB,MAAMc,EAAOkN,EAAMjN,GAGnB,GAAoB,iBAATD,EACP,OAAO,EACX,GAAIA,IAASzD,EACT,OAAO0D,EACXA,GACJ,CAEJ,OAAO,CACX,CAhDeipH,CAAuBh8G,EAAO3Q,EAE7C,CACA,SAAS4sH,GAA2BlB,EAAOxnE,EAAUqnE,GAAmB,GACpE,QAAS7nH,EAAI,EAAGA,EAAIwgD,EAASvhD,OAAQe,IACjC,GAAImoH,GAAuBH,EAAOxnE,EAASxgD,GAAI6nH,GAC3C,OAAO,EAGf,OAAO,CACX,CA4CA,SAASsB,GAAyB3oE,EAAUlI,GACxC8wE,EAAkB,QAASppH,EAAI,EAAGA,EAAIs4C,EAAKr5C,OAAQe,IAAK,CACpD,MAAMqpH,EAAwB/wE,EAAKt4C,GACnC,GAAIwgD,EAASvhD,SAAWoqH,EAAsBpqH,OAG9C,SAAS2lH,EAAI,EAAGA,EAAIpkE,EAASvhD,OAAQ2lH,IACjC,GAAIpkE,EAASokE,KAAOyE,EAAsBzE,GACtC,SAASwE,EAGjB,OAAO,EACX,CACA,OAAO,CACX,CACA,SAASE,GAAuBC,EAAgBC,GAC5C,OAAOD,EAAiB,QAAUC,EAAMj6G,OAAS,IAAMi6G,CAC3D,CACA,SAASC,GAAqBjpE,GAC1B,IAAI51C,EAAS41C,EAAS,GAClBxgD,EAAI,EACJooH,EAAO,EACPsB,EAAe,GACfH,GAAiB,EACrB,KAAOvpH,EAAIwgD,EAASvhD,QAAQ,CACxB,IAAI0qH,EAAgBnpE,EAASxgD,GAC7B,GAA6B,iBAAlB2pH,EACP,GAAW,EAAPvB,EAAwC,CACxC,MAAMwB,EAAYppE,IAAWxgD,GAC7B0pH,GACI,IAAMC,GAAiBC,EAAU3qH,OAAS,EAAI,KAAO2qH,EAAY,IAAM,IAAM,GACrF,MACgB,EAAPxB,EACLsB,GAAgB,IAAMC,EAEV,EAAPvB,IACLsB,GAAgB,IAAMC,OAqBL,KAAjBD,IAAwBjB,GAAWkB,KACnC/+G,GAAU0+G,GAAuBC,EAAgBG,GACjDA,EAAe,IAEnBtB,EAAOuB,EAGPJ,EAAiBA,IAAmBd,GAAWL,GAEnDpoH,GACJ,CACA,MAAqB,KAAjB0pH,IACA9+G,GAAU0+G,GAAuBC,EAAgBG,IAE9C9+G,CACX,CAwEA,SAASi/G,GAAkBC,GACvB,OAAO7E,GAAc,KAIjB,MAAM8E,EAAUC,GAAkBF,GAC5BG,EAAM,IACLF,EACH7wH,MAAO4wH,EAAoB5wH,MAC3BC,KAAM2wH,EAAoB3wH,KAC1BE,SAAUywH,EAAoBzwH,SAC9BD,OAAQ0wH,EAAoB1wH,QAAU,KACtCJ,mBAAoB8wH,EAAoB9wH,mBACxCkxH,OAAQJ,EAAoBK,kBAAoBjF,GAAwBC,OACxEiF,cAAe,KACfC,SAAU,KACVC,aAAcP,EAAQ3Z,YAAc0Z,EAAoBQ,cAAgB,KACxEC,sBAAuB,KACvBC,QAASV,EAAoBU,UAAW,EACxC5iH,KAAMkiH,EAAoBliH,MAAQ,CAAC,EACnC6iH,cAAeX,EAAoBW,eAAiBrF,GAAoBE,SACxEh5C,OAAQw9C,EAAoBx9C,QAAUuiC,GACtCllG,EAAG,KACH+gH,QAASZ,EAAoBY,SAAW,KACxCC,MAAO,KACP9pH,GAAI,IAER+pH,GAAaX,GACb,MAAMK,EAAeR,EAAoBQ,aACzCL,SAAIG,cAAgBS,GAAwBP,GAA4B,GACxEL,EAAII,SAAWQ,GAAwBP,GAA4B,GACnEL,EAAIppH,GAuQZ,SAASiqH,GAAeC,GACpB,IAAIztF,EAAO,EAUX,MAAM0tF,EAAgB,CAClBD,EAAajyH,UACbiyH,EAAa/xH,mBACb+xH,EAAaE,SACbF,EAAaG,UACbH,EAAa3xH,OACb2xH,EAAa5xH,KACb4xH,EAAa7xH,MACb6xH,EAAaN,cACbM,EAAa3a,WACb2a,EAAaP,QACbO,EAAaI,SACb9rG,KAAKC,UAAUyrG,EAAahyH,QAC5BsmB,KAAKC,UAAUyrG,EAAaK,SAG5BxuH,OAAOyuH,oBAAoBN,EAAapmH,KAAK9H,aAC3CkuH,EAAaO,iBACbP,EAAaQ,WACjB5rH,KAAK,KACP,UAAWk/C,KAAQmsE,EACf1tF,EAAOzhC,KAAK2vH,KAAK,GAAIluF,GAAQuhB,EAAK2nE,WAAW,IAAM,EAIvDlpF,UAAQ,WACO,IAAMA,CAczB,CA1TiBwtF,CAAeb,GACjBA,GAEf,CAeA,SAASwB,GAAoB9mH,GACzB,OAAO+mH,GAAgB/mH,IAASgnH,GAAgBhnH,EACpD,CACA,SAASinH,GAAQhpH,GACb,OAAiB,OAAVA,CACX,CAIA,SAASipH,GAAiB5B,GACtB,OAAOhF,GAAc,MAEbtgH,KAAMslH,EAAItlH,KACVyxF,UAAW6zB,EAAI7zB,WAAayY,GAC5Bid,aAAc7B,EAAI6B,cAAgBjd,GAClC/X,QAASmzB,EAAInzB,SAAW+X,GACxBkd,QAAS9B,EAAI8B,SAAWld,GACxBmd,wBAAyB,KACzBtB,QAAST,EAAIS,SAAW,KACxB7pH,GAAIopH,EAAIppH,IAAM,OAI1B,CA0EA,SAASorH,GAAarwH,EAAKswH,GACvB,GAAW,MAAPtwH,EACA,OAAO6pH,GACX,MAAM0G,EAAY,CAAC,EACnB,UAAWC,KAAexwH,EACtB,GAAIA,EAAIyJ,eAAe+mH,GAAc,CACjC,IAAIC,EAAazwH,EAAIwwH,GACjBE,EAAeD,EACfjtH,MAAMC,QAAQgtH,KACdC,EAAeD,EAAW,GAC1BA,EAAaA,EAAW,IAE5BF,EAAUE,GAAcD,EACpBF,IACCA,EAAUG,GAAcC,EAEjC,CAEJ,OAAOH,CACX,CAiBA,SAASI,GAAkBC,GACvB,OAAOvH,GAAc,KACjB,MAAMgF,EAAMD,GAAkBwC,GAC9B5B,UAAaX,GACNA,GAEf,CAiBA,SAASwC,GAAaC,GAClB,MAAO,CACH/nH,KAAM+nH,EAAQ/nH,KACdrI,KAAMowH,EAAQpwH,KACdhB,QAAS,KACTqxH,MAAuB,IAAjBD,EAAQC,KACdvc,YAAmC,IAAvBsc,EAAQtc,WACpBwc,UAAWF,EAAQ/nH,KAAK9H,UAAUkyC,aAAe,KAEzD,CAMA,SAAS28E,GAAgB/mH,GACrB,OAAOA,EAAK+gH,KAAgB,IAChC,CACA,SAASiG,GAAgBhnH,GACrB,OAAOA,EAAKihH,KAAe,IAC/B,CACA,SAASiH,GAAaloH,GAClB,OAAOA,EAAKkhH,KAAgB,IAChC,CASA,SAASiH,GAAanoH,GAClB,MAAMslH,EAAMyB,GAAgB/mH,IAASgnH,GAAgBhnH,IAASkoH,GAAaloH,GAC3E,OAAe,OAARslH,GAAeA,EAAI7Z,UAC9B,CACA,SAAS2c,GAAepoH,EAAMqoH,GAC1B,MAAMC,EAActoH,EAAKohH,KAAe,KACxC,IAAKkH,IAAiC,IAAlBD,EAChB,MAAM,IAAI7vH,MAAO,QAAOmiB,GAAU3a,0CAEtC,OAAOsoH,CACX,CACA,SAASjD,GAAkBwC,GACvB,MAAMU,EAAiB,CAAC,EACxB,MAAO,CACHvoH,KAAM6nH,EAAoB7nH,KAC1BwoH,kBAAmB,KACnB7xH,QAAS,KACT8xH,aAAcZ,EAAoBY,cAAgB,KAClDnC,SAAUuB,EAAoBvB,UAAY,EAC1CC,UAAWsB,EAAoBtB,WAAa,KAC5CI,eAAgBkB,EAAoBlB,gBAAkB,KACtD4B,iBACAG,gBAAiB,KACjBC,YAAad,EAAoBzzH,QAAU0sH,GAC3C0F,SAAUqB,EAAoBrB,UAAY,KAC1C/a,YAA+C,IAAnCoc,EAAoBpc,WAChCoa,SAAyC,IAAhCgC,EAAoBhC,QAC7B1xH,UAAW0zH,EAAoB1zH,WAAa+1G,GAC5C0c,UAAWiB,EAAoBjB,WAAa,KAC5C7X,SAAU8Y,EAAoB9Y,UAAY,KAC1C6Z,SAAU,KACVC,sBAAuB,KACvBC,eAAgB,KAChB10H,OAAQkzH,GAAaO,EAAoBzzH,OAAQm0H,GACjD9B,QAASa,GAAaO,EAAoBpB,SAElD,CACA,SAASR,GAAa8C,GAClBA,EAAWha,UAAU/yG,QAAS6d,GAAOA,EAAGkvG,GAC5C,CACA,SAAS7C,GAAwBP,EAAcoC,GAC3C,IAAKpC,EACD,OAAO,KAEX,MAAMqD,EAAejB,EAAUG,GAAepB,GAC9C,MAAO,KAA+B,mBAAjBnB,EAA8BA,IAAiBA,GAC/D5pH,IAAIktH,GAAOD,EAAaC,IACxBrtH,OAAOqrH,GAChB,CAiEA,MAAMiC,GAAO,EACPC,GAAQ,EACRC,GAAQ,EACRC,GAAS,EACTC,GAAO,EACPC,GAA8B,EAC9BC,GAAS,EACTC,GAAU,EACVC,GAAU,EACVC,GAAa,EACbC,GAAc,GACdC,GAAW,GACXC,GAAa,GACbC,GAAa,GAEbC,GAAmB,GACnBC,GAA6B,GAC7BC,GAAyB,GACzBC,GAAsB,GACtBC,GAAU,GACVC,GAAK,GACLC,GAAyB,GACzBC,GAAmB,GACnBC,GAAY,GACZC,GAA6B,GAC7BC,GAAiC,GAQjCC,GAAgB,GAUhBC,GAAO,EAcPC,GAAyB,EAKzBC,GAAS,EAETC,GAAc,EAQdC,GAA0B,GAShC,SAASC,GAAQhtH,GACb,OAAOxD,MAAMC,QAAQuD,IAAiC,iBAAhBA,EAAM2sH,GAChD,CAKA,SAASM,GAAajtH,GAClB,OAAOxD,MAAMC,QAAQuD,KAA0B,IAAhBA,EAAM2sH,GACzC,CACA,SAASO,GAAmB9H,GACxB,OAA8D,IAAxC,EAAdA,EAAMxE,MAClB,CACA,SAASuM,GAAgB/H,GACrB,OAAOA,EAAMgI,iBAAkB,CACnC,CACA,SAASC,GAAgBjI,GACrB,OAA8D,IAAxC,EAAdA,EAAMxE,MAClB,CACA,SAAS0M,GAAejG,GACpB,QAASA,EAAI5wH,QACjB,CACA,SAAS82H,GAAWvrH,GAChB,OAAyD,IAAjC,IAAhBA,EAAOmpH,IACnB,CAwHA,SAASqC,GAAczrH,EAAMqoH,GAKzB,OAJsBroH,EAAKU,eAAe2gH,IAInBrhH,EAAKqhH,IAAkB,IAClD,CAwCA,IAAIqK,GAAiB,KACjBC,IAAsB,EAC1B,SAASC,GAAkBC,GACvB,MAAM19E,EAAOu9E,GACbA,UAAiBG,EACV19E,CACX,CACA,MAAM29E,GAAgB,CAClB72G,QAAS,EACT82G,OAAO,EACPC,kBAAc70H,EACd80H,6BAAyB90H,EACzB+0H,yBAAqB/0H,EACrBg1H,kBAAmB,EACnBC,sBAAkBj1H,EAClBk1H,6BAAyBl1H,EACzBm1H,2BAA2B,EAC3BC,sBAAsB,EACtBC,sBAAuBA,KAAM,EAC7BC,uBAAwBA,OACxBC,oBAAqBA,QA8CzB,SAASC,GAA2B1sE,GAChC,IAAI2sE,GAAe3sE,IAAUA,EAAK8rE,MAKlC,KAAK9rE,EAAKusE,sBAAsBvsE,KAAU4sE,GAA+B5sE,GAIrE,YADAA,EAAK8rE,OAAQ,GAGjB9rE,EAAKwsE,uBAAuBxsE,GAE5BA,EAAK8rE,OAAQ,EACjB,CA6BA,SAASe,GAAkB7sE,GACvBA,EAAK8rE,OAAQ,EA1BjB,SAASgB,GAAwB9sE,GAC7B,QAA8B9oD,IAA1B8oD,EAAKmsE,iBACL,OAGJ,MAAMj+E,EAAOw9E,GACbA,IAAsB,EACtB,IACI,UAAWE,KAAY5rE,EAAKmsE,iBACnBP,EAASE,OACVe,GAAkBjB,EAG9B,SAEIF,GAAsBx9E,CAC1B,CACJ,CAUI4+E,CAAwB9sE,GACxBA,EAAKysE,sBAAsBzsE,EAC/B,CAOA,SAAS+sE,GAA0B/sE,GAC/BA,WAASA,EAAKksE,kBAAoB,GAC3BP,GAAkB3rE,EAC7B,CAOA,SAASgtE,GAAyBhtE,EAAMitE,GAEpC,GADAtB,GAAkBsB,GACbjtE,QAA8B9oD,IAAtB8oD,EAAK+rE,mBAA2D70H,IAA7B8oD,EAAKisE,0BAChB/0H,IAAjC8oD,EAAKgsE,wBAGT,IAAIW,GAAe3sE,GAGf,QAAS5kD,EAAI4kD,EAAKksE,kBAAmB9wH,EAAI4kD,EAAK+rE,aAAa1xH,OAAQe,IAC/D8xH,GAAkCltE,EAAK+rE,aAAa3wH,GAAI4kD,EAAKisE,oBAAoB7wH,IAMzF,KAAO4kD,EAAK+rE,aAAa1xH,OAAS2lD,EAAKksE,mBACnClsE,EAAK+rE,aAAav2G,MAClBwqC,EAAKgsE,wBAAwBx2G,MAC7BwqC,EAAKisE,oBAAoBz2G,KAAI,CAErC,CAKA,SAASo3G,GAA+B5sE,GACpCmtE,GAAmBntE,GAEnB,QAAS5kD,EAAI,EAAGA,EAAI4kD,EAAK+rE,aAAa1xH,OAAQe,IAAK,CAC/C,MAAMgyH,EAAWptE,EAAK+rE,aAAa3wH,GAC7BiyH,EAAcrtE,EAAKgsE,wBAAwB5wH,GAWjD,GARIiyH,IAAgBD,EAASp4G,UAK7B03G,GAA2BU,GAGvBC,IAAgBD,EAASp4G,SACzB,OAAO,CAEf,CACA,OAAO,CACX,CAIA,SAASs4G,GAAgBttE,GAErB,GADAmtE,GAAmBntE,GACf2sE,GAAe3sE,GAEf,QAAS5kD,EAAI,EAAGA,EAAI4kD,EAAK+rE,aAAa1xH,OAAQe,IAC1C8xH,GAAkCltE,EAAK+rE,aAAa3wH,GAAI4kD,EAAKisE,oBAAoB7wH,IAIzF4kD,EAAK+rE,aAAa1xH,OAAS2lD,EAAKgsE,wBAAwB3xH,OAAS2lD,EAAKisE,oBAAoB5xH,OACtF,EACA2lD,EAAKmsE,mBACLnsE,EAAKmsE,iBAAiB9xH,OAAS2lD,EAAKosE,wBAAwB/xH,OAAS,EAE7E,CAsBA,SAAS6yH,GAAkCltE,EAAMqzD,GAM7C,GAiCJ,SAASka,GAAmBvtE,GACxBA,EAAKmsE,mBAAqB,GAC1BnsE,EAAKosE,0BAA4B,EACrC,CAzCImB,CAAmBvtE,GACnBmtE,GAAmBntE,GAIkB,IAAjCA,EAAKmsE,iBAAiB9xH,OAItB,QAASe,EAAI,EAAGA,EAAI4kD,EAAK+rE,aAAa1xH,OAAQe,IAC1C8xH,GAAkCltE,EAAK+rE,aAAa3wH,GAAI4kD,EAAKisE,oBAAoB7wH,IAKzF,MAAMoyH,EAAUxtE,EAAKmsE,iBAAiB9xH,OAAS,EAQ/C,GAPA2lD,EAAKmsE,iBAAiB9Y,GAAOrzD,EAAKmsE,iBAAiBqB,GACnDxtE,EAAKosE,wBAAwB/Y,GAAOrzD,EAAKosE,wBAAwBoB,GAEjExtE,EAAKmsE,iBAAiB9xH,SACtB2lD,EAAKosE,wBAAwB/xH,SAGzBg5G,EAAMrzD,EAAKmsE,iBAAiB9xH,OAAQ,CACpC,MAAMozH,EAAcztE,EAAKosE,wBAAwB/Y,GAC3CuY,EAAW5rE,EAAKmsE,iBAAiB9Y,GACvC8Z,GAAmBvB,GACnBA,EAASK,oBAAoBwB,GAAepa,CAChD,CACJ,CACA,SAASsZ,GAAe3sE,GACpB,OAAOA,EAAKssE,uBAAyBtsE,GAAMmsE,kBAAkB9xH,QAAU,GAAK,CAChF,CACA,SAAS8yH,GAAmBntE,GACxBA,EAAK+rE,eAAiB,GACtB/rE,EAAKisE,sBAAwB,GAC7BjsE,EAAKgsE,0BAA4B,EACrC,CA+FA,IAAI0B,OAgGJ,SAASC,GAAUC,GACf,MAAMX,EAAetB,GAAkB,MAGvC,IACI,OAAOiC,GACX,SAEIjC,GAAkBsB,EACtB,CACJ,CAmCA,MAAMY,GAAkBA,OAIlBC,GAA8B,UAEzBjC,GACHS,sBAAsB,EACtBD,2BAA2B,EAC3BI,oBAAsBzsE,IAClBA,EAAKy+C,SAASz+C,EAAK+tE,IAAG,EAE1BC,QAAQ,EACRC,UAAWJ,KATiB,GA0BpC,MAAMK,GACFx6H,YAAY2iD,EAAe83E,EAAcC,GACrCz6H,KAAK0iD,cAAgBA,EACrB1iD,KAAKw6H,aAAeA,EACpBx6H,KAAKy6H,YAAcA,CACvB,CAIAC,gBACI,OAAO16H,KAAKy6H,WAChB,EAyBJ,SAASE,KACL,OAAOC,EACX,CACA,SAASA,GAAuBzF,GAC5B,OAAIA,EAAW/oH,KAAK9H,UAAU02G,cAC1Bma,EAAWH,SAAW6F,IAEnBC,EACX,CAgBA,SAASA,KACL,MAAMC,EAAqBC,GAAsBh7H,MAC3CuyC,EAAUwoF,GAAoBxoF,QACpC,GAAIA,EAAS,CACT,MAAMwnB,EAAWghE,EAAmBhhE,SACpC,GAAIA,IAAamzD,GACb6N,EAAmBhhE,SAAWxnB,OAK9B,QAAShrC,KAAOgrC,EACZwnB,EAASxyD,GAAOgrC,EAAQhrC,GAGhCwzH,EAAmBxoF,QAAU,KAC7BvyC,KAAKg7G,YAAYzoE,EACrB,CACJ,CACA,SAASsoF,GAAoB/pB,EAAUzmG,EAAOypH,EAAYmH,GACtD,MAAMlH,EAAe/zH,KAAK20H,eAAeb,GAEnCiH,EAAqBC,GAAsBlqB,IAYrD,SAASoqB,GAAsBpqB,EAAUqqB,GACrC,OAAOrqB,EAASsqB,IAAwBD,CAC5C,CAbQD,CAAsBpqB,EAAU,CAAE/2C,SAAUmzD,GAAW36E,QAAS,OAC9DA,EAAUwoF,EAAmBxoF,UAAYwoF,EAAmBxoF,QAAU,CAAC,GACvEwnB,EAAWghE,EAAmBhhE,SAC9BshE,EAAiBthE,EAASg6D,GAChCxhF,EAAQwhF,GAAgB,IAAIwG,GAAac,GAAkBA,EAAeb,aAAcnwH,EAAO0vD,IAAamzD,IAC5Gpc,EAASmqB,GAAe5wH,CAC5B,CAxCAswH,GAAqBW,WAAY,EAyCjC,MAAMF,GAAuB,sBAC7B,SAASJ,GAAsBlqB,GAC3B,OAAOA,EAASsqB,KAAyB,IAC7C,CAgBA,MAYMG,GAAW,SAAUhtH,EAAOuiG,EAAU0qB,GAI5C,EAEMC,GAAgB,MAuBtB,SAASC,GAAYrxH,GACjB,KAAOxD,MAAMC,QAAQuD,IACjBA,EAAQA,EAAMirH,IAElB,OAAOjrH,CACX,CAmBA,SAASsxH,GAAiBroH,EAAOsoH,GAG7B,OAAOF,GAAYE,EAAMtoH,GAC7B,CASA,SAASuoH,GAAiBpM,EAAOmM,GAI7B,OADaF,GAAYE,EAAMnM,EAAMn8G,OAEzC,CAmBA,SAASwoH,GAAS1J,EAAO9+G,GAKrB,OAFc8+G,EAAM/iH,KAAKiE,EAG7B,CAMA,SAASyoH,GAAyBC,EAAWC,GAGzC,MAAMC,EAAYD,EAASD,GAE3B,OADc3E,GAAQ6E,GAAaA,EAAYA,EAAU5G,GAE7D,CAkBA,SAAS6G,GAAYt7H,EAAQyS,GACzB,OAAc,MAAVA,EACO,KAEJzS,EAAOyS,EAClB,CAKA,SAAS8oH,GAAuBR,GAC5BA,EAAMrF,IAAuB,CACjC,CAKA,SAAS8F,GAAmBT,GACJ,KAAfA,EAAMpG,MACPoG,EAAMpG,KAAU,KAChB8G,GAAqBV,EAAO,GAEpC,CAKA,SAASW,GAAqBX,GACP,KAAfA,EAAMpG,MACNoG,EAAMpG,MAAU,KAChB8G,GAAqBV,GAAO,GAEpC,CAQA,SAASU,GAAqBV,EAAOY,GACjC,IAAI3lD,EAAS+kD,EAAMnG,IACnB,GAAe,OAAX5+C,EACA,OAEJA,EAAO8+C,KAAgC6G,EACvC,IAAIC,EAAkB5lD,EAEtB,IADAA,EAASA,EAAO4+C,IACE,OAAX5+C,IACU,IAAX2lD,GAAiE,IAAjDC,EAAgB9G,MAClB,IAAX6G,GAAkE,IAAjDC,EAAgB9G,MACtC9+C,EAAO8+C,KAAgC6G,EACvCC,EAAkB5lD,EAClBA,EAASA,EAAO4+C,GAExB,CAyBA,MAAMiH,GAAmB,CACrBC,OAAQC,GAAa,MACrBC,iBAAiB,EACjBC,uBAAwB,MA4B5B,SAASC,KACL,OAAOL,GAAiBG,eAC5B,CAKA,SAASG,KACL,OAAmD,OAA5CN,GAAiBI,sBAC5B,CAqEA,SAASG,KACL,OAAOP,GAAiBC,OAAOf,KACnC,CAIA,SAASsB,KACL,OAAOR,GAAiBC,OAAOvK,KACnC,CAaA,SAAS+K,GAAcC,GACnBV,UAAiBC,OAAOU,aAAeD,EAChCA,EAActH,GACzB,CAOA,SAASwH,GAAYjzH,GACjBqyH,UAAiBC,OAAOU,aAAe,KAChChzH,CACX,CACA,SAASkzH,KACL,IAAIC,EAAeC,KACnB,KAAwB,OAAjBD,GAA+C,KAAtBA,EAAapxH,MACzCoxH,EAAeA,EAAa3mD,OAEhC,OAAO2mD,CACX,CACA,SAASC,KACL,OAAOf,GAAiBC,OAAOa,YACnC,CAMA,SAASE,GAAgBjO,EAAOkO,GAE5B,MAAMhB,EAASD,GAAiBC,OAChCA,EAAOa,aAAe/N,EACtBkN,EAAOgB,SAAWA,CACtB,CACA,SAASC,KACL,OAAOlB,GAAiBC,OAAOgB,QACnC,CACA,SAASE,KACLnB,GAAiBC,OAAOgB,UAAW,CACvC,CAeA,SAASG,KACL,MAAMnB,EAASD,GAAiBC,OAChC,IAAIrpH,EAAQqpH,EAAOoB,iBACnB,OAAc,IAAVzqH,IACAA,EAAQqpH,EAAOoB,iBAAmBpB,EAAOvK,MAAM4L,mBAE5C1qH,CACX,CAOA,SAAS2qH,IACL,OAAOvB,GAAiBC,OAAOuB,cACnC,CACA,SAASC,EAAsBxtD,GAC3B,MAAMgsD,EAASD,GAAiBC,OAC1BrpH,EAAQqpH,EAAOuB,aACrBvB,SAAOuB,aAAevB,EAAOuB,aAAevtD,EACrCr9D,CACX,CAkBA,SAAS8qH,EAA8BL,EAAkBM,GACrD,MAAM1B,EAASD,GAAiBC,OAChCA,EAAOuB,aAAevB,EAAOoB,iBAAmBA,EAChDO,GAAyBD,EAC7B,CAcA,SAASC,GAAyBD,GAC9B3B,GAAiBC,OAAO0B,sBAAwBA,CACpD,CAWA,SAASE,KACL,OAAO7B,GAAiBC,OAAO6B,iBACnC,CACA,SAASC,GAAqBp0H,GAC1BqyH,GAAiBC,OAAO6B,kBAAoBn0H,CAChD,CAMA,SAASq0H,GAAoB9C,GACzB,MAAMxJ,EAAQwJ,EAAMrG,IAEpB,OAAmB,IAAfnD,EAAMhmH,KAECgmH,EAAMuM,UAKE,IAAfvM,EAAMhmH,KACCwvH,EAAMhG,IAGV,IACX,CAcA,SAASgJ,GAAQhD,EAAOnM,EAAOxE,GAE3B,GAAIA,EAAQX,GAAYI,SAAU,CAE9B,IAAImU,EAAcpP,EACdqP,EAAclD,EAClB,OAEIiD,EAAcA,EAAYhoD,OACN,OAAhBgoD,GAA0B5T,EAAQX,GAAYE,OAC9CqU,EAAcH,GAAoBI,GACd,OAAhBD,IAKJC,EAAcA,EAAY1I,IAIF,GAApByI,EAAYzyH,UAQxB,GAAoB,OAAhByyH,EAEA,OAAO,EAGPpP,EAAQoP,EACRjD,EAAQkD,CAEhB,CAEA,MAAMnC,EAASD,GAAiBC,OAASoC,KACzCpC,SAAOa,aAAe/N,EACtBkN,EAAOf,MAAQA,GACR,CACX,CAYA,SAASoD,GAAUC,GAGf,MAAMC,EAAYH,KAYZ3M,EAAQ6M,EAAQ1J,IACtBmH,GAAiBC,OAASuC,EAE1BA,EAAU1B,aAAepL,EAAMz8E,WAC/BupF,EAAUtD,MAAQqD,EAClBC,EAAU9M,MAAQA,EAClB8M,EAAU7B,aAAe4B,EACzBC,EAAUhB,aAAe9L,EAAM4L,kBAC/BkB,EAAUC,QAAS,CACvB,CAIA,SAASJ,KACL,MAAMK,EAAgB1C,GAAiBC,OACjC0C,EAAgC,OAAlBD,EAAyB,KAAOA,EAAcnrD,MAElE,OADkC,OAAhBorD,EAAuBzC,GAAawC,GAAiBC,CAE3E,CACA,SAASzC,GAAa/lD,GAClB,MAAM8lD,EAAS,CACXa,aAAc,KACdG,UAAU,EACV/B,MAAO,KACPxJ,MAAO,KACPkN,eAAe,EACfjC,aAAc,KACdkC,kBAAmB,EACnBC,iBAAkB,KAClBnB,uBAAuB,EACvBN,kBAAkB,EAClBG,cAAc,EACdM,kBAAmB,EACnB3nD,OAAQA,EACR5C,MAAO,KACPkrD,QAAQ,GAEZtoD,OAAW,OAAXA,IAAoBA,EAAO5C,MAAQ0oD,GAC5BA,CACX,CAUA,SAAS8C,KACL,MAAMC,EAAYhD,GAAiBC,OACnCD,UAAiBC,OAAS+C,EAAU7oD,OACpC6oD,EAAUlC,aAAe,KACzBkC,EAAU9D,MAAQ,KACX8D,CACX,CAOA,MAAMC,GAAUF,GAShB,SAASG,KACL,MAAMF,EAAYD,KAClBC,EAAU/B,UAAW,EACrB+B,EAAUtN,MAAQ,KAClBsN,EAAUJ,eAAgB,EAC1BI,EAAUrC,aAAe,KACzBqC,EAAUH,kBAAoB,EAC9BG,EAAUrB,uBAAwB,EAClCqB,EAAUF,iBAAmB,KAC7BE,EAAU3B,kBAAmB,EAC7B2B,EAAUxB,cAAe,EACzBwB,EAAUlB,kBAAoB,CAClC,CAqBA,SAASqB,KACL,OAAOnD,GAAiBC,OAAO2C,aACnC,CAUA,SAASQ,GAAiBxsH,GAKtBopH,GAAiBC,OAAO2C,cAAgBhsH,CAC5C,CAIA,SAASysH,KACL,MAAMpD,EAASD,GAAiBC,OAChC,OAAOb,GAASa,EAAOvK,MAAOuK,EAAO2C,cACzC,CAMA,SAASU,KACLtD,GAAiBC,OAAO6C,iBAAmB/D,EAC/C,CAeA,SAASwE,MAOT,SAASC,KACLxD,GAAiBC,OAAO6C,iBAAmB,IAC/C,CARIU,EACJ,CAWA,IAAIC,IAAsB,EAK1B,SAASC,KACL,OAAOD,EACX,CAKA,SAASE,GAAmB/T,GACxB6T,GAAsB7T,CAC1B,CAgDA,SAASgU,GAAuBlO,EAAO3C,GAKnC,QAAShoH,EAAIgoH,EAAM8Q,eAAgB/0G,EAAMikG,EAAM+Q,aAAc/4H,EAAI+jB,EAAK/jB,IAAK,CAGvE,MAAMg5H,EAFerO,EAAM/iH,KAAK5H,GAEI2E,KAAK9H,WACjCo8H,qBAAoBC,wBAAuBC,kBAAiBC,qBAAoBrqF,eAAgBiqF,EACpGC,IACCtO,EAAM0O,eAAiB,IAAI75H,MAAMQ,EAAGi5H,GAErCC,KACCvO,EAAM0O,eAAiB,IAAI75H,KAAKQ,EAAGk5H,IACnCvO,EAAM2O,oBAAsB,IAAI95H,KAAKQ,EAAGk5H,IAEzCC,IACCxO,EAAM4O,YAAc,IAAI/5H,MAAMQ,EAAGm5H,GAElCC,KACCzO,EAAM4O,YAAc,IAAI/5H,KAAKQ,EAAGo5H,IAChCzO,EAAM6O,iBAAmB,IAAIh6H,KAAKQ,EAAGo5H,IAEvB,MAAfrqF,IACC47E,EAAM8O,eAAiB,IAAIj6H,KAAKQ,EAAG+uC,EAE5C,CACJ,CAiCA,SAAS2qF,GAAkBvF,EAAOwF,EAAOpF,GACrCqF,GAAUzF,EAAOwF,EAAO,EAA2CpF,EACvE,CAcA,SAASsF,GAAyB1F,EAAOwF,EAAOG,EAAWvF,IAGnC,EAAfJ,EAAMpG,OAAoD+L,GAC3DF,GAAUzF,EAAOwF,EAAOG,EAAWvF,EAE3C,CACA,SAASwF,GAAwB5F,EAAO2F,GAGpC,IAAItW,EAAQ2Q,EAAMpG,KACL,EAARvK,KAAmDsW,IACpDtW,GAAS,KACTA,GAAS,EACT2Q,EAAMpG,IAASvK,EAEvB,CAeA,SAASoW,GAAUI,EAAan1G,EAAKi1G,EAAWG,GAG5C,MAGMC,EAAiBD,IAA8C,EAC/D33H,EAAMuiB,EAAI5lB,OAAS,EACzB,IAAIk7H,EAAqB,EACzB,QAASn6H,OAN+BlE,IAArBm+H,EACqB,MAAnCD,EAAYlL,IACb,EAIqB9uH,EAAIsC,EAAKtC,IAE9B,GAAoB,iBADP6kB,EAAI7kB,EAAI,IAGjB,GADAm6H,EAAqBt1G,EAAI7kB,GACD,MAApBi6H,GAA4BE,GAAsBF,EAClD,WAIep1G,EAAI7kB,GAAK,IAExBg6H,EAAYlL,KAAwB,QAEpCqL,EAAqBD,IAAoC,GAAlBA,KACvCE,GAASJ,EAAaF,EAAWj1G,EAAK7kB,GACtCg6H,EAAYlL,KAC4B,WAAnCkL,EAAYlL,KAAyF9uH,EAClG,GAEZA,GAGZ,CAMA,SAASq6H,GAAiBC,EAAWxnG,GACjCghG,GAAS,EAA0CwG,EAAWxnG,GAC9D,MAAM++F,EAAetB,GAAkB,MACvC,IACIz9F,EAAK71B,KAAKq9H,EACd,SAEI/J,GAAkBsB,GAClBiC,GAAS,EAAwCwG,EAAWxnG,EAChE,CACJ,CASA,SAASsnG,GAASJ,EAAaF,EAAWj1G,EAAK7kB,GAC3C,MAAMu6H,EAAa11G,EAAI7kB,GAAK,EACtB8yB,EAAOjO,EAAI7kB,EAAI,GAEfs6H,EAAYN,EADKO,GAAc11G,EAAI7kB,GAAK6kB,EAAI7kB,IAE9Cu6H,EAC8BP,EAAYjM,KAAU,GAG/CiM,EAAYlL,KAAwB,KACf,EAArBkL,EAAYjM,OAAoD+L,IACjEE,EAAYjM,KAAU,KACtBsM,GAAiBC,EAAWxnG,IAIhCunG,GAAiBC,EAAWxnG,EAEpC,CAEA,MAAM0nG,IAAqB,EA+F3B,MAAMC,GACFniI,YAIAgD,EAIAo/H,EAAgBC,GACZpiI,KAAK+C,QAAUA,EAKf/C,KAAKqiI,WAAY,EAGjBriI,KAAKsiI,oBAAsBH,EAC3BniI,KAAKuiI,WAAaH,CACtB,EAgGJ,SAASI,GAAkBC,GACvB,OAAOA,IAAmBR,EAC9B,CACA,SAASS,GAAuBD,GAM5B,OAAwB,MAAjBA,CACX,CAaA,SAASE,GAAsBzvG,EAAU0vG,GACrC,IAAIC,EAbR,SAASC,GAA4BL,GACjC,OAAOA,GAAkB,EAC7B,CAWqBK,CAA4B5vG,GACzC6vG,EAAaH,EAKjB,KAAOC,EAAa,GAChBE,EAAaA,EAAW3M,IACxByM,IAEJ,OAAOE,CACX,CAsCA,IAAIC,IAAuB,EAC3B,SAASC,GAAwB/5D,GAC7B,MAAMlU,EAAWguE,GACjBA,UAAuB95D,EAChBlU,CACX,CAOA,MAAMkuE,GADa,IAObC,GAAoB,EAE1B,IAAIC,GAAkB,EAEtB,MAAMC,GAAY,CAAC,EA0CnB,SAASC,GAA+B7T,EAAOmM,GAC3C,MAAM2H,EAAwBC,GAAiB/T,EAAOmM,GACtD,IAA8B,IAA1B2H,EACA,OAAOA,EAEX,MAAMnR,EAAQwJ,EAAMrG,IAChBnD,EAAMqR,kBACNhU,EAAMiU,cAAgB9H,EAAMl1H,OAC5Bi9H,GAAYvR,EAAM/iH,KAAMogH,GACxBkU,GAAY/H,EAAO,MACnB+H,GAAYvR,EAAMwR,UAAW,OAEjC,MAAMC,EAAYC,GAA0BrU,EAAOmM,GAC7C8H,EAAgBjU,EAAMiU,cAG5B,GAAIlB,GAAkBqB,GAAY,CAC9B,MAAME,EAAcrB,GAAuBmB,GACrC/E,EAAc6D,GAAsBkB,EAAWjI,GAC/CoI,EAAalF,EAAYvJ,IAAOlmH,KAGtC,QAAS5H,EAAI,EAAGA,EAAI,EAAuCA,IACvDm0H,EAAM8H,EAAgBj8H,GAAKq3H,EAAYiF,EAAct8H,GAAKu8H,EAAWD,EAAct8H,EAE3F,CACAm0H,SAAM8H,EAAgB,GAAqCG,EACpDH,CACX,CACA,SAASC,GAAYr3G,EAAK23G,GACtB33G,EAAIrlB,KAAK,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAG,EAAGg9H,EACrC,CACA,SAAST,GAAiB/T,EAAOmM,GAC7B,OAA4B,IAAxBnM,EAAMiU,eAGLjU,EAAM54C,QAAU44C,EAAM54C,OAAO6sD,gBAAkBjU,EAAMiU,eAGa,OAAnE9H,EAAMnM,EAAMiU,cAAgB,IACrB,EAIAjU,EAAMiU,aAErB,CAQA,SAASI,GAA0BrU,EAAOmM,GACtC,GAAInM,EAAM54C,SAAyC,IAA/B44C,EAAM54C,OAAO6sD,cAG7B,OAAOjU,EAAM54C,OAAO6sD,cAKxB,IAAIQ,EAAwB,EACxBrF,EAAc,KACdsF,EAAcvI,EAIlB,KAAuB,OAAhBuI,GAAsB,CAEzB,GADAtF,EAAcuF,GAAkBD,GACZ,OAAhBtF,EAEA,OAAOoD,GAMX,GAFAiC,IACAC,EAAcA,EAAY/N,KACQ,IAA9ByI,EAAY6E,cAEZ,OAAQ7E,EAAY6E,cACfQ,GAAyB,EAEtC,CACA,OAAOjC,EACX,CAQA,SAASoC,GAAmBX,EAAetR,EAAOn+E,IA/HlD,SAASqwF,GAASZ,EAAetR,EAAOhmH,GAEpC,IAAI9D,EACgB,iBAAT8D,EACP9D,EAAK8D,EAAK6hH,WAAW,IAAM,EAEtB7hH,EAAKU,eAAe4gH,MACzBplH,EAAK8D,EAAKshH,KAIJ,MAANplH,IACAA,EAAK8D,EAAKshH,IAAiB0V,MAI/B,MAAMmB,EAAYj8H,EAAK46H,GAQvB9Q,EAAM/iH,KAAKq0H,GAAiBa,GAAapB,MAJ5B,GAAKoB,CAKtB,CAuGID,CAASZ,EAAetR,EAAOn+E,EACnC,CA2EA,SAASuwF,GAAqBxZ,EAAe/2E,EAAOg3E,GAChD,GAAKA,EAAQX,GAAYK,eAA+BpnH,IAAlBynH,EAClC,OAAOA,EAGP5B,IAER,CAUA,SAASqb,GAA+B7I,EAAO3nF,EAAOg3E,EAAOD,GAKzD,GAJKC,EAAQX,GAAYK,eAA+BpnH,IAAlBynH,IAElCA,EAAgB,QAEfC,GAASX,GAAYG,KAAOH,GAAYE,OAAc,CACvD,MAAMka,EAAiB9I,EAAM7F,IAIvB4O,EAA+B9Z,QAAwBtnH,GAC7D,IACI,OAAImhI,EACOA,EAAen3H,IAAI0mC,EAAO+2E,EAAeC,EAAQX,GAAYK,UAG7DI,GAAmB92E,EAAO+2E,EAAeC,EAAQX,GAAYK,SAE5E,SAEIE,GAAwB8Z,EAC5B,CACJ,CACA,OAAOH,GAAqBxZ,EAAe/2E,EAAOg3E,EACtD,CAiBA,SAAS2Z,GAAsBnV,EAAOmM,EAAO3nF,EAAOg3E,EAAQX,GAAYC,QAASS,GAC7E,GAAc,OAAVyE,EAAgB,CAGhB,GAAmB,KAAfmM,EAAMpG,OAGJvK,EAAQX,GAAYG,MAAO,CAC7B,MAAMoa,EAyWlB,SAASC,GAAiCrV,EAAOmM,EAAO3nF,EAAOg3E,EAAOD,GAClE,IAAIwS,EAAe/N,EACfsV,EAAenJ,EAOnB,KAAwB,OAAjB4B,GAA0C,OAAjBuH,GACL,KAAtBA,EAAavP,OACU,IAAtBuP,EAAavP,MAAuC,CAKtD,MAAMwP,EAAoBC,GAA6BzH,EAAcuH,EAAc9wF,EAAOg3E,EAAQX,GAAYG,KAAM4Y,IACpH,GAAI2B,IAAsB3B,GACtB,OAAO2B,EAGX,IAAInG,EAAcrB,EAAa3mD,OAG/B,IAAKgoD,EAAa,CAEd,MAAMqG,EAAuBH,EAAarO,IAC1C,GAAIwO,EAAsB,CACtB,MAAMC,EAA4BD,EAAqB33H,IAAI0mC,EAAOovF,GAAWpY,GAC7E,GAAIka,IAA8B9B,GAC9B,OAAO8B,CAEf,CAEAtG,EAAcuF,GAAkBW,GAChCA,EAAeA,EAAa3O,GAChC,CACAoH,EAAeqB,CACnB,CACA,OAAO7T,CACX,CAjZ0C8Z,CAAiCrV,EAAOmM,EAAO3nF,EAAOg3E,EAAOoY,IAC3F,GAAIwB,IAA0BxB,GAC1B,OAAOwB,CAEf,CAEA,MAAMx6H,EAAQ46H,GAA6BxV,EAAOmM,EAAO3nF,EAAOg3E,EAAOoY,IACvE,GAAIh5H,IAAUg5H,GACV,OAAOh5H,CAEf,CAEA,OAAOo6H,GAA+B7I,EAAO3nF,EAAOg3E,EAAOD,EAC/D,CAWA,SAASia,GAA6BxV,EAAOmM,EAAO3nF,EAAOg3E,EAAOD,GAC9D,MAAMuZ,EAqOV,SAASa,GAAsBnxF,GAE3B,GAAqB,iBAAVA,EACP,OAAOA,EAAMg6E,WAAW,IAAM,EAElC,MAAMoX,EAENpxF,EAAMnnC,eAAe4gH,IAAiBz5E,EAAMy5E,SAAiBnqH,EAE7D,MAAuB,iBAAZ8hI,EACHA,GAAW,EACJA,EAAUnC,GAKVoC,GAIJD,CAEf,CA3PsBD,CAAsBnxF,GAGxC,GAAyB,mBAAdswF,EAA0B,CACjC,IAAK3F,GAAQhD,EAAOnM,EAAOxE,GAGvB,OAAQA,EAAQX,GAAYE,KACxBga,GAAqBxZ,EAAe/2E,EAAOg3E,GAC3CwZ,GAA+B7I,EAAO3nF,EAAOg3E,EAAOD,GAE5D,IACI,IAAI3gH,EAYJ,GAFIA,EAAQk6H,EAAUtZ,GAET,MAAT5gH,GAAmB4gH,EAAQX,GAAYK,SAIvC,OAAOtgH,EAHP++G,IAKR,SAEIuW,IACJ,CACJ,SAC8B,iBAAd4E,EAAwB,CAIpC,IAAIgB,EAAgB,KAChB7B,EAAgBF,GAAiB/T,EAAOmM,GACxC6G,EAAiBR,GACjBuD,EAAmBva,EAAQX,GAAYE,KAAOoR,EAAMvF,IAA4BT,IAAU,KAiB9F,MAdsB,IAAlB8N,GAAwBzY,EAAQX,GAAYI,YAC5C+X,GAAmC,IAAlBiB,EAAuBI,GAA0BrU,EAAOmM,GACrEA,EAAM8H,EAAgB,GACtBjB,IAAmBR,IAAuBwD,GAAmBxa,GAAO,IAIpEsa,EAAgB3J,EAAMrG,IACtBmO,EAAgBhB,GAAuBD,GACvC7G,EAAQ+G,GAAsBF,EAAgB7G,IAL9C8H,GAAgB,IAUC,IAAlBA,GAAsB,CAGzB,MAAMtR,EAAQwJ,EAAMrG,IAGpB,GAAImQ,GAAcnB,EAAWb,EAAetR,EAAM/iH,MAAO,CAIrD,MAAMyhG,EAAW60B,GAAuBjC,EAAe9H,EAAO3nF,EAAOsxF,EAAeta,EAAOua,GAC3F,GAAI10B,IAAauyB,GACb,OAAOvyB,CAEf,CACA2xB,EAAiB7G,EAAM8H,EAAgB,GACnCjB,IAAmBR,IACnBwD,GAAmBxa,EAAO2Q,EAAMrG,IAAOlmH,KAAKq0H,EAAgB,KAAsC8B,IAClGE,GAAcnB,EAAWb,EAAe9H,IAGxC2J,EAAgBnT,EAChBsR,EAAgBhB,GAAuBD,GACvC7G,EAAQ+G,GAAsBF,EAAgB7G,IAM9C8H,GAAgB,CAExB,CACJ,CACA,OAAO1Y,CACX,CACA,SAAS2a,GAAuBjC,EAAe9H,EAAO3nF,EAAOsxF,EAAeta,EAAOua,GAC/E,MAAMI,EAAehK,EAAMrG,IACrB9F,EAAQmW,EAAav2H,KAAKq0H,EAAgB,GAsB1CmC,EAAgBC,GAA0BrW,EAAOmW,EAAc3xF,EAnBrB,MAAjBsxF,EAQ1B/N,GAAgB/H,IAAUuT,GAO1BuC,GAAiBK,GAA+D,IAAhC,EAAbnW,EAAMrjH,MAGnB6+G,EAAQX,GAAYE,MAASgb,IAAqB/V,GAE7E,OAAsB,OAAlBoW,EACOE,GAAkBnK,EAAOgK,EAAcC,EAAepW,GAGtD4T,EAEf,CAWA,SAASyC,GAA0BrW,EAAO2C,EAAOn+E,EAAO+xF,EAAwBC,GAC5E,MAAMC,EAAsBzW,EAAM0W,gBAC5BC,EAAehU,EAAM/iH,KACrBg3H,EAAyC,QAAtBH,EACnBI,EAAkB7W,EAAM8Q,eAExBgG,EAAwBL,GAAuB,GAG/CM,EAAWP,EAAoBI,EAAmBE,EAJnC9W,EAAM+Q,aAK3B,QAAS/4H,EAHau+H,EAAyBK,EAAmBA,EAAmBE,EAGzD9+H,EAAI++H,EAAU/+H,IAAK,CAC3C,MAAMg/H,GAAqBL,EAAa3+H,GACxC,GAAIA,EAAI6+H,GAAmBryF,IAAUwyF,IACjCh/H,GAAK6+H,GAAmBG,GAAmBr6H,OAAS6nC,EACpD,OAAOxsC,CAEf,CACA,GAAIw+H,EAAmB,CACnB,MAAMS,EAASN,EAAaE,GAC5B,GAAII,GAAU/O,GAAe+O,IAAWA,EAAOt6H,OAAS6nC,EACpD,OAAOqyF,CAEf,CACA,OAAO,IACX,CAQA,SAASP,GAAkBnK,EAAOxJ,EAAO9+G,EAAOm8G,GAC5C,IAAIplH,EAAQuxH,EAAMtoH,GAClB,MAAMqzH,EAAQvU,EAAM/iH,KACpB,GAxpBJ,SAASu3H,GAAUvjI,GACf,OAAOA,aAAe6+H,EAC1B,CAspBQ0E,CAAUv8H,GAAQ,CAClB,MAAMtH,EAAUsH,EACZtH,EAAQs/H,WAxgJpB,SAASwE,GAA2B5yF,EAAOxkB,GACvC,MAAMq3G,EAAUr3G,EAAQ,sBAAqBA,EAAKroB,KAAK,YAAY6sC,IAAU,GAC7E,MAAM,IAAIg1E,IAAa,IAAmD,0CAAyCh1E,IAAQ6yF,IAC/H,CAsgJYD,CAnhJZ,SAASE,GAAkB18H,GACvB,MAAqB,mBAAVA,EACAA,EAAMtG,MAAQsG,EAAM9F,WACV,iBAAV8F,GAA+B,MAATA,GAAuC,mBAAfA,EAAM+B,KACpD/B,EAAM+B,KAAKrI,MAAQsG,EAAM+B,KAAK7H,WAElC4kH,GAAgB9+G,EAC3B,CA4gJuC08H,CAAkBJ,EAAMrzH,KAEvD,MAAM0zH,EAA+B/D,GAAwBlgI,EAAQu/H,qBACrEv/H,EAAQs/H,WAAY,EAWpB,MAAMsC,EAA+B5hI,EAAQw/H,WAAa1X,GAAwB9nH,EAAQw/H,YAAc,KACxF3D,GAAQhD,EAAOnM,EAAOnF,GAAYC,SAGlD,IACIlgH,EAAQuxH,EAAMtoH,GAASvQ,EAAQA,aAAQQ,EAAWojI,EAAO/K,EAAOnM,GAQ5D2C,EAAMqR,iBAAmBnwH,GAASm8G,EAAM8Q,gBArgCxD,SAAS0G,GAAsBC,EAAgBC,EAAc/U,GAEzD,MAAQpX,cAAahf,WAAUib,aAAckwB,EAAa/6H,KAAK9H,UAC/D,GAAI02G,EAAa,CACb,MAAMosB,EAAmBxM,GAAuBuM,IAC/C/U,EAAMiV,gBAAkB,IAAIpgI,KAAKigI,EAAgBE,IACjDhV,EAAMkV,qBAAuB,IAAIrgI,KAAKigI,EAAgBE,EAC3D,CACIprC,IACCo2B,EAAMiV,gBAAkB,IAAIpgI,KAAK,EAAIigI,EAAgBlrC,GAEtDib,KACCmb,EAAMiV,gBAAkB,IAAIpgI,KAAKigI,EAAgBjwB,IACjDmb,EAAMkV,qBAAuB,IAAIrgI,KAAKigI,EAAgBjwB,GAE/D,CAw/BgBgwB,CAAsB3zH,EAAOqzH,EAAMrzH,GAAQ8+G,EAEnD,SAGqC,OAAjCuS,GACI9Z,GAAwB8Z,GAC5B1B,GAAwB+D,GACxBjkI,EAAQs/H,WAAY,EACpB1C,IACJ,CACJ,CACA,OAAOt1H,CACX,CAoCA,SAASq7H,GAAcnB,EAAWb,EAAe6D,GAW7C,SAHcA,EAAa7D,GAAiBa,GAAapB,KAJ5C,GAAKoB,EAQtB,CAEA,SAASkB,GAAmBxa,EAAOuc,GAC/B,QAASvc,EAAQX,GAAYG,MAAWQ,EAAQX,GAAYE,MAAQgd,EACxE,CAOA,MAAMC,GACF1nI,YAAY2nI,EAAQC,GAChB3nI,KAAK0nI,OAASA,EACd1nI,KAAK2nI,OAASA,CAClB,CACAp6H,IAAI0mC,EAAO+2E,EAAeC,GACtB,OAAO2Z,GAAsB5kI,KAAK0nI,OAAQ1nI,KAAK2nI,OAAQ1zF,EAAOg4E,GAAkBhB,GAAQD,EAC5F,EAGJ,SAASsa,KACL,OAAO,IAAImC,GAAalK,KAAmBN,KAC/C,CAIA,SAAS2K,GAAsBx7H,GAC3B,OAAOsgH,GAAc,KACjB,MAAMmb,EAAiBz7H,EAAK9H,UAAUvE,YAChC+nI,EAAaD,EAAepa,KAAmBsa,GAAaF,GAC5DG,EAAkB3jI,OAAOC,UAC/B,IAAIuyE,EAASxyE,OAAOgJ,eAAejB,EAAK9H,WAAWvE,YAEnD,KAAO82E,GAAUA,IAAWmxD,GAAiB,CACzC,MAAMjlI,EAAU8zE,EAAO42C,KAAmBsa,GAAalxD,GAMvD,GAAI9zE,GAAWA,IAAY+kI,EACvB,OAAO/kI,EAEX8zE,EAASxyE,OAAOgJ,eAAewpE,EACnC,CAKA,OAAQz2E,GAAM,IAAIA,CAAE,EAE5B,CACA,SAAS2nI,GAAa37H,GAClB,OAAI08G,GAAa18G,GACN,KACH,MAAMrJ,EAAUglI,GAAalf,GAAkBz8G,IAC/C,OAAOrJ,GAAWA,GAAQ,EAG3B80H,GAAczrH,EACzB,CAqDA,SAASg4H,GAAkBxI,GACvB,MAAMxJ,EAAQwJ,EAAMrG,IACd0S,EAAY7V,EAAMhmH,KAExB,OAAkB,IAAd67H,EAEO7V,EAAMuM,UAEM,IAAdsJ,EAGErM,EAAMhG,IAEV,IACX,CAOA,SAASsS,GAAkBC,GACvB,OAthBJ,SAASC,GAAoB3Y,EAAO0Y,GAGhC,GAAyB,UAArBA,EACA,OAAO1Y,EAAMnoH,QAEjB,GAAyB,UAArB6gI,EACA,OAAO1Y,EAAM17C,OAEjB,MAAMr/D,EAAQ+6G,EAAM/6G,MACpB,GAAIA,EAAO,CACP,MAAM2zH,EAAc3zH,EAAMhO,OAC1B,IAAIe,EAAI,EACR,KAAOA,EAAI4gI,GAAa,CACpB,MAAMh+H,EAAQqK,EAAMjN,GAEpB,GAAIgnH,GAA0BpkH,GAC1B,MAEJ,GAAc,IAAVA,EAKA5C,GAAQ,UAEc,iBAAV4C,EAGZ,IADA5C,IACOA,EAAI4gI,GAAmC,iBAAb3zH,EAAMjN,IACnCA,QAGH,IAAI4C,IAAU89H,EACf,OAAOzzH,EAAMjN,EAAI,GAGjBA,GAAQ,EAEhB,CACJ,CACA,OAAO,IACX,CA4eW2gI,CAAoB7K,KAAmB4K,EAClD,CAEA,MACMG,GAAa,iBA8CnB,SAASC,GAAmBxkI,EAAMykI,EAAOC,GACrC,OAAO/b,GAAc,KACjB,MAAMgc,EAZd,SAASC,GAAiBH,GACtB,OAAO,YAAiB5+H,GACpB,GAAI4+H,EAAO,CACP,MAAM/5H,EAAS+5H,KAAS5+H,GACxB,UAAWg/H,KAAYn6H,EACnBzO,KAAK4oI,GAAYn6H,EAAOm6H,EAEhC,CACJ,CACJ,CAGyBD,CAAiBH,GAClC,SAASK,KAAyBj/H,GAC9B,GAAI5J,gBAAgB6oI,EAChBH,SAAS9kH,MAAM5jB,KAAM4J,GACd5J,KAEX,MAAM8oI,EAAqB,IAAID,KAAyBj/H,GACxDm/H,SAAeC,WAAaF,EACrBC,EACP,SAASA,EAAejpC,EAAKmpC,EAAW31H,GAGpC,MAAM41H,EAAappC,EAAIhzF,eAAew7H,IAClCxoC,EAAIwoC,IACJjkI,OAAOmH,eAAes0F,EAAKwoC,GAAY,CAAEj+H,MAAO,KAAMi+H,IAG1D,KAAOY,EAAWxiI,QAAU4M,GACxB41H,EAAWjiI,KAAK,MAEpB,OAACiiI,EAAW51H,GAAS41H,EAAW51H,IAAU,IAAIrM,KAAK6hI,GAC5ChpC,CACX,CACJ,CACA,OAAI2oC,IACAI,EAAsBvkI,UAAYD,OAAO6hG,OAAOuiC,EAAYnkI,YAEhEukI,EAAsBvkI,UAAU+mH,eAAiBtnH,EACjD8kI,EAAsBM,cAAgBN,EAC/BA,GAEf,CAgNA,SAASO,GAAYl/H,EAAO+b,GACxB/b,EAAM9B,QAAQiC,GAASxD,MAAMC,QAAQuD,GAAS++H,GAAY/+H,EAAO4b,GAAMA,EAAG5b,GAC9E,CACA,SAASg/H,GAAW/8G,EAAKhZ,EAAOjJ,GAExBiJ,GAASgZ,EAAI5lB,OACb4lB,EAAIrlB,KAAKoD,GAGTiiB,EAAI5E,OAAOpU,EAAO,EAAGjJ,EAE7B,CACA,SAASi/H,GAAgBh9G,EAAKhZ,GAE1B,OAAIA,GAASgZ,EAAI5lB,OAAS,EACf4lB,EAAIzK,MAGJyK,EAAI5E,OAAOpU,EAAO,GAAG,EAEpC,CACA,SAASi2H,GAAS/iE,EAAMn8D,GACpB,MAAM01C,EAAO,GACb,QAASt4C,EAAI,EAAGA,EAAI++D,EAAM/+D,IACtBs4C,EAAK94C,KAAKoD,GAEd,OAAO01C,CACX,CAyGA,SAASypF,GAAiBC,EAAeliI,EAAK8C,GAC1C,IAAIiJ,EAAQo2H,GAAqBD,EAAeliI,GAChD,OAAI+L,GAAS,EAETm2H,EAAsB,EAARn2H,GAAajJ,GAG3BiJ,GAASA,EAvDjB,SAASq2H,GAAan9B,EAAOl5F,EAAOs2H,EAAQC,GAExC,IAAIr+G,EAAMghF,EAAM9lG,OAChB,GAAI8kB,GAAOlY,EAEPk5F,EAAMvlG,KAAK2iI,EAAQC,QAAM,GAEZ,IAARr+G,EAELghF,EAAMvlG,KAAK4iI,EAAQr9B,EAAM,IACzBA,EAAM,GAAKo9B,MAEV,CAGD,IAFAp+G,IACAghF,EAAMvlG,KAAKulG,EAAMhhF,EAAM,GAAIghF,EAAMhhF,IAC1BA,EAAMlY,GAETk5F,EAAMhhF,GAAOghF,EADOhhF,EAAM,GAE1BA,IAEJghF,EAAMl5F,GAASs2H,EACfp9B,EAAMl5F,EAAQ,GAAKu2H,CACvB,CACJ,CAiCQF,CAAaF,EAAen2H,EAAO/L,EAAK8C,IAErCiJ,CACX,CAQA,SAASw2H,GAAiBL,EAAeliI,GACrC,MAAM+L,EAAQo2H,GAAqBD,EAAeliI,GAClD,GAAI+L,GAAS,EAET,OAAOm2H,EAAsB,EAARn2H,EAG7B,CAWA,SAASo2H,GAAqBD,EAAeliI,GACzC,OAqCJ,SAASwiI,GAAoBv9B,EAAOniG,EAAOw5D,GAEvC,IAAItgB,EAAQ,EACR/3B,EAAMghF,EAAM9lG,QAAUm9D,EAC1B,KAAOr4C,IAAQ+3B,GAAO,CAClB,MAAMymF,EAASzmF,GAAU/3B,EAAM+3B,GAAU,GACnChR,EAAUi6D,EAAMw9B,GAAUnmE,GAChC,GAAIx5D,IAAUkoC,EACV,OAAQy3F,GAAUnmE,EAEbtxB,EAAUloC,EACfmhB,EAAMw+G,EAGNzmF,EAAQymF,EAAS,CAEzB,CACA,QAASx+G,GAAOq4C,EACpB,CAvDWkmE,CAAoBN,EAAeliI,EAAK,EACnD,CAyTA,MAUMojH,GAGN6B,GAAiB+b,GAAmB,YAAa,GAiB3C7d,GAGN8B,GAAiB+b,GAAmB,YAAa,GAiiBjD,SAAS0B,GAA4Bxa,GACjC,OAAqE,MAA/C,IAAdA,EAAMxE,MAClB,CAyBA,IAAIif,GACH,SAAUA,GAOPA,SAAoBA,EAAoBC,UAAe,GAAK,YAI5DD,EAAoBA,EAAoBE,SAAc,GAAK,WAXpDF,CAYX,CAZC,CAYEA,IAA8C,CAAC,GAOlD,MAAMG,GAAqB,6BAIrBC,GAAoB,SACpBC,GAA4B,iBAiClC,MAAMC,GAAiB,IAAIt9H,IAE3B,IAAIu9H,GAAkB,EAiMtB,MAAMC,GAAwB,gBAK9B,SAASC,GAAgBt+H,EAAQgD,GAKzBgoH,GAAQhoH,IACRhD,EAAOq+H,IAAyBr7H,EAAKonH,IAtM7C,SAASmU,GAAchP,GAEnB4O,GAAe/8H,IAAImuH,EAAMnF,IAAKmF,EAClC,CAoMQgP,CAAcv7H,IAGdhD,EAAOq+H,IAAyBr7H,CAExC,CAkJA,IAAIw7H,GAIJ,SAASC,GAAoBC,EAAmBnP,GAC5C,OAAOiP,GAAqBE,EAAmBnP,EACnD,CAoBA,SAASoP,GAAepP,GAEpB,MAAM/kD,EAAS+kD,EAAMnG,IACrB,OAAO6B,GAAazgD,GAAUA,EAAO4+C,IAAU5+C,CACnD,CAgCA,SAASo0D,GAAmBrP,GACxB,OAAOsP,GAAqBtP,EAAM1F,IACtC,CAIA,SAASiV,GAAkBC,GACvB,OAAOF,GAAqBE,EAAU1V,IAC1C,CACA,SAASwV,GAAqBzO,GAC1B,KAA2B,OAApBA,IAA6BnF,GAAamF,IAC7CA,EAAkBA,EAAgB/G,IAEtC,OAAO+G,CACX,CAMA,SAAS4O,GAA0BC,EAAQnd,EAAUt3C,EAAQ00D,EAAeC,GAKxE,GAAqB,MAAjBD,EAAuB,CACvB,IAAIE,EACAC,GAAc,EAIdpU,GAAaiU,GACbE,EAAaF,EAERlU,GAAQkU,KACbG,GAAc,EAEdH,EAAgBA,EAAcjW,KAElC,MAAMqW,EAAQjQ,GAAY6P,GACX,IAAXD,GAA4D,OAAXz0D,EAC/B,MAAd20D,EACAI,GAAkBzd,EAAUt3C,EAAQ80D,GAGpCE,GAAmB1d,EAAUt3C,EAAQ80D,EAAOH,GAAc,MAAM,GAGpD,IAAXF,GAA4D,OAAXz0D,EACtDg1D,GAAmB1d,EAAUt3C,EAAQ80D,EAAOH,GAAc,MAAM,GAEhD,IAAXF,EAkpBjB,SAASQ,GAAiB3d,EAAUwd,EAAOI,GAEvC,MAAMC,EAAeC,GAAiB9d,EAAUwd,GAC5CK,GAlLR,SAASE,GAAkB/d,EAAUt3C,EAAQ5C,EAAO83D,GAChD5d,EAASnqF,YAAY6yC,EAAQ5C,EAAO83D,EACxC,CAiLQG,CAAkB/d,EAAU6d,EAAcL,EAAOI,EAEzD,CAvpBYD,CAAiB3d,EAAUwd,EAAOD,GAElB,IAAXJ,GAELnd,EAASge,YAAYR,GAEP,MAAdF,GA8wBZ,SAASW,GAAeje,EAAUmd,EAAQG,EAAYY,EAAgBb,GAElE,MAAMc,EAASb,EAAWvU,IAQtBoV,IAPW5Q,GAAY+P,IAYvBJ,GAA0BC,EAAQnd,EAAUke,EAAgBC,EAAQd,GAExE,QAAS/jI,EAAI2vH,GAAyB3vH,EAAIgkI,EAAW/kI,OAAQe,IAAK,CAC9D,MAAMm0H,EAAQ6P,EAAWhkI,GACzB8kI,GAAU3Q,EAAMrG,IAAQqG,EAAOzN,EAAUmd,EAAQe,EAAgBC,EACrE,CACJ,CAlyBYF,CAAeje,EAAUmd,EAAQG,EAAY50D,EAAQ20D,EAE7D,CACJ,CAUA,SAASgB,GAAkBre,EAAU9jH,GAEjC,OAAO8jH,EAASse,cAnfpB,SAASC,GAAkBriI,GACvB,OAAOA,EAAM4D,QAAQo8H,GAAqB19E,GAASA,EAAK1+C,QAAQq8H,GAAmBC,IACvF,CAifkCmC,CAAkBriI,GACpD,CAQA,SAASsiI,GAAkBxe,EAAUpqH,EAAM6oI,GAEvC,OAAOze,EAASzqF,cAAc3/B,EAAM6oI,EACxC,CAuKA,SAASC,GAAgBC,EAAsBlR,GAI3C,MAAMmR,EAAaD,EAAqB3V,IAClC6V,EAAuBD,EAAWrgH,QAAQkvG,GAKhDW,GAAqBX,GACrBmR,EAAWrlH,OAAOslH,EAAsB,EAC5C,CAWA,SAASC,GAAWxB,EAAYyB,GAC5B,GAAIzB,EAAW/kI,QAAU0wH,GACrB,OACJ,MAAM+V,EAAmB/V,GAA0B8V,EAC7CE,EAAe3B,EAAW0B,GAChC,GAAIC,EAAc,CACd,MAAMC,EAAwBD,EAAa9W,IACb,OAA1B+W,GAAkCA,IAA0B5B,GAC5DoB,GAAgBQ,EAAuBD,GAEvCF,EAAc,IACdzB,EAAW0B,EAAmB,GAAGzX,IAAQ0X,EAAa1X,KAE1D,MAAM4X,EAAehE,GAAgBmC,EAAYrU,GAA0B8V,IAhMnF,SAASK,GAAkBnb,EAAOwJ,GAE9B2Q,GAAUna,EAAOwJ,EADAA,EAAM3F,IACW,EAAoC,KAAM,MAC5E2F,EAAMtG,IAAQ,KACdsG,EAAMhG,IAAU,IACpB,CA4LQ2X,CAAkBH,EAAa7X,IAAQ6X,GAEvC,MAAMI,EAAWF,EAAa9W,IACb,OAAbgX,GACAA,EAASP,WAAWK,EAAa/X,KAErC6X,EAAa3X,IAAU,KACvB2X,EAAa1X,IAAQ,KAErB0X,EAAa5X,MAAU,GAC3B,CACA,OAAO4X,CACX,CAQA,SAASK,GAAarb,EAAOwJ,GACzB,KAAqB,IAAfA,EAAMpG,KAA0C,CAClD,MAAMrH,EAAWyN,EAAM3F,IACvB2F,EAAM/E,KAA+B8C,GAAgBiC,EAAM/E,KAC3D+E,EAAM9E,KAAmC6C,GAAgBiC,EAAM9E,KAC3D3I,EAASge,aACTI,GAAUna,EAAOwJ,EAAOzN,EAAU,EAAqC,KAAM,MA5KzF,SAASuf,GAAgBC,GAErB,IAAIC,EAAoBD,EAASzX,IACjC,IAAK0X,EACD,OAAOC,GAAYF,EAASpY,IAAQoY,GAExC,KAAOC,GAAmB,CACtB,IAAIv5G,EAAO,KACX,GAAIgjG,GAAQuW,GAERv5G,EAAOu5G,EAAkB1X,QAExB,CAGD,MAAM4X,EAAYF,EAAkBxW,IAChC0W,IACAz5G,EAAOy5G,EACf,CACA,IAAKz5G,EAAM,CAGP,KAAOu5G,IAAsBA,EAAkBlY,KAASkY,IAAsBD,GACtEtW,GAAQuW,IACRC,GAAYD,EAAkBrY,IAAQqY,GAE1CA,EAAoBA,EAAkBnY,IAEhB,OAAtBmY,IACAA,EAAoBD,GACpBtW,GAAQuW,IACRC,GAAYD,EAAkBrY,IAAQqY,GAE1Cv5G,EAAOu5G,GAAqBA,EAAkBlY,GAClD,CACAkY,EAAoBv5G,CACxB,CACJ,CAyIQq5G,CAAgB9R,EACpB,CACJ,CASA,SAASiS,GAAYzb,EAAOwJ,GACxB,KAAqB,IAAfA,EAAMpG,KAA0C,CAGlDoG,EAAMpG,MAAU,IAMhBoG,EAAMpG,KAAU,IAqExB,SAASuY,GAAkB3b,EAAOwJ,GAC9B,IAAIsF,EACJ,GAAa,MAAT9O,GAAwD,OAAtC8O,EAAe9O,EAAM8O,cACvC,QAASz5H,EAAI,EAAGA,EAAIy5H,EAAax6H,OAAQe,GAAK,EAAG,CAC7C,MAAMiM,EAAUkoH,EAAMsF,EAAaz5H,IAEnC,KAAMiM,aAAmBwuH,IAAsB,CAC3C,MAAM8L,EAAS9M,EAAaz5H,EAAI,GAChC,GAAIZ,MAAMC,QAAQknI,GACd,QAAS3hB,EAAI,EAAGA,EAAI2hB,EAAOtnI,OAAQ2lH,GAAK,EAAG,CACvC,MAAM4hB,EAAcv6H,EAAQs6H,EAAO3hB,IAC7B9xF,EAAOyzG,EAAO3hB,EAAI,GACxBkP,GAAS,EAA0C0S,EAAa1zG,GAChE,IACIA,EAAK71B,KAAKupI,EACd,SAEI1S,GAAS,EAAwC0S,EAAa1zG,EAClE,CACJ,KAEC,CACDghG,GAAS,EAA0C7nH,EAASs6H,GAC5D,IACIA,EAAOtpI,KAAKgP,EAChB,SAEI6nH,GAAS,EAAwC7nH,EAASs6H,EAC9D,CACJ,CACJ,CACJ,CAER,CArGQD,CAAkB3b,EAAOwJ,GAyBjC,SAASsS,GAAgB9b,EAAOwJ,GAC5B,MAAMuS,EAAW/b,EAAMtsE,QACjBsoF,EAAWxS,EAAM/F,IACvB,GAAiB,OAAbsY,EACA,QAAS1mI,EAAI,EAAGA,EAAI0mI,EAASznI,OAAS,EAAGe,GAAK,EAC1C,GAA2B,iBAAhB0mI,EAAS1mI,GAAiB,CAGjC,MAAM4mI,EAAYF,EAAS1mI,EAAI,GAE3B4mI,GAAa,EAEbD,EAASC,KAITD,GAAUC,GAAW53F,cAEzBhvC,GAAK,CACT,MAII0mI,EAAS1mI,GAAG/C,KADI0pI,EAASD,EAAS1mI,EAAI,KAKjC,OAAb2mI,IACAxS,EAAM/F,IAAW,MAErB,MAAMqL,EAAetF,EAAMjF,IAC3B,GAAqB,OAAjBuK,EAAuB,CAGvBtF,EAAMjF,IAAoB,KAC1B,QAASlvH,EAAI,EAAGA,EAAIy5H,EAAax6H,OAAQe,KAGrC6mI,EAFuBpN,EAAaz5H,KAI5C,CACJ,CAjEQymI,CAAgB9b,EAAOwJ,GAEG,IAAtBA,EAAMrG,IAAOnpH,MAEbwvH,EAAM3F,IAAUrgD,UAEpB,MAAMk3D,EAAuBlR,EAAMtF,IAEnC,GAA6B,OAAzBwW,GAAiCxV,GAAasE,EAAMnG,KAAU,CAE1DqX,IAAyBlR,EAAMnG,KAC/BoX,GAAgBC,EAAsBlR,GAG1C,MAAM4R,EAAW5R,EAAMpF,IACN,OAAbgX,GACAA,EAASP,WAAW7a,EAE5B,EAzvBR,SAASmc,GAAgB3S,GAErB4O,GAAe/iH,OAAOm0G,EAAMnF,IAChC,CAwvBQ8X,CAAgB3S,EACpB,CACJ,CA+FA,SAAS4S,GAAkBpc,EAAO3C,EAAOmM,GACrC,OAiBJ,SAAS6S,GAAmBrc,EAAO3C,EAAOmM,GACtC,IAAIiD,EAAcpP,EAGlB,KAAuB,OAAhBoP,GACkB,GAApBA,EAAYzyH,MAEbyyH,GADApP,EAAQoP,GACYhoD,OAIxB,GAAoB,OAAhBgoD,EAGA,OAAOjD,EAAMtG,IAEZ,CAED,MAAQmC,mBAAoBoH,EAC5B,GAAIpH,GAAkB,EAAI,CAEtB,MAAQvF,iBAAkBE,EAAM/iH,KAAKwvH,EAAY0B,eAAiB9I,GAOlE,GAAIvF,IAAkBrF,GAAoBG,MACtCkF,IAAkBrF,GAAoBE,SACtC,OAAO,IAEf,CACA,OAAO8O,GAAiBgD,EAAajD,EACzC,CACJ,CApDW6S,CAAmBrc,EAAO3C,EAAM54C,OAAQ+kD,EACnD,CAwDA,SAASiQ,GAAmB1d,EAAUt3C,EAAQ5C,EAAOu3D,EAAYkD,GAE7DvgB,EAASwgB,aAAa93D,EAAQ5C,EAAOu3D,EAAYkD,EACrD,CACA,SAAS9C,GAAkBzd,EAAUt3C,EAAQ5C,GAGzCk6C,EAASrqF,YAAY+yC,EAAQ5C,EACjC,CACA,SAAS26D,GAA2BzgB,EAAUt3C,EAAQ5C,EAAOu3D,EAAYkD,GAClD,OAAflD,EACAK,GAAmB1d,EAAUt3C,EAAQ5C,EAAOu3D,EAAYkD,GAGxD9C,GAAkBzd,EAAUt3C,EAAQ5C,EAE5C,CAYA,SAASg4D,GAAiB9d,EAAU9hE,GAChC,OAAO8hE,EAASjnH,WAAWmlD,EAC/B,CAiBA,SAASwiF,GAAwBhQ,EAAarB,EAAc5B,GACxD,OAAOkT,GAAiCjQ,EAAarB,EAAc5B,EACvE,CAuBA,IAMImT,GAqXAC,GAgKA78B,GA+CA88B,GA1kBAH,GAXJ,SAASI,GAAkCrQ,EAAarB,EAAc5B,GAClE,OAAwB,GAApBiD,EAAYzyH,KACLyvH,GAAiBgD,EAAajD,GAElC,IACX,EAyBA,SAAS93F,GAAYsuF,EAAOwJ,EAAOuT,EAAYC,GAC3C,MAAMC,EAAcb,GAAkBpc,EAAOgd,EAAYxT,GACnDzN,EAAWyN,EAAM3F,IAEjBqZ,EAAaT,GADCO,EAAWv4D,QAAU+kD,EAAMhG,IACSwZ,EAAYxT,GACpE,GAAmB,MAAfyT,EACA,GAAIxoI,MAAMC,QAAQqoI,GACd,QAAS1nI,EAAI,EAAGA,EAAI0nI,EAAWzoI,OAAQe,IACnCmnI,GAA2BzgB,EAAUkhB,EAAaF,EAAW1nI,GAAI6nI,GAAY,QAIjFV,GAA2BzgB,EAAUkhB,EAAaF,EAAYG,GAAY,QAGrD/rI,IAA7BwrI,IACIA,GAAyB5gB,EAAUihB,EAAYxT,EAAOuT,EAAYE,EAC1E,CAMA,SAASE,GAAmB3T,EAAOnM,GAC/B,GAAc,OAAVA,EAAgB,CAGhB,MAAM+f,EAAY/f,EAAMrjH,KACxB,GAAgB,EAAZojI,EACA,OAAO3T,GAAiBpM,EAAOmM,GAE9B,GAAgB,EAAZ4T,EACL,OAAOC,IAAqB,EAAI7T,EAAMnM,EAAMn8G,QAE3C,GAAgB,EAAZk8H,EAAgD,CACrD,MAAME,EAAsBjgB,EAAMx7C,MAClC,GAA4B,OAAxBy7D,EACA,OAAOH,GAAmB3T,EAAO8T,GAEhC,CACD,MAAMC,EAAoB/T,EAAMnM,EAAMn8G,OACtC,OAAIgkH,GAAaqY,GACNF,IAAqB,EAAIE,GAGzBjU,GAAYiU,EAE3B,CACJ,CACK,GAAgB,GAAZH,EAIL,OAHgB1E,GAAoBrb,EAAOmM,EAA3BkP,IAGApP,GAAYE,EAAMnM,EAAMn8G,QAEvC,CACD,MAAMs8H,EAAkBC,GAAmBjU,EAAOnM,GAClD,OAAwB,OAApBmgB,EACI/oI,MAAMC,QAAQ8oI,GACPA,EAAgB,GAIpBL,GAFYvE,GAAepP,EAAMvF,KAEFuZ,GAG/BL,GAAmB3T,EAAOnM,EAAMp7F,KAE/C,CACJ,CACA,OAAO,IACX,CACA,SAASw7G,GAAmBjU,EAAOnM,GAC/B,OAAc,OAAVA,EACsBmM,EAAMvF,IACQT,IAGfka,WAFLrgB,EAAMqgB,YAInB,IACX,CACA,SAASL,GAAqBM,EAAsBtE,GAChD,MAAMuE,EAAgB5Y,GAA0B2Y,EAAuB,EACvE,GAAIC,EAAgBvE,EAAW/kI,OAAQ,CACnC,MAAMk1H,EAAQ6P,EAAWuE,GACnBC,EAAmBrU,EAAMrG,IAAO5/E,WACtC,GAAyB,OAArBs6F,EACA,OAAOV,GAAmB3T,EAAOqU,EAEzC,CACA,OAAOxE,EAAWvU,GACtB,CA6BA,SAASgZ,GAAW/hB,EAAUmd,EAAQ7b,EAAOmM,EAAOyQ,EAAgBb,EAAY2E,GAC5E,KAAgB,MAAT1gB,GAAe,CAIlB,MAAM2gB,EAAexU,EAAMnM,EAAMn8G,OAC3Bk8H,EAAY/f,EAAMrjH,KAOxB,GANI+jI,GACe,IAAX7E,IACA8E,GAAgBzF,GAAgBjP,GAAY0U,GAAexU,GAC3DnM,EAAMxE,OAAS,GAGgC,KAApC,GAAdwE,EAAMxE,OACP,GAAgB,EAAZukB,EACAU,GAAW/hB,EAAUmd,EAAQ7b,EAAMx7C,MAAO2nD,EAAOyQ,EAAgBb,GAAY,GAC7EH,GAA0BC,EAAQnd,EAAUke,EAAgB+D,EAAc5E,QAAU,GAEnE,GAAZgE,EAAoC,CACzC,MAAMa,EAAYvF,GAAoBrb,EAAOmM,GAC7C,IAAI+P,EACJ,KAAOA,EAAQ0E,KACXhF,GAA0BC,EAAQnd,EAAUke,EAAgBV,EAAOH,GAEvEH,GAA0BC,EAAQnd,EAAUke,EAAgB+D,EAAc5E,EAC9E,MACqB,GAAZgE,EACLc,GAAyBniB,EAAUmd,EAAQ1P,EAAOnM,EAAO4c,EAAgBb,GAIzEH,GAA0BC,EAAQnd,EAAUke,EAAgB+D,EAAc5E,GAGlF/b,EAAQ0gB,EAAe1gB,EAAM8gB,eAAiB9gB,EAAMp7F,IACxD,CACJ,CACA,SAASk4G,GAAUna,EAAOwJ,EAAOzN,EAAUmd,EAAQe,EAAgBb,GAC/D0E,GAAW/hB,EAAUmd,EAAQlZ,EAAMz8E,WAAYimF,EAAOyQ,EAAgBb,GAAY,EACtF,CAgCA,SAAS8E,GAAyBniB,EAAUmd,EAAQ1P,EAAO4U,EAAiBnE,EAAgBb,GACxF,MAAMiF,EAAiB7U,EAAMvF,IAIvBqa,EAHgBD,EAAe7a,IAGOka,WAAWU,EAAgBV,YACvE,GAAIjpI,MAAMC,QAAQ4pI,GAMd,QAASjpI,EAAI,EAAGA,EAAIipI,EAAsBhqI,OAAQe,IAE9C4jI,GAA0BC,EAAQnd,EAAUke,EAD9BqE,EAAsBjpI,GAC+B+jI,OAGtE,CACD,IAAImF,EAAgBD,EACpB,MAAME,EAA0BH,EAAehb,IAG3CwU,GAA4BuG,KAC5BG,EAAc1lB,OAAS,KAE3BilB,GAAW/hB,EAAUmd,EAAQqF,EAAeC,EAAyBvE,EAAgBb,GAAY,EACrG,CACJ,CAuGA,SAASqF,GAAiB1iB,EAAU1oF,EAASy/B,GAExB,KAAbA,EAEAipD,EAAS74D,gBAAgB7vB,EAAS,SAGlC0oF,EAASn4E,aAAavQ,EAAS,QAASy/B,EAGhD,CAEA,SAAS4rE,GAAsB3iB,EAAU1oF,EAASgqF,GAC9C,MAAQshB,cAAazpI,UAASysE,UAAW07C,EACrB,OAAhBshB,GACA7iB,GAAgBC,EAAU1oF,EAASsrG,GAEvB,OAAZzpI,GACAupI,GAAiB1iB,EAAU1oF,EAASn+B,GAEzB,OAAXysE,GAnCR,SAASi9D,GAAiB7iB,EAAU1oF,EAASy/B,GAEzCipD,EAASn4E,aAAavQ,EAAS,QAASy/B,EAE5C,CAgCQ8rE,CAAiB7iB,EAAU1oF,EAASsuC,EAE5C,CAkDA,SAASk9D,GAAsBC,GAC3B,OA/BJ,SAASC,KACL,QAAiB5tI,IAAbyrI,KACAA,GAAW,KACP7jB,GAAQimB,cACR,IACIpC,GAAW7jB,GAAQimB,aAAaC,aAAa,UAAW,CACpDC,WAAatnF,GAAMA,EACnBunF,aAAevnF,GAAMA,EACrBwnF,gBAAkBxnF,GAAMA,GAEhC,OAKI,CAIZ,OAAOglF,EACX,CAWWmC,IAAeG,WAAWJ,IAASA,CAC9C,CAmIA,SAASO,GAAY3pH,GACjBqqF,GAAWrqF,CACf,CAOA,SAAS4pH,KACL,QAAiBnuI,IAAb4uG,GACA,OAAOA,GAEN,UAAWrqF,SAAa,IACzB,OAAOA,SAEX,MAAM,IAAImhG,GAAa,KAAkFpF,EAO7G,CAqBA,SAAS8tB,KACL,QAAepuI,IAAX0rI,KACAA,GAAS,KACL9jB,GAAQimB,cACR,IACInC,GAAS9jB,GAAQimB,aACZC,aAAa,wBAAyB,CACvCC,WAAatnF,GAAMA,EACnBunF,aAAevnF,GAAMA,EACrBwnF,gBAAkBxnF,GAAMA,GAEhC,OAKI,CAIZ,OAAOilF,EACX,CASA,SAAS2C,GAA4BV,GACjC,OAAOS,MAAaL,WAAWJ,IAASA,CAC5C,CAoBA,SAASW,GAAiC1oH,GACtC,OAAOwoH,MAAaH,gBAAgBroH,IAAQA,CAChD,CAEA,MAAM2oH,GACF/xI,YAAYgyI,GACR/xI,KAAK+xI,sCAAwCA,CACjD,CACAxtI,WACI,MAAQ,0CAAyCvE,KAAK+xI,8CACzC/oB,KACjB,EAEJ,MAAMgpB,WAAqBF,GACvBG,cACI,MAAO,MACX,EAEJ,MAAMC,WAAsBJ,GACxBG,cACI,MAAO,OACX,EAEJ,MAAME,WAAuBL,GACzBG,cACI,MAAO,QACX,EAEJ,MAAMG,WAAoBN,GACtBG,cACI,MAAO,KACX,EAEJ,MAAMI,WAA4BP,GAC9BG,cACI,MAAO,aACX,EAEJ,SAASK,GAAgBjoI,GACrB,OAAOA,aAAiBynI,GAAgBznI,EAAM0nI,sCAC1C1nI,CACR,CACA,SAASkoI,GAAgCloI,EAAO+B,GAC5C,MAAMomI,EASV,SAASC,GAA0BpoI,GAC/B,OAAOA,aAAiBynI,IAAiBznI,EAAM4nI,eAAiB,IACpE,CAXuBQ,CAA0BpoI,GAC7C,GAAkB,MAAdmoI,GAAsBA,IAAepmI,EAAM,CAE3C,GAAmB,gBAAfomI,GAAsE,QAATpmI,EAC7D,OAAO,EACX,MAAM,IAAIxH,MAAO,mBAAkBwH,YAAeomI,UAAmBxpB,MACzE,CACA,OAAOwpB,IAAepmI,CAC1B,CAaA,SAASsmI,GAA4BC,GACjC,OAAO,IAAIX,GAAaW,EAC5B,CAUA,SAASC,GAA6BC,GAClC,OAAO,IAAIX,GAAcW,EAC7B,CAUA,SAASC,GAA8BC,GACnC,OAAO,IAAIZ,GAAeY,EAC9B,CAUA,SAASC,GAA2BC,GAChC,OAAO,IAAIb,GAAYa,EAC3B,CAUA,SAASC,GAAmCC,GACxC,OAAO,IAAId,GAAoBc,EACnC,CAiBA,MAAMC,GACFrzI,YAAYszI,GACRrzI,KAAKqzI,oBAAsBA,CAC/B,CACAC,oBAAoBpC,GAKhBA,EAAO,0BAA4BA,EACnC,IACI,MAAM/tG,GAAO,IAAIz/B,OAAO6vI,WACnBC,gBAAgBvC,GAAsBC,GAAO,aAC7C/tG,KACL,OAAa,OAATA,EAIOnjC,KAAKqzI,oBAAoBC,oBAAoBpC,IAExD/tG,EAAKa,YAAYb,EAAKwS,YACfxS,EACX,OAEI,OAAO,IACX,CACJ,EAMJ,MAAMswG,GACF1zI,YAAY2zI,GACR1zI,KAAK0zI,WAAaA,EAClB1zI,KAAK2zI,cAAgB3zI,KAAK0zI,WAAW9uE,eAAeC,mBAAmB,qBAC3E,CACAyuE,oBAAoBpC,GAChB,MAAM0C,EAAa5zI,KAAK2zI,cAAcjwG,cAAc,YACpDkwG,SAAWC,UAAY5C,GAAsBC,GACtC0C,CACX,EA6CJ,MAAME,GAAmB,4DACzB,SAASC,GAAa5qH,GAElB,OADAA,EAAM7e,OAAO6e,IACL9D,MAAMyuH,IACH3qH,EAIJ,UAAYA,CACvB,CAEA,SAAS6qH,GAAOh8H,GACZ,MAAMgK,EAAM,CAAC,EACb,UAAW5hB,KAAK4X,EAAKzP,MAAM,KACvByZ,EAAI5hB,IAAK,EACb,OAAO4hB,CACX,CACA,SAASiyH,MAASC,GACd,MAAMlyH,EAAM,CAAC,EACb,UAAWgoC,KAAKkqF,EACZ,UAAWhrE,KAAKlf,EACRA,EAAEl9C,eAAeo8D,KACjBlnD,EAAIknD,IAAK,GAGrB,OAAOlnD,CACX,CAMA,MAAMmyH,GAAgBH,GAAO,0BAGvBI,GAAkCJ,GAAO,kDACzCK,GAAmCL,GAAO,SAU1CM,GAAiBL,GAAME,GAPNF,GAAMG,GAAiCJ,GAAO,oMAI7CC,GAAMI,GAAkCL,GAAO,+LANrCC,GAAMI,GAAkCD,KAWpEG,GAAYP,GAAO,gEAoBnBQ,GAAcP,GAAMM,GAnBPP,GAAO,wdAMPA,GAAO,6qBAmBpBS,GAA8CT,GAAO,yBAK3D,MAAMU,GACF30I,cAGIC,KAAK20I,oBAAqB,EAC1B30I,KAAK40B,IAAM,EACf,CACAggH,iBAAiBvtI,GAIb,IAAIkrC,EAAUlrC,EAAGsuC,WACbk/F,GAAkB,EACtB,KAAOtiG,GAWH,GAVIA,EAAQqd,WAAakO,KAAKjO,aAC1BglF,EAAkB70I,KAAK80I,aAAaviG,GAE/BA,EAAQqd,WAAakO,KAAKpH,UAC/B12D,KAAKovD,MAAM7c,EAAQwiG,WAInB/0I,KAAK20I,oBAAqB,EAE1BE,GAAmBtiG,EAAQoD,WAC3BpD,EAAUA,EAAQoD,gBAGtB,KAAOpD,GAAS,CAERA,EAAQqd,WAAakO,KAAKjO,cAC1B7vD,KAAKg1I,WAAWziG,GAEpB,IAAIle,EAAOr0B,KAAKi1I,sBAAsB1iG,EAASA,EAAQykB,aACvD,GAAI3iC,EAAM,CACNke,EAAUle,EACV,KACJ,CACAke,EAAUvyC,KAAKi1I,sBAAsB1iG,EAASA,EAAQrrC,WAC1D,CAEJ,OAAOlH,KAAK40B,IAAIxtB,KAAK,GACzB,CASA0tI,aAAarvG,GACT,MAAM/9B,EAAU+9B,EAAQo3B,SAAS/0D,cACjC,IAAKwsI,GAAexnI,eAAepF,GAC/B,OAAA1H,KAAK20I,oBAAqB,GAClBF,GAA4C3nI,eAAepF,GAEvE1H,KAAK40B,IAAI3tB,KAAK,KACdjH,KAAK40B,IAAI3tB,KAAKS,GACd,MAAMwtI,EAAUzvG,EAAQwP,WACxB,QAASxtC,EAAI,EAAGA,EAAIytI,EAAQxuI,OAAQe,IAAK,CACrC,MAAM0tI,EAASD,EAAQxnI,KAAKjG,GACtB6mH,EAAW6mB,EAAOpxI,KAClBqxI,EAAQ9mB,EAASxmH,cACvB,IAAK0sI,GAAY1nI,eAAesoI,GAAQ,CACpCp1I,KAAK20I,oBAAqB,EAC1B,QACJ,CACA,IAAItqI,EAAQ8qI,EAAO9qI,MAEfkqI,GAAUa,KACV/qI,EAAQ0pI,GAAa1pI,IACzBrK,KAAK40B,IAAI3tB,KAAK,IAAKqnH,EAAU,KAAM+mB,GAAehrI,GAAQ,IAC9D,CACA,OAAArK,KAAK40B,IAAI3tB,KAAK,MACP,CACX,CACA+tI,WAAWziG,GACP,MAAM7qC,EAAU6qC,EAAQsqB,SAAS/0D,cAC7BwsI,GAAexnI,eAAepF,KAAaysI,GAAcrnI,eAAepF,KACxE1H,KAAK40B,IAAI3tB,KAAK,MACdjH,KAAK40B,IAAI3tB,KAAKS,GACd1H,KAAK40B,IAAI3tB,KAAK,KAEtB,CACAmoD,MAAMA,GACFpvD,KAAK40B,IAAI3tB,KAAKouI,GAAejmF,GACjC,CACA6lF,sBAAsB5oF,EAAMywD,GACxB,GAAIA,IACCzwD,EAAKipF,wBAAwBx4B,GAC1Bh/C,KAAKy3E,kCAAoCz3E,KAAKy3E,+BAClD,MAAM,IAAI3wI,MAAO,6DAA4DynD,EAAKg+B,aAEtF,OAAOyyB,CACX,EAGJ,MAAM04B,GAAwB,kCAExBC,GAA0B,gBAOhC,SAASJ,GAAehrI,GACpB,OAAOA,EAAM4D,QAAQ,KAAM,SACtBA,QAAQunI,GAAuB,SAAUnwH,GAG1C,MAAO,MAAyB,MAFrBA,EAAM4oG,WAAW,GAEN,QADV5oG,EAAM4oG,WAAW,GACmB,OAAU,OAAW,GACzE,GACKhgH,QAAQwnI,GAAyB,SAAUpwH,GAC5C,MAAO,KAAOA,EAAM4oG,WAAW,GAAK,GACxC,GACKhgH,QAAQ,KAAM,QACdA,QAAQ,KAAM,OACvB,CACA,IAAIynI,GAKJ,SAASC,GAAcjC,EAAYkC,GAC/B,IAAIC,EAAmB,KACvB,IACIH,GAAkBA,IA7S1B,SAASI,GAAmBpC,GACxB,MAAML,EAAsB,IAAII,GAAoBC,GACpD,OAwDJ,SAASqC,KACL,IACI,SAAS,IAAIryI,OAAO6vI,WAAYC,gBAAgBvC,GAAsB,IAAK,YAC/E,OAEI,OAAO,CACX,CACJ,CA/DW8E,GAAyB,IAAI3C,GAAgBC,GAAuBA,CAC/E,CA0S6CyC,CAAmBpC,GAExD,IAAIsC,EAAaJ,EAAkBtrI,OAAOsrI,GAAmB,GAC7DC,EAAmBH,GAAgBpC,oBAAoB0C,GAGvD,IAAIC,EAAe,EACfC,EAAaF,EACjB,EAAG,CACC,GAAqB,IAAjBC,EACA,MAAM,IAAIrxI,MAAM,yDAEpBqxI,IACAD,EAAaE,EACbA,EAAaL,EAAiBhC,UAC9BgC,EAAmBH,GAAgBpC,oBAAoB0C,EAC3D,OAASA,IAAeE,GAMxB,OAAOjF,IALW,IAAIyD,IACKE,iBAAiBuB,GAAmBN,IAAqBA,GAKxF,SAGI,GAAIA,EAAkB,CAClB,MAAMh/D,EAASs/D,GAAmBN,IAAqBA,EACvD,KAAOh/D,EAAOlhC,YACVkhC,EAAO7yC,YAAY6yC,EAAOlhC,WAElC,CACJ,CACJ,CACA,SAASwgG,GAAmB9uI,GACxB,MAAO,YAAaA,GAIxB,SAAS+uI,GAAkB/uI,GACvB,OAAOA,EAAGuoD,WAAakO,KAAKjO,cAAgC,aAAhBxoD,EAAGw1D,QACnD,CANgEu5E,CAAkB/uI,GAC1EA,EAAGgvI,QACH,IACR,CAcA,IAAIC,GACH,SAAUA,GACPA,SAAgBA,EAAgBC,KAAU,GAAK,OAC/CD,EAAgBA,EAAgBE,KAAU,GAAK,OAC/CF,EAAgBA,EAAgBG,MAAW,GAAK,QAChDH,EAAgBA,EAAgBI,OAAY,GAAK,SACjDJ,EAAgBA,EAAgBtvD,IAAS,GAAK,MAC9CsvD,EAAgBA,EAAgBK,aAAkB,GAAK,eANhDL,CAOX,CAPC,CAOEA,IAAsC,CAAC,GAiB1C,SAASM,GAAeZ,GACpB,MAAMa,EAAYC,KAClB,OAAID,EACOjF,GAA4BiF,EAAUE,SAAST,GAAgBE,KAAMR,IAAe,IAE3FzD,GAAgCyD,EAAY,QACrCpE,GAA4BU,GAAgB0D,IAEhDL,GAAcjE,KAAevoB,GAAgB6sB,GACxD,CAsCA,SAASgB,GAAcC,GACnB,MAAMJ,EAAYC,KAClB,OAAID,EACOA,EAAUE,SAAST,GAAgBtvD,IAAKiwD,IAAc,GAE7D1E,GAAgC0E,EAAW,OACpC3E,GAAgB2E,GAEpBlD,GAAa5qB,GAAgB8tB,GACxC,CAYA,SAASC,GAAsBC,GAC3B,MAAMN,EAAYC,KAClB,GAAID,EACA,OAAOhF,GAAiCgF,EAAUE,SAAST,GAAgBK,aAAcQ,IAAsB,IAEnH,GAAI5E,GAAgC4E,EAAmB,eACnD,OAAOtF,GAAiCS,GAAgB6E,IAE5D,MAAM,IAAIluB,GAAa,KAAyDpF,EACpF,CAwGA,SAASuzB,GAA2BH,EAAW54F,EAAKxiC,GAChD,OAzBJ,SAASw7H,GAAgBh5F,EAAKxiC,GAC1B,MAAc,QAATA,IACQ,UAARwiC,GAA2B,UAARA,GAA2B,WAARA,GAA4B,UAARA,GAC/C,WAARA,IACM,SAATxiC,IAA4B,SAARwiC,GAA0B,SAARA,GAChC64F,GAEJF,EACX,CAiBWK,CAAgBh5F,EAAKxiC,EAArBw7H,CAA2BJ,EACtC,CAiBA,SAASH,KACL,MAAMlb,EAAQqB,KACd,OAAOrB,GAASA,EAAM5F,IAAa6gB,SACvC,CAQA,MAAMS,GAA0B,IAAIllC,GAAe,2BAU7CmlC,GAAW,IAAInlC,GAAe,YAGpC,GAEMolC,GAAqB,IAAIplC,GAAe,sBAE9C,MAAMqlC,GACFlqI,IAAI0mC,EAAO+2E,EAAgBO,IACvB,GAAIP,IAAkBO,GAAoB,CACtC,MAAM78F,EAAQ,IAAI9pB,MAAO,sCAAqCmiB,GAAUktB,OACxEvlB,QAAM3qB,KAAO,oBACP2qB,CACV,CACA,OAAOs8F,CACX,EAOJ,SAASjE,GAAyBJ,GAC9B,MAAO,CACHG,gBAAYH,EAEpB,CAyCA,SAAS+wB,MAAuB/zC,GAC5B,MAAO,CACHmjB,gBAAY6wB,GAA4B,EAAMh0C,GAC9Ci0C,oBAAe,EAEvB,CACA,SAASD,GAA4BE,KAA0Bl0C,GAC3D,MAAMm0C,EAAe,GACfC,EAAQ,IAAI31E,IAClB,IAAI41E,EACJ,MAAMC,EAAoBC,IACtBJ,EAAa7wI,KAAKixI,EAAQ,EAE9B9O,UAAYzlC,EAASz4F,IAQjB,MAAMitI,EAAiBjtI,EACnBktI,GAAiBD,EAAgBF,EAAkB,GAAIF,KACvDC,IAA+B,GAC/BA,EAA2B/wI,KAAKkxI,GAAc,QAInB50I,IAA/By0I,GACAK,GAAkCL,EAA4BC,GAE3DH,CACX,CAKA,SAASO,GAAkCC,EAAoBC,GAC3D,QAAS9wI,EAAI,EAAGA,EAAI6wI,EAAmB5xI,OAAQe,IAAK,CAChD,MAAQ+wI,WAAU7xB,aAAc2xB,EAAmB7wI,GACnDgxI,GAAoB9xB,EAAWuxB,IAE3BK,EAAQL,EAAUM,EAAQ,EAElC,CACJ,CAUA,SAASJ,GAAiBhN,EAAWmN,EAASG,EAASX,GAEnD,KADA3M,EAAYviB,GAAkBuiB,IAE1B,OAAO,EAGX,IAAIuN,EAAU,KACVC,EAAS3uB,GAAemhB,GAC5B,MAAMyN,GAAUD,GAAUzlB,GAAgBiY,GAC1C,GAAKwN,GAAWC,EAgBX,IAAIA,IAAWA,EAAOhhC,WACvB,OAAO,EAGP8gC,EAAUvN,MApBU,CAMpB,MAAMoN,EAAWpN,EAAUoN,SAE3B,GADAI,EAAS3uB,GAAeuuB,IACpBI,EAKA,OAAO,EAJPD,EAAUH,CAMlB,CAcA,MAAMM,EAAcf,EAAMzwH,IAAIqxH,GAC9B,GAAIE,EAAQ,CACR,GAAIC,EAEA,OAAO,EAGX,GADAf,EAAMxwH,IAAIoxH,GACNE,EAAO9mB,aAAc,CACrB,MAAM5zB,EAAsC,mBAAxB06C,EAAO9mB,aAA8B8mB,EAAO9mB,eAAiB8mB,EAAO9mB,aACxF,UAAWsD,KAAOl3B,EACdi6C,GAAiB/iB,EAAKkjB,EAASG,EAASX,EAEhD,CACJ,UACSa,EAwDL,OAAO,EAxDM,CAEb,GAAsB,MAAlBA,EAAOr6C,UAAoBu6C,EAAa,CAMxC,IAAIC,EADJhB,EAAMxwH,IAAIoxH,GAEV,IACIvP,GAAYwP,EAAOr6C,QAASy6C,IACpBZ,GAAiBY,EAAUT,EAASG,EAASX,KAC7CgB,IAA6B,GAG7BA,EAAyB9xI,KAAK+xI,GAAQ,EAGlD,SAIA,MAIiCz1I,IAA7Bw1I,GACAV,GAAkCU,EAA0BR,EAEpE,CACA,IAAKO,EAAa,CAGd,MAAM/1I,EAAU80H,GAAc8gB,IAAO,KAAY,IAAIA,GAKrDJ,EAAQ,CAAEz6C,QAAS66C,EAASr6C,WAAYv7F,EAASo7F,KAAMmY,IAAeqiC,GAEtEJ,EAAQ,CAAEz6C,QAAS05C,GAAoBt5C,SAAUy6C,EAAS16C,OAAO,GAAQ06C,GAEzEJ,EAAQ,CAAEz6C,QAASw5C,GAAyBp5C,SAAUA,IAAM4X,GAAS6iC,GAAU16C,OAAO,GAAQ06C,EAClG,CAEA,MAAMM,EAAeL,EAAOjyB,UAC5B,GAAoB,MAAhBsyB,IAAyBH,EAAa,CACtC,MAAMI,EAAe9N,EACrBqN,GAAoBQ,EAAcf,IAE9BK,EAAQL,EAAUgB,EAAY,EAEtC,CACJ,CAGW,CAEX,OAAQP,IAAYvN,QACQ7nI,IAAxB6nI,EAAUzkB,SAClB,CAYA,SAAS8xB,GAAoB9xB,EAAW1gG,GACpC,QAASiyH,KAAYvxB,EACboC,GAAuBmvB,KACvBA,EAAWA,EAASpxB,iBAEpBjgH,MAAMC,QAAQoxI,GACdO,GAAoBP,EAAUjyH,GAG9BA,EAAGiyH,EAGf,CACA,MAAMiB,GAAchxB,GAAuB,CAAErqB,QAASxzF,OAAQ4zF,SAAUiqB,KACxE,SAASixB,GAAgB/uI,GACrB,OAAiB,OAAVA,GAAkC,iBAATA,GAAqB8uI,MAAe9uI,CACxE,CAOA,SAASgvI,GAAehvI,GACpB,MAAwB,mBAAVA,CAClB,CAUA,MAAMivI,GAAiB,IAAIlnC,GAAe,uBAKpCmnC,GAAU,CAAC,EAQXC,GAAW,CAAC,EAIlB,IAAIC,GACJ,SAASC,KACL,YAAsBn2I,IAAlBk2I,KACAA,GAAgB,IAAIhC,IAEjBgC,EACX,CAKA,MAAME,IAEN,MAAMC,WAAmBD,GAIrB,aAAIE,GACA,OAAO75I,KAAK85I,UAChB,CACA/5I,YAAY4mH,EAAW9vC,EAAQ3rE,EAAQ6uI,GACnCzjH,QACAt2B,KAAK62E,OAASA,EACd72E,KAAKkL,OAASA,EACdlL,KAAK+5I,OAASA,EAMd/5I,KAAKg6I,QAAU,IAAI9sI,IAInBlN,KAAKi6I,kBAAoB,IAAI73E,IAC7BpiE,KAAKk6I,gBAAkB,GACvBl6I,KAAK85I,YAAa,EAElBK,GAAsBxzB,EAAWuxB,GAAYl4I,KAAKo6I,gBAAgBlC,IAElEl4I,KAAKg6I,QAAQvsI,IAAI8pI,GAAU8C,QAAW92I,EAAWvD,OAE7C+5I,EAAOzyH,IAAI,gBACXtnB,KAAKg6I,QAAQvsI,IAAIksI,GAAqBU,QAAW92I,EAAWvD,OAIhE,MAAMi2E,EAASj2E,KAAKg6I,QAAQzsI,IAAI+rI,IAClB,MAAVrjE,GAA0C,iBAAjBA,EAAO5rE,OAChCrK,KAAK+5I,OAAOxyH,IAAI0uD,EAAO5rE,OAE3BrK,KAAKs6I,iBACD,IAAIl4E,IAAIpiE,KAAKuN,IAAIiqI,GAAmBv5C,MAAOqY,GAAagU,GAAYG,MAC5E,CAOA70C,UACI51E,KAAKu6I,qBAELv6I,KAAK85I,YAAa,EAClB,IAEI,UAAWU,KAAWx6I,KAAKi6I,kBACvBO,EAAQhkG,cAEZ,MAAMikG,EAAiBz6I,KAAKk6I,gBAG5Bl6I,KAAKk6I,gBAAkB,GACvB,UAAW3/G,KAAQkgH,EACflgH,GAER,SAGIv6B,KAAKg6I,QAAQh7H,QACbhf,KAAKi6I,kBAAkBj7H,QACvBhf,KAAKs6I,iBAAiBt7H,OAC1B,CACJ,CACAq1G,UAAUtrH,GACN,OAAA/I,KAAKu6I,qBACLv6I,KAAKk6I,gBAAgBjzI,KAAK8B,GACnB,IAAM/I,KAAK06I,gBAAgB3xI,EACtC,CACAy6G,aAAav9F,GACTjmB,KAAKu6I,qBACL,MAAMI,EAAmB9uB,EAAmB7rH,MACtC2kI,EAA+B9Z,QAAwBtnH,GAK7D,IACI,OAAO0iB,GACX,SAEI4lG,EAAmB8uB,GACnB9vB,GAAwB8Z,EAE5B,CACJ,CACAp3H,IAAI0mC,EAAO+2E,EAAgBO,GAAoBN,EAAQX,GAAYC,SAE/D,GADAvqH,KAAKu6I,qBACDtmG,EAAMnnC,eAAe6gH,IACrB,OAAO15E,EAAM05E,IAAW3tH,MAE5BirH,EAAQgB,GAAkBhB,GAM1B,MAAM0vB,EAAmB9uB,EAAmB7rH,MACtC2kI,EAA+B9Z,QAAwBtnH,GAC7D,IAEI,KAAM0nH,EAAQX,GAAYI,UAAW,CAEjC,IAAIz0C,EAASj2E,KAAKg6I,QAAQzsI,IAAI0mC,GAC9B,QAAe1wC,IAAX0yE,EAAsB,CAGtB,MAAMy7C,EA2R1B,SAASkpB,GAAsBvwI,GAC3B,MAAyB,mBAAVA,GACO,iBAAVA,GAAsBA,aAAiB+nG,EACvD,CA9RgCwoC,CAAsB3mG,IAAU01E,GAAiB11E,GASzDgiC,EARAy7C,GAAO1xH,KAAK66I,qBAAqBnpB,GAQxB2oB,GAAWS,GAAkC7mG,GAAQslG,IAGrD,KAEbv5I,KAAKg6I,QAAQvsI,IAAIwmC,EAAOgiC,EAC5B,CAEA,GAAc,MAAVA,EACA,OAAOj2E,KAAK+6I,QAAQ9mG,EAAOgiC,EAEnC,CAMA+0C,OAHuBC,EAAQX,GAAYG,KAAsBivB,KAAd15I,KAAK62E,QAMpCtpE,IAAI0mC,EAHxB+2E,EAAiBC,EAAQX,GAAYK,UAAaK,IAAkBO,GAChE,KACAP,EAER,OACO94G,GACH,GAAe,sBAAXA,EAAEnO,KAA8B,CAGhC,IAFamO,EAAEu5G,IAAsBv5G,EAAEu5G,KAAuB,IACzDrhD,QAAQrjD,GAAUktB,IACnB0mG,EAEA,MAAMzoI,EAIN,OArpQpB,SAAS8oI,GAAmB9oI,EAAG+hC,EAAOgnG,EAAmB/vI,GACrD,MAAMgwI,EAAYhpI,EAAEu5G,IACpB,MAAIx3E,EAAM03E,KACNuvB,EAAU9wE,QAAQn2B,EAAM03E,KAE5Bz5G,EAAElG,QAKN,SAASmvI,GAAYxuF,EAAMtpD,EAAK43I,EAAmB/vI,EAAS,MACxDyhD,EAAOA,GAA2B,OAAnBA,EAAK4C,OAAO,IAxMX,UAwM0B5C,EAAK4C,OAAO,GAAoB5C,EAAK3iD,MAAM,GAAK2iD,EAC1F,IAAIj5C,EAAUqT,GAAU1jB,GACxB,GAAIwD,MAAMC,QAAQzD,GACdqQ,EAAUrQ,EAAI8E,IAAI4e,IAAW3f,KAAK,aAAM,GAEpB,iBAAR/D,EAAkB,CAC9B,IAAI8wB,EAAQ,GACZ,QAAS5sB,KAAOlE,EACZ,GAAIA,EAAIyJ,eAAevF,GAAM,CACzB,IAAI8C,EAAQhH,EAAIkE,GAChB4sB,EAAMltB,KAAKM,EAAM,KAAwB,iBAAV8C,EAAqByc,KAAKC,UAAU1c,GAAS0c,GAAU1c,IAC1F,CAEJqJ,EAAW,IAAGygB,EAAM/sB,KAAK,QAC7B,CACA,MAAQ,GAAE6zI,IAAoB/vI,EAAS,IAAMA,EAAS,IAAM,MAAMwI,OAAai5C,EAAK1+C,QAAQy9G,GAAU,SAC1G,CAtBgByvB,CAAY,KAAOjpI,EAAElG,QAASkvI,EAAWD,EAAmB/vI,GACxEgH,EAAe,YAAIgpI,EACnBhpI,EAAEu5G,IAAsB,KAClBv5G,CACV,CA4oQ2B8oI,CAAmB9oI,EAAG+hC,EAAO,kBAAmBj0C,KAAKkL,OAEpE,CAEI,MAAMgH,CAEd,SAGI24G,GAAwB8Z,GACxB9Y,EAAmB8uB,EAEvB,CACJ,CAEAS,8BACI,MAAMT,EAAmB9uB,EAAmB7rH,MACtC2kI,EAA+B9Z,QAAwBtnH,GAK7D,IACI,MAAM83I,EAAer7I,KAAKuN,IAAI+pI,GAAwBr5C,MAAOqY,GAAagU,GAAYG,MAOtF,UAAW6wB,KAAeD,EACtBC,GAER,SAEIzvB,EAAmB8uB,GACnB9vB,GAAwB8Z,EAE5B,CACJ,CACApgI,WACI,MAAMg3I,EAAS,GACTvB,EAAUh6I,KAAKg6I,QACrB,UAAW/lG,KAAS+lG,EAAQ7wI,OACxBoyI,EAAOt0I,KAAK8f,GAAUktB,IAE1B,MAAQ,cAAasnG,EAAOn0I,KAAK,QACrC,CACAmzI,qBACI,GAAIv6I,KAAK85I,WACL,MAAM,IAAI7wB,GAAa,KAAuDpF,EAEtF,CAIAu2B,gBAAgBlC,GAIZ,IAAIjkG,EAAQolG,GADZnB,EAAWrvB,GAAkBqvB,IACUA,EAAWrvB,GAAkBqvB,GAAYA,EAASp6C,SAEzF,MAAM7nB,EAqHd,SAASulE,GAAiBtD,GACtB,OAAIkB,GAAgBlB,GACTmC,QAAW92I,EAAW20I,EAASh6C,UAI/Bm8C,GADSoB,GAAkBvD,GACPqB,GAEnC,CA7HuBiC,CAAiBtD,GAYhC,GAAKmB,GAAenB,KAAgC,IAAnBA,EAASj6C,MAmBrBj+F,KAAKg6I,QAAQzsI,IAAI0mC,OAnBoB,CAGtD,IAAIynG,EAAc17I,KAAKg6I,QAAQzsI,IAAI0mC,GAC/BynG,IAOAA,EAAcrB,QAAW92I,EAAWg2I,IAAS,GAC7CmC,EAAY34I,QAAU,IAAMopH,GAAWuvB,EAAYz9C,OACnDj+F,KAAKg6I,QAAQvsI,IAAIwmC,EAAOynG,IAE5BznG,EAAQikG,EACRwD,EAAYz9C,MAAMh3F,KAAKixI,EAC3B,CAOAl4I,KAAKg6I,QAAQvsI,IAAIwmC,EAAOgiC,EAC5B,CACA8kE,QAAQ9mG,EAAOgiC,GAIN,OAAIA,EAAO5rE,QAAUkvI,KACtBtjE,EAAO5rE,MAAQmvI,GAQXvjE,EAAO5rE,MAAQ4rE,EAAOlzE,WAGF,iBAAjBkzE,EAAO5rE,OAAsB4rE,EAAO5rE,OA0HvD,SAASsxI,GAAatxI,GAClB,OAAiB,OAAVA,GAAmC,iBAAVA,GACC,mBAAtBA,EAAMmsC,WACrB,CA7HgEmlG,CAAa1lE,EAAO5rE,QACxErK,KAAKi6I,kBAAkB1yH,IAAI0uD,EAAO5rE,OAE/B4rE,EAAO5rE,KAClB,CACAwwI,qBAAqBnpB,GACjB,IAAKA,EAAIzuH,WACL,OAAO,EAEX,MAAMA,EAAa4lH,GAAkB6I,EAAIzuH,YACzC,MAA0B,iBAAfA,EACe,QAAfA,GAAyBjD,KAAK+5I,OAAOzyH,IAAIrkB,GAGzCjD,KAAKs6I,iBAAiBhzH,IAAIrkB,EAEzC,CACAy3I,gBAAgB3xI,GACZ,MAAM6yI,EAAe57I,KAAKk6I,gBAAgBxtH,QAAQ3jB,IAC7B,IAAjB6yI,GACA57I,KAAKk6I,gBAAgBxyH,OAAOk0H,EAAc,EAElD,EAEJ,SAASd,GAAkC7mG,GAEvC,MAAMi3E,EAAgBvB,GAAiB11E,GACjClxC,EAA4B,OAAlBmoH,EAAyBA,EAAcnoH,QAAU80H,GAAc5jF,GAC/E,GAAgB,OAAZlxC,EACA,OAAOA,EAIX,GAAIkxC,aAAiBm+D,GACjB,MAAM,IAAI6W,GAAa,KAAoDpF,GAG/E,GAAI5vE,aAAiB9kB,SACjB,OAKR,SAAS0sH,GAAgC5nG,GAErC,MAAM6nG,EAAc7nG,EAAMvtC,OAC1B,GAAIo1I,EAAc,EAEd,MADavS,GAASuS,EAAa,KAC7B,IAAI7yB,GAAa,KAAoDpF,GAO/E,MAAMk4B,EAj4RV,SAASC,GAA0B5vI,GAE/B,OADYA,IAASA,EAAKy9G,KAAgBz9G,EAAK09G,MAQpC,IAEf,CAs3RmCkyB,CAA0B/nG,GACzD,OAA+B,OAA3B8nG,EACO,IAAMA,EAAuBh5I,QAAQkxC,GAGrC,IAAM,IAAIA,CAEzB,CAxBe4nG,CAAgC5nG,GAG3C,MAAM,IAAIg1E,GAAa,KAAoDpF,EAC/E,CAmCA,SAAS43B,GAAkBvD,EAAU+D,EAAct1B,GAC/C,IAAI5jH,EAIJ,GAAIs2I,GAAenB,GAAW,CAC1B,MAAMgE,EAAoBrzB,GAAkBqvB,GAC5C,OAAOrgB,GAAcqkB,IAAsBpB,GAAkCoB,EACjF,IAEQ9C,GAAgBlB,GAChBn1I,EAAUA,IAAM8lH,GAAkBqvB,EAASh6C,eAAQ,GApZ/D,SAASi+C,GAAkB9xI,GACvB,SAAUA,IAASA,EAAMi0F,WAC7B,CAoZiB69C,CAAkBjE,GACvBn1I,EAAUA,IAAMm1I,EAAS55C,cAAc6tB,GAAW+rB,EAAS/5C,MAAQ,UAAG,GA1ZlF,SAASi+C,GAAmB/xI,GACxB,SAAUA,IAASA,EAAMu8G,YAC7B,CA0ZiBw1B,CAAmBlE,GACxBn1I,EAAUA,IAAM+yG,GAAS+S,GAAkBqvB,EAAStxB,kBAEnD,CACD,MAAMy1B,EAAWxzB,GAAkBqvB,IAC9BA,EAASl6C,UAAYk6C,EAASp6C,UAInC,IAiBZ,SAASw+C,GAAQjyI,GACb,QAASA,EAAM8zF,IACnB,CAnBgBm+C,CAAQpE,GAIR,OAAOrgB,GAAcwkB,IAAavB,GAAkCuB,GAHpEt5I,EAAUA,IAAM,IAAKs5I,KAAalwB,GAAW+rB,EAAS/5C,MAK9D,CAEJ,OAAOp7F,CACX,CACA,SAASs3I,GAAWt3I,EAASsH,EAAO4zF,GAAQ,GACxC,MAAO,CACHl7F,QAASA,EACTsH,MAAOA,EACP4zF,MAAOA,EAAQ,QAAK16F,EAE5B,CAYA,SAAS42I,GAAsBxzB,EAAW1gG,GACtC,UAAWiyH,KAAYvxB,EACf9/G,MAAMC,QAAQoxI,GACdiC,GAAsBjC,EAAUjyH,GAE3BiyH,GAAYnvB,GAAuBmvB,GACxCiC,GAAsBjC,EAASpxB,gBAAY7gG,GAG3CA,EAAGiyH,EAGf,CAgCA,MAAMqE,GAAS,IAAInqC,GAAe,QAAS,CACvCnvG,WAAY,OACZF,QAASA,IAAMy5I,KAGbA,GAAiB,KAKjBC,GAAuB,IAAIrqC,GAAe,wBAK1C0T,GAAc,IAAI1T,GAAe,cAAe,CAClDnvG,WAAY,WACZF,QAASA,IAAM,YA0Bb25I,GAAY,IAAItqC,GAAe,YAAa,CAC9CnvG,WAAY,OACZF,QAASA,IAkBE2uI,KAAcvuG,MAAM+kB,cAAc,iBAAiBhgD,aAAa,eAAiB,OAkMhG,IAAIy0I,GAA6BA,CAAChR,EAAOzwB,EAAU0c,IAAe,KAmFlE,SAASglB,GAAsBjR,EAAOzwB,EAAU0c,GAAa,GACzD,OAAO+kB,GAA2BhR,EAAOzwB,EAAU0c,EACvD,CAgJA,MAAMilB,IAcN,MAAMC,IAYN,MAAMC,GACFC,wBAAwBzsH,GACpB,MAXR,SAAS0sH,GAAwB1sH,GAC7B,MAAM7B,EAAQ9pB,MAAO,kCAAiCmiB,GAAUwJ,OAChE7B,SAAqB,YAAI6B,EAClB7B,CACX,CAOcuuH,CAAwB1sH,EAClC,EAEJ,IAeM2sH,GAA0B,MAAhC,MAAMA,EAA2B/8I,SACpBH,KAAKm9I,KAAwB,IAAIJ,GAC7C,OAFKG,CAA0B,KAShC,SAASE,KACL,OAAOC,GAAiB9f,KAAmBN,KAC/C,CAQA,SAASogB,GAAiB5tB,EAAOmM,GAC7B,OAAO,IAAI0hB,GAAWzhB,GAAiBpM,EAAOmM,GAClD,CAeA,IACM0hB,GAAU,MAAhB,MAAMA,EACFv9I,YAAY23G,GACR13G,KAAK03G,cAAgBA,CACzB,CACAv3G,SAISH,KAAKsrH,kBAAoB8xB,GACrC,OATKE,CAAU,KAgBhB,SAASC,GAAiBlzI,GACtB,OAAOA,aAAiBizI,GAAajzI,EAAMqtG,cAAgBrtG,CAC/D,CAOA,MAAMmzI,IAEN,IAeMC,GAAS,MAAf,MAAMA,EACF19I,cAKIC,KAAKmsI,YAAc,IACvB,CACAhsI,SAISH,KAAKsrH,kBAAoB,IAGtC,SAASoyB,KAGL,MAAM9hB,EAAQqB,KAER0gB,EAAc5hB,GADNwB,KACqCjqH,MAAOsoH,GAC1D,OAAQvE,GAAQsmB,GAAeA,EAAc/hB,GAAO3F,GACxD,CAV4CynB,GAC3C,OAbKD,CAAS,KA6BTG,GAAS,MAAf,MAAMA,EACFz9I,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CACrC1nE,MAAO2pG,EACP36I,WAAY,OACZF,QAASA,IAAM,OAEtB,OAPK66I,CAAS,KAcf,MAAMC,GACF99I,YAAY+9I,GACR99I,KAAK89I,KAAOA,EACZ99I,KAAK6+F,MAAQi/C,EAAKv1I,MAAM,KAAK,GAC7BvI,KAAK+9I,MAAQD,EAAKv1I,MAAM,KAAK,GAC7BvI,KAAKs6D,MAAQwjF,EAAKv1I,MAAM,KAAKyB,MAAM,GAAG5C,KAAK,IAC/C,EAKJ,MAAMw3F,GAAU,IAAIi/C,GAAQ,WAmBtBG,GAAwC,CAAC,EA8J/C,SAASC,GAAetF,EAAS9hE,EAAS,KAAMqnE,EAAsB,KAAMn6I,GACxE,MAAMm3G,EAAWijC,GAAuCxF,EAAS9hE,EAAQqnE,EAAqBn6I,GAC9Fm3G,SAASkgC,8BACFlgC,CACX,CAMA,SAASijC,GAAuCxF,EAAS9hE,EAAS,KAAMqnE,EAAsB,KAAMn6I,EAAMg2I,EAAS,IAAI33E,KACnH,MAAMukD,EAAY,CACdu3B,GAAuB5nC,GACvBohC,GAAoBiB,IAExB50I,SAAOA,IAA4B,iBAAZ40I,OAAuBp1I,EAAYwjB,GAAU4xH,IAC7D,IAAIiB,GAAWjzB,EAAW9vC,GAAU6iE,KAAmB31I,GAAQ,KAAMg2I,EAChF,CAEA,IAwBMqE,GAAQ,MAAd,MAAMA,EAASj+I,SACFH,KAAKurH,mBAAqBA,GAAkBprH,SAC5CH,KAAKm9I,KAAwB,IAAI1F,GAC1C,aAAOvxC,CAAOhgG,EAAS2wE,GACnB,GAAIhwE,MAAMC,QAAQZ,GACd,OAAO+3I,GAAe,CAAEl6I,KAAM,IAAM8yE,EAAQ3wE,EAAS,IAEpD,CACD,MAAMnC,EAAOmC,EAAQnC,MAAQ,GAC7B,OAAOk6I,GAAe,CAAEl6I,QAAQmC,EAAQ2wE,OAAQ3wE,EAAQygH,UAAW5iH,EACvE,CACJ,CACA5D,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CACrC1nE,MAAOmqG,EACPn7I,WAAY,MACZF,QAASA,IAAM+yG,GAASyhC,MAE5Bp3I,SAISH,KAAKsrH,mBAAoB,EACrC,OAvBK8yB,CAAQ,KAuDd,SAASC,GAAiB3vH,GACtB,OAAOA,EAA0B,eACrC,CA2BA,MAAMgvE,GACF39F,cAIIC,KAAKs+I,SAAWt1I,OACpB,CACAkqC,YAAYxkB,GACR,MAAM6vH,EAAgBv+I,KAAKw+I,mBAAmB9vH,GAC9C1uB,KAAKs+I,SAAS5vH,MAAM,QAASA,GACzB6vH,GACAv+I,KAAKs+I,SAAS5vH,MAAM,iBAAkB6vH,EAE9C,CAEAC,mBAAmB9vH,GACf,IAAIxc,EAAIwc,GAAS2vH,GAAiB3vH,GAClC,KAAOxc,GAAKmsI,GAAiBnsI,IACzBA,EAAImsI,GAAiBnsI,GAEzB,OAAOA,GAAK,IAChB,EAwEJ,SAASusI,GAAex4H,GACpB,OAAQ5b,IACJg1B,WAAWpZ,OAAI1iB,EAAW8G,EAAK,CAEvC,CAIA,MAAMwqG,GA1CN,MAAM6pC,WAAsBt6C,IACxBrkG,YAAY4+I,GAAU,GAClBroH,QACAt2B,KAAK4+I,UAAYD,CACrB,CACArlI,KAAKjP,GACDisB,MAAMjC,KAAKhqB,EACf,CACAksC,UAAU0uD,EAAgBv2E,EAAO6mC,GAC7B,IAAIspF,EAAS55C,EACT65C,EAAUpwH,QAAgB,MAC1BqwH,EAAaxpF,EACjB,GAAI0vC,GAA4C,iBAAnBA,EAA6B,CACtD,MAAMz9B,EAAWy9B,EACjB45C,EAASr3E,EAASnzC,MAAMtH,KAAKy6C,GAC7Bs3E,EAAUt3E,EAAS94C,OAAO3B,KAAKy6C,GAC/Bu3E,EAAav3E,EAASjS,UAAUxoC,KAAKy6C,EACzC,CACIxnE,KAAK4+I,YACLE,EAAUL,GAAeK,GACrBD,IACAA,EAASJ,GAAeI,IAExBE,IACAA,EAAaN,GAAeM,KAGpC,MAAMr5C,EAAOpvE,MAAMigB,UAAU,CAAEliB,KAAMwqH,EAAQnwH,MAAOowH,EAASvpF,SAAUwpF,IACvE,OAAI95C,aAA0B3uD,MAC1B2uD,EAAe19E,IAAIm+E,GAEhBA,CACX,GAYJ,SAAS8C,MAAQ5+F,GACb,CAmIJ,MAAMo1I,GACFj/I,aAAck/I,wBAAuB,EAAOC,sCAAqC,EAAOC,oCAAmC,IA2BvH,GA1BAn/I,KAAKo/I,sBAAuB,EAC5Bp/I,KAAKq/I,sBAAuB,EAI5Br/I,KAAKs/I,UAAW,EAIhBt/I,KAAKu/I,WAAa,IAAI1qC,IAAa,GAMnC70G,KAAKw/I,iBAAmB,IAAI3qC,IAAa,GAMzC70G,KAAKy/I,SAAW,IAAI5qC,IAAa,GAIjC70G,KAAK4tG,QAAU,IAAIiH,IAAa,UACrBviE,KAAQ,IACf,MAAM,IAAI22E,GAAa,KAA2CpF,GAEtEvxE,KAAKotG,oBACL,MAAM/7I,EAAO3D,KACb2D,EAAKg8I,SAAW,EAChBh8I,EAAKi8I,OAASj8I,EAAKk8I,OAASvtG,KAAKC,QAS7BD,KAAKwtG,uBACLn8I,EAAKk8I,OAASl8I,EAAKk8I,OAAOE,KAAK,IAAIztG,KAAKwtG,uBAExCb,GAAwB3sG,KAAK0tG,yBAC7Br8I,EAAKk8I,OAASl8I,EAAKk8I,OAAOE,KAAKztG,KAAK0tG,yBAIxCr8I,EAAKu7I,oCACAC,GAAoCD,EACzCv7I,EAAKw7I,iCAAmCA,EACxCx7I,EAAKs8I,6BAA8B,EACnCt8I,EAAKu8I,4BAvLb,SAASC,KAKL,MAAM53F,EAAwD,mBAArC4iE,GAAQlgF,sBAOjC,IAAIi1G,EAA8B/0B,GAAQ5iE,EAAY,wBAA0B,cAC5E63F,EAA6Bj1B,GAAQ5iE,EAAY,uBAAyB,gBAC9E,UAAWjW,KAAS,KAAe4tG,GAA+BE,EAA4B,CAO1F,MAAMC,EAAiCH,EAA4B5tG,KAAKi1B,WAAW,qBAC/E84E,IACAH,EAA8BG,GAElC,MAAMC,EAAgCF,EAA2B9tG,KAAKi1B,WAAW,qBAC7E+4E,IACAF,EAA6BE,EAErC,CACA,MAAO,CAAEJ,8BAA6BE,6BAC1C,CAwJ2CD,GAAiCD,4BAkK5E,SAASK,GAAiCC,GACtC,MAAMC,EAAwCA,MAzClD,SAASC,GAA8BF,GAc/BA,EAAKG,uBAA6D,IAArCH,EAAKP,8BAGtCO,EAAKP,4BAA8BO,EAAKN,4BAA4Bx7I,KAAKymH,GAAS,KAUzEq1B,EAAKI,mBACNJ,EAAKI,iBAAmBtuG,KAAKG,KAAKouG,kBAAkB,mBAAoB,KACpEL,EAAKP,6BAA8B,EACnCa,GAAsBN,GACtBA,EAAKG,sBAAuB,EAC5BI,GAAYP,GACZA,EAAKG,sBAAuB,QAC7Bp9I,EAAW,OAAW,SAE7Bi9I,EAAKI,iBAAiBI,QAAO,GAEjCF,GAAsBN,GAC1B,CAGQE,CAA8BF,EAAI,EAEtCA,EAAKX,OAASW,EAAKX,OAAOE,KAAK,CAC3Bh8I,KAAM,UACNk9I,WAAY,CAAEC,eAAiB,GAC/BC,aAAcA,CAAC/wC,EAAU79D,EAASlmC,EAAQ8hC,EAAMizG,EAAWC,KACvD,GA0JZ,SAASC,GAAsBD,GAM3B,SALKx6I,MAAMC,QAAQu6I,IAKM,IAArBA,EAAU36I,UAIuC,IAA9C26I,EAAU,GAAGhyI,MAAOkyI,kBAC/B,CArKgBD,CAAsBD,GACtB,OAAOjxC,EAASoxC,WAAWn1I,EAAQ8hC,EAAMizG,EAAWC,GAExD,IACII,UAAQjB,GACDpwC,EAASoxC,WAAWn1I,EAAQ8hC,EAAMizG,EAAWC,EACxD,UAESb,EAAKtB,oCAAoD,cAAd/wG,EAAK/hC,MACjDo0I,EAAKrB,mCACLsB,IAEJiB,GAAQlB,EACZ,GAEJmB,SAAUA,CAACvxC,EAAU79D,EAASlmC,EAAQtD,EAAUq4I,EAAWC,EAAWn2I,KAClE,IACIu2I,UAAQjB,GACDpwC,EAAS4wC,OAAO30I,EAAQtD,EAAUq4I,EAAWC,EAAWn2I,EACnE,SAEQs1I,EAAKrB,kCACLsB,IAEJiB,GAAQlB,EACZ,GAEJoB,UAAWA,CAACxxC,EAAU79D,EAASlmC,EAAQw1I,KACnCzxC,EAAS0xC,QAAQz1I,EAAQw1I,GACrBtvG,IAAYlmC,IAGe,aAAvBw1I,EAAaE,QACbvB,EAAKwB,sBAAwBH,EAAaI,UAC1CnB,GAAsBN,GACtBO,GAAYP,IAEgB,aAAvBqB,EAAaE,SAClBvB,EAAKpB,qBAAuByC,EAAaK,aAIrDC,cAAeA,CAAC/xC,EAAU79D,EAASlmC,EAAQqiB,KACvC0hF,EAASl9D,YAAY7mC,EAAQqiB,GAC7B8xH,EAAKhuG,kBAAkB,IAAMguG,EAAK5yC,QAAQt0F,KAAKoV,KACxC,IAGnB,CAzNQ6xH,CAAiC58I,EACrC,CAIA,sBAAOy+I,GAEH,cAAc9vG,KAAS,MAAqD,IAAtCA,KAAKC,QAAQhlC,IAAI,gBAC3D,CAIA,0BAAO80I,GACH,IAAKrD,GAAOoD,kBACR,MAAM,IAAIn5B,GAAa,KAAkDpF,EAEjF,CAIA,6BAAOy+B,GACH,GAAItD,GAAOoD,kBACP,MAAM,IAAIn5B,GAAa,KAAkDpF,EAEjF,CAaAthG,IAAI0D,EAAIm7H,EAAWC,GACf,OAAOrhJ,KAAK6/I,OAAOt9H,IAAI0D,EAAIm7H,EAAWC,EAC1C,CAaAkB,QAAQt8H,EAAIm7H,EAAWC,EAAWt9I,GAC9B,MAAMy8I,EAAOxgJ,KAAK6/I,OACZ1xG,EAAOqyG,EAAKK,kBAAkB,gBAAkB98I,EAAMkiB,EAAIu8H,GAAeh6C,GAAMA,IACrF,IACI,OAAOg4C,EAAK+B,QAAQp0G,EAAMizG,EAAWC,EACzC,SAEIb,EAAKiC,WAAWt0G,EACpB,CACJ,CAKAu0G,WAAWz8H,EAAIm7H,EAAWC,GACtB,OAAOrhJ,KAAK6/I,OAAO6C,WAAWz8H,EAAIm7H,EAAWC,EACjD,CAcA7uG,kBAAkBvsB,GACd,OAAOjmB,KAAK4/I,OAAOr9H,IAAI0D,EAC3B,EAEJ,MAAMu8H,GAAgB,CAAC,EACvB,SAASzB,GAAYP,GAgBjB,GAAqB,GAAjBA,EAAKb,WAAkBa,EAAKnB,uBAAyBmB,EAAKlB,SAC1D,IACIkB,EAAKb,WACLa,EAAKhB,iBAAiBlmI,KAAK,KAC/B,SAGI,GADAknI,EAAKb,YACAa,EAAKnB,qBACN,IACImB,EAAKhuG,kBAAkB,IAAMguG,EAAKf,SAASnmI,KAAK,MACpD,SAEIknI,EAAKlB,UAAW,CACpB,CAER,CAER,CAkGA,SAASwB,GAAsBN,GAIvBA,EAAKnB,wBAHLmB,EAAKwB,wBACHxB,EAAKtB,oCAAsCsB,EAAKrB,oCACT,IAArCqB,EAAKP,4BAMjB,CACA,SAASwB,GAAQjB,GACbA,EAAKb,WACDa,EAAKlB,WACLkB,EAAKlB,UAAW,EAChBkB,EAAKjB,WAAWjmI,KAAK,MAE7B,CACA,SAASooI,GAAQlB,GACbA,EAAKb,WACLoB,GAAYP,EAChB,CAKA,MAAMmC,GACF5iJ,cACIC,KAAKq/I,sBAAuB,EAC5Br/I,KAAKo/I,sBAAuB,EAC5Bp/I,KAAKs/I,UAAW,EAChBt/I,KAAKu/I,WAAa,IAAI1qC,GACtB70G,KAAKw/I,iBAAmB,IAAI3qC,GAC5B70G,KAAKy/I,SAAW,IAAI5qC,GACpB70G,KAAK4tG,QAAU,IAAIiH,EACvB,CACAtyF,IAAI0D,EAAIm7H,EAAWC,GACf,OAAOp7H,EAAGrC,MAAMw9H,EAAWC,EAC/B,CACAqB,WAAWz8H,EAAIm7H,EAAWC,GACtB,OAAOp7H,EAAGrC,MAAMw9H,EAAWC,EAC/B,CACA7uG,kBAAkBvsB,GACd,OAAOA,GACX,CACAs8H,QAAQt8H,EAAIm7H,EAAWC,EAAWt9I,GAC9B,OAAOkiB,EAAGrC,MAAMw9H,EAAWC,EAC/B,EASJ,MAAMuB,GAA4B,IAAIxwC,GAAmD,GAAI,CACzFnvG,WAAY,OAIZF,QAAS8/I,KAEb,SAASA,KACL,MAAMrC,EAAOhuC,GAAOwsC,IACpB,IAAI8D,GAAU,EAuCd,OC38VG,SAAS7O,MAASrqI,GACrB,MAAM6/F,KAAYC,OAAa9/F,GACzBolG,KAAauB,OAAU3mG,EAAMs3C,KAC7ByiD,EAAU/5F,EAChB,OAAQ+5F,EAAQj9F,OAGS,IAAnBi9F,EAAQj9F,QAAW,EAEb6kG,OAAU5H,EAAQ,KAAE,EAEpBoL,MAASC,EAFW,EAED,EAAEtpF,MAAKi+E,EAAS8F,IALvCJ,GAMZ,CD+7VW05C,CAtCmB,IAAIl+C,IAAYr9B,IACtCs7E,EAAUtC,EAAKlB,WAAakB,EAAKpB,uBAAyBoB,EAAKnB,qBAC/DmB,EAAKhuG,kBAAkB,KACnBg1B,EAASnzC,KAAKyuH,GACdt7E,EAASjS,UAAS,EACrB,GAEY,IAAIsvC,IAAYr9B,IAG7B,IAAIw7E,EACJxC,EAAKhuG,kBAAkB,KACnBwwG,EAAYxC,EAAKf,SAASlpG,UAAU,KAChCyoG,GAAOsD,yBAGPW,eAAe,MACNH,IAAYtC,EAAKpB,uBAAyBoB,EAAKnB,uBAChDyD,GAAU,EACVt7E,EAASnzC,MAAK,GAAI,EAEzB,EACJ,GAEL,MAAM6uH,EAAc1C,EAAKjB,WAAWhpG,UAAU,KAC1CyoG,GAAOqD,sBACHS,IACAA,GAAU,EACVtC,EAAKhuG,kBAAkB,KACnBg1B,EAASnzC,MAAK,EAAK,GACtB,GAGT,MAAO,KACH2uH,EAAUvsG,cACVysG,EAAYzsG,aAAY,CAC5B,GAEuChC,KAAK2yE,MACpD,CAuDA,SAAS+7B,GAAc94I,GACnB,OAAIA,aAAiB8kB,SACV9kB,IAGAA,CAEf,CAyMA,IAIM+4I,GAAuB,MAA7B,MAAMA,EACFrjJ,cACIC,KAAKqjJ,YAAc,EAEnBrjJ,KAAKgT,QAAU,IACnB,CAKAswI,QACItjJ,KAAKgT,SAASuwI,gBACdvjJ,KAAKqjJ,aACT,CAKA73H,MAEIxrB,KAAKqjJ,cACoB,IAArBrjJ,KAAKqjJ,aACLrjJ,KAAKgT,SAASy3F,SAEtB,CACAj0D,cACIx2C,KAAKgT,SAAS4iE,UACd51E,KAAKgT,QAAU,IACnB,CACA7S,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CACrC1nE,MAAOmvG,EACPngJ,WAAY,OACZF,QAASA,IAAM,IAAIqgJ,IAE1B,OAnCKA,CAAuB,KAgD7B,SAASI,GAAc5nB,GACnB,KAAOA,GAAO,CACVA,EAAMpG,KAAU,GAChB,MAAM3+C,EAASm0D,GAAepP,GAE9B,GAAIhE,GAAWgE,KAAW/kD,EACtB,OAAO+kD,EAGXA,EAAQ/kD,CACZ,CACA,OAAO,IACX,CAMA,MAQM4sE,GAAwB,IAAIrxC,GAA6F,GAAI,CAC/HnvG,WAAY,OACZF,QAASA,KAPyB,IAuItC,IAAI2gJ,GAAkB,KAMtB,SAASC,GAAyB/nB,EAAOgoB,GACrC,OAAOhoB,EAAMgoB,IAASC,IAC1B,CAWA,SAASC,GAAkCloB,EAAOgoB,GAC9C,MAAM3rB,EAAW4rB,KACZ5rB,EAASG,cAAc1xH,SAG5Bk1H,EAAMgoB,GAAQF,GACdzrB,EAAS2D,MAAQA,EACjB8nB,GAAkBK,KACtB,CACA,MAAMC,GAA+B,IAC9B9rB,GACHS,sBAAsB,EACtBG,oBAAsBzsE,IAGlBm3F,GAAcn3F,EAAKuvE,MAAK,EAE5BA,MAAO,MAEX,SAASmoB,KACL,OAAO1/I,OAAO6hG,OAAO89C,GACzB,CACA,SAASH,KACLH,YAAoBK,KACbL,EACX,CAGA,MAAMO,GAA2F,CAAC,EAyBlG,SAASC,GAAUzlG,GAEf0lG,GAAoBjnB,KAAYD,KAAY4C,KAAqBphF,GAAO,EAC5E,CACA,SAAS0lG,GAAoB/xB,EAAOwJ,EAAOtoH,EAAO8wI,GAI9C,IAAKA,EAED,GAD2F,IAA3C,EAAfxoB,EAAMpG,KACV,CACzB,MAAM8R,EAAqBlV,EAAMkV,mBACN,OAAvBA,GACAnG,GAAkBvF,EAAO0L,EAAoBh0H,EAErD,KACK,CACD,MAAM+zH,EAAgBjV,EAAMiV,cACN,OAAlBA,GACA/F,GAAyB1F,EAAOyL,EAAe,EAA2C/zH,EAElG,CAMJwsH,GAAiBxsH,EACrB,CAEA,SAAS+wI,GAAkBpwG,EAAOg3E,EAAQX,GAAYC,SAClD,MAAMqR,EAAQqB,KAGd,OAAc,OAAVrB,EAGO9lB,GAAS7hE,EAAOg3E,GAGb2Z,GADArH,KAC6B3B,EAAO/S,GAAkB50E,GAAQg3E,EAGhF,CAaA,SAASq5B,KAEL,MAAM,IAAI1/I,MADiF,UAE/F,CAgDA,SAAS2/I,GAAYzlB,EAAa1M,EAAO1+G,EAASu3G,EAAOz7F,EAAMg1H,EAAW5iJ,EAAausH,EAAUjT,EAAUgqB,EAAsBuf,GAC7H,MAAM7oB,EAAQxJ,EAAMwR,UAAU55H,QAC9B4xH,SAAMtG,IAAQ9lG,EACdosG,EAAMpG,IAAiB,IAARvK,GACc,OAAzBia,GACCpG,GAAqC,KAArBA,EAAYtJ,OAC7BoG,EAAMpG,KAAU,MAEpB4G,GAAuBR,GAEvBA,EAAMnG,IAAUmG,EAAMxF,IAAoB0I,EAC1ClD,EAAM9F,IAAWpiH,EACjBkoH,EAAM5F,IAAgBp0H,GAAek9H,GAAeA,EAAY9I,IAEhE4F,EAAM3F,IAAa9H,GAAY2Q,GAAeA,EAAY7I,IAE1D2F,EAAM7F,IAAc7a,GAAY4jB,GAAeA,EAAY/I,KAAe,KAC1E6F,EAAMhG,IAAU4uB,EAChB5oB,EAAMnF,IA/vKV,SAASiuB,KACL,OAAOja,IACX,CA6vKgBia,GACZ9oB,EAAMhF,IAAa6tB,EACnB7oB,EAAMlF,IAA0BwO,EAGhCtJ,EAAMvF,IACY,GAAdjE,EAAMhmH,KAAqC0yH,EAAYzI,IAA8BuF,EAClFA,CACX,CACA,SAAS+oB,GAAiBvyB,EAAO9+G,EAAOlH,EAAMrI,EAAM2Q,GAMhD,IAAI+6G,EAAQ2C,EAAM/iH,KAAKiE,GACvB,GAAc,OAAVm8G,EACAA,EAqBR,SAASm1B,GAAmBxyB,EAAO9+G,EAAOlH,EAAMrI,EAAM2Q,GAClD,MAAM8oH,EAAeC,KACfE,EAAWC,KAGXnO,EAAQ2C,EAAM/iH,KAAKiE,GA8T7B,SAASuxI,GAAYzyB,EAAO0yB,EAAS14I,EAAMkH,EAAOjJ,EAAOqK,GAOrD,IAAIgvH,EAAgBohB,EAAUA,EAAQphB,eAAgB,EAClDzY,EAAQ,EACZ,OAAI+R,OACA/R,GAAS,KAEC,CACV7+G,OACAkH,QACAyxI,kBAAmB,KACnBrhB,gBACAnD,gBAAgB,EAChBC,cAAc,EACdwkB,sBAAsB,EACtBvtB,iBAAiB,EACjBwtB,iBAAkB,KAClBh6B,QACAkb,gBAAiB,EACjB97H,MAAOA,EACPqK,MAAOA,EACPq8H,YAAa,KACbmU,WAAY,KACZC,mBAAe5hJ,EACf/C,OAAQ,KACRqyH,QAAS,KACTT,MAAO,KACP/9F,KAAM,KACNkmB,KAAM,KACNg2F,eAAgB,KAChBt8D,MAAO,KACP4C,OAAQiuE,EACRhV,WAAY,KACZ/7D,OAAQ,KACRqxE,kBAAmB,KACnBC,oBAAgB9hJ,EAChB+D,QAAS,KACTg+I,mBAAoB,KACpBC,qBAAiBhiJ,EACjBiiJ,cAAe,EACfC,cAAe,EASvB,CAnXQZ,CAAYzyB,EAHDuL,EAAWH,EAAeA,GAAgBA,EAAa3mD,OAGvCzqE,EAAMkH,EAAOvP,EAAM2Q,GAIlD,OAAyB,OAArB09G,EAAMz8E,aACNy8E,EAAMz8E,WAAa85E,GAEF,OAAjB+N,IACIG,EAE0B,MAAtBH,EAAavpD,OAAkC,OAAjBw7C,EAAM54C,SAEpC2mD,EAAavpD,MAAQw7C,GAIC,OAAtB+N,EAAanpG,OAGbmpG,EAAanpG,KAAOo7F,EACpBA,EAAMl1E,KAAOijF,IAIlB/N,CACX,CApDgBm1B,CAAmBxyB,EAAO9+G,EAAOlH,EAAMrI,EAAM2Q,GA5tQ7D,SAASgxI,IACL,OAAOhpB,GAAiBC,OAAOwC,MACnC,CA2tQYumB,KAKAj2B,EAAMxE,OAAS,YAGD,GAAbwE,EAAMrjH,KAAuC,CAClDqjH,EAAMrjH,KAAOA,EACbqjH,EAAMplH,MAAQtG,EACd0rH,EAAM/6G,MAAQA,EACd,MAAMmiE,EA/xQd,SAAS8uE,KACL,MAAMhpB,EAASD,GAAiBC,OAC1Ba,EAAeb,EAAOa,aAC5B,OAAOb,EAAOgB,SAAWH,EAAeA,EAAa3mD,MACzD,CA2xQuB8uE,GACfl2B,EAAMiU,cAA2B,OAAX7sD,GAAkB,EAAKA,EAAO6sD,aAGxD,CACAhG,UAAgBjO,GAAO,GAChBA,CACX,CA2CA,SAASm2B,GAAaxzB,EAAOwJ,EAAOiqB,EAAiBC,GACjD,GAAwB,IAApBD,EACA,OAAO,EAQX,MAAME,EAAWnqB,EAAMl1H,OACvB,QAASe,EAAI,EAAGA,EAAIo+I,EAAiBp+I,IACjCm0H,EAAM30H,KAAK6+I,GACX1zB,EAAMwR,UAAU38H,KAAK6+I,GACrB1zB,EAAM/iH,KAAKpI,KAAK,MAEpB,OAAO8+I,CACX,CACA,SAASC,GAAgB5zB,EAAOwJ,EAAOqqB,EAAYllJ,EAAI2S,GACnD,MAAMukH,EAAW0rB,GAAyB/nB,EAAO/E,IAC3CqvB,EAAoBrmB,KACpBsmB,EAAqB,EAALplJ,EACtB,IACI++H,IAAiB,GACbqmB,GAAiBvqB,EAAMl1H,OAASqwH,IAGhCotB,GAAoB/xB,EAAOwJ,EAAO7E,IAAe,GAGrDwE,GADoB4qB,EAAgB,EAA4C,EAC1DzyI,GACtB,MAAM0yI,EAAoBD,EAAgBluB,EAAW,KAC/CqB,EAAeF,GAA0BgtB,GAC/C,IAC8B,OAAtBA,IACAA,EAAkBjuB,OAAQ,GAE9B8tB,EAAWllJ,EAAI2S,EACnB,SAEI2lH,GAAyB+sB,EAAmB9sB,EAChD,CACJ,SAEQ6sB,GAAuD,OAAtCvqB,EAAM/E,KACvBitB,GAAkCloB,EAAO/E,IAE7CiJ,GAAiBomB,GAEjB3qB,GADqB4qB,EAAgB,EAA0C,EACxDzyI,EAC3B,CACJ,CAIA,SAAS2yI,GAAsBj0B,EAAO3C,EAAOmM,GACzC,GAAIrE,GAAmB9H,GAAQ,CAC3B,MAAM6J,EAAetB,GAAkB,MACvC,IACI,MACMxsG,EAAMikG,EAAM+Q,aAClB,QAAS0G,EAFKzX,EAAM8Q,eAEa2G,EAAiB17G,EAAK07G,IAAkB,CACrE,MAAMxV,EAAMU,EAAM/iH,KAAK63H,GACnBxV,EAAIqB,gBACJrB,EAAIqB,eAAe,EAA4B6I,EAAMsL,GAAiBA,EAE9E,CACJ,SAEIlP,GAAkBsB,EACtB,CACJ,CACJ,CAIA,SAASgtB,GAA0Bl0B,EAAOwJ,EAAOnM,GACxCsN,OA0jBT,SAASwpB,GAAyBn0B,EAAOwJ,EAAOnM,EAAOrB,GACnD,MAAM7qE,EAAQksE,EAAM8Q,eACd/0G,EAAMikG,EAAM+Q,aAGdhJ,GAAgB/H,IAqMxB,SAAS+2B,GAAkB5qB,EAAO6qB,EAAW/0B,GACzC,MAAMtD,EAASyN,GAAiB4qB,EAAW7qB,GACrCxJ,EAAQs0B,GAA0Bh1B,GAIxC,IAAIi1B,EAAa,GACbj1B,EAAIO,QACJ00B,EAAa,KAERj1B,EAAIC,SACTg1B,EAAa,IAEjB,MAAMC,EAAgBC,GAAcjrB,EAAO2oB,GAAY3oB,EAAOxJ,EAAO,KAAMu0B,EAAYv4B,EAAQq4B,EAAW,KARlF7qB,EAAM5F,IAAa8wB,gBAQqFC,eAAe34B,EAAQsD,GAAM,KAAM,KAAM,OAGzKkK,EAAM6qB,EAAUnzI,OAASszI,CAC7B,CApNQJ,CAAkB5qB,EAAOnM,EAAO2C,EAAM/iH,KAAKk0C,EAAQksE,EAAMgI,kBAExDrF,EAAMqR,iBACPH,GAA+B7T,EAAOmM,GAE1C+O,GAAgBvc,EAAQwN,GACxB,MAAMupB,EAAgB11B,EAAM01B,cAC5B,QAAS19I,EAAI87C,EAAO97C,EAAI+jB,EAAK/jB,IAAK,CAC9B,MAAMiqH,EAAMU,EAAM/iH,KAAK5H,GACjBs6H,EAAYgE,GAAkBnK,EAAOxJ,EAAO3qH,EAAGgoH,GACrDkb,GAAgB5I,EAAWnG,GACL,OAAlBupB,GACA6B,GAAmBprB,EAAOn0H,EAAI87C,EAAOw+E,EAAWrQ,EAAKjC,EAAO01B,GAE5DxtB,GAAejG,KACOqK,GAAyBtM,EAAMn8G,MAAOsoH,GAC9C9F,IAAWiQ,GAAkBnK,EAAOxJ,EAAO3qH,EAAGgoH,GAEpE,CACJ,CAllBI82B,CAAyBn0B,EAAOwJ,EAAOnM,EAAOoM,GAAiBpM,EAAOmM,IACV,KAAzC,GAAdnM,EAAMxE,QACPg8B,GAA6B70B,EAAOwJ,EAAOnM,GAEnD,CAKA,SAASy3B,GAAyBC,EAAU13B,EAAO23B,EAAoBvrB,IACnE,MAAMqpB,EAAaz1B,EAAMy1B,WACzB,GAAmB,OAAfA,EAAqB,CACrB,IAAImC,EAAa53B,EAAMn8G,MAAQ,EAC/B,QAAS7L,EAAI,EAAGA,EAAIy9I,EAAWx+I,OAAQe,GAAK,EAAG,CAC3C,MAAM6L,EAAQ4xI,EAAWz9I,EAAI,GACvB4C,GAAkB,IAAViJ,EACV8zI,EAAkB33B,EAAO03B,GACzBA,EAAS7zI,GACb6zI,EAASE,KAAgBh9I,CAC7B,CACJ,CACJ,CAQA,SAASq8I,GAA0Bh1B,GAC/B,MAAMU,EAAQV,EAAIU,MAGlB,OAAc,OAAVA,GAAkBA,EAAMk1B,oBAIjB51B,EAAIU,MAAQm1B,GAAY,EAA6B5oB,KAAWjN,EAAI5wH,SAAU4wH,EAAI/wH,MAAO+wH,EAAI9wH,KAAM8wH,EAAIG,cAAeH,EAAII,SAAUJ,EAAIsB,UAAWtB,EAAIS,QAAST,EAAI7wH,OAAQ6wH,EAAIppH,IAEpL8pH,CACX,CAcA,SAASm1B,GAAYn7I,EAAMuyH,EAAWsnB,EAAYtlJ,EAAOC,EAAM4mJ,EAAYC,EAAOz0B,EAAWb,EAASu1B,EAAiBC,GAEnH,MAAM3pB,EAAoBjH,GAAgBp2H,EAIpCinJ,EAAoB5pB,EAAoBp9H,EACxCgjI,EA2CV,SAASikB,GAAoB7pB,EAAmB4pB,GAC5C,MAAMhkB,EAAY,GAClB,QAASn8H,EAAI,EAAGA,EAAImgJ,EAAmBngJ,IACnCm8H,EAAU38H,KAAKQ,EAAIu2H,EAAoB,KAAOimB,IAElD,OAAOrgB,CACX,CAjDsBikB,CAAoB7pB,EAAmB4pB,GACnD/mJ,GAAoC,mBAApB6mJ,EAAiCA,IAAoBA,EAwC3E,OAvCc9jB,EAAUrO,IAAS,CAC7BnpH,KAAMA,EACNw3H,UAAWA,EACX9iI,SAAUmlJ,EACV6B,QAAS,KACT90B,UAAWA,EACX2L,UAAWA,EACXtvH,KAAMu0H,EAAU55H,QAAQiB,KAAK,KAAM+yH,GACnCA,kBAAmBA,EACnB+pB,kBAAmBH,EACnBI,mBAAoB,KACpBvkB,iBAAiB,EACjBwkB,iBAAiB,EACjBC,mBAAmB,EACnBC,sBAAsB,EACtB9gB,cAAe,KACfC,mBAAoB,KACpBxG,aAAc,KACdC,kBAAmB,KACnBC,UAAW,KACXC,eAAgB,KAChBC,aAAc,KACdp7E,QAAS,KACTitE,eAAgB,KAChBhjG,WAAY,KACZq4H,kBAAyC,mBAAfZ,EAA4BA,IAAeA,EACrEa,aAA+B,mBAAVZ,EAAuBA,IAAUA,EACtD9xG,WAAY,KACZw8E,QAASA,EACTtxH,OAAQA,GACRymJ,qBAAqB,EACrBK,QASR,CA+CA,IAAIW,GAAkCC,GAAgB,KAoHtD,SAASC,GAAwBC,EAAUvhB,EAAgBwhB,EAAiBC,GACxE,QAAS70B,KAAc20B,EACnB,GAAIA,EAAS37I,eAAegnH,GAAa,CACrC40B,EAAsC,OAApBA,EAA2B,CAAC,EAAIA,EAClD,MAAME,EAAeH,EAAS30B,GAOA,OAA1B60B,EACAE,GAAiBH,EAAiBxhB,EAAgBpT,EAAY80B,GAEzDD,EAAsB77I,eAAegnH,IAC1C+0B,GAAiBH,EAAiBxhB,EAAgByhB,EAAsB70B,GAAa80B,EAE7F,CAEJ,OAAOF,CACX,CACA,SAASG,GAAiBH,EAAiBxhB,EAAgBpT,EAAY80B,GAC/DF,EAAgB57I,eAAegnH,GAC/B40B,EAAgB50B,GAAY7sH,KAAKigI,EAAgB0hB,GAGjDF,EAAgB50B,GAAc,CAACoT,EAAgB0hB,EAEvD,CAqEA,SAASE,GAAwB12B,EAAO3C,EAAOmM,EAAOgN,EAAUv+H,EAAO8jH,EAAU0oB,EAAWkS,GAExF,MAAMtjH,EAAUo2F,GAAiBpM,EAAOmM,GACxC,IACIotB,EADAC,EAAYx5B,EAAMjvH,QAEjBuoJ,GAA2B,MAAbE,IAAsBD,EAAYC,EAAUrgB,KAC3DsgB,GAAqB92B,EAAOwJ,EAAOotB,EAAWpgB,EAAUv+H,GACpDmtH,GAAgB/H,IA6B5B,SAAS05B,GAAkBvtB,EAAOwtB,GAE9B,MAAMC,EAAsBttB,GAAyBqtB,EAAWxtB,GAC7B,GAA7BytB,EAAoB7zB,MACtB6zB,EAAoB7zB,KAAU,GAEtC,CAlCY2zB,CAAkBvtB,EAAOnM,EAAMn8G,QAKjB,EAAbm8G,EAAMrjH,OACXw8H,EA7BR,SAAS0gB,GAAYvlJ,GACjB,MAAa,UAATA,EACO,YACE,QAATA,EACO,UACE,eAATA,EACO,aACE,cAATA,EACO,YACE,aAATA,EACO,WACE,aAATA,EACO,WACJA,CACX,CAemBulJ,CAAY1gB,GAUvBv+H,EAAqB,MAAbwsI,EAAoBA,EAAUxsI,EAAOolH,EAAMplH,OAAS,GAAIu+H,GAAYv+H,EAC5E8jH,EAASp/C,YAAYtpC,EAASmjG,EAAUv+H,GAShD,CA4CA,SAASk/I,GAAkBn3B,EAAOwJ,EAAOnM,EAAO+5B,GAI5C,GAAIzsB,KAAsB,CACtB,MAAM0sB,EAA2B,OAAdD,EAAqB,KAAO,CAAE,IAAI,GAC/CE,EAwLd,SAASC,GAAwBv3B,EAAO3C,GAGpC,MAAM3rG,EAAWsuG,EAAMg2B,kBACvB,IAAIr4F,EAAU,KACV65F,EAAoB,KACxB,GAAI9lI,EACA,QAASrc,EAAI,EAAGA,EAAIqc,EAASpd,OAAQe,IAAK,CACtC,MAAMiqH,EAAM5tG,EAASrc,GACrB,GAAIkpH,GAA2BlB,EAAOiC,EAAInxH,WAAkC,GAExE,GADAwvD,IAAYA,EAAU,IAClB4nE,GAAejG,GAkBf,GAAkC,OAA9BA,EAAIuD,sBAAgC,CACpC,MAAM40B,EAAuB,GAC7BD,EAAoBA,GAAqB,IAAI18I,IAC7CwkH,EAAIuD,sBAAsBvD,EAAKm4B,EAAsBD,GAIrD75F,EAAQqa,WAAWy/E,EAAsBn4B,GAGzCo4B,GAAoB13B,EAAO3C,EADHo6B,EAAqBnjJ,OAEjD,MAIIqpD,EAAQqa,QAAQsnD,GAChBo4B,GAAoB13B,EAAO3C,EAAO,QAKtCm6B,EAAoBA,GAAqB,IAAI18I,IAC7CwkH,EAAIuD,wBAAwBvD,EAAK3hE,EAAS65F,GAC1C75F,EAAQ9oD,KAAKyqH,EAGzB,CAEJ,OAAmB,OAAZ3hE,EAAmB,KAAO,CAACA,EAAS65F,EAC/C,CAlP4BD,CAAwBv3B,EAAO3C,GACnD,IAAIoC,EACA+3B,EACgB,OAAhBF,EACA73B,EAAgB+3B,EAAoB,MAGnC/3B,EAAe+3B,GAAqBF,EAEnB,OAAlB73B,GACAk4B,GAAqB33B,EAAOwJ,EAAOnM,EAAOoC,EAAe43B,EAAYG,GAErEH,GAmPZ,SAASO,GAAwBv6B,EAAO+5B,EAAWC,GAC/C,GAAID,EAAW,CACX,MAAMtE,EAAaz1B,EAAMy1B,WAAa,GAItC,QAASz9I,EAAI,EAAGA,EAAI+hJ,EAAU9iJ,OAAQe,GAAK,EAAG,CAC1C,MAAM6L,EAAQm2I,EAAWD,EAAU/hJ,EAAI,IACvC,GAAa,MAAT6L,EACA,MAAM,IAAI21G,IAAa,KAA8CpF,GACzEqhC,EAAWj+I,KAAKuiJ,EAAU/hJ,GAAI6L,EAClC,CACJ,CACJ,CA/PY02I,CAAwBv6B,EAAO+5B,EAAWC,EAClD,CAEAh6B,EAAMshB,YAAcpiB,GAAec,EAAMshB,YAAathB,EAAM/6G,MAChE,CAEA,SAASq1I,GAAqB33B,EAAOwJ,EAAOnM,EAAO+3B,EAAYiC,EAAYG,GAIvE,QAASniJ,EAAI,EAAGA,EAAI+/I,EAAW9gJ,OAAQe,IACnC48H,GAAmBf,GAA+B7T,EAAOmM,GAAQxJ,EAAOo1B,EAAW//I,GAAG2E,OAyQ9F,SAAS69I,GAAex6B,EAAOn8G,EAAO42I,GAGlCz6B,EAAMxE,OAAS,EAEfwE,EAAM8Q,eAAiBjtH,EACvBm8G,EAAM+Q,aAAeltH,EAAQ42I,EAC7Bz6B,EAAM0W,gBAAkB7yH,CAC5B,CA/QI22I,CAAex6B,EAAO2C,EAAM/iH,KAAK3I,OAAQ8gJ,EAAW9gJ,QAOpD,QAASe,EAAI,EAAGA,EAAI+/I,EAAW9gJ,OAAQe,IAAK,CACxC,MAAMiqH,EAAM81B,EAAW//I,GACnBiqH,EAAIkD,mBACJlD,EAAIkD,kBAAkBlD,EAC9B,CACA,IAAIy4B,GAAqB,EACrBC,GAA0B,EAC1BC,EAAezE,GAAaxzB,EAAOwJ,EAAO4rB,EAAW9gJ,OAAQ,MAGjE,QAASe,EAAI,EAAGA,EAAI+/I,EAAW9gJ,OAAQe,IAAK,CACxC,MAAMiqH,EAAM81B,EAAW//I,GAGvBgoH,EAAMshB,YAAcpiB,GAAec,EAAMshB,YAAarf,EAAIiB,WAC1D23B,GAA2Bl4B,EAAO3C,EAAOmM,EAAOyuB,EAAc34B,GAC9D64B,GAAoBF,EAAc34B,EAAK+3B,GACZ,OAAvB/3B,EAAIqB,iBACJtD,EAAMxE,OAAS,IACM,OAArByG,EAAImD,cAA2C,OAAlBnD,EAAIiB,WAAuC,IAAjBjB,EAAIgB,YAC3DjD,EAAMxE,OAAS,IACnB,MAAMu/B,EAAiB94B,EAAItlH,KAAK9H,WAG3B6lJ,IACAK,EAAexvC,aAAewvC,EAAexuD,UAAYwuD,EAAevzC,cAIxEmb,EAAMiV,gBAAkB,IAAIpgI,KAAKwoH,EAAMn8G,OACxC62I,GAAqB,IAEpBC,IAA4BI,EAAexvC,aAAewvC,EAAevzC,cACzEmb,EAAMkV,qBAAuB,IAAIrgI,KAAKwoH,EAAMn8G,OAC7C82I,GAA0B,GAE9BC,GACJ,EA1NJ,SAASI,GAAgCr4B,EAAO3C,EAAOi7B,GAEnD,MACMl/H,EAAMikG,EAAM+Q,aACZmqB,EAAYv4B,EAAM/iH,KAClBu7I,EAAan7B,EAAM/6G,MACnBm2I,EAAkB,GACxB,IAAIC,EAAc,KACdC,EAAe,KACnB,QAAS7jB,EAPKzX,EAAM8Q,eAOa2G,EAAiB17G,EAAK07G,IAAkB,CACrE,MAAMC,EAAewjB,EAAUzjB,GACzB8jB,EAAYN,EAA6BA,EAA2Bn9I,IAAI45H,GAAgB,KAExF8jB,GAAiBD,EAAYA,EAAUn4B,QAAU,KACvDi4B,EACItC,GAAwBrhB,EAAa3mI,OAAQ0mI,EAAgB4jB,EAH3CE,EAAYA,EAAUxqJ,OAAS,MAIrDuqJ,EACIvC,GAAwBrhB,EAAatU,QAASqU,EAAgB6jB,EAAcE,IAKhF,MAAM9F,GAAiC,OAAhB2F,GAAuC,OAAfF,GAAwBp7B,GAAiBC,GAEpF,KADAy7B,GAAsBJ,EAAa5jB,EAAgB0jB,GAEvDC,EAAgB5jJ,KAAKk+I,GACzB,CACoB,OAAhB2F,IACIA,EAAYh+I,eAAe,WAC3B2iH,EAAMxE,OAAS,GAEf6/B,EAAYh+I,eAAe,WAC3B2iH,EAAMxE,OAAS,KAGvBwE,EAAM01B,cAAgB0F,EACtBp7B,EAAMjvH,OAASsqJ,EACfr7B,EAAMoD,QAAUk4B,CACpB,CAqLIN,CAAgCr4B,EAAO3C,EAAOm6B,EAClD,CA4EA,SAAS3C,GAA6B70B,EAAOwJ,EAAOnM,GAChD,MAAMlsE,EAAQksE,EAAM8Q,eACd/0G,EAAMikG,EAAM+Q,aACZ2qB,EAAe17B,EAAMn8G,MACrB+qH,EAt6RV,SAAS+sB,IACL,OAAO1uB,GAAiBC,OAAO0B,qBACnC,CAo6RkC+sB,GAC9B,IACItrB,GAAiBqrB,GACjB,QAASE,EAAW9nG,EAAO8nG,EAAW7/H,EAAK6/H,IAAY,CACnD,MAAM35B,EAAMU,EAAM/iH,KAAKg8I,GACjBtpB,EAAYnG,EAAMyvB,GACxB/sB,GAAyB+sB,IACA,OAArB35B,EAAImD,cAA0C,IAAjBnD,EAAIgB,UAAoC,OAAlBhB,EAAIiB,YACvD24B,GAAiC55B,EAAKqQ,EAE9C,CACJ,SAEIjC,IAAiB,GACjBxB,GAAyBD,EAC7B,CACJ,CAOA,SAASitB,GAAiC55B,EAAKqQ,GAClB,OAArBrQ,EAAImD,cACJnD,EAAImD,aAAa,EAA4BkN,EAErD,CAqEA,SAAS+nB,GAAoB13B,EAAOq0B,EAAWhvB,GAG3CgvB,EAAUhvB,gBAAkBA,GAC3BrF,EAAMriG,aAAe,IAAI9oB,KAAKw/I,EAAUnzI,MAC7C,CAoBA,SAASi3I,GAAoBF,EAAc34B,EAAK+3B,GAC5C,GAAIA,EAAY,CACZ,GAAI/3B,EAAIkB,SACJ,QAASnrH,EAAI,EAAGA,EAAIiqH,EAAIkB,SAASlsH,OAAQe,IACrCgiJ,EAAW/3B,EAAIkB,SAASnrH,IAAM4iJ,EAGlC1yB,GAAejG,KACf+3B,EAAW,IAAMY,EACzB,CACJ,CA2BA,SAASC,GAA2Bl4B,EAAO3C,EAAOmM,EAAOsL,EAAgBxV,GAGrEU,EAAM/iH,KAAK63H,GAAkBxV,EAC7B,MAAM65B,EAAmB75B,EAAI3uH,UAAY2uH,EAAI3uH,QAAU80H,GAAcnG,EAAItlH,OAInEo/I,EAAsB,IAAItpB,GAAoBqpB,EAAkB5zB,GAAejG,GAAM2yB,IAC3FjyB,EAAMwR,UAAUsD,GAAkBskB,EAClC5vB,EAAMsL,GAAkBskB,EA9O5B,SAASC,GAA2Br5B,EAAO3C,EAAO46B,EAAcqB,EAAkBh6B,GAE9E,MAAMmD,EAAenD,EAAImD,aACzB,GAAIA,EAAc,CACd,IAAImzB,EAAqB51B,EAAM41B,mBACJ,OAAvBA,IACAA,EAAqB51B,EAAM41B,mBAAqB,IAEpD,MAAM2D,GAAel8B,EAAMn8G,OAkBnC,SAASs4I,GAAuB5D,GAC5B,IAAIvgJ,EAAIugJ,EAAmBthJ,OAC3B,KAAOe,EAAI,GAAG,CACV,MAAM4C,EAAQ29I,IAAqBvgJ,GACnC,GAAqB,iBAAV4C,GAAsBA,EAAQ,EACrC,OAAOA,CAEf,CACA,OAAO,CACX,EA1BYuhJ,CAAuB5D,IAAuB2D,GAI9C3D,EAAmB/gJ,KAAK0kJ,GAE5B3D,EAAmB/gJ,KAAKojJ,EAAcqB,EAAkB72B,EAC5D,CACJ,CA8NI42B,CAA2Br5B,EAAO3C,EAAOyX,EAAgB0e,GAAaxzB,EAAOwJ,EAAOlK,EAAIgB,SAAUuxB,IAAYvyB,EAClH,CAmBA,SAASm6B,GAAyBp8B,EAAOmM,EAAO73H,EAAMsG,EAAOwsI,EAAWjK,GAOpE,MAAMnnG,EAAUo2F,GAAiBpM,EAAOmM,IAG5C,SAASkwB,GAAoB39B,EAAU1oF,EAASmnG,EAAWllI,EAAS3D,EAAMsG,EAAOwsI,GAC7E,GAAa,MAATxsI,EAEA8jH,EAAS74D,gBAAgB7vB,EAAS1hC,EAAM6oI,OAEvC,CAED,MAAMmf,EAAwB,MAAblV,EAAoB1tB,GAAgB9+G,GAASwsI,EAAUxsI,EAAO3C,GAAW,GAAI3D,GAC9FoqH,EAASn4E,aAAavQ,EAAS1hC,EAAMgoJ,EAAUnf,EACnD,CACJ,CAZIkf,CAAoBlwB,EAAM3F,IAAWxwF,EAASmnG,EAAWnd,EAAMplH,MAAOtG,EAAMsG,EAAOwsI,EACvF,CAqBA,SAASmQ,GAAmBprB,EAAOsL,EAAgBp2B,EAAU4gB,EAAKjC,EAAOu8B,GACrE,MAAM7G,EAAgB6G,EAAiB9kB,GACvC,GAAsB,OAAlBie,EACA,QAAS19I,EAAI,EAAGA,EAAI09I,EAAcz+I,QAI9BulJ,GAAsBv6B,EAAK5gB,EAHRq0C,EAAc19I,KACb09I,EAAc19I,KACpB09I,EAAc19I,KAQxC,CACA,SAASwkJ,GAAsBv6B,EAAK5gB,EAAUgjB,EAAYmH,EAAa5wH,GACnE,MAAMivH,EAAetB,GAAkB,MACvC,IACI,MAAMlD,EAAkBpD,EAAIoD,gBACJ,OAApBA,GAA4BA,EAAgBhoH,eAAemuH,KAC3D5wH,EAAQyqH,EAAgBmG,GAAav2H,KAAKosG,EAAUzmG,IAEnC,OAAjBqnH,EAAIsD,SACJtD,EAAIsD,SAASlkB,EAAUzmG,EAAOypH,EAAYmH,GAG1CnqB,EAASmqB,GAAe5wH,CAEhC,SAEI2tH,GAAkBsB,EACtB,CACJ,CAgBA,SAAS4xB,GAAsB1qJ,EAAQ0mI,EAAgBxyH,GACnD,IAAIw3I,EAAgB,KAChBzkJ,EAAI,EACR,KAAOA,EAAIiN,EAAMhO,QAAQ,CACrB,MAAM4nH,EAAW55G,EAAMjN,GACvB,GAAiB,IAAb6mH,EAIJ,GACsB,IAAbA,EADT,CAOA,GAAwB,iBAAbA,EACP,MACJ,GAAI9tH,EAAOsM,eAAewhH,GAAW,CACX,OAAlB49B,IACAA,EAAgB,IAIpB,MAAMn3B,EAAcv0H,EAAO8tH,GAC3B,QAASjC,EAAI,EAAGA,EAAI0I,EAAYruH,OAAQ2lH,GAAK,EACzC,GAAI0I,EAAY1I,KAAO6a,EAAgB,CACnCglB,EAAcjlJ,KAAKqnH,EAAUyG,EAAY1I,EAAI,GAAI33G,EAAMjN,EAAI,IAE3D,KACJ,CAER,CACAA,GAAK,CAnBL,MAFIA,GAAK,OALLA,GAAK,CA2Bb,CACA,OAAOykJ,CACX,CAcA,SAASC,GAAiBC,EAAY3qB,EAAarT,EAAQqB,GAiBvD,MAfmB,CACf28B,GACA,GACA,EACA3qB,EACA,KACA,EACAhS,EACArB,EACA,KACA,KACA,KAKR,CAEA,SAASi+B,GAAsBj6B,EAAOwJ,GAClC,MAAM7I,EAAiBX,EAAMW,eAC7B,GAAuB,OAAnBA,EACA,QAAStrH,EAAI,EAAGA,EAAIsrH,EAAersH,OAAQe,GAAK,EAAG,CAC/C,MACM6kJ,EAAkBv5B,EAAetrH,EAAI,GAC3C,IAAwB,IAApB6kJ,EAAwB,CACxB,MAAMnlB,EAAe/U,EAAM/iH,KAAKi9I,GAIhC7tB,GAPkB1L,EAAetrH,IAQjC0/H,EAAapU,eAAe,EAA4B6I,EAAM0wB,GAAkBA,EACpF,CACJ,CAER,CAYA,SAASzF,GAAcjrB,EAAOgS,GAK1B,OAAIhS,EAAM1F,IACN0F,EAAMzF,IAAYT,IAAQkY,EAG1BhS,EAAM1F,IAAc0X,EAExBhS,EAAMzF,IAAcyX,EACbA,CACX,CAIA,SAAS2e,GAAmBthC,EAAOuhC,EAAaj8H,GAE5CkuG,GAAqB,GACrB,MAAMnF,EAAetB,GAAkB,MACvC,IACIw0B,EAAYvhC,EAAO16F,EACvB,SAEIynG,GAAkBsB,EACtB,CACJ,CA0CA,SAASmzB,GAAwBpzC,GAE7B,OAAOA,EAAKwc,MAAaxc,EAAKwc,IAAW,GAC7C,CACA,SAAS62B,GAAwBt6B,GAC7B,OAAOA,EAAMtsE,UAAYssE,EAAMtsE,QAAU,GAC7C,CAkBA,SAAS5S,GAAY0oF,EAAOltG,GACxB,MAAMwsF,EAAW0gB,EAAM7F,IACjBrvD,EAAew0C,EAAWA,EAAS3tG,IAAImwF,GAAc,MAAQ,KACnEh3B,GAAgBA,EAAaxzB,YAAYxkB,EAC7C,CAUA,SAASw6H,GAAqB92B,EAAOwJ,EAAOp7H,EAAQszH,EAAYzpH,GAC5D,QAAS5C,EAAI,EAAGA,EAAIjH,EAAOkG,QAAS,CAChC,MAAM4M,EAAQ9S,EAAOiH,KACfwzH,EAAcz6H,EAAOiH,KAI3BwkJ,GADY75B,EAAM/iH,KAAKiE,GAFNsoH,EAAMtoH,GAGcwgH,EAAYmH,EAAa5wH,EAClE,CACJ,CAIA,SAASsiJ,GAAoB/wB,EAAOtoH,EAAOjJ,GAIvC,MAAMo7B,EAAUk2F,GAAiBroH,EAAOsoH,IA1/L5C,SAASgxB,GAAez+B,EAAUwd,EAAOthI,GAErC8jH,EAAS0+B,SAASlhB,EAAOthI,EAC7B,CAy/LIuiJ,CAAehxB,EAAM3F,IAAWxwF,EAASp7B,EAC7C,CAEA,SAASyiJ,GAAgBC,EAAWC,GAEhC,MAAMpG,EAAgB7qB,GAAyBixB,EAAkBD,GAC3DE,EAAiBrG,EAAcrxB,KAoCzC,SAAS23B,GAAsB96B,EAAOwJ,GAClC,QAASn0H,EAAIm0H,EAAMl1H,OAAQe,EAAI2qH,EAAMwR,UAAUl9H,OAAQe,IACnDm0H,EAAM30H,KAAKmrH,EAAMwR,UAAUn8H,GAEnC,CAvCIylJ,CAAsBD,EAAgBrG,GACtC,MAAMuG,EAAYvG,EAActxB,IAEd,OAAd63B,GAAmD,OAA7BvG,EAAchwB,MACpCgwB,EAAchwB,IAAagmB,GAAsBuQ,EAAWvG,EAAc7wB,MAE9Eq3B,GAAWH,EAAgBrG,EAAeA,EAAc9wB,IAC5D,CAwCA,SAASs3B,GAAWh7B,EAAOwJ,EAAOloH,GAE9BsrH,GAAUpD,GACV,IACI,MAAM5I,EAAYZ,EAAMY,UACN,OAAdA,GACAu5B,GAAmB,EAA4Bv5B,EAAWt/G,GAI9D,MAAMuyI,EAAa7zB,EAAMtxH,SACN,OAAfmlJ,GACAD,GAAgB5zB,EAAOwJ,EAAOqqB,EAAY,EAA4BvyI,GAOtE0+G,EAAMqR,kBACNrR,EAAMqR,iBAAkB,GAKxBrR,EAAM+1B,sBACNkE,GAAsBj6B,EAAOwJ,GAK7BxJ,EAAM81B,mBACNqE,GAAmB,EAA4Bn6B,EAAMY,UAAWt/G,GAGpE,MAAMqc,EAAaqiG,EAAMriG,WACN,OAAfA,GAmBZ,SAASs9H,GAAsBN,EAAWh9H,GACtC,QAAStoB,EAAI,EAAGA,EAAIsoB,EAAWrpB,OAAQe,IACnCqlJ,GAAgBC,EAAWh9H,EAAWtoB,GAE9C,CAtBY4lJ,CAAsBzxB,EAAO7rG,EAErC,OACOrB,GAGH,MAAI0jG,EAAMqR,kBACNrR,EAAMk1B,qBAAsB,EAC5Bl1B,EAAMqR,iBAAkB,GAEtB/0G,CACV,SAEIktG,EAAMpG,MAAU,EAChBoK,IACJ,CACJ,CAQA,IAGM0tB,GAAa,MAAnB,MAAMA,EACFvtJ,cACIC,KAAKitC,IAAM,IAAIm1B,IACfpiE,KAAKutJ,MAAQ,IAAIrgJ,GACrB,CACAg5F,OAAOsnD,EAAUC,EAAYC,GACzB,MAAMlN,SAAeluG,KAAS,IAAe,KAAOA,KAAKC,QACnDo7G,EA/nUd,SAASC,GAAM3nI,EAAI6kF,EAAU4iD,GACzB,MAAMrhG,EAAOhoD,OAAO6hG,OAAOi0B,IACvBuzB,IACArhG,EAAKqsE,2BAA4B,GAErCrsE,EAAKpmC,GAAKA,EACVomC,EAAKy+C,SAAWA,EAChB,MAAM+iD,EAAqBvzB,IACvBjuE,EAAKiuE,UAAYA,GAkBrBjuE,SAAK+tE,IAAM,CACP0zB,OAAQA,IAAM50B,GAAkB7sE,GAChC9pC,IAlBQA,KAER,GADA8pC,EAAK8rE,OAAQ,EACT9rE,EAAKguE,SAAWpB,GAA+B5sE,GAC/C,OAEJA,EAAKguE,QAAS,EACd,MAAMf,EAAeF,GAA0B/sE,GAC/C,IACIA,EAAKiuE,YACLjuE,EAAKiuE,UAAYJ,GACjB7tE,EAAKpmC,GAAG4nI,EACZ,SAEIx0B,GAAyBhtE,EAAMitE,EACnC,GAKAxzE,QAASA,IAAMuG,EAAKiuE,aAEjBjuE,EAAK+tE,GAChB,CA+lUkBwzB,CAAMJ,EAAWI,IAClB5tJ,KAAKitC,IAAI3lB,IAAIsmI,IAGlB5tJ,KAAKutJ,MAAM9/I,IAAImgJ,EAAOpN,EAAI,EAC3BkN,GAIH,IAAIK,EAHJ/tJ,KAAKitC,IAAI1lB,IAAIomI,GAEbA,EAAEG,SAEF,MAAMl4E,EAAUA,KACZ+3E,EAAE7nG,UACFioG,MACA/tJ,KAAKitC,IAAIxlB,OAAOkmI,GAChB3tJ,KAAKutJ,MAAM9lI,OAAOkmI,EAAC,EAEvBI,SAAsBN,GAAYp5B,UAAUz+C,GACrC,CACHA,UAER,CACA99C,QACI,GAAwB,IAApB93B,KAAKutJ,MAAM/mF,KAGf,UAAYonF,EAAOpN,KAASxgJ,KAAKutJ,MAC7BvtJ,KAAKutJ,MAAM9lI,OAAOmmI,GACdpN,EACAA,EAAKj+H,IAAI,IAAMqrI,EAAMrrI,OAGrBqrI,EAAMrrI,KAGlB,CACA,gBAAIyrI,GACA,OAA2B,IAApBhuJ,KAAKutJ,MAAM/mF,IACtB,CACArmE,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CACrC1nE,MAAOq5G,EACPrqJ,WAAY,OACZF,QAASA,IAAM,IAAIuqJ,IAE1B,OAnDKA,CAAa,KA4EnB,SAASW,GAAqBx+B,EAAO/6G,EAAOw5I,GAGxC,IAAIn6E,EAASm6E,EAAcz+B,EAAM17C,OAAS,KACtCzsE,EAAU4mJ,EAAcz+B,EAAMnoH,QAAU,KACxCuoH,EAAO,EACX,GAAc,OAAVn7G,EACA,QAASjN,EAAI,EAAGA,EAAIiN,EAAMhO,OAAQe,IAAK,CACnC,MAAM4C,EAAQqK,EAAMjN,GACC,iBAAV4C,EACPwlH,EAAOxlH,EAEM,GAARwlH,EACLvoH,EAAUkhH,GAAuBlhH,EAAS+C,GAE7B,GAARwlH,IAGL97C,EAASy0C,GAAuBz0C,EAFlB1pE,EAEkC,KAD7BqK,IAAQjN,GACyC,KAE5E,CAEJymJ,EAAcz+B,EAAM17C,OAASA,EAAS07C,EAAM21B,kBAAoBrxE,EAChEm6E,EAAcz+B,EAAMnoH,QAAUA,EAAUmoH,EAAM61B,mBAAqBh+I,CACvE,CAEA,SAAS6mJ,GAAmB/7B,EAAOwJ,EAAOnM,EAAOp9G,EAAQ89H,GAAe,GACpE,KAAiB,OAAV1gB,GAAgB,CAGnB,MAAM2+B,EAAQxyB,EAAMnM,EAAMn8G,OACZ,OAAV86I,GACA/7I,EAAOpL,KAAKy0H,GAAY0yB,IAKxB92B,GAAa82B,IACbC,GAA+BD,EAAO/7I,GAE1C,MAAMm9H,EAAY/f,EAAMrjH,KACxB,GAAgB,EAAZojI,EACA2e,GAAmB/7B,EAAOwJ,EAAOnM,EAAMx7C,MAAO5hE,QAAM,GAEnC,GAAZm9H,EAAoC,CACzC,MAAMa,EAAYvF,GAAoBrb,EAAOmM,GAC7C,IAAI+P,EACJ,KAAOA,EAAQ0E,KACXh+H,EAAOpL,KAAK0kI,EAEpB,SACqB,GAAZ6D,EAA2C,CAChD,MAAM8e,EAAcze,GAAmBjU,EAAOnM,GAC9C,GAAI5oH,MAAMC,QAAQwnJ,GACdj8I,EAAOpL,QAAQqnJ,OAEd,CACD,MAAMvrB,EAAaiI,GAAepP,EAAMvF,KAExC83B,GAAmBprB,EAAWxN,IAAQwN,EAAYurB,EAAaj8I,GAAQ,EAC3E,CACJ,CACAo9G,EAAQ0gB,EAAe1gB,EAAM8gB,eAAiB9gB,EAAMp7F,IACxD,CACA,OAAOhiB,CACX,CAIA,SAASg8I,GAA+B5iB,EAAYp5H,GAChD,QAAS5K,EAAI2vH,GAAyB3vH,EAAIgkI,EAAW/kI,OAAQe,IAAK,CAC9D,MAAM8mJ,EAAoB9iB,EAAWhkI,GAC/B+mJ,EAAuBD,EAAkBh5B,IAAO5/E,WACzB,OAAzB64G,GACAL,GAAmBI,EAAkBh5B,IAAQg5B,EAAmBC,EAAsBn8I,EAE9F,CAcIo5H,EAAWvU,MAAYuU,EAAWnW,KAClCjjH,EAAOpL,KAAKwkI,EAAWvU,IAE/B,CAEA,SAASu3B,GAAsBr8B,EAAOwJ,EAAOloH,EAASg7I,GAAqB,GACvE,MAAM9sJ,EAAcg6H,EAAM5F,IACpB8wB,EAAkBllJ,EAAYklJ,gBAC9B6H,EAA0B/sJ,EAAY+sJ,wBAMxC7H,EAAgBxD,UAChBqL,GAAyBrL,QAE7B,IACIsL,GAAYx8B,EAAOwJ,EAAOxJ,EAAMtxH,SAAU4S,EAC9C,OACOgb,GACH,MAAIggI,GACAx7G,GAAY0oF,EAAOltG,GAEjBA,CACV,SAGQo4H,EAAgBt7H,QAGhB5pB,EAAYitJ,eAAe/2H,QAE3B62H,GAAyBnjI,KAEjC,CACJ,CA6BA,SAASojI,GAAYx8B,EAAOwJ,EAAOqqB,EAAYvyI,GAE3C,MAAMu3G,EAAQ2Q,EAAMpG,IACpB,GAAiD,MAApC,IAARvK,GAAL,CAK2B2Q,EAAM5F,IAAa64B,eAAe/2H,QAC7DknG,GAAUpD,GACV,IACIQ,GAAuBR,GAhyT/B,SAASkzB,EAAgBzkJ,GACrB,OAAOqyH,GAAiBC,OAAOuB,aAAe7zH,CAClD,CA+xTQykJ,CAAgB18B,EAAM4L,mBACH,OAAfioB,GACAD,GAAgB5zB,EAAOwJ,EAAOqqB,EAAY,EAA4BvyI,GAE1E,MAAMq7I,EAA8E,IAA3C,EAAR9jC,GAI7B,GAAI8jC,EAAyB,CACzB,MAAMznB,EAAqBlV,EAAMkV,mBACN,OAAvBA,GACAnG,GAAkBvF,EAAO0L,EAAoB,KAErD,KACK,CACD,MAAMD,EAAgBjV,EAAMiV,cACN,OAAlBA,GACA/F,GAAyB1F,EAAOyL,EAAe,EAA2C,MAE9F7F,GAAwB5F,EAAO,EACnC,CAcA,GAqFZ,SAASozB,GAAgCpzB,GACrC,QAAS6P,EAAaR,GAAmBrP,GAAuB,OAAf6P,EAAqBA,EAAaN,GAAkBM,GAAa,CAC9G,IAAKA,EAAWxU,IACZ,SACJ,MAAM8V,EAAatB,EAAWtU,IAE9B,QAAS1vH,EAAI,EAAGA,EAAIslI,EAAWrmI,OAAQe,IAAK,CAIxC40H,GAHmB0Q,EAAWtlI,GAIlC,CACJ,CACJ,CA3GQunJ,CAAgCpzB,GAChCqzB,GAA6BrzB,EAAO,GAEP,OAAzBxJ,EAAMW,gBACNs5B,GAAsBj6B,EAAOwJ,GAKzBmzB,EAAyB,CACzB,MAAMhuB,EAAoB3O,EAAM2O,kBACN,OAAtBA,GACAI,GAAkBvF,EAAOmF,EAEjC,KACK,CACD,MAAMD,EAAe1O,EAAM0O,aACN,OAAjBA,GACAQ,GAAyB1F,EAAOkF,EAAc,GAElDU,GAAwB5F,EAAO,EACnC,EA/qDZ,SAASszB,GAA0B98B,EAAOwJ,GACtC,MAAMosB,EAAqB51B,EAAM41B,mBACjC,GAA2B,OAAvBA,EACA,OACJ,MAAM/vB,EAAW0rB,GAAyB/nB,EAAO9E,IACjD,IACI,QAASrvH,EAAI,EAAGA,EAAIugJ,EAAmBthJ,OAAQe,IAAK,CAChD,MAAM0nJ,EAASnH,EAAmBvgJ,GAClC,GAAI0nJ,EAAS,EAETrvB,IAAkBqvB,OAEjB,CAED,MAAM9E,EAAe8E,EACfC,EAAkBpH,IAAqBvgJ,GACvC4nJ,EAAgBrH,IAAqBvgJ,GAC3C22H,EAA8BgxB,EAAiB/E,GAC/CpyB,EAASE,OAAQ,EACjB,MAAMmB,EAAeF,GAA0BnB,GAC/C,IAEIo3B,EAAc,EADEzzB,EAAMyuB,GAE1B,SAEIhxB,GAAyBpB,EAAUqB,EACvC,CACJ,CACJ,CACJ,SAEkD,OAA1CsC,EAAM9E,KACNgtB,GAAkCloB,EAAO9E,IAE7CgJ,IAAiB,EACrB,CACJ,CA6oDQovB,CAA0B98B,EAAOwJ,GAEjC,MAAM7rG,EAAaqiG,EAAMriG,WACN,OAAfA,GACAu/H,GAA+B1zB,EAAO7rG,EAAY,GAKtD,MAAMijG,EAAYZ,EAAMY,UAOpB,GANc,OAAdA,GACAu5B,GAAmB,EAA4Bv5B,EAAWt/G,GAKtDq7I,EAAyB,CACzB,MAAM9tB,EAAiB7O,EAAM6O,eACN,OAAnBA,GACAE,GAAkBvF,EAAOqF,EAEjC,KACK,CACD,MAAMD,EAAY5O,EAAM4O,UACN,OAAdA,GACAM,GAAyB1F,EAAOoF,EAAW,GAE/CQ,GAAwB5F,EAAO,EACnC,EAE0B,IAA1BxJ,EAAM61B,kBAON71B,EAAM61B,iBAAkB,GASxBrsB,EAAMpG,MAAU,GAEpB+G,GAAqBX,EACzB,SAEIgE,IACJ,CA5GI,CA6GR,CAKA,SAASqvB,GAA6BrzB,EAAO/L,GACzC,QAAS4b,EAAaR,GAAmBrP,GAAuB,OAAf6P,EAAqBA,EAAaN,GAAkBM,GACjG,QAAShkI,EAAI2vH,GAAyB3vH,EAAIgkI,EAAW/kI,OAAQe,IAEzD8nJ,GADsB9jB,EAAWhkI,GACEooH,EAG/C,CA0BA,SAAS2/B,GAAyBzC,EAAWC,EAAkBn9B,GAG3D0/B,GADsBxzB,GAAyBixB,EAAkBD,GAC9Bl9B,EACvC,CAcA,SAAS0/B,GAAoB3zB,EAAO/L,GAChC,IA1tUJ,SAAS4/B,GAA6Bp2C,GAClC,OAAyD,MAAnC,IAAdA,EAAKmc,IACjB,CAwtUSi6B,CAA6B7zB,GAC9B,OAEJ,MAAMxJ,EAAQwJ,EAAMrG,IACdtK,EAAQ2Q,EAAMpG,IACpB,GAAc,GAATvK,GACQ,IAAT4E,GACQ,KAAR5E,GACS,IAAT4E,EACA++B,GAAYx8B,EAAOwJ,EAAOxJ,EAAMtxH,SAAU86H,EAAM9F,UAAQ,GAEnD8F,EAAMjG,IAA+B,EAAG,CAC7Cs5B,GAA6BrzB,EAAO,GACpC,MAAM7rG,EAAaqiG,EAAMriG,WACN,OAAfA,GACAu/H,GAA+B1zB,EAAO7rG,EAAY,EAE1D,CACJ,CAEA,SAASu/H,GAA+BvC,EAAWh9H,EAAY8/F,GAC3D,QAASpoH,EAAI,EAAGA,EAAIsoB,EAAWrpB,OAAQe,IACnC+nJ,GAAyBzC,EAAWh9H,EAAWtoB,GAAIooH,EAE3D,CAEA,MAAM6/B,GACF,aAAIC,GACA,MAAM/zB,EAAQ57H,KAAK2nI,OACbvV,EAAQwJ,EAAMrG,IACpB,OAAO44B,GAAmB/7B,EAAOwJ,EAAOxJ,EAAMz8E,WAAY,GAC9D,CACA51C,YAYA4nI,EAOAioB,GACI5vJ,KAAK2nI,OAASA,EACd3nI,KAAK4vJ,oBAAsBA,EAC3B5vJ,KAAK6vJ,QAAU,KACf7vJ,KAAK8vJ,0BAA2B,CACpC,CACA,WAAIp8I,GACA,OAAO1T,KAAK2nI,OAAO7R,GACvB,CACA,WAAIpiH,CAAQrJ,GACRrK,KAAK2nI,OAAO7R,IAAWzrH,CAC3B,CACA,aAAIwvI,GACA,OAAiE,MAApC,IAArB75I,KAAK2nI,OAAOnS,IACxB,CACA5/C,UACI,GAAI51E,KAAK6vJ,QACL7vJ,KAAK6vJ,QAAQ5iB,WAAWjtI,WAAI,GAEvBA,KAAK8vJ,yBAA0B,CACpC,MAAMj5E,EAAS72E,KAAK2nI,OAAOlS,IAC3B,GAAI6B,GAAazgD,GAAS,CACtB,MAAMk5E,EAAWl5E,EA7uWf,GA8uWIvjE,EAAQy8I,EAAWA,EAASrjI,QAAQ1sB,OAAQ,EAC9CsT,GAAQ,IAGR25H,GAAWp2D,EAAQvjE,GACnBg2H,GAAgBymB,EAAUz8I,GAElC,CACAtT,KAAK8vJ,0BAA2B,CACpC,CACAriB,GAAaztI,KAAK2nI,OAAOpS,IAAQv1H,KAAK2nI,OAC1C,CACAtT,UAAUtrH,IA9uUd,SAASinJ,GAAoBp0B,EAAOq0B,GAChC,GAAwD,MAApC,IAAfr0B,EAAMpG,KACP,MAAM,IAAIvM,GAAa,KAAmDpF,GAE9C,OAA5B+X,EAAMjF,MACNiF,EAAMjF,IAAoB,IAE9BiF,EAAMjF,IAAkB1vH,KAAKgpJ,EACjC,CAuuUQD,CAAoBhwJ,KAAK2nI,OAAQ5+H,EACrC,CAgCAmnJ,eACI1M,GAAcxjJ,KAAK4vJ,qBAAuB5vJ,KAAK2nI,OACnD,CAsDAwoB,SACInwJ,KAAK2nI,OAAOnS,MAAU,GAC1B,CAyDA46B,WACIpwJ,KAAK2nI,OAAOnS,KAAU,GAC1B,CAsBA66B,gBACI5B,GAAsBzuJ,KAAK2nI,OAAOpS,IAAQv1H,KAAK2nI,OAAQ3nI,KAAK0T,QAChE,CAOA48I,iBAIA,CACAC,2BACI,GAAIvwJ,KAAK6vJ,QACL,MAAM,IAAI5mC,GAAa,KAAkDpF,GAE7E7jH,KAAK8vJ,0BAA2B,CACpC,CACAU,mBACIxwJ,KAAK6vJ,QAAU,KA/tNvB,SAASY,GAAkBr+B,EAAOwJ,GAC9B2Q,GAAUna,EAAOwJ,EAAOA,EAAM3F,IAAW,EAAoC,KAAM,KACvF,CA8tNQw6B,CAAkBzwJ,KAAK2nI,OAAOpS,IAAQv1H,KAAK2nI,OAC/C,CACA+oB,eAAeC,GACX,GAAI3wJ,KAAK8vJ,yBACL,MAAM,IAAI7mC,GAAa,KAAkDpF,GAE7E7jH,KAAK6vJ,QAAUc,CACnB,EAGJ,MAAMC,WAAoBlB,GACtB3vJ,YAAY8wJ,GACRv6H,MAAMu6H,GACN7wJ,KAAK6wJ,MAAQA,CACjB,CACAR,gBACI,MAAMz0B,EAAQ57H,KAAK6wJ,MAGnBpC,GAFc7yB,EAAMrG,IAESqG,EADbA,EAAM9F,KACuB,EACjD,CACAw6B,iBAOA,CACA,WAAI58I,GACA,OAAO,IACX,EAGJ,MAAMo9I,WAAiC5T,GAInCn9I,YAAYy4I,GACRliH,QACAt2B,KAAKw4I,SAAWA,CACpB,CACAwE,wBAAwBzsH,GAEpB,MAAMiiG,EAAeW,GAAgB5iG,GACrC,OAAO,IAAIwgI,GAAiBv+B,EAAcxyH,KAAKw4I,SACnD,EAEJ,SAASwY,GAAW7oJ,GAChB,MAAMqkG,EAAQ,GACd,QAASykD,KAAe9oJ,EAChBA,EAAI2E,eAAemkJ,IAEnBzkD,EAAMvlG,KAAK,CAAE2hI,SADIzgI,EAAI8oJ,GACYC,aAAcD,IAGvD,OAAOzkD,CACX,CASA,MAAM2kD,GACFpxJ,YAAYm7G,EAAUk2C,GAClBpxJ,KAAKk7G,SAAWA,EAChBl7G,KAAKoxJ,eAAiBA,CAC1B,CACA7jJ,IAAI0mC,EAAO+2E,EAAeC,GACtBA,EAAQgB,GAAkBhB,GAC1B,MAAM5gH,EAAQrK,KAAKk7G,SAAS3tG,IAAI0mC,EAAO+pG,GAAuC/yB,GAC9E,OAAI5gH,IAAU2zI,IACVhzB,IAAkBgzB,GAMX3zI,EAEJrK,KAAKoxJ,eAAe7jJ,IAAI0mC,EAAO+2E,EAAeC,EACzD,EAKJ,MAAM8lC,WAAyBjU,GAC3B,UAAIt8I,GACA,MAAMgyH,EAAexyH,KAAKwyH,aACpBsC,EAAkBtC,EAAasC,gBAC/Bu8B,EAAWL,GAAWx+B,EAAahyH,QACzC,GAAwB,OAApBs0H,EACA,UAAW5qH,KAASmnJ,EACZv8B,EAAgBhoH,eAAe5C,EAAM0+H,YACrC1+H,EAAMonJ,UAAYx8B,EAAgB5qH,EAAM0+H,WAIpD,OAAOyoB,CACX,CACA,WAAIx+B,GACA,OAAOm+B,GAAWhxJ,KAAKwyH,aAAaK,QACxC,CAKA9yH,YAAYyyH,EAAcgmB,GACtBliH,QACAt2B,KAAKwyH,aAAeA,EACpBxyH,KAAKw4I,SAAWA,EAChBx4I,KAAKuxJ,cAAgB/+B,EAAapmH,KAClCpM,KAAKioD,SAxgYb,SAASupG,GAAyBC,GAC9B,OAAOA,EAAatpJ,IAAI+oH,IAAsB9pH,KAAK,IACvD,CAsgYwBoqJ,CAAyBh/B,EAAajyH,WACtDP,KAAKS,mBACD+xH,EAAa/xH,mBAAqB+xH,EAAa/xH,mBAAqB,GACxET,KAAK0xJ,kBAAoBlZ,CAC7B,CACAtyC,OAAOgV,EAAUy2C,EAAkBC,EAAoBC,GAEnD,IAAIC,GADJD,EAAsBA,GAAuB7xJ,KAAKw4I,oBACWmB,GACzDkY,EACAA,GAAqB32C,SACrB42C,GAAuE,OAA5C9xJ,KAAKwyH,aAAaR,wBAC7C8/B,EAA0B9xJ,KAAKwyH,aAAaR,sBAAsB8/B,IAC9DA,GAER,MAAMC,EAAmBD,EAA0B,IAAIX,GAAgBj2C,EAAU42C,GAA2B52C,EACtG4rC,EAAkBiL,EAAiBxkJ,IAAIiwI,GAAkB,MAC/D,GAAwB,OAApBsJ,EACA,MAAM,IAAI79B,GAAa,KAA+CpF,GAK1E,MAGMjiH,EAAc,CAChBklJ,kBACAjQ,UALckb,EAAiBxkJ,IAAIqwI,GAAW,MAM9CiR,cALkBkD,EAAiBxkJ,IAAI+/I,GAAe,MAMtDqB,wBAL4BoD,EAAiBxkJ,IAAI61I,GAAyB,OAOxE4O,EAAelL,EAAgBC,eAAe,KAAM/mJ,KAAKwyH,cAGzDy/B,EAAcjyJ,KAAKwyH,aAAajyH,UAAU,GAAG,IAAM,MACnD4sJ,GAAYyE,EAj4D1B,SAASM,GAAkB/jC,EAAUgkC,EAAmBjgC,EAAehX,GAUnE,MAAMk3C,EAHsBl3C,EAAS3tG,IAAIk2I,IAzmBP,IA4mBavxB,IAAkBrF,GAAoBI,UAC/Es7B,EAAcp6B,EAASkkC,kBAAkBF,EAAmBC,GAClEE,OASJ,SAASA,GAA0B/J,GAC/BD,GAA+BC,EACnC,CAXI+J,CAA0B/J,GACnBA,CACX,CAo3DY2J,CAAkBF,EAAcJ,EAAoB5xJ,KAAKwyH,aAAaN,cAAe6/B,GACrFplB,GAAkBqlB,EAAcC,EA9F5C,SAASM,GAAaN,GAClB,MAAMluJ,EAAOkuJ,EAAYnqJ,cACzB,MAAgB,QAAT/D,EAAiB03H,GAA0B,SAAT13H,EA/pVnB,OA+pVyD,IACnF,CA2FyDwuJ,CAAaN,IAMxDO,GAAYxyJ,KAAKwyH,aAAaP,QAJf,KAEEjyH,KAAKwyH,aAAab,OAAS,IAC9C,IAEJ,IAAI8yB,GAAgB,KACF,OAAd0I,KACA1I,GAAgB7H,GAAsBuQ,GAAW4E,GAAkB,IAGvE,MAAMU,GAAYlL,GAAY,EAAwB,KAAM,KAAM,EAAG,EAAG,KAAM,KAAM,KAAM,KAAM,KAAM,MAChGmL,GAAYnO,GAAY,KAAMkO,GAAW,KAAMD,GAAW,KAAM,KAAM5wJ,EAAaowJ,EAAcD,EAAkB,KAAMtN,IAO/H,IAAIl0H,GACAoiI,GAFJ3zB,GAAU0zB,IAGV,IACI,MAAME,GAAmB5yJ,KAAKwyH,aAC9B,IAAIqgC,GACAjJ,GAAoB,KACpBgJ,GAAiB39B,uBACjB49B,GAAiB,GACjBjJ,GAAoB,IAAI18I,IACxB0lJ,GAAiB39B,sBAAsB29B,GAAkBC,GAAgBjJ,IACzEiJ,GAAe5rJ,KAAK2rJ,KAGpBC,GAAiB,CAACD,IAEtB,MAAMnM,GAgFlB,SAASqM,GAAyBl3B,EAAO+P,GACrC,MAAMvZ,EAAQwJ,EAAMrG,IACdjiH,EAAQyjH,GAEd6E,SAAMtoH,GAASq4H,EAIRgZ,GAAiBvyB,EAAO9+G,EAAO,EAA2B,QAAS,KAC9E,CAzF8Bw/I,CAAyBJ,GAAWvF,IAChDvG,GAqGlB,SAASmM,GAAwBtjC,EAAO09B,EAAWyF,EAAkBC,EAAgBllB,EAAU/rI,EAAaowJ,GACxG,MAAM5/B,EAAQub,EAASpY,KAyB3B,SAASy9B,GAA0BH,EAAgBpjC,EAAOkc,EAAOqmB,GAC7D,UAAWtgC,KAAOmhC,EACdpjC,EAAMshB,YAAcpiB,GAAec,EAAMshB,YAAarf,EAAIiB,WAEpC,OAAtBlD,EAAMshB,cACNkd,GAAqBx+B,EAAOA,EAAMshB,aAAa,GACjC,OAAVpF,GACAmF,GAAsBkhB,EAAcrmB,EAAOlc,GAGvD,CAlCIujC,CAA0BH,EAAgBpjC,EAAO09B,EAAW6E,GAG5D,IAAIvN,EAAgB,KACF,OAAd0I,IACA1I,EAAgB7H,GAAsBuQ,EAAWxf,EAAS5X,MAE9D,MAAMk9B,EAAerxJ,EAAYklJ,gBAAgBC,eAAeoG,EAAWyF,GAC3E,IAAIjM,EAAa,GACbiM,EAAiB3gC,QACjB00B,EAAa,KAERiM,EAAiBjhC,SACtBg1B,EAAa,IAEjB,MAAMC,EAAgBrC,GAAY5W,EAAU+Y,GAA0BkM,GAAmB,KAAMjM,EAAYhZ,EAASle,EAAMn8G,OAAQm8G,EAAO7tH,EAAaqxJ,EAAc,KAAM,KAAMxO,GAChL,OAAIryB,EAAMqR,iBACNqmB,GAAoB13B,EAAO3C,EAAOojC,EAAensJ,OAAS,GAE9DmgJ,GAAclZ,EAAUiZ,GAEjBjZ,EAASle,EAAMn8G,OAASszI,CACnC,CA7HkCmM,CAAwBtM,GAAW0G,GAAWyF,GAAkBC,GAAgBH,GAAW9wJ,EAAaowJ,GAC9HW,GAAe72B,GAAS22B,GAAW17B,IAI/Bo2B,IAyKhB,SAAS+F,GAAsBlB,EAAcx/B,EAAc26B,EAAWyE,GAClE,GAAIA,EACA1jC,GAAgB8jC,EAAc7E,EAAW,CAAC,aAAcvuD,GAAQk/C,WAE/D,CAID,MAAQppI,QAAOpN,WA1vYvB,SAAS6rJ,GAAmClrG,GACxC,MAAMvzC,EAAQ,GACRpN,EAAU,GAChB,IAAIG,EAAI,EACJooH,EAAO,EACX,KAAOpoH,EAAIwgD,EAASvhD,QAAQ,CACxB,IAAI0qH,EAAgBnpE,EAASxgD,GAC7B,GAA6B,iBAAlB2pH,EACM,IAATvB,EACsB,KAAlBuB,GACA18G,EAAMzN,KAAKmqH,EAAenpE,IAAWxgD,IAG3B,IAATooH,GACLvoH,EAAQL,KAAKmqH,OAGhB,CAID,IAAKlB,GAAWL,GACZ,MACJA,EAAOuB,CACX,CACA3pH,GACJ,CACA,MAAO,CAAEiN,QAAOpN,UACpB,CA8tYmC6rJ,CAAmC3gC,EAAajyH,UAAU,IACjFmU,GACAw5G,GAAgB8jC,EAAc7E,EAAWz4I,GAEzCpN,GAAWA,EAAQZ,OAAS,GAC5BmqI,GAAiBmhB,EAAc7E,EAAW7lJ,EAAQF,KAAK,KAE/D,CACJ,CAxLgB8rJ,CAAsBlB,EAAcY,GAAkBzF,GAAWyE,QAE5CruJ,IAArBouJ,GAwLhB,SAASyB,GAAa3jC,EAAOhvH,EAAoBkxJ,GAC7C,MAAM7hB,EAAargB,EAAMqgB,WAAa,GACtC,QAASroI,EAAI,EAAGA,EAAIhH,EAAmBiG,OAAQe,IAAK,CAChD,MAAM4rJ,EAAe1B,EAAiBlqJ,GAMtCqoI,EAAW7oI,KAAqB,MAAhBosJ,EAAuBxsJ,MAAM6e,KAAK2tI,GAAgB,KACtE,CACJ,CAlMgBD,CAAaT,GAAc3yJ,KAAKS,mBAAoBkxJ,GAKxDphI,GAgIZ,SAAS+iI,GAAoB1M,EAAegM,EAAkBC,EAAgBjJ,EAAmB8I,EAAWa,GACxG,MAAMC,EAAYj2B,KAEZnL,EAAQsgC,EAAUn9B,IAClBnH,EAASyN,GAAiB23B,EAAWd,GAC3C3I,GAAqB33B,EAAOsgC,EAAWc,EAAWX,EAAgB,KAAMjJ,GACxE,QAASniJ,EAAI,EAAGA,EAAIorJ,EAAensJ,OAAQe,IAGvCkjI,GAD0B5E,GAAkB2sB,EAAWtgC,EADhCohC,EAAUjzB,eAAiB94H,EAC4B+rJ,GAC3Cd,GAEvCzL,GAA6B70B,EAAOsgC,EAAWc,GAC3CplC,GACAuc,GAAgBvc,EAAQskC,GAM5B,MAAMniI,EAAYw1G,GAAkB2sB,EAAWtgC,EAAOohC,EAAUjzB,eAAiBizB,EAAU/7B,gBAAiB+7B,GAE5G,GADA5M,EAAc9wB,IAAW48B,EAAU58B,IAAWvlG,EACzB,OAAjBgjI,EACA,UAAW1sC,KAAW0sC,EAClB1sC,EAAQt2F,EAAWqiI,GAK3BvM,UAAsBj0B,EAAOohC,EAAW5M,GACjCr2H,CACX,CA9JwB+iI,CAAoB1M,GAAegM,GAAkBC,GAAgBjJ,GAAmB8I,GAAW,CAACe,KAChHrG,GAAWqF,GAAWC,GAAW,KACrC,SAEI9yB,IACJ,CACA,OAAO,IAAI8zB,GAAa1zJ,KAAKuxJ,cAAehhI,GAAW8sH,GAAiBsV,GAAcD,IAAYA,GAAWC,GACjH,EAUJ,MAAMe,WAAqB7W,GACvB98I,YAAYwxJ,EAAezgD,EAAU59E,EAAUygI,EAAYjsB,GACvDpxG,QACAt2B,KAAKkzB,SAAWA,EAChBlzB,KAAK2zJ,WAAaA,EAClB3zJ,KAAK0nI,OAASA,EACd1nI,KAAK4zJ,oBAAsB,KAC3B5zJ,KAAK8wG,SAAWA,EAChB9wG,KAAKi8H,SAAWj8H,KAAK6zJ,kBAAoB,IAAIjD,GAAY+C,GACzD3zJ,KAAKuxJ,cAAgBA,CACzB,CACAv8B,SAASjxH,EAAMsG,GACX,MAAM4+I,EAAYjpJ,KAAK0nI,OAAOlnI,OAC9B,IAAIwoJ,EACJ,GAAkB,OAAdC,IAAuBD,EAAYC,EAAUllJ,IAAQ,CAIrD,GAHA/D,KAAK4zJ,sBAAwB,IAAI1mJ,IAG7BlN,KAAK4zJ,oBAAoBtsI,IAAIvjB,IAC7BM,OAAOyvJ,GAAG9zJ,KAAK4zJ,oBAAoBrmJ,IAAIxJ,GAAOsG,GAC9C,OAEJ,MAAMuxH,EAAQ57H,KAAK2zJ,WACnBzK,GAAqBttB,EAAMrG,IAAQqG,EAAOotB,EAAWjlJ,EAAMsG,GAC3DrK,KAAK4zJ,oBAAoBnmJ,IAAI1J,EAAMsG,GAEnCm5I,GAD4BznB,GAAyB/7H,KAAK0nI,OAAOp0H,MAAOsoH,GAE5E,CASJ,CACA,YAAI1gB,GACA,OAAO,IAAIusB,GAAaznI,KAAK0nI,OAAQ1nI,KAAK2zJ,WAC9C,CACA/9E,UACI51E,KAAKi8H,SAASrmD,SAClB,CACAy+C,UAAUtrH,GACN/I,KAAKi8H,SAAS5H,UAAUtrH,EAC5B,EA6IJ,SAAS0qJ,KACL,MAAMhkC,EAAQ8N,KAEd+C,GAAuBrD,KAAW1H,IAAQ9F,EAC9C,CAWA,SAASskC,GAA2B5+B,GAChC,IAAI6+B,EAVR,SAASC,GAAa7nJ,GAClB,OAAO/H,OAAOgJ,eAAejB,EAAK9H,WAAWvE,WACjD,CAQoBk0J,CAAa9+B,EAAW/oH,MACpC8nJ,GAAsB,EAC1B,MAAMC,EAAmB,CAACh/B,GAC1B,KAAO6+B,GAAW,CACd,IAAII,EACJ,GAAIz8B,GAAexC,GAEfi/B,EAAWJ,EAAU5mC,WAAQ4mC,EAAUp8C,cAEtC,CACD,GAAIo8C,EAAU5mC,UACV,MAAM,IAAInE,GAAa,KAAgDpF,GAI3EuwC,EAAWJ,EAAUp8C,SACzB,CACA,GAAIw8C,EAAU,CACV,GAAIF,EAAqB,CACrBC,EAAiBltJ,KAAKmtJ,GAGtB,MAAMC,EAAel/B,EACrBk/B,EAAa7zJ,OAAS8zJ,GAAiBn/B,EAAW30H,QAClD6zJ,EAAav/B,gBAAkBw/B,GAAiBn/B,EAAWL,iBAC3Du/B,EAAa1/B,eAAiB2/B,GAAiBn/B,EAAWR,gBAC1D0/B,EAAaxhC,QAAUyhC,GAAiBn/B,EAAWtC,SAEnD,MAAM0hC,EAAoBH,EAASv/B,aACnC0/B,GAAqBC,GAAoBr/B,EAAYo/B,GAErD,MAAME,EAAiBL,EAASphC,UAC1B0hC,EAAsBN,EAASrhC,eAerC,GAdA0hC,GAAkBE,GAAiBx/B,EAAYs/B,GAC/CC,GAAuBE,GAAsBz/B,EAAYu/B,GAEzDrsC,GAAe8M,EAAW30H,OAAQ4zJ,EAAS5zJ,QAC3C6nH,GAAe8M,EAAWR,eAAgBy/B,EAASz/B,gBACnDtM,GAAe8M,EAAWtC,QAASuhC,EAASvhC,SACX,OAA7BuhC,EAASt/B,kBAC4B,OAAjCu/B,EAAav/B,kBACbu/B,EAAav/B,gBAAkB,CAAC,GAEpCzM,GAAegsC,EAAav/B,gBAAiBs/B,EAASt/B,kBAItD6C,GAAey8B,IAAaA,EAAS/kJ,KAAKwlJ,UAAW,CAGrD,MAAMC,EAAU3/B,EAAW9lH,KAC3BylJ,EAAQD,WAAaC,EAAQD,WAAa,IAAIz5I,OAAOg5I,EAAS/kJ,KAAKwlJ,UACvE,CACJ,CAEA,MAAM15C,EAAWi5C,EAASj5C,SAC1B,GAAIA,EACA,QAAS1zG,EAAI,EAAGA,EAAI0zG,EAASz0G,OAAQe,IAAK,CACtC,MAAMo/G,EAAU1L,EAAS1zG,GACrBo/G,GAAWA,EAAQyU,WACnBzU,EAAQsO,GASRtO,IAAYktC,KACZG,GAAsB,EAE9B,CAER,CACAF,EAAY3vJ,OAAOgJ,eAAe2mJ,EACtC,EAUJ,SAASe,GAAgCZ,GACrC,IAAIzhC,EAAW,EACXC,EAAY,KAEhB,QAASlrH,EAAI0sJ,EAAiBztJ,OAAS,EAAGe,GAAK,EAAGA,IAAK,CACnD,MAAMiqH,EAAMyiC,EAAiB1sJ,GAE7BiqH,EAAIgB,SAAYA,GAAYhB,EAAIgB,SAEhChB,EAAIiB,UACAhE,GAAe+C,EAAIiB,UAAWA,EAAYhE,GAAegE,EAAWjB,EAAIiB,WAChF,CACJ,CArBIoiC,CAAgCZ,EACpC,CAqBA,SAASG,GAAiBjqJ,GACtB,OAAIA,IAAU6iH,GACH,CAAC,EAEH7iH,IAAUisG,GACR,GAGAjsG,CAEf,CACA,SAASsqJ,GAAiBx/B,EAAYs/B,GAClC,MAAMO,EAAgB7/B,EAAWnC,UAE7BmC,EAAWnC,UADXgiC,EACuB,CAACj0J,EAAIC,KACxByzJ,EAAe1zJ,EAAIC,GACnBg0J,EAAcj0J,EAAIC,EAAG,EAIFyzJ,CAE/B,CACA,SAASG,GAAsBz/B,EAAYu/B,GACvC,MAAMO,EAAqB9/B,EAAWpC,eAElCoC,EAAWpC,eADXkiC,EAC4B,CAACl0J,EAAIC,EAAKkmI,KAClCwtB,EAAoB3zJ,EAAIC,EAAKkmI,GAC7B+tB,EAAmBl0J,EAAIC,EAAKkmI,EAAc,EAIlBwtB,CAEpC,CACA,SAASF,GAAoBr/B,EAAYo/B,GACrC,MAAMW,EAAmB//B,EAAWN,aAEhCM,EAAWN,aADXqgC,EAC0B,CAACn0J,EAAIC,KAC3BuzJ,EAAkBxzJ,EAAIC,GACtBk0J,EAAiBn0J,EAAIC,EAAG,EAIFuzJ,CAElC,CAyOA,SAASY,GAAyBhgC,GAC9B,MAAM30H,EAAS20H,EAAWJ,YACpBD,EAAkB,CAAC,EACzB,UAAWjB,KAAerzH,EACtB,GAAIA,EAAOsM,eAAe+mH,GAAc,CAGpC,MAAMxpH,EAAQ7J,EAAOqzH,GACjBhtH,MAAMC,QAAQuD,IAAUA,EAAM,KAC9ByqH,EAAgBjB,GAAexpH,EAAM,GAE7C,CAEJ8qH,EAAWL,gBACPA,CACR,CAKA,SAASsgC,GAAmB/xJ,GACxB,QAAKgyJ,GAAWhyJ,KAETwD,MAAMC,QAAQzD,MACdA,aAAe6J,MACd+9F,OAAOD,YAAY3nG,EAC/B,CA6BA,SAASgyJ,GAAWr3I,GAChB,OAAa,OAANA,IAA4B,mBAANA,GAAiC,iBAANA,EAC5D,CAsBA,SAASs3I,GAAc15B,EAAOsC,EAAc7zH,GACxC,OAAOuxH,EAAMsC,GAAgB7zH,CACjC,CAqBA,SAASkrJ,GAAe35B,EAAOsC,EAAc7zH,GAKzC,OAAIhG,OAAOyvJ,GADMl4B,EAAMsC,GACC7zH,KAkBpBuxH,EAAMsC,GAAgB7zH,GACf,EAEf,CA8BA,SAASmrJ,GAAYzxJ,EAAMsG,EAAOwsI,EAAWjK,GACzC,MAAMhR,EAAQqB,KAQd,OANIs4B,GAAe35B,EADEqC,IACmB5zH,KACtB6yH,KAEd2uB,GADc9rB,KACkBnE,EAAO73H,EAAMsG,EAAOwsI,EAAWjK,IAG5D4oB,EACX,CAyCA,SAASC,GAAe75B,EAAO85B,EAAQC,EAAIC,GAEvC,OADkBL,GAAe35B,EAAOqC,IAAoB03B,GACzCD,EAASvsC,GAAgBwsC,GAAMC,EAAS3R,EAC/D,CAIA,SAAS4R,GAAej6B,EAAO85B,EAAQC,EAAI10J,EAAI60J,EAAIF,GAC/C,MACMG,EAxFV,SAASC,GAAgBp6B,EAAOsC,EAAc+3B,EAAMC,GAChD,MAAMH,EAAYR,GAAe35B,EAAOsC,EAAc+3B,GACtD,OAAOV,GAAe35B,EAAOsC,EAAe,EAAGg4B,IAASH,CAC5D,CAqFsBC,CAAgBp6B,EAptWtC,SAASu6B,KACL,OAAOz5B,GAAiBC,OAAOuB,YACnC,CAitWyBi4B,GACkCR,EAAIG,GAC3D33B,SAAsB,GACf43B,EAAYL,EAASvsC,GAAgBwsC,GAAM10J,EAAKkoH,GAAgB2sC,GAAMF,EAAS3R,EAC1F,CAwpCA,SAASmS,GAAW9iJ,EAAO2yI,EAAYtlJ,EAAOC,EAAM8G,EAAS2uJ,EAAYC,EAAgBlP,GACrF,MAAMxrB,EAAQqB,KACR7K,EAAQ8K,KACRq5B,EAAgBjjJ,EAAQyjH,GACxBtH,EAAQ2C,EAAMqR,gBAtCxB,SAAS+yB,EAAwBljJ,EAAO8+G,EAAOwJ,EAAOqqB,EAAYtlJ,EAAOC,EAAM8G,EAAS2uJ,EAAYC,GAGhG,MAAMG,EAAcrkC,EAAMvxH,OAEpB4uH,EAAQk1B,GAAiBvyB,EAAO9+G,EAAO,EAA6B5L,GAAW,KAAMy0H,GAAYs6B,EAAaJ,IACpH9M,GAAkBn3B,EAAOwJ,EAAOnM,EAAO0M,GAAYs6B,EAAaH,IAChEh2B,GAAuBlO,EAAO3C,GAC9B,MAAMinC,EAAgBjnC,EAAM2C,MAAQm1B,GAAY,EAA4B93B,EAAOw2B,EAAYtlJ,EAAOC,EAAMwxH,EAAMg2B,kBAAmBh2B,EAAMi2B,aAAc,KAAMj2B,EAAMD,QAASskC,EAAa,MAC3L,OAAsB,OAAlBrkC,EAAM01B,UACN11B,EAAM01B,QAAQhnJ,SAASsxH,EAAO3C,GAC9BinC,EAAc5O,QAAU11B,EAAM01B,QAAQ4O,cAAcjnC,IAEjDA,CACX,CAwB0C+mC,CAAwBD,EAAenkC,EAAOwJ,EAAOqqB,EAAYtlJ,EAAOC,EAAM8G,EAAS2uJ,EAAYC,GACrIlkC,EAAM/iH,KAAKknJ,GACf74B,GAAgBjO,GAAO,GACvB,MAAM/3D,EAAUi/F,GAA+BvkC,EAAOwJ,EAAOnM,EAAOn8G,GAChE8sH,MACAt8F,GAAYsuF,EAAOwJ,EAAOlkE,EAAS+3D,GAEvCkb,GAAgBjzE,EAASkkE,GACzBirB,GAAcjrB,EAAOA,EAAM26B,GAAiBpK,GAAiBz0F,EAASkkE,EAAOlkE,EAAS+3D,IAClFiI,GAAgBjI,IAChB62B,GAA0Bl0B,EAAOwJ,EAAOnM,GAEtB,MAAlB6mC,GACApP,GAAyBtrB,EAAOnM,EAAO23B,EAE/C,CACA,IAAIuP,GAIJ,SAASC,GAA0BxkC,EAAOwJ,EAAOnM,EAAOn8G,GACpD+sH,WAAmB,GACZzE,EAAM3F,IAAUwW,cAAwC,GACnE,EAoEA,SAASoqB,GAAYvjJ,GAEjB,OA7vZJ,SAASwjJ,GAAKz9C,EAAM/lG,GAEhB,OAAO+lG,EAAK/lG,EAChB,CA0vZWwjJ,CAt+YX,SAASC,KAGL,OAFqBr6B,GAAiBC,OAAOU,YAGjD,CAi+YyB05B,GACKhgC,GAAgBzjH,EAC9C,CAoBA,SAAS0jJ,GAAWpuB,EAAUv+H,EAAOwsI,GACjC,MAAMjb,EAAQqB,KAQd,OANIs4B,GAAe35B,EADEqC,IACmB5zH,IAGpCy+I,GAFc5rB,KACA6C,KACwBnE,EAAOgN,EAAUv+H,EAAOuxH,EAAM3F,IAAW4gB,GAAW,GAGvFmgB,EACX,CAKA,SAASC,GAAsC7kC,EAAO3C,EAAOmM,EAAOvxH,EAAO6sJ,GACvE,MACMrqJ,EAAWqqJ,EAAe,QAAU,QAE1ChO,GAAqB92B,EAAOwJ,EAHbnM,EAAMjvH,OAGqBqM,GAAWA,EAAUxC,EACnE,CAmCA,SAAS8sJ,GAAe7jJ,EAAOvP,EAAMsyJ,EAAYC,GAC7C,MAAM16B,EAAQqB,KACR7K,EAAQ8K,KACRq5B,EAAgBx/B,GAAgBzjH,EAIhC66G,EAAWyN,EAAM3F,IACjBxG,EAAQ2C,EAAMqR,gBAzCxB,SAAS2zB,GAA4B9jJ,EAAO8+G,EAAOwJ,EAAO73H,EAAMsyJ,EAAYC,GAGxE,MAAMG,EAAcrkC,EAAMvxH,OAEpB4uH,EAAQk1B,GAAiBvyB,EAAO9+G,EAAO,EAA2BvP,EAD1Do4H,GAAYs6B,EAAaJ,IAEvC9M,UAAkBn3B,EAAOwJ,EAAOnM,EAAO0M,GAAYs6B,EAAaH,IAC5C,OAAhB7mC,EAAM/6G,OACNu5I,GAAqBx+B,EAAOA,EAAM/6G,OAAO,GAEnB,OAAtB+6G,EAAMshB,aACNkd,GAAqBx+B,EAAOA,EAAMshB,aAAa,GAE7B,OAAlB3e,EAAM01B,SACN11B,EAAM01B,QAAQuP,aAAajlC,EAAO3C,GAE/BA,CACX,CAyBQ2nC,CAA4Bb,EAAenkC,EAAOwJ,EAAO73H,EAAMsyJ,EAAYC,GAC3ElkC,EAAM/iH,KAAKknJ,GACTnoC,EAASkpC,GAA2BllC,EAAOwJ,EAAOnM,EAAOtB,EAAUpqH,EAAMuP,GAC/EsoH,EAAM26B,GAAiBnoC,EACvB,MAAMmpC,EAAgB7/B,GAAgBjI,GAItCiO,UAAgBjO,GAAO,GACvBqhB,GAAsB3iB,EAAUC,EAAQqB,GACe,KAApC,GAAdA,EAAMxE,QAA8EmV,MAGrFt8F,GAAYsuF,EAAOwJ,EAAOxN,EAAQqB,GAKP,IAluZnC,SAAS+nC,KACL,OAAO96B,GAAiBC,OAAO4C,iBACnC,CAguZQi4B,IACA7sB,GAAgBvc,EAAQwN,GAhuZhC,SAAS67B,KACL/6B,GAAiBC,OAAO4C,mBAC5B,CAguZIk4B,GACIF,IACAjR,GAA0Bl0B,EAAOwJ,EAAOnM,GACxC42B,GAAsBj0B,EAAO3C,EAAOmM,IAEjB,OAAnB06B,GACApP,GAAyBtrB,EAAOnM,GAE7B0nC,EACX,CAOA,SAASO,KACL,IAAIl6B,EAAeD,KAEfK,KACAC,MAIAL,EAAeA,EAAa3mD,OAC5B6mD,GAAgBF,GAAc,IAElC,MAAM/N,EAAQ+N,GAxuZlB,SAASm6B,GAAyBloC,GAC9B,OAAOiN,GAAiBI,yBAA2BrN,CACvD,EAwuZQkoC,CAAyBloC,IAjrZjC,SAASmoC,KACLl7B,GAAiBI,uBAAyB,IAC9C,CAgrZQ86B,GA7vZR,SAASC,KACLn7B,GAAiBC,OAAO4C,mBAC5B,CA6vZIs4B,GACA,MAAMzlC,EAAQ8K,KACd,OAAI9K,EAAMqR,kBACNnD,GAAuBlO,EAAOoL,GAC1BjG,GAAmBiG,IACnBpL,EAAM01B,QAAQgQ,WAAWt6B,IAGD,MAA5B/N,EAAM61B,oBAx3Xd,SAASyS,GAActoC,GACnB,OAA4D,IAAtC,EAAdA,EAAMxE,MAClB,CAs3X4C8sC,CAActoC,IAClDwnC,GAAsC7kC,EAAO3C,EAAOwN,KAAYxN,EAAM61B,oBAAoB,GAE/D,MAA3B71B,EAAM21B,mBAn2Xd,SAAS4S,GAAcvoC,GACnB,OAA6D,IAAvC,GAAdA,EAAMxE,MAClB,CAi2X2C+sC,CAAcvoC,IACjDwnC,GAAsC7kC,EAAO3C,EAAOwN,KAAYxN,EAAM21B,mBAAmB,GAEtFsS,EACX,CAYA,SAASO,GAAU3kJ,EAAOvP,EAAMsyJ,EAAYC,GACxCa,UAAe7jJ,EAAOvP,EAAMsyJ,EAAYC,GACxCoB,KACOO,EACX,CACA,IAAIX,GAA6BA,CAACllC,EAAOwJ,EAAOnM,EAAOtB,EAAUpqH,EAAMuP,KACnE+sH,IAAmB,GACZsM,GAAkBxe,EAAUpqH,EA9yYvC,SAASm0J,KACL,OAAOx7B,GAAiBC,OAAO6C,gBACnC,CA4yY6C04B,KAsF7C,SAASC,GAAwB7kJ,EAAO+iJ,EAAYC,GAChD,MAAM16B,EAAQqB,KACR7K,EAAQ8K,KACRq5B,EAAgBjjJ,EAAQyjH,GAIxBtH,EAAQ2C,EAAMqR,gBAvCxB,SAAS20B,GAAqC9kJ,EAAO8+G,EAAOwJ,EAAOy6B,EAAYC,GAE3E,MAAMG,EAAcrkC,EAAMvxH,OACpB6T,EAAQynH,GAAYs6B,EAAaJ,GACjC5mC,EAAQk1B,GAAiBvyB,EAAO9+G,EAAO,EAAoC,eAAgBoB,GAOjG60I,OAJc,OAAV70I,GACAu5I,GAAqBx+B,EAAO/6G,GAAO,GAGvC60I,GAAkBn3B,EAAOwJ,EAAOnM,EADd0M,GAAYs6B,EAAaH,IAErB,OAAlBlkC,EAAM01B,SACN11B,EAAM01B,QAAQuP,aAAajlC,EAAO3C,GAE/BA,CACX,CAwBQ2oC,CAAqC7B,EAAenkC,EAAOwJ,EAAOy6B,EAAYC,GAC9ElkC,EAAM/iH,KAAKknJ,GACf74B,GAAgBjO,GAAO,GACvB,MAAM/3D,EAAU2gG,GAAoCjmC,EAAOwJ,EAAOnM,EAAOn8G,GACzEsoH,SAAM26B,GAAiB7+F,EACnB0oE,MACAt8F,GAAYsuF,EAAOwJ,EAAOlkE,EAAS+3D,GAEvCkb,GAAgBjzE,EAASkkE,GACrBlE,GAAgBjI,KAChB62B,GAA0Bl0B,EAAOwJ,EAAOnM,GACxC42B,GAAsBj0B,EAAO3C,EAAOmM,IAElB,MAAlB06B,GACApP,GAAyBtrB,EAAOnM,GAE7B0oC,EACX,CAOA,SAASG,KACL,IAAI96B,EAAeD,KACnB,MAAMnL,EAAQ8K,KACd,OAAIU,KACAC,MAIAL,EAAeA,EAAa3mD,OAC5B6mD,GAAgBF,GAAc,IAG9BpL,EAAMqR,kBACNnD,GAAuBlO,EAAOoL,GAC1BjG,GAAmBiG,IACnBpL,EAAM01B,QAAQgQ,WAAWt6B,IAG1B86B,EACX,CAYA,SAASC,GAAmBjlJ,EAAO+iJ,EAAYC,GAC3C6B,UAAwB7kJ,EAAO+iJ,EAAYC,GAC3CgC,KACOC,EACX,CACA,IAAIF,GAAsCA,CAACjmC,EAAOwJ,EAAOnM,EAAOn8G,KAC5D+sH,IAAmB,GACZmM,GAAkB5Q,EAAM3F,IAAwC,KA4C3E,SAASuiC,KACL,OAAOv7B,IACX,CAKA,SAASvxB,GAAUroG,GAGf,QAASA,GAA2B,mBAAbA,EAAImC,IAC/B,CAIA,SAASizJ,GAAep1J,GACpB,QAASA,GAAgC,mBAAlBA,EAAIkzC,SAC/B,CAiBA,SAASmiH,GAAW/sH,EAAWgtH,EAAYC,EAAYC,GACnD,MAAMj9B,EAAQqB,KACR7K,EAAQ8K,KACRzN,EAAQ8N,KACdu7B,OA+DJ,SAASA,GAAiB1mC,EAAOwJ,EAAOzN,EAAUsB,EAAO9jF,EAAWgtH,EAAYE,GAC5E,MAAME,EAAuBrhC,GAAgBjI,GAEvC0e,EADkB/b,EAAMqR,iBACMipB,GAAwBt6B,GACtD1+G,EAAUkoH,EAAM9F,IAIhBsY,EAAWqe,GAAwB7wB,GAEzC,IAAIo9B,GAAiB,EAKrB,GAAkB,EAAbvpC,EAAMrjH,MAAsCysJ,EAAqB,CAClE,MAAMzqC,GAASyN,GAAiBpM,EAAOmM,GACjCvvH,GAASwsJ,EAAsBA,EAAoBzqC,IAAUA,GAC7D6qC,GAAgB7qB,EAAS1nI,OACzBwyJ,GAAoBL,EACrBlxB,IAAWkxB,EAAoBn9B,GAAYiM,GAAOlY,EAAMn8G,SACzDm8G,EAAMn8G,MAaV,IAAI6lJ,GAAmB,KAUvB,IAHKN,GAAuBE,IACxBI,GAnEZ,SAASC,GAAqBhnC,EAAOwJ,EAAOjwF,EAAW0tH,GACnD,MAAMlrB,EAAW/b,EAAMtsE,QACvB,GAAgB,MAAZqoF,EACA,QAAS1mI,EAAI,EAAGA,EAAI0mI,EAASznI,OAAS,EAAGe,GAAK,EAAG,CAC7C,MAAM6xJ,EAAmBnrB,EAAS1mI,GAClC,GAAI6xJ,IAAqB3tH,GAAawiG,EAAS1mI,EAAI,KAAO4xJ,EAAU,CAIhE,MAAMjrB,EAAWxS,EAAM/F,IACjB0jC,EAAwBprB,EAAS1mI,EAAI,GAC3C,OAAO2mI,EAAS1nI,OAAS6yJ,EAAwBnrB,EAASmrB,GAAyB,IACvF,CAMgC,iBAArBD,IACP7xJ,GAAK,EAEb,CAEJ,OAAO,IACX,CA2C+B2xJ,CAAqBhnC,EAAOwJ,EAAOjwF,EAAW8jF,EAAMn8G,QAElD,OAArB6lJ,IAKuBA,GAAiBK,sBAAwBL,IACjDM,qBAAuBd,EACtCQ,GAAiBK,qBAAuBb,EACxCK,GAAiB,MAEhB,CACDL,EAAae,GAAajqC,EAAOmM,EAAOloH,EAASilJ,GAAY,GAC7D,MAAMr+B,GAAYnM,EAASwrC,OAAOttJ,GAAQs/B,EAAWgtH,GAErDvqB,EAASnnI,KAAK0xJ,EAAYr+B,IAC1B6T,GAAYA,EAASlnI,KAAK0kC,EAAWutH,GAAmBD,GAAeA,GAAgB,EAC3F,CACJ,MAIIN,EAAae,GAAajqC,EAAOmM,EAAOloH,EAASilJ,GAAY,GAGjE,MAAM9lC,EAAUpD,EAAMoD,QACtB,IAAI2V,GACJ,GAAIwwB,GAA8B,OAAZnmC,IAAqB2V,GAAQ3V,EAAQlnF,IAAa,CACpE,MAAMiuH,GAAcpxB,GAAM9hI,OAC1B,GAAIkzJ,GACA,QAASnyJ,GAAI,EAAGA,GAAImyJ,GAAanyJ,IAAK,EAAG,CACrC,MAQM+8F,GALoBo3B,EAHZ4M,GAAM/gI,KAEC+gI,GAAM/gI,GAAI,IAMH8uC,UAAUoiH,GAChCj5C,GAAM0uB,EAAS1nI,OACrB0nI,EAASnnI,KAAK0xJ,EAAYn0D,IAC1B2pC,GAAYA,EAASlnI,KAAK0kC,EAAW8jF,EAAMn8G,MAAOosG,KAAOA,GAAM,GACnE,CAER,CACJ,CAxJIo5C,CAAiB1mC,EAAOwJ,EAAOA,EAAM3F,IAAWxG,EAAO9jF,EAAWgtH,EAAYE,GACvEH,EACX,CAuJA,SAASmB,GAAiCj+B,EAAOloH,EAASilJ,EAAYzmJ,GAClE,IACIqpH,UAAS,EAAmC7nH,EAASilJ,IAE5B,IAAlBA,EAAWzmJ,EACtB,OACOwc,GACHwkB,UAAY0oF,EAAOltG,IACZ,CACX,SAEI6sG,GAAS,EAAiC7nH,EAASilJ,EACvD,CACJ,CAWA,SAASe,GAAajqC,EAAOmM,EAAOloH,EAASilJ,EAAYmB,GAGrD,OAAO,SAASC,EAA0C7nJ,GAGtD,GAAIA,IAAMid,SACN,OAAOwpI,EAKXnV,GADkB/zB,EAAMgI,iBAAkB,EAAKsE,GAAyBtM,EAAMn8G,MAAOsoH,GAASA,GAE9F,IAAIvpH,EAASwnJ,GAAiCj+B,EAAOloH,EAASilJ,EAAYzmJ,GAGtE8nJ,EAAiBD,EAA0CN,qBAC/D,KAAOO,GAEH3nJ,EAASwnJ,GAAiCj+B,EAAOloH,EAASsmJ,EAAgB9nJ,IAAMG,EAChF2nJ,EAAiBA,EAAeP,qBAEpC,OAAIK,IAAqC,IAAXznJ,GAC1BH,EAAE+nJ,iBAEC5nJ,CACX,CACJ,CAcA,SAAS6nJ,GAAc9wJ,EAAQ,GAC3B,OAr0ZJ,SAAS+wJ,GAAgB/wJ,GAGrB,OAFqBszH,GAAiBC,OAAOU,aAIjD,SAAS+8B,GAAYC,EAAc54B,GAC/B,KAAO44B,EAAe,GAGlB54B,EAAcA,EAAYrL,IAC1BikC,IAEJ,OAAO54B,CACX,CAXQ24B,CAAYhxJ,EAAOszH,GAAiBC,OAAOU,eAC3BvH,GACxB,CAi0ZWqkC,CAAgB/wJ,EAC3B,CAUA,SAASkxJ,GAA4B7qC,EAAO8qC,GACxC,IAAIC,EAAyB,KAC7B,MAAMC,EA54dV,SAASC,GAAsBjrC,GAC3B,MAAMK,EAAYL,EAAM/6G,MACxB,GAAiB,MAAbo7G,EAAmB,CACnB,MAAM6qC,EAAqB7qC,EAAUpjG,QAAQ,GAG7C,KAA0B,EAArBiuI,GACD,OAAO7qC,EAAU6qC,EAAqB,EAE9C,CACA,OAAO,IACX,CAi4d+BD,CAAsBjrC,GACjD,QAAShoH,EAAI,EAAGA,EAAI8yJ,EAAgB7zJ,OAAQe,IAAK,CAC7C,MAAMy0H,EAAYq+B,EAAgB9yJ,GAGlC,GAAkB,MAAdy0H,GAMJ,GAA2B,OAAvBu+B,EACA9pC,GAA2BlB,EAAOyM,GAAkC,GACpEtL,GAAyB6pC,EAAoBv+B,GAC7C,OAAOz0H,OARP+yJ,EAAyB/yJ,CAUjC,CACA,OAAO+yJ,CACX,CA0BA,SAASI,GAAgBL,GACrB,MAAMM,EAAgB59B,KAAW5G,IAA4BT,IAC7D,IAAKilC,EAAc/qB,WAAY,CAG3B,MACMgrB,EAAkBD,EAAc/qB,WAClCvG,GAFuBgxB,EAAkBA,EAAgB7zJ,OAAS,EAErC,MAC3Bq0J,EAAQD,EAAgB9wJ,QAC9B,IAAIgxJ,EAAiBH,EAAc5mF,MACnC,KAA0B,OAAnB+mF,GAAyB,CAC5B,MAAMC,EAAYV,EAAkBD,GAA4BU,EAAgBT,GAAmB,EACjF,OAAdU,IACIF,EAAME,GACNF,EAAME,GAAW1qB,eAAiByqB,EAGlCF,EAAgBG,GAAaD,EAEjCD,EAAME,GAAaD,GAEvBA,EAAiBA,EAAe3mI,IACpC,CACJ,CACJ,CAYA,SAAS6mI,GAAal/B,EAAWm/B,EAAgB,EAAGzmJ,GAChD,MAAMknH,EAAQqB,KACR7K,EAAQ8K,KACRsT,EAAkBmU,GAAiBvyB,EAAO2E,GAAgBiF,EAAW,GAA+B,KAAMtnH,GAAS,MAEtF,OAA/B87H,EAAgBV,aAChBU,EAAgBV,WAAaqrB,GAEjCt9B,OACsBjC,EAAMhF,KACiBoG,OAEoB,KAApC,GAAxBwT,EAAgBvlB,QAziSzB,SAASmwC,GAAgBhpC,EAAOwJ,EAAO4U,GAKnCF,GAJiB1U,EAAM3F,IAIY,EAAoC2F,EAAO4U,EAH1DhC,GAAkBpc,EAAOoe,EAAiB5U,GAE7CiT,GADG2B,EAAgB35D,QAAU+kD,EAAMhG,IACE4a,EAAiB5U,GAE3E,CAqiSQw/B,CAAgBhpC,EAAOwJ,EAAO4U,EAEtC,CA+BA,SAAS6qB,GAAsBzyB,EAAU+sB,EAAI9e,GACzCykB,UAAuB1yB,EAAU,GAAI+sB,EAAI,GAAI9e,GACtCwkB,EACX,CA6BA,SAASC,GAAuB1yB,EAAU8sB,EAAQC,EAAIC,EAAQ/e,GAC1D,MAAMjb,EAAQqB,KACRs+B,EAAoB9F,GAAe75B,EAAO85B,EAAQC,EAAIC,GAQ5D,OAPI2F,IAAsBtX,IAGtB6E,GAFc5rB,KACA6C,KACwBnE,EAAOgN,EAAU2yB,EAAmB3/B,EAAM3F,IAAW4gB,GAAW,GAInGykB,EACX,CAuYA,SAASE,GAAgBjhH,EAAMlmB,GAG3B,OAAQkmB,GAAQ,GAAmClmB,GAAQ,CAC/D,CACA,SAASonI,GAAqBC,GAE1B,OAAQA,GAAiB,GAAoC,KACjE,CAUA,SAASC,GAA8BD,GAEnC,OAAwB,EAAhBA,CACZ,CACA,SAASE,GAAqBF,GAE1B,OAAwB,OAAhBA,IAAwD,CACpE,CACA,SAASG,GAAqBH,EAAernI,GAGzC,OAAyB,OAAhBqnI,EACLrnI,GAAQ,CAChB,CAKA,SAASynI,GAA8BJ,GAEnC,OAAwB,EAAhBA,CACZ,CAoVA,SAASK,GAAep1B,EAAOq1B,EAAa1oJ,EAAO2oJ,EAAWC,GAC1D,MAAMC,EAAkBx1B,EAAMrzH,EAAQ,GAChC8oJ,EAAwB,OAAhBJ,EACd,IAAIK,EAASJ,EAAYR,GAAqBU,GAAmBP,GAAqBO,GAClFG,GAAiB,EAMrB,KAAkB,IAAXD,KAAoC,IAAnBC,GAA4BF,IAAQ,CAExD,MACMG,EAAsB51B,EAAM01B,EAAS,GACvCG,GAF0B71B,EAAM01B,GAEML,KACtCM,GAAiB,EACjB31B,EAAM01B,EAAS,GAAKJ,EAAYH,GAA8BS,GAC1DZ,GAA8BY,IAEtCF,EAASJ,EAAYR,GAAqBc,GACtCX,GAAqBW,EAC7B,CACID,IAEA31B,EAAMrzH,EAAQ,GAAK2oJ,EAAYN,GAA8BQ,GACzDL,GAA8BK,GAE1C,CAmBA,SAASK,GAAeC,EAAmBT,GAGvC,OAA0B,OAAtBS,GAEe,MAAfT,IAECn1J,MAAMC,QAAQ21J,GAAqBA,EAAkB,GAAKA,KACvDT,MAICn1J,MAAMC,QAAQ21J,IAA6C,iBAAhBT,IAGzCtyB,GAAqB+yB,EAAmBT,IAC3C,CAGZ,CAGA,MAAMU,GAAc,CAChBC,QAAS,EACTp1J,IAAK,EACLq1J,OAAQ,EACRvyJ,MAAO,EACPwyJ,SAAU,GAMd,SAASC,GAAiBnwG,GACtB,OAAOA,EAAKr1C,UAAUolJ,GAAYn1J,IAAKm1J,GAAYE,OACvD,CAwCA,SAASG,GAAmBpwG,EAAMr5C,GAC9B,MAAMkY,EAAMkxI,GAAYC,QACxB,OAAInxI,IAAQlY,GACD,GAEXA,EAAQopJ,GAAYE,OAmFxB,SAASI,GAAkBrwG,EAAMswG,EAAYz2B,GACzC,KAAOy2B,EAAaz2B,GAAY75E,EAAKshE,WAAWgvC,GAAc,IAC1DA,IAEJ,OAAOA,CACX,CAxFiCD,CAAkBrwG,EAAM+vG,GAAYn1J,IAAM+L,EAAOkY,GACvE0xI,GAAkBvwG,EAAMr5C,EAAOkY,GAC1C,CAmEA,SAAS0xI,GAAkBvwG,EAAMswG,EAAYz2B,GACzC,KAAOy2B,EAAaz2B,GAAY75E,EAAKshE,WAAWgvC,IAAe,IAC3DA,IAEJ,OAAOA,CACX,CAgJA,SAASE,GAAYthJ,EAAMxR,EAAOurJ,GAC9BwH,UAAqBvhJ,EAAMxR,EAAOurJ,GAAQ,GACnCuH,EACX,CAgBA,SAASE,GAAYv4J,EAAWuF,GAC5B+yJ,UAAqBt4J,EAAWuF,EAAO,MAAM,GACtCgzJ,EACX,CAuDA,SAASC,GAAWh2J,IAkDpB,SAASi2J,GAAgB/zB,EAAkBg0B,EAAcnzJ,EAAO6sJ,GAC5D,MAAM9kC,EAAQ8K,KACRgB,EAAeC,EAAsB,GACvC/L,EAAM61B,iBACNwV,GAAuBrrC,EAAO,KAAM8L,EAAcg5B,GAEtD,MAAMt7B,EAAQqB,KACd,GAAI5yH,IAAU45I,IAAasR,GAAe35B,EAAOsC,EAAc7zH,GAAQ,CAGnE,MAAMolH,EAAQ2C,EAAM/iH,KAAKwwH,MACzB,GAAI69B,GAAsBjuC,EAAOynC,KAAkByG,GAAiBvrC,EAAO8L,GAAe,CActF,IAAI0/B,EAAe1G,EAAeznC,EAAM61B,mBAAqB71B,EAAM21B,kBAG9C,OAAjBwY,IAEAvzJ,EAAQm+G,GAAuBo1C,EAAcvzJ,GAAgB,KAIjE4sJ,GAAsC7kC,EAAO3C,EAAOmM,EAAOvxH,EAAO6sJ,EACtE,MA4YR,SAAS2G,GAAiBzrC,EAAO3C,EAAOmM,EAAOzN,EAAU2vC,EAAkBC,EAAkB7G,EAAch5B,GACnG4/B,IAAqB7Z,KAErB6Z,EAAmBxnD,IAEvB,IAAI0nD,EAAW,EACXC,EAAW,EACXC,EAAS,EAAIJ,EAAiBp3J,OAASo3J,EAAiB,GAAK,KAC7DK,EAAS,EAAIJ,EAAiBr3J,OAASq3J,EAAiB,GAAK,KACjE,KAAkB,OAAXG,GAA8B,OAAXC,GAAiB,CAGvC,MAAMnpG,EAAWgpG,EAAWF,EAAiBp3J,OAASo3J,EAAiBE,EAAW,QAAKz6J,EACjF2hE,EAAW+4F,EAAWF,EAAiBr3J,OAASq3J,EAAiBE,EAAW,QAAK16J,EACvF,IACIspJ,GADAuR,GAAS,KAETF,IAAWC,GAEXH,GAAY,EACZC,GAAY,EACRjpG,IAAakQ,IACbk5F,GAASD,EACTtR,GAAW3nF,IAGC,OAAXi5F,GAA8B,OAAXD,GAAmBA,EAASC,GAKpDH,GAAY,EACZI,GAASF,IAOTD,GAAY,EACZG,GAASD,EACTtR,GAAW3nF,GAEA,OAAXk5F,IACAC,GAAcjsC,EAAO3C,EAAOmM,EAAOzN,EAAUiwC,GAAQvR,GAAUqK,EAAch5B,GAEjFggC,EAASF,EAAWF,EAAiBp3J,OAASo3J,EAAiBE,GAAY,KAC3EG,EAASF,EAAWF,EAAiBr3J,OAASq3J,EAAiBE,GAAY,IAC/E,CACJ,CA1bYJ,CAAiBzrC,EAAO3C,EAAOmM,EAAOA,EAAM3F,IAAW2F,EAAMsC,EAAe,GAAItC,EAAMsC,EAAe,GA8TjH,SAASogC,GAAuB90B,EAAkBg0B,EAAcnzJ,GAC5D,GAAa,MAATA,GAAuD,KAAVA,EAC7C,OAAOisG,GACX,MAAMioD,EAAqB,GACrBC,EAAiBlsB,GAAgBjoI,GACvC,GAAIxD,MAAMC,QAAQ03J,GACd,QAAS/2J,EAAI,EAAGA,EAAI+2J,EAAe93J,OAAQe,IACvC+hI,EAAiB+0B,EAAoBC,EAAe/2J,IAAI,QAAI,GAGjC,iBAAnB+2J,EACZ,UAAWj3J,KAAOi3J,EACVA,EAAe1xJ,eAAevF,IAC9BiiI,EAAiB+0B,EAAoBh3J,EAAKi3J,EAAej3J,QAIlC,iBAAnBi3J,GACZhB,EAAae,EAAoBC,GAMrC,OAAOD,CACX,CAvVsHD,CAAuB90B,EAAkBg0B,EAAcnzJ,GAAQ6sJ,EAAch5B,EAE/L,CACJ,CAzFIq/B,CAAgBkB,GAAuBC,GAAmBp3J,GAAS,EACvE,CAUA,SAASo3J,GAAkBj1B,EAAe98E,GACtC,QAASllD,EA5Ub,SAASk3J,GAAehyG,GACpBiyG,OA4EJ,SAASA,GAAiBjyG,GACtB+vG,GAAYn1J,IAAM,EAClBm1J,GAAYE,OAAS,EACrBF,GAAYryJ,MAAQ,EACpBqyJ,GAAYG,SAAW,EACvBH,GAAYC,QAAUhwG,EAAKjmD,MAC/B,CAlFIk4J,CAAiBjyG,GACVowG,GAAmBpwG,EAAMuwG,GAAkBvwG,EAAM,EAAG+vG,GAAYC,SAC3E,CAyUiBgC,CAAehyG,GAAOllD,GAAK,EAAGA,EAAIs1J,GAAmBpwG,EAAMllD,GACpE+hI,GAAiBC,EAAeqzB,GAAiBnwG,IAAO,EAEhE,CASA,SAASywG,GAAqBvhJ,EAAMxR,EAAOurJ,EAAQsB,GAC/C,MAAMt7B,EAAQqB,KACR7K,EAAQ8K,KAIRgB,EAAeC,EAAsB,GACvC/L,EAAM61B,iBACNwV,GAAuBrrC,EAAOv2G,EAAMqiH,EAAcg5B,GAElD7sJ,IAAU45I,IAAasR,GAAe35B,EAAOsC,EAAc7zH,IAE3Dg0J,GAAcjsC,EADAA,EAAM/iH,KAAKwwH,MACGjE,EAAOA,EAAM3F,IAAWp6G,EAAM+/G,EAAMsC,EAAe,GAunBvF,SAAS2gC,GAAgBx0J,EAAOurJ,GAC5B,OAAa,MAATvrJ,GAA2B,KAAVA,IAMM,iBAAXurJ,EACZvrJ,GAAgBurJ,EAEM,iBAAVvrJ,IACZA,EAAQ0c,GAAUurH,GAAgBjoI,MAE/BA,CACX,CAroB4Fw0J,CAAgBx0J,EAAOurJ,GAASsB,EAAch5B,EAE1I,CA0DA,SAASy/B,GAAiBvrC,EAAO8L,GAE7B,OAAOA,GAAgB9L,EAAM21B,iBACjC,CAUA,SAAS0V,GAAuBrrC,EAAO4pC,EAAa99B,EAAcg5B,GAE9D,MAAMvwB,EAAQvU,EAAM/iH,KACpB,GAAgC,OAA5Bs3H,EAAMzI,EAAe,GAAa,CAMlC,MAAMzO,EAAQkX,EAAM9G,MAEdi/B,EAAiBnB,GAAiBvrC,EAAO8L,GAC3Cw/B,GAAsBjuC,EAAOynC,IAAiC,OAAhB8E,IAAyB8C,IAKvE9C,GAAc,GAElBA,EAkBR,SAAS+C,GAAuBp4B,EAAOlX,EAAOuvC,EAAY9H,GACtD,MAAM+H,EA5/cV,SAASC,EAAuBv4B,GAC5B,MAAMtI,EAAwB3B,GAAiBC,OAAO0B,sBACtD,OAAiC,IAA1BA,EAA+B,KAAOsI,EAAMtI,EACvD,CAy/c6B6gC,CAAuBv4B,GAChD,IAAIw4B,EAAWjI,EAAeznC,EAAM81B,gBAAkB91B,EAAM41B,eAC5D,GAAyB,OAArB4Z,EAK2G,KAA9D/H,EAAeznC,EAAM+1B,cAAgB/1B,EAAMg2B,iBAMpFuZ,EAAaI,GADbJ,EAAaK,GAA6B,KAAM14B,EAAOlX,EAAOuvC,EAAY9H,GACxBznC,EAAM/6G,MAAOwiJ,GAE/DiI,EAAW,UAGd,CAGD,MAAMna,EAAuBv1B,EAAMu1B,qBAEnC,IADwE,IAAzBA,GAA+Bre,EAAMqe,KAA0Bia,EAI1G,GAFAD,EACIK,GAA6BJ,EAAkBt4B,EAAOlX,EAAOuvC,EAAY9H,GAC5D,OAAbiI,EAAmB,CAOnB,IAAIG,EAuCpB,SAASC,GAA2B54B,EAAOlX,EAAOynC,GAC9C,MAAMsI,EAAWtI,EAAeznC,EAAM+1B,cAAgB/1B,EAAMg2B,cAC5D,GAAuC,IAAnCmW,GAAqB4D,GAIzB,OAAO74B,EAAM80B,GAAqB+D,GACtC,CA9CyCD,CAA2B54B,EAAOlX,EAAOynC,QACvC3zJ,IAAvB+7J,GAAoCz4J,MAAMC,QAAQw4J,KAIlDA,EAAqBD,GAA6B,KAAM14B,EAAOlX,EAAO6vC,EAAmB,GAAkCpI,GAC3HoI,EACIF,GAAyBE,EAAoB7vC,EAAM/6G,MAAOwiJ,GA4FlF,SAASuI,GAA2B94B,EAAOlX,EAAOynC,EAAc8E,GAI5Dr1B,EAAM80B,GAHWvE,EAAeznC,EAAM+1B,cAAgB/1B,EAAMg2B,gBAGpBuW,CAC5C,CAhGoByD,CAA2B94B,EAAOlX,EAAOynC,EAAcoI,GAE/D,MAOIH,EAkGhB,SAASO,GAAgB/4B,EAAOlX,EAAOynC,GACnC,IAAIiI,EACJ,MAAM3+B,EAAe/Q,EAAM+Q,aAK3B,QAAS/4H,EAAI,EAAIgoH,EAAMu1B,qBAAsBv9I,EAAI+4H,EAAc/4H,IAE3D03J,EAAWC,GAAyBD,EADtBx4B,EAAMl/H,GAAGkrH,UAC8BukC,GAEzD,OAAOkI,GAAyBD,EAAU1vC,EAAM/6G,MAAOwiJ,EAC3D,CA9G2BwI,CAAgB/4B,EAAOlX,EAAOynC,EAGrD,CACA,YAAiB3zJ,IAAb47J,IACAjI,EAAgBznC,EAAM81B,gBAAkB4Z,EAAa1vC,EAAM41B,eAAiB8Z,GAEzEH,CACX,CA7EsBD,CAAuBp4B,EAAOlX,EAAOusC,EAAa9E,GArsBxE,SAASyI,GAAsBh5B,EAAOlX,EAAOmwC,EAAuBtsJ,EAAOusJ,EAAe3D,GAEtF,IAAI4D,EAAY5D,EAAiBzsC,EAAM+1B,cAAgB/1B,EAAMg2B,cACzDsa,EAAWtE,GAAqBqE,GAChCE,EAAWpE,GAAqBkE,GACpCn5B,EAAMrzH,GAASssJ,EACf,IACI5D,EADAiE,GAAyB,EAgB7B,GAdIp5J,MAAMC,QAAQ84J,IAGd5D,EAD4B4D,EACM,IAEd,OAAhB5D,GACAtyB,GAJwBk2B,EAIkB5D,GAAe,KAEzDiE,GAAyB,IAI7BjE,EAAc4D,EAEdC,EAMA,GAHyC,IAAbG,EAGH,CAErB,MAAME,EAAezE,GAAqB90B,EAAMo5B,EAAW,IAC3Dp5B,EAAMrzH,EAAQ,GAAKkoJ,GAAgB0E,EAAcH,GAG5B,IAAjBG,IAEAv5B,EAAMu5B,EAAe,GACjBrE,GAAqBl1B,EAAMu5B,EAAe,GAAI5sJ,IAGtDqzH,EAAMo5B,EAAW,GAvP7B,SAASI,GAAqBzE,EAAe3hG,GAGzC,OAAyB,OAAhB2hG,EAA6D3hG,GAAY,EACtF,CAmPkComG,CAAqBx5B,EAAMo5B,EAAW,GAAIzsJ,EACpE,MAEIqzH,EAAMrzH,EAAQ,GAAKkoJ,GAAgBuE,EAAU,GAG5B,IAAbA,IAEAp5B,EAAMo5B,EAAW,GAAKlE,GAAqBl1B,EAAMo5B,EAAW,GAAIzsJ,IAGpEysJ,EAAWzsJ,OAMfqzH,EAAMrzH,EAAQ,GAAKkoJ,GAAgBwE,EAAU,GAG5B,IAAbD,EACAA,EAAWzsJ,EAIXqzH,EAAMq5B,EAAW,GAAKnE,GAAqBl1B,EAAMq5B,EAAW,GAAI1sJ,GAEpE0sJ,EAAW1sJ,EAIX2sJ,IACAt5B,EAAMrzH,EAAQ,GAAKqoJ,GAA8Bh1B,EAAMrzH,EAAQ,KAEnEyoJ,GAAep1B,EAAOq1B,EAAa1oJ,GAAO,GAC1CyoJ,GAAep1B,EAAOq1B,EAAa1oJ,GAAO,GAoB9C,SAAS8sJ,GAA+B3wC,EAAOusC,EAAar1B,EAAOrzH,EAAO4oJ,GACtE,MAAMiD,EAAWjD,EAAiBzsC,EAAM81B,gBAAkB91B,EAAM41B,eAChD,MAAZ8Z,GAA6D,iBAAfnD,GAC9CtyB,GAAqBy1B,EAAUnD,IAAgB,IAE/Cr1B,EAAMrzH,EAAQ,GAAKwoJ,GAA8Bn1B,EAAMrzH,EAAQ,IAEvE,CA1BI8sJ,CAA+B3wC,EAAOusC,EAAar1B,EAAOrzH,EAAO4oJ,GACjE4D,EAAYtE,GAAgBuE,EAAUC,GAClC9D,EACAzsC,EAAM+1B,cAAgBsa,EAGtBrwC,EAAMg2B,cAAgBqa,CAE9B,CAknBQH,CAAsBh5B,EAAOlX,EAAOusC,EAAa99B,EAAc4gC,EAAgB5H,EACnF,CACJ,CA6LA,SAASmI,GAA6BJ,EAAkBt4B,EAAOlX,EAAOuvC,EAAY9H,GAG9E,IAAImJ,EAAmB,KACvB,MAAM7/B,EAAe/Q,EAAM+Q,aAC3B,IAAIwkB,EAAuBv1B,EAAMu1B,qBAOjC,KAN6B,IAAzBA,EACAA,EAAuBv1B,EAAM8Q,eAG7BykB,IAEGA,EAAuBxkB,IAC1B6/B,EAAmB15B,EAAMqe,GAEzBga,EAAaI,GAAyBJ,EAAYqB,EAAiB1tC,UAAWukC,GAC1EmJ,IAAqBpB,IAEzBja,IAEJ,OAAyB,OAArBia,IAIAxvC,EAAMu1B,qBAAuBA,GAE1Bga,CACX,CAQA,SAASI,GAAyBJ,EAAYtqJ,EAAOwiJ,GACjD,MAAMoJ,EAAgBpJ,EAAe,EAAkC,EACvE,IAAIqJ,GAAgB,EACpB,GAAc,OAAV7rJ,EACA,QAASjN,EAAI,EAAGA,EAAIiN,EAAMhO,OAAQe,IAAK,CACnC,MAAMiG,EAAOgH,EAAMjN,GACC,iBAATiG,EACP6yJ,EAAgB7yJ,EAGZ6yJ,IAAkBD,IACbz5J,MAAMC,QAAQk4J,KACfA,OAA4Bz7J,IAAfy7J,EAA2B,GAAK,CAAC,GAAIA,IAEtDx1B,GAAiBw1B,EAAYtxJ,IAAMwpJ,GAAsBxiJ,IAAQjN,IAG7E,CAEJ,YAAsBlE,IAAfy7J,EAA2B,KAAOA,CAC7C,CA4EA,SAASP,GAAsBh1B,EAAeliI,EAAK8C,GAM/C,MAAMm2J,EAAYl2J,OAAO/C,GACP,KAAdi5J,IAAqBA,EAAUx1J,SAAS,MACxCw+H,GAAiBC,EAAe+2B,EAAWn2J,EAEnD,CAqFA,SAASg0J,GAAcjsC,EAAO3C,EAAOmM,EAAOzN,EAAUtyG,EAAMxR,EAAO6sJ,EAAch5B,GAC7E,KAAmB,EAAbzO,EAAMrjH,MAGR,OAEJ,MAAMu6H,EAAQvU,EAAM/iH,KACdoxJ,EAAS95B,EAAMzI,EAAe,GAC9BwiC,EA3yCV,SAASC,GAA8BjF,GAEnC,OAAmE,IAAzC,EAAjBA,EACb,CAwyCgCiF,CAA8BF,GACtDG,GAAiBj6B,EAAOlX,EAAOmM,EAAO//G,EAAM+/I,GAAqB6E,GAASvJ,QAC1E3zJ,EACCs9J,GAAsBH,KAElBG,GAAsBx2J,IAv0CnC,SAASy2J,GAA8BpF,GAEnC,OAAgE,IAAxC,EAAhBA,EACZ,CAs0CgBoF,CAA8BL,KAE9Bp2J,EAAQu2J,GAAiBj6B,EAAO,KAAM/K,EAAO//G,EAAMqiH,EAAcg5B,IApvVjF,SAAS6J,GAAa5yC,EAAU+oC,EAAcvrB,EAAO9vH,EAAMxR,GACvD,GAAI6sJ,EAEK7sJ,EAMD8jH,EAAS1W,SAASk0B,EAAO9vH,GAJzBsyG,EAASxW,YAAYg0B,EAAO9vH,OAO/B,CACD,IAAIovG,GAA8B,IAAtBpvG,EAAK6Q,QAAQ,UAAcnpB,EAAY2mI,GAAoBE,SAC1D,MAAT//H,EAEA8jH,EAAS6yC,YAAYr1B,EAAO9vH,EAAMovG,IAKG,iBAAV5gH,GAAqBA,EAAM67C,SAAS,gBAG3D77C,EAAQA,EAAML,MAAM,GAAG,IACvBihH,GAASif,GAAoBC,WAGjChc,EAAS8yC,SAASt1B,EAAO9vH,EAAMxR,EAAO4gH,GAE9C,CACJ,CAytVQ81C,CAAa5yC,EAAU+oC,EADTv7B,GAAiBkE,KAAoBjE,GACP//G,EAAMxR,GAE1D,CA6BA,SAASu2J,GAAiBj6B,EAAOlX,EAAOmM,EAAO//G,EAAMvI,EAAO4jJ,GAMxD,MAAMgK,EAA4B,OAAVzxC,EACxB,IAAIplH,EACJ,KAAOiJ,EAAQ,GAAG,CACd,MAAM6tJ,EAASx6B,EAAMrzH,GACf8tJ,EAAkBv6J,MAAMC,QAAQq6J,GAEhC55J,EAAM65J,EAAkBD,EAAO,GAAKA,EACpCE,EAAuB,OAAR95J,EACrB,IAAI+5J,EAAoB1lC,EAAMtoH,EAAQ,GAClCguJ,IAAsBrd,KAQtBqd,EAAoBD,EAAe/qD,QAAc/yG,GAErD,IAAIi3H,EAAe6mC,EAAev3B,GAAiBw3B,EAAmBzlJ,GACjEtU,IAAQsU,EAAOylJ,OAAoB/9J,EAIxC,GAHI69J,IAAoBP,GAAsBrmC,KAC1CA,EAAesP,GAAiBq3B,EAAQtlJ,IAExCglJ,GAAsBrmC,KACtBnwH,EAAQmwH,EACJ0mC,GACA,OAAO72J,EAGf,MAAMo2J,GAAS95B,EAAMrzH,EAAQ,GAC7BA,EAAQ4tJ,EAAkBzF,GAAqBgF,IAAU7E,GAAqB6E,GAClF,CACA,GAAc,OAAVhxC,EAAgB,CAGhB,IAAI0vC,EAAWjI,EAAeznC,EAAM81B,gBAAkB91B,EAAM41B,eAC5C,MAAZ8Z,IACA90J,EAAQy/H,GAAiBq1B,EAAUtjJ,GAE3C,CACA,OAAOxR,CACX,CAOA,SAASw2J,GAAsBx2J,GAK3B,YAAiB9G,IAAV8G,CACX,CAgCA,SAASqzJ,GAAsBjuC,EAAOynC,GAClC,OAAiH,IAAzGznC,EAAMxE,OAASisC,EAAe,EAAmC,IAC7E,CAUA,SAASqK,GAAOjuJ,EAAOjJ,EAAQ,IAC3B,MAAMuxH,EAAQqB,KACR7K,EAAQ8K,KACRq5B,EAAgBjjJ,EAAQyjH,GAIxBtH,EAAQ2C,EAAMqR,gBAChBkhB,GAAiBvyB,EAAOmkC,EAAe,EAAwBlsJ,EAAO,MACtE+nH,EAAM/iH,KAAKknJ,GACTiL,EAAaC,GAAwBrvC,EAAOwJ,EAAOnM,EAAOplH,EAAOiJ,GACvEsoH,EAAM26B,GAAiBiL,EACnBphC,MACAt8F,GAAYsuF,EAAOwJ,EAAO4lC,EAAY/xC,GAG1CiO,GAAgBjO,GAAO,EAC3B,CACA,IAAIgyC,GAA0BA,CAACrvC,EAAOwJ,EAAOnM,EAAOplH,EAAOiJ,KACvD+sH,IAAmB,GA5rXvB,SAASqhC,GAAevzC,EAAU9jH,GAG9B,OAAO8jH,EAASwzC,WAAWt3J,EAC/B,CAyrXWq3J,CAAe9lC,EAAM3F,IAAW5rH,IA4C3C,SAASu3J,GAAkBjM,GACvBkM,UAAmB,GAAIlM,EAAI,IACpBiM,EACX,CAoBA,SAASC,GAAmBnM,EAAQC,EAAIC,GACpC,MAAMh6B,EAAQqB,KACR6kC,EAAerM,GAAe75B,EAAO85B,EAAQC,EAAIC,GACvD,OAAIkM,IAAiB7d,IACjB0I,GAAoB/wB,EAAOiE,KAAoBiiC,GAE5CD,EACX,CAoBA,SAASE,GAAmBrM,EAAQC,EAAI10J,EAAI60J,EAAIF,GAC5C,MAAMh6B,EAAQqB,KACR6kC,EAAejM,GAAej6B,EAAO85B,EAAQC,EAAI10J,EAAI60J,EAAIF,GAC/D,OAAIkM,IAAiB7d,IACjB0I,GAAoB/wB,EAAOiE,KAAoBiiC,GAE5CC,EACX,CAstCA,MAAMC,QAAIz+J,EAOV,IAAI0+J,GAAW,CAAC,KAAM,CAAC,CAAC,IAAK,KAAM,CAAC,KAAM,MAAOD,IAAI,CAAC,CAAC,KAAM,MAAOA,GAAGA,IAAI,CAAC,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,KAAM,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,OAAQ,CAAC,SAAU,SAAU,UAAW,YAAa,WAAY,SAAU,YAAa,CAAC,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,OAAQA,GAAG,CAAC,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,KAAM,CAAC,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,MAAO,OAAQ,CAAC,UAAW,WAAY,QAAS,QAAS,MAAO,OAAQ,OAAQ,SAAU,YAAa,UAAW,WAAY,aAAcA,GAAG,CAAC,CAAC,IAAK,KAAM,CAAC,KAAM,MAAO,CAAC,gBAAiB,gBAAiB,EAAG,CAAC,EAAG,GAAI,CAAC,SAAU,WAAY,YAAa,mBAAoB,CAAC,SAAU,YAAa,cAAe,kBAAmB,CAAC,WAAYA,GAAG,eAAgBA,IAAI,CAAC,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,OAAK,SAAK,SAAK,MAAO,KAAM,CAAC,YAAa,SAAU,eAAa,OAAQ,MAAO,IAAK,YAAa,CAAC,EAAG,MANl6B,SAASE,GAAO1vJ,GACZ,MAAe/K,EAAInE,KAAKm8C,MAAMn8C,KAAKmN,IAAI+B,IAAO02D,EAAI12D,EAAIjO,WAAW0J,QAAQ,YAAa,IAAIvH,OAC1F,OAAU,IAANe,GAAiB,IAANyhE,EACJ,EACJ,CACX,GAMA,IAAIi5F,GAAc,CAAC,EA0BnB,SAASC,GAAeC,GACpB,MAAMC,EAyFV,SAASC,GAAgBF,GACrB,OAAOA,EAAOv6J,cAAcmG,QAAQ,KAAM,IAC9C,CA3F6Bs0J,CAAgBF,GACzC,IAAIh9I,EAAQm9I,GAAcF,GAC1B,GAAIj9I,EACA,OAAOA,EAGX,MAAMo9I,EAAeH,EAAiB/5J,MAAM,KAAK,GAEjD,GADA8c,EAAQm9I,GAAcC,GAClBp9I,EACA,OAAOA,EAEX,GAAqB,OAAjBo9I,EACA,OAAOR,GAEX,MAAM,IAAIh5C,GAAa,KAAgDpF,EAC3E,CAsBA,SAAS6+C,GAAoBL,GAEzB,OADaD,GAAeC,GAChBM,GAAgBC,WAChC,CAKA,SAASJ,GAAcF,GACnB,OAAMA,KAAoBH,KACtBA,GAAYG,GAAoBn3C,GAAQ03C,IAAM13C,GAAQ03C,GAAGC,QAAU33C,GAAQ03C,GAAGC,OAAOC,SACjF53C,GAAQ03C,GAAGC,OAAOC,QAAQT,IAE3BH,GAAYG,EACvB,CAUA,IAAIK,GACH,SAAUA,GACPA,SAAgBA,EAAgBK,SAAc,GAAK,WACnDL,EAAgBA,EAAgBM,iBAAsB,GAAK,mBAC3DN,EAAgBA,EAAgBO,qBAA0B,GAAK,uBAC/DP,EAAgBA,EAAgBQ,WAAgB,GAAK,aACrDR,EAAgBA,EAAgBS,eAAoB,GAAK,iBACzDT,EAAgBA,EAAgBU,aAAkB,GAAK,eACvDV,EAAgBA,EAAgBW,iBAAsB,GAAK,mBAC3DX,EAAgBA,EAAgBY,KAAU,GAAK,OAC/CZ,EAAgBA,EAAgBa,eAAoB,GAAK,iBACzDb,EAAgBA,EAAgBc,aAAkB,GAAK,eACvDd,EAAgBA,EAAgBe,WAAgB,IAAM,aACtDf,EAAgBA,EAAgBgB,WAAgB,IAAM,aACtDhB,EAAgBA,EAAgBiB,eAAoB,IAAM,iBAC1DjB,EAAgBA,EAAgBkB,cAAmB,IAAM,gBACzDlB,EAAgBA,EAAgBmB,cAAmB,IAAM,gBACzDnB,EAAgBA,EAAgBoB,aAAkB,IAAM,eACxDpB,EAAgBA,EAAgBqB,eAAoB,IAAM,iBAC1DrB,EAAgBA,EAAgBsB,aAAkB,IAAM,eACxDtB,EAAgBA,EAAgBuB,WAAgB,IAAM,aACtDvB,EAAgBA,EAAgBwB,eAAoB,IAAM,iBAC1DxB,EAAgBA,EAAgBC,WAAgB,IAAM,aACtDD,EAAgBA,EAAgByB,UAAe,IAAM,YAtB9CzB,CAuBX,CAvBC,CAuBEA,IAAsC,CAAC,GAoB1C,MAAM0B,GAAoB,QAmD1B,IAAIC,GAAcD,GAy1DlB,SAASE,GAAgBrsB,EAAU9R,EAAco+B,EAAuB94B,EAAavJ,GAEjF,GADA+V,EAAWrvB,GAAkBqvB,GACzBrxI,MAAMC,QAAQoxI,GAId,QAASzwI,EAAI,EAAGA,EAAIywI,EAASxxI,OAAQe,IACjC88J,GAAgBrsB,EAASzwI,GAAI2+H,EAAco+B,EAAuB94B,EAAavJ,OAGlF,CACD,MAAM/P,EAAQ8K,KACRtB,EAAQqB,KACRxN,EAAQ8N,KACd,IAAItpF,EAAQolG,GAAenB,GAAYA,EAAWrvB,GAAkBqvB,EAASp6C,SAC7E,MAAM2mE,EAAkBhpB,GAAkBvD,GAOpCwsB,EAAqC,QAAxBj1C,EAAM0W,gBACnBK,EAAW/W,EAAM8Q,eACjBgG,EAAwB9W,EAAM0W,iBAAmB,GACvD,GAAIkT,GAAenB,KAAcA,EAASj6C,MAAO,CAE7C,MAAMl7F,EAAU,IAAIm/H,GAAoBuiC,EAAiBtiC,EAAgBkiB,IACnEsgB,GAAuBj4I,GAAQunB,EAAOmyF,EAAcjE,EAAiBuiC,EAAaA,EAAan+B,EAAuBC,IAC/F,IAAzBm+B,IACAtgC,GAAmBf,GAA+B7T,EAAOmM,GAAQxJ,EAAOn+E,GACxE2wH,GAAgCxyC,EAAO8lB,EAAU9R,EAAa1/H,QAC9D0/H,EAAan/H,KAAKgtC,GAClBw7E,EAAM8Q,iBACN9Q,EAAM+Q,eACF2B,IACA1S,EAAM0W,iBAAmB,SAE7Bq+B,EAAsBv9J,KAAKlE,GAC3B64H,EAAM30H,KAAKlE,KAGXyhK,EAAsBG,IAAwB5hK,EAC9C64H,EAAM+oC,IAAwB5hK,EAEtC,KACK,CAqBD,MAAM8hK,EAAgCn4I,GAAQunB,EAAOmyF,EAAcs+B,EAAan+B,EAAuBC,GACjGs+B,GAAoCp4I,GAAQunB,EAAOmyF,EAAcs+B,EAAYA,EAAan+B,GAG1Fw+B,GAAgCD,IAAqC,GACvEN,EAAsBM,IAC1B,GAAI3iC,IAAmB4iC,KAClB5iC,KAL6B0iC,GAAiC,GAC/DL,EAAsBK,IAIyB,CAE/CxgC,GAAmBf,GAA+B7T,EAAOmM,GAAQxJ,EAAOn+E,GACxE,MAAMlxC,GAgItB,SAASiiK,GAAaC,EAAW3xJ,EAAO6uH,EAAgBuJ,EAAaw5B,GACjE,MAAMniK,EAAU,IAAIm/H,GAAoB+iC,EAAW9iC,EAAgBkiB,IACnEthJ,SAAQk7F,MAAQ,GAChBl7F,EAAQuQ,MAAQA,EAChBvQ,EAAQoiK,mBAAqB,EAC7BC,GAAgBriK,EAASmiK,EAAGx5B,IAAgBvJ,GACrCp/H,CACX,CAvIgCiiK,CAAa7iC,EAAiBkjC,GAAoCC,GAA+Bd,EAAsB99J,OAAQy7H,EAAgBuJ,EAAa+4B,IACvKtiC,GAAkB4iC,KACnBP,EAAsBM,IAAmCL,gBAAkB1hK,IAE/E6hK,GAAgCxyC,EAAO8lB,EAAU9R,EAAa1/H,OAAQ,GACtE0/H,EAAan/H,KAAKgtC,GAClBw7E,EAAM8Q,iBACN9Q,EAAM+Q,eACF2B,IACA1S,EAAM0W,iBAAmB,SAE7Bq+B,EAAsBv9J,KAAKlE,IAC3B64H,EAAM30H,KAAKlE,GACf,MAKI6hK,GAAgCxyC,EAAO8lB,EAAU2sB,GAAgC,EAAKA,EAClFC,GAHmBM,GAAgBZ,EAAsBriC,EAAiB2iC,GAC1ED,GAAgCJ,GAAkBtiC,GAAkBuJ,KAIvEvJ,GAAkBuJ,GAAeq5B,IAClCP,EAAsBM,IAAmCK,oBAEjE,CACJ,CACJ,CASA,SAASP,GAAgCxyC,EAAO8lB,EAAUqtB,EAAcC,GACpE,MAAMC,EAAyBpsB,GAAenB,GACxCwtB,EAphaV,SAASC,GAAgBt7J,GACrB,QAASA,EAAM2zF,QACnB,CAkhaoC2nE,CAAgBztB,GAChD,GAAIutB,GAA0BC,EAAyB,CAInD,MAAMlvH,GAFakvH,EAA0B78C,GAAkBqvB,EAASl6C,UAAYk6C,GACvD5zI,UACCkyC,YAC9B,GAAIA,EAAa,CACb,MAAM4qF,EAAQhP,EAAM8O,eAAiB9O,EAAM8O,aAAe,IAC1D,IAAKukC,GAA0BvtB,EAASj6C,MAAO,CAG3C,MAAM2nE,EAAyBxkC,EAAM10G,QAAQ64I,IACd,IAA3BK,EACAxkC,EAAMn6H,KAAKs+J,EAAc,CAACC,EAAgBhvH,IAG1C4qF,EAAMwkC,EAAyB,GAAG3+J,KAAKu+J,EAAgBhvH,EAE/D,MAEI4qF,EAAMn6H,KAAKs+J,EAAc/uH,EAEjC,CACJ,CACJ,CAKA,SAAS4uH,GAAgBJ,EAAcjiK,EAAS8iK,GAC5C,OAAIA,GACAb,EAAaG,qBAEVH,EAAa/mE,MAAMh3F,KAAKlE,GAAW,CAC9C,CAIA,SAAS2pB,GAAQhf,EAAM4e,EAAKg3H,EAAO93H,GAC/B,QAAS/jB,EAAI67I,EAAO77I,EAAI+jB,EAAK/jB,IACzB,GAAI6kB,EAAI7kB,KAAOiG,EACX,OAAOjG,EAEf,OAAO,CACX,CAIA,SAAS69J,GAA8Bl0J,EAAGu1H,EAAOm/B,EAAOr2C,GACpD,OAAOs2C,GAAa/lK,KAAKi+F,MAAO,GACpC,CAMA,SAASonE,GAAkCj0J,EAAGu1H,EAAO/K,EAAOnM,GACxD,MAAMu2C,EAAYhmK,KAAKi+F,MACvB,IAAI5rF,EACJ,GAAIrS,KAAKykK,gBAAiB,CACtB,MAAMwB,EAAiBjmK,KAAKykK,gBAAgBU,mBACtCe,EAAiBngC,GAAkBnK,EAAOA,EAAMrG,IAAQv1H,KAAKykK,gBAAgBnxJ,MAAOm8G,GAE1Fp9G,EAAS6zJ,EAAel8J,MAAM,EAAGi8J,GAEjCF,GAAaC,EAAW3zJ,GAExB,QAAS5K,EAAIw+J,EAAgBx+J,EAAIy+J,EAAex/J,OAAQe,IACpD4K,EAAOpL,KAAKi/J,EAAez+J,GAEnC,MAEI4K,EAAS,GAET0zJ,GAAaC,EAAW3zJ,GAE5B,OAAOA,CACX,CAIA,SAAS0zJ,GAAaC,EAAW3zJ,GAC7B,QAAS5K,EAAI,EAAGA,EAAIu+J,EAAUt/J,OAAQe,IAElC4K,EAAOpL,MAAKlE,EADIijK,EAAUv+J,OAG9B,OAAO4K,CACX,CA6CA,SAAS8zJ,GAAmBx/C,EAAWy/C,EAAgB,IACnD,OAAQjxC,IACJA,EAAWP,kBACP,CAAClD,EAAK20C,IAtQlB,SAASzxC,GAAkBlD,EAAK/K,EAAWy/C,GACvC,MAAMh0C,EAAQ8K,KACd,GAAI9K,EAAMqR,gBAAiB,CACvB,MAAMiI,EAAc/T,GAAejG,GAEnC6yC,GAAgB6B,EAAeh0C,EAAM/iH,KAAM+iH,EAAMwR,UAAW8H,GAAa,GAEzE64B,GAAgB59C,EAAWyL,EAAM/iH,KAAM+iH,EAAMwR,UAAW8H,GAAa,EACzE,CACJ,CA8PuB9W,CAAkBlD,EACzB20C,EAAqBA,EAAmB1/C,GAAaA,EACrDy/C,EAAa,CAG7B,CAQA,MAAME,IAaN,MAAMC,IAaN,SAASC,GAAehuB,EAAU4Y,GAC9B,OAAO,IAAIqV,GAAYjuB,EAAU4Y,GAAkB,KAAM,GAC7D,CAQA,MAAMqV,WAAoBH,GACtBvmK,YAAYk8I,EAAcyqB,EAASxoB,GAC/B5nH,QACAt2B,KAAK0mK,QAAUA,EAEf1mK,KAAK2mK,qBAAuB,GAC5B3mK,KAAK4mK,WAAa,GAOlB5mK,KAAK6mK,yBAA2B,IAAI/V,GAAyB9wJ,MAC7D,MAAM00H,EAAcF,GAAeynB,GAGnCj8I,KAAK2mK,qBAAuBxjB,GAAczuB,EAAY72B,WACtD79F,KAAK8mK,YAAc3oB,GAAuClC,EAAcyqB,EAAS,CAC7E,CAAE5oE,QAASwoE,GAAepoE,SAAUl+F,MAAQ,CACxC89F,QAASo/C,GACTh/C,SAAUl+F,KAAK6mK,6BAEhB3oB,GACJn3H,GAAUk1H,GAAe,IAAI75E,IAAI,CAAC,iBAIrCpiE,KAAK8mK,YAAY1rB,8BACjBp7I,KAAK8wG,SAAW9wG,KAAK8mK,YAAYv5J,IAAI0uI,EACzC,CACA,YAAI/gC,GACA,OAAOl7G,KAAK8mK,WAChB,CACAlxF,UAEI,MAAMslC,EAAWl7G,KAAK8mK,aACrB5rD,EAAS2+B,WAAa3+B,EAAStlC,UAChC51E,KAAK4mK,WAAWx+J,QAAQ6d,GAAMA,KAC9BjmB,KAAK4mK,WAAa,IACtB,CACAvyC,UAAUtrH,GAEN/I,KAAK4mK,WAAW3/J,KAAK8B,EACzB,EAEJ,MAAMg+J,WAAwBR,GAC1BxmK,YAAYinK,GACR1wI,QACAt2B,KAAKgnK,WAAaA,CACtB,CACA9gE,OAAOkrD,GACH,OAAO,IAAIqV,GAAYzmK,KAAKgnK,WAAY5V,EAAgB,GAC5D,EAKJ,MAAM6V,WAAsCX,GACxCvmK,YAAYo0C,GACR7d,QACAt2B,KAAK6mK,yBAA2B,IAAI/V,GAAyB9wJ,MAC7DA,KAAK8wG,SAAW,KAChB,MAAMoK,EAAW,IAAI0+B,GAAW,IACzBzlG,EAAOwyE,UACV,CAAE7oB,QAASwoE,GAAepoE,SAAUl+F,MACpC,CAAE89F,QAASo/C,GAA4Bh/C,SAAUl+F,KAAK6mK,2BACvD1yH,EAAO0iC,QAAU6iE,KAAmBvlG,EAAO+yH,UAAW,IAAI9kG,IAAI,CAAC,iBAClEpiE,KAAKk7G,SAAWA,EACZ/mE,EAAOgzH,4BACPjsD,EAASkgC,6BAEjB,CACAxlE,UACI51E,KAAKk7G,SAAStlC,SAClB,CACAy+C,UAAUtrH,GACN/I,KAAKk7G,SAASmZ,UAAUtrH,EAC5B,EAeJ,SAASq+J,GAA0BzgD,EAAW9vC,EAAQqwF,EAAY,MAE9D,OADgB,IAAID,GAA8B,CAAEtgD,YAAW9vC,SAAQqwF,YAAWC,4BAA4B,IAC/FjsD,QACnB,CAEA,IAKMmsD,GAAiB,MAAvB,MAAMA,EACFtnK,YAAYunK,GACRtnK,KAAKsnK,UAAYA,EACjBtnK,KAAKunK,gBAAkB,IAAIr6J,GAC/B,CACAs6J,8BAA8Bh1C,GAC1B,IAAKA,EAAa3a,WACd,OAAO,KAEX,IAAK73G,KAAKunK,gBAAgBjgJ,IAAIkrG,GAAe,CACzC,MAAM7L,EAAYgxB,GAA4B,EAAOnlB,EAAapmH,MAC5Dq7J,EAAqB9gD,EAAUjgH,OAAS,EAC1C0gK,GAA0B,CAACzgD,GAAY3mH,KAAKsnK,UAAY,cAAa90C,EAAapmH,KAAKrI,SACvF,KACJ/D,KAAKunK,gBAAgB95J,IAAI+kH,EAAci1C,EAC3C,CACA,OAAOznK,KAAKunK,gBAAgBh6J,IAAIilH,EACpC,CACAh8E,cACI,IACI,UAAW0kE,KAAYl7G,KAAKunK,gBAAgB94J,SACvB,OAAbysG,GACAA,EAAStlC,SAGrB,SAEI51E,KAAKunK,gBAAgBvoJ,OACzB,CACJ,CACA7e,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CACrC1nE,MAAOozH,EACPpkK,WAAY,cACZF,QAASA,IAAM,IAAIskK,EAAkBvxD,GAAS6jC,OAErD,OApCK0tB,CAAiB,KA+CvB,SAASK,GAAoBvyC,GACzBA,EAAWnD,sBAAyBo/B,GACzBA,EAAe7jJ,IAAI85J,IAAmBG,8BAA8BryC,EAEnF,CAicA,SAASwyC,GAAgBC,EAAYC,EAAQ35F,GACzC,MAAMgwD,EAAeJ,KAAmB8pC,EAClChsC,EAAQqB,KACd,OAAOrB,EAAMsC,KAAkB+lB,GAC3BqR,GAAc15B,EAAOsC,EAAchwD,EAAU25F,EAAOnjK,KAAKwpE,GAAW25F,KA3wQ5E,SAASC,GAAWlsC,EAAOsC,GAIvB,OAAOtC,EAAMsC,EACjB,CAuwQQ4pC,CAAWlsC,EAAOsC,EAC1B,CAaA,SAAS6pC,GAAgBH,EAAYC,EAAQG,EAAK95F,GAC9C,OAyMJ,SAAS+5F,GAAsBrsC,EAAOssC,EAAaN,EAAYC,EAAQG,EAAK95F,GACxE,MAAMgwD,EAAegqC,EAAcN,EACnC,OAAOrS,GAAe35B,EAAOsC,EAAc8pC,GACvC1S,GAAc15B,EAAOsC,EAAe,EAAGhwD,EAAU25F,EAAOnjK,KAAKwpE,EAAS85F,GAAOH,EAAOG,IApB5F,SAASG,GAA2BvsC,EAAOwsC,GAEvC,MAAMC,EAAkBzsC,EAAMwsC,GAC9B,OAAOC,IAAoBpkB,QAAY1gJ,EAAY8kK,CACvD,CAiBQF,CAA2BvsC,EAAOsC,EAAe,EACzD,CA9MW+pC,CAAsBhrC,KAAYa,KAAkB8pC,EAAYC,EAAQG,EAAK95F,EACxF,CAigBA,SAASo6F,KAEL,OAAOtoK,KAAKuoK,SAASt9D,OAAOD,WAChC,CA2BA,MAAMw9D,GAAUroK,SACH8qG,OAAOD,SAIhB,WAAI6N,GACA,OAAO74G,KAAKyoK,WAAazoK,KAAKyoK,SAAW,IAAI5zD,GACjD,CAMA90G,YAAY2oK,GAA2B,GACnC1oK,KAAK0oK,yBAA2BA,EAChC1oK,KAAKm4H,OAAQ,EACbn4H,KAAKuoK,SAAW,GAChBvoK,KAAK2oK,kBAAmB,EACxB3oK,KAAKyoK,SAAW,KAChBzoK,KAAK0G,OAAS,EACd1G,KAAKmmF,WAAQ5iF,EACbvD,KAAKomF,UAAO7iF,EAKZ,MAAMs9B,EAAQ2nI,GAAUlkK,UACnBu8B,EAAMoqE,OAAOD,YACdnqE,EAAMoqE,OAAOD,UAAYs9D,GACjC,CAIA/6J,IAAI+F,GACA,OAAOtT,KAAKuoK,SAASj1J,EACzB,CAKAnL,IAAI8d,GACA,OAAOjmB,KAAKuoK,SAASpgK,IAAI8d,EAC7B,CACAje,OAAOie,GACH,OAAOjmB,KAAKuoK,SAASvgK,OAAOie,EAChC,CAKAqK,KAAKrK,GACD,OAAOjmB,KAAKuoK,SAASj4I,KAAKrK,EAC9B,CAKAhQ,OAAOgQ,EAAInS,GACP,OAAO9T,KAAKuoK,SAAStyJ,OAAOgQ,EAAInS,EACpC,CAKA1L,QAAQ6d,GACJjmB,KAAKuoK,SAASngK,QAAQ6d,EAC1B,CAKAtb,KAAKsb,GACD,OAAOjmB,KAAKuoK,SAAS59J,KAAKsb,EAC9B,CAIA2iJ,UACI,OAAO5oK,KAAKuoK,SAASv+J,OACzB,CACAzF,WACI,OAAOvE,KAAKuoK,SAAShkK,UACzB,CAaAioD,MAAMq8G,EAAaC,GAGf,MAAMnlK,EAAO3D,KACb2D,EAAKw0H,OAAQ,EACb,MAAM4wC,EAnpkBd,SAASC,GAAQjpH,GACb,OAAOA,EAAKkpH,KAAKluI,OAAOmuI,kBAC5B,CAipkB8BF,CAAQH,IAC1B7oK,KAAK2oK,kBAvqkBjB,SAASQ,GAAYtkJ,EAAGC,EAAGgkJ,GACvB,GAAIjkJ,EAAEne,SAAWoe,EAAEpe,OACf,OAAO,EACX,QAASe,EAAI,EAAGA,EAAIod,EAAEne,OAAQe,IAAK,CAC/B,IAAI2hK,EAASvkJ,EAAEpd,GACX4hK,EAASvkJ,EAAErd,GAKf,GAJIqhK,IACAM,EAASN,EAAiBM,GAC1BC,EAASP,EAAiBO,IAE1BA,IAAWD,EACX,OAAO,CAEf,CACA,OAAO,CACX,CAwpkBqCD,CAAYxlK,EAAK4kK,SAAUQ,EAAeD,MACnEnlK,EAAK4kK,SAAWQ,EAChBplK,EAAK+C,OAASqiK,EAAcriK,OAC5B/C,EAAKyiF,KAAO2iF,EAAc/oK,KAAK0G,OAAS,GACxC/C,EAAKwiF,MAAQ4iF,EAAc,GAEnC,CAIAO,kBACQtpK,KAAKyoK,WAAazoK,KAAK2oK,mBAAqB3oK,KAAK0oK,2BACjD1oK,KAAKyoK,SAASnvJ,KAAKtZ,KAC3B,CAEAupK,WACIvpK,KAAKm4H,OAAQ,CACjB,CAEAviD,UACI51E,KAAK64G,QAAQtjD,WACbv1D,KAAK64G,QAAQpiE,aACjB,EAgCJ,SAAS+yH,GAAqB/9B,EAAY7P,EAAOtoH,EAAOm2J,GAAW,GAC/D,MAAMr3C,EAAQwJ,EAAMrG,IAIpB,GA1+gBJ,SAASm0C,GAAWt3C,EAAOwJ,EAAO6P,EAAYn4H,GAG1C,MAAM65H,EAAmB/V,GAA0B9jH,EAC7Cq2J,EAAkBl+B,EAAW/kI,OAC/B4M,EAAQ,IAERm4H,EAAW0B,EAAmB,GAAGzX,IAAQkG,GAEzCtoH,EAAQq2J,EAAkBvyC,IAC1BwE,EAAMlG,IAAQ+V,EAAW0B,GACzB9D,GAAWoC,EAAYrU,GAA0B9jH,EAAOsoH,KAGxD6P,EAAWxkI,KAAK20H,GAChBA,EAAMlG,IAAQ,MAElBkG,EAAMnG,IAAUgW,EAEhB,MAAM4B,EAAwBzR,EAAMtF,IACN,OAA1B+W,GAAkC5B,IAAe4B,GAezD,SAASu8B,GAAe98B,EAAsBlR,GAG1C,MAAMmR,EAAaD,EAAqB3V,IAKTyE,EAAMvF,MAJVuF,EAAMnG,IAEiBA,IAAQY,MAQtDyW,EAAqB7V,KAA0B,GAEhC,OAAf8V,EACAD,EAAqB3V,IAAe,CAACyE,GAGrCmR,EAAW9lI,KAAK20H,EAExB,CApCQguC,CAAev8B,EAAuBzR,GAG1C,MAAM4R,EAAW5R,EAAMpF,IACN,OAAbgX,GACAA,EAASk8B,WAAWt3C,GAGxBwJ,EAAMpG,KAAU,GACpB,CA08gBIk0C,CAAWt3C,EAAOwJ,EAAO6P,EAAYn4H,GAEjCm2J,EAAU,CACV,MAAMj+B,EAAaiE,GAAqBn8H,EAAOm4H,GACzCtd,EAAWyN,EAAM3F,IACjBoZ,EAAcpD,GAAiB9d,EAAUsd,EAAWvU,KACtC,OAAhBmY,GA5jhBZ,SAASw6B,GAAaz3C,EAAOyM,EAAa1Q,EAAUyN,EAAOkuC,EAAkBt+B,GACzE5P,EAAMtG,IAAQw0C,EACdluC,EAAMhG,IAAUiJ,EAChB0N,GAAUna,EAAOwJ,EAAOzN,EAAU,EAAoC27C,EAAkBt+B,EAC5F,CAyjhBYq+B,CAAaz3C,EAAOqZ,EAAW7V,IAASzH,EAAUyN,EAAOyT,EAAa7D,EAE9E,CACJ,CASA,IAkBMu+B,GAAW,MAAjB,MAAMA,EACF5pK,SAISH,KAAKsrH,kBAAoB0+C,GACrC,OANKD,CAAW,KAOjB,MAAME,GAAwBF,GAGxBG,GAAgB,cAA0BD,GAC5ClqK,YAAYoqK,EAAmBC,EAAwBC,GACnD/zI,QACAt2B,KAAKmqK,kBAAoBA,EACzBnqK,KAAKoqK,uBAAyBA,EAC9BpqK,KAAKqqK,WAAaA,CACtB,CAOA,SAAI1iB,GACA,OAAO3nJ,KAAKoqK,uBAAuBh4C,OAAOu1B,OAAS,IACvD,CACAvuC,mBAAmB1lG,EAASwnG,GACxB,OAAOl7G,KAAKsqK,uBAAuB52J,EAASwnG,EAChD,CAIAovD,uBAAuB52J,EAASwnG,EAAUupC,GACtC,MAAM8lB,EAtGd,SAASC,GAA6BC,EAAkBC,EAAeh3J,EAASxN,GAC5E,MAAMwwJ,EAAgBgU,EAAct4C,MAM9Bm4C,EAAgBhmB,GAAYkmB,EAAkB/T,EAAehjJ,EAFpB,KAA1B+2J,EAAiBj1C,IACL,KAAmC,GACmB,KAAMk1C,EAAe,KAAM,KAAM,KAAMxkK,GAASg1G,UAAY,KAAMh1G,GAASu+I,eAAiB,MAGnL8lB,EAAcj0C,IAFgBm0C,EAAiBC,EAAcp3J,OAG7D,MAAMq3J,EAA0BF,EAAiBj0C,IACjD,OAAgC,OAA5Bm0C,IACAJ,EAAc/zC,IAAWm0C,EAAwBvxD,mBAAmBs9C,IAGxEtJ,GAAWsJ,EAAe6T,EAAe72J,GAClC62J,CACX,CAoF8BC,CAA6BxqK,KAAKmqK,kBAAmBnqK,KAAKoqK,uBAAwB12J,EAAS,CAAEwnG,WAAUupC,kBAC7H,OAAO,IAAIiL,GAAU6a,EACzB,GAOJ,SAASP,KACL,OAAOY,GAAkBrtC,KAAmBN,KAChD,CAQA,SAAS2tC,GAAkBnkB,EAAWsG,GAClC,OAAqB,EAAjBtG,EAAUr6I,KAEH,IAAI89J,GAAcnd,EAAWtG,EAAWpJ,GAAiBoJ,EAAWsG,IAExE,IACX,CAoKA,IAiDM8d,GAAgB,MAAtB,MAAMA,EACF1qK,SAISH,KAAKsrH,kBAAoBw/C,GACrC,OANKD,CAAgB,KAatB,SAASC,KAEL,OAAOC,GADextC,KACmBN,KAC7C,CACA,MAAM+tC,GAAsBH,GAGtBI,GAAqB,cAA+BD,GACtDjrK,YAAYmrK,EAAaC,EAAYC,GACjC90I,QACAt2B,KAAKkrK,YAAcA,EACnBlrK,KAAKmrK,WAAaA,EAClBnrK,KAAKorK,WAAaA,CACtB,CACA,WAAI3lI,GACA,OAAO43G,GAAiBr9I,KAAKmrK,WAAYnrK,KAAKorK,WAClD,CACA,YAAIlwD,GACA,OAAO,IAAIusB,GAAaznI,KAAKmrK,WAAYnrK,KAAKorK,WAClD,CAEA,kBAAIha,GACA,MAAM3uB,EAAiBqB,GAA0B9jI,KAAKmrK,WAAYnrK,KAAKorK,YACvE,GAAI5oC,GAAkBC,GAAiB,CACnC,MAAMM,EAAaJ,GAAsBF,EAAgBziI,KAAKorK,YACxD1nC,EAAgBhB,GAAuBD,GAG7C,OAAO,IAAIgF,GADS1E,EAAWxN,IAAOlmH,KAAKq0H,EAAgB,GACtBX,EACzC,CAEI,OAAO,IAAI0E,GAAa,KAAMznI,KAAKorK,WAE3C,CACApsJ,QACI,KAAOhf,KAAK0G,OAAS,GACjB1G,KAAKkuC,OAAOluC,KAAK0G,OAAS,EAElC,CACA6G,IAAI+F,GACA,MAAMy8I,EAAWsb,GAAYrrK,KAAKkrK,aAClC,OAAoB,OAAbnb,GAAqBA,EAASz8I,IAAU,IACnD,CACA,UAAI5M,GACA,OAAO1G,KAAKkrK,YAAYxkK,OAAS0wH,EACrC,CACAhe,mBAAmBS,EAAanmG,EAAS43J,GACrC,IAAIh4J,EACA4nG,EAC0B,iBAAnBowD,EACPh4J,EAAQg4J,EAEe,MAAlBA,IACLh4J,EAAQg4J,EAAeh4J,MACvB4nG,EAAWowD,EAAepwD,UAE9B,MACMqwD,EAAU1xD,EAAYywD,uBAAuB52J,GAAW,CAAC,EAAGwnG,EA9JV,MAmKxD,OAAAl7G,KAAKwrK,WAAWD,EAASj4J,EADA,OAElBi4J,CACX,CACAE,gBAAgBC,EAAwBJ,EAAgBpwD,EAAUy2C,EAAkBE,GAChF,MAAM8Z,EAAqBD,IA/mlBnC,SAASE,GAAO1iG,GACZ,MAAoB,mBAANA,CAClB,CA6mlB8D0iG,CAAOF,GAC7D,IAAIp4J,EAMJ,GAAIq4J,EAQAr4J,EAAQg4J,MAEP,CASD,MAAMplK,GAAWolK,GAAkB,CAAC,EAIpCh4J,EAAQpN,GAAQoN,MAChB4nG,EAAWh1G,GAAQg1G,SACnBy2C,EAAmBzrJ,GAAQyrJ,iBAC3BE,EAAsB3rJ,GAAQ2rJ,qBAAuB3rJ,GAAQ2lK,WACjE,CACA,MAAMC,EAAmBH,EACrBD,EACA,IAAI3a,GAAiB59B,GAAgBu4C,IACnCK,EAAkB7wD,GAAYl7G,KAAKoxJ,eAEzC,IAAKS,GAAoD,MAA7Bia,EAAiBtzB,SAAkB,CAqB3D,MAAMnmI,IAJYs5J,EAAqBI,EAAkB/rK,KAAKoxJ,gBAIrC7jJ,IAAIosI,GAAqB,MAC9CtnI,KACAw/I,EAAsBx/I,GAE9B,CACqB8gH,GAAgB24C,EAAiBva,eAAiB,CAAC,GAAxE,MAGMya,EAAeF,EAAiB5lE,OAAO6lE,EAAiBpa,EADlB,KAC2CE,GAKvF,OAAA7xJ,KAAKwrK,WAAWQ,EAAa/vC,SAAU3oH,EADd,OAElB04J,CACX,CACAC,OAAOV,EAASj4J,GACZ,OAAOtT,KAAKwrK,WAAWD,EAASj4J,GAAO,EAC3C,CACAk4J,WAAWD,EAASj4J,EAAO44J,GACvB,MAAMtwC,EAAQ2vC,EAAQ5jC,OAKtB,GAnxpBR,SAASwkC,GAAwB9yD,GAC7B,OAAOie,GAAaje,EAAKoc,IAC7B,CAixpBY02C,CAAwBvwC,GAAQ,CAEhC,MAAMwwC,EAAUpsK,KAAK0sB,QAAQ6+I,GAK7B,IAAgB,IAAZa,EACApsK,KAAKmwJ,OAAOic,OAEX,CACD,MAAMC,EAAiBzwC,EAAMnG,IAKvB62C,EAAY,IAAIrB,GAAmBoB,EAAgBA,EAAez2C,IAASy2C,EAAe52C,KAChG62C,EAAUnc,OAAOmc,EAAU5/I,QAAQ6+I,GACvC,CACJ,CAEA,MAAMgB,EAAcvsK,KAAKwsK,aAAal5J,GAChCm4H,EAAazrI,KAAKkrK,YACxB1B,UAAqB/9B,EAAY7P,EAAO2wC,GAAcL,GACtDX,EAAQhb,2BACRlnB,GAAWojC,GAAoBhhC,GAAa8gC,EAAahB,GAClDA,CACX,CACAjyD,KAAKiyD,EAAStN,GAIV,OAAOj+J,KAAKisK,OAAOV,EAAStN,EAChC,CACAvxI,QAAQ6+I,GACJ,MAAMmB,EAAcrB,GAAYrrK,KAAKkrK,aACrC,OAAuB,OAAhBwB,EAAuBA,EAAYhgJ,QAAQ6+I,IAAW,CACjE,CACAr9H,OAAO56B,GACH,MAAMi5J,EAAcvsK,KAAKwsK,aAAal5J,GAAO,GACvCq5J,EAAe1/B,GAAWjtI,KAAKkrK,YAAaqB,GAC9CI,IAOArjC,GAAgBmjC,GAAoBzsK,KAAKkrK,aAAcqB,GACvD9+B,GAAak/B,EAAap3C,IAAQo3C,GAE1C,CACAxc,OAAO78I,GACH,MAAMi5J,EAAcvsK,KAAKwsK,aAAal5J,GAAO,GACvC+lG,EAAO4zB,GAAWjtI,KAAKkrK,YAAaqB,GAE1C,OADoBlzD,GAA+E,MAAvEiwB,GAAgBmjC,GAAoBzsK,KAAKkrK,aAAcqB,GAC9D,IAAI7c,GAAUr2C,GAAQ,IAC/C,CACAmzD,aAAal5J,EAAOuwD,EAAQ,GACxB,OAAIvwD,GACOtT,KAAK0G,OAASm9D,CAQ7B,GAEJ,SAASwnG,GAAY5/B,GACjB,OAAOA,EAxyrBO,EAyyrBlB,CACA,SAASghC,GAAoBhhC,GACzB,OAAQA,EA3yrBM,KA2yrBoBA,EA3yrBpB,GA2yrB4C,GAC9D,CAQA,SAASs/B,GAAmBtkB,EAAWsG,GAEnC,IAAIthB,EACJ,MAAMvP,EAAY6wB,EAAUtG,EAAUnzI,OACtC,OAAIgkH,GAAa4E,GAEbuP,EAAavP,GAMbuP,EAAa0gB,GAAiBjwB,EAAW6wB,EAAW,KAAMtG,GAC1DsG,EAAUtG,EAAUnzI,OAASm4H,EAC7Bob,GAAckG,EAAWthB,IAE7BmhC,GAA0BnhC,EAAYshB,EAAWtG,EAAWvqB,GACrD,IAAI+uC,GAAmBx/B,EAAYgb,EAAWsG,EACzD,CAiBA,IAAI6f,GAKJ,SAASC,GAAiBphC,EAAYshB,EAAWtG,EAAWvqB,GAExD,GAAIuP,EAAWvU,IACX,OACJ,IAAI41C,EAMAA,EADiB,EAAjBrmB,EAAUr6I,KACIsvH,GAAYQ,GAxBlC,SAAS6wC,GAAiBhgB,EAAWtG,GACjC,MAAMt4B,EAAW4+B,EAAU92B,IAErB62C,EAAc3+C,EAASse,cAAwC,IAC/D2f,EAAavwB,GAAiB4qB,EAAWsG,GAE/ClhB,UAAmB1d,EADQ8d,GAAiB9d,EAAUi+B,GACL0gB,EAjthBrD,SAASE,GAAkB7+C,EAAU9hE,GACjC,OAAO8hE,EAASn3D,YAAY3K,EAChC,CA+shBkE2gH,CAAkB7+C,EAAUi+B,IAAa,GAChG0gB,CACX,CAmBsBC,CAAiBhgB,EAAWtG,GAE9Chb,EAAWvU,IAAU41C,CACzB,EA6CA,MAAMG,GACFltK,YAAYmtK,GACRltK,KAAKktK,UAAYA,EACjBltK,KAAK+vD,QAAU,IACnB,CACAlzC,QACI,OAAO,IAAIowJ,GAAQjtK,KAAKktK,UAC5B,CACA3D,WACIvpK,KAAKktK,UAAU3D,UACnB,EAEJ,MAAM4D,GACFptK,YAAY+nJ,EAAU,IAClB9nJ,KAAK8nJ,QAAUA,CACnB,CACA1uC,mBAAmBgZ,GACf,MAAMg7C,EAAWh7C,EAAM01B,QACvB,GAAiB,OAAbslB,EAAmB,CACnB,MAAMC,EAAgD,OAAzBj7C,EAAMW,eAA0BX,EAAMW,eAAe,GAAKq6C,EAAS1mK,OAC1F4mK,EAAe,GAKrB,QAAS7lK,EAAI,EAAGA,EAAI4lK,EAAsB5lK,IAAK,CAC3C,MAAM8lK,EAASH,EAASI,WAAW/lK,GAEnC6lK,EAAarmK,KADQjH,KAAK8nJ,QAAQylB,EAAOE,wBACV5wJ,QACnC,CACA,OAAO,IAAIswJ,GAAUG,EACzB,CACA,OAAO,IACX,CACA5D,WAAWt3C,GACPpyH,KAAK0tK,wBAAwBt7C,EACjC,CACA6a,WAAW7a,GACPpyH,KAAK0tK,wBAAwBt7C,EACjC,CACAs7C,wBAAwBt7C,GACpB,QAAS3qH,EAAI,EAAGA,EAAIzH,KAAK8nJ,QAAQphJ,OAAQe,IACD,OAAhCkmK,GAAUv7C,EAAO3qH,GAAGsoD,SACpB/vD,KAAK8nJ,QAAQrgJ,GAAG8hK,UAG5B,EAEJ,MAAMqE,GACF7tK,YAAY8uG,EAAWoc,EAAOzZ,EAAO,MACjCxxG,KAAK6uG,UAAYA,EACjB7uG,KAAKirH,MAAQA,EACbjrH,KAAKwxG,KAAOA,CAChB,EAEJ,MAAMq8D,GACF9tK,YAAY+nJ,EAAU,IAClB9nJ,KAAK8nJ,QAAUA,CACnB,CACAuP,aAAajlC,EAAO3C,GAGhB,QAAShoH,EAAI,EAAGA,EAAIzH,KAAK8nJ,QAAQphJ,OAAQe,IACrCzH,KAAK8nJ,QAAQrgJ,GAAG4vJ,aAAajlC,EAAO3C,EAE5C,CACAqoC,WAAWroC,GACP,QAAShoH,EAAI,EAAGA,EAAIzH,KAAK8nJ,QAAQphJ,OAAQe,IACrCzH,KAAK8nJ,QAAQrgJ,GAAGqwJ,WAAWroC,EAEnC,CACAinC,cAAcjnC,GACV,IAAIq+C,EAAwB,KAC5B,QAASrmK,EAAI,EAAGA,EAAIzH,KAAK0G,OAAQe,IAAK,CAClC,MAAMsmK,EAA4C,OAA1BD,EAAiCA,EAAsBpnK,OAAS,EAClFsnK,EAAchuK,KAAKwtK,WAAW/lK,GAAGivJ,cAAcjnC,EAAOs+C,GACxDC,IACAA,EAAYP,uBAAyBhmK,EACP,OAA1BqmK,EACAA,EAAsB7mK,KAAK+mK,GAG3BF,EAAwB,CAACE,GAGrC,CACA,OAAiC,OAA1BF,EAAiC,IAAID,GAAUC,GAAyB,IACnF,CACAhtK,SAASsxH,EAAO3C,GAGZ,QAAShoH,EAAI,EAAGA,EAAIzH,KAAK8nJ,QAAQphJ,OAAQe,IACrCzH,KAAK8nJ,QAAQrgJ,GAAG3G,SAASsxH,EAAO3C,EAExC,CACA+9C,WAAWl6J,GAEP,OAAOtT,KAAK8nJ,QAAQx0I,EACxB,CACA,UAAI5M,GACA,OAAO1G,KAAK8nJ,QAAQphJ,MACxB,CACAunK,MAAMC,GACFluK,KAAK8nJ,QAAQ7gJ,KAAKinK,EACtB,EAEJ,MAAMC,GACFpuK,YAAYga,EAAUiiH,GAAY,GAC9Bh8H,KAAK+Z,SAAWA,EAChB/Z,KAAK+vD,QAAU,KACf/vD,KAAKytK,wBAAyB,EAC9BztK,KAAKouK,mBAAoB,EAMzBpuK,KAAKquK,oBAAqB,EAC1BruK,KAAKsuK,sBAAwBtyC,CACjC,CACAq7B,aAAajlC,EAAO3C,GACZzvH,KAAKuuK,iBAAiB9+C,IACtBzvH,KAAKwuK,WAAWp8C,EAAO3C,EAE/B,CACAqoC,WAAWroC,GACHzvH,KAAKsuK,wBAA0B7+C,EAAMn8G,QACrCtT,KAAKquK,oBAAqB,EAElC,CACAvtK,SAASsxH,EAAO3C,GACZzvH,KAAKq3J,aAAajlC,EAAO3C,EAC7B,CACAinC,cAAcjnC,EAAOs+C,GACjB,OAAI/tK,KAAKuuK,iBAAiB9+C,IACtBzvH,KAAKouK,mBAAoB,EAGzBpuK,KAAKyuK,UAAUh/C,EAAMn8G,MAAOy6J,GACrB,IAAII,GAAQnuK,KAAK+Z,WAErB,IACX,CACAw0J,iBAAiB9+C,GACb,GAAIzvH,KAAKquK,oBACsD,IAApC,EAAtBruK,KAAK+Z,SAASkxG,OAA4E,CAC3F,MAAMyjD,EAAqB1uK,KAAKsuK,sBAChC,IAAIz3F,EAAS44C,EAAM54C,OAWnB,KAAkB,OAAXA,GAAkC,EAAdA,EAAOzqE,MAC9ByqE,EAAOvjE,QAAUo7J,GACjB73F,EAASA,EAAOA,OAEpB,OAAO63F,KAAmC,OAAX73F,EAAkBA,EAAOvjE,OAAQ,EACpE,CACA,OAAOtT,KAAKquK,kBAChB,CACAG,WAAWp8C,EAAO3C,GACd,MAAM5gB,EAAY7uG,KAAK+Z,SAAS80F,UAChC,GAAIhoG,MAAMC,QAAQ+nG,GACd,QAASpnG,EAAI,EAAGA,EAAIonG,EAAUnoG,OAAQe,IAAK,CACvC,MAAM1D,EAAO8qG,EAAUpnG,GACvBzH,KAAK2uK,yBAAyBv8C,EAAO3C,EAAOm/C,GAAyBn/C,EAAO1rH,IAE5E/D,KAAK2uK,yBAAyBv8C,EAAO3C,EAAOqW,GAA0BrW,EAAO2C,EAAOruH,GAAM,GAAO,GACrG,MAGI8qG,IAAck7D,GACG,EAAbt6C,EAAMrjH,MACNpM,KAAK2uK,yBAAyBv8C,EAAO3C,GAAO,GAIhDzvH,KAAK2uK,yBAAyBv8C,EAAO3C,EAAOqW,GAA0BrW,EAAO2C,EAAOvjB,GAAW,GAAO,GAGlH,CACA8/D,yBAAyBv8C,EAAO3C,EAAOo/C,GACnC,GAAqB,OAAjBA,EAAuB,CACvB,MAAMr9D,EAAOxxG,KAAK+Z,SAASy3F,KAC3B,GAAa,OAATA,EACA,GAAIA,IAAS8rC,IAAc9rC,IAASq5D,IAChCr5D,IAASu4D,IAA6B,EAAbt6C,EAAMrjH,KAC/BpM,KAAKyuK,SAASh/C,EAAMn8G,OAAO,OAE1B,CACD,MAAMw7J,EAAyBhpC,GAA0BrW,EAAO2C,EAAO5gB,GAAM,GAAO,GACrD,OAA3Bs9D,GACA9uK,KAAKyuK,SAASh/C,EAAMn8G,MAAOw7J,EAEnC,MAGA9uK,KAAKyuK,SAASh/C,EAAMn8G,MAAOu7J,EAEnC,CACJ,CACAJ,SAASpV,EAAU0V,GACM,OAAjB/uK,KAAK+vD,QACL/vD,KAAK+vD,QAAU,CAACspG,EAAU0V,GAG1B/uK,KAAK+vD,QAAQ9oD,KAAKoyJ,EAAU0V,EAEpC,EAUJ,SAASH,GAAyBn/C,EAAOxnE,GACrC,MAAMi9F,EAAaz1B,EAAMy1B,WACzB,GAAmB,OAAfA,EACA,QAASz9I,EAAI,EAAGA,EAAIy9I,EAAWx+I,OAAQe,GAAK,EACxC,GAAIy9I,EAAWz9I,KAAOwgD,EAClB,OAAOi9F,EAAWz9I,EAAI,GAIlC,OAAO,IACX,CAUA,SAASunK,GAAoBpzC,EAAOnM,EAAOw/C,EAAaz9D,GACpD,OAAoB,IAAhBy9D,EAVR,SAASC,GAAwBz/C,EAAOgS,GACpC,OAAkB,GAAdhS,EAAMrjH,KACCixI,GAAiB5tB,EAAOgS,GAEb,EAAbhS,EAAMrjH,KACJw+J,GAAkBn7C,EAAOgS,GAE7B,IACX,CAIeytC,CAAwBz/C,EAAOmM,IAEjB,IAAhBqzC,EASb,SAASE,GAAmBvzC,EAAOnM,EAAOje,GACtC,OAAIA,IAAS8rC,GACFD,GAAiB5tB,EAAOmM,GAE1BpqB,IAASu4D,GACPa,GAAkBn7C,EAAOmM,GAE3BpqB,IAASq5D,GAEPE,GAAmBt7C,EAAOmM,QAFhC,CAQT,CAtBeuzC,CAAmBvzC,EAAOnM,EAAOje,GAIjCu0B,GAAkBnK,EAAOA,EAAMrG,IAAQ05C,EAAax/C,EAEnE,CAsBA,SAAS2/C,GAAuBh9C,EAAOwJ,EAAO2xC,EAAQ8B,GAClD,MAAMC,EAAS1zC,EAAMpF,IAASsxB,QAAQunB,GACtC,GAAuB,OAAnBC,EAAOv/G,QAAkB,CACzB,MAAM46F,EAAYv4B,EAAM/iH,KAClBkgK,EAAgBhC,EAAOx9G,QACvB19C,EAAS,GACf,QAAS5K,EAAI,EAAGA,EAAI8nK,EAAc7oK,OAAQe,GAAK,EAAG,CAC9C,MAAM+nK,EAAiBD,EAAc9nK,GAKjC4K,EAAOpL,KAJPuoK,EAAiB,EAIL,KAKAR,GAAoBpzC,EADlB+uB,EAAU6kB,GACsBD,EAAc9nK,EAAI,GAAI8lK,EAAOxzJ,SAASy3F,MAE5F,CACA89D,EAAOv/G,QAAU19C,CACrB,CACA,OAAOi9J,EAAOv/G,OAClB,CAKA,SAAS0/G,GAAoBr9C,EAAOwJ,EAAOyzC,EAAYh9J,GACnD,MAAMk7J,EAASn7C,EAAM01B,QAAQ0lB,WAAW6B,GAClCE,EAAgBhC,EAAOx9G,QAC7B,GAAsB,OAAlBw/G,EAAwB,CACxB,MAAMG,EAAeN,GAAuBh9C,EAAOwJ,EAAO2xC,EAAQ8B,GAClE,QAAS5nK,EAAI,EAAGA,EAAI8nK,EAAc7oK,OAAQe,GAAK,EAAG,CAC9C,MAAM4xJ,EAAWkW,EAAc9nK,GAC/B,GAAI4xJ,EAAW,EACXhnJ,EAAOpL,KAAKyoK,EAAajoK,EAAI,QAE5B,CACD,MAAMsmK,EAAkBwB,EAAc9nK,EAAI,GACpC4lI,EAAwBzR,GAAOy9B,GAGrC,QAAS5xJ,EAAI2vH,GAAyB3vH,EAAI4lI,EAAsB3mI,OAAQe,IAAK,CACzE,MAAM8iK,EAAgBl9B,EAAsB5lI,GACxC8iK,EAAcj0C,MAA4Bi0C,EAAc90C,KACxDg6C,GAAoBlF,EAAch1C,IAAQg1C,EAAewD,EAAiB17J,EAElF,CAGA,GAA2C,OAAvCg7H,EAAsBlW,IAAuB,CAC7C,MAAMw4C,EAAiBtiC,EAAsBlW,IAC7C,QAAS1vH,EAAI,EAAGA,EAAIkoK,EAAejpK,OAAQe,IAAK,CAC5C,MAAM8iK,EAAgBoF,EAAeloK,GACrCgoK,GAAoBlF,EAAch1C,IAAQg1C,EAAewD,EAAiB17J,EAC9E,CACJ,CACJ,CACJ,CACJ,CACA,OAAOA,CACX,CAUA,SAASu9J,GAAe1C,GACpB,MAAMtxC,EAAQqB,KACR7K,EAAQ8K,KACRmyC,EAAa9wC,KACnBE,GAAqB4wC,EAAa,GAClC,MAAM9B,EAASI,GAAUv7C,EAAOi9C,GAChC,GAAInC,EAAU/0C,OA7zqBlB,SAAS03C,GAAex2D,GACpB,OAA2D,IAArC,EAAdA,EAAKmc,IACjB,CA4zqBSq6C,CAAej0C,MAC+C,IAAjC,EAAxB2xC,EAAOxzJ,SAASkxG,QAAwE,CAC9F,GAAuB,OAAnBsiD,EAAOx9G,QACPm9G,EAAU1gH,MAAM,QAEf,CACD,MAAMn6C,EAASk7J,EAAOa,kBAClBqB,GAAoBr9C,EAAOwJ,EAAOyzC,EAAY,IAC9CD,GAAuBh9C,EAAOwJ,EAAO2xC,EAAQ8B,GACjDnC,EAAU1gH,MAAMn6C,EAAQkrI,IACxB2vB,EAAU5D,iBACd,CACA,OAAO,CACX,CACA,OAAO,CACX,CAUA,SAASwG,GAAYjhE,EAAWoc,EAAOzZ,GAEnC,MAAM4gB,EAAQ8K,KACV9K,EAAMqR,kBACNssC,GAAa39C,EAAO,IAAIw7C,GAAgB/+D,EAAWoc,EAAOzZ,IAAO,GACnB,IAAjC,EAARyZ,KACDmH,EAAM81B,mBAAoB,IAGlC8nB,GAAa59C,EAAO6K,KAAYhS,EACpC,CAaA,SAASglD,GAAe/oC,EAAgBr4B,EAAWoc,EAAOzZ,GAEtD,MAAM4gB,EAAQ8K,KACd,GAAI9K,EAAMqR,gBAAiB,CACvB,MAAMhU,EAAQ8N,KACdwyC,GAAa39C,EAAO,IAAIw7C,GAAgB/+D,EAAWoc,EAAOzZ,GAAOie,EAAMn8G,OAkC/E,SAAS48J,GAAkC99C,EAAO8U,GAC9C,MAAMipC,EAAsB/9C,EAAMW,iBAAmBX,EAAMW,eAAiB,IAExEmU,KAD4BipC,EAAoBzpK,OAASypK,EAAoBA,EAAoBzpK,OAAS,IAAK,IAE/GypK,EAAoBlpK,KAAKmrH,EAAM01B,QAAQphJ,OAAS,EAAGwgI,EAE3D,CAvCQgpC,CAAkC99C,EAAO8U,GACK,IAAjC,EAARjc,KACDmH,EAAM+1B,sBAAuB,EAErC,CACA6nB,GAAa59C,EAAO6K,KAAYhS,EACpC,CAMA,SAASmlD,KACL,OAEJ,SAASC,GAAkBz0C,EAAOyzC,GAI9B,OAAOzzC,EAAMpF,IAASsxB,QAAQunB,GAAYnC,SAC9C,CAPWmD,CAAkBpzC,KAAYsB,KACzC,CAOA,SAASyxC,GAAa59C,EAAOwJ,EAAO3Q,GAChC,MAAMiiD,EAAY,IAAI1E,GAAmE,IAAhD,EAARv9C,KA1jZrC,SAASqlD,GAAwBl+C,EAAOwJ,EAAOloH,EAAS4mH,GACpD,MAAM8T,EAAWqe,GAAwB7wB,GAOzCwS,EAASnnI,KAAKyM,GACV0+G,EAAMqR,iBACNipB,GAAwBt6B,GAAOnrH,KAAKqzH,EAAW8T,EAAS1nI,OAAS,EASzE,EAwiZI4pK,CAAwBl+C,EAAOwJ,EAAOsxC,EAAWA,EAAUt3F,SACpC,OAAnBgmD,EAAMpF,MACNoF,EAAMpF,IAAW,IAAI22C,IACzBvxC,EAAMpF,IAASsxB,QAAQ7gJ,KAAK,IAAIgmK,GAAQC,GAC5C,CACA,SAAS6C,GAAa39C,EAAOr4G,EAAUiiH,GACb,OAAlB5J,EAAM01B,UACN11B,EAAM01B,QAAU,IAAI+lB,IACxBz7C,EAAM01B,QAAQmmB,MAAM,IAAIE,GAAQp0J,EAAUiiH,GAC9C,CAQA,SAAS2xC,GAAUv7C,EAAO9+G,GAEtB,OAAO8+G,EAAM01B,QAAQ0lB,WAAWl6J,EACpC,CAQA,SAASi9J,GAAuB9gD,EAAOmM,GACnC,OAAOgvC,GAAkBn7C,EAAOmM,EACpC,CAgMA,SAAS40C,GAAWnmK,GAChB,QAASmqH,GAAenqH,EAC5B,CAy/BA,MAqQMg0F,GAAkB,IAAI+T,GAAe,2BAC3C,IAKMq+D,GAAqB,MAA3B,MAAMA,EACF1wK,cACIC,KAAK0wK,aAAc,EACnB1wK,KAAKmrG,MAAO,EACZnrG,KAAK2wK,YAAc,IAAIhyF,QAAQ,CAAC38D,EAAK4uJ,KACjC5wK,KAAKiR,QAAU+Q,EACfhiB,KAAKqR,OAASu/J,IAElB5wK,KAAK6wK,SAAWr+D,GAAOnU,GAAiB,CAAEwkB,UAAU,KAAW,EAOnE,CAEAiuD,kBACI,GAAI9wK,KAAK0wK,YACL,OAEJ,MAAMK,EAAoB,GAC1B,UAAWF,KAAY7wK,KAAK6wK,SAAU,CAClC,MAAMG,EAAaH,IACnB,GAAInlE,GAAUslE,GACVD,EAAkB9pK,KAAK+pK,QAAU,GAE5BvY,GAAeuY,GAAa,CACjC,MAAMC,EAAsB,IAAItyF,QAAQ,CAAC1tE,EAASI,KAC9C2/J,EAAWz6H,UAAU,CAAEgf,SAAUtkD,EAASyd,MAAOrd,GAAQ,GAE7D0/J,EAAkB9pK,KAAKgqK,EAC3B,CACJ,CACA,MAAM17G,EAAWA,KAEbv1D,KAAKmrG,MAAO,EACZnrG,KAAKiR,SAAQ,EAEjB0tE,QAAQ1xC,IAAI8jI,GACPvrK,KAAK,KACN+vD,GAAS,GAERhjD,MAAML,IACPlS,KAAKqR,OAAOa,EAAC,GAEgB,IAA7B6+J,EAAkBrqK,QAClB6uD,IAEJv1D,KAAK0wK,aAAc,CACvB,CAACvwK,SACQH,KAAKgD,UAAO,SAAuC5C,GAAK,OAAO,IAAKA,GAAKqwK,EAA0B,EAACtwK,SACpGH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAOw8H,EAAuB1tK,QAAS0tK,EAAsBztK,UAAMC,WAAY,SAC3I,OArDKwtK,CAAqB,KA2DrBS,GAAO,MAAb,MAAMA,EACFvlK,IAAIK,GAEAhD,QAAQ2C,IAAIK,EAChB,CAEAyK,KAAKzK,GAEDhD,QAAQyN,KAAKzK,EACjB,CAAC7L,SACQH,KAAKgD,UAAO,SAAyB5C,GAAK,OAAO,IAAKA,GAAK8wK,EAAY,EAAC/wK,SACxEH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAOi9H,EAASnuK,QAASmuK,EAAQluK,UAAMC,WAAY,aAC/G,OAZKiuK,CAAO,KAmEb,MAAMC,GAAY,IAAI/+D,GAAe,WAAY,CAC7CnvG,WAAY,OACZF,QAASA,IAAMyvG,GAAO2+D,GAAW7mD,GAAYK,SAAWL,GAAYI,WA7CxE,SAAS0mD,KAkBD,cAAeC,UAAc,KAAeA,UAAUhP,QAAWgC,EAEzE,CAyBqF+M,KAwC/EE,GAAwB,IAAIl/D,GAAe,sBAAuB,CACpEnvG,WAAY,OACZF,QAASA,IAjrMa,QAgwM1B,IASMwuK,GAAyB,MAA/B,MAAMA,EACFxxK,cACIC,KAAKijH,OAAS,EACdjjH,KAAK+iH,aAAe,IAAI3gD,IACxBpiE,KAAKwxK,gBAAkB,IAAIrtE,MAAgB,EAC/C,CACA58E,MACIvnB,KAAKwxK,gBAAgBn9I,MAAK,GAC1B,MAAM4uF,EAASjjH,KAAKijH,SACpB,OAAAjjH,KAAK+iH,aAAax7F,IAAI07F,GACfA,CACX,CACA/0E,OAAO+0E,GACHjjH,KAAK+iH,aAAat7F,OAAOw7F,GACM,IAA3BjjH,KAAK+iH,aAAav8C,MAClBxmE,KAAKwxK,gBAAgBn9I,MAAK,EAElC,CACAmiB,cACIx2C,KAAK+iH,aAAa/jG,QAClBhf,KAAKwxK,gBAAgBn9I,MAAK,EAC9B,CAACl0B,SACQH,KAAKgD,UAAO,SAA2C5C,GAAK,OAAO,IAAKA,GAAKmxK,EAA8B,EAACpxK,SAC5GH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAOs9H,EAA2BxuK,QAASwuK,EAA0BvuK,UAAMC,WAAY,SACnJ,OAxBKsuK,CAAyB,KAwC/B,MAAME,GACF1xK,YAAY2xK,EAAiBC,GACzB3xK,KAAK0xK,gBAAkBA,EACvB1xK,KAAK2xK,mBAAqBA,CAC9B,EAEJ,IAgBMC,GAAQ,MAAd,MAAMA,EAKFC,kBAAkB7K,GACd,OAAO,IAAID,GAAgBC,EAC/B,CAIA8K,mBAAmB9K,GACf,OAAOroF,QAAQ1tE,QAAQjR,KAAK6xK,kBAAkB7K,GAClD,CAIA+K,kCAAkC/K,GAC9B,MAAM0K,EAAkB1xK,KAAK6xK,kBAAkB7K,GAEzC2K,EAAqBxuB,GADT3uB,GAAewyC,GACkBzzC,cAC9Ct9G,OAAO,CAAC+vJ,EAAWgM,KACpB,MAAMx/C,EAAeW,GAAgB6+C,GACrCx/C,UAAgBwzC,EAAU/+J,KAAK,IAAI8pJ,GAAiBv+B,IAC7CwzC,GACR,IACH,OAAO,IAAIyL,GAA6BC,EAAiBC,EAC7D,CAIAM,mCAAmCjL,GAC/B,OAAOroF,QAAQ1tE,QAAQjR,KAAK+xK,kCAAkC/K,GAClE,CAIAkL,aAAe,CAIfC,cAAc/lK,GAAQ,CAItBgmK,YAAYpL,GAEZ,CAAC7mK,SACQH,KAAKgD,UAAO,SAA0B5C,GAAK,OAAO,IAAKA,GAAKwxK,EAAa,EAACzxK,SAC1EH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAO29H,EAAU7uK,QAAS6uK,EAAS5uK,UAAMC,WAAY,SACjH,OAlDK2uK,CAAQ,KAg0Bd,MAAMS,GAAc,IAAIjgE,GAAe,IAIjCkgE,GAAqB,IAAIlgE,GAAe,IAC9C,IAwRImgE,GApQEC,GAAW,MAAjB,MAAMA,EACFzyK,YAAY0yK,EAAS3uJ,EAAU4uJ,GAC3B1yK,KAAKyyK,QAAUA,EACfzyK,KAAK8jB,SAAWA,EAChB9jB,KAAK2yK,cAAgB,EACrB3yK,KAAK4yK,eAAgB,EAOrB5yK,KAAK6yK,UAAW,EAChB7yK,KAAK8yK,WAAa,GAClB9yK,KAAK+yK,iBAAmB,KAGnBR,KAgPb,SAASS,GAAqBC,GAC1BV,GAAqBU,CACzB,CAjPYD,CAAqBN,GACrBA,EAAkBQ,YAAYpvJ,IAElC9jB,KAAKmzK,sBACLV,EAAQlwJ,IAAI,KACRviB,KAAK+yK,wBACMzgI,KAAQ,IAAc,KAAOA,KAAKC,QAAQhlC,IAAI,mBAAkB,EAEnF,CACA4lK,sBACInzK,KAAKyyK,QAAQlzB,WAAWhpG,UAAU,CAC9BliB,KAAMA,KACFr0B,KAAK6yK,UAAW,EAChB7yK,KAAK4yK,eAAgB,KAG7B5yK,KAAKyyK,QAAQjgI,kBAAkB,KAC3BxyC,KAAKyyK,QAAQhzB,SAASlpG,UAAU,CAC5BliB,KAAMA,KACF2qH,GAAOsD,yBACPW,eAAe,KACXjjJ,KAAK4yK,eAAgB,EACrB5yK,KAAKozK,sBAAqB,EAC7B,GAER,EAET,CAKAC,8BACI,OAAArzK,KAAK2yK,eAAiB,EACtB3yK,KAAK6yK,UAAW,EACT7yK,KAAK2yK,aAChB,CAKAW,8BAEI,GADAtzK,KAAK2yK,eAAiB,EAClB3yK,KAAK2yK,cAAgB,EACrB,MAAM,IAAI/tK,MAAM,qCAEpB,OAAA5E,KAAKozK,uBACEpzK,KAAK2yK,aAChB,CAIArzB,WACI,OAAOt/I,KAAK4yK,eAAwC,IAAvB5yK,KAAK2yK,gBAAwB3yK,KAAKyyK,QAAQrzB,oBAC3E,CACAg0B,uBACI,GAAIpzK,KAAKs/I,WAEL2D,eAAe,KACX,KAAkC,IAA3BjjJ,KAAK8yK,WAAWpsK,QAAc,CACjC,IAAIy5C,EAAKngD,KAAK8yK,WAAWjxJ,MACzB8f,aAAawe,EAAGozH,WAChBpzH,EAAGqzH,OAAOxzK,KAAK6yK,SACnB,CACA7yK,KAAK6yK,UAAW,QAGnB,CAED,IAAIY,EAAUzzK,KAAK0zK,kBACnB1zK,KAAK8yK,WAAa9yK,KAAK8yK,WAAW9qK,OAAQm4C,IAClCA,EAAGwzH,WAAYxzH,EAAGwzH,SAASF,KAC3B9xI,aAAawe,EAAGozH,YACT,IAIfvzK,KAAK6yK,UAAW,CACpB,CACJ,CACAa,kBACI,OAAK1zK,KAAK+yK,iBAIH/yK,KAAK+yK,iBAAiBa,WAAWzrK,IAAK/H,KAErC8K,OAAQ9K,EAAE8K,OAGV2oK,iBAAkBzzK,EAAEyzK,iBACpBxkK,KAAMjP,EAAEiP,QATL,EAYf,CACAykK,YAAY3zH,EAAIpoB,EAAS47I,GACrB,IAAIJ,GAAY,EACZx7I,GAAWA,EAAU,IACrBw7I,EAAYl0I,WAAW,KACnBr/B,KAAK8yK,WAAa9yK,KAAK8yK,WAAW9qK,OAAQm4C,GAAOA,EAAGozH,YAAcA,GAClEpzH,EAAGngD,KAAK6yK,SAAU7yK,KAAK0zK,kBAAiB,EACzC37I,IAEP/3B,KAAK8yK,WAAW7rK,KAAK,CAAEusK,OAAQrzH,EAAIozH,UAAWA,EAAWI,SAAUA,GACvE,CAaAI,WAAWP,EAAQz7I,EAAS47I,GACxB,GAAIA,IAAa3zK,KAAK+yK,iBAClB,MAAM,IAAInuK,MAAM,8HAIpB5E,KAAK8zK,YAAYN,EAAQz7I,EAAS47I,GAClC3zK,KAAKozK,sBACT,CAKAY,yBACI,OAAOh0K,KAAK2yK,aAChB,CAOAsB,oBAAoBhgI,GAChBj0C,KAAK8jB,SAASmwJ,oBAAoBhgI,EAAOj0C,KAC7C,CAOAk0K,sBAAsBjgI,GAClBj0C,KAAK8jB,SAASowJ,sBAAsBjgI,EACxC,CAOAkgI,cAAcC,EAAOl8B,EAAUm8B,GAE3B,MAAO,EACX,CAACl0K,SACQH,KAAKgD,UAAO,SAA6B5C,GAAK,OAAO,IAAKA,GAAKoyK,GAAa18D,GAASkpC,IAASlpC,GAASw+D,IAAsBx+D,GAASw8D,IAAsB,EAACnyK,SAC7JH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAOu+H,EAAazvK,QAASyvK,EAAYxvK,YACrG,OArLKwvK,CAAW,KAgMX8B,GAAmB,MAAzB,MAAMA,EACFv0K,cAEIC,KAAKu0K,cAAgB,IAAIrnK,GAC7B,CAMA+mK,oBAAoBhgI,EAAOugI,GACvBx0K,KAAKu0K,cAAc9mK,IAAIwmC,EAAOugI,EAClC,CAKAN,sBAAsBjgI,GAClBj0C,KAAKu0K,cAAc9sJ,OAAOwsB,EAC9B,CAIAwgI,4BACIz0K,KAAKu0K,cAAcv1J,OACvB,CAKA01J,eAAezuK,GACX,OAAOjG,KAAKu0K,cAAchnK,IAAItH,IAAS,IAC3C,CAIA0uK,sBACI,OAAO9tK,MAAM6e,KAAK1lB,KAAKu0K,cAAc9lK,SACzC,CAIAmmK,qBACI,OAAO/tK,MAAM6e,KAAK1lB,KAAKu0K,cAAcprK,OACzC,CAOA0rK,sBAAsB5uK,EAAM6uK,GAAkB,GAC1C,OAAOvC,IAAoBsC,sBAAsB70K,KAAMiG,EAAM6uK,IAAoB,IACrF,CAAC30K,SACQH,KAAKgD,UAAO,SAAqC5C,GAAK,OAAO,IAAKA,GAAKk0K,EAAwB,EAACn0K,SAChGH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAOqgI,EAAqBvxK,QAASuxK,EAAoBtxK,UAAMC,WAAY,aACvI,OAxDKqxK,CAAmB,KAsErBS,GAAoB,KAKxB,MAAMC,GAA2B,IAAI5iE,GAAe,sBAO9C6iE,GAA6B,IAAI7iE,GAAe,4BAWhD8iE,GAAyB,IAAI9iE,GAAe,wBA4DlD,MAAM+iE,GACFp1K,YAAYgE,EAAMkwC,GACdj0C,KAAK+D,KAAOA,EACZ/D,KAAKi0C,MAAQA,CACjB,EAiIJ,SAASmhI,GAAsBC,EAAuBtxK,EAAM4iH,EAAY,IACpE,MAAM2uD,EAAQ,aAAYvxK,IACpB2qH,EAAS,IAAItc,GAAekjE,GAClC,MAAO,CAACC,EAAiB,MACrB,IAAIv1I,EAAWw1I,KACf,IAAKx1I,GAAYA,EAASk7E,SAAS3tG,IAAIynK,IAA0B,GAAQ,CACrE,MAAMS,EAAoB,IACnB9uD,KACA4uD,EACH,CAAEz3E,QAAS4wB,EAAQxwB,UAAU,IAE7Bm3E,EACAA,EAAsBI,GArItC,SAASC,GAAex6D,GACpB,GAAI65D,KAAsBA,GAAkBxnK,IAAIynK,IAA0B,GACtE,MAAM,IAAI/rD,GAAa,KAA+CpF,IA7B9E,SAAS8xD,MAhuxBT,SAASC,EAAkC3vJ,GACvC8zG,EAAmC9zG,CACvC,CA+txBI2vJ,CAAkC,KAC9B,MAAM,IAAI3sD,GAAa,KAA8DpF,EAEQ,EAErG,EA2BI8xD,GACAZ,GAAoB75D,EACpB,MAAMl7E,EAAWk7E,EAAS3tG,IAAIsoK,KAsBlC,SAASC,GAAwB56D,GACfA,EAAS3tG,IAAIkvI,GAAsB,OAC1Cr0I,QAAS0L,GAASA,IAC7B,EAxBIgiK,CAAwB56D,EAE5B,CA6HgBw6D,CA0BhB,SAASK,GAAuBpvD,EAAY,GAAI5iH,GAC5C,OAAOq6I,GAASl4C,OAAO,CACnBniG,OACA4iH,UAAW,CACP,CAAE7oB,QAASw7C,GAAgBp7C,SAAU,YACrC,CAAEJ,QAASm3E,GAA4B/2E,SAAU,IAAI97B,IAAI,CAAC,IAAM2yG,GAAoB,WACjFpuD,IAGf,CAnC+BovD,CAAuBN,EAAmBH,GAEjE,CACA,OAQR,SAASU,GAAeC,GACpB,MAAMj2I,EAAWw1I,KACjB,IAAKx1I,EACD,MAAM,IAAIipF,GAAa,KAA+CpF,GAM1E,OAAO7jF,CACX,CAlBeg2I,EAAqB,CAEpC,CA6CA,SAASR,KACL,OAAOT,IAAmBxnK,IAAIsoK,KAAgB,IAClD,CACA,IASMA,GAAW,MAAjB,MAAMA,EAEF91K,YAAYunK,GACRtnK,KAAKsnK,UAAYA,EACjBtnK,KAAKk2K,SAAW,GAChBl2K,KAAKm2K,kBAAoB,GACzBn2K,KAAK85I,YAAa,CACtB,CAOAs8B,uBAAuBC,EAAenwK,GAKlC,MAAMowK,EAoId,SAASC,GAAUC,EAAc,UAAWtwK,GACxC,MAAoB,SAAhBswK,EACO,IAAI7zB,GAEK,YAAhB6zB,EACO,IAAIx3B,GAAO94I,GAEfswK,CACX,CA5IuBD,CAAUrwK,GAASowK,OA6H1C,SAASG,GAAiBvwK,GACtB,MAAO,CACH+4I,sBAAiE,EACjEC,mCAAoCh5I,GAASwwK,kBAAmB,EAChEv3B,iCAAkCj5I,GAASywK,gBAAiB,EAEpE,CAnIkDF,CAAiB,CACvDC,gBAAiBxwK,GAAS0wK,sBAC1BD,cAAezwK,GAAS2wK,uBAM5B,OAAOP,EAAO/zJ,IAAI,KACd,MAAMu0J,EA9/KlB,SAASC,GAA+B/P,EAAY5V,EAAgBlT,GAChE,OAAO,IAAIuoB,GAAYO,EAAY5V,EAAgBlT,EACvD,CA4/K8B64B,CAA+BV,EAAcrP,WAAYhnK,KAAKk7G,SAijB5F,SAAS87D,GAAmCC,GACxC,MAAO,CACH,CAAEn5E,QAASkhD,GAAQ1gD,WAAY24E,GAC/B,CACIn5E,QAASw5C,GACTr5C,OAAO,EACPK,WAAYA,KACR,MAAM44E,EAAiC1kE,GAAO2kE,GAAgC,CAAEt0D,UAAU,IAM1F,MAAO,IAAMq0D,EAA+BE,YAAW,GAG/D,CAAEt5E,QAASu5E,GAAoC/4E,WAAYg5E,IAC3D,CAAEx5E,QAAS8kD,GAA2BtkD,WAAYukD,IAE1D,CApkBsGm0B,CAAmC,IAAMV,IAK7HiB,EAAmBT,EAAU57D,SAAS3tG,IAAImwF,GAAc,MAI9D44E,SAAO9jI,kBAAkB,KACrB,MAAMgyD,EAAe8xE,EAAO1oE,QAAQr3D,UAAU,CAC1CliB,KAAO3F,IACH6oJ,EAAiBrkI,YAAYxkB,EAAK,IAG1CooJ,EAAUziD,UAAU,KAChBnmF,GAAOluC,KAAKk2K,SAAUY,GACtBtyE,EAAa/tD,aAAY,EAC5B,GAkHjB,SAAS+gI,GAA6B9wG,EAAc4vG,EAAQvtK,GACxD,IACI,MAAMsJ,EAAStJ,IACf,OAAI2iG,GAAUr5F,GACHA,EAAOE,MAAOL,IACjBokK,QAAO9jI,kBAAkB,IAAMk0B,EAAaxzB,YAAYhhC,IAElDA,IAGPG,CACX,OACOH,GACHokK,QAAO9jI,kBAAkB,IAAMk0B,EAAaxzB,YAAYhhC,IAElDA,CACV,CACJ,CAjImBslK,CAA6BD,EAAkBjB,EAAQ,KAC1D,MAAMmB,EAAaX,EAAU57D,SAAS3tG,IAAIkjK,IAC1CgH,SAAW3G,kBACJ2G,EAAW9G,YAAYnrK,KAAK,KAxsPnD,SAASkyK,GAAYC,GACjBruD,GAAcquD,EAAW,mCACD,iBAAbA,IACPrT,GAAcqT,EAAS7vK,cAAcmG,QAAQ,KAAM,KAE3D,CAssPoBypK,CADiBZ,EAAU57D,SAAS3tG,IAAI4jK,GAAW9M,KAC3BA,IACxBrkK,KAAK43K,mBAAmBd,GACjBA,GACV,EACJ,EAET,CAiBA9yE,gBAAgBgjE,EAAY6Q,EAAkB,IAC1C,MAAM3xK,EAAU4xK,GAAe,CAAC,EAAGD,GACnC,OA5VR,SAASE,GAAuB78D,EAAUh1G,EAAS8gK,GAE/C,MAAMqP,EAAgB,IAAItP,GAAgBC,GAGtC,OAAOroF,QAAQ1tE,QAAQolK,EAgC/B,CAuTe0B,CAAuB/3K,EAAekG,EAAS8gK,GACjDxhK,KAAK6wK,GAAiBr2K,KAAKo2K,uBAAuBC,EAAenwK,GAC1E,CACA0xK,mBAAmBd,GACf,MAAMnmB,EAASmmB,EAAU57D,SAAS3tG,IAAIyqK,IACtC,GAAIlB,EAAUnQ,qBAAqBjgK,OAAS,EACxCowK,EAAUnQ,qBAAqBv+J,QAAQ88J,GAAKvU,EAAO9yD,UAAUqnE,QAAE,KAE1D4R,EAAUhmE,SAASmnE,cAIxB,MAAM,IAAIhvD,IAAa,KAA4DpF,GAHnFizD,EAAUhmE,SAASmnE,cAActnB,EAMI,CAEzC3wJ,KAAKk2K,SAASjvK,KAAK6vK,EACvB,CAIAziD,UAAUtrH,GACN/I,KAAKm2K,kBAAkBlvK,KAAK8B,EAChC,CAKA,YAAImyG,GACA,OAAOl7G,KAAKsnK,SAChB,CAKA1xF,UACI,GAAI51E,KAAK85I,WACL,MAAM,IAAI7wB,GAAa,KAAuDpF,GAElF7jH,KAAKk2K,SAASlsK,QAAQ5B,QAAQ8vK,GAAUA,EAAOtiG,WAC/C51E,KAAKm2K,kBAAkB/tK,QAAQ24B,GAAYA,KAC3C,MAAMo3I,EAAmBn4K,KAAKsnK,UAAU/5J,IAAI0nK,GAA4B,MACpEkD,IACAA,EAAiB/vK,QAAQ24B,GAAYA,KACrCo3I,EAAiBn5J,SAErBhf,KAAK85I,YAAa,CACtB,CAIA,aAAID,GACA,OAAO75I,KAAK85I,UAChB,CAAC35I,SACQH,KAAKgD,UAAO,SAA6B5C,GAAK,OAAO,IAAKA,GAAKy1K,GAAa//D,GAASsoC,IAAY,EAACj+I,SAClGH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAO4hI,EAAa9yK,QAAS8yK,EAAY7yK,UAAMC,WAAY,aACvH,OAxIK4yK,CAAW,KAkLjB,SAASiC,GAAelpD,EAAKwpD,GACzB,OAAIvxK,MAAMC,QAAQsxK,GACPA,EAAKniK,OAAO6hK,GAAgBlpD,GAEhC,IAAKA,KAAQwpD,EACxB,CACA,IA4FMJ,GAAc,MAApB,MAAMA,EACFj4K,cAEIC,KAAKq4K,oBAAsB,GAC3Br4K,KAAKs4K,cAAe,EACpBt4K,KAAK85I,YAAa,EAClB95I,KAAKm2K,kBAAoB,GAEzBn2K,KAAKu4K,OAAS,GACdv4K,KAAKw4K,qBAAuBhmE,GAAO6kE,IACnCr3K,KAAKy4K,aAAejmE,GAAOowC,IAK3B5iJ,KAAK04K,eAAiB,GAItB14K,KAAK+vB,WAAa,GAIlB/vB,KAAKs/I,SAAW9sC,GAAO++D,IAClBC,gBAAgB/8H,QAAKq7D,MAAU0hE,GAAmBA,KAAkBlkE,QAAG,GAASttG,KAAKy4K,eAAY,EAAGlqE,QAAwB6Y,MACjIpnH,KAAKsnK,UAAY90D,GAAOmnC,GAC5B,CAIA,aAAIE,GACA,OAAO75I,KAAK85I,UAChB,CAIA,YAAI5+B,GACA,OAAOl7G,KAAKsnK,SAChB,CAsCAzpE,UAAU86E,EAAoB/mB,GAE1B,MAAM+Z,EAAqBgN,aAA8B77B,GAEzD,IADmB98I,KAAKsnK,UAAU/5J,IAAIkjK,IACtBtlE,KAKZ,MAJoBwgE,GAAsBp3C,GAAaokD,GAIjD,IAAI1vD,GAAa,KAAkGpF,GAE7H,IAAIioD,EAEAA,EADAH,EACmBgN,EAGF34K,KAAKsnK,UAAU/5J,IAAI2vI,IACRF,wBAAwB27B,GAExD34K,KAAK04K,eAAezxK,KAAK6kK,EAAiBva,eAE1C,MAAM/Y,EA/kBd,SAASkZ,GAAgBknB,GACrB,OAAOA,EAAGlnB,eACd,CA6kByBA,CAAgBoa,QAAoBvoK,EAAYvD,KAAKsnK,UAAU/5J,IAAI+4J,IAE9EuS,EAAU/M,EAAiB5lE,OAAOk4C,GAASjB,KAAM,GADhCyU,GAAsBka,EAAiB7jH,SACauwF,GACrE9gC,EAAgBmhE,EAAQ3lJ,SAASwkF,cACjC88D,EAAcqE,EAAQ39D,SAAS3tG,IAAI8kK,GAAa,MACtDmC,UAAaP,oBAAoBv8D,GACjCmhE,EAAQxkD,UAAU,KACdr0H,KAAKitI,WAAW4rC,EAAQ58C,UACxB/tF,GAAOluC,KAAK+vB,WAAY8oJ,GACxBrE,GAAaN,sBAAsBx8D,EAAa,GAEpD13G,KAAK84K,eAAeD,GAKbA,CACX,CAWAE,OAEI,GAAI/4K,KAAKs4K,aACL,MAAM,IAAIrvD,GAAa,KAA2DpF,GAEtF,IACI7jH,KAAKs4K,cAAe,EACpB,QAASj/D,KAAQr5G,KAAKu4K,OAClBl/D,EAAKg3C,eAOb,OACOn+I,GAEHlS,KAAKw4K,qBAAqBtmK,EAC9B,SAEIlS,KAAKs4K,cAAe,CACxB,CACJ,CAMAU,WAAWzN,GAEP,MAAMlyD,EAAOkyD,EACbvrK,KAAKu4K,OAAOtxK,KAAKoyG,GACjBA,EAAKq3C,eAAe1wJ,KACxB,CAIAitI,WAAWs+B,GAEP,MAAMlyD,EAAOkyD,EACbr9H,GAAOluC,KAAKu4K,OAAQl/D,GACpBA,EAAKm3C,kBACT,CACAsoB,eAAe9M,GACXhsK,KAAKg5K,WAAWhN,EAAa/vC,UAC7Bj8H,KAAK+4K,OACL/4K,KAAK+vB,WAAW9oB,KAAK+kK,GAErB,MAAMiN,EAAYj5K,KAAKsnK,UAAU/5J,IAAI2nK,GAAwB,IAO7D+D,EAAUhyK,QAAQjH,KAAKq4K,qBACvBY,EAAU7wK,QAAS24B,GAAaA,EAASirI,GAC7C,CAEAx1H,cACI,IAAIx2C,KAAK85I,WAET,IAEI95I,KAAKm2K,kBAAkB/tK,QAAQ24B,GAAYA,KAE3C/gC,KAAKu4K,OAAOvuK,QAAQ5B,QAASixG,GAASA,EAAKzjC,UAC/C,SAGI51E,KAAK85I,YAAa,EAElB95I,KAAKu4K,OAAS,GACdv4K,KAAKq4K,oBAAsB,GAC3Br4K,KAAKm2K,kBAAoB,EAC7B,CACJ,CAOA9hD,UAAUtrH,GAEN,OAAA/I,KAAKm2K,kBAAkBlvK,KAAK8B,GACrB,IAAMmlC,GAAOluC,KAAKm2K,kBAAmBptK,EAChD,CAMA6sE,UACI,GAAI51E,KAAK85I,WACL,MAAM,IAAI7wB,GAAa,KAA8DpF,GAEzF,MAAM3I,EAAWl7G,KAAKsnK,UAElBpsD,EAAStlC,UAAYslC,EAAS2+B,WAG9B3+B,EAAStlC,SAEjB,CAIA,aAAIsjG,GACA,OAAOl5K,KAAKu4K,OAAO7xK,MACvB,CACAyyK,kBAIA,CAACh5K,SACQH,KAAKgD,UAAO,SAAgC5C,GAAK,OAAO,IAAKA,GAAK43K,EAAmB,EAAC73K,SACtFH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAO+jI,EAAgBj1K,QAASi1K,EAAeh1K,UAAMC,WAAY,SAC7H,OApPK+0K,CAAc,KAyPpB,SAAS9pI,GAAO6R,EAAM14C,GAClB,MAAMiM,EAAQysC,EAAKrzB,QAAQrlB,GACvBiM,GAAQ,GACRysC,EAAKr4B,OAAOpU,EAAO,EAE3B,CAeA,MAAM+jK,GAAqC,IAAIjlE,GAA4F,GAAI,CAC3InvG,WAAY,OACZF,QAASA,IACoByvG,GAAO9U,IACRxqD,YAAYnmB,UAAKxpB,KAGjD,SAAS+zK,KACL,MAAM92B,EAAOhuC,GAAOwsC,IACdo6B,EAAmB5mE,GAAO9U,IAChC,OAAQxrF,GAAMsuI,EAAKhuG,kBAAkB,IAAM4mI,EAAiBlmI,YAAYhhC,GAC5E,CAAC,IACKilK,GAA8B,MAApC,MAAMA,EACFp3K,cACIC,KAAKwgJ,KAAOhuC,GAAOwsC,IACnBh/I,KAAKq5K,eAAiB7mE,GAAOwlE,GACjC,CACAZ,aACQp3K,KAAKs5K,gCAGTt5K,KAAKs5K,8BAAgCt5K,KAAKwgJ,KAAKhB,iBAAiBjpG,UAAU,CACtEliB,KAAMA,KACFr0B,KAAKwgJ,KAAKj+H,IAAI,KACVviB,KAAKq5K,eAAeN,MAAK,EAC5B,IAGb,CACAviI,cACIx2C,KAAKs5K,+BAA+B7iI,aACxC,CAACt2C,SACQH,KAAKgD,UAAO,SAAgD5C,GAAK,OAAO,IAAKA,GAAK+2K,EAAmC,EAACh3K,SACtHH,KAAKg0C,WAAsB2nE,GAAmB,CAAE1nE,MAAOkjI,EAAgCp0K,QAASo0K,EAA+Bn0K,UAAMC,WAAY,SAC7J,OAtBKk0K,CAA8B,KAkJpC,IA6CMoC,GAAiB,MAAvB,MAAMA,EACFp5K,SAISH,KAAKsrH,kBAAoBkuD,GACrC,OANKD,CAAiB,KAQvB,SAASC,GAAwBvuD,GAC7B,OAUJ,SAASwuD,GAAchqD,EAAOmM,EAAO89C,GACjC,GAAIliD,GAAgB/H,KAAWiqD,EAAQ,CAGnC,MAAM9yB,EAAgB7qB,GAAyBtM,EAAMn8G,MAAOsoH,GAC5D,OAAO,IAAI8zB,GAAU9I,EAAeA,EACxC,QACuB,GAAdn3B,EAAMrjH,KAIJ,IAAIsjJ,GADe9zB,EAAMvF,IACQuF,GAErC,IACX,CAxBW69C,CAAcl8C,KAAmBN,KAA+D,KAA1C,GAARhS,GACzD,CAipBA,MAAM0uD,GACF55K,cAAgB,CAChB65K,SAASv2K,GACL,OAAO+xJ,GAAmB/xJ,EAC9B,CACA6iG,OAAO2zE,GACH,OAAO,IAAIC,GAAsBD,EACrC,EAEJ,MAAME,GAAkBA,CAACzmK,EAAO5F,IAASA,EAKzC,MAAMosK,GACF/5K,YAAY85K,GACR75K,KAAK0G,OAAS,EAEd1G,KAAKg6K,eAAiB,KAEtBh6K,KAAKi6K,iBAAmB,KACxBj6K,KAAKk6K,gBAAkB,KACvBl6K,KAAKm6K,QAAU,KACfn6K,KAAKo6K,QAAU,KACfp6K,KAAKq6K,eAAiB,KACtBr6K,KAAKs6K,eAAiB,KACtBt6K,KAAKu6K,WAAa,KAClBv6K,KAAKw6K,WAAa,KAClBx6K,KAAKy6K,cAAgB,KACrBz6K,KAAK06K,cAAgB,KAErB16K,KAAK26K,qBAAuB,KAC5B36K,KAAK46K,qBAAuB,KAC5B56K,KAAKu4G,WAAashE,GAAaE,EACnC,CACAc,YAAY50J,GACR,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKm6K,QAAoB,OAAXlkG,EAAiBA,EAASA,EAAOwxB,MACzDxhF,EAAGgwD,EAEX,CACAgjC,iBAAiBhzF,GACb,IAAI60J,EAAS96K,KAAKm6K,QACdY,EAAa/6K,KAAKy6K,cAClBO,EAAkB,EAClBC,EAAc,KAClB,KAAOH,GAAUC,GAAY,CAGzB,MAAM9kG,GAAU8kG,GACZD,GACIA,EAAOzkK,aACH6kK,GAAiBH,EAAYC,EAAiBC,GACtDH,EACAC,EACEI,EAAmBD,GAAiBjlG,EAAQ+kG,EAAiBC,GAC7D5kK,EAAe4/D,EAAO5/D,aAE5B,GAAI4/D,IAAW8kG,EACXC,IACAD,EAAaA,EAAWK,qBAGxBN,EAASA,EAAOrzE,MACY,MAAxBxxB,EAAOkjC,cACP6hE,QAEC,CAEIC,IACDA,EAAc,IAClB,MAAMI,EAAyBF,EAAmBH,EAC5CM,EAAoBjlK,EAAe2kK,EACzC,GAAIK,GAA0BC,EAAmB,CAC7C,QAAS7zK,EAAI,EAAGA,EAAI4zK,EAAwB5zK,IAAK,CAC7C,MAAMqtB,EAASrtB,EAAIwzK,EAAYv0K,OAASu0K,EAAYxzK,GAAMwzK,EAAYxzK,GAAK,EACrE6L,GAAQwhB,EAASrtB,EACnB6zK,GAAqBhoK,IAASA,GAAQ+nK,IACtCJ,EAAYxzK,GAAKqtB,EAAS,EAElC,CAEAmmJ,EADsBhlG,EAAOkjC,eACAmiE,EAAoBD,CACrD,CACJ,CAEAF,IAAqB9kK,GACrB4P,EAAGgwD,EAAQklG,EAAkB9kK,EAErC,CACJ,CACAklK,oBAAoBt1J,GAChB,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKk6K,gBAA4B,OAAXjkG,EAAiBA,EAASA,EAAOulG,cACjEv1J,EAAGgwD,EAEX,CACAwlG,iBAAiBx1J,GACb,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKq6K,eAA2B,OAAXpkG,EAAiBA,EAASA,EAAOylG,WAChEz1J,EAAGgwD,EAEX,CACA0lG,iBAAiB11J,GACb,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKu6K,WAAuB,OAAXtkG,EAAiBA,EAASA,EAAO2lG,WAC5D31J,EAAGgwD,EAEX,CACA4lG,mBAAmB51J,GACf,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKy6K,cAA0B,OAAXxkG,EAAiBA,EAASA,EAAOmlG,aAC/Dn1J,EAAGgwD,EAEX,CACAwjC,sBAAsBxzF,GAClB,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAK26K,qBAAiC,OAAX1kG,EAAiBA,EAASA,EAAO6lG,oBACtE71J,EAAGgwD,EAEX,CACA6iC,KAAKijE,GAGD,GAFkB,MAAdA,IACAA,EAAa,KACZ3mB,GAAmB2mB,GACpB,MAAM,IAAI9yD,GAAa,KAAiDpF,GAG5E,OAAI7jH,KAAKg8K,MAAMD,GACJ/7K,KAGA,IAEf,CACAq0H,YAAc,CACd2nD,MAAMD,GACF/7K,KAAKi8K,SACL,IAEI3oK,EACA5F,EACAwuK,EAJAjmG,EAASj2E,KAAKm6K,QACdgC,GAAa,EAIjB,GAAIt1K,MAAMC,QAAQi1K,GAAa,CAC3B/7K,KAAK0G,OAASq1K,EAAWr1K,OACzB,QAAS4M,EAAQ,EAAGA,EAAQtT,KAAK0G,OAAQ4M,IACrC5F,EAAOquK,EAAWzoK,GAClB4oK,EAAcl8K,KAAKu4G,WAAWjlG,EAAO5F,GACtB,OAAXuoE,GAAoB5xE,OAAOyvJ,GAAG79E,EAAOmmG,UAAWF,IAK5CC,IAEAlmG,EAASj2E,KAAKq8K,mBAAmBpmG,EAAQvoE,EAAMwuK,EAAa5oK,IAE3DjP,OAAOyvJ,GAAG79E,EAAOvoE,KAAMA,IACxB1N,KAAKs8K,mBAAmBrmG,EAAQvoE,KATpCuoE,EAASj2E,KAAKu8K,UAAUtmG,EAAQvoE,EAAMwuK,EAAa5oK,GACnD6oK,GAAa,GAUjBlmG,EAASA,EAAOwxB,KAExB,MAEIn0F,EAAQ,EA1xdpB,SAASkpK,GAAgBn5K,EAAK4iB,GAC1B,GAAIpf,MAAMC,QAAQzD,GACd,QAASoE,EAAI,EAAGA,EAAIpE,EAAIqD,OAAQe,IAC5Bwe,EAAG5iB,EAAIoE,QAGV,CACD,MAAMujG,EAAW3nG,EAAI4nG,OAAOD,YAC5B,IAAIt9F,EACJ,OAAUA,EAAOs9F,EAAS32E,QAAQ82E,MAC9BllF,EAAGvY,EAAKrD,MAEhB,CACJ,CA8wdYmyK,CAAgBT,EAAaruK,IACzBwuK,EAAcl8K,KAAKu4G,WAAWjlG,EAAO5F,GACtB,OAAXuoE,GAAoB5xE,OAAOyvJ,GAAG79E,EAAOmmG,UAAWF,IAK5CC,IAEAlmG,EAASj2E,KAAKq8K,mBAAmBpmG,EAAQvoE,EAAMwuK,EAAa5oK,IAE3DjP,OAAOyvJ,GAAG79E,EAAOvoE,KAAMA,IACxB1N,KAAKs8K,mBAAmBrmG,EAAQvoE,KATpCuoE,EAASj2E,KAAKu8K,UAAUtmG,EAAQvoE,EAAMwuK,EAAa5oK,GACnD6oK,GAAa,GAUjBlmG,EAASA,EAAOwxB,MAChBn0F,MAEJtT,KAAK0G,OAAS4M,EAElB,OAAAtT,KAAKy8K,UAAUxmG,GAEfj2E,KAAK+7K,WAAaA,EACX/7K,KAAK08K,OAChB,CAIA,WAAIA,GACA,OAA+B,OAAxB18K,KAAKq6K,gBAA+C,OAApBr6K,KAAKu6K,YACjB,OAAvBv6K,KAAKy6K,eAAwD,OAA9Bz6K,KAAK26K,oBAC5C,CASAsB,SACI,GAAIj8K,KAAK08K,QAAS,CACd,IAAIzmG,EACJ,IAAKA,EAASj2E,KAAKk6K,gBAAkBl6K,KAAKm6K,QAAoB,OAAXlkG,EAAiBA,EAASA,EAAOwxB,MAChFxxB,EAAOulG,cAAgBvlG,EAAOwxB,MAElC,IAAKxxB,EAASj2E,KAAKq6K,eAA2B,OAAXpkG,EAAiBA,EAASA,EAAOylG,WAChEzlG,EAAOkjC,cAAgBljC,EAAO5/D,aAGlC,IADArW,KAAKq6K,eAAiBr6K,KAAKs6K,eAAiB,KACvCrkG,EAASj2E,KAAKu6K,WAAuB,OAAXtkG,EAAiBA,EAASA,EAAO2lG,WAC5D3lG,EAAOkjC,cAAgBljC,EAAO5/D,aAElCrW,KAAKu6K,WAAav6K,KAAKw6K,WAAa,KACpCx6K,KAAKy6K,cAAgBz6K,KAAK06K,cAAgB,KAC1C16K,KAAK26K,qBAAuB36K,KAAK46K,qBAAuB,IAG5D,CACJ,CAWA2B,UAAUtmG,EAAQvoE,EAAMwuK,EAAa5oK,GAEjC,IAAIqpK,EACJ,OAAe,OAAX1mG,EACA0mG,EAAiB38K,KAAKo6K,SAGtBuC,EAAiB1mG,EAAO2mG,MAExB58K,KAAK68K,QAAQ5mG,IAIF,QADfA,EAAmC,OAA1Bj2E,KAAKi6K,iBAA4B,KAAOj6K,KAAKi6K,iBAAiB1sK,IAAI2uK,EAAa,QAI/E73K,OAAOyvJ,GAAG79E,EAAOvoE,KAAMA,IACxB1N,KAAKs8K,mBAAmBrmG,EAAQvoE,GACpC1N,KAAK88K,eAAe7mG,EAAQ0mG,EAAgBrpK,IAK7B,QADf2iE,EAAiC,OAAxBj2E,KAAKg6K,eAA0B,KAAOh6K,KAAKg6K,eAAezsK,IAAI2uK,EAAa5oK,KAK3EjP,OAAOyvJ,GAAG79E,EAAOvoE,KAAMA,IACxB1N,KAAKs8K,mBAAmBrmG,EAAQvoE,GACpC1N,KAAK+8K,WAAW9mG,EAAQ0mG,EAAgBrpK,IAIxC2iE,EACIj2E,KAAKg9K,UAAU,IAAIC,GAAsBvvK,EAAMwuK,GAAcS,EAAgBrpK,GAGlF2iE,CACX,CA4BAomG,mBAAmBpmG,EAAQvoE,EAAMwuK,EAAa5oK,GAC1C,IAAI4pK,EAA2C,OAA1Bl9K,KAAKi6K,iBAA4B,KAAOj6K,KAAKi6K,iBAAiB1sK,IAAI2uK,EAAa,MACpG,OAAuB,OAAnBgB,EACAjnG,EAASj2E,KAAK88K,eAAeI,EAAgBjnG,EAAO2mG,MAAOtpK,GAEtD2iE,EAAO5/D,cAAgB/C,IAC5B2iE,EAAO5/D,aAAe/C,EACtBtT,KAAKm9K,YAAYlnG,EAAQ3iE,IAEtB2iE,CACX,CAQAwmG,UAAUxmG,GAEN,KAAkB,OAAXA,GAAiB,CACpB,MAAMmnG,EAAannG,EAAOwxB,MAC1BznG,KAAKq9K,eAAer9K,KAAKs9K,QAAQrnG,IACjCA,EAASmnG,CACb,CAC8B,OAA1Bp9K,KAAKi6K,kBACLj6K,KAAKi6K,iBAAiBj7J,QAEE,OAAxBhf,KAAKs6K,iBACLt6K,KAAKs6K,eAAeoB,WAAa,MAEb,OAApB17K,KAAKw6K,aACLx6K,KAAKw6K,WAAWoB,WAAa,MAEZ,OAAjB57K,KAAKo6K,UACLp6K,KAAKo6K,QAAQ3yE,MAAQ,MAEE,OAAvBznG,KAAK06K,gBACL16K,KAAK06K,cAAcU,aAAe,MAEJ,OAA9Bp7K,KAAK46K,uBACL56K,KAAK46K,qBAAqBkB,oBAAsB,KAExD,CAEAgB,eAAe7mG,EAAQsnG,EAAYjqK,GACD,OAA1BtT,KAAKi6K,kBACLj6K,KAAKi6K,iBAAiB/rI,OAAO+nC,GAEjC,MAAM17B,EAAO07B,EAAOunG,aACdnpJ,EAAO4hD,EAAOmlG,aACpB,OAAa,OAAT7gI,EACAv6C,KAAKy6K,cAAgBpmJ,EAGrBkmB,EAAK6gI,aAAe/mJ,EAEX,OAATA,EACAr0B,KAAK06K,cAAgBngI,EAGrBlmB,EAAKmpJ,aAAejjI,EAExBv6C,KAAKy9K,aAAaxnG,EAAQsnG,EAAYjqK,GACtCtT,KAAKm9K,YAAYlnG,EAAQ3iE,GAClB2iE,CACX,CAEA8mG,WAAW9mG,EAAQsnG,EAAYjqK,GAC3B,OAAAtT,KAAKs9K,QAAQrnG,GACbj2E,KAAKy9K,aAAaxnG,EAAQsnG,EAAYjqK,GACtCtT,KAAKm9K,YAAYlnG,EAAQ3iE,GAClB2iE,CACX,CAEA+mG,UAAU/mG,EAAQsnG,EAAYjqK,GAC1B,OAAAtT,KAAKy9K,aAAaxnG,EAAQsnG,EAAYjqK,GAIlCtT,KAAKs6K,eAHmB,OAAxBt6K,KAAKs6K,eAGiBt6K,KAAKq6K,eAAiBpkG,EAMtBj2E,KAAKs6K,eAAeoB,WAAazlG,EAEpDA,CACX,CAEAwnG,aAAaxnG,EAAQsnG,EAAYjqK,GAK7B,MAAM+gB,EAAsB,OAAfkpJ,EAAsBv9K,KAAKm6K,QAAUoD,EAAW91E,MAI7DxxB,SAAOwxB,MAAQpzE,EACf4hD,EAAO2mG,MAAQW,EACF,OAATlpJ,EACAr0B,KAAKo6K,QAAUnkG,EAGf5hD,EAAKuoJ,MAAQ3mG,EAEE,OAAfsnG,EACAv9K,KAAKm6K,QAAUlkG,EAGfsnG,EAAW91E,MAAQxxB,EAEK,OAAxBj2E,KAAKg6K,iBACLh6K,KAAKg6K,eAAiB,IAAI0D,IAE9B19K,KAAKg6K,eAAe/3D,IAAIhsC,GACxBA,EAAO5/D,aAAe/C,EACf2iE,CACX,CAEA4mG,QAAQ5mG,GACJ,OAAOj2E,KAAKq9K,eAAer9K,KAAKs9K,QAAQrnG,GAC5C,CAEAqnG,QAAQrnG,GACwB,OAAxBj2E,KAAKg6K,gBACLh6K,KAAKg6K,eAAe9rI,OAAO+nC,GAE/B,MAAM17B,EAAO07B,EAAO2mG,MACdvoJ,EAAO4hD,EAAOwxB,MAIpB,OAAa,OAATltD,EACAv6C,KAAKm6K,QAAU9lJ,EAGfkmB,EAAKktD,MAAQpzE,EAEJ,OAATA,EACAr0B,KAAKo6K,QAAU7/H,EAGflmB,EAAKuoJ,MAAQriI,EAEV07B,CACX,CAEAknG,YAAYlnG,EAAQ0nG,GAGhB,OAAI1nG,EAAOkjC,gBAAkBwkE,IAMzB39K,KAAKw6K,WAHe,OAApBx6K,KAAKw6K,WAGax6K,KAAKu6K,WAAatkG,EAKlBj2E,KAAKw6K,WAAWoB,WAAa3lG,GAE5CA,CACX,CACAonG,eAAepnG,GACX,OAA8B,OAA1Bj2E,KAAKi6K,mBACLj6K,KAAKi6K,iBAAmB,IAAIyD,IAEhC19K,KAAKi6K,iBAAiBh4D,IAAIhsC,GAC1BA,EAAO5/D,aAAe,KACtB4/D,EAAOmlG,aAAe,KACK,OAAvBp7K,KAAK06K,eAGL16K,KAAK06K,cAAgB16K,KAAKy6K,cAAgBxkG,EAC1CA,EAAOunG,aAAe,OAMtBvnG,EAAOunG,aAAex9K,KAAK06K,cAC3B16K,KAAK06K,cAAgB16K,KAAK06K,cAAcU,aAAenlG,GAEpDA,CACX,CAEAqmG,mBAAmBrmG,EAAQvoE,GACvBuoE,SAAOvoE,KAAOA,EAEV1N,KAAK46K,qBADyB,OAA9B56K,KAAK46K,qBACuB56K,KAAK26K,qBAAuB1kG,EAG5Bj2E,KAAK46K,qBAAqBkB,oBAAsB7lG,EAEzEA,CACX,EAEJ,MAAMgnG,GACFl9K,YAAY2N,EAAM0uK,GACdp8K,KAAK0N,KAAOA,EACZ1N,KAAKo8K,UAAYA,EACjBp8K,KAAKqW,aAAe,KACpBrW,KAAKm5G,cAAgB,KAErBn5G,KAAKw7K,cAAgB,KAErBx7K,KAAK48K,MAAQ,KAEb58K,KAAKynG,MAAQ,KAEbznG,KAAK49K,SAAW,KAEhB59K,KAAK69K,SAAW,KAEhB79K,KAAKw9K,aAAe,KAEpBx9K,KAAKo7K,aAAe,KAEpBp7K,KAAK07K,WAAa,KAElB17K,KAAK47K,WAAa,KAElB57K,KAAK87K,oBAAsB,IAC/B,EAGJ,MAAMgC,GACF/9K,cAEIC,KAAK+9K,MAAQ,KAEb/9K,KAAKg+K,MAAQ,IACjB,CAMAz2J,IAAI0uD,GACmB,OAAfj2E,KAAK+9K,OACL/9K,KAAK+9K,MAAQ/9K,KAAKg+K,MAAQ/nG,EAC1BA,EAAO4nG,SAAW,KAClB5nG,EAAO2nG,SAAW,OAMlB59K,KAAKg+K,MAAMH,SAAW5nG,EACtBA,EAAO2nG,SAAW59K,KAAKg+K,MACvB/nG,EAAO4nG,SAAW,KAClB79K,KAAKg+K,MAAQ/nG,EAErB,CAGA1oE,IAAI6uK,EAAW6B,GACX,IAAIhoG,EACJ,IAAKA,EAASj2E,KAAK+9K,MAAkB,OAAX9nG,EAAiBA,EAASA,EAAO4nG,SACvD,IAAwB,OAAnBI,GAA2BA,GAAkBhoG,EAAO5/D,eACrDhS,OAAOyvJ,GAAG79E,EAAOmmG,UAAWA,GAC5B,OAAOnmG,EAGf,OAAO,IACX,CAMA/nC,OAAO+nC,GASH,MAAM17B,EAAO07B,EAAO2nG,SACdvpJ,EAAO4hD,EAAO4nG,SACpB,OAAa,OAATtjI,EACAv6C,KAAK+9K,MAAQ1pJ,EAGbkmB,EAAKsjI,SAAWxpJ,EAEP,OAATA,EACAr0B,KAAKg+K,MAAQzjI,EAGblmB,EAAKupJ,SAAWrjI,EAEE,OAAfv6C,KAAK+9K,KAChB,EAEJ,MAAML,GACF39K,cACIC,KAAKmI,IAAM,IAAI+E,GACnB,CACA+0G,IAAIhsC,GACA,MAAM1uE,EAAM0uE,EAAOmmG,UACnB,IAAI8B,EAAal+K,KAAKmI,IAAIoF,IAAIhG,GACzB22K,IACDA,EAAa,IAAIJ,GACjB99K,KAAKmI,IAAIsF,IAAIlG,EAAK22K,IAEtBA,EAAW32J,IAAI0uD,EACnB,CAQA1oE,IAAI6uK,EAAW6B,GACX,MACME,EAAan+K,KAAKmI,IAAIoF,IADhB6uK,GAEZ,OAAO+B,EAAaA,EAAW5wK,IAAI6uK,EAAW6B,GAAkB,IACpE,CAMA/vI,OAAO+nC,GACH,MAAM1uE,EAAM0uE,EAAOmmG,UAGnB,OAFmBp8K,KAAKmI,IAAIoF,IAAIhG,GAEjB2mC,OAAO+nC,IAClBj2E,KAAKmI,IAAIsf,OAAOlgB,GAEb0uE,CACX,CACA,WAAImoG,GACA,OAAyB,IAAlBp+K,KAAKmI,IAAIq+D,IACpB,CACAxnD,QACIhf,KAAKmI,IAAI6W,OACb,EAEJ,SAASk8J,GAAiBxtK,EAAMstK,EAAiBC,GAC7C,MAAM9hE,EAAgBzrG,EAAKyrG,cAC3B,GAAsB,OAAlBA,EACA,OAAOA,EACX,IAAIklE,EAAa,EACjB,OAAIpD,GAAe9hE,EAAgB8hE,EAAYv0K,SAC3C23K,EAAapD,EAAY9hE,IAEtBA,EAAgB6hE,EAAkBqD,CAC7C,CAEA,MAAMC,GACFv+K,cAAgB,CAChB65K,SAASv2K,GACL,OAAOA,aAAe6J,KAAOmoJ,GAAWhyJ,EAC5C,CACA6iG,SACI,OAAO,IAAIq4E,EACf,EAEJ,MAAMA,GACFx+K,cACIC,KAAKw+K,SAAW,IAAItxK,IACpBlN,KAAKy+K,SAAW,KAEhBz+K,KAAK0+K,aAAe,KACpB1+K,KAAK2+K,iBAAmB,KACxB3+K,KAAK4+K,aAAe,KACpB5+K,KAAK6+K,aAAe,KACpB7+K,KAAKq6K,eAAiB,KACtBr6K,KAAKs6K,eAAiB,KACtBt6K,KAAKy6K,cAAgB,KACrBz6K,KAAK06K,cAAgB,IACzB,CACA,WAAIgC,GACA,OAA+B,OAAxB18K,KAAKq6K,gBAAiD,OAAtBr6K,KAAK4+K,cACjB,OAAvB5+K,KAAKy6K,aACb,CACAI,YAAY50J,GACR,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKy+K,SAAqB,OAAXxoG,EAAiBA,EAASA,EAAOwxB,MAC1DxhF,EAAGgwD,EAEX,CACAslG,oBAAoBt1J,GAChB,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAK2+K,iBAA6B,OAAX1oG,EAAiBA,EAASA,EAAOulG,cAClEv1J,EAAGgwD,EAEX,CACA6oG,mBAAmB74J,GACf,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAK4+K,aAAyB,OAAX3oG,EAAiBA,EAASA,EAAO8oG,aAC9D94J,EAAGgwD,EAEX,CACAwlG,iBAAiBx1J,GACb,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKq6K,eAA2B,OAAXpkG,EAAiBA,EAASA,EAAOylG,WAChEz1J,EAAGgwD,EAEX,CACA4lG,mBAAmB51J,GACf,IAAIgwD,EACJ,IAAKA,EAASj2E,KAAKy6K,cAA0B,OAAXxkG,EAAiBA,EAASA,EAAOmlG,aAC/Dn1J,EAAGgwD,EAEX,CACA6iC,KAAK3wG,GACD,GAAKA,GACa,KAEPA,aAAe+E,KAAOmoJ,GAAWltJ,IACxC,MAAM,IAAI8gH,GAAa,KAAiDpF,QAHxE17G,EAAM,IAAI+E,IAMd,OAAOlN,KAAKg8K,MAAM7zK,GAAOnI,KAAO,IACpC,CACAq0H,YAAc,CAKd2nD,MAAM7zK,GACFnI,KAAKi8K,SACL,IAAIttC,EAAe3uI,KAAKy+K,SAcxB,GAbAz+K,KAAK0+K,aAAe,KACpB1+K,KAAKg/K,SAAS72K,EAAK,CAACkC,EAAO9C,KACvB,GAAIonI,GAAgBA,EAAapnI,MAAQA,EACrCvH,KAAKi/K,mBAAmBtwC,EAActkI,GACtCrK,KAAK0+K,aAAe/vC,EACpBA,EAAeA,EAAalnC,UAE3B,CACD,MAAMxxB,EAASj2E,KAAKk/K,yBAAyB33K,EAAK8C,GAClDskI,EAAe3uI,KAAKm/K,sBAAsBxwC,EAAc14D,EAC5D,IAGA04D,EAAc,CACVA,EAAaiuC,QACbjuC,EAAaiuC,MAAMn1E,MAAQ,MAE/BznG,KAAKy6K,cAAgB9rC,EACrB,QAAS14D,EAAS04D,EAAyB,OAAX14D,EAAiBA,EAASA,EAAOmlG,aACzDnlG,IAAWj2E,KAAKy+K,WAChBz+K,KAAKy+K,SAAW,MAEpBz+K,KAAKw+K,SAAS/2J,OAAOwuD,EAAO1uE,KAC5B0uE,EAAOmlG,aAAenlG,EAAOwxB,MAC7BxxB,EAAOvzB,cAAgBuzB,EAAOukD,aAC9BvkD,EAAOukD,aAAe,KACtBvkD,EAAO2mG,MAAQ,KACf3mG,EAAOwxB,MAAQ,IAEvB,CAEA,OAAIznG,KAAK6+K,eACL7+K,KAAK6+K,aAAaE,aAAe,MACjC/+K,KAAKs6K,iBACLt6K,KAAKs6K,eAAeoB,WAAa,MAC9B17K,KAAK08K,OAChB,CASAyC,sBAAsBtgJ,EAAQo3C,GAC1B,GAAIp3C,EAAQ,CACR,MAAM0b,EAAO1b,EAAO+9I,MACpB3mG,SAAOwxB,MAAQ5oE,EACfo3C,EAAO2mG,MAAQriI,EACf1b,EAAO+9I,MAAQ3mG,EACX17B,IACAA,EAAKktD,MAAQxxB,GAEbp3C,IAAW7+B,KAAKy+K,WAChBz+K,KAAKy+K,SAAWxoG,GAEpBj2E,KAAK0+K,aAAe7/I,EACbA,CACX,CACA,OAAI7+B,KAAK0+K,cACL1+K,KAAK0+K,aAAaj3E,MAAQxxB,EAC1BA,EAAO2mG,MAAQ58K,KAAK0+K,cAGpB1+K,KAAKy+K,SAAWxoG,EAEpBj2E,KAAK0+K,aAAezoG,EACb,IACX,CACAipG,yBAAyB33K,EAAK8C,GAC1B,GAAIrK,KAAKw+K,SAASl3J,IAAI/f,GAAM,CACxB,MAAM0uE,EAASj2E,KAAKw+K,SAASjxK,IAAIhG,GACjCvH,KAAKi/K,mBAAmBhpG,EAAQ5rE,GAChC,MAAMkwC,EAAO07B,EAAO2mG,MACdvoJ,EAAO4hD,EAAOwxB,MACpB,OAAIltD,IACAA,EAAKktD,MAAQpzE,GAEbA,IACAA,EAAKuoJ,MAAQriI,GAEjB07B,EAAOwxB,MAAQ,KACfxxB,EAAO2mG,MAAQ,KACR3mG,CACX,CACA,MAAMA,EAAS,IAAImpG,GAAsB73K,GACzC,OAAAvH,KAAKw+K,SAAS/wK,IAAIlG,EAAK0uE,GACvBA,EAAOukD,aAAenwH,EACtBrK,KAAKq/K,gBAAgBppG,GACdA,CACX,CAEAgmG,SACI,GAAIj8K,KAAK08K,QAAS,CACd,IAAIzmG,EAGJ,IADAj2E,KAAK2+K,iBAAmB3+K,KAAKy+K,SACxBxoG,EAASj2E,KAAK2+K,iBAA6B,OAAX1oG,EAAiBA,EAASA,EAAOwxB,MAClExxB,EAAOulG,cAAgBvlG,EAAOwxB,MAIlC,IAAKxxB,EAASj2E,KAAK4+K,aAAyB,OAAX3oG,EAAiBA,EAASA,EAAO8oG,aAC9D9oG,EAAOvzB,cAAgBuzB,EAAOukD,aAElC,IAAKvkD,EAASj2E,KAAKq6K,eAA0B,MAAVpkG,EAAgBA,EAASA,EAAOylG,WAC/DzlG,EAAOvzB,cAAgBuzB,EAAOukD,aAElCx6H,KAAK4+K,aAAe5+K,KAAK6+K,aAAe,KACxC7+K,KAAKq6K,eAAiBr6K,KAAKs6K,eAAiB,KAC5Ct6K,KAAKy6K,cAAgB,IACzB,CACJ,CAEAwE,mBAAmBhpG,EAAQ/Q,GAClB7gE,OAAOyvJ,GAAG5uF,EAAU+Q,EAAOukD,gBAC5BvkD,EAAOvzB,cAAgBuzB,EAAOukD,aAC9BvkD,EAAOukD,aAAet1D,EACtBllE,KAAKs/K,cAAcrpG,GAE3B,CACAopG,gBAAgBppG,GACgB,OAAxBj2E,KAAKq6K,eACLr6K,KAAKq6K,eAAiBr6K,KAAKs6K,eAAiBrkG,GAG5Cj2E,KAAKs6K,eAAeoB,WAAazlG,EACjCj2E,KAAKs6K,eAAiBrkG,EAE9B,CACAqpG,cAAcrpG,GACgB,OAAtBj2E,KAAK4+K,aACL5+K,KAAK4+K,aAAe5+K,KAAK6+K,aAAe5oG,GAGxCj2E,KAAK6+K,aAAaE,aAAe9oG,EACjCj2E,KAAK6+K,aAAe5oG,EAE5B,CAEA+oG,SAAS37K,EAAK4iB,GACN5iB,aAAe6J,IACf7J,EAAI+E,QAAQ6d,GAGZ5hB,OAAO8E,KAAK9F,GAAK+E,QAAQ+jB,GAAKlG,EAAG5iB,EAAI8oB,GAAIA,GAEjD,EAEJ,MAAMizJ,GACFr/K,YAAYwH,GACRvH,KAAKuH,IAAMA,EACXvH,KAAK0iD,cAAgB,KACrB1iD,KAAKw6H,aAAe,KAEpBx6H,KAAKw7K,cAAgB,KAErBx7K,KAAKynG,MAAQ,KAEbznG,KAAK48K,MAAQ,KAEb58K,KAAK07K,WAAa,KAElB17K,KAAKo7K,aAAe,KAEpBp7K,KAAK++K,aAAe,IACxB,EAGJ,SAASQ,KACL,OAAO,IAAIC,GAAgB,CAAC,IAAI7F,IACpC,CACA,IAKM6F,GAAe,MAArB,MAAMA,EACFr/K,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CAAE1nE,MAAOurI,EAAiBv8K,WAAY,OAAQF,QAASw8K,KAChGx/K,YAAYimK,GACRhmK,KAAKgmK,UAAYA,CACrB,CACA,aAAO9/D,CAAO8/D,EAAWnvF,GACrB,GAAc,MAAVA,EAAgB,CAChB,MAAM4oG,EAAS5oG,EAAOmvF,UAAUh8J,QAChCg8J,EAAYA,EAAU5qJ,OAAOqkK,EACjC,CACA,OAAO,IAAID,EAAgBxZ,EAC/B,CAqBA,aAAO0Z,CAAO1Z,GACV,MAAO,CACHloE,QAAS0hF,EACTlhF,WAAaznB,GAIF2oG,EAAgBt5E,OAAO8/D,EAAWnvF,GAAU0oG,MAGvDphF,KAAM,CAAC,CAACqhF,EAAiB,IAAI90D,GAAY,IAAIC,KAErD,CACAr6F,KAAKs8E,GACD,MAAM7pG,EAAU/C,KAAKgmK,UAAU11I,KAAK40I,GAAKA,EAAE0U,SAAShtE,IACpD,GAAe,MAAX7pG,EACA,OAAOA,EAGP,MAAM,IAAIkmH,GAAa,KAAyDpF,EAGxF,EACH,OAxDK27D,CAAe,KA6DrB,SAASG,KACL,OAAO,IAAIC,GAAgB,CAAC,IAAItB,IACpC,CACA,IAKMsB,GAAe,MAArB,MAAMA,EACFz/K,SACSH,KAAKg0C,WAAQ2nE,GAAmB,CAAE1nE,MAAO2rI,EAAiB38K,WAAY,OAAQF,QAAS48K,KAChG5/K,YAAYimK,GACRhmK,KAAKgmK,UAAYA,CACrB,CACA,aAAO9/D,CAAO8/D,EAAWnvF,GACrB,GAAIA,EAAQ,CACR,MAAM4oG,EAAS5oG,EAAOmvF,UAAUh8J,QAChCg8J,EAAYA,EAAU5qJ,OAAOqkK,EACjC,CACA,OAAO,IAAIG,EAAgB5Z,EAC/B,CAqBA,aAAO0Z,CAAO1Z,GACV,MAAO,CACHloE,QAAS8hF,EACTthF,WAAaznB,GAIF+oG,EAAgB15E,OAAO8/D,EAAWnvF,GAAU8oG,MAGvDxhF,KAAM,CAAC,CAACyhF,EAAiB,IAAIl1D,GAAY,IAAIC,KAErD,CACAr6F,KAAKuvJ,GACD,MAAM98K,EAAU/C,KAAKgmK,UAAU11I,KAAK40I,GAAKA,EAAE0U,SAASiG,IACpD,GAAI98K,EACA,OAAOA,EAEX,MAAM,IAAIkmH,GAAa,KAAyDpF,EACpF,EACH,OArDK+7D,CAAe,KA0DrB,MAmBME,GAAe1K,GAAsB,KAAM,OAAQ,IAEzD,IAOM2K,GAAiB,MAAvB,MAAMA,EAEFhgL,YAAY4wJ,GAAU,CAACxwJ,SACdH,KAAKgD,UAAO,SAAmC5C,GAAK,OAAO,IAAKA,GAAK2/K,GAAmBjqE,GAASkiE,IAAkB,EAAC73K,SACpHH,KAAKo7G,UAAqBkY,GAAiB,CAAElnH,KAAM2zK,IAAoB5/K,SACvEH,KAAKq7G,UAAqBqO,GAAiB,CAAC,GACxD,OANKq2D,CAAiB,KAwsBvB,SAASC,GAAiB31K,GACtB,MAAwB,kBAAVA,EAAsBA,EAAkB,MAATA,GAA2B,UAAVA,CAClE,CAkOA,SAAS41K,GAAqB1vJ,GAC1B,MAAMiiG,EAAeW,GAAgB5iG,GACrC,IAAKiiG,EACD,OAAO,KACX,MAAMzvH,EAAU,IAAIguJ,GAAiBv+B,GACrC,MAAO,CACH,YAAIvqE,GACA,OAAOllD,EAAQklD,QACnB,EACA,QAAI77C,GACA,OAAOrJ,EAAQwuJ,aACnB,EACA,UAAI/wJ,GACA,OAAOuC,EAAQvC,MACnB,EACA,WAAIqyH,GACA,OAAO9vH,EAAQ8vH,OACnB,EACA,sBAAIpyH,GACA,OAAOsC,EAAQtC,kBACnB,EACA,gBAAI8zH,GACA,OAAO/B,EAAa3a,UACxB,EACA,YAAIqoE,GACA,OAAO1tD,EAAaP,OACxB,EAER,iGE7g+BA,MAAMkuD,UAAiCC,KACnCrgL,cACIu2B,SAAS2I,WACTj/B,KAAKqgL,mBAAoB,CAC7B,EAUJ,MAAMC,WAA0BH,EAC5B,kBAAOI,IACHC,QAAmB,IAAIF,GAC3B,CACAG,YAAYp5K,EAAIojB,EAAKsW,GACjB15B,SAAGq4B,iBAAiBjV,EAAKsW,GAClB,KACH15B,EAAGyqC,oBAAoBrnB,EAAKsW,EAAQ,CAE5C,CACA2/I,cAAcr5K,EAAIojB,GACdpjB,EAAGq5K,cAAcj2J,EACrB,CACAyjB,OAAOme,GACCA,EAAKnlD,YACLmlD,EAAKnlD,WAAW88B,YAAYqoB,EAEpC,CACA3oB,cAAch8B,EAAS+7B,GACnBA,SAAMA,GAAOzjC,KAAK2gL,sBACPj9I,cAAch8B,EAC7B,CACAk5K,qBACI,OAAO94J,SAAS88C,eAAeC,mBAAmB,YACtD,CACA87G,qBACI,OAAO74J,QACX,CACA+4J,cAAcx0H,GACV,OAAOA,EAAKuD,WAAakO,KAAKjO,YAClC,CACAnG,aAAa2C,GACT,OAAOA,aAAgBy0H,gBAC3B,CAEA7tE,qBAAqBxvE,EAAKp3B,GACtB,MAAe,WAAXA,EACO3I,OAEI,aAAX2I,EACOo3B,EAEI,SAAXp3B,EACOo3B,EAAIN,KAER,IACX,CACA4vE,YAAYtvE,GACR,MAAMtQ,EAcd,SAAS4tJ,IACLC,UAAcA,IAAel5J,SAASogC,cAAc,QAC7C84H,GAAcA,GAAY94K,aAAa,QAAU,IAC5D,CAjBqB64K,GACb,OAAe,MAAR5tJ,EAAe,KAmB9B,SAAS8tJ,GAAa93J,IAClB+3J,GAAiBA,IAAkBp5J,SAAS4b,cAAc,KAC1Dw9I,GAAelrI,aAAa,OAAQ7sB,IACpC,MAAMg4J,EAAWD,GAAev5H,SAChC,MAA8B,MAAvBw5H,EAAS5xH,OAAO,GAAa4xH,EAAY,IAAGA,GACvD,CAxBqCF,CAAa9tJ,EAC9C,CACAiuJ,mBACIJ,GAAc,IAClB,CACAK,eACI,OAAO39K,OAAO0f,UAAUrO,SAC5B,CACAusK,UAAUv9K,GACN,SAAO8hH,MAAkB/9F,SAASmuF,OAAQlyG,EAC9C,EAEJ,IAMIm9K,GANAF,GAAc,KAmEZO,GAAU,MAAhB,MAAMA,GACFx9D,QACI,OAAO,IAAIhiF,cACf,CAAC5hC,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFmhL,GAAU,EAAoDphL,SAChKH,KAAKg0C,WADmF/yC,MAAE,CAAAgzC,MACYstI,GAAUx+K,QAAVw+K,GAAUv+K,YAC5H,OANKu+K,EAAU,KAgBhB,MAAMC,GAAwB,IAAIpvE,MAAe,uBACjD,IAMMqvE,GAAY,MAAlB,MAAMA,GAIF1hL,YAAY0xE,EAASiwG,GACjB1hL,KAAK0hL,MAAQA,EACb1hL,KAAK2hL,mBAAqB,IAAIz0K,IAC9BukE,EAAQrpE,QAASopE,KACbA,GAAOgD,QAAUx0E,IAAA,GAErBA,KAAK4hL,SAAWnwG,EAAQznE,QAAQ7C,SACpC,CAUAu4B,iBAAiB+F,EAASkG,EAAW34B,IAEjC,OADehT,KAAK6hL,eAAel2I,GACrBjM,iBAAiB+F,EAASkG,EAAW34B,GACvD,CAIA8uK,UACI,OAAO9hL,KAAK0hL,KAChB,CAEAG,eAAel2I,GACX,IAAI6lC,EAASxxE,KAAK2hL,mBAAmBp0K,IAAIo+B,GACzC,GAAI6lC,EACA,OAAOA,EAIX,GADAA,EADgBxxE,KAAK4hL,SACJtxJ,KAAMkhD,IAAWA,GAAOooG,SAASjuI,KAC7C6lC,EACD,MAAM,IAAIoyC,MAAc,MAAsFC,GAGlH,OAAA7jH,KAAK2hL,mBAAmBl0K,IAAIk+B,EAAW6lC,GAChCA,CACX,CAACrxE,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFqhL,IAjEVxgL,MAiEwCugL,IAjExCvgL,MAiE0EA,OAAS,EAA6Cd,SACxNH,KAAKg0C,WAlEmF/yC,MAAE,CAAAgzC,MAkEYwtI,GAAY1+K,QAAZ0+K,GAAYz+K,YAC9H,OAhDKy+K,EAAY,KAuDlB,MAAMM,GACFhiL,YAAY4yG,GACR3yG,KAAK2yG,KAAOA,CAChB,EAIJ,MAAMqvE,GAAwB,YAAY,IACpCC,GAAgB,MAAtB,MAAMA,GACFliL,YAAY0jC,EAAKy+I,EAAOC,GAAO1mE,GAAa,CAAC,GACzCz7G,KAAKyjC,IAAMA,EACXzjC,KAAKkiL,MAAQA,EACbliL,KAAKmiL,MAAQA,GACbniL,KAAKy7G,WAAaA,GAElBz7G,KAAKoiL,SAAW,IAAIl1K,IACpBlN,KAAKqiL,UAAY,IAAIjgH,IACrBpiE,KAAKsiL,gBAAkBtiL,KAAKuiL,8BAC5BviL,KAAKwiL,oBAAmBhnE,MAAiBC,IACzCz7G,KAAKyiL,gBACT,CACAC,UAAU3uG,GACN,UAAW3P,KAAS2P,EAEG,IADA/zE,KAAK2iL,iBAAiBv+G,EAAO,IAE5CpkE,KAAK4iL,aAAax+G,EAG9B,CACAy+G,aAAa9uG,GACT,UAAW3P,KAAS2P,EACG/zE,KAAK2iL,iBAAiBv+G,GAAO,IAC9B,GACdpkE,KAAK8iL,eAAe1+G,EAGhC,CACA5tB,cACI,MAAM8rI,EAAkBtiL,KAAKsiL,gBACzBA,IACAA,EAAgBl6K,QAASikD,GAASA,EAAKne,UACvCo0I,EAAgBtjK,SAEpB,UAAWolD,KAASpkE,KAAK+iL,eACrB/iL,KAAK8iL,eAAe1+G,GAExBpkE,KAAKyiL,gBACT,CACAO,QAAQC,GACJjjL,KAAKqiL,UAAU96J,IAAI07J,GACnB,UAAW7+G,KAASpkE,KAAK+iL,eACrB/iL,KAAKkjL,eAAeD,EAAU7+G,EAEtC,CACA++G,WAAWF,GACPjjL,KAAKqiL,UAAU56J,OAAOw7J,EAC1B,CACAF,eACI,OAAO/iL,KAAKoiL,SAASj5K,MACzB,CACAy5K,aAAax+G,GACT,UAAW50C,KAAQxvB,KAAKqiL,UACpBriL,KAAKkjL,eAAe1zJ,EAAM40C,EAElC,CACA0+G,eAAe1+G,GACX,MAAMg+G,EAAWpiL,KAAKoiL,SACtBA,EAAS70K,IAAI62D,IAAQg/G,UAAUh7K,QAASikD,IAASA,GAAKne,UACtDk0I,EAAS36J,OAAO28C,EACpB,CACAm+G,8BACI,MAAMxuG,EAAS/zE,KAAKyjC,IAAII,MAAMolC,iBAAkB,SAAQ+4G,OAA0BhiL,KAAKkiL,WACvF,GAAInuG,GAAQrtE,OAAQ,CAChB,MAAM28K,EAAW,IAAIn2K,IACrB6mE,SAAO3rE,QAASg8D,KACa,MAArBA,GAAM1Q,aACN2vH,EAAS51K,IAAI22D,GAAM1Q,YAAa0Q,GAAK,GAGtCi/G,CACX,CACA,OAAO,IACX,CACAV,iBAAiBv+G,EAAO3lB,GACpB,MAAMt2C,GAAMnI,KAAKoiL,SACjB,GAAIj6K,GAAImf,IAAI88C,GAAQ,CAChB,MAAMk/G,GAAgBn7K,GAAIoF,IAAI62D,GAC9Bk/G,UAAcC,OAAS9kI,EAChB6kI,GAAcC,KACzB,CACAp7K,UAAIsF,IAAI22D,EAAO,CAAEm/G,MAAO9kI,EAAO2kI,SAAU,KAClC3kI,CACX,CACA+kI,gBAAgBh0J,EAAM40C,GAClB,MAAMk+G,GAAkBtiL,KAAKsiL,gBACvBmB,GAAUnB,IAAiB/0K,IAAI62D,GACrC,GAAIq/G,IAASv8K,aAAesoB,EAExB8yJ,UAAgB76J,OAAO28C,GACvBq/G,GAAQnuH,gBAAgB0sH,IAKjByB,GAEN,CACD,MAAMA,GAAUzjL,KAAKyjC,IAAIC,cAAc,SACvC,OAAI1jC,KAAKmiL,OACLsB,GAAQztI,aAAa,QAASh2C,KAAKmiL,OAEvCsB,GAAQ/vH,YAAc0Q,EAClBpkE,KAAKwiL,kBACLiB,GAAQztI,aAAagsI,GAAuBhiL,KAAKkiL,OAE9CuB,EACX,CACJ,CACAP,eAAe1zJ,EAAM40C,GACjB,MAAMq/G,GAAUzjL,KAAKwjL,gBAAgBh0J,EAAM40C,GAC3C50C,EAAKsU,YAAY2/I,IACjB,MAAMrB,GAAWpiL,KAAKoiL,SAChBsB,GAAatB,GAAS70K,IAAI62D,IAAQg/G,SACpCM,GACAA,GAAWz8K,KAAKw8K,IAGhBrB,GAAS30K,IAAI22D,EAAO,CAAEg/G,SAAU,CAACK,IAAUF,MAAO,GAE1D,CACAd,iBACI,MAAMJ,EAAYriL,KAAKqiL,UACvBA,EAAUrjK,QAEVqjK,EAAU96J,IAAIvnB,KAAKyjC,IAAII,KAC3B,CAAC1jC,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF6hL,IAlNVhhL,MAkN4CkxG,MAlN5ClxG,MAkNiEs7I,OAlNjEt7I,MAkNoFy7I,MAAS,GAlN7Fz7I,MAkN0H6kH,OAAW,EAA6C3lH,SAC1QH,KAAKg0C,WAnNmF/yC,MAAE,CAAAgzC,MAmNYguI,GAAgBl/K,QAAhBk/K,GAAgBj/K,YAClI,OAlIKi/K,EAAgB,KAqJtB,MAAM0B,GAAiB,CACnBC,IAAO,6BACPC,MAAS,+BACTC,MAAS,+BACTC,IAAO,uCACPC,MAAS,gCACTC,KAAQ,kCAENC,GAAkB,UAelBC,GAAqC,IAAI/xE,MAAe,4BAA6B,CACvFnvG,WAAY,OACZF,QAASA,KAVsC,IAkBnD,SAASqhL,GAAkBC,GAAQtwG,GAC/B,OAAOA,EAAO5rE,IAAI6hD,GAAKA,EAAE/7C,QAAQi2K,GAAiBG,IACtD,CAAC,IACKC,GAAmB,MAAzB,MAAMA,GACFvkL,YAAYwkL,EAAcC,EAAkBtC,GAAOuC,GAA2BhhJ,GAAKg4E,GAAY66D,GAAQ6L,GAAQ,MAC3GniL,KAAKukL,aAAeA,EACpBvkL,KAAKwkL,iBAAmBA,EACxBxkL,KAAKkiL,MAAQA,GACbliL,KAAKykL,0BAA4BA,GACjCzkL,KAAKyjC,IAAMA,GACXzjC,KAAKy7G,WAAaA,GAClBz7G,KAAKs2K,OAASA,GACdt2K,KAAKmiL,MAAQA,GACbniL,KAAK0kL,iBAAmB,IAAIx3K,IAC5BlN,KAAKwiL,oBAAmBhnE,MAAiBC,IACzCz7G,KAAK2kL,gBACD,IAAIC,GAAoBL,EAAc9gJ,GAAK6yI,GAAQt2K,KAAKwiL,iBAChE,CACAz7B,eAAethH,EAASr5B,GACpB,IAAKq5B,IAAYr5B,EACb,OAAOpM,KAAK2kL,gBAEZ3kL,KAAKwiL,kBAAoBp2K,EAAK8lH,gBAAkBpF,MAAkBG,YAElE7gH,EAAO,IAAKA,EAAM8lH,cAAepF,MAAkBC,WAEvD,MAAMoB,GAAWnuH,KAAK6kL,oBAAoBp/I,EAASr5B,GAGnD,OAAI+hH,cAAoB22D,GACpB32D,GAAS42D,YAAYt/I,GAEhB0oF,cAAoB62D,IACzB72D,GAAS82D,cAEN92D,EACX,CACA02D,oBAAoBp/I,EAASr5B,GACzB,MAAMs4K,GAAmB1kL,KAAK0kL,iBAC9B,IAAIv2D,GAAWu2D,GAAiBn3K,IAAInB,EAAK9D,IACzC,IAAK6lH,GAAU,CACX,MAAM1qF,GAAMzjC,KAAKyjC,IACX6yI,GAASt2K,KAAKs2K,OACdiO,GAAevkL,KAAKukL,aACpBC,GAAmBxkL,KAAKwkL,iBACxBC,GAA4BzkL,KAAKykL,0BACjCjC,GAAmBxiL,KAAKwiL,iBAC9B,OAAQp2K,EAAK8lH,eACT,KAAKpF,MAAkBC,SACnBoB,GAAW,IAAI22D,GAAkCP,GAAcC,GAAkBp4K,EAAMpM,KAAKkiL,MAAOuC,GAA2BhhJ,GAAK6yI,GAAQkM,IAC3I,MACJ,KAAK11D,MAAkBG,UACnB,OAAO,IAAIi4D,GAAkBX,GAAcC,GAAkB/+I,EAASr5B,EAAMq3B,GAAK6yI,GAAQt2K,KAAKmiL,MAAOK,IACzG,QACIr0D,GAAW,IAAI62D,GAA6BT,GAAcC,GAAkBp4K,EAAMq4K,GAA2BhhJ,GAAK6yI,GAAQkM,IAGlIkC,GAAiBj3K,IAAIrB,EAAK9D,GAAI6lH,GAClC,CACA,OAAOA,EACX,CACA33E,cACIx2C,KAAK0kL,iBAAiB1lK,OAC1B,CAAC7e,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFkkL,IAxUVrjL,MAwU+CwgL,IAxU/CxgL,MAwUwEghL,IAxUxEhhL,MAwUqGs7I,OAxUrGt7I,MAwUwHkjL,IAxUxHljL,MAwUuKkxG,MAxUvKlxG,MAwU4L6kH,OAxU5L7kH,MAwUoNA,OAxUpNA,MAwU0Oy7I,OAAS,EAA6Cv8I,SACxXH,KAAKg0C,WAzUmF/yC,MAAE,CAAAgzC,MAyUYqwI,GAAmBvhL,QAAnBuhL,GAAmBthL,YACrI,OA/DKshL,EAAmB,KAkFzB,MAAMM,GACF7kL,YAAYwkL,EAAc9gJ,EAAK6yI,EAAQkM,IACnCxiL,KAAKukL,aAAeA,EACpBvkL,KAAKyjC,IAAMA,EACXzjC,KAAKs2K,OAASA,EACdt2K,KAAKwiL,iBAAmBA,GACxBxiL,KAAKqP,KAAOhL,OAAO6hG,OAAO,MAC1BlmG,KAAKmsI,YAAc,IACvB,CACAv2D,UAAY,CACZlyC,cAAc3/B,EAAM6oI,GAChB,OAAIA,EAUO5sI,KAAKyjC,IAAI0hJ,gBAAgBxB,GAAe/2C,IAAcA,EAAW7oI,GAErE/D,KAAKyjC,IAAIC,cAAc3/B,EAClC,CACA0oI,cAAcpiI,GACV,OAAOrK,KAAKyjC,IAAIgpG,cAAcpiI,EAClC,CACAs3J,WAAWt3J,GACP,OAAOrK,KAAKyjC,IAAIi+H,eAAer3J,EACnC,CACAy5B,YAAY+yC,EAAQuuG,IACKC,GAAexuG,GAAUA,EAAOw/D,QAAUx/D,GAClD/yC,YAAYshJ,EAC7B,CACAz2C,aAAa93D,EAAQuuG,EAAUE,GACvBzuG,IACqBwuG,GAAexuG,GAAUA,EAAOw/D,QAAUx/D,GAClD83D,aAAay2C,EAAUE,EAE5C,CACAthJ,YAAY6yC,EAAQ0uG,GACZ1uG,GACAA,EAAO7yC,YAAYuhJ,EAE3B,CACAlzB,kBAAkBmzB,EAAgBpzB,GAC9B,IAAI/qJ,EAA+B,iBAAnBm+K,EAA8BxlL,KAAKyjC,IAAIykB,cAAcs9H,GACjEA,EACJ,IAAKn+K,EACD,MAAM,IAAIu8G,OAAc,MAAuFC,GAGnH,OAAKuuC,IACD/qJ,EAAGqsD,YAAc,IAEdrsD,CACX,CACAH,WAAWmlD,GACP,OAAOA,EAAKnlD,UAChB,CACA8vD,YAAY3K,GACR,OAAOA,EAAK2K,WAChB,CACAhhB,aAAa3uC,EAAItD,EAAMsG,EAAOuiI,IAC1B,GAAIA,GAAW,CACX7oI,EAAO6oI,GAAY,IAAM7oI,EACzB,MAAM0hL,GAAe9B,GAAe/2C,IAChC64C,GACAp+K,EAAGq+K,eAAeD,GAAc1hL,EAAMsG,GAGtChD,EAAG2uC,aAAajyC,EAAMsG,EAE9B,MAEIhD,EAAG2uC,aAAajyC,EAAMsG,EAE9B,CACAirD,gBAAgBjuD,EAAItD,EAAM6oI,GACtB,GAAIA,EAAW,CACX,MAAM64C,GAAe9B,GAAe/2C,GAChC64C,GACAp+K,EAAGs+K,kBAAkBF,GAAc1hL,GAGnCsD,EAAGiuD,gBAAiB,GAAEs3E,KAAa7oI,IAE3C,MAEIsD,EAAGiuD,gBAAgBvxD,EAE3B,CACA0zG,SAASpwG,EAAItD,GACTsD,EAAG8oD,UAAU5oC,IAAIxjB,EACrB,CACA4zG,YAAYtwG,EAAItD,GACZsD,EAAG8oD,UAAUjiB,OAAOnqC,EACxB,CACAk9J,SAAS55J,EAAI+8D,EAAO/5D,EAAO4gH,IACnBA,IAASif,MAAoBE,SAAWF,MAAoBC,WAC5D9iI,EAAG+8D,MAAM2K,YAAY3K,EAAO/5D,EAAO4gH,GAAQif,MAAoBC,UAAY,YAAc,IAGzF9iI,EAAG+8D,MAAMA,GAAS/5D,CAE1B,CACA22J,YAAY35J,EAAI+8D,EAAO6mD,GACfA,EAAQif,MAAoBE,SAE5B/iI,EAAG+8D,MAAM+K,eAAe/K,GAGxB/8D,EAAG+8D,MAAMA,GAAS,EAE1B,CACA2K,YAAY1nE,EAAItD,EAAMsG,GAElBhD,EAAGtD,GAAQsG,CACf,CACAwiJ,SAASxgG,EAAMhiD,GACXgiD,EAAK0oF,UAAY1qI,CACrB,CACAsvJ,OAAOttJ,EAAQkC,EAAOxF,GAElB,GAAsB,iBAAXsD,KACPA,KAASu5K,OAAU3yE,qBAAqBjzG,KAAKyjC,IAAKp3B,IAE9C,MAAM,IAAIzH,MAAO,4BAA2ByH,eAAoBkC,KAGxE,OAAOvO,KAAKukL,aAAa7kJ,iBAAiBrzB,EAAQkC,EAAOvO,KAAK6lL,uBAAuB98K,GACzF,CACA88K,uBAAuBj9G,GAKnB,OAAQr6D,IAMJ,GAAc,iBAAVA,EACA,OAAOq6D,GAOkB,KAHA5oE,KAAKwiL,iBAC9BxiL,KAAKs2K,OAAO5zB,WAAW,IAAM95E,EAAar6D,IAC1Cq6D,EAAar6D,KAEbA,EAAM0rJ,gBAAe,CAIjC,EAUJ,SAASorB,GAAeh5H,IACpB,MAAwB,aAAjBA,GAAK3kD,cAA2CnE,IAAjB8oD,GAAKgqF,OAC/C,CACA,MAAM6uC,WAA0BN,GAC5B7kL,YAAYwkL,EAAcC,EAAkBsB,EAAQv1J,GAAWkT,GAAK6yI,GAAQ6L,GAAOK,IAC/ElsJ,MAAMiuJ,EAAc9gJ,GAAK6yI,GAAQkM,IACjCxiL,KAAKwkL,iBAAmBA,EACxBxkL,KAAK8lL,OAASA,EACd9lL,KAAK6pD,WAAai8H,EAAOrpE,aAAa,CAAEoT,KAAM,SAC9C7vH,KAAKwkL,iBAAiBxB,QAAQhjL,KAAK6pD,YACnC,MAAMkqB,GAASqwG,GAAkB7zJ,GAAUjoB,GAAIioB,GAAUwjD,QACzD,UAAW3P,MAAS2P,GAAQ,CACxB,MAAM0vG,GAAU37J,SAAS4b,cAAc,SACnCy+I,IACAsB,GAAQztI,aAAa,QAASmsI,IAElCsB,GAAQ/vH,YAAc0Q,GACtBpkE,KAAK6pD,WAAW/lB,YAAY2/I,GAChC,CACJ,CACAsC,iBAAiB15H,GACb,OAAOA,IAASrsD,KAAK8lL,OAAS9lL,KAAK6pD,WAAawC,CACpD,CACAvoB,YAAY+yC,EAAQuuG,GAChB,OAAO9uJ,MAAMwN,YAAY9jC,KAAK+lL,iBAAiBlvG,GAASuuG,EAC5D,CACAz2C,aAAa93D,EAAQuuG,EAAUE,GAC3B,OAAOhvJ,MAAMq4G,aAAa3uI,KAAK+lL,iBAAiBlvG,GAASuuG,EAAUE,EACvE,CACAthJ,YAAY6yC,EAAQ0uG,GAChB,OAAOjvJ,MAAM0N,YAAYhkC,KAAK+lL,iBAAiBlvG,GAAS0uG,EAC5D,CACAr+K,WAAWmlD,GACP,OAAOrsD,KAAK+lL,iBAAiBzvJ,MAAMpvB,WAAWlH,KAAK+lL,iBAAiB15H,IACxE,CACAupB,UACI51E,KAAKwkL,iBAAiBrB,WAAWnjL,KAAK6pD,WAC1C,EAEJ,MAAMm7H,WAAqCJ,GACvC7kL,YAAYwkL,EAAcC,EAAkBj0J,EAAWk0J,GAA2BhhJ,GAAK6yI,GAAQkM,GAAkB6B,IAC7G/tJ,MAAMiuJ,EAAc9gJ,GAAK6yI,GAAQkM,IACjCxiL,KAAKwkL,iBAAmBA,EACxBxkL,KAAKykL,0BAA4BA,GACjCzkL,KAAK+zE,OAASswG,GAASD,GAAkBC,GAAQ9zJ,EAAUwjD,QAAUxjD,EAAUwjD,MACnF,CACAkxG,cACIjlL,KAAKwkL,iBAAiB9B,UAAU1iL,KAAK+zE,OACzC,CACA6B,UACS51E,KAAKykL,2BAGVzkL,KAAKwkL,iBAAiB3B,aAAa7iL,KAAK+zE,OAC5C,EAEJ,MAAM+wG,WAA0CE,GAC5CjlL,YAAYwkL,EAAcC,EAAkBj0J,EAAW2xJ,GAAOuC,GAA2BhhJ,GAAK6yI,GAAQkM,IAClG,MAAM6B,GAASnC,GAAQ,IAAM3xJ,EAAUjoB,GACvCguB,MAAMiuJ,EAAcC,EAAkBj0J,EAAWk0J,GAA2BhhJ,GAAK6yI,GAAQkM,GAAkB6B,IAC3GrkL,KAAKgmL,YA9Tb,SAASC,GAAqBC,IAC1B,MAjBkB,oBAiBEj4K,QAAQi2K,GAAiBgC,GACjD,CA4T2BD,CAAqB5B,IACxCrkL,KAAKmmL,SA5Tb,SAASC,GAAkBF,IACvB,MArBe,iBAqBEj4K,QAAQi2K,GAAiBgC,GAC9C,CA0TwBE,CAAkB/B,GACtC,CACAU,YAAYt/I,GACRzlC,KAAKilL,cACLjlL,KAAKg2C,aAAavQ,EAASzlC,KAAKmmL,SAAU,GAC9C,CACAziJ,cAAcmzC,EAAQ9yE,GAClB,MAAMsD,EAAKivB,MAAMoN,cAAcmzC,EAAQ9yE,GACvC,OAAAuyB,MAAM0f,aAAa3uC,EAAIrH,KAAKgmL,YAAa,IAClC3+K,CACX,EACH,IAEKg/K,GAAe,MAArB,MAAMA,WAAwBtE,GAC1BhiL,YAAY0jC,GACRnN,MAAMmN,EACV,CAGAm2I,SAASjuI,GACL,OAAO,CACX,CACAjM,iBAAiB+F,EAASkG,EAAW34B,IACjCyyB,SAAQ/F,iBAAiBiM,EAAW34B,IAAS,GACtC,IAAMhT,KAAK8xC,oBAAoBrM,EAASkG,EAAW34B,GAC9D,CACA8+B,oBAAoBzlC,EAAQs/B,EAAW5iC,IACnC,OAAOsD,EAAOylC,oBAAoBnG,EAAW5iC,GACjD,CAAC5I,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFimL,IA9lBVplL,MA8lB2CkxG,MAAQ,EAA6ChyG,SACxLH,KAAKg0C,WA/lBmF/yC,MAAE,CAAAgzC,MA+lBYoyI,GAAetjL,QAAfsjL,GAAerjL,YACjI,OAlBKqjL,EAAe,KA6BrB,MAAMC,GAAgB,CAAC,MAAO,UAAW,OAAQ,SAG3CC,GAAU,CACZ,KAAM,YACN,KAAM,MACN,OAAQ,SACR,OAAQ,SACRC,IAAO,SACPC,IAAO,SACPC,KAAQ,YACRC,MAAS,aACTC,GAAM,UACNC,KAAQ,YACRC,KAAQ,cACR3nH,OAAU,aACV4nH,IAAO,MAKLC,EAAuB,CACzBC,IAAQ14K,IAAUA,GAAMo+E,OACxBu6F,QAAY34K,IAAUA,GAAMs+E,QAC5BvgC,KAAS/9C,IAAUA,GAAMq+E,QACzB/oB,MAAUt1D,IAAUA,GAAMu+E,UAE9B,IAIMq6F,EAAe,MAArB,MAAMA,WAAwBpF,GAK1BhiL,YAAY0jC,GACRnN,MAAMmN,EACV,CAMAm2I,SAASjuI,GACL,OAAoD,MAA7Cw7I,GAAgBC,eAAez7I,EAC1C,CASAjM,iBAAiB+F,EAASkG,EAAW34B,IACjC,MAAMq0K,GAAcF,GAAgBC,eAAez7I,GAC7C27I,GAAiBH,GAAgBI,cAAcF,GAAYG,QAAYx0K,GAAShT,KAAKw0E,QAAQstG,WACnG,OAAO9hL,KAAKw0E,QAAQstG,UAAUtvI,kBAAkB,OACrCozI,OAAUnF,YAAYh7I,EAAS4hJ,GAAYI,aAAiBH,IAE3E,CAUA,qBAAOF,CAAez7I,GAClB,MAAMxX,EAAQwX,EAAU7jC,cAAcS,MAAM,KACtCk/K,GAAetzJ,EAAM0vC,QAC3B,GAAsB,IAAjB1vC,EAAMztB,QAAoC,YAAjB+gL,IAA+C,UAAjBA,GACxD,OAAO,KAEX,MAAMlgL,GAAM4/K,GAAgBO,cAAcvzJ,EAAMtS,OAChD,IAAI2lK,GAAU,GACVG,GAASxzJ,EAAMzH,QAAQ,QAa3B,GAZIi7J,IAAS,IACTxzJ,EAAMzM,OAAOigK,GAAQ,GACrBH,GAAU,SAEdlB,GAAcl+K,QAAQw/K,KAClB,MAAMt0K,GAAQ6gB,EAAMzH,QAAQk7J,IACxBt0K,IAAQ,IACR6gB,EAAMzM,OAAOpU,GAAO,GACpBk0K,IAAWI,GAAe,OAGlCJ,IAAWjgL,GACS,GAAhB4sB,EAAMztB,QAA8B,IAAfa,GAAIb,OAEzB,OAAO,KAKX,MAAM2L,GAAS,CAAC,EAChBA,UAAOo1K,aAAkBA,GACzBp1K,GAAOm1K,QAAaA,GACbn1K,EACX,CAWA,4BAAOw1K,CAAsBt5K,EAAOu5K,GAChC,IAAIC,GAAUxB,GAAQh4K,EAAMhH,MAAQgH,EAAMhH,IACtCA,GAAM,GAMV,OALIugL,EAAYp7J,QAAQ,UAAW,IAC/Bq7J,GAAUx5K,EAAMovB,KAChBp2B,GAAM,WAGK,MAAXwgL,KAAoBA,MAExBA,GAAUA,GAAQjgL,cACF,MAAZigL,GACAA,GAAU,QAEO,MAAZA,KACLA,GAAU,OAEdzB,GAAcl+K,QAAQw/K,KACdA,KAAiBG,KAEbC,EADmBhB,EAAqBY,KACzBr5K,KACfhH,IAAOqgL,GAAe,IAE9B,GAEJrgL,IAAOwgL,GACAxgL,KAAQugL,EACnB,CAQA,oBAAOP,CAAcC,EAASx0K,EAASwtI,IACnC,OAAQjyI,KACA44K,GAAgBU,sBAAsBt5K,GAAOi5K,IAC7ChnC,GAAKkC,WAAW,IAAM1vI,EAAQzE,IAAM,CAGhD,CAEA,oBAAOm5K,CAAcO,GAEjB,MACS,QADDA,EAEO,SAEAA,CAEnB,CAAC9nL,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF+mL,IAjxBVlmL,MAixB2CkxG,MAAQ,EAA6ChyG,SACxLH,KAAKg0C,WAlxBmF/yC,MAAE,CAAAgzC,MAkxBYkzI,GAAepkL,QAAfokL,GAAenkL,YACjI,OAzIKmkL,EAAe,KAmQrB,MAWMe,IAAkB9S,SAAsB0K,MAAc,UAXhB,CACxC,CAAEhiF,QAASgoB,MAAa5nB,SAAUiqF,MAClC,CAAErqF,QAAS2+C,MAAsBv+C,SAbrC,SAASkqF,KACL9H,GAAkBC,aACtB,EAW+DtiF,OAAO,GAClE,CAAEH,QAASqU,KAAU7T,WARzB,SAAS+pF,KAELC,gBAAaxgK,UACNA,QACX,EAIgDq2E,KAAM,MAehDoqF,GAAkC,IAAIn2E,MAAoG,IAC1Io2E,GAAwB,CAC1B,CACI1qF,QAAS2qF,MACTzqF,SA59BR,MAAM0qF,GACFxV,YAAYpvJ,GACR6kK,MAAQC,sBAA2B,CAAC3iL,EAAM6uK,IAAkB,KACxD,MAAMN,GAAc1wJ,EAAS+wJ,sBAAsB5uK,EAAM6uK,IACzD,GAAmB,MAAfN,GACA,MAAM,IAAI5wD,MAAc,MAAwFC,GAGpH,OAAO2wD,IAEXmU,MAAQE,2BAAgC,IAAM/kK,EAAS6wJ,sBACvDgU,MAAQG,0BAA+B,IAAMhlK,EAAS8wJ,qBAgBjD+T,MAAQI,uBACTJ,MAAQI,qBAA0B,IAEtCJ,MAAQI,qBAAwB9hL,KAlBT8B,IACnB,MAAMigL,GAAgBL,MAAQE,6BAC9B,IAAIl4G,GAAQq4G,GAActiL,OACtBuiL,IAAU,EACd,MAAMC,GAAY,SAAUC,IACxBF,GAAUA,IAAWE,GACrBx4G,KACa,GAATA,IACA5nE,EAASkgL,GAEjB,EACAD,GAAc5gL,QAASosK,KACnBA,GAAYT,WAAWmV,GAAS,EACnC,EAMT,CACArU,sBAAsB/wJ,EAAU7d,EAAM6uK,GAClC,OAAY,MAAR7uK,EACO,KAED6d,EAAS4wJ,eAAezuK,KAIxB6uK,KAGN8Q,OAAUl8H,aAAazjD,GAChBjG,KAAK60K,sBAAsB/wJ,EAAU7d,EAAKupB,MAAM,GAEpDxvB,KAAK60K,sBAAsB/wJ,EAAU7d,EAAKyqD,eAAe,GALrD,KAMf,GA86BIytC,KAAM,IAEV,CACIL,QAASsrF,MACTprF,SAAUw0E,MACVr0E,KAAM,CAAC6gD,MAAQs1B,MAAqBmU,QAExC,CACI3qF,QAAS00E,MACTx0E,SAAUw0E,MACVr0E,KAAM,CAAC6gD,MAAQs1B,MAAqBmU,SAGtCY,GAA2B,CAC7B,CAAEvrF,QAASwrF,MAAiBprF,SAAU,QACtC,CAAEJ,QAASJ,MAAcY,WA9C7B,SAAS53B,KACL,OAAO,IAAIg3B,KACf,EA4CuDS,KAAM,IAAM,CAC3DL,QAAS0jF,GACTxjF,SAAUqoF,GACVpoF,OAAO,EACPE,KAAM,CAACgU,KAAU6sC,MAAQl5B,QAE7B,CAAEhoB,QAAS0jF,GAAuBxjF,SAAUmpF,EAAiBlpF,OAAO,EAAME,KAAM,CAACgU,OACjFmyE,GAAqBrC,GAAkBR,GACvC,CAAE3jF,QAAS0/C,MAAkB52B,YAAa09D,IAC1C,CAAExmF,QAASsf,KAAYpf,SAAUujF,GAAYpjF,KAAM,IAG/C,IAER,IASMK,GAAa,MAAnB,MAAMA,GACFz+F,YAAYwpL,GAKZ,CAWA,2BAAOC,CAAqBrrJ,GACxB,MAAO,CACHq6G,SAAUh6C,GACVmoB,UAAW,CACP,CAAE7oB,QAASy+C,MAAQr+C,SAAU//D,EAAO+jJ,QAGhD,CAAC/hL,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFo+F,IAn+BVv9F,MAm+ByCsnL,GAA+B,MAA2EpoL,SAC3OH,KAAKo7G,UAp+BmFn6G,MAAE,CAAAmL,KAo+BSoyF,KAA4Dr+F,SAC/JH,KAAKq7G,UAr+BmFp6G,MAAE,CAAA0lH,UAq+BmC,IAAI0iE,MAA6Bb,IAAsBjqF,QAAA,CAAYl9F,KAAc0+K,SAC1N,OA5BKvhF,EAAa,KAwObirF,GAAK,MAAX,MAAMA,GACF1pL,YAAY4yG,GACR3yG,KAAK2yG,KAAOA,CAChB,CAIA+2E,WACI,OAAO1pL,KAAK2yG,KAAK7W,KACrB,CAKA6tF,SAASC,GACL5pL,KAAK2yG,KAAK7W,MAAQ8tF,GAAY,EAClC,CAACzpL,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFqpL,IAnsCVxoL,MAmsCiCkxG,MAAQ,EAA6ChyG,SAC9KH,KAAKg0C,WApsCmF/yC,MAAE,CAAAgzC,MAosCYw1I,GAAK1mL,QAAA,SAAA3C,GAAA,IAAAmmE,GAAA,YAAAA,GAAAnmE,EAAA,IAAAA,EA/BxH,SAASypL,KACL,OAAO,IAAIJ,MAAM3zE,OAAS3D,MAC9B,CA6B0J03E,GAAWtjH,EAAA,EAAAtjE,WAA/B,SACrI,OAnBKwmL,EAAK,YA8CQ/lL,OAAW,KAAeA,OAqM7C,IAuOMomL,GAAY,MAAlB,MAAMA,GAAa3pL,SACNH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF0pL,GAAY,EAAoD3pL,SAClKH,KAAKg0C,WA9oDmF/yC,MAAE,CAAAgzC,MA8oDY61I,GAAY/mL,QAAA,SAAA3C,GAAA,IAAAmmE,GAAA,YAAAA,GAAAnmE,EAAA,IAAAA,GAAZ0pL,IA9oDd7oL,MA8oDgG8oL,IAAgBxjH,EAAA,EAAAtjE,WAAxE,SAC5I,OAHK6mL,EAAY,KAWZC,GAAgB,MAAtB,MAAMA,WAAyBD,GAC3B/pL,YAAY4yG,GACRr8E,QACAt2B,KAAK2yG,KAAOA,CAChB,CACAokC,SAAS/1I,EAAKqJ,GACV,GAAa,MAATA,EACA,OAAO,KACX,OAAQrJ,GACJ,KAAKs1I,MAAgBC,KACjB,OAAOlsI,EACX,KAAKisI,MAAgBE,KACjB,SAAIwzC,OAAiC3/K,EAAO,SAA4B,EAC7D4/K,OAAiB5/K,IAAK,EAE1B6/K,OAAelqL,KAAK2yG,KAAMroG,OAAOD,IAAQ9F,WACpD,KAAK+xI,MAAgBG,MACjB,SAAIuzC,OAAiC3/K,EAAO,UAA8B,EAC/D4/K,OAAiB5/K,GAErBA,EACX,KAAKisI,MAAgBI,OACjB,MAAIszC,OAAiC3/K,EAAO,UACxC,SAAO4/K,OAAiB5/K,GAE5B,MAAM,IAAIu5G,MAAc,MAA6FC,GAEzH,KAAKyyB,MAAgBtvD,IACjB,SAAIgjG,OAAiC3/K,EAAO,QAA0B,EAC3D4/K,OAAiB5/K,IAAK,EAE1B8/K,OAAc7/K,OAAOD,IAChC,KAAKisI,MAAgBK,aACjB,MAAIqzC,OAAiC3/K,EAAO,eACxC,SAAO4/K,OAAiB5/K,GAE5B,MAAM,IAAIu5G,MAAc,MAAmGC,GAE/H,QACI,MAAM,IAAID,MAAc,MAA8FC,GAGlI,CACAumE,wBAAwB//K,GACpB,SAAOggL,OAA6BhgL,EACxC,CACAigL,yBAAyBjgL,GACrB,SAAOkgL,OAA8BlgL,EACzC,CACAmgL,0BAA0BngL,GACtB,SAAOogL,OAA+BpgL,EAC1C,CACAqgL,uBAAuBrgL,GACnB,SAAOsgL,OAA4BtgL,EACvC,CACAugL,+BAA+BvgL,GAC3B,SAAOwgL,OAAoCxgL,EAC/C,CAAClK,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF2pL,IAjtDV9oL,MAitD4CkxG,MAAQ,EAA6ChyG,SACzLH,KAAKg0C,WAltDmF/yC,MAAE,CAAAgzC,MAktDY81I,GAAgBhnL,QAAA,SAAA3C,GAAA,IAAAmmE,GAAA,YAAAA,GAAAnmE,EAAA,IAAAA,EA9DnI,SAAS0qL,GAAwB5vE,IAC7B,OAAO,IAAI6uE,GAAiB7uE,GAAS3tG,IAAI4kG,MAC7C,CA4DqK24E,CAltDhE7pL,MAktDyGm9I,QAAQ73E,EAAA,EAAAtjE,WAArE,SAChJ,OA5DK8mL,EAAgB,oOC1zDf,MAAMgB,eAAa3kF,GAAkBC,GAAW,WACnDA,EAAOrmG,MACPA,KAAK+D,KAAO,aACZ/D,KAAKgM,QAAU,yBACnB,8BCFO,SAASoP,MAAUxR,GACtB,OCHG,SAASohL,KACZ,SAAOj8E,MAAS,EACpB,CDCWi8E,IAAU,EAAEtlK,MAAK9b,KAAM8/F,OAAa9/F,IAC/C,iBEHO,SAASqhL,GAAMC,GAClB,OAAO,IAAIrmF,IAAYN,KACnBgH,SAAU2/E,KAAqB30I,UAAUguD,EAAU,EAE3D,4ECJO,SAASrjE,KACZ,SAAO0pE,MAAQ,CAAC1/F,EAAQq5F,KACpB,IAAIxB,EAAa,KACjB73F,EAAOigL,YACP,MAAMC,KAAa9gF,MAAyB/F,OAAYhhG,OAAWA,OAAWA,EAAW,KACrF,IAAK2H,GAAUA,EAAOigL,WAAa,GAAK,IAAMjgL,EAAOigL,UAEjD,YADApoF,EAAa,MAGjB,MAAMsoF,EAAmBngL,EAAOogL,YAC1BvjE,EAAOhlB,EACbA,EAAa,KACTsoF,KAAsBtjE,GAAQsjE,IAAqBtjE,IACnDsjE,EAAiB50I,cAErB8tD,EAAW9tD,aAAY,GAE3BvrC,EAAOqrC,UAAU60I,GACZA,EAAW3mF,SACZ1B,EAAa73F,EAAOqgL,UAAQ,EAGxC,CCnBO,MAAMC,WAA8B3mF,IACvC9kG,YAAYmL,EAAQugL,GAChBn1J,QACAt2B,KAAKkL,OAASA,EACdlL,KAAKyrL,eAAiBA,EACtBzrL,KAAK40G,SAAW,KAChB50G,KAAKmrL,UAAY,EACjBnrL,KAAKsrL,YAAc,QACf55E,MAAQxmG,KACRlL,KAAK8kG,KAAO55F,EAAO45F,KAE3B,CACAR,WAAWC,GACP,OAAOvkG,KAAK0rL,aAAan1I,UAAUguD,EACvC,CACAmnF,aACI,MAAMjlF,EAAUzmG,KAAK40G,SACrB,QAAKnO,GAAWA,EAAQD,aACpBxmG,KAAK40G,SAAW50G,KAAKyrL,kBAElBzrL,KAAK40G,QAChB,CACA/5B,YACI76E,KAAKmrL,UAAY,EACjB,MAAQG,eAAgBtrL,KACxBA,KAAK40G,SAAW50G,KAAKsrL,YAAc,KACuBA,GAAY70I,aAC1E,CACA80I,UACI,IAAIxoF,EAAa/iG,KAAKsrL,YACtB,IAAKvoF,EAAY,CACbA,EAAa/iG,KAAKsrL,YAAc,IAAIh1I,MACpC,MAAMmwD,EAAUzmG,KAAK0rL,aACrB3oF,EAAWx7E,IAAIvnB,KAAKkL,OAAOqrC,aAAU+zD,MAAyB7D,OAASljG,EAAW,KAC9EvD,KAAK66E,YACL4rB,EAAQlxC,UAAS,EACjBjvC,IACAtmB,KAAK66E,YACL4rB,EAAQ/3E,MAAMpI,EAAG,EAClB,IAAMtmB,KAAK66E,eACVkoB,EAAW0B,SACXzkG,KAAKsrL,YAAc,KACnBvoF,EAAazsD,MAAa+yD,MAElC,CACA,OAAOtG,CACX,CACA7hE,WACI,OAAOyqJ,KAAsB3rL,KACjC,sDCnDG,SAAS4rL,GAAKj7G,GACjB,OAAOA,GAAS,EAER,IAAM04B,QACRuB,MAAQ,CAAC1/F,EAAQq5F,KACf,IAAIsnF,EAAO,EACX3gL,EAAOqrC,aAAU+zD,MAAyB/F,EAAal6F,MAC7CwhL,GAAQl7G,IACV4zB,EAAWlwE,KAAKhqB,GACZsmE,GAASk7G,GACTtnF,EAAWhvC,WAAS,GAG9B,EAEd,6BChBO,SAASu2H,GAAet7E,GAC3B,SAAO5F,MAAQ,CAAC1/F,EAAQq5F,KACpB,IAAIwnF,GAAW,EACf7gL,EAAOqrC,aAAU+zD,MAAyB/F,EAAal6F,IACnD0hL,GAAW,EACXxnF,EAAWlwE,KAAKhqB,EAAK,EACtB,KACM0hL,GACDxnF,EAAWlwE,KAAKm8E,GAEpBjM,EAAWhvC,UAAS,GACtB,EAEV,CCZO,SAASy2H,GAAav+E,EAAew+E,IACxC,SAAOrhF,MAAQ,CAAC1/F,EAAQq5F,KACpB,IAAIwnF,GAAW,EACf7gL,EAAOqrC,aAAU+zD,MAAyB/F,EAAal6F,IACnD0hL,GAAW,EACXxnF,EAAWlwE,KAAKhqB,EAAK,EACtB,IAAO0hL,EAAWxnF,EAAWhvC,WAAagvC,EAAW71E,MAAM++E,MAAiB,EAEvF,CACA,SAASw+E,KACL,OAAO,IAAIlB,EACf,iBCRO,SAAS5kG,EAAM0oB,EAAW2B,GAC7B,MAAM07E,EAAkBjtJ,UAAUv4B,QAAU,EAC5C,OAAQwE,GAAWA,EAAOupC,KAAKo6D,KAAY7mG,MAAO,CAACkhE,EAAGzhE,IAAMonG,EAAU3lC,EAAGzhE,EAAGyD,IAAW++F,KAAU2hF,GAAK,GAAIM,EAAkBJ,GAAet7E,GAAgBw7E,GAAa,IAAM,IAAIjB,IACtL,uCCNO,SAASoB,GAASx7G,GACrB,OAAOA,GAAS,EACV,IAAM04B,QACNuB,MAAQ,CAAC1/F,EAAQq5F,KACf,IAAIxvE,EAAS,GACb7pB,EAAOqrC,aAAU+zD,MAAyB/F,EAAal6F,IACnD0qB,EAAO9tB,KAAKoD,GACZsmE,EAAQ57C,EAAOruB,QAAUquB,EAAO8uC,OAAM,EACvC,KACC,UAAWx5D,KAAS0qB,EAChBwvE,EAAWlwE,KAAKhqB,GAEpBk6F,EAAWhvC,UAAS,OACrBhyD,EAAW,KACVwxB,EAAS,OACX,EAEd,yCCDA,MAAMq3J,GAAiB,UAMjBC,GAAgCphF,OAAO,cAC7C,MAAMqhF,GACFvsL,YAAYo+B,GACRn+B,KAAKm+B,OAASA,GAAU,CAAC,CAC7B,CACA7W,IAAIvjB,GACA,OAAOM,OAAOC,UAAUwI,eAAepI,KAAK1E,KAAKm+B,OAAQp6B,EAC7D,CACAwJ,IAAIxJ,GACA,GAAI/D,KAAKsnB,IAAIvjB,GAAO,CAChB,MAAMmlE,EAAIlpE,KAAKm+B,OAAOp6B,GACtB,OAAO8C,MAAMC,QAAQoiE,GAAKA,EAAE,GAAKA,CACrC,CACA,OAAO,IACX,CACA20C,OAAO95G,GACH,GAAI/D,KAAKsnB,IAAIvjB,GAAO,CAChB,MAAMmlE,EAAIlpE,KAAKm+B,OAAOp6B,GACtB,OAAO8C,MAAMC,QAAQoiE,GAAKA,EAAI,CAACA,EACnC,CACA,MAAO,EACX,CACA,QAAI//D,GACA,OAAO9E,OAAO8E,KAAKnJ,KAAKm+B,OAC5B,EASJ,SAASouJ,GAAkBpuJ,GACvB,OAAO,IAAImuJ,GAAYnuJ,EAC3B,CAgBA,SAASquJ,GAAkBC,EAAUC,EAAcl3I,GAC/C,MAAMrhB,EAAQqhB,EAAM/lB,KAAKlnB,MAAM,KAK/B,GAJI4rB,EAAMztB,OAAS+lL,EAAS/lL,QAIJ,SAApB8uC,EAAMonD,YACL8vF,EAAaC,eAAiBx4J,EAAMztB,OAAS+lL,EAAS/lL,QAEvD,OAAO,KAEX,MAAMkmL,EAAY,CAAC,EAEnB,QAASt5K,EAAQ,EAAGA,EAAQ6gB,EAAMztB,OAAQ4M,IAAS,CAC/C,MAAMwiC,EAAO3hB,EAAM7gB,GACb4F,GAAUuzK,EAASn5K,GAEzB,GADoBwiC,EAAK5tB,WAAW,KAEhC0kK,EAAU92I,EAAKx+B,UAAU,IAAM4B,WAE1B48B,IAAS58B,GAAQuW,KAEtB,OAAO,IAEf,CACA,MAAO,CAAEo9J,SAAUJ,EAASziL,MAAM,EAAGmqB,EAAMztB,QAASkmL,YACxD,CAWA,SAASE,GAAajoK,EAAGC,GAGrB,MAAMioK,EAAKloK,EAAIxgB,OAAO8E,KAAK0b,QAAKthB,EAC1BypL,EAAKloK,EAAIzgB,OAAO8E,KAAK2b,QAAKvhB,EAChC,IAAKwpL,IAAOC,GAAMD,EAAGrmL,QAAUsmL,EAAGtmL,OAC9B,OAAO,EAEX,IAAIa,EACJ,QAASE,EAAI,EAAGA,EAAIslL,EAAGrmL,OAAQe,IAE3B,GADAF,EAAMwlL,EAAGtlL,IACJwlL,GAAoBpoK,EAAEtd,GAAMud,EAAEvd,IAC/B,OAAO,EAGf,OAAO,CACX,CAIA,SAAS0lL,GAAoBpoK,EAAGC,GAC5B,GAAIje,MAAMC,QAAQ+d,IAAMhe,MAAMC,QAAQge,GAAI,CACtC,GAAID,EAAEne,SAAWoe,EAAEpe,OACf,OAAO,EACX,MAAMwmL,EAAU,IAAIroK,GAAGD,OACjBuoK,EAAU,IAAIroK,GAAGF,OACvB,OAAOsoK,EAAQE,MAAM,CAAC56K,EAAKc,IAAU65K,EAAQ75K,KAAWd,EAC5D,CAEI,OAAOqS,IAAMC,CAErB,CAIA,SAASshE,GAAKvhE,GACV,OAAOA,EAAEne,OAAS,EAAIme,EAAEA,EAAEne,OAAS,GAAK,IAC5C,CACA,SAAS2mL,GAAmBhjL,GACxB,OCtJG,SAASijL,GAAajqL,GACzB,QAASA,IAAQA,aAAewhG,QAAeQ,KAAWhiG,EAAIyhG,QAAI,EAAKO,KAAWhiG,EAAIkzC,WAC1F,CDoJQ+2I,CAAajjL,GACNA,KAEPkjL,OAAWljL,IAAK,EAITqb,MAAKi5D,QAAQ1tE,QAAQ5G,KAAM,EAE/BijG,MAAGjjG,EACd,CAEA,MAAMmjL,GAAiB,CACnBC,MAiBJ,SAASC,GAAmBtiD,EAAWuiD,EAAWC,GAM9C,IALKC,GAAUziD,EAAUqhD,SAAUkB,EAAUlB,YAExCqB,GAAkB1iD,EAAUqhD,SAAUkB,EAAUlB,SAAUmB,IAG3DxiD,EAAU2iD,mBAAqBJ,EAAUI,iBACzC,OAAO,EACX,UAAW1/K,KAAKs/K,EAAUK,SAGtB,IAFK5iD,EAAU4iD,SAAS3/K,KAEnBq/K,GAAmBtiD,EAAU4iD,SAAS3/K,GAAIs/K,EAAUK,SAAS3/K,GAAIu/K,GAClE,OAAO,EAEf,OAAO,CACX,EA/BIK,OAAUC,IAERC,GAAkB,CACpBV,MASJ,SAASW,GAAYhjD,EAAWuiD,GAE5B,OAAOb,GAAa1hD,EAAWuiD,EACnC,EAXIM,OA4BJ,SAASI,GAAejjD,EAAWuiD,GAC/B,OAAOtpL,OAAO8E,KAAKwkL,GAAWjnL,QAAUrC,OAAO8E,KAAKiiI,GAAW1kI,QAC3DrC,OAAO8E,KAAKwkL,GAAWP,MAAM7lL,GAAO0lL,GAAoB7hD,EAAU7jI,GAAMomL,EAAUpmL,IAC1F,EA9BI+mL,QAAWA,KAAM,GAErB,SAASC,GAAanjD,EAAWuiD,EAAWznL,GACxC,OAAOsnL,GAAetnL,EAAQsoL,OAAOpjD,EAAU34F,KAAMk7I,EAAUl7I,KAAMvsC,EAAQ0nL,eACzEO,GAAgBjoL,EAAQquG,aAAa62B,EAAU72B,YAAao5E,EAAUp5E,gBAC/C,UAArBruG,EAAQ2+B,UAAwBumG,EAAUvmG,WAAa8oJ,EAAU9oJ,SAC3E,CAyBA,SAASqpJ,GAAqB9iD,EAAWuiD,EAAWC,GAChD,OAAOa,GAA2BrjD,EAAWuiD,EAAWA,EAAUlB,SAAUmB,EAChF,CACA,SAASa,GAA2BrjD,EAAWuiD,EAAWe,EAAgBd,GACtE,GAAIxiD,EAAUqhD,SAAS/lL,OAASgoL,EAAehoL,OAAQ,CACnD,MAAM6rC,EAAU64F,EAAUqhD,SAASziL,MAAM,EAAG0kL,EAAehoL,QAK3D,SAJKmnL,GAAUt7I,EAASm8I,IAEpBf,EAAUhB,gBAETmB,GAAkBv7I,EAASm8I,EAAgBd,GAGpD,IACSxiD,EAAUqhD,SAAS/lL,SAAWgoL,EAAehoL,OAAQ,CAG1D,IAFKmnL,GAAUziD,EAAUqhD,SAAUiC,KAE9BZ,GAAkB1iD,EAAUqhD,SAAUiC,EAAgBd,GACvD,OAAO,EACX,UAAWv/K,KAAKs/K,EAAUK,SAGtB,IAFK5iD,EAAU4iD,SAAS3/K,KAEnB6/K,GAAqB9iD,EAAU4iD,SAAS3/K,GAAIs/K,EAAUK,SAAS3/K,GAAIu/K,GACpE,OAAO,EAGf,OAAO,CACX,CACK,CACD,MAAMr7I,EAAUm8I,EAAe1kL,MAAM,EAAGohI,EAAUqhD,SAAS/lL,QACrD2tB,EAAOq6J,EAAe1kL,MAAMohI,EAAUqhD,SAAS/lL,QAKrD,SAJKmnL,GAAUziD,EAAUqhD,SAAUl6I,IAE9Bu7I,GAAkB1iD,EAAUqhD,SAAUl6I,EAASq7I,IAE/CxiD,EAAU4iD,SAAS5B,MAEjBqC,GAA2BrjD,EAAU4iD,SAAS5B,IAAiBuB,EAAWt5J,EAAMu5J,EAC3F,CACJ,CACA,SAASE,GAAkBa,EAAgBD,EAAgBxoL,GACvD,OAAOwoL,EAAetB,MAAM,CAACwB,EAAkBnnL,IACpC0mL,GAAgBjoL,GAASyoL,EAAelnL,GAAGyhI,WAAY0lD,EAAiB1lD,YAEvF,CA+BA,MAAM2lD,GACF9uL,YAEA0yC,EAAO,IAAIq8I,GAAgB,GAAI,CAAC,GAEhCv6E,EAAc,CAAC,EAEf1vE,EAAW,MACP7kC,KAAKyyC,KAAOA,EACZzyC,KAAKu0G,YAAcA,EACnBv0G,KAAK6kC,SAAWA,CAOpB,CACA,iBAAIkqJ,GACA,OAAK/uL,KAAKgvL,iBACNhvL,KAAKgvL,eAAiBzC,GAAkBvsL,KAAKu0G,cAE1Cv0G,KAAKgvL,cAChB,CAEAzqL,WACI,OAAO0qL,GAAmBC,UAAUlvL,KACxC,EAWJ,MAAM8uL,GACF/uL,YAEA0sL,EAEAuB,GACIhuL,KAAKysL,SAAWA,EAChBzsL,KAAKguL,SAAWA,EAEhBhuL,KAAK62E,OAAS,KACdxyE,OAAOoK,OAAOu/K,GAAU5lL,QAAS8gE,GAAOA,EAAE2N,OAAS72E,KACvD,CAEA2sL,cACI,OAAO3sL,KAAK+tL,iBAAmB,CACnC,CAEA,oBAAIA,GACA,OAAO1pL,OAAO8E,KAAKnJ,KAAKguL,UAAUtnL,MACtC,CAEAnC,WACI,OAAO4qL,GAAenvL,KAC1B,EA4BJ,MAAMovL,GACFrvL,YAEA0vB,EAEAy5G,GACIlpI,KAAKyvB,KAAOA,EACZzvB,KAAKkpI,WAAaA,CACtB,CACA,gBAAImmD,GACA,OAAKrvL,KAAKsvL,gBACNtvL,KAAKsvL,cAAgB/C,GAAkBvsL,KAAKkpI,aAEzClpI,KAAKsvL,aAChB,CAEA/qL,WACI,OAAOgrL,EAAcvvL,KACzB,EAKJ,SAAS6tL,GAAUl2H,EAAI63H,GACnB,OAAI73H,EAAGjxD,SAAW8oL,EAAG9oL,QAEdixD,EAAGy1H,MAAM,CAACvoK,EAAGpd,IAAMod,EAAE4K,OAAS+/J,EAAG/nL,GAAGgoB,KAC/C,CAeA,IAYMggK,GAAa,MAAnB,MAAMA,EAActvL,SACPH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFqvL,EAAa,EAAoDtvL,SACnKH,KAAKg0C,WADmF/yC,MAAE,CAAAgzC,MACYw7I,EAAa1sL,QAAA,kBAAwC,IAAI2sL,EAAsB,EAAAzsL,WAApD,SAC7I,OAHKwsL,CAAa,KA0BnB,MAAMC,GAEF7hJ,MAAM1kB,GACF,MAAMpE,EAAI,IAAI4qK,EAAUxmK,GACxB,OAAO,IAAI0lK,GAAQ9pK,EAAE6qK,mBAAoB7qK,EAAE8qK,mBAAoB9qK,EAAE+qK,gBACrE,CAEAZ,UAAUa,GACN,MAAM72K,EAAW,IAAG82K,GAAiBD,EAAKt9I,MAAM,KAC1C7N,EAgGd,SAASqrJ,GAAqB9xJ,GAC1B,MAAM+xJ,EAAY7rL,OAAO8E,KAAKg1B,GACzBh2B,IAAKpE,IACN,MAAMsG,EAAQ8zB,EAAOp6B,GACrB,OAAO8C,MAAMC,QAAQuD,GACjBA,EAAMlC,IAAI+gE,GAAM,GAAEinH,GAAepsL,MAASosL,GAAejnH,MAAM9hE,KAAK,KACnE,GAAE+oL,GAAepsL,MAASosL,GAAe9lL,IAAO,GAEpDrC,OAAOgiD,KAAOA,GACnB,OAAOkmI,EAAUxpL,OAAU,IAAGwpL,EAAU9oL,KAAK,OAAS,EAC1D,CA1GsB6oL,CAAqBF,EAAKx7E,aAExC,MAAQ,GAAEr7F,IAAU0rB,IADuB,iBAAnBmrJ,EAAKlrJ,SAAyB,IAkE9D,SAASurJ,GAAkBpmI,GACvB,OAAOnjC,UAAUmjC,EACrB,CApEiEomI,CAAkBL,EAAKlrJ,YAAc,IAElG,EAEJ,MAAMoqJ,GAAqB,IAAIS,GAC/B,SAASP,GAAej2K,GACpB,OAAOA,EAAQuzK,SAAStkL,IAAI4c,GAAKwqK,EAAcxqK,IAAI3d,KAAK,IAC5D,CACA,SAAS4oL,GAAiB92K,EAASu5B,GAC/B,IAAKv5B,EAAQyzK,cACT,OAAOwC,GAAej2K,GAE1B,GAAIu5B,EAAM,CACN,MAAM49I,EAAUn3K,EAAQ80K,SAAS5B,IAC7B4D,GAAiB92K,EAAQ80K,SAAS5B,KAAiB,GACnD,GACE4B,EAAW,GACjB3pL,cAAO2R,QAAQkD,EAAQ80K,UAAU5lL,QAAQ,EAAE+jB,EAAG+8C,MACtC/8C,IAAMigK,IACN4B,EAAS/mL,KAAM,GAAEklB,KAAK6jK,GAAiB9mH,GAAG,KAAQ,GAGnD8kH,EAAStnL,OAAS,EAAK,GAAE2pL,KAAWrC,EAAS5mL,KAAK,SAAWipL,CACxE,CACK,CACD,MAAMrC,EAvFd,SAASsC,GAAqBp3K,EAAS+M,GACnC,IAAIjE,EAAM,GACV3d,cAAO2R,QAAQkD,EAAQ80K,UAAU5lL,QAAQ,EAAEmoL,EAAat8G,MAChDs8G,IAAgBnE,KAChBpqK,EAAMA,EAAI5G,OAAO6K,EAAGguD,EAAOs8G,IAAY,GAG/ClsL,OAAO2R,QAAQkD,EAAQ80K,UAAU5lL,QAAQ,EAAEmoL,EAAat8G,MAChDs8G,IAAgBnE,KAChBpqK,EAAMA,EAAI5G,OAAO6K,EAAGguD,EAAOs8G,IAAY,GAGxCvuK,CACX,CA0EyBsuK,CAAqBp3K,EAAS,CAACgwD,EAAG/8C,IAC3CA,IAAMigK,GACC,CAAC4D,GAAiB92K,EAAQ80K,SAAS5B,KAAiB,IAExD,CAAE,GAAEjgK,KAAK6jK,GAAiB9mH,GAAG,OAGxC,OAA6C,IAAzC7kE,OAAO8E,KAAK+P,EAAQ80K,UAAUtnL,QAAoD,MAApCwS,EAAQ80K,SAAS5B,IACvD,GAAE+C,GAAej2K,MAAY80K,EAAS,KAE1C,GAAEmB,GAAej2K,OAAa80K,EAAS5mL,KAAK,QACxD,CACJ,CAOA,SAASopL,GAAgBxmI,GACrB,OAAOzzC,mBAAmByzC,GACrB/7C,QAAQ,OAAQ,KAChBA,QAAQ,QAAS,KACjBA,QAAQ,OAAQ,KAChBA,QAAQ,QAAS,IAC1B,CAOA,SAASkiL,GAAenmI,GACpB,OAAOwmI,GAAgBxmI,GAAG/7C,QAAQ,QAAS,IAC/C,CAiBA,SAASwiL,GAAiBzmI,GACtB,OAAOwmI,GAAgBxmI,GAAG/7C,QAAQ,MAAO,OAAOA,QAAQ,MAAO,OAAOA,QAAQ,QAAS,IAC3F,CACA,SAASyiL,GAAO1mI,GACZ,OAAOjzC,mBAAmBizC,EAC9B,CAGA,SAAS2mI,EAAY3mI,GACjB,OAAO0mI,GAAO1mI,EAAE/7C,QAAQ,MAAO,OACnC,CACA,SAASshL,EAAc9/J,GACnB,MAAQ,GAAEghK,GAAiBhhK,EAAKA,QAEpC,SAASmhK,EAAsBzyJ,GAC3B,OAAO95B,OAAO8E,KAAKg1B,GACdh2B,IAAIZ,GAAQ,IAAGkpL,GAAiBlpL,MAAQkpL,GAAiBtyJ,EAAO52B,OAChEH,KAAK,GACd,CAN4CwpL,CAAsBnhK,EAAKy5G,aACvE,CAiBA,MAAM2nD,GAAa,eACnB,SAASC,GAAchnL,GACnB,MAAMub,EAAQvb,EAAIub,MAAMwrK,IACxB,OAAOxrK,EAAQA,EAAM,GAAK,EAC9B,CACA,MAAM0rK,GAA0B,gBAK1BC,GAAiB,YAMjBC,GAAuB,UAM7B,MAAMtB,EACF5vL,YAAYopB,GACRnpB,KAAKmpB,IAAMA,EACXnpB,KAAKi6D,UAAY9wC,CACrB,CACAymK,mBAEI,OADA5vL,KAAKkxL,gBAAgB,KACE,KAAnBlxL,KAAKi6D,WAAoBj6D,KAAKmxL,eAAe,MAAQnxL,KAAKmxL,eAAe,KAClE,IAAIrC,GAAgB,GAAI,CAAC,GAG7B,IAAIA,GAAgB,GAAI9uL,KAAKoxL,gBACxC,CACAvB,mBACI,MAAM1xJ,EAAS,CAAC,EAChB,GAAIn+B,KAAKkxL,gBAAgB,KACrB,GACIlxL,KAAKqxL,gBAAgBlzJ,SAChBn+B,KAAKkxL,gBAAgB,MAElC,OAAO/yJ,CACX,CACA2xJ,gBACI,OAAO9vL,KAAKkxL,gBAAgB,KAAOn6K,mBAAmB/W,KAAKi6D,WAAa,IAC5E,CACAm3H,gBACI,GAAuB,KAAnBpxL,KAAKi6D,UACL,MAAO,CAAC,EAEZj6D,KAAKkxL,gBAAgB,KACrB,MAAMzE,EAAW,GAIjB,IAHKzsL,KAAKmxL,eAAe,MACrB1E,EAASxlL,KAAKjH,KAAKsxL,gBAEhBtxL,KAAKmxL,eAAe,OAASnxL,KAAKmxL,eAAe,QAAUnxL,KAAKmxL,eAAe,OAClFnxL,KAAK4hD,QAAQ,KACb6qI,EAASxlL,KAAKjH,KAAKsxL,gBAEvB,IAAItD,EAAW,CAAC,EACZhuL,KAAKmxL,eAAe,QACpBnxL,KAAK4hD,QAAQ,KACbosI,EAAWhuL,KAAKuxL,aAAY,IAEhC,IAAIvvK,EAAM,CAAC,EACX,OAAIhiB,KAAKmxL,eAAe,OACpBnvK,EAAMhiB,KAAKuxL,aAAY,KAEvB9E,EAAS/lL,OAAS,GAAKrC,OAAO8E,KAAK6kL,GAAUtnL,OAAS,KACtDsb,EAAIoqK,IAAkB,IAAI0C,GAAgBrC,EAAUuB,IAEjDhsK,CACX,CAGAsvK,eACI,MAAM7hK,EAAOqhK,GAAc9wL,KAAKi6D,WAChC,GAAa,KAATxqC,GAAezvB,KAAKmxL,eAAe,KACnC,MAAM,IAAIvtE,MAAc,MAAyFC,GAGrH,OAAA7jH,KAAK4hD,QAAQnyB,GACN,IAAI2/J,GAAWsB,GAAOjhK,GAAOzvB,KAAKwxL,oBAC7C,CACAA,oBACI,MAAMrzJ,EAAS,CAAC,EAChB,KAAOn+B,KAAKkxL,gBAAgB,MACxBlxL,KAAKyxL,WAAWtzJ,GAEpB,OAAOA,CACX,CACAszJ,WAAWtzJ,GACP,MAAM52B,EAvFd,SAASmqL,GAAuB5nL,GAC5B,MAAMub,EAAQvb,EAAIub,MAAM0rK,IACxB,OAAO1rK,EAAQA,EAAM,GAAK,EAC9B,CAoFoBqsK,CAAuB1xL,KAAKi6D,WACxC,IAAK1yD,EACD,OAEJvH,KAAK4hD,QAAQr6C,GACb,IAAI8C,EAAQ,GACZ,GAAIrK,KAAKkxL,gBAAgB,KAAM,CAC3B,MAAMS,EAAab,GAAc9wL,KAAKi6D,WAClC03H,IACAtnL,EAAQsnL,EACR3xL,KAAK4hD,QAAQv3C,GAErB,CACA8zB,EAAOuyJ,GAAOnpL,IAAQmpL,GAAOrmL,EACjC,CAEAgnL,gBAAgBlzJ,GACZ,MAAM52B,EAlGd,SAASqqL,GAAiB9nL,GACtB,MAAMub,EAAQvb,EAAIub,MAAM2rK,IACxB,OAAO3rK,EAAQA,EAAM,GAAK,EAC9B,CA+FoBusK,CAAiB5xL,KAAKi6D,WAClC,IAAK1yD,EACD,OAEJvH,KAAK4hD,QAAQr6C,GACb,IAAI8C,EAAQ,GACZ,GAAIrK,KAAKkxL,gBAAgB,KAAM,CAC3B,MAAMS,EAnGlB,SAASE,EAAwB/nL,GAC7B,MAAMub,EAAQvb,EAAIub,MAAM4rK,IACxB,OAAO5rK,EAAQA,EAAM,GAAK,EAC9B,CAgG+BwsK,CAAwB7xL,KAAKi6D,WAC5C03H,IACAtnL,EAAQsnL,EACR3xL,KAAK4hD,QAAQv3C,GAErB,CACA,MAAMynL,EAAanB,EAAYppL,GACzBwqL,EAAapB,EAAYtmL,GAC/B,GAAI8zB,EAAOrxB,eAAeglL,GAAa,CAEnC,IAAIE,EAAa7zJ,EAAO2zJ,GACnBjrL,MAAMC,QAAQkrL,KACfA,EAAa,CAACA,GACd7zJ,EAAO2zJ,GAAcE,GAEzBA,EAAW/qL,KAAK8qL,EACpB,MAGI5zJ,EAAO2zJ,GAAcC,CAE7B,CAEAR,YAAYU,GACR,MAAMxF,EAAW,CAAC,EAElB,IADAzsL,KAAK4hD,QAAQ,MACL5hD,KAAKkxL,gBAAgB,MAAQlxL,KAAKi6D,UAAUvzD,OAAS,GAAG,CAC5D,MAAM+oB,EAAOqhK,GAAc9wL,KAAKi6D,WAC1B5lC,EAAOr0B,KAAKi6D,UAAUxqC,EAAK/oB,QAGjC,GAAa,MAAT2tB,GAAyB,MAATA,GAAyB,MAATA,EAChC,MAAM,IAAIuvF,MAAc,MAAiFC,GAE7G,IAAIquE,EACAziK,EAAK/C,QAAQ,MAAO,GACpBwlK,EAAaziK,EAAKzlB,MAAM,EAAGylB,EAAK/C,QAAQ,MACxC1sB,KAAK4hD,QAAQswI,GACblyL,KAAK4hD,QAAQ,MAERqwI,IACLC,EAAa9F,IAEjB,MAAM4B,EAAWhuL,KAAKoxL,gBACtB3E,EAASyF,GAA+C,IAAjC7tL,OAAO8E,KAAK6kL,GAAUtnL,OAAesnL,EAAS5B,IACjE,IAAI0C,GAAgB,GAAId,GAC5BhuL,KAAKkxL,gBAAgB,KACzB,CACA,OAAOzE,CACX,CACA0E,eAAernL,GACX,OAAO9J,KAAKi6D,UAAU/xC,WAAWpe,EACrC,CAEAonL,gBAAgBpnL,GACZ,QAAI9J,KAAKmxL,eAAernL,KACpB9J,KAAKi6D,UAAYj6D,KAAKi6D,UAAU3iD,UAAUxN,EAAIpD,SACvC,EAGf,CACAk7C,QAAQ93C,GACJ,IAAK9J,KAAKkxL,gBAAgBpnL,GACtB,MAAM,IAAI85G,MAAc,MAA0FC,EAE1H,EAEJ,SAASsuE,EAAWC,GAChB,OAAOA,EAAc3F,SAAS/lL,OAAS,EACnC,IAAIooL,GAAgB,GAAI,CAAEuD,CAACjG,IAAiBgG,IAC5CA,CACR,CAWA,SAASE,GAAmB5F,GACxB,MAAM6F,EAAc,CAAC,EACrB,UAAWhC,KAAelsL,OAAO8E,KAAKujL,EAAasB,UAAW,CAC1D,MACMwE,EAAiBF,GADT5F,EAAasB,SAASuC,IAGpC,GAAIA,IAAgBnE,IAAqD,IAAnCoG,EAAe/F,SAAS/lL,QAC1D8rL,EAAe7F,cACf,UAAY8F,EAAkBC,MAAeruL,OAAO2R,QAAQw8K,EAAexE,UACvEuE,EAAYE,GAAoBC,QAG/BF,EAAe/F,SAAS/lL,OAAS,GAAK8rL,EAAe7F,iBAC1D4F,EAAYhC,GAAeiC,EAEnC,CAEA,OAUJ,SAASG,GAAqB3oI,GAC1B,GAA2B,IAAvBA,EAAE+jI,kBAA0B/jI,EAAEgkI,SAAS5B,IAAiB,CACxD,MAAM/9K,EAAI27C,EAAEgkI,SAAS5B,IACrB,OAAO,IAAI0C,GAAgB9kI,EAAEyiI,SAASrxK,OAAO/M,EAAEo+K,UAAWp+K,EAAE2/K,SAChE,CACA,OAAOhkI,CACX,CAhBW2oI,CADG,IAAI7D,GAAgBpC,EAAaD,SAAU8F,GAEzD,CAgBA,SAASK,GAAU1pH,GACf,OAAOA,aAAa2lH,EACxB,CAyDA,SAASgE,GAA4Br9I,GACjC,IAAIs9I,EAaJ,MACMC,EAAmBZ,EAbzB,SAASa,EAAqCt9I,GAC1C,MAAMu9I,EAAe,CAAC,EACtB,UAAWC,KAAiBx9I,EAAas4I,SAAU,CAC/C,MAAMv7I,GAAOugJ,EAAqCE,GAClDD,EAAaC,EAAcC,QAAU1gJ,EACzC,CACA,MAAMi6I,GAAe,IAAIoC,GAAgBp5I,EAAavsB,IAAK8pK,GAC3D,OAAIv9I,IAAiBF,IACjBs9I,EAAcpG,IAEXA,EACX,CACsBsG,CAAqCx9I,EAAM/C,OAEjE,OAAOqgJ,GAAeC,CAC1B,CACA,SAASK,GAA8BC,EAAYC,EAAU/+E,EAAa1vE,GACtE,IAAI4N,EAAO4gJ,EACX,KAAO5gJ,EAAKokC,QACRpkC,EAAOA,EAAKokC,OAKhB,GAAwB,IAApBy8G,EAAS5sL,OACT,OAAOqpL,GAAKt9I,EAAMA,EAAMA,EAAM8hE,EAAa1vE,GAE/C,MAAM0uJ,EA4EV,SAASC,GAAkBF,GACvB,GAA4B,iBAAhBA,EAAS,IAAwC,IAApBA,EAAS5sL,QAAgC,MAAhB4sL,EAAS,GACvE,OAAO,IAAIG,IAAW,EAAM,EAAGH,GAEnC,IAAII,EAAqB,EACrBC,GAAa,EACjB,MAAM3xK,EAAMsxK,EAASr9K,OAAO,CAAC+L,EAAK4xK,EAAKC,KACnC,GAAmB,iBAARD,GAA2B,MAAPA,EAAa,CACxC,GAAIA,EAAIE,QAAS,CACb,MAAMA,GAAU,CAAC,EACjBzvL,cAAO2R,QAAQ49K,EAAIE,SAAS1rL,QAAQ,EAAErE,EAAMuvL,OACxCQ,GAAQ/vL,GAA4B,iBAAbuvL,GAAwBA,GAAS/qL,MAAM,KAAO+qL,KAElE,IAAItxK,EAAK,CAAE8xK,YACtB,CACA,GAAIF,EAAIG,YACJ,MAAO,IAAI/xK,EAAK4xK,EAAIG,YAE5B,CACA,MAAqB,iBAARH,EACF,IAAI5xK,EAAK4xK,GAEL,IAAXC,GACAD,EAAIrrL,MAAM,KAAKH,QAAQ,CAAC4rL,GAASC,KACZ,GAAbA,GAA8B,MAAZD,KAGA,GAAbC,GAA8B,KAAZD,GACvBL,GAAa,EAEI,OAAZK,GACLN,IAEgB,IAAXM,IACLhyK,EAAI/a,KAAK+sL,IAAO,GAGjBhyK,GAEJ,IAAIA,EAAK4xK,EAAG,EACpB,IACH,OAAO,IAAIH,GAAWE,EAAYD,EAAoB1xK,EAC1D,CAtHgBwxK,CAAkBF,GAC9B,GAAIC,EAAIW,SACJ,OAAOnE,GAAKt9I,EAAMA,EAAM,IAAIq8I,GAAgB,GAAI,CAAC,GAAIv6E,EAAa1vE,GAEtE,MAAM08B,EA0HV,SAAS4yH,GAAmCZ,EAAK9gJ,EAAMpmC,GACnD,GAAIknL,EAAII,WACJ,OAAO,IAAIS,GAAS3hJ,GAAM,EAAM,GAEpC,IAAKpmC,EAKD,OAAO,IAAI+nL,GAAS3hJ,GAAM,EAAO4hJ,KAErC,GAAsB,OAAlBhoL,EAAOwqE,OACP,OAAO,IAAIu9G,GAAS/nL,GAAQ,EAAM,GAEtC,MAAMioL,EAAWC,GAAehB,EAAID,SAAS,IAAM,EAAI,EAEvD,OAEJ,SAASkB,GAAiCC,EAAOnhL,EAAOogL,GACpD,IAAIgB,EAAID,EACJE,EAAKrhL,EACLshL,EAAKlB,EACT,KAAOkB,EAAKD,GAAI,CAGZ,GAFAC,GAAMD,EACND,EAAIA,EAAE79G,QACD69G,EACD,MAAM,IAAI9wE,MAAc,MAAsFC,GAElH8wE,EAAKD,EAAEjI,SAAS/lL,MACpB,CACA,OAAO,IAAI0tL,GAASM,GAAG,EAAOC,EAAKC,EACvC,CAfWJ,CAAiCnoL,EAD1BA,EAAOogL,SAAS/lL,OAAS,EAAI4tL,EACYf,EAAIG,mBAC/D,CA3IqBS,CAAmCZ,EAAK9gJ,EAAM4gJ,GACzDwB,GAAkBtzH,EAASuzH,gBAC7BC,GAA2BxzH,EAASmrH,aAAcnrH,EAASjuD,MAAOigL,EAAID,UACtE0B,GAAmBzzH,EAASmrH,aAAcnrH,EAASjuD,MAAOigL,EAAID,UAClE,OAAOvD,GAAKt9I,EAAM8uB,EAASmrH,aAAcmI,GAAiBtgF,EAAa1vE,EAC3E,CACA,SAAS0vJ,GAAeU,GACpB,MAA0B,iBAAZA,GAAmC,MAAXA,IAAoBA,EAAQnB,UAAYmB,EAAQlB,WAC1F,CAKA,SAASmB,GAAqBD,GAC1B,MAA0B,iBAAZA,GAAmC,MAAXA,GAAmBA,EAAQnB,OACrE,CACA,SAAS/D,GAAKoF,EAASC,EAAiBP,EAAiBtgF,EAAa1vE,GAClE,IAMIutJ,EANAiD,EAAK,CAAC,EACN9gF,GACAlwG,OAAO2R,QAAQu+F,GAAansG,QAAQ,EAAErE,EAAMsG,OACxCgrL,EAAGtxL,GAAQ8C,MAAMC,QAAQuD,IAASA,GAAMlC,IAAK+gE,IAAO,GAAEA,MAAQ,GAAE7+D,IAAM,GAK1E+nL,EADA+C,IAAYC,EACIP,EAGAS,GAAeH,EAASC,EAAiBP,GAE7D,MAAMU,GAAUpD,EAAWG,GAAmBF,IAC9C,OAAO,IAAIvD,GAAQ0G,GAASF,EAAIxwJ,EACpC,CAQA,SAASywJ,GAAe/iJ,EAASijJ,EAAYC,GACzC,MAAMzH,EAAW,CAAC,EAClB3pL,cAAO2R,QAAQu8B,EAAQy7I,UAAU5lL,QAAQ,EAAE8pL,EAAY7jL,MAE/C2/K,EAASkE,GADT7jL,IAAMmnL,EACiBC,EAGAH,GAAejnL,EAAGmnL,EAAYC,EAAU,GAGhE,IAAI3G,GAAgBv8I,EAAQk6I,SAAUuB,EACjD,CACA,MAAMyF,GACF1zL,YAAY4zL,EAAYD,EAAoBJ,GAIxC,GAHAtzL,KAAK2zL,WAAaA,EAClB3zL,KAAK0zL,mBAAqBA,EAC1B1zL,KAAKszL,SAAWA,EACZK,GAAcL,EAAS5sL,OAAS,GAAK6tL,GAAejB,EAAS,IAC7D,MAAM,IAAI1vE,MAAc,MAA6FC,GAGzH,MAAM6xE,EAAgBpC,EAAShjK,KAAK4kK,IACpC,GAAIQ,GAAiBA,IAAkBtvG,GAAKktG,GACxC,MAAM,IAAI1vE,MAAc,MAA4FC,EAG5H,CACAqwE,SACI,OAAOl0L,KAAK2zL,YAAuC,IAAzB3zL,KAAKszL,SAAS5sL,QAAoC,KAApB1G,KAAKszL,SAAS,EAC1E,EA8CJ,MAAMc,GACFr0L,YAAY2sL,EAAcoI,EAAiBxhL,GACvCtT,KAAK0sL,aAAeA,EACpB1sL,KAAK80L,gBAAkBA,EACvB90L,KAAKsT,MAAQA,CACjB,EAwCJ,SAAS0hL,GAAmBtI,EAAczvB,EAAYq2B,GAIlD,GAHK5G,IACDA,EAAe,IAAIoC,GAAgB,GAAI,CAAC,IAEP,IAAjCpC,EAAaD,SAAS/lL,QAAgBgmL,EAAaC,cACnD,OAAOoI,GAA2BrI,EAAczvB,EAAYq2B,GAEhE,MAAM5uH,EAuEV,SAASixH,GAAajJ,EAAczvB,EAAYq2B,GAC5C,IAAIsC,EAAsB,EACtBC,EAAmB54B,EACvB,MAAM64B,EAAU,CAAEzwK,OAAO,EAAO0wK,UAAW,EAAGC,aAAc,GAC5D,KAAOH,EAAmBnJ,EAAaD,SAAS/lL,QAAQ,CACpD,GAAIkvL,GAAuBtC,EAAS5sL,OAChC,OAAOovL,EACX,MAAMrmK,EAAOi9J,EAAaD,SAASoJ,GAC7BZ,GAAU3B,EAASsC,GAIzB,GAAIV,GAAqBD,IACrB,MAEJ,MAAM3zF,EAAQ,GAAE2zF,KACV5gK,GAAOuhK,EAAsBtC,EAAS5sL,OAAS,EAAI4sL,EAASsC,EAAsB,GAAK,KAC7F,GAAIC,EAAmB,QAActyL,IAAT+9F,EACxB,MACJ,GAAIA,GAAQjtE,IAAyB,iBAATA,SAAuC9wB,IAAjB8wB,GAAKy/J,QAAuB,CAC1E,IAAKmC,GAAQ30F,EAAMjtE,GAAM5E,GACrB,OAAOqmK,EACXF,GAAuB,CAC3B,KACK,CACD,IAAKK,GAAQ30F,EAAM,CAAC,EAAG7xE,GACnB,OAAOqmK,EACXF,GACJ,CACAC,GACJ,CACA,MAAO,CAAExwK,OAAO,EAAM0wK,UAAWF,EAAkBG,aAAcJ,EACrE,CAvGcD,CAAajJ,EAAczvB,EAAYq2B,GAC3C4C,EAAiB5C,EAAStpL,MAAM06D,EAAEsxH,cACxC,GAAItxH,EAAEr/C,OAASq/C,EAAEqxH,UAAYrJ,EAAaD,SAAS/lL,OAAQ,CACvD,MAAMguL,EAAI,IAAI5F,GAAgBpC,EAAaD,SAASziL,MAAM,EAAG06D,EAAEqxH,WAAY,CAAC,GAC5ErB,SAAE1G,SAAS5B,IACP,IAAI0C,GAAgBpC,EAAaD,SAASziL,MAAM06D,EAAEqxH,WAAYrJ,EAAasB,UACxE+G,GAA2BL,EAAG,EAAGwB,EAC5C,CACK,OAAIxxH,EAAEr/C,OAAmC,IAA1B6wK,EAAexvL,OACxB,IAAIooL,GAAgBpC,EAAaD,SAAU,CAAC,GAE9C/nH,EAAEr/C,QAAUqnK,EAAaC,cACvBwJ,GAAsBzJ,EAAczvB,EAAYq2B,GAElD5uH,EAAEr/C,MACA0vK,GAA2BrI,EAAc,EAAGwJ,GAG5CC,GAAsBzJ,EAAczvB,EAAYq2B,EAE/D,CACA,SAASyB,GAA2BrI,EAAczvB,EAAYq2B,GAC1D,GAAwB,IAApBA,EAAS5sL,OACT,OAAO,IAAIooL,GAAgBpC,EAAaD,SAAU,CAAC,GAElD,CACD,MAAMqH,EAvCd,SAASsC,GAAW9C,GAChB,OAAI4B,GAAqB5B,EAAS,IACvBA,EAAS,GAAGQ,QAEhB,CAAEzB,CAACjG,IAAiBkH,EAC/B,CAkCwB8C,CAAW9C,GACrBtF,EAAW,CAAC,EAsBlB,GAAI3pL,OAAO8E,KAAK2qL,GAASnpL,KAAKqT,GAAKA,IAAMouK,KACrCM,EAAasB,SAAS5B,KAAqD,IAAlCM,EAAaqB,kBACI,IAA1DrB,EAAasB,SAAS5B,IAAgBK,SAAS/lL,OAAc,CAC7D,MAAM2vL,EAAuBtB,GAA2BrI,EAAasB,SAAS5B,IAAiBnvB,EAAYq2B,GAC3G,OAAO,IAAIxE,GAAgBpC,EAAaD,SAAU4J,EAAqBrI,SAC3E,CACA3pL,cAAO2R,QAAQ89K,GAAS1rL,QAAQ,EAAE+qL,EAAQG,MACd,iBAAbA,IACPA,EAAW,CAACA,IAEC,OAAbA,IACAtF,EAASmF,GAAU6B,GAAmBtI,EAAasB,SAASmF,GAASl2B,EAAYq2B,GAAQ,GAGjGjvL,OAAO2R,QAAQ02K,EAAasB,UAAU5lL,QAAQ,EAAEmoL,EAAat8G,WAC5B1wE,IAAzBuwL,EAAQvD,KACRvC,EAASuC,GAAet8G,KAGzB,IAAI66G,GAAgBpC,EAAaD,SAAUuB,EACtD,CACJ,CAkCA,SAASmI,GAAsBzJ,EAAczvB,EAAYq2B,GACrD,MAAM9E,EAAQ9B,EAAaD,SAASziL,MAAM,EAAGizJ,GAC7C,IAAIx1J,EAAI,EACR,KAAOA,EAAI6rL,EAAS5sL,QAAQ,CACxB,MAAMuuL,EAAU3B,EAAS7rL,GACzB,GAAIytL,GAAqBD,GAAU,CAC/B,MAAMjH,EAAWsI,GAAyBrB,EAAQnB,SAClD,OAAO,IAAIhF,GAAgBN,EAAOR,EACtC,CAEA,GAAU,IAANvmL,GAAW8sL,GAAejB,EAAS,IAAK,CAExC9E,EAAMvnL,KAAK,IAAImoL,GADL1C,EAAaD,SAASxvB,GACJxtI,KAAM1I,GAAUusK,EAAS,MACrD7rL,IACA,QACJ,CACA,MAAM65F,EAAO4zF,GAAqBD,GAAWA,EAAQnB,QAAQ1H,IAAmB,GAAE6I,IAC5E5gK,GAAQ5sB,EAAI6rL,EAAS5sL,OAAS,EAAK4sL,EAAS7rL,EAAI,GAAK,KACvD65F,GAAQjtE,IAAQkgK,GAAelgK,KAC/Bm6J,EAAMvnL,KAAK,IAAImoL,GAAW9tF,EAAMv6E,GAAUsN,MAC1C5sB,GAAK,IAGL+mL,EAAMvnL,KAAK,IAAImoL,GAAW9tF,EAAM,CAAC,IACjC75F,IAER,CACA,OAAO,IAAIqnL,GAAgBN,EAAO,CAAC,EACvC,CACA,SAAS8H,GAAyBxC,GAC9B,MAAM9F,EAAW,CAAC,EAClB3pL,cAAO2R,QAAQ89K,GAAS1rL,QAAQ,EAAE+qL,EAAQG,MACd,iBAAbA,IACPA,EAAW,CAACA,IAEC,OAAbA,IACAtF,EAASmF,GAAUgD,GAAsB,IAAIrH,GAAgB,GAAI,CAAC,GAAI,EAAGwE,GAAQ,GAGlFtF,CACX,CACA,SAASjnK,GAAUoX,GACf,MAAMnc,EAAM,CAAC,EACb3d,cAAO2R,QAAQmoB,GAAQ/1B,QAAQ,EAAE+jB,EAAG+8C,KAAOlnD,EAAImK,GAAM,GAAE+8C,KAChDlnD,CACX,CACA,SAASi0K,GAAQxmK,EAAM0O,EAAQjlB,GAC3B,OAAOuW,GAAQvW,EAAQuW,MAAQq9J,GAAa3uJ,EAAQjlB,EAAQgwH,WAChE,CAEA,MAAMqtD,GAAwB,aAyB9B,MAAMC,GACFz2L,YAEAuI,EAEA6gB,GACInpB,KAAKsI,GAAKA,EACVtI,KAAKmpB,IAAMA,CACf,EAOJ,MAAMurB,WAAwB8hJ,GAC1Bz2L,YAEAuI,EAEA6gB,EAEAksB,EAAoB,aAEpBohJ,EAAgB,MACZngK,MAAMhuB,EAAI6gB,GACVnpB,KAAKoM,KAAO,EACZpM,KAAKq1C,kBAAoBA,EACzBr1C,KAAKy2L,cAAgBA,CACzB,CAEAlyL,WACI,MAAQ,uBAAsBvE,KAAKsI,aAAatI,KAAKmpB,OACzD,EAWJ,MAAM+sB,WAAsBsgJ,GACxBz2L,YAEAuI,EAEA6gB,EAEAutK,GACIpgK,MAAMhuB,EAAI6gB,GACVnpB,KAAK02L,kBAAoBA,EACzB12L,KAAKoM,KAAO,CAChB,CAEA7H,WACI,MAAQ,qBAAoBvE,KAAKsI,aAAatI,KAAKmpB,6BAA6BnpB,KAAK02L,qBACzF,EAaJ,MAAMvgJ,WAAyBqgJ,GAC3Bz2L,YAEAuI,EAEA6gB,EAKAhY,EAMAwsB,GACIrH,MAAMhuB,EAAI6gB,GACVnpB,KAAKmR,OAASA,EACdnR,KAAK29B,KAAOA,EACZ39B,KAAKoM,KAAO,CAChB,CAEA7H,WACI,MAAQ,wBAAuBvE,KAAKsI,aAAatI,KAAKmpB,OAC1D,EAUJ,MAAMwtK,WAA0BH,GAC5Bz2L,YAEAuI,EAEA6gB,EAKAhY,EAMAwsB,GACIrH,MAAMhuB,EAAI6gB,GACVnpB,KAAKmR,OAASA,EACdnR,KAAK29B,KAAOA,EACZ39B,KAAKoM,KAAO,EAChB,EAWJ,MAAMgqC,WAAwBogJ,GAC1Bz2L,YAEAuI,EAEA6gB,EAEAuF,EAOAriB,GACIiqB,MAAMhuB,EAAI6gB,GACVnpB,KAAK0uB,MAAQA,EACb1uB,KAAKqM,OAASA,EACdrM,KAAKoM,KAAO,CAChB,CAEA7H,WACI,MAAQ,uBAAsBvE,KAAKsI,aAAatI,KAAKmpB,gBAAgBnpB,KAAK0uB,QAC9E,EAOJ,MAAMkoK,WAAyBJ,GAC3Bz2L,YAEAuI,EAEA6gB,EAEAutK,EAEA7jL,GACIyjB,MAAMhuB,EAAI6gB,GACVnpB,KAAK02L,kBAAoBA,EACzB12L,KAAK6S,MAAQA,EACb7S,KAAKoM,KAAO,CAChB,CAEA7H,WACI,MAAQ,wBAAuBvE,KAAKsI,aAAatI,KAAKmpB,6BAA6BnpB,KAAK02L,8BAA8B12L,KAAK6S,QAC/H,EASJ,MAAMgkL,WAAyBL,GAC3Bz2L,YAEAuI,EAEA6gB,EAEAutK,EAEA7jL,GACIyjB,MAAMhuB,EAAI6gB,GACVnpB,KAAK02L,kBAAoBA,EACzB12L,KAAK6S,MAAQA,EACb7S,KAAKoM,KAAO,CAChB,CACA7H,WACI,MAAQ,wBAAuBvE,KAAKsI,aAAatI,KAAKmpB,6BAA6BnpB,KAAK02L,8BAA8B12L,KAAK6S,QAC/H,EASJ,MAAMikL,WAAuBN,GACzBz2L,YAEAuI,EAEA6gB,EAEAutK,EAEA7jL,EAEAkkL,GACIzgK,MAAMhuB,EAAI6gB,GACVnpB,KAAK02L,kBAAoBA,EACzB12L,KAAK6S,MAAQA,EACb7S,KAAK+2L,eAAiBA,EACtB/2L,KAAKoM,KAAO,CAChB,CACA7H,WACI,MAAQ,sBAAqBvE,KAAKsI,aAAatI,KAAKmpB,6BAA6BnpB,KAAK02L,8BAA8B12L,KAAK6S,0BAA0B7S,KAAK+2L,iBAC5J,EAYJ,MAAMC,WAAqBR,GACvBz2L,YAEAuI,EAEA6gB,EAEAutK,EAEA7jL,GACIyjB,MAAMhuB,EAAI6gB,GACVnpB,KAAK02L,kBAAoBA,EACzB12L,KAAK6S,MAAQA,EACb7S,KAAKoM,KAAO,CAChB,CACA7H,WACI,MAAQ,oBAAmBvE,KAAKsI,aAAatI,KAAKmpB,6BAA6BnpB,KAAK02L,8BAA8B12L,KAAK6S,QAC3H,EAQJ,MAAM0iC,WAAmBihJ,GACrBz2L,YAEAuI,EAEA6gB,EAEAutK,EAEA7jL,GACIyjB,MAAMhuB,EAAI6gB,GACVnpB,KAAK02L,kBAAoBA,EACzB12L,KAAK6S,MAAQA,EACb7S,KAAKoM,KAAO,CAChB,CACA7H,WACI,MAAQ,kBAAiBvE,KAAKsI,aAAatI,KAAKmpB,6BAA6BnpB,KAAK02L,8BAA8B12L,KAAK6S,QACzH,EASJ,MAAMokL,GACFl3L,YAEAy1C,GACIx1C,KAAKw1C,MAAQA,EACbx1C,KAAKoM,KAAO,CAChB,CACA7H,WACI,MAAQ,8BAA6BvE,KAAKw1C,MAAM/lB,OACpD,EASJ,MAAMynK,GACFn3L,YAEAy1C,GACIx1C,KAAKw1C,MAAQA,EACbx1C,KAAKoM,KAAO,EAChB,CACA7H,WACI,MAAQ,4BAA2BvE,KAAKw1C,MAAM/lB,OAClD,EAUJ,MAAM0nK,GACFp3L,YAEA40E,GACI30E,KAAK20E,SAAWA,EAChB30E,KAAKoM,KAAO,EAChB,CACA7H,WAEI,MAAQ,+BADKvE,KAAK20E,SAAS/+B,aAAe51C,KAAK20E,SAAS/+B,YAAYnmB,MAAQ,MAEhF,EASJ,MAAM2nK,GACFr3L,YAEA40E,GACI30E,KAAK20E,SAAWA,EAChB30E,KAAKoM,KAAO,EAChB,CACA7H,WAEI,MAAQ,6BADKvE,KAAK20E,SAAS/+B,aAAe51C,KAAK20E,SAAS/+B,YAAYnmB,MAAQ,MAEhF,EAUJ,MAAM4nK,GACFt3L,YAEA40E,GACI30E,KAAK20E,SAAWA,EAChB30E,KAAKoM,KAAO,EAChB,CACA7H,WAEI,MAAQ,0BADKvE,KAAK20E,SAAS/+B,aAAe51C,KAAK20E,SAAS/+B,YAAYnmB,MAAQ,MAEhF,EAUJ,MAAM6nK,GACFv3L,YAEA40E,GACI30E,KAAK20E,SAAWA,EAChB30E,KAAKoM,KAAO,EAChB,CACA7H,WAEI,MAAQ,wBADKvE,KAAK20E,SAAS/+B,aAAe51C,KAAK20E,SAAS/+B,YAAYnmB,MAAQ,MAEhF,EAOJ,MAAM0vC,GACFp/D,YAEAw3L,EAEAh2H,EAEA+qE,GACItsI,KAAKu3L,YAAcA,EACnBv3L,KAAKuhE,SAAWA,EAChBvhE,KAAKssI,OAASA,EACdtsI,KAAKoM,KAAO,EAChB,CACA7H,WAEI,MAAQ,mBAAkBvE,KAAKssI,uBADnBtsI,KAAKuhE,SAAY,GAAEvhE,KAAKuhE,SAAS,OAAOvhE,KAAKuhE,SAAS,KAAO,QAE7E,EAEJ,MAAMi2H,IAEN,MAAMC,GACF13L,YAAYopB,GACRnpB,KAAKmpB,IAAMA,CACf,EA+CJ,MAAMuuK,GACF33L,cACIC,KAAKmzL,OAAS,KACdnzL,KAAKw1C,MAAQ,KACbx1C,KAAKk7G,SAAW,KAChBl7G,KAAKguL,SAAW,IAAI2J,GACpB33L,KAAK43L,UAAY,IACrB,EAEJ,IAKMD,GAAsB,MAA5B,MAAMA,EACF53L,cAEIC,KAAK0a,SAAW,IAAIxN,GACxB,CAEA2qL,qBAAqBC,EAAW3E,GAC5B,MAAMz/K,EAAU1T,KAAK+3L,mBAAmBD,GACxCpkL,EAAQy/K,OAASA,EACjBnzL,KAAK0a,SAASjN,IAAIqqL,EAAWpkL,EACjC,CAMAskL,uBAAuBF,GACnB,MAAMpkL,EAAU1T,KAAKk0D,WAAW4jI,GAC5BpkL,IACAA,EAAQy/K,OAAS,KACjBz/K,EAAQkkL,UAAY,KAE5B,CAKAK,sBACI,MAAMv9K,EAAW1a,KAAK0a,SACtB,OAAA1a,KAAK0a,SAAW,IAAIxN,IACbwN,CACX,CACAw9K,mBAAmBx9K,GACf1a,KAAK0a,SAAWA,CACpB,CACAq9K,mBAAmBD,GACf,IAAIpkL,EAAU1T,KAAKk0D,WAAW4jI,GAC9B,OAAKpkL,IACDA,EAAU,IAAIgkL,GACd13L,KAAK0a,SAASjN,IAAIqqL,EAAWpkL,IAE1BA,CACX,CACAwgD,WAAW4jI,GACP,OAAO93L,KAAK0a,SAASnN,IAAIuqL,IAAc,IAC3C,CAAC33L,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFu3L,EAAsB,EAAoDx3L,SAC5KH,KAAKg0C,WAj1CmF/yC,MAAE,CAAAgzC,MAi1CY0jJ,EAAsB50L,QAAtB40L,EAAsB30L,UAAAC,WAAc,SACtJ,OAhDK00L,CAAsB,KAsD5B,MAAMQ,GACFp4L,YAAY0yC,GACRzyC,KAAKo4L,MAAQ3lJ,CACjB,CACA,QAAIA,GACA,OAAOzyC,KAAKo4L,MAAM/tL,KACtB,CAIAwsE,OAAOz2E,GACH,MAAM2kB,EAAI/kB,KAAKq4L,aAAaj4L,GAC5B,OAAO2kB,EAAEre,OAAS,EAAIqe,EAAEA,EAAEre,OAAS,GAAK,IAC5C,CAIAsnL,SAAS5tL,GACL,MAAMupD,EAAI2uI,GAASl4L,EAAGJ,KAAKo4L,OAC3B,OAAOzuI,EAAIA,EAAEqkI,SAAS7lL,IAAI/H,GAAKA,EAAEiK,OAAS,EAC9C,CAIAsrC,WAAWv1C,GACP,MAAMupD,EAAI2uI,GAASl4L,EAAGJ,KAAKo4L,OAC3B,OAAOzuI,GAAKA,EAAEqkI,SAAStnL,OAAS,EAAIijD,EAAEqkI,SAAS,GAAG3jL,MAAQ,IAC9D,CAIAkuL,SAASn4L,GACL,MAAM2kB,EAAIyzK,GAASp4L,EAAGJ,KAAKo4L,OAC3B,OAAIrzK,EAAEre,OAAS,EACJ,GACDqe,EAAEA,EAAEre,OAAS,GAAGsnL,SAAS7lL,IAAIkG,GAAKA,EAAEhE,OACrCrC,OAAOywL,GAAMA,IAAOr4L,EACjC,CAIAi4L,aAAaj4L,GACT,OAAOo4L,GAASp4L,EAAGJ,KAAKo4L,OAAOjwL,IAAI6hD,GAAKA,EAAE3/C,MAC9C,EAGJ,SAASiuL,GAASjuL,EAAOgiD,GACrB,GAAIhiD,IAAUgiD,EAAKhiD,MACf,OAAOgiD,EACX,UAAW4nB,KAAS5nB,EAAK2hI,SAAU,CAC/B,MAAM3hI,EAAOisI,GAASjuL,EAAO4pE,GAC7B,GAAI5nB,EACA,OAAOA,CACf,CACA,OAAO,IACX,CAEA,SAASmsI,GAASnuL,EAAOgiD,GACrB,GAAIhiD,IAAUgiD,EAAKhiD,MACf,MAAO,CAACgiD,GACZ,UAAW4nB,KAAS5nB,EAAK2hI,SAAU,CAC/B,MAAMv+J,EAAO+oK,GAASnuL,EAAO4pE,GAC7B,GAAIxkD,EAAK/oB,OACL+oB,SAAK26C,QAAQ/d,GACN58B,CAEf,CACA,MAAO,EACX,CACA,MAAMipK,GACF34L,YAAYsK,EAAO2jL,GACfhuL,KAAKqK,MAAQA,EACbrK,KAAKguL,SAAWA,CACpB,CACAzpL,WACI,MAAQ,YAAWvE,KAAKqK,QAC5B,EAGJ,SAASsuL,GAAkBtsI,GACvB,MAAMlkD,EAAM,CAAC,EACb,OAAIkkD,GACAA,EAAK2hI,SAAS5lL,QAAQ6rE,GAAS9rE,EAAI8rE,EAAM5pE,MAAM8oL,QAAUl/G,GAEtD9rE,CACX,CAiCA,MAAMywL,WAAoBT,GAEtBp4L,YAAY0yC,EAEZkiC,GACIr+C,MAAMmc,GACNzyC,KAAK20E,SAAWA,EAChBkkH,GAAe74L,KAAMyyC,EACzB,CACAluC,WACI,OAAOvE,KAAK20E,SAASpwE,UACzB,EAEJ,SAASu0L,GAAiBC,EAASC,GAC/B,MAAMrkH,EAUV,SAASskH,GAAyBF,EAASC,GACvC,MAIME,EAAY,IAAIC,GAAuB,GAJzB,CAAC,EAEI,CAAC,EACT,GAFC,CAAC,EAGkF/M,GAAgB4M,EAAe,KAAM,CAAC,GAC3I,OAAO,IAAII,GAAoB,GAAI,IAAIV,GAASQ,EAAW,IAC/D,CAjBqBD,CAAyBF,EAASC,GAC7CK,EAAW,IAAIl1F,KAAgB,CAAC,IAAIirF,GAAW,GAAI,CAAC,KACpDkK,EAAc,IAAIn1F,KAAgB,CAAC,GACnCo1F,EAAY,IAAIp1F,KAAgB,CAAC,GACjCq1F,EAAmB,IAAIr1F,KAAgB,CAAC,GACxCt/D,GAAW,IAAIs/D,KAAgB,IAC/B+0F,EAAY,IAAIO,GAAeJ,EAAUC,EAAaE,EAAkB30J,GAAU00J,EAAWnN,GAAgB4M,EAAerkH,EAASliC,MAC3IymJ,SAAUvkH,SAAWA,EAASliC,KACvB,IAAImmJ,GAAY,IAAIF,GAASQ,EAAW,IAAKvkH,EACxD,CA4BA,MAAM8kH,GAEF15L,YAEA25L,EAEAC,EAEAC,EAEAC,EAEAC,EAEA3G,EAEA5iK,GAAWwpK,GACP/5L,KAAK05L,WAAaA,EAClB15L,KAAK25L,cAAgBA,EACrB35L,KAAK45L,mBAAqBA,EAC1B55L,KAAK65L,gBAAkBA,EACvB75L,KAAK85L,YAAcA,EACnB95L,KAAKmzL,OAASA,EACdnzL,KAAKuwB,UAAYA,GACjBvwB,KAAKg6L,gBAAkBD,EACvB/5L,KAAK87F,MAAQ97F,KAAK85L,aAAarlJ,QAAKtsC,MAAKiyD,IAAMA,GAAEiyH,QAAe,EAAK/+E,WAAG/pG,GAExEvD,KAAKmpB,IAAMuwK,EACX15L,KAAKm+B,OAASw7J,EACd35L,KAAKu0G,YAAcqlF,EACnB55L,KAAK6kC,SAAWg1J,EAChB75L,KAAKqP,KAAOyqL,CAChB,CAEA,eAAIlkJ,GACA,OAAO51C,KAAKg6L,gBAAgBpkJ,WAChC,CAEA,QAAInD,GACA,OAAOzyC,KAAKi6L,aAAaxnJ,IAC7B,CAEA,UAAIokC,GACA,OAAO72E,KAAKi6L,aAAapjH,OAAO72E,KACpC,CAEA,cAAI21C,GACA,OAAO31C,KAAKi6L,aAAatkJ,WAAW31C,KACxC,CAEA,YAAIguL,GACA,OAAOhuL,KAAKi6L,aAAajM,SAAShuL,KACtC,CAEA,gBAAIq4L,GACA,OAAOr4L,KAAKi6L,aAAa5B,aAAar4L,KAC1C,CAMA,YAAIk6L,GACA,OAAKl6L,KAAKm6L,YACNn6L,KAAKm6L,UAAYn6L,KAAKm+B,OAAOsW,QAAKtsC,MAAK4c,GAAMwnK,GAAkBxnK,MAE5D/kB,KAAKm6L,SAChB,CAKA,iBAAIpL,GACA,OAAK/uL,KAAKgvL,iBACNhvL,KAAKgvL,eACDhvL,KAAKu0G,YAAY9/D,QAAKtsC,MAAK4c,GAAMwnK,GAAkBxnK,MAEpD/kB,KAAKgvL,cAChB,CACAzqL,WACI,OAAOvE,KAAK20E,SAAW30E,KAAK20E,SAASpwE,WAAc,UAASvE,KAAKg6L,kBACrE,EAOJ,SAASI,GAA2B5kJ,EAAO6kJ,EAA4B,aACnE,MAAMhC,EAAe7iJ,EAAM6iJ,aAC3B,IAAIiC,EAAyB,EAC7B,GAAkC,WAA9BD,EAEA,IADAC,EAAyBjC,EAAa3xL,OAAS,EACxC4zL,GAA0B,GAAG,CAChC,MAAM/nJ,EAAU8lJ,EAAaiC,GACvBzjH,EAASwhH,EAAaiC,EAAyB,GAErD,GAAI/nJ,EAAQqD,aAA4C,KAA7BrD,EAAQqD,YAAYnmB,KAC3C6qK,YAGMzjH,EAAOtmD,UAIb,MAHA+pK,GAGA,CAER,CAEJ,OAGJ,SAASC,GAAiBlC,GACtB,OAAOA,EAAapiL,OAAO,CAAC+L,EAAKs/E,KAItB,CAAEnjE,OAHM,IAAKnc,EAAImc,UAAWmjE,EAAKnjE,QAGvB9uB,KAFJ,IAAK2S,EAAI3S,QAASiyF,EAAKjyF,MAEb4B,QADP,IAAKqwF,EAAKjyF,QAAS2S,EAAI/Q,WAAYqwF,EAAK1rD,aAAavmC,QAASiyF,EAAKk5F,iBAEpF,CAAEr8J,OAAQ,CAAC,EAAG9uB,KAAM,CAAC,EAAG4B,QAAS,CAAC,GACzC,CAVWspL,CAAiBlC,EAAaruL,MAAMswL,GAC/C,CAiCA,MAAMnB,GAEF,SAAIr9F,GAGA,OAAO97F,KAAKqP,OAAOg9K,GACvB,CAEAtsL,YAEAopB,EAoBAgV,EAEAo2E,EAEA1vE,EAEAx1B,EAEA8jL,EAEA5iK,GAAWqlB,EAAa3kC,IACpBjR,KAAKmpB,IAAMA,EACXnpB,KAAKm+B,OAASA,EACdn+B,KAAKu0G,YAAcA,EACnBv0G,KAAK6kC,SAAWA,EAChB7kC,KAAKqP,KAAOA,EACZrP,KAAKmzL,OAASA,EACdnzL,KAAKuwB,UAAYA,GACjBvwB,KAAK41C,YAAcA,EACnB51C,KAAKgS,SAAWf,EACpB,CAEA,QAAIwhC,GACA,OAAOzyC,KAAKi6L,aAAaxnJ,IAC7B,CAEA,UAAIokC,GACA,OAAO72E,KAAKi6L,aAAapjH,OAAO72E,KACpC,CAEA,cAAI21C,GACA,OAAO31C,KAAKi6L,aAAatkJ,WAAW31C,KACxC,CAEA,YAAIguL,GACA,OAAOhuL,KAAKi6L,aAAajM,SAAShuL,KACtC,CAEA,gBAAIq4L,GACA,OAAOr4L,KAAKi6L,aAAa5B,aAAar4L,KAC1C,CACA,YAAIk6L,GACA,OAAKl6L,KAAKm6L,YACNn6L,KAAKm6L,UAAY5N,GAAkBvsL,KAAKm+B,SAErCn+B,KAAKm6L,SAChB,CACA,iBAAIpL,GACA,OAAK/uL,KAAKgvL,iBACNhvL,KAAKgvL,eAAiBzC,GAAkBvsL,KAAKu0G,cAE1Cv0G,KAAKgvL,cAChB,CACAzqL,WAGI,MAAQ,cAFIvE,KAAKmpB,IAAIhhB,IAAI+Q,GAAWA,EAAQ3U,YAAY6C,KAAK,gBAC7CpH,KAAK41C,YAAc51C,KAAK41C,YAAYnmB,KAAO,MAE/D,EA6BJ,MAAM2pK,WAA4BjB,GAE9Bp4L,YAEAopB,EAAKspB,GACDnc,MAAMmc,GACNzyC,KAAKmpB,IAAMA,EACX0vK,GAAe74L,KAAMyyC,EACzB,CACAluC,WACI,OAAO6tD,GAAcpyD,KAAKo4L,MAC9B,EAEJ,SAASS,GAAehmL,EAAOw5C,GAC3BA,EAAKhiD,MAAM4vL,aAAepnL,EAC1Bw5C,EAAK2hI,SAAS5lL,QAAQiG,GAAKwqL,GAAehmL,EAAOxE,GACrD,CACA,SAAS+jD,GAAc/F,GACnB,MAAMh+C,EAAIg+C,EAAK2hI,SAAStnL,OAAS,EAAK,MAAK2lD,EAAK2hI,SAAS7lL,IAAIiqD,IAAehrD,KAAK,WAAa,GAC9F,MAAQ,GAAEilD,EAAKhiD,QAAQgE,GAC3B,CAMA,SAASosL,GAAsBjlJ,GAC3B,GAAIA,EAAMm/B,SAAU,CAChB,MAAM+lH,EAAkBllJ,EAAMm/B,SACxBgmH,EAAenlJ,EAAMwkJ,gBAC3BxkJ,EAAMm/B,SAAWgmH,EACZ7N,GAAa4N,EAAgBnmF,YAAaomF,EAAapmF,cACxD/+D,EAAMokJ,mBAAmBvlK,KAAKsmK,EAAapmF,aAE3CmmF,EAAgB71J,WAAa81J,EAAa91J,UAC1C2Q,EAAMqkJ,gBAAgBxlK,KAAKsmK,EAAa91J,UAEvCioJ,GAAa4N,EAAgBv8J,OAAQw8J,EAAax8J,SACnDqX,EAAMmkJ,cAActlK,KAAKsmK,EAAax8J,QAvmElD,SAASy8J,GAAmB/1K,EAAGC,GAC3B,GAAID,EAAEne,SAAWoe,EAAEpe,OACf,OAAO,EACX,QAASe,EAAI,EAAGA,EAAIod,EAAEne,SAAUe,EAC5B,IAAKqlL,GAAajoK,EAAEpd,GAAIqd,EAAErd,IACtB,OAAO,EAEf,OAAO,CACX,CAimEamzL,CAAmBF,EAAgBvxK,IAAKwxK,EAAaxxK,MACtDqsB,EAAMkkJ,WAAWrlK,KAAKsmK,EAAaxxK,KAElC2jK,GAAa4N,EAAgBrrL,KAAMsrL,EAAatrL,OACjDmmC,EAAMskJ,YAAYzlK,KAAKsmK,EAAatrL,KAE5C,MAEImmC,EAAMm/B,SAAWn/B,EAAMwkJ,gBAEvBxkJ,EAAMskJ,YAAYzlK,KAAKmhB,EAAMwkJ,gBAAgB3qL,KAErD,CACA,SAASwrL,GAA0Bh2K,EAAGC,GAClC,MAAMg2K,EAAiBhO,GAAajoK,EAAEsZ,OAAQrZ,EAAEqZ,SA71DpD,SAAS48J,GAAcpjI,EAAI63H,GACvB,OAAO3B,GAAUl2H,EAAI63H,IAAO73H,EAAGy1H,MAAM,CAACvoK,EAAGpd,IAAMqlL,GAAajoK,EAAEqkH,WAAYsmD,EAAG/nL,GAAGyhI,YACpF,CA21D+D6xD,CAAcl2K,EAAEsE,IAAKrE,EAAEqE,KAElF,OAAO2xK,MADkBj2K,EAAEgyD,SAAY/xD,EAAE+xD,WAEnChyD,EAAEgyD,QAAUgkH,GAA0Bh2K,EAAEgyD,OAAQ/xD,EAAE+xD,QAC5D,CAEA,IAmDMmkH,GAAY,MAAlB,MAAMA,EACFj7L,cACIC,KAAKk5L,UAAY,KACjBl5L,KAAKi7L,gBAAkB,KAMvBj7L,KAAK+D,KAAOqoL,GACZpsL,KAAKk7L,eAAiB,IAAIrmF,MAC1B70G,KAAKm7L,iBAAmB,IAAItmF,MAK5B70G,KAAKo7L,aAAe,IAAIvmF,MAKxB70G,KAAKq7L,aAAe,IAAIxmF,MACxB70G,KAAKs7L,kBAAiB9oF,OAAOmlF,IAC7B33L,KAAKkzB,YAAWs/E,OAAOq4D,OACvB7qK,KAAKu7L,kBAAiB/oF,OAAO+mE,OAC7Bv5K,KAAK6xJ,uBAAsBr/C,OAAOmnC,OAClC35I,KAAKw7L,eAAchpF,OAAOipF,GAAc,CAAE54E,UAAU,IAEpD7iH,KAAK07L,kCAAmC,CAC5C,CAEA,yBAAIC,GACA,OAAO37L,KAAKk5L,SAChB,CAEAl+E,YAAYnC,GACR,GAAIA,EAAQ90G,KAAS,CACjB,MAAQ02H,cAAa/3E,iBAAkBm2D,EAAQ90G,KAC/C,GAAI02H,EAGA,OAGAz6H,KAAK47L,0BAA0Bl5I,KAC/B1iD,KAAK67L,aACL77L,KAAKs7L,eAAetD,uBAAuBt1I,IAG/C1iD,KAAK87L,0BACT,CACJ,CAEAtlJ,cAEQx2C,KAAK47L,0BAA0B57L,KAAK+D,OACpC/D,KAAKs7L,eAAetD,uBAAuBh4L,KAAK+D,MAEpD/D,KAAKw7L,aAAaO,yBAAyB/7L,KAC/C,CACA47L,0BAA0B1J,GACtB,OAAOlyL,KAAKs7L,eAAepnI,WAAWg+H,IAAaiB,SAAWnzL,IAClE,CAEAg8F,WACIh8F,KAAK87L,0BACT,CACAA,2BAEI,GADA97L,KAAKs7L,eAAezD,qBAAqB73L,KAAK+D,KAAM/D,MAChDA,KAAKk5L,UACL,OAIJ,MAAMxlL,EAAU1T,KAAKs7L,eAAepnI,WAAWl0D,KAAK+D,MAChD2P,GAAS8hC,QACL9hC,EAAQkkL,UAER53L,KAAKg8L,OAAOtoL,EAAQkkL,UAAWlkL,EAAQ8hC,OAIvCx1C,KAAKi8L,aAAavoL,EAAQ8hC,MAAO9hC,EAAQwnG,UAGrD,CACA,eAAIghF,GACA,QAASl8L,KAAKk5L,SAClB,CAKA,aAAI3oK,GACA,IAAKvwB,KAAKk5L,UACN,MAAM,IAAIt1E,MAAc,MAAuFC,GACnH,OAAO7jH,KAAKk5L,UAAUpoF,QAC1B,CACA,kBAAIqrF,GACA,IAAKn8L,KAAKk5L,UACN,MAAM,IAAIt1E,MAAc,MAAuFC,GACnH,OAAO7jH,KAAKi7L,eAChB,CACA,sBAAImB,GACA,OAAIp8L,KAAKi7L,gBACEj7L,KAAKi7L,gBAAgBtmH,SAAStlE,KAElC,CAAC,CACZ,CAIA8gJ,SACI,IAAKnwJ,KAAKk5L,UACN,MAAM,IAAIt1E,MAAc,MAAuFC,GACnH7jH,KAAKkzB,SAASi9H,SACd,MAAMksC,EAAMr8L,KAAKk5L,UACjB,OAAAl5L,KAAKk5L,UAAY,KACjBl5L,KAAKi7L,gBAAkB,KACvBj7L,KAAKq7L,aAAa/hL,KAAK+iL,EAAIvrF,UACpBurF,CACX,CAIAL,OAAO5hE,EAAK+hE,GACRn8L,KAAKk5L,UAAY9+D,EACjBp6H,KAAKi7L,gBAAkBkB,EACvBn8L,KAAKkzB,SAAS+4I,OAAO7xC,EAAI6B,UACzBj8H,KAAKw7L,aAAac,oCAAoCt8L,MACtDA,KAAKo7L,aAAa9hL,KAAK8gH,EAAItpB,SAC/B,CACA+qF,aACI,GAAI77L,KAAKk5L,UAAW,CAChB,MAAM7qL,EAAIrO,KAAKuwB,UACfvwB,KAAKk5L,UAAUtjH,UACf51E,KAAKk5L,UAAY,KACjBl5L,KAAKi7L,gBAAkB,KACvBj7L,KAAKm7L,iBAAiB7hL,KAAKjL,EAC/B,CACJ,CACA4tL,aAAaE,EAAgBtqC,GACzB,GAAI7xJ,KAAKk8L,YACL,MAAM,IAAIt4E,MAAc,MAA2FC,GAGvH7jH,KAAKi7L,gBAAkBkB,EACvB,MAAMjpK,EAAWlzB,KAAKkzB,SAEhB3C,EADW4rK,EAAexnH,SACLpkD,UACrBgsK,GAAgBv8L,KAAKs7L,eAAevD,mBAAmB/3L,KAAK+D,MAAMiqL,SAClE9yE,EAAW,IAAIshF,GAAeL,EAAgBI,GAAerpK,EAASgoF,UAC5El7G,KAAKk5L,UAAYhmK,EAASu4I,gBAAgBl7I,EAAW,CACjDjd,MAAO4f,EAASxsB,OAChBw0G,WACA22C,oBAAqBA,GAAuB7xJ,KAAK6xJ,sBAIrD7xJ,KAAKu7L,eAAerrC,eACpBlwJ,KAAKw7L,aAAac,oCAAoCt8L,MACtDA,KAAKk7L,eAAe5hL,KAAKtZ,KAAKk5L,UAAUpoF,SAC5C,CAAC3wG,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF46L,EAAY,EAAmD76L,SACjKH,KAAK43G,UAvhEmF32G,MAAE,CAAAmL,KAuhEJ4uL,EAAYz6L,UAAA,oBAAAC,OAAA,CAAAuD,KAAA,QAAA8uH,QAAA,CAAAqoE,eAAA,WAAAC,iBAAA,aAAAC,aAAA,SAAAC,aAAA,UAAAzoE,SAAA,WAAA/a,YAAA,EAAAsD,SAAA,CAvhEVl6G,SAwhEpG,OArKK+5L,CAAY,KA4LlB,MAAMwB,GACFz8L,YAAYy1C,EAAO+mJ,EAAe1lH,GAC9B72E,KAAKw1C,MAAQA,EACbx1C,KAAKu8L,cAAgBA,EACrBv8L,KAAK62E,OAASA,CAClB,CACAtpE,IAAI0mC,EAAO+2E,GACP,OAAI/2E,IAAUwlJ,GACHz5L,KAAKw1C,MAEZvB,IAAU0jJ,GACH33L,KAAKu8L,cAETv8L,KAAK62E,OAAOtpE,IAAI0mC,EAAO+2E,EAClC,EAEJ,MAAMywE,GAAe,IAAIrpF,MAAe,IACxC,IAcMqqF,GAA0B,MAAhC,MAAMA,EACF18L,cACIC,KAAK08L,wBAA0B,IAAIxvL,GACvC,CACAovL,oCAAoCnJ,GAChCnzL,KAAK+7L,yBAAyB5I,GAC9BnzL,KAAK28L,qBAAqBxJ,EAC9B,CACA4I,yBAAyB5I,GACrBnzL,KAAK08L,wBAAwBnvL,IAAI4lL,IAAS18I,cAC1Cz2C,KAAK08L,wBAAwBj1K,OAAO0rK,EACxC,CACAwJ,qBAAqBxJ,GACjB,MAAQgJ,kBAAmBhJ,EACrByJ,KAAmBpzF,MAAc,CACnC2yF,EAAe5nF,YACf4nF,EAAeh+J,OACfg+J,EAAe9sL,OAEdolC,QAAKq7D,MAAU,EAAEyE,EAAap2E,EAAQ9uB,IAAOiE,KAC9CjE,GAAO,IAAKklG,KAAgBp2E,KAAW9uB,IAGzB,IAAViE,GAAU,EACHg6F,MAAGj+F,IAKPsvE,QAAQ1tE,QAAQ5B,OAEtBknC,UAAUlnC,IAGX,IAAK8jL,EAAO+I,cAAgB/I,EAAOwI,uBAC/BxI,EAAOgJ,iBAAmBA,GAA+C,OAA7BA,EAAe5rK,UAE3D,YADAvwB,KAAK+7L,yBAAyB5I,GAGlC,MAAMniI,KAASivH,OAAqBkc,EAAe5rK,WACnD,GAAKygC,EAIL,UAAakgG,mBAAkBlgG,EAAOxwD,OAClC2yL,EAAOwI,sBAAsB3mE,SAASk8B,GAAc7hJ,EAAK6hJ,UAJzDlxJ,KAAK+7L,yBAAyB5I,EAIwC,GAG9EnzL,KAAK08L,wBAAwBjvL,IAAI0lL,EAAQyJ,EAC7C,CAACz8L,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFq8L,EAA0B,EAAoDt8L,SAChLH,KAAKg0C,WAjoEmF/yC,MAAE,CAAAgzC,MAioEYwoJ,EAA0B15L,QAA1B05L,EAA0Bz5L,YAC5I,OApDKy5L,CAA0B,KA6DhC,SAASI,GAAWC,EAAoBx7F,EAAMy7F,GAE1C,GAAIA,GAAaD,EAAmBE,iBAAiB17F,EAAKj3F,MAAO0yL,EAAU1yL,MAAMsqE,UAAW,CACxF,MAAMtqE,EAAQ0yL,EAAU1yL,MACxBA,EAAM2vL,gBAAkB14F,EAAKj3F,MAC7B,MAAM2jL,EAmBd,SAASiP,GAAsBH,EAAoBx7F,EAAMy7F,GACrD,OAAOz7F,EAAK0sF,SAAS7lL,IAAI8rE,IACrB,UAAWlvD,KAAKg4K,EAAU/O,SACtB,GAAI8O,EAAmBE,iBAAiB/oH,EAAM5pE,MAAO0a,EAAE1a,MAAMsqE,UACzD,OAAOkoH,GAAWC,EAAoB7oH,EAAOlvD,GAGrD,OAAO83K,GAAWC,EAAoB7oH,EAAK,EAEnD,CA5ByBgpH,CAAsBH,EAAoBx7F,EAAMy7F,GACjE,OAAO,IAAIrE,GAASruL,EAAO2jL,EAC/B,CACK,CACD,GAAI8O,EAAmBI,aAAa57F,EAAKj3F,OAAQ,CAE7C,MAAM8yL,EAAsBL,EAAmBM,SAAS97F,EAAKj3F,OAC7D,GAA4B,OAAxB8yL,EAA8B,CAC9B,MAAMpN,EAAOoN,EAAoB3nJ,MACjCu6I,SAAK1lL,MAAM2vL,gBAAkB14F,EAAKj3F,MAClC0lL,EAAK/B,SAAW1sF,EAAK0sF,SAAS7lL,IAAIkG,IAAKwuL,GAAWC,EAAoBzuL,KAC/D0hL,CACX,CACJ,CACA,MAAM1lL,EAed,SAASgzL,GAAqBhvL,GAC1B,OAAO,IAAIorL,GAAe,IAAIt1F,KAAgB91F,EAAE8a,KAAM,IAAIg7E,KAAgB91F,EAAE8vB,QAAS,IAAIgmE,KAAgB91F,EAAEkmG,aAAc,IAAIpQ,KAAgB91F,EAAEw2B,UAAW,IAAIs/D,KAAgB91F,EAAEgB,MAAOhB,EAAE8kL,OAAQ9kL,EAAEkiB,UAAWliB,EAClN,CAjBsBgvL,CAAqB/7F,EAAKj3F,OAClC2jL,EAAW1sF,EAAK0sF,SAAS7lL,IAAIkG,GAAKwuL,GAAWC,EAAoBzuL,IACvE,OAAO,IAAIqqL,GAASruL,EAAO2jL,EAC/B,CACJ,CAeA,MAAMsP,GAA6B,6BACnC,SAASC,GAA2BC,EAAeC,GAC/C,MAAQ9gG,aAAY+gG,6BAA8B9K,GAAU6K,GAAY,CAAE9gG,WAAY8gG,EAAUC,+BAA2Bn6L,GAAck6L,EACnI/uK,EAAQivK,IAAyB95E,EAAwE,EAA6C45E,GAC5J/uK,SAAMvF,IAAMwzE,EACZjuE,EAAMgvK,0BAA4BA,EAC3BhvK,CACX,CACA,SAASivK,GAAyB3xL,EAAS2xB,EAAMigK,GAC7C,MAAMlvK,EAAQ,IAAI9pB,MAAM,8BAAgCoH,GAAW,KACnE0iB,SAAM4uK,KAA8B,EACpC5uK,EAAMmvK,iBAAmBlgK,EACrBigK,IACAlvK,EAAMvF,IAAMy0K,GAETlvK,CACX,CAIA,SAASovK,GAA6BpvK,GAClC,OAAOA,GAASA,EAAM4uK,GAC1B,CAEA,IASMS,GAAqB,MAA3B,MAAMA,EAAsB59L,SACfH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF29L,EAAqB,EAAmD59L,SAC1KH,KAAKotH,UAptEmFnsH,MAAE,CAAAmL,KAotEJ2xL,EAAqBx9L,UAAA,mBAAAs3G,YAAA,EAAAsD,SAAA,CAptEnBl6G,OAAEN,MAAA,EAAAC,KAAA,EAAAE,SAAA,SAAAC,EAAAC,GAAA,EAAAD,GAAFE,MAAE,kBAotEyH,EAAA8wH,aAAA,CAA6DipE,IAAY9oE,cAAA,IACxS,OAHK6rE,CAAqB,KA+I3B,SAASC,GAAkBz3H,GACvB,MAAMynH,EAAWznH,EAAEynH,UAAYznH,EAAEynH,SAAS7lL,IAAI61L,IACxC3vL,EAAI2/K,EAAW,IAAKznH,EAAGynH,YAAa,IAAKznH,GAC/C,OAAMl4D,EAAEkiB,YAAcliB,EAAE4vL,gBAAmBjQ,GAAY3/K,EAAE+tF,eACpD/tF,EAAE8kL,QAAU9kL,EAAE8kL,SAAW/G,KAC1B/9K,EAAEkiB,UAAYwtK,IAEX1vL,CACX,CAEA,SAAS6vL,GAAU1oJ,GACf,OAAOA,EAAM29I,QAAU/G,EAC3B,CAsBA,SAAS+R,GAAwBxpH,GAC7B,IAAKA,EACD,OAAO,KAIX,GAAIA,EAAS/+B,aAAa0xH,UACtB,OAAO3yF,EAAS/+B,YAAY0xH,UAEhC,QAASt9G,EAAI2qB,EAASkC,OAAQ7sB,EAAGA,EAAIA,EAAE6sB,OAAQ,CAC3C,MAAMrhC,EAAQwU,EAAEpU,YAKhB,GAAIJ,GAAO4oJ,gBACP,OAAO5oJ,EAAM4oJ,gBACjB,GAAI5oJ,GAAO8xH,UACP,OAAO9xH,EAAM8xH,SACrB,CACA,OAAO,IACX,CAQA,MAAM+2B,GACFt+L,YAAY+8L,EAAoBwB,EAAaC,EAAWC,EAAcC,GAClEz+L,KAAK88L,mBAAqBA,EAC1B98L,KAAKs+L,YAAcA,EACnBt+L,KAAKu+L,UAAYA,EACjBv+L,KAAKw+L,aAAeA,EACpBx+L,KAAKy+L,oBAAsBA,CAC/B,CACAC,SAASpD,GACL,MAAMqD,EAAa3+L,KAAKs+L,YAAYlG,MAC9BwG,EAAW5+L,KAAKu+L,UAAYv+L,KAAKu+L,UAAUnG,MAAQ,KACzDp4L,KAAK6+L,sBAAsBF,EAAYC,EAAUtD,GACjDb,GAAsBz6L,KAAKs+L,YAAY7rJ,MACvCzyC,KAAK8+L,oBAAoBH,EAAYC,EAAUtD,EACnD,CAEAuD,sBAAsBE,EAAYC,EAAUtkL,GACxC,MAAMszK,EAAW2K,GAAkBqG,GAEnCD,EAAW/Q,SAAS5lL,QAAQ62L,IACxB,MAAMC,EAAkBD,EAAY50L,MAAM8oL,OAC1CnzL,KAAKm/L,iBAAiBF,EAAajR,EAASkR,GAAkBxkL,UACvDszK,EAASkR,EAAe,GAGnC76L,OAAOoK,OAAOu/K,GAAU5lL,QAAS8gE,IAC7BlpE,KAAKo/L,8BAA8Bl2H,EAAGxuD,EAAQ,EAEtD,CACAykL,iBAAiBJ,EAAYC,EAAUK,GACnC,MAAMC,EAASP,EAAW10L,MACpBi3F,EAAO09F,EAAWA,EAAS30L,MAAQ,KACzC,GAAIi1L,IAAWh+F,EAEX,GAAIg+F,EAAO/uK,UAAW,CAElB,MAAM7c,EAAU2rL,EAAcnrI,WAAWorI,EAAOnM,QAC5Cz/K,GACA1T,KAAK6+L,sBAAsBE,EAAYC,EAAUtrL,EAAQs6K,SAEjE,MAGIhuL,KAAK6+L,sBAAsBE,EAAYC,EAAUK,QAIjD/9F,GAEAthG,KAAKo/L,8BAA8BJ,EAAUK,EAGzD,CACAD,8BAA8B5pJ,EAAO8lJ,GAG7B9lJ,EAAMnrC,MAAMkmB,WAAavwB,KAAK88L,mBAAmByC,aAAa/pJ,EAAMnrC,MAAMsqE,UAC1E30E,KAAKw/L,2BAA2BhqJ,EAAO8lJ,GAGvCt7L,KAAKy/L,yBAAyBjqJ,EAAO8lJ,EAE7C,CACAkE,2BAA2BhqJ,EAAO8lJ,GAC9B,MAAM5nL,EAAU4nL,EAAepnI,WAAW1e,EAAMnrC,MAAM8oL,QAChDz4K,EAAWhH,GAAW8hC,EAAMnrC,MAAMkmB,UAAY7c,EAAQs6K,SAAWsN,EACjEtN,EAAW2K,GAAkBnjJ,GACnC,UAAW+6I,KAAelsL,OAAO8E,KAAK6kL,GAClChuL,KAAKo/L,8BAA8BpR,EAASuC,GAAc71K,GAE9D,GAAIhH,GAAWA,EAAQy/K,OAAQ,CAC3B,MAAMnnB,EAAet4J,EAAQy/K,OAAOhjC,SAC9Bz1I,GAAWhH,EAAQs6K,SAASiK,sBAClCj4L,KAAK88L,mBAAmB3hE,MAAM3lF,EAAMnrC,MAAMsqE,SAAU,CAAEq3F,eAAcx2H,QAAO96B,aAC/E,CACJ,CACA+kL,yBAAyBjqJ,EAAO8lJ,GAC5B,MAAM5nL,EAAU4nL,EAAepnI,WAAW1e,EAAMnrC,MAAM8oL,QAGhDz4K,EAAWhH,GAAW8hC,EAAMnrC,MAAMkmB,UAAY7c,EAAQs6K,SAAWsN,EACjEtN,EAAW2K,GAAkBnjJ,GACnC,UAAW+6I,KAAelsL,OAAO8E,KAAK6kL,GAClChuL,KAAKo/L,8BAA8BpR,EAASuC,GAAc71K,GAE1DhH,IACIA,EAAQy/K,SAERz/K,EAAQy/K,OAAO0I,aAEfnoL,EAAQs6K,SAASiK,uBAKrBvkL,EAAQkkL,UAAY,KACpBlkL,EAAQ8hC,MAAQ,KAExB,CACAspJ,oBAAoBC,EAAYC,EAAUtkL,GACtC,MAAMszK,EAAW2K,GAAkBqG,GACnCD,EAAW/Q,SAAS5lL,QAAQiG,IACxBrO,KAAK0/L,eAAerxL,EAAG2/K,EAAS3/K,EAAEhE,MAAM8oL,QAASz4K,GACjD1a,KAAKw+L,aAAa,IAAIlH,GAAcjpL,EAAEhE,MAAMsqE,UAAS,GAErDoqH,EAAW/Q,SAAStnL,QACpB1G,KAAKw+L,aAAa,IAAIpH,GAAmB2H,EAAW10L,MAAMsqE,UAElE,CACA+qH,eAAeX,EAAYC,EAAU1D,GACjC,MAAMgE,EAASP,EAAW10L,MACpBi3F,EAAO09F,EAAWA,EAAS30L,MAAQ,KAGzC,GAFAowL,GAAsB6E,GAElBA,IAAWh+F,EACX,GAAIg+F,EAAO/uK,UAAW,CAElB,MAAM7c,EAAU4nL,EAAevD,mBAAmBuH,EAAOnM,QACzDnzL,KAAK8+L,oBAAoBC,EAAYC,EAAUtrL,EAAQs6K,SAC3D,MAGIhuL,KAAK8+L,oBAAoBC,EAAYC,EAAU1D,QAAc,GAI7DgE,EAAO/uK,UAAW,CAElB,MAAM7c,EAAU4nL,EAAevD,mBAAmBuH,EAAOnM,QACzD,GAAInzL,KAAK88L,mBAAmBI,aAAaoC,EAAO3qH,UAAW,CACvD,MAAMgrH,GAAS3/L,KAAK88L,mBAAmBM,SAASkC,EAAO3qH,UACvD30E,KAAK88L,mBAAmB3hE,MAAMmkE,EAAO3qH,SAAU,MAC/CjhE,EAAQs6K,SAASkK,mBAAmByH,GAAOjlL,UAC3ChH,EAAQkkL,UAAY+H,GAAO3zB,aAC3Bt4J,EAAQ8hC,MAAQmqJ,GAAOnqJ,MAAMnrC,MACzBqJ,EAAQy/K,QAGRz/K,EAAQy/K,OAAO6I,OAAO2D,GAAO3zB,aAAc2zB,GAAOnqJ,MAAMnrC,OAE5DowL,GAAsBkF,GAAOnqJ,MAAMnrC,OACnCrK,KAAK8+L,oBAAoBC,EAAY,KAAMrrL,EAAQs6K,SACvD,KACK,CACD,MAAM9yE,GAAWijF,GAAwBmB,EAAO3qH,UAChDjhE,EAAQkkL,UAAY,KACpBlkL,EAAQ8hC,MAAQ8pJ,EAChB5rL,EAAQwnG,SAAWA,GACfxnG,EAAQy/K,QAGRz/K,EAAQy/K,OAAO8I,aAAaqD,EAAQ5rL,EAAQwnG,UAEhDl7G,KAAK8+L,oBAAoBC,EAAY,KAAMrrL,EAAQs6K,SACvD,CACJ,MAGIhuL,KAAK8+L,oBAAoBC,EAAY,KAAMzD,EAavD,EAGJ,MAAMsE,GACF7/L,YAAY0vB,GACRzvB,KAAKyvB,KAAOA,EACZzvB,KAAKw1C,MAAQx1C,KAAKyvB,KAAKzvB,KAAKyvB,KAAK/oB,OAAS,EAC9C,EAEJ,MAAMm5L,GACF9/L,YAAYwwB,EAAWilB,GACnBx1C,KAAKuwB,UAAYA,EACjBvwB,KAAKw1C,MAAQA,CACjB,EAEJ,SAASsqJ,GAAkBR,EAAQh+F,EAAMg6F,GACrC,MAAMqD,EAAaW,EAAOlH,MAE1B,OAAO2H,GAAoBpB,EADVr9F,EAAOA,EAAK82F,MAAQ,KACYkD,EAAgB,CAACqD,EAAWt0L,OACjF,CAOA,SAAS21L,GAA2BC,EAAiB/kF,GACjD,MAAMmoB,EAAYp4B,SACZ54F,EAAS6oG,EAAS3tG,IAAI0yL,EAAiB58D,GAC7C,OAAIhxH,IAAWgxH,EACoB,mBAApB48D,IAAkC,EAACC,OAAcD,GAMjD/kF,EAAS3tG,IAAI0yL,GAJbA,EAOR5tL,CACX,CACA,SAAS0tL,GAAoBhB,EAAYC,EAAUtkL,EAAUylL,EAAYC,EAAS,CAC9EC,oBAAqB,GACrBC,kBAAmB,KAEnB,MAAMC,EAAe5H,GAAkBqG,GAEvCD,SAAW/Q,SAAS5lL,QAAQiG,KAShC,SAASmyL,GAAezB,EAAYC,EAAU1D,EAAgB6E,EAAYC,EAAS,CAC/EC,oBAAqB,GACrBC,kBAAmB,KAEnB,MAAMhB,EAASP,EAAW10L,MACpBi3F,EAAO09F,EAAWA,EAAS30L,MAAQ,KACnCqJ,GAAU4nL,EAAiBA,EAAepnI,WAAW6qI,EAAW10L,MAAM8oL,QAAU,KAEtF,GAAI7xF,GAAQg+F,EAAO1pJ,cAAgB0rD,EAAK1rD,YAAa,CACjD,MAAM6qJ,EAqCd,SAASC,GAA4Bp/F,EAAMg+F,EAAQzvE,GAC/C,GAAoB,mBAATA,EACP,OAAOA,EAAKvuB,EAAMg+F,GAEtB,OAAQzvE,GACJ,IAAK,mBACD,OAAQg+D,GAAUvsF,EAAKn4E,IAAKm2K,EAAOn2K,KACvC,IAAK,gCACD,OAAQ0kK,GAAUvsF,EAAKn4E,IAAKm2K,EAAOn2K,OAC9B2jK,GAAaxrF,EAAKiT,YAAa+qF,EAAO/qF,aAC/C,IAAK,SACD,OAAO,EACX,IAAK,4BACD,OAAQsmF,GAA0Bv5F,EAAMg+F,KACnCxS,GAAaxrF,EAAKiT,YAAa+qF,EAAO/qF,aAE/C,QACI,OAAQsmF,GAA0Bv5F,EAAMg+F,GAEpD,CAxD0BoB,CAA4Bp/F,EAAMg+F,EAAQA,EAAO1pJ,YAAY+qJ,uBAC3EF,EACAL,EAAOE,kBAAkBr5L,KAAK,IAAI24L,GAAYO,KAI9Cb,EAAOjwL,KAAOiyF,EAAKjyF,KACnBiwL,EAAO9E,cAAgBl5F,EAAKk5F,eAI5BuF,GAAoBhB,EAAYC,EADhCM,EAAO/uK,UACmC7c,GAAUA,GAAQs6K,SAAW,KAI7BsN,EAJmC6E,EAAYC,GAMzFK,GAAa/sL,IAAWA,GAAQy/K,QAAUz/K,GAAQy/K,OAAO+I,aACzDkE,EAAOC,oBAAoBp5L,KAAK,IAAI44L,GAAcnsL,GAAQy/K,OAAO5iK,UAAW+wE,GAEpF,MAEQA,GACA89F,GAA8BJ,EAAUtrL,GAAS0sL,GAErDA,EAAOE,kBAAkBr5L,KAAK,IAAI24L,GAAYO,IAG1CJ,GAAoBhB,EAAY,KADhCO,EAAO/uK,UAC+B7c,GAAUA,GAAQs6K,SAAW,KAI7BsN,EAJmC6E,EAAYC,EAQjG,EArDQI,CAAenyL,EAAGkyL,EAAalyL,EAAEhE,MAAM8oL,QAASz4K,EAAUylL,EAAW/kL,OAAO,CAAC/M,EAAEhE,QAAS+1L,UACjFG,EAAalyL,EAAEhE,MAAM8oL,OAAM,GAGtC9uL,OAAO2R,QAAQuqL,GACVn4L,QAAQ,EAAE+jB,EAAG+8C,MAAOk2H,GAA8Bl2H,GAAGxuD,EAASw5C,WAAW/nC,GAAIi0K,IAC3EA,CACX,CAmEA,SAAShB,GAA8B5pJ,EAAO9hC,EAAS0sL,GACnD,MAAMpS,EAAW2K,GAAkBnjJ,GAC7B+wB,EAAI/wB,EAAMnrC,MAChBhG,OAAO2R,QAAQg4K,GAAU5lL,QAAQ,EAAE0vL,EAAWzrI,MAKtC+yI,GAA8B/yI,EAJ7Bka,EAAEh2C,UAGE7c,EAC+BA,EAAQs6K,SAAS95H,WAAW4jI,GAG5B,KANApkL,EAGwC0sL,EAHzB,GAavDA,EAAOC,oBAAoBp5L,KAAK,IAAI44L,GAJnCt5H,EAAEh2C,WAGE7c,GAAWA,EAAQy/K,QAAUz/K,EAAQy/K,OAAO+I,YACCxoL,EAAQy/K,OAAO5iK,UAHf,KAG0Bg2C,GAKpF,CAeA,SAAS8+B,GAAWn8B,GAChB,MAAoB,mBAANA,CAClB,CAyBA,SAAS03H,GAAa1uL,GAClB,OAAOA,aAAa64K,IAA0B,eAAZ74K,GAAGnO,IACzC,CAEA,MAAM88L,GAAgC51F,OAAO,iBAC7C,SAAS61F,KACL,SAAOhxF,MAAUxD,MACN9C,MAAc8C,EAAInkG,IAAI6V,GAAKA,EAAEy2B,KAAKm3I,GAAK,GE/qG/C,SAASmV,MAAatyL,GACzB,MAAMg7F,KAAYC,OAAaj7F,GAC/B,SAAOm8F,MAAQ,CAAC1/F,EAAQq5F,MACnBkF,EAAYruF,GAAO3M,EAAQvD,EAAQu+F,GAAaruF,GAAO3M,EAAQvD,IAASqrC,UAAUguD,EAAU,EAErG,CF0qG0Dw8F,CAAUF,OACvDpsJ,QAAKtsC,MAAK64L,IACX,UAAW3uL,KAAU2uL,EACjB,IAAe,IAAX3uL,EAIC,IAAIA,IAAWwuL,GAEhB,OAAOA,GAEN,IAAe,IAAXxuL,GAAoBA,aAAkBw8K,GAI3C,OAAOx8K,EAIf,OAAO,KACV,EAAGrK,MAAQ0F,GAASA,IAASmzL,IAAgBjV,GAAK,IAE3D,CA0HA,SAASqV,GAAkBzD,GACvB,SAAO/oJ,SAAKE,MAAKtiC,IACb,GAAKugL,GAAUvgL,GAEf,MAAMkrL,GAA2BC,EAAenrL,EAAM,IACzD,EAAGlK,MAAIkK,IAAqB,IAAXA,GACtB,CAgBA,MAAM6uL,GACFnhM,YAAY2sL,GACR1sL,KAAK0sL,aAAeA,GAAgB,IACxC,EAEJ,MAAMyU,GACFphM,YAAYg5L,GACR/4L,KAAK+4L,QAAUA,CACnB,EAEJ,SAASqI,GAAU1U,GACf,SAAOn/E,MAAW,IAAI2zF,GAAQxU,GAClC,CACA,SAAS2U,GAAiBC,GACtB,SAAO/zF,MAAW,IAAI4zF,GAAiBG,GAC3C,CASA,MAAMC,GACFxhM,YAAYy9L,EAAezE,GACvB/4L,KAAKw9L,cAAgBA,EACrBx9L,KAAK+4L,QAAUA,CACnB,CACAyI,aAAatvL,GACT,OAAO,IAAI0xG,MAAc,MAA2EC,EAExG,CACA49E,mBAAmBjsJ,EAAOujJ,GACtB,IAAI/2K,EAAM,GACN3T,EAAI0qL,EAAQtmJ,KAChB,OAAa,CAET,GADAzwB,EAAMA,EAAI5G,OAAO/M,EAAEo+K,UACQ,IAAvBp+K,EAAE0/K,iBACF,SAAOzgF,MAAGtrF,GAEd,GAAI3T,EAAE0/K,iBAAmB,IAAM1/K,EAAE2/K,SAAS5B,IACtC,OAzBZ,EAAO7+E,MAAW,IAAIqW,MAAc,KAAwFC,IA2BpHx1G,EAAIA,EAAE2/K,SAAS5B,GACnB,CACJ,CACAsV,sBAAsBjV,EAAU9vF,EAAYiwF,GACxC,OAAO5sL,KAAK2hM,2BAA2BhlG,EAAY38F,KAAKw9L,cAAc3vJ,MAAM8uD,GAAa8vF,EAAUG,EACvG,CACA+U,2BAA2BhlG,EAAYo8F,EAAStM,EAAUG,GACtD,MAAM2I,EAAUv1L,KAAK4hM,mBAAmBjlG,EAAYo8F,EAAQtmJ,KAAMg6I,EAAUG,GAC5E,OAAO,IAAIiC,GAAQ0G,EAASv1L,KAAK6hM,kBAAkB9I,EAAQxkF,YAAav0G,KAAK+4L,QAAQxkF,aAAcwkF,EAAQl0J,SAC/G,CACAg9J,kBAAkBC,EAAkBC,GAChC,MAAM//K,EAAM,CAAC,EACb3d,cAAO2R,QAAQ8rL,GAAkB15L,QAAQ,EAAE+jB,EAAG+8C,MAE1C,GADqC,iBAANA,GAAkBA,EAAEhhD,WAAW,KACzC,CACjB,MAAM85K,GAAa94H,EAAE5xD,UAAU,GAC/B0K,EAAImK,GAAK41K,EAAaC,GAC1B,MAEIhgL,EAAImK,GAAK+8C,IAGVlnD,CACX,CACA4/K,mBAAmBjlG,EAAY83F,EAAOhI,EAAUG,GAC5C,MAAMqV,EAAkBjiM,KAAKkiM,eAAevlG,EAAY83F,EAAMhI,SAAUA,EAAUG,GAClF,IAAIoB,EAAW,CAAC,EAChB3pL,cAAO2R,QAAQy+K,EAAMzG,UAAU5lL,QAAQ,EAAErE,GAAMkwE,MAC3C+5G,EAASjqL,IAAQ/D,KAAK4hM,mBAAmBjlG,EAAY1oB,EAAOw4G,EAAUG,EAAS,GAE5E,IAAIkC,GAAgBmT,EAAiBjU,EAChD,CACAkU,eAAevlG,EAAYwlG,EAAoBC,EAAgBxV,GAC3D,OAAOuV,EAAmBh6L,IAAI6hD,GAAKA,EAAEv6B,KAAKvH,WAAW,KAAOloB,KAAKqiM,aAAa1lG,EAAY3yC,EAAG4iI,GACzF5sL,KAAKsiM,aAAat4I,EAAGo4I,GAC7B,CACAC,aAAa1lG,EAAY4lG,EAAsB3V,GAC3C,MAAM39H,EAAM29H,EAAU2V,EAAqB9yK,KAAKnY,UAAU,IAC1D,IAAK23C,EACD,MAAM,IAAI20D,MAAc,MAAmFC,GAE/G,OAAO50D,CACX,CACAqzI,aAAaC,EAAsBH,GAC/B,IAAI1iF,EAAM,EACV,UAAW11D,KAAKo4I,EAAgB,CAC5B,GAAIp4I,EAAEv6B,OAAS8yK,EAAqB9yK,KAChC2yK,SAAe16K,OAAOg4F,GACf11D,EAEX01D,GACJ,CACA,OAAO6iF,CACX,EAGJ,MAAMzM,GAAU,CACZ0M,SAAS,EACTC,iBAAkB,GAClBC,kBAAmB,GACnBx5D,WAAY,CAAC,EACby5D,wBAAyB,CAAC,GAE9B,SAASC,GAAgBlW,EAAcl3I,EAAOi3I,EAAUvxE,EAAUsiF,GAC9D,MAAMnrL,EAASgT,GAAMqnK,EAAcl3I,EAAOi3I,GAC1C,OAAKp6K,EAAOmwL,SAKZtnF,EA9zBJ,SAAS2nF,GAAiCrtJ,EAAOstJ,GAC7C,OAAIttJ,EAAMmxE,YAAcnxE,EAAM8xH,YAC1B9xH,EAAM8xH,aACFF,OAA0B5xH,EAAMmxE,UAAWm8E,EAAkB,UAASttJ,EAAM/lB,SAE7E+lB,EAAM8xH,WAAaw7B,CAC9B,CAwzBeD,CAAiCrtJ,EAAO0lE,GAjIvD,SAAS6nF,GAAkB7nF,EAAU1lE,EAAOi3I,EAAU+Q,GAClD,MAAMwF,EAAWxtJ,EAAMwtJ,SACvB,IAAKA,GAAgC,IAApBA,EAASt8L,OACtB,SAAO4mG,OAAG,GACd,MAAM21F,EAAsBD,EAAS76L,IAAI+6L,IACrC,MAAMC,GAAQnD,GAA2BkD,EAAgBhoF,GAIzD,OAAOmyE,GAhLf,SAAS+V,GAAWD,GAChB,OAAOA,GAAS99F,GAAW89F,EAAMH,SACrC,CA2KyBI,CAAWD,IACxBA,GAAMH,SAASxtJ,EAAOi3I,GACtBvxE,EAASsI,aAAa,IAAM2/E,GAAM3tJ,EAAOi3I,IACX,GAEtC,SAAOn/E,MAAG21F,GACLxuJ,KAAKqsJ,KAAyBG,KACvC,CAqHW8B,CAAkB7nF,EAAU1lE,EAAOi3I,GACrCh4I,QAAKtsC,MAAK+gE,IAAY,IAANA,EAAa72D,EAAS,IAAKyjL,QAAU,EAN/CxoF,MAAGj7F,EAOlB,CACA,SAASgT,GAAMqnK,EAAcl3I,EAAOi3I,GAChC,GAAmB,KAAfj3I,EAAM/lB,KACN,MAAwB,SAApB+lB,EAAMonD,YAAyB8vF,EAAaC,eAAiBF,EAAS/lL,OAAS,GACxE,IAAKovL,IAET,CACH0M,SAAS,EACTC,iBAAkB,GAClBC,kBAAmBjW,EACnBvjD,WAAY,CAAC,EACby5D,wBAAyB,CAAC,GAIlC,MAAM3gL,GADUwzB,EAAM6tJ,SAAW7W,IACbC,EAAUC,EAAcl3I,GAC5C,IAAKxzB,EACD,MAAO,IAAK8zK,IAChB,MAAMlJ,EAAY,CAAC,EACnBvoL,OAAO2R,QAAQgM,EAAI4qK,WAAa,CAAC,GAAGxkL,QAAQ,EAAE+jB,GAAG+8C,MAC7C0jH,EAAUzgK,IAAK+8C,EAAEz5C,OAErB,MAAMy5G,EAAalnH,EAAI6qK,SAASnmL,OAAS,EACrC,IAAKkmL,KAAc5qK,EAAI6qK,SAAS7qK,EAAI6qK,SAASnmL,OAAS,GAAGwiI,YACzD0jD,EACJ,MAAO,CACH4V,SAAS,EACTC,iBAAkBzgL,EAAI6qK,SACtB6V,kBAAmBjW,EAASziL,MAAMgY,EAAI6qK,SAASnmL,QAE/CwiI,aACAy5D,wBAAyB3gL,EAAI4qK,WAAa,CAAC,EAEnD,CACA,SAASrkL,GAAMmkL,EAAc+V,EAAkBa,EAAgBnvJ,GAC3D,OAAImvJ,EAAe58L,OAAS,GAkChC,SAAS68L,GAAyC7W,EAAc4W,EAAgBnnG,GAC5E,OAAOA,EAAOxxF,KAAK47D,GAAKi9H,GAAe9W,EAAc4W,EAAgB/8H,IAAM23H,GAAU33H,KAAO6lH,GAChG,CAnCQmX,CAAyC7W,EAAc4W,EAAgBnvJ,GAEhE,CAAEu4I,aADC,IAAIoC,GAAgB2T,EAAkBgB,GAA4BtvJ,EAAQ,IAAI26I,GAAgBwU,EAAgB5W,EAAasB,YAC3GsV,eAAgB,IAEhB,IAA1BA,EAAe58L,QAgCvB,SAASg9L,GAAyBhX,EAAc4W,EAAgBnnG,GAC5D,OAAOA,EAAOxxF,KAAK47D,GAAKi9H,GAAe9W,EAAc4W,EAAgB/8H,GACzE,CAjCQm9H,CAAyBhX,EAAc4W,EAAgBnvJ,GAEhD,CAAEu4I,aADC,IAAIoC,GAAgBpC,EAAaD,SAAUkX,GAAgCjX,EAAc+V,EAAkBa,EAAgBnvJ,EAAQu4I,EAAasB,WAChIsV,kBAGvB,CAAE5W,aADC,IAAIoC,GAAgBpC,EAAaD,SAAUC,EAAasB,UACxCsV,iBAC9B,CACA,SAASK,GAAgCjX,EAAc+V,EAAkBa,EAAgBnnG,EAAQ6xF,GAC7F,MAAMhsK,EAAM,CAAC,EACb,UAAWukD,KAAK41B,EACZ,GAAIqnG,GAAe9W,EAAc4W,EAAgB/8H,KAAOynH,EAASkQ,GAAU33H,IAAK,CAC5E,MAAMvc,GAAI,IAAI8kI,GAAgB,GAAI,CAAC,GACnC9sK,EAAIk8K,GAAU33H,IAAMvc,EACxB,CAEJ,MAAO,IAAKgkI,KAAahsK,EAC7B,CACA,SAASyhL,GAA4BtnG,EAAQynG,GACzC,MAAM5hL,EAAM,CAAC,EACbA,EAAIoqK,IAAkBwX,EACtB,UAAWr9H,KAAK41B,EACZ,GAAe,KAAX51B,EAAE92C,MAAeyuK,GAAU33H,KAAO6lH,GAAgB,CAClD,MAAMpiI,EAAI,IAAI8kI,GAAgB,GAAI,CAAC,GACnC9sK,EAAIk8K,GAAU33H,IAAMvc,CACxB,CAEJ,OAAOhoC,CACX,CAOA,SAASwhL,GAAe9W,EAAc4W,EAAgB/8H,GAClD,SAAKmmH,EAAaC,eAAiB2W,EAAe58L,OAAS,IAAsB,SAAhB6/D,EAAEq2B,YAGjD,KAAXr2B,EAAE92C,IACb,CAmCA,MAAMo0K,GACF9jM,YAAYm7G,EAAU4oF,EAAcC,EAAmB5vJ,EAAQ4kJ,EAASsB,EAA2BmD,IAC/Fx9L,KAAKk7G,SAAWA,EAChBl7G,KAAK8jM,aAAeA,EACpB9jM,KAAK+jM,kBAAoBA,EACzB/jM,KAAKm0C,OAASA,EACdn0C,KAAK+4L,QAAUA,EACf/4L,KAAKq6L,0BAA4BA,EACjCr6L,KAAKw9L,cAAgBA,GACrBx9L,KAAKgkM,gBAAiB,EACtBhkM,KAAKikM,eAAiB,IAAI1C,GAAevhM,KAAKw9L,cAAex9L,KAAK+4L,QACtE,CACAyI,aAAatvL,GACT,OAAO,IAAI0xG,MAAc,MAA2EC,EAExG,CACAqgF,YACI,MAAMnR,EAAmBxqL,GAAMvI,KAAK+4L,QAAQtmJ,KAAM,GAAI,GAAIzyC,KAAKm0C,QAAQu4I,aACvE,OAAO1sL,KAAKmkM,oBAAoBnkM,KAAKk7G,SAAUl7G,KAAKm0C,OAAQ4+I,EAAkB3G,IACzE33I,QAAKu5D,MAAY97F,IAClB,GAAIA,aAAaivL,GAGb,OAAAnhM,KAAKgkM,gBAAiB,EACtBhkM,KAAK+4L,QAAU7mL,EAAE6mL,QACV/4L,KAAKqlB,MAAMnT,EAAE6mL,SAExB,MAAI7mL,aAAagvL,GACPlhM,KAAKwhM,aAAatvL,GAEtBA,KACT,EAAG/J,MAAI6lL,IAGJ,MAAMv7I,EAAO,IAAI0mJ,GAAuB,GAAI90L,OAAO0hE,OAAO,CAAC,GAAI1hE,OAAO0hE,OAAO,IAAK/lE,KAAK+4L,QAAQxkF,cAAgBv0G,KAAK+4L,QAAQl0J,SAAU,CAAC,EAAGunJ,GAAgBpsL,KAAK+jM,kBAAmB,KAAM,CAAC,GACnLK,EAAW,IAAI1L,GAASjmJ,EAAMu7I,GAC9BqW,EAAa,IAAIjL,GAAoB,GAAIgL,GACzCrU,EAnxFlB,SAASuU,GAA0BjR,EAAYC,EAAU/+E,EAAc,KAAM1vE,EAAW,MAEpF,OAAOuuJ,GAD2BP,GAA4BQ,GACEC,EAAU/+E,EAAa1vE,EAC3F,CAgxFyBy/J,CAA0B7xJ,EAAM,GAAIzyC,KAAK+4L,QAAQxkF,YAAav0G,KAAK+4L,QAAQl0J,UAIxFkrJ,SAAKx7E,YAAcv0G,KAAK+4L,QAAQxkF,YAChC8vF,EAAWl7K,IAAMnpB,KAAKw9L,cAActO,UAAUa,GAC9C/vL,KAAKukM,qBAAqBF,EAAWjM,OAC9B,CAAEvlL,MAAOwxL,EAAYtU,OAAK,GAEzC,CACA1qK,MAAM0qK,GAEF,OADkB/vL,KAAKmkM,oBAAoBnkM,KAAKk7G,SAAUl7G,KAAKm0C,OAAQ47I,EAAKt9I,KAAM25I,IACjE33I,QAAKu5D,MAAY97F,IAC9B,MAAIA,aAAagvL,GACPlhM,KAAKwhM,aAAatvL,GAEtBA,IAEd,CACAqyL,qBAAqBC,GACjB,MAAMhvJ,EAAQgvJ,EAAUn6L,MAClB5C,EAAI2yL,GAA2B5kJ,EAAOx1C,KAAKq6L,2BACjD7kJ,EAAMrX,OAAS95B,OAAO0hE,OAAOt+D,EAAE02B,QAC/BqX,EAAMnmC,KAAOhL,OAAO0hE,OAAOt+D,EAAE4H,MAC7Bm1L,EAAUxW,SAAS5lL,QAAQuhD,GAAK3pD,KAAKukM,qBAAqB56I,GAC9D,CACAw6I,oBAAoBjpF,EAAU/mE,EAAQu4I,EAAcyG,GAChD,OAAqC,IAAjCzG,EAAaD,SAAS/lL,QAAgBgmL,EAAaC,cAC5C3sL,KAAK80L,gBAAgB55E,EAAU/mE,EAAQu4I,GAE3C1sL,KAAKykM,eAAevpF,EAAU/mE,EAAQu4I,EAAcA,EAAaD,SAAU0G,GAAQ,EAC9F,CASA2B,gBAAgB55E,EAAU/mE,EAAQu4I,GAG9B,MAAMuG,EAAe,GACrB,UAAWh/G,KAAS5vE,OAAO8E,KAAKujL,EAAasB,UAC3B,YAAV/5G,EACAg/G,EAAa7oH,QAAQ6J,GAGrBg/G,EAAahsL,KAAKgtE,GAG1B,SAAOvuD,MAAKutK,GACPx+I,QAAK25D,KAAUmiF,IAChB,MAAMt8G,EAAQy4G,EAAasB,SAASuC,GAI9BmU,GAx4BlB,SAASC,GAAsBxoG,EAAQ+1F,GACnC,MAAMwS,EAAevoG,EAAOn0F,OAAOu+D,GAAK23H,GAAU33H,KAAO2rH,GACzDwS,SAAaz9L,QAAQk1F,EAAOn0F,OAAOu+D,GAAK23H,GAAU33H,KAAO2rH,IAClDwS,CACX,CAo4BiCC,CAAsBxwJ,EAAQo8I,GACnD,OAAOvwL,KAAKmkM,oBAAoBjpF,EAAUwpF,GAAczwH,EAAOs8G,EAAW,GG9pH/E,SAASqU,GAAKC,EAAaC,GAC9B,SAAOl6F,MCFJ,SAASm6F,GAAcF,EAAaC,EAAME,EAASC,EAAYC,GAClE,MAAO,CAACh6L,EAAQq5F,KACZ,IAAI4gG,GAAWH,EACXnyL,EAAQiyL,EACRxxL,GAAQ,EACZpI,EAAOqrC,aAAU+zD,MAAyB/F,EAAal6F,KACnD,MAAM5C,GAAI6L,KACVT,EAAQsyL,GAEAN,EAAYhyL,EAAOxI,GAAO5C,KAExB09L,IAAW,EAAO96L,IAC5B46L,GAAc1gG,EAAWlwE,KAAKxhB,EAAK,EACpCqyL,SAEKC,IAAY5gG,EAAWlwE,KAAKxhB,GAC5B0xF,EAAWhvC,UACf,IAAG,CAEf,CDjBmBwvI,CAAcF,EAAaC,EAAM7lK,UAAUv4B,QAAU,GAAG,GAC3E,CH6pHYk+L,CAAK,CAAC5W,EAAUoX,KAChBpX,EAAS/mL,QAAQm+L,GACVpX,IACPlC,GAAe,MK9pHpB,SAAS1lG,GAAKyoB,EAAW2B,GAC5B,MAAM07E,EAAkBjtJ,UAAUv4B,QAAU,EAC5C,OAAQwE,GAAWA,EAAOupC,KAAKo6D,KAAY7mG,MAAO,CAACkhE,EAAGzhE,IAAMonG,EAAU3lC,EAAGzhE,EAAGyD,IAAW++F,KAAUkiF,GAAS,GAAID,EAAkBJ,GAAet7E,GAAgBw7E,GAAa,IAAM,IAAIjB,IAC1L,CL2pHkCsa,IAAO,EAAG/2F,MAAS0/E,IACzC,GAAiB,OAAbA,EACA,OAAOoT,GAAU1U,GAIrB,MAAM4Y,EAAiBC,GAAsBvX,GAM7CwX,OA6JZ,SAASA,GAA4BC,GACjCA,EAAM7gL,KAAK,CAACC,EAAGC,IACPD,EAAExa,MAAM8oL,SAAW/G,IACZ,EACPtnK,EAAEza,MAAM8oL,SAAW/G,GACZ,EACJvnK,EAAExa,MAAM8oL,OAAOuS,cAAc5gL,EAAEza,MAAM8oL,QAEpD,CArKYqS,CAA4BF,IAAc,EACnCh4F,MAAGg4F,EAAc,GAEhC,CACAb,eAAevpF,EAAU/e,EAAQuwF,EAAcD,EAAU0G,EAAQ6Q,GAC7D,SAAOt+K,MAAKy2E,GAAQ1nD,QAAK25D,KAAU7nC,IACxBvmE,KACF2lM,2BAA2Bp/H,GAAE+gG,WAAapsD,EAAU/e,EAAQ51B,GAAGmmH,EAAcD,EAAU0G,EAAQ6Q,GAC/FvvJ,QAAKu5D,MAAY97F,IAClB,GAAIA,aAAagvL,GACb,SAAO5zF,MAAG,MAEd,MAAMp7F,MAEVi0E,EAAOhyB,MAAQA,KAAC,EAAG65C,MAAW97F,KAC9B,GAAI0uL,GAAa1uL,IACb,OAxIhB,SAAS0zL,GAAiBlZ,EAAcD,EAAU0G,GAC9C,OAA2B,IAApB1G,EAAS/lL,SAAiBgmL,EAAasB,SAASmF,EAC3D,CAsIoByS,CAAiBlZ,EAAcD,EAAU0G,IAAM,EACxC7lF,MAAG,IAEP8zF,GAAU1U,GAErB,MAAMx6K,KAEd,CACAyzL,2BAA2BzqF,EAAU/e,EAAQ3mD,EAAOqwJ,EAAYpZ,EAAU0G,EAAQ6Q,IAC9E,OAtKR,SAAS8B,GAAiBtwJ,EAAOqwJ,EAAYpZ,EAAU0G,GAYnD,SAAI+K,GAAU1oJ,KAAW29I,GACpBA,IAAW/G,IAAmBoX,GAAeqC,EAAYpZ,EAAUj3I,MAGrD,OAAfA,EAAM/lB,MAGHpK,GAAMwgL,EAAYrwJ,EAAOi3I,GAAU+V,QAC9C,CAkJasD,CAAiBtwJ,EAAOqwJ,EAAYpZ,EAAU0G,QAE1B5vL,IAArBiyC,EAAMmnD,WACC38F,KAAK+lM,yBAAyB7qF,EAAU2qF,EAAYrwJ,EAAOi3I,EAAU0G,EAAQ6Q,IAEpFA,IAAkBhkM,KAAKgkM,eAChBhkM,KAAKgmM,uCAAuC9qF,EAAU2qF,EAAY1pG,EAAQ3mD,EAAOi3I,EAAU0G,GAE/FiO,GAAUyE,GAPNzE,GAAUyE,EAQzB,CACAG,uCAAuC9qF,EAAUwxE,EAAcvwF,EAAQ3mD,EAAOi3I,EAAU0G,GACpF,MAAmB,OAAf39I,EAAM/lB,KACCzvB,KAAKimM,kDAAkD/qF,EAAU/e,EAAQ3mD,EAAO29I,GAEpFnzL,KAAKkmM,8CAA8ChrF,EAAUwxE,EAAcvwF,EAAQ3mD,EAAOi3I,EAAU0G,EAC/G,CACA8S,kDAAkD/qF,EAAU/e,EAAQ3mD,EAAO29I,GACvE,MAAMmO,EAAUthM,KAAKikM,eAAevC,sBAAsB,GAAIlsJ,EAAMmnD,WAAY,CAAC,GACjF,OAAInnD,EAAMmnD,WAAWz0E,WAAW,KACrBm5K,GAAiBC,GAErBthM,KAAKikM,eAAexC,mBAAmBjsJ,EAAO8rJ,GAChD7sJ,QAAK65D,MAAU63F,IAChB,MAAM1R,GAAQ,IAAI3F,GAAgBqX,EAAa,CAAC,GAChD,OAAOnmM,KAAKykM,eAAevpF,EAAU/e,EAAQs4F,GAAO0R,EAAahT,GAAQ,EAAK,GAEtF,CACA+S,8CAA8ChrF,EAAUwxE,EAAcvwF,EAAQ3mD,EAAOi3I,EAAU0G,GAC3F,MAAQqP,WAASC,mBAAkBC,qBAAmBC,4BAA4Bt9K,GAAMqnK,EAAcl3I,EAAOi3I,GAC7G,IAAK+V,GACD,OAAOpB,GAAU1U,GACrB,MAAM4U,GAAUthM,KAAKikM,eAAevC,sBAAsBe,EAAkBjtJ,EAAMmnD,WAAYgmG,IAC9F,OAAIntJ,EAAMmnD,WAAWz0E,WAAW,KACrBm5K,GAAiBC,IAErBthM,KAAKikM,eAAexC,mBAAmBjsJ,EAAO8rJ,IAChD7sJ,QAAK65D,MAAU63F,IACTnmM,KAAKykM,eAAevpF,EAAU/e,EAAQuwF,EAAcyZ,GAAY/qL,OAAOsnL,IAAoBvP,GAAQ,IAElH,CACA4S,yBAAyB7qF,EAAU2qF,EAAYrwJ,EAAOi3I,EAAU0G,EAAQ6Q,GACpE,IAAIt6C,GACJ,GAAmB,OAAfl0G,EAAM/lB,KAAe,CACrB,MAAM0O,EAASsuJ,EAAS/lL,OAAS,EAAI0/E,GAAKqmG,GAAUvjD,WAAa,CAAC,EAC5Dv0D,GAAW,IAAIwkH,GAAuB1M,EAAUtuJ,EAAQ95B,OAAO0hE,OAAO,IAAK/lE,KAAK+4L,QAAQxkF,cAAgBv0G,KAAK+4L,QAAQl0J,SAAUuhK,GAAQ5wJ,GAAQ0oJ,GAAU1oJ,GAAQA,EAAMjlB,WAAailB,EAAM6wJ,kBAAoB,KAAM7wJ,EAAO8wJ,GAAW9wJ,IAC5Ok0G,MAAcp8C,MAAG,CACb34B,YACA8tH,iBAAkB,GAClBC,kBAAmB,KAMvBmD,EAAW7X,SAAW,CAAC,CAC3B,MAEItkC,GACIk5C,GAAgBiD,EAAYrwJ,EAAOi3I,EAAUvxE,GACxCzmE,QAAKtsC,MAAI,EAAGq6L,UAASC,oBAAkBC,qBAAmBx5D,iBACtDs5D,EAIE,CAAE7tH,SADQ,IAAIwkH,GAAuBsJ,GAAkBv5D,GAAY7kI,OAAO0hE,OAAO,IAAK/lE,KAAK+4L,QAAQxkF,cAAgBv0G,KAAK+4L,QAAQl0J,SAAUuhK,GAAQ5wJ,GAAQ0oJ,GAAU1oJ,GAAQA,EAAMjlB,WAAailB,EAAM6wJ,kBAAoB,KAAM7wJ,EAAO8wJ,GAAW9wJ,IACrOitJ,oBAAkBC,sBAH1B,OAMvB,OAAOh5C,GAAYj1G,QAAKq7D,MAAWz9F,GAChB,OAAXA,EACO+uL,GAAUyE,GAId7lM,KAAKumM,eADZrrF,EAAW1lE,EAAM8xH,WAAapsD,EACO1lE,EAAOi3I,GACvCh4I,QAAKq7D,MAAU,EAAG3T,OAAQqqG,OAC3B,MAAMC,GAAgBjxJ,EAAM4oJ,iBAAmBljF,GACvCvmC,YAAU8tH,oBAAkBC,sBAAsBrwL,GAClDq6K,gBAAc4W,mBAAmB/6L,GAAMs9L,EAAYpD,GAAkBC,GAAmB8D,IAChG,GAA8B,IAA1BlD,GAAe58L,QAAgBgmL,GAAaC,cAC5C,OAAO3sL,KAAK80L,gBAAgB2R,GAAeD,GAAa9Z,IACnDj4I,QAAKtsC,MAAI6lL,IACO,OAAbA,GACO,KAEJ,CAAC,IAAI0K,GAAS/jH,GAAUq5G,OAGvC,GAA2B,IAAvBwY,GAAY9/L,QAA0C,IAA1B48L,GAAe58L,OAC3C,SAAO4mG,MAAG,CAAC,IAAIorF,GAAS/jH,GAAU,MAEtC,MAAM+xH,GAAkBxI,GAAU1oJ,KAAW29I,EAS7C,OAAOnzL,KACFykM,eAAegC,GAAeD,GAAa9Z,GAAc4W,GAAgBoD,GAAkBta,GAAiB+G,GAAQ,GACpH1+I,QAAKtsC,MAAI6lL,IACH,CAAC,IAAI0K,GAAS/jH,GAAUq5G,MACjC,KAGd,CACAuY,eAAerrF,EAAU1lE,EAAOi3I,GAC5B,OAAIj3I,EAAMw4I,YAEC1gF,MAAG,CAAEnR,OAAQ3mD,EAAMw4I,SAAU9yE,aAEpC1lE,EAAM4mD,kBAEsB74F,IAAxBiyC,EAAMmxJ,eAAkBpjM,EACjB+pG,MAAG,CAAEnR,OAAQ3mD,EAAMmxJ,cAAezrF,SAAU1lE,EAAM4oJ,kBAzgBzE,SAASwI,GAAiB1rF,EAAU1lE,EAAOi3I,EAAU+Q,GACjD,MAAMqJ,EAAUrxJ,EAAMqxJ,QACtB,QAAgBtjM,IAAZsjM,GAA4C,IAAnBA,EAAQngM,OACjC,SAAO4mG,OAAG,GAEd,MAAMw5F,EAAqBD,EAAQ1+L,IAAK+6L,IACpC,MAAMC,GAAQnD,GAA2BkD,EAAgBhoF,GAIzD,OAAOmyE,GAvKf,SAAS0Z,GAAU5D,GACf,OAAOA,GAAS99F,GAAW89F,EAAM0D,QACrC,CAkKyBE,CAAU5D,IACvBA,GAAM0D,QAAQrxJ,EAAOi3I,GACrBvxE,EAASsI,aAAa,IAAM2/E,GAAM3tJ,EAAOi3I,IACX,GAEtC,SAAOn/E,MAAGw5F,GACLryJ,KAAKqsJ,KAAyBG,KACvC,CA6fmB2F,CAAiB1rF,EAAU1lE,EAAOi3I,GACpCh4I,QAAK65D,MAAU04F,GACZA,EACOhnM,KAAK8jM,aAAa1nG,aAAa8e,EAAU1lE,GAC3Cf,QAAKE,MAAKsyJ,IACXzxJ,EAAMmxJ,cAAgBM,EAAI9qG,OAC1B3mD,EAAM4oJ,gBAAkB6I,EAAI/rF,YAxdpD,SAASgsF,GAAa1xJ,GAClB,SAAO+3D,MAAWowF,IAA8D95E,EACkB,GACtG,CAwduBqjF,MACT,EAEC55F,MAAG,CAAEnR,OAAQ,GAAI+e,YAC5B,EAWJ,SAASisF,GAAmB96I,GACxB,MAAMlY,EAASkY,EAAKhiD,MAAMurC,YAC1B,OAAOzB,GAA0B,KAAhBA,EAAO1kB,IAC5B,CAMA,SAAS81K,GAAsBE,GAC3B,MAAMpzL,EAAS,GAET+0L,EAAc,IAAIhlI,IACxB,UAAW/V,KAAQo5I,EAAO,CACtB,IAAK0B,GAAmB96I,GAAO,CAC3Bh6C,EAAOpL,KAAKolD,GACZ,QACJ,CACA,MAAMg7I,EAAyBh1L,EAAOie,KAAKg3K,GAAcj7I,EAAKhiD,MAAMurC,cAAgB0xJ,EAAWj9L,MAAMurC,kBACtEryC,IAA3B8jM,GACAA,EAAuBrZ,SAAS/mL,QAAQolD,EAAK2hI,UAC7CoZ,EAAY7/K,IAAI8/K,IAGhBh1L,EAAOpL,KAAKolD,EAEpB,CAKA,UAAWk7I,KAAcH,EAAa,CAClC,MAAM9B,EAAiBC,GAAsBgC,EAAWvZ,UACxD37K,EAAOpL,KAAK,IAAIyxL,GAAS6O,EAAWl9L,MAAOi7L,GAC/C,CACA,OAAOjzL,EAAOrK,OAAO2hD,IAAMy9I,EAAY9/K,IAAIqiC,GAC/C,CAcA,SAASy8I,GAAQ5wJ,GACb,OAAOA,EAAMnmC,MAAQ,CAAC,CAC1B,CACA,SAASi3L,GAAW9wJ,GAChB,OAAOA,EAAMvkC,SAAW,CAAC,CAC7B,CAyDA,SAASu2L,EAAerzJ,GACpB,MAA+B,iBAAjBA,EAAO2nD,OAAuC,OAAjB3nD,EAAO2nD,KACtD,CAQA,SAAS2rG,GAAUpzK,GACf,SAAOy7E,MAAU5mC,IACb,MAAMw+H,EAAarzK,EAAK60C,GACxB,OAAIw+H,KACOhiL,MAAKgiL,GAAYjzJ,QAAKtsC,MAAI,IAAM+gE,KAAE,EAEtCokC,MAAGpkC,EAAC,EAEnB,CAYA,MAAMy+H,GAAS,IAAIv1F,MAAe,UAAU,IACtCw1F,GAAkB,MAAxB,MAAMA,EACF7nM,cACIC,KAAK6nM,iBAAmB,IAAI38K,QAC5BlrB,KAAK8nM,gBAAkB,IAAI58K,QAC3BlrB,KAAK+nM,YAAWv1F,OAAOo/D,MAC3B,CACAqsB,cAAczoJ,GACV,GAAIx1C,KAAK6nM,iBAAiBt6L,IAAIioC,GAC1B,OAAOx1C,KAAK6nM,iBAAiBt6L,IAAIioC,GAEhC,GAAIA,EAAM6wJ,iBACX,SAAO/4F,MAAG93D,EAAM6wJ,kBAEhBrmM,KAAKgoM,qBACLhoM,KAAKgoM,oBAAoBxyJ,GAE7B,MAAMyyJ,EAAa5a,GAAmB73I,EAAMyoJ,iBACvCxpJ,QAAKtsC,MAAI+/L,KAAwB,EAAGvzJ,MAAIpkB,IACrCvwB,KAAKmoM,mBACLnoM,KAAKmoM,kBAAkB3yJ,GAI3BA,EAAM6wJ,iBAAmB91K,KAC5B,EAAGu+E,MAAS,KACT9uG,KAAK6nM,iBAAiBpgL,OAAO+tB,EAAK,IAGhC4yJ,EAAS,IAAI5c,GAAsByc,EAAY,IAAM,IAAI7jG,MAAW3vD,KAAKvT,MAC/E,OAAAlhC,KAAK6nM,iBAAiBp6L,IAAI+nC,EAAO4yJ,GAC1BA,CACX,CACAhsG,aAAag1D,EAAgB57G,GACzB,GAAIx1C,KAAK8nM,gBAAgBv6L,IAAIioC,GACzB,OAAOx1C,KAAK8nM,gBAAgBv6L,IAAIioC,GAE/B,GAAIA,EAAMmxJ,cACX,SAAOr5F,MAAG,CAAEnR,OAAQ3mD,EAAMmxJ,cAAezrF,SAAU1lE,EAAM4oJ,kBAEzDp+L,KAAKgoM,qBACLhoM,KAAKgoM,oBAAoBxyJ,GAG7B,MAAMyyJ,EAwBd,SAAS7rG,GAAa5mD,EAAOuyJ,EAAU32C,EAAgB+2C,GACnD,OAAO9a,GAAmB73I,EAAM4mD,gBAC3B3nD,QAAKtsC,MAAI+/L,KAAwB,EAAG55F,MAAUluG,GAC3CA,aAAa2mK,OAAmBlgK,MAAMC,QAAQ1G,IAAC,EACxCktG,MAAGltG,IAAC,EAGJslB,MAAKqiL,EAASj2B,mBAAmB1xK,MAE/C,EAAG+H,MAAKkgM,IACDF,GACAA,EAAkB3yJ,GAItB,IAAI0lE,EACAotF,EACAC,IAA8B,EAClC,OAAI1hM,MAAMC,QAAQuhM,IACdC,EAAYD,GACkB,IAG9BntF,EAAWmtF,EAAgBniG,OAAOkrD,GAAgBl2C,SAKlDotF,EAAYptF,EAAS3tG,IAAIo6L,GAAQ,GAAI,CAAE9kF,UAAU,EAAMl/G,MAAM,IAAQslK,QAKlE,CAAE9sE,OAHMmsG,EAAUngM,IAAI61L,IAGZ9iF,WAAS,GAElC,CA5DuC9e,CAAa5mD,EAAOx1C,KAAK+nM,SAAU32C,EAAgBpxJ,KAAKmoM,mBAC7C1zJ,QAAKq6D,MAAS,KACpD9uG,KAAK8nM,gBAAgBrgL,OAAO+tB,EAAK,IAG/B4yJ,EAAS,IAAI5c,GAAsByc,EAAY,IAAM,IAAI7jG,MAC1D3vD,KAAKvT,MACV,OAAAlhC,KAAK8nM,gBAAgBr6L,IAAI+nC,EAAO4yJ,GACzBA,CACX,CAACjoM,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFwnM,EAAkB,EAAoDznM,SACxKH,KAAKg0C,WArnHmF/yC,MAAE,CAAAgzC,MAqnHY2zJ,EAAkB7kM,QAAlB6kM,EAAkB5kM,UAAAC,WAAc,SAClJ,OAtDK2kM,CAAkB,KA6GxB,SAASM,GAAyBh+L,GAG9B,OATJ,SAASs+L,GAAuBn+L,GAI5B,OAAOA,GAA0B,iBAAVA,GAAsB,YAAaA,CAC9D,CAIWm+L,CAAuBt+L,GAASA,EAAMu+L,QAAav+L,CAC9D,CAAC,IAEKw+L,GAAqB,MAA3B,MAAMA,EACF,0BAAIC,GACA,OAA6B,IAAtB3oM,KAAK4oM,YAChB,CACA7oM,cACIC,KAAK6oM,kBAAoB,KACzB7oM,KAAK8oM,kBAAoB,KACzB9oM,KAAK+oM,yBAA2B,KAMhC/oM,KAAKw0C,OAAS,IAAI4vD,KAIlBpkG,KAAKgpM,uBAAyB,IAAI5kG,KAClCpkG,KAAK8jM,gBAAetxF,OAAOo1F,IAC3B5nM,KAAK6xJ,uBAAsBr/C,OAAOmnC,OAClC35I,KAAKw9L,iBAAgBhrF,OAAOi9E,IAC5BzvL,KAAKipM,gBAAez2F,OAAOmlF,IAC3B33L,KAAKy+L,oBAAmE,QAAnEA,EAAsBjsF,OAAOipF,GAAc,CAAE54E,UAAU,IAC5D7iH,KAAK4oM,aAAe,EAOpB5oM,KAAKkpM,mBAAqB,OAAM57F,WAAG,GAEnCttG,KAAK+jM,kBAAoB,KAGzB/jM,KAAK8jM,aAAaqE,kBADC5hI,GAAMvmE,KAAKw0C,OAAOngB,KAAK,IAAI6iK,GAAmB3wH,IAEjEvmE,KAAK8jM,aAAakE,oBAHGzhI,GAAMvmE,KAAKw0C,OAAOngB,KAAK,IAAI4iK,GAAqB1wH,GAIzE,CACAhR,WACIv1D,KAAKmpM,aAAa5zI,UACtB,CACA6zI,wBAAwBlgL,GACpB,MAAM5gB,IAAOtI,KAAK4oM,aAClB5oM,KAAKmpM,aAAa90K,KAAK,IAAKr0B,KAAKmpM,YAAY9+L,SAAU6e,EAAS5gB,MACpE,CACA+gM,iBAAiBC,EAAQC,EAAgBC,GACrC,OAAAxpM,KAAKmpM,YAAc,IAAIhlG,KAAgB,CACnC77F,GAAI,EACJmhM,eAAgBF,EAChBG,cAAeH,EACfI,kBAAmBJ,EACnBK,aAAcN,EAAOO,oBAAoBC,QAAQP,GACjD7S,kBAAmB4S,EAAOO,oBAAoBC,QAAQP,GACtDQ,OAAQR,EACRrrL,OAAQ,CAAC,EACTjN,QAAS,KACTI,OAAQ,KACRgoB,QAASslD,QAAQ1tE,SAAQ,GACzB/F,OAAQqrL,GACRE,cAAe,KACfiE,gBAAiB8O,EAAmB70H,SACpCq1H,eAAgB,KAChBC,mBAAoBT,EACpBU,kBAAmB,KACnBC,OAAQ,CAAE7J,kBAAmB,GAAID,oBAAqB,IACtD+J,aAAc,OAEXpqM,KAAKmpM,YAAY10J,QAAKzsC,MAAO5H,GAAc,IAATA,EAAEkI,KAAQ,EAEnDH,MAAI/H,QAAWA,EAAGwpM,aAAcN,EAAOO,oBAAoBC,QAAQ1pM,EAAE2pM,YAAU,EAE/Ej6F,MAAUu6F,IACNrqM,KAAK8oM,kBAAoBuB,EACzB,IAAIC,GAAY,EACZ3vK,IAAU,EACd,SAAO2yE,MAAG+8F,GACL51J,QAELE,MAAIv0C,IACAJ,KAAK6oM,kBAAoB,CACrBvgM,GAAIlI,EAAEkI,GACNoqF,WAAYtyF,EAAE2pM,OACdH,aAAcxpM,EAAEwpM,aAChBW,QAASnqM,EAAE8K,OACXgT,OAAQ9d,EAAE8d,OACVssL,mBAAqBxqM,KAAK+oM,yBAAkC,IACrD/oM,KAAK+oM,yBACRyB,mBAAoB,MAF6B,KAIzD,IACH,EAAG16F,MAAU1vG,IACV,MAAMqqM,GAAiBrqM,EAAEupM,kBAAkBplM,WACrCmmM,IAAiBpB,EAAOqB,WAC1BvqM,EAAEwpM,aAAarlM,aAAekmM,IAK9BA,KAAmBrqM,EAAEqpM,eAAellM,WAExC,IAAKmmM,IAAyC,YADlBtqM,EAAE8d,OAAO0sL,qBAAuBtB,EAAOsB,qBACX,CACpD,MAAMz5L,GAEF,GACJ,OAAAnR,KAAKw0C,OAAOngB,KAAK,IAAIsiK,GAAkBv2L,EAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,EAAE2pM,QAAS54L,GAAQ,IAC7F/Q,EAAE6Q,QAAQ,MACHo4F,IACX,CACA,GAAIigG,EAAOO,oBAAoBgB,iBAAiBzqM,EAAE2pM,QAC9C,SAAOz8F,MAAGltG,GAAGq0C,QAEbq7D,MAAU1vG,KACN,MAAM0qM,GAAa9qM,KAAKmpM,aAAa9kG,WAErC,OADArkG,KAAKw0C,OAAOngB,KAAK,IAAIqgB,GAAgBt0C,GAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,GAAEwpM,cAAexpM,GAAE8K,OAAQ9K,GAAEq2L,gBACjGqU,KAAe9qM,KAAKmpM,aAAa9kG,WAC1BgF,KAIJ1qB,QAAQ1tE,QAAQ7Q,GAAC,GAhUhD,SAAS8jM,GAAUhpF,EAAU4oF,EAAcC,EAAmB5vJ,EAAQ42J,EAAY1Q,GAC9E,SAAO/rF,MAASluG,GApVpB,SAAS4qM,GAAY9vF,EAAU4oF,EAAcC,EAAmB5vJ,EAAQ4kJ,EAASyE,EAAenD,EAA4B,aACxH,OAAO,IAAIwJ,GAAW3oF,EAAU4oF,EAAcC,EAAmB5vJ,EAAQ4kJ,EAASsB,EAA2BmD,GACxG0G,WACT,CAiVyB8G,CAAY9vF,EAAU4oF,EAAcC,EAAmB5vJ,EAAQ/zC,EAAEwpM,aAAcmB,EAAY1Q,GAC3G5lJ,QAAKtsC,MAAI,EAAG0K,MAAOm3L,GAAgBja,KAAM2G,MAAkB,IAChDt2L,EAAG4pM,kBAAgBtT,wBAEvC,CA8ToBwN,CAAUlkM,KAAK6xJ,oBAAqB7xJ,KAAK8jM,aAAc9jM,KAAK+jM,kBAAmBuF,EAAOn1J,OAAQn0C,KAAKw9L,cAAe8L,EAAOjP,4BAAyB,EAElJ1lJ,MAAIv0C,KACAiqM,EAAuBL,eAAiB5pM,GAAE4pM,eAC1CK,EAAuB3T,kBAAoBt2L,GAAEs2L,kBAC7C12L,KAAK6oM,kBAAoB,IAClB7oM,KAAK6oM,kBACRoC,SAAU7qM,GAAEs2L,mBAGhB,MAAMwU,GAAmB,IAAItU,GAAiBx2L,GAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,GAAEwpM,cAAe5pM,KAAKw9L,cAActO,UAAU9uL,GAAEs2L,mBAAoBt2L,GAAE4pM,gBACvJhqM,KAAKw0C,OAAOngB,KAAK62K,GAAgB,IAGpC,GAAIR,IACLpB,EAAOO,oBAAoBgB,iBAAiBzqM,EAAEspM,eAAgB,CAI9D,MAAQphM,MAAIshM,gBAAc1+L,UAAQurL,iBAAev4K,WAAW9d,EACtD+qM,GAAW,IAAIz2J,GAAgBpsC,GAAItI,KAAKw9L,cAActO,UAAU0a,IAAe1+L,GAAQurL,IAC7Fz2L,KAAKw0C,OAAOngB,KAAK82K,IACjB,MAAMnB,GAAiBlR,GAAiB8Q,EAAc5pM,KAAK+jM,mBAAmBpvH,SAC9E,OAAA30E,KAAK8oM,kBAAoBuB,EAAyB,IAC3CjqM,EACH4pM,kBACAtT,kBAAmBkT,GACnB1rL,OAAQ,IAAKA,GAAQktL,oBAAoB,EAAOC,YAAY,KAChE,EACO/9F,MAAG+8F,EACd,CACK,CAMD,MAAMl5L,GAGF,GACJ,OAAAnR,KAAKw0C,OAAOngB,KAAK,IAAIsiK,GAAkBv2L,EAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,EAAEwpM,cAAez4L,GAAQ,IACnG/Q,EAAE6Q,QAAQ,MACHo4F,IACX,KACH,EAED10D,MAAIv0C,IACA,MAAMkrM,GAAc,IAAIzU,GAAiBz2L,EAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,EAAEwpM,cAAe5pM,KAAKw9L,cAActO,UAAU9uL,EAAEs2L,mBAAoBt2L,EAAE4pM,gBAClJhqM,KAAKw0C,OAAOngB,KAAKi3K,GAAW,IAC/B,EAAGnjM,MAAI/H,IACJJ,KAAK8oM,kBAAoBuB,EAAyB,IAC3CjqM,EACH+pM,OAAQrK,GAAkB1/L,EAAE4pM,eAAgB5pM,EAAEs6L,gBAAiB16L,KAAKipM,eAEjEoB,IA/jCvB,SAASkB,GAAYrwF,EAAUsjF,GAC3B,SAAOlwF,MAASluG,IACZ,MAAQ4pM,iBAAgBtP,kBAAiByP,QAAU7J,oBAAmBD,wBAA0BjgM,EAChG,OAAmC,IAA/BigM,EAAoB35L,QAA6C,IAA7B45L,EAAkB55L,QAAW,EAC1D4mG,MAAG,IAAKltG,EAAGgqM,cAAc,IAU5C,SAASoB,GAAuBpL,EAAQqL,EAAWC,EAASxwF,GACxD,SAAOx1F,MAAK06K,GAAQ3rJ,QAAK65D,MAAS0tE,GA4EtC,SAAS2vB,GAAiBp7K,EAAWq7K,EAASF,EAASD,EAAWvwF,GAC9D,MAAM2wF,EAAgBD,GAAWA,EAAQh2J,YAAcg2J,EAAQh2J,YAAYi2J,cAAgB,KAC3F,IAAKA,GAA0C,IAAzBA,EAAcnlM,OAChC,SAAO4mG,OAAG,GACd,MAAMw+F,EAA2BD,EAAc1jM,IAAKkG,KAChD,MAAM09L,EAAkB5N,GAAwByN,IAAY1wF,EACtDioF,GAAQnD,GAA2B3xL,GAAG09L,GAI5C,OAAO1e,GAhJf,SAAS2e,GAAgB7I,GACrB,OAAOA,GAAS99F,GAAW89F,EAAM0I,cACrC,CA2IyBG,CAAgB7I,IAC7BA,GAAM0I,cAAct7K,EAAWq7K,EAASF,EAASD,GACjDM,EAAgBvoF,aAAa,IAAM2/E,GAAM5yK,EAAWq7K,EAASF,EAASD,KACtCh3J,KAAK0xC,IAAO,GAEpD,SAAOmnB,MAAGw+F,GAA0Br3J,KAAKqsJ,KAC7C,CAzF+C6K,CAAiB3vB,EAAMzrJ,UAAWyrJ,EAAMxmI,MAAOk2J,EAASD,EAAWvwF,IAAY/0B,EAAM9zE,IAC1G,IAAXA,GACR,GACP,CAZem5L,CAAuBnL,EAAqB2J,EAAgBtP,EAAiBx/E,GAC/EzmE,QAAK65D,MAASu9F,IACRA,IA/DnB,SAASI,GAAU/iI,GACf,MAAoB,kBAANA,CAClB,CA6DoC+iI,CAAUJ,IAW9C,SAASK,GAAqBnS,EAAgBqG,EAAQllF,EAAUsjF,GAC5D,SAAO94K,MAAK06K,GAAQ3rJ,QAAK25D,KAAW4tE,GACzB5gK,GA2Bf,SAAS+wL,GAAyBx3H,EAAU6pH,GACxC,OAAiB,OAAb7pH,GAAqB6pH,GACrBA,EAAa,IAAIrH,GAAqBxiH,KAAS,EAE5C24B,OAAG,EACd,CAhCsB6+F,CAAyBnwB,EAAMxmI,MAAMqhC,OAAQ2nH,GAanE,SAAS4N,GAAoBz3H,EAAU6pH,GACnC,OAAiB,OAAb7pH,GAAqB6pH,GACrBA,EAAa,IAAInH,GAAgB1iH,KAAS,EAEvC24B,OAAG,EACd,CAlBkF8+F,CAAoBpwB,EAAMxmI,MAAOgpJ,GAiDnH,SAAS6N,GAAoBZ,EAAWh8K,EAAMyrF,GAC1C,MAAMoxF,EAAY78K,EAAKA,EAAK/oB,OAAS,GAK/B6lM,EAJyB98K,EAAKzlB,MAAM,EAAGylB,EAAK/oB,OAAS,GACtDS,UACAgB,IAAI4c,GAhRb,SAASynL,GAAoBznL,GACzB,MAAM0nL,EAAmB1nL,EAAE6wB,YAAc7wB,EAAE6wB,YAAY62J,iBAAmB,KAC1E,OAAKA,GAAgD,IAA5BA,EAAiB/lM,OAEnC,CAAE2lD,KAAMtnC,EAAGolL,OAAQsC,GADf,IAEf,CA2QkBD,CAAoBznL,IAC7B/c,OAAOoJ,GAAW,OAANA,GAC2CjJ,IAAKiyD,GACtD6wH,GAAM,KACT,MAAMyhB,GAAetyI,EAAE+vI,OAAOhiM,IAAKskM,IAC/B,MAAMV,GAAkB5N,GAAwB/jI,EAAE/N,OAAS6uD,EACrDioF,GAAQnD,GAA2ByM,EAAkBV,IAI3D,OAAO1e,GAlIvB,SAASsf,GAAmBxJ,GACxB,OAAOA,GAAS99F,GAAW89F,EAAMsJ,iBACrC,CA6HiCE,CAAmBxJ,IAChCA,GAAMsJ,iBAAiBH,EAAWb,GAClCM,GAAgBvoF,aAAa,IAAM2/E,GAAMmJ,EAAWb,KACpBh3J,KAAK0xC,IAAO,GAEpD,SAAOmnB,MAAGo/F,IAAcj4J,KAAKqsJ,KAAuB,IAG5D,SAAOxzF,MAAGi/F,GAA8B93J,KAAKqsJ,KACjD,CArEkIuL,CAAoBtS,EAAgB/d,EAAMvsJ,KAAMyrF,GAiClL,SAAS0xF,GAAenB,EAAWa,EAAWpxF,GAC1C,MAAM2xF,EAAcP,EAAU12J,YAAc02J,EAAU12J,YAAYi3J,YAAc,KAChF,IAAKA,GAAsC,IAAvBA,EAAYnmM,OAC5B,SAAO4mG,OAAG,GACd,MAAMw/F,EAAyBD,EAAY1kM,IAAK0kM,GACrC5hB,GAAM,KACT,MAAM8gB,EAAkB5N,GAAwBmO,IAAcpxF,EACxDioF,GAAQnD,GAA2B6M,EAAad,GAItD,OAAO1e,GAlHnB,SAAS0f,GAAc5J,GACnB,OAAOA,GAAS99F,GAAW89F,EAAM0J,YACrC,CA6G6BE,CAAc5J,IAC3BA,GAAM0J,YAAYP,EAAWb,GAC7BM,EAAgBvoF,aAAa,IAAM2/E,GAAMmJ,EAAWb,KACpBh3J,KAAK0xC,IAAO,IAGxD,SAAOmnB,MAAGw/F,GAAwBr4J,KAAKqsJ,KAC3C,CAhD6L8L,CAAe7S,EAAgB/d,EAAMxmI,MAAO0lE,KACjO/0B,EAAM9zE,IACY,IAAXA,GACR,GACP,CAhBgB65L,CAAqBlC,EAAgB1J,EAAmBplF,EAAUsjF,IAAY,EAC9ElxF,MAAGu+F,MACV,EAAG1jM,MAAIiiM,SAAsBhqM,EAAGgqM,mBAAgB,EAEzD,CAmjCgBmB,CAAYvrM,KAAK6xJ,oBAAsBpnI,GAAQzqB,KAAKw0C,OAAOngB,KAAK5J,KAAI,EAAGkqB,MAAIv0C,IAE3E,GADAiqM,EAAuBD,aAAehqM,EAAEgqM,aACpCxX,GAAUxyL,EAAEgqM,cACZ,MAAM7M,GAA2Bv9L,EAAoBI,EAAEgqM,cAE3D,MAAM4C,GAAY,IAAIlW,GAAe12L,EAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,EAAEwpM,cAAe5pM,KAAKw9L,cAActO,UAAU9uL,EAAEs2L,mBAAoBt2L,EAAE4pM,iBAAkB5pM,EAAEgqM,cAClKpqM,KAAKw0C,OAAOngB,KAAK24K,GAAS,IAC7B,EAAGhlM,MAAO5H,KACFA,EAAEgqM,eACHpqM,KAAKitM,2BAA2B7sM,EAAG,GAAI,IAChC,IAKfqnM,GAAUrnM,IACN,GAAIA,EAAE+pM,OAAO7J,kBAAkB55L,OAC3B,SAAO4mG,MAAGltG,GAAGq0C,QAAKE,MAAIv0C,KAClB,MAAM8sM,GAAe,IAAIlW,GAAa52L,GAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,GAAEwpM,cAAe5pM,KAAKw9L,cAActO,UAAU9uL,GAAEs2L,mBAAoBt2L,GAAE4pM,gBAC/IhqM,KAAKw0C,OAAOngB,KAAK64K,GAAY,IAChC,EAAGp9F,MAAU1vG,KACV,IAAI+sM,IAAe,EACnB,SAAO7/F,MAAGltG,IAAGq0C,KA1YrC,SAAS24J,EAAY/S,EAA2Bn/E,GAC5C,SAAO5M,MAASluG,IACZ,MAAQ4pM,iBAAgBG,QAAU7J,sBAAwBlgM,EAC1D,IAAKkgM,EAAkB55L,OACnB,SAAO4mG,MAAGltG,GAEd,IAAIitM,EAA4B,EAChC,SAAO3nL,MAAK46K,GACP7rJ,QAAK25D,KAAU4tE,GAG5B,SAASsxB,EAAWhB,EAAWb,EAAWpR,EAA2Bn/E,GACjE,MAAM/mE,EAASm4J,EAAU12J,YACnB3kC,EAAUq7L,EAAUt6L,SAC1B,YAAsBzO,IAAlB4wC,GAAQ2nD,QAAwB0rG,EAAerzJ,KAC/CljC,EAAQo7K,IAAiBl4I,EAAO2nD,OAWxC,SAASyxG,EAAYt8L,EAASq7L,EAAWb,EAAWvwF,GAChD,MAAM/xG,EAUV,SAASqkM,EAAYnqM,GACjB,MAAO,IAAIgB,OAAO8E,KAAK9F,MAASgB,OAAOopM,sBAAsBpqM,GACjE,CAZiBmqM,CAAYv8L,GACzB,GAAoB,IAAhB9H,EAAKzC,OACL,SAAO4mG,MAAG,CAAC,GAEf,MAAMj+F,EAAO,CAAC,EACd,SAAOqW,MAAKvc,GAAMsrC,QAAK65D,MAAS/mG,GAQpC,SAASmmM,EAAYxK,EAAgBoJ,EAAWb,EAAWvwF,GACvD,MAAM6wF,EAAkB5N,GAAwBmO,IAAcpxF,EACxDyyF,EAAW3N,GAA2BkD,EAAgB6I,GAI5D,OAAO1e,GAHesgB,EAAS18L,QAC3B08L,EAAS18L,QAAQq7L,EAAWb,GAC5BM,EAAgBvoF,aAAa,IAAMmqF,EAASrB,EAAWb,IAE/D,CAf2CiC,CAAYz8L,EAAQ1J,GAAM+kM,EAAWb,EAAWvwF,GAClFzmE,KAAK0xC,KAAM,EAAGxxC,MAAKtqC,KACpBgF,EAAK9H,GAAO8C,OACV8hL,GAAS,GMx7HZ,SAASyhB,GAAMvjM,GAClB,SAAOlC,MAAI,IAAMkC,EACrB,CNs7HuBujM,CAAMv+L,IAAI,EAAG2+F,MAAY97F,GAAM0uL,GAAa1uL,GAAKm3F,QAAQkE,MAAWr7F,IAC3F,CAnBWq7L,CAAYt8L,EAASq7L,EAAWb,EAAWvwF,GAAUzmE,QAAKtsC,MAAK0lM,IAClEvB,EAAU9R,cAAgBqT,EAC1BvB,EAAUj9L,KAAO+qL,GAA2BkS,EAAWjS,GAA2BppL,QAC9EkjC,GAAUqzJ,EAAerzJ,KACzBm4J,EAAUj9L,KAAKg9K,IAAiBl4I,EAAO2nD,OAEpC,OAEf,CAjBqCwxG,CAAWtxB,EAAMxmI,MAAOw0J,EAAgB3P,EAA2Bn/E,KAAS,EAAGvmE,MAAI,IAAM04J,KAA8BlhB,GAAS,IAAC,EAAG79E,MAASl9F,GAAKi8L,IAA8B/M,EAAkB55L,UAAS4mG,MAAGltG,GAAKipG,MAAM,EAE9P,CAgY0C+jG,CAAY9D,EAAOjP,0BAA2Br6L,KAAK6xJ,sBAAmB,EAAGl9G,MAAI,CAC3FtgB,KAAMA,IAAM84K,IAAe,EAC3B53I,SAAUA,KACD43I,IACDntM,KAAKitM,2BAA2B7sM,GAE5B,GAAI,EAAqD,IAGvE,IACL,EAAGu0C,MAAIv0C,KACJ,MAAM0tM,GAAa,IAAIv4J,GAAWn1C,GAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,GAAEwpM,cAAe5pM,KAAKw9L,cAActO,UAAU9uL,GAAEs2L,mBAAoBt2L,GAAE4pM,gBAC3IhqM,KAAKw0C,OAAOngB,KAAKy5K,GAAU,GAC7B,GAKVrG,GAAWrnM,IACP,MAAM2tM,GAAkBv4J,KACpB,MAAMw4J,GAAU,GACZx4J,GAAMI,aAAaqoJ,gBAClBzoJ,GAAMI,YAAYywJ,kBACnB2H,GAAQ/mM,KAAKjH,KAAK8jM,aAAa7F,cAAczoJ,GAAMI,aAC9CnB,QAAKE,MAAIs5J,KACVz4J,GAAMjlB,UAAY09K,MACrB,EAAG9lM,MAAI,UAEZ,UAAW8rE,MAASz+B,GAAMw4I,SACtBggB,GAAQ/mM,QAAQ8mM,GAAe95H,KAEnC,OAAO+5H,IAEX,SAAOxkG,MAAcukG,GAAe3tM,EAAE4pM,eAAev3J,OAChDgC,KAAKq3I,KAAkBF,GAAK,GAAE,GACnC6b,GAAU,IAAMznM,KAAKkpM,uBAAoB,EAAG/gM,MAAK/H,IACjD,MAAM8pM,GAxxDtB,SAASgE,GAAkBpR,EAAoBx7F,EAAMy7F,GACjD,MAAMtqJ,EAAOoqJ,GAAWC,EAAoBx7F,EAAK82F,MAAO2E,EAAYA,EAAU3E,WAAQ70L,GACtF,OAAO,IAAIq1L,GAAYnmJ,EAAM6uD,EACjC,CAqxD0C4sG,CAAkB5E,EAAOxM,mBAAoB18L,EAAE4pM,eAAgB5pM,EAAE6pM,oBAC3F,OAAAjqM,KAAK8oM,kBACDuB,EAAyB,IAAKjqM,EAAG8pM,sBAC9BG,KACV,EAAG11J,MAAI,KACJ30C,KAAKw0C,OAAOngB,KAAK,IAAImjK,GAAsB,GAzgDpCkI,EAACuJ,EAAcnM,EAAoB0B,EAAcC,OAAwBt2L,MAAI/H,IAChG,IAAIi+L,GAAevB,EAAoB18L,EAAE8pM,kBAAmB9pM,EAAE6pM,mBAAoBzL,EAAcC,GAC3FC,SAASuK,GACP7oM,IAugDKs/L,CAAe1/L,KAAKipM,aAAcK,EAAOxM,mBAAqBryK,GAAQzqB,KAAKw0C,OAAOngB,KAAK5J,GAAMzqB,KAAKy+L,qBAItG7S,GAAK,IAAC,EAAGj3I,MAAI,CACTtgB,KAAOj0B,IACHkqM,GAAY,EACZtqM,KAAK+oM,yBAA2B/oM,KAAK6oM,kBACrC7oM,KAAKw0C,OAAOngB,KAAK,IAAI6hB,GAAc91C,EAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,EAAEwpM,cAAe5pM,KAAKw9L,cAActO,UAAU9uL,EAAEs2L,qBACtH4S,EAAO6E,eAAeC,YAAYhuM,EAAE8pM,kBAAkBv1H,UACtDv0E,EAAE6Q,SAAQ,EAAI,EAElBskD,SAAUA,KACN+0I,GAAY,KOn1IzB,SAAS+D,GAAUC,GACtB,SAAO1jG,MAAQ,CAAC1/F,EAAQq5F,MACpBgH,SAAU+iG,GAAU/3J,aAAU+zD,MAAyB/F,EAAY,IAAMA,EAAWhvC,WAAYizC,QAC/FjE,EAAWE,QAAUv5F,EAAOqrC,UAAUguD,EAAU,EAEzD,CPw1IY8pG,CAAUruM,KAAKgpM,uBAAuBv0J,QAAKE,MAAIruB,IAC3C,MAAMA,OACP,EAAGwoF,MAAS,KAONw7F,GAAc3vK,IAKf36B,KAAKitM,2BAA2B5C,EAD5B,GACuE,GAI3ErqM,KAAK6oM,mBAAmBvgM,KAAO+hM,EAAuB/hM,KACtDtI,KAAK6oM,kBAAoB,SAEhC,EAAG76F,MAAY97F,IAIZ,GAHAyoB,IAAU,EAGNmjK,GAA6B5rL,GAC7BlS,KAAKw0C,OAAOngB,KAAK,IAAI8hB,GAAiBk0J,EAAuB/hM,GAAItI,KAAKw9L,cAActO,UAAUmb,EAAuBT,cAAe13L,EAAElG,QAASkG,EAAE2rL,mBApxDrK,SAAS0Q,GAAwC7/K,GAC7C,OAAOovK,GAA6BpvK,IAAUkkK,GAAUlkK,EAAMvF,IAClE,CAqxDyBolL,CAAwCr8L,GAIzClS,KAAKw0C,OAAOngB,KAAK,IAAIojK,GAAgBvlL,EAAEiX,MAHvCkhL,EAAuBp5L,SAAQ,OAQlC,CACDjR,KAAKw0C,OAAOngB,KAAK,IAAI+hB,GAAgBi0J,EAAuB/hM,GAAItI,KAAKw9L,cAActO,UAAUmb,EAAuBT,cAAe13L,EAAGm4L,EAAuBL,qBAAkBzmM,IAC/K,IACI8mM,EAAuBp5L,QAAQq4L,EAAO5iI,aAAax0D,GACvD,OACOs8L,IACHnE,EAAuBh5L,OAAOm9L,GAClC,CACJ,CACA,OAAOnlG,OACT,GAGV,CACA4jG,2BAA2B7sM,EAAG+Q,EAAQwsB,GAClC,MAAM8wK,EAAY,IAAIt4J,GAAiB/1C,EAAEkI,GAAItI,KAAKw9L,cAActO,UAAU9uL,EAAEwpM,cAAez4L,EAAQwsB,GACnG39B,KAAKw0C,OAAOngB,KAAKo6K,GACjBruM,EAAE6Q,SAAQ,EACd,CAAC9Q,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFsoM,EAAqB,EAAoDvoM,SAC3KH,KAAKg0C,WAt/HmF/yC,MAAE,CAAAgzC,MAs/HYy0J,EAAqB3lM,QAArB2lM,EAAqB1lM,UAAAC,WAAc,SACrJ,OApUKylM,CAAqB,KAyU3B,SAASgG,GAA6BxjM,GAClC,OAAOA,IAAWqrL,EACtB,CAEA,IAuBMoY,GAAa,MAAnB,MAAMA,EAIFC,WAAWj6H,GACP,IAAIk6H,EACAr5J,EAAQm/B,EAASliC,KACrB,UAAiBlvC,IAAViyC,GACHq5J,EAAY7uM,KAAK8uM,yBAAyBt5J,IAAUq5J,EACpDr5J,EAAQA,EAAMw4I,SAAS19J,KAAK2jD,GAASA,EAAMk/G,SAAW/G,IAE1D,OAAOyiB,CACX,CAKAC,yBAAyBn6H,GACrB,OAAOA,EAAStlE,KAAKg9K,GACzB,CAAClsL,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFuuM,EAAa,EAAoDxuM,SACnKH,KAAKg0C,WA5iImF/yC,MAAE,CAAAgzC,MA4iIY06J,EAAa5rM,QAAA,kBAAkC,EAAMyvG,OAAOu8F,GAAqB,EAAA9rM,WAAtD,SAC7I,OAtBK0rM,CAAa,KA8BbI,GAAoB,MAA1B,MAAMA,UAA6BJ,GAC/B5uM,YAAY+7F,GACRxlE,QACAt2B,KAAK87F,MAAQA,CACjB,CAMAsyG,YAAYz5H,GACR,MAAMmnB,EAAQ97F,KAAK4uM,WAAWj6H,QAChBpxE,IAAVu4F,GACA97F,KAAK87F,MAAM6tF,SAAS7tF,EAE5B,CAAC37F,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF2uM,GArkIV9tM,MAqkIgDy1C,OAAQ,EAA6Cv2C,SAC7LH,KAAKg0C,WAtkImF/yC,MAAE,CAAAgzC,MAskIY86J,EAAoBhsM,QAApBgsM,EAAoB/rM,UAAAC,WAAc,SACpJ,OAlBK8rM,CAAoB,KA+BpBC,GAAkB,MAAxB,MAAMA,EAAmB7uM,SACZH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF4uM,EAAkB,EAAoD7uM,SACxKH,KAAKg0C,WAtlImF/yC,MAAE,CAAAgzC,MAslIY+6J,EAAkBjsM,QAAA,kBAAkC,EAAMyvG,OAAOy8F,GAA0B,EAAAhsM,WAA3D,SAClJ,OAHK+rM,CAAkB,KAyBxB,MAAME,GAKF3P,aAAa/pJ,GACT,OAAO,CACX,CAIA2lF,MAAM3lF,EAAO25J,GAAgB,CAE7BjS,aAAa1nJ,GACT,OAAO,CACX,CAEA4nJ,SAAS5nJ,GACL,OAAO,IACX,CAMAwnJ,iBAAiBsC,EAAQh+F,GACrB,OAAOg+F,EAAO1pJ,cAAgB0rD,EAAK1rD,WACvC,EACH,IACKq5J,GAAyB,MAA/B,MAAMA,UAAkCC,GAAuB/uM,SAClDH,KAAKgD,UAAI,eAAAosM,EAAA,gBAAAhvM,GAAA,OAAAgvM,MA3oI+EnuM,MA2oIUguM,KAAyB7uM,GAAzB6uM,EAAyB,EAAlH,GAAwK9uM,SACjLH,KAAKg0C,WA5oImF/yC,MAAE,CAAAgzC,MA4oIYg7J,EAAyBlsM,QAAzBksM,EAAyBjsM,UAAAC,WAAc,SACzJ,OAHKgsM,CAAyB,KAc/B,MAAMI,GAAuB,IAAIj9F,MAAmF,GAAI,CACpHnvG,WAAY,OACZF,QAASA,MAAQ,KAGrB,IAOMusM,GAAmB,MAAzB,MAAMA,EAAoBnvM,SACbH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFkvM,EAAmB,EAAoDnvM,SACzKH,KAAKg0C,WAtqImF/yC,MAAE,CAAAgzC,MAsqIYq7J,EAAmBvsM,QAAA,kBAAkC,EAAMyvG,OAAO+8F,GAA2B,EAAAtsM,WAA5D,SACnJ,OAHKqsM,CAAmB,KAWnBC,GAA0B,MAAhC,MAAMA,EACF1E,iBAAiB1hL,GACb,OAAO,CACX,CACA2gL,QAAQ3gL,GACJ,OAAOA,CACX,CACA8qH,MAAMu7D,EAAYC,GACd,OAAOD,CACX,CAACrvM,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFmvM,EAA0B,EAAoDpvM,SAChLH,KAAKg0C,WA1rImF/yC,MAAE,CAAAgzC,MA0rIYs7J,EAA0BxsM,QAA1BwsM,EAA0BvsM,UAAAC,WAAc,SAC1J,OAZKssM,CAA0B,KAkBhC,IAAIG,GACH,SAAUA,GACPA,SAAiBA,EAAiBC,SAAc,GAAK,WACrDD,EAAiBA,EAAiBE,OAAY,GAAK,SACnDF,EAAiBA,EAAiBG,YAAiB,GAAK,cAHjDH,CAIX,CAJC,CAIEA,IAAwC,CAAC,GAU5C,SAASI,GAAoBxG,EAAQh+D,GACjCg+D,EAAO90J,OACFC,QAAKzsC,MAAQkK,GAAMA,aAAagkC,IAAiBhkC,aAAaikC,IAC/DjkC,aAAakkC,IAAmBlkC,aAAaykL,KAAiB,EAAGxuL,MAAI+J,GACjEA,aAAagkC,IAAiBhkC,aAAaykL,GACpC+Y,GAAiBC,SAERz9L,aAAaikC,KACjB,IAAXjkC,EAAEyrB,MACY,IAAXzrB,EAAEyrB,MAEW+xK,GAAiBG,YAAcH,GAAiBE,SACxE,EAAG5nM,MAAQqK,GAAWA,IAAWq9L,GAAiBG,aAAcjkB,GAAK,IACjEr1I,UAAU,KACX+0F,GAAO,EAEf,CAEA,SAAS7iC,GAAoB/5E,GACzB,MAAMA,CACV,CACA,SAASqhL,GAAgCrhL,EAAO8uK,EAAer0K,GAC3D,OAAOq0K,EAAc3vJ,MAAM,IAC/B,CAKA,MAAMmiK,GAAoB,CACtBxhB,MAAO,QACP3pJ,SAAU,UACV+oJ,aAAc,UACdr5E,YAAa,SAMX07F,GAAqB,CACvBzhB,MAAO,SACP3pJ,SAAU,UACV+oJ,aAAc,UACdr5E,YAAa,UAEjB,IAYMnW,GAAM,MAAZ,MAAMA,EAGF,gBAAIwqG,GACA,OAAO5oM,KAAKkwM,sBAAsBtH,YACtC,CAMA,iBAAIuH,GACA,MAA0C,aAAtCnwM,KAAKowM,6BACEpwM,KAAKqwM,cAETrwM,KAAKkzB,SAASsgF,YAAY88F,oBAAiBtwM,KAAKqwM,aAC3D,CAIA,UAAI77J,GAKA,OAAOx0C,KAAK6nB,OAChB,CACA9nB,cACIC,KAAKuwM,UAAW,EAShBvwM,KAAKqwM,cAAgB,EACrBrwM,KAAKgJ,WAAUwpG,OAAOg+F,OACtBxwM,KAAKqyC,iBAAkB,EAMvBryC,KAAK6nB,QAAU,IAAIu8E,KACnBpkG,KAAKkG,WAAUssG,OAAO68F,GAAsB,CAAExsF,UAAU,KAAW,CAAC,EACpE7iH,KAAK+iH,gBAAevQ,OAAOwQ,OAQ3BhjH,KAAK0mE,aAAe1mE,KAAKkG,QAAQwgE,cAAgB+hC,GAWjDzoG,KAAKywM,yBAA2BzwM,KAAKkG,QAAQuqM,0BAA4BV,GAKzE/vM,KAAK2qM,WAAY,EACjB3qM,KAAK0wM,kBAAmB,EAQxB1wM,KAAK6pM,uBAAsBr3F,OAAO88F,IAOlCtvM,KAAK88L,sBAAqBtqF,OAAOw8F,IAOjChvM,KAAKmuM,iBAAgB37F,OAAOm8F,IAU5B3uM,KAAK4qM,oBAAsB5qM,KAAKkG,QAAQ0kM,qBAAuB,SAe/D5qM,KAAKq6L,0BAA4Br6L,KAAKkG,QAAQm0L,2BAA6B,YAa3Er6L,KAAK2wM,kBAAoB3wM,KAAKkG,QAAQyqM,mBAAqB,WA2B3D3wM,KAAKowM,6BAA+BpwM,KAAKkG,QAAQkqM,8BAAgC,UACjFpwM,KAAKm0C,UAASq+D,OAAOm1F,GAAQ,CAAE9kF,UAAU,KAASomD,QAAU,GAC5DjpK,KAAKkwM,yBAAwB19F,OAAOk2F,IACpC1oM,KAAKw9L,iBAAgBhrF,OAAOi9E,IAC5BzvL,KAAKkzB,YAAWs/E,OAAOkC,OAOvB10G,KAAK4wM,gCAAgC,EAACp+F,OAAOipF,GAAc,CAAE54E,UAAU,IACvE7iH,KAAK6wM,mBAAqB,IAAIv6J,MAC9Bt2C,KAAKqyC,mBAAkBmgE,OAAOwsC,iBAAmBA,OAAUA,MAAOoD,kBAClEpiJ,KAAK8wM,YAAY9wM,KAAKm0C,QACtBn0C,KAAKypM,eAAiB,IAAI5a,GAC1B7uL,KAAK+wM,WAAa/wM,KAAKypM,eACvBzpM,KAAKyqM,eAAiBzqM,KAAKypM,eAC3BzpM,KAAKgxM,YAAclY,GAAiB94L,EAAqB,MACzDA,KAAKkwM,sBAAsB7G,iBAAiBrpM,KAAMA,KAAKypM,eAAgBzpM,KAAKgxM,aACvEz6J,UAAUn2C,IACXJ,KAAK0wM,iBAAmBtwM,EAAEkI,GAC1BtI,KAAKqwM,cAAgBrwM,KAAKmwM,eAC3Bj+L,IACClS,KAAKgJ,QAAQyN,KAAM,+BAA8BvE,IAAG,GAExDlS,KAAKixM,6BACT,CACAA,8BACI,MAAMzsG,EAAexkG,KAAKkwM,sBAAsB17J,OAAO+B,UAAUrkC,IAC7D,IACI,MAAQ42L,qBAAsB9oM,KAAKkwM,sBACnC,GAA0B,OAAtBpH,EAIA,YAHIoI,GAAoBh/L,IACpBlS,KAAK6nB,QAAQwM,KAAKniB,IAI1B,GAAIA,aAAawiC,GAGTg6J,GAA6B5F,EAAkB59L,UAC/ClL,KAAKyqM,eAAiB3B,EAAkBc,sBAGvC13L,aAAaykL,GAClB32L,KAAK+wM,WAAajI,EAAkBiB,eAE/B73L,aAAa0kL,IAClB,GAA+B,UAA3B52L,KAAK2wM,kBAA+B,CACpC,IAAK7H,EAAkB5qL,OAAOktL,mBAAoB,CAC9C,MAAMrB,EAAS/pM,KAAK6pM,oBAAoB51D,MAAM60D,EAAkBpS,kBAAmBoS,EAAkBiB,QACrG/pM,KAAKmxM,cAAcpH,EAAQjB,EAC/B,CACA9oM,KAAKyqM,eAAiB3B,EAAkBpS,iBAC5C,UAEKxkL,aAAaslL,GAClBx3L,KAAKypM,eAAiBX,EAAkBpS,kBACxC12L,KAAK+wM,WAAa/wM,KAAK6pM,oBAAoB51D,MAAM60D,EAAkBpS,kBAAmBoS,EAAkBiB,QACxG/pM,KAAKgxM,YAAclI,EAAkBoB,kBACN,aAA3BlqM,KAAK2wM,oBACA7H,EAAkB5qL,OAAOktL,oBAC1BprM,KAAKmxM,cAAcnxM,KAAK+wM,WAAYjI,GAExC9oM,KAAKyqM,eAAiB3B,EAAkBpS,2BAGvCxkL,aAAaikC,GACH,IAAXjkC,EAAEyrB,MACS,IAAXzrB,EAAEyrB,OAIF39B,KAAK2qM,WAAY,IAEN,IAAXz4L,EAAEyrB,MACS,IAAXzrB,EAAEyrB,OACF39B,KAAKoxM,eAAetI,QAAiB,GAGpC52L,aAAaulL,GAAiB,CACnC,MAAM4Z,EAAarxM,KAAK6pM,oBAAoB51D,MAAM/hI,EAAEiX,IAAK2/K,EAAkBY,eACrExrL,EAAS,CACXktL,mBAAoBtC,EAAkB5qL,OAAOktL,mBAK7CC,WAAuC,UAA3BrrM,KAAK2wM,mBACbjC,GAA6B5F,EAAkB59L,SAEvDlL,KAAKsxM,mBAAmBD,EAAY9a,GAAuB,KAAMr4K,EAAQ,CACrEjN,QAAS63L,EAAkB73L,QAC3BI,OAAQy3L,EAAkBz3L,OAC1BgoB,QAASyvK,EAAkBzvK,SAEnC,CACInnB,aAAakkC,IACbp2C,KAAKoxM,eAAetI,GAAmB,GAEvC52L,aAAagkC,KACbl2C,KAAK2qM,WAAY,GAKjBuG,GAAoBh/L,IACpBlS,KAAK6nB,QAAQwM,KAAKniB,EAE1B,OACOA,GACHlS,KAAKkwM,sBAAsBlH,uBAAuB30K,KAAKniB,EAC3D,IAEJlS,KAAK6wM,mBAAmBtpL,IAAIi9E,EAChC,CAEA+sG,uBAAuBxN,GAGnB/jM,KAAKgxM,YAAYv+J,KAAKliB,UAAYwzK,EAClC/jM,KAAKkwM,sBAAsBnM,kBAAoBA,CACnD,CAIAyN,oBAEI,GADAxxM,KAAKyxM,+BACAzxM,KAAKkwM,sBAAsBvH,uBAAwB,CACpD,MAAM91L,EAAQ7S,KAAKkzB,SAASsgF,WAC5BxzG,KAAK0xM,0BAA0B1xM,KAAKkzB,SAASzD,MAAK,GAAO8mK,GAAuB1jL,EACpF,CACJ,CAMA4+L,8BAISzxM,KAAK2xM,uBACN3xM,KAAK2xM,qBAAuB3xM,KAAKkzB,SAASqjB,UAAUhoC,IAChD,MAAMrD,EAA2B,aAAlBqD,EAAMnC,KAAyB,WAAa,aAC5C,aAAXlB,GAGAm0B,WAAW,KACPr/B,KAAK0xM,0BAA0BnjM,EAAM4a,IAAQje,EAAQqD,EAAMsE,MAAK,EACjE,EAAC,GAIpB,CAQA6+L,0BAA0BvoL,EAAKje,EAAQ2H,GACnC,MAAMqL,EAAS,CAAEmtL,YAAY,GAQvB5U,EAAgB5jL,GAAO+1L,aAAe/1L,EAAQ,KAGpD,GAAIA,EAAO,CACP,MAAM++L,EAAY,IAAK/+L,UAChB++L,EAAUhJ,oBACVgJ,EAAUtB,mBACqB,IAAlCjsM,OAAO8E,KAAKyoM,GAAWlrM,SACvBwX,EAAOrL,MAAQ++L,EAEvB,CACA,MAAM7Y,GAAU/4L,KAAKoiC,SAASjZ,GAC9BnpB,KAAKsxM,mBAAmBvY,GAAS7tL,EAAQurL,EAAev4K,EAC5D,CAEA,OAAIiL,GACA,OAAOnpB,KAAK6xM,aAAa7xM,KAAKypM,eAClC,CAKAqI,uBACI,OAAO9xM,KAAKkwM,sBAAsBrH,iBACtC,CAKA,4BAAIE,GACA,OAAO/oM,KAAKkwM,sBAAsBnH,wBACtC,CAiBA+H,YAAY38J,GAERn0C,KAAKm0C,OAASA,EAAOhsC,IAAI61L,IACzBh+L,KAAK2qM,WAAY,EACjB3qM,KAAK0wM,kBAAmB,CAC5B,CAEAl6J,cACIx2C,KAAK+xM,SACT,CAEAA,UACI/xM,KAAKkwM,sBAAsB36I,WACvBv1D,KAAK2xM,uBACL3xM,KAAK2xM,qBAAqBl7J,cAC1Bz2C,KAAK2xM,0BAAuBpuM,GAEhCvD,KAAKuwM,UAAW,EAChBvwM,KAAK6wM,mBAAmBp6J,aAC5B,CAiDAu7J,cAAc1e,EAAU2e,EAAmB,CAAC,GACxC,MAAQ5e,aAAY9+E,cAAa1vE,WAAUqtK,uBAAqBC,oBAAqBF,EAC/E/sC,GAAIitC,EAAmBnyM,KAAKypM,eAAe5kK,SAAWA,EAC5D,IAcIutK,GAdAC,GAAI,KACR,OAAQH,IACJ,IAAK,QACDG,GAAI,IAAKryM,KAAKypM,eAAel1F,eAAgBA,GAC7C,MACJ,IAAK,WACD89F,GAAIryM,KAAKypM,eAAel1F,YACxB,MACJ,QACI89F,GAAI99F,GAAe,KAEjB,OAAN89F,KACAA,GAAIryM,KAAKsyM,iBAAiBD,KAG9B,IAEID,GAA4Bvf,GADDQ,EAAaA,EAAW1+G,SAAW30E,KAAKgxM,YAAYr8H,SAASliC,KAE5F,QAO+B,iBAAhB6gJ,EAAS,KAAoBA,EAAS,GAAGprK,WAAW,QAQ3DorK,EAAW,IAEf8e,GAA4BpyM,KAAKypM,eAAeh3J,IACpD,CACA,OAAO2gJ,GAA8Bgf,GAA2B9e,EAAU+e,GAAGntC,IAAK,KACtF,CAyBAqtC,cAAcppL,EAAKjL,EAAS,CACxBktL,oBAAoB,IAOpB,MAAMrS,EAAUnG,GAAUzpK,GAAOA,EAAMnpB,KAAKoiC,SAASjZ,GAC/CkoL,EAAarxM,KAAK6pM,oBAAoB51D,MAAM8kD,EAAS/4L,KAAK+wM,YAChE,OAAO/wM,KAAKsxM,mBAAmBD,EAAY9a,GAAuB,KAAMr4K,EAC5E,CA+BAs0L,SAASlf,EAAUp1K,EAAS,CAAEktL,oBAAoB,IAC9CqH,OA+KR,SAASA,GAAiBnf,GACtB,QAAS7rL,EAAI,EAAGA,EAAI6rL,EAAS5sL,OAAQe,IAEjC,GAAW,MADC6rL,EAAS7rL,GAEjB,MAAM,IAAIm8G,MAAc,MAAkFC,EAItH,CAvLQ4uF,CAAiBnf,GACVtzL,KAAKuyM,cAAcvyM,KAAKgyM,cAAc1e,EAAUp1K,GAASA,EACpE,CAEA2zL,aAAa1oL,GACT,OAAOnpB,KAAKw9L,cAActO,UAAU/lK,EACxC,CAEAiZ,SAASjZ,GACL,IAAI4vK,EACJ,IACIA,EAAU/4L,KAAKw9L,cAAc3vJ,MAAM1kB,EACvC,OACOjX,GACH6mL,EAAU/4L,KAAKywM,yBAAyBv+L,EAAGlS,KAAKw9L,cAAer0K,EACnE,CACA,OAAO4vK,CACX,CACA2Z,SAASvpL,EAAKwpL,GACV,IAAIzsM,EAUJ,GARIA,GADiB,IAAjBysM,EACU,IAAK3C,KAEO,IAAjB2C,EACK,IAAK1C,IAGL0C,EAEV/f,GAAUzpK,GACV,OAAOolK,GAAavuL,KAAKypM,eAAgBtgL,EAAKjjB,GAElD,MAAM6yL,EAAU/4L,KAAKoiC,SAASjZ,GAC9B,OAAOolK,GAAavuL,KAAKypM,eAAgB1Q,EAAS7yL,EACtD,CACAosM,iBAAiBn0K,GACb,OAAO95B,OAAO8E,KAAKg1B,GAAQloB,OAAO,CAAC5D,EAAQ9K,KACvC,MAAM8C,EAAQ8zB,EAAO52B,GACrB,OAAc,MAAV8C,IACAgI,EAAO9K,GAAO8C,GAEXgI,GACR,CAAC,EACR,CAEAi/L,mBAAmBvH,EAAQ7+L,EAAQurL,EAAev4K,EAAQ00L,GACtD,GAAI5yM,KAAKuwM,SACL,OAAO5xH,QAAQ1tE,SAAQ,GAE3B,IAAIA,GACAI,EACAgoB,GACAu5K,GACA3hM,GAAU2hM,EAAa3hM,QACvBI,EAASuhM,EAAavhM,OACtBgoB,GAAUu5K,EAAav5K,SAGvBA,GAAU,IAAIslD,QAAQ,CAAC38D,GAAK4uJ,MACxB3/J,GAAU+Q,GACV3Q,EAASu/J,KAIjB,MAAM3tD,GAASjjH,KAAK+iH,aAAax7F,MACjCuoL,UAAoB9vM,KAAM,KAGtBijJ,eAAe,IAAMjjJ,KAAK+iH,aAAa70E,OAAO+0E,IAAO,GAEzDjjH,KAAKkwM,sBAAsB9G,wBAAwB,CAC/Cl+L,SACAurL,gBACAgT,eAAgBzpM,KAAKypM,eACrBC,cAAe1pM,KAAKypM,eACpBE,kBAAmB3pM,KAAKyqM,eACxBV,SACA7rL,SACAjN,WACAI,SACAgoB,WACAqhK,gBAAiB16L,KAAKgxM,YAAYr8H,SAClCs1H,mBAAoBjqM,KAAKgxM,cAItB33K,GAAQ9mB,MAAOL,IACXysE,QAAQttE,OAAOa,IAE9B,CAEAi/L,cAAchoL,EAAK2hL,GACf,MAAMr7K,EAAOzvB,KAAKw9L,cAActO,UAAU/lK,GAC1C,GAAInpB,KAAKkzB,SAASmiF,qBAAqB5lF,IAAWq7K,EAAW5sL,OAAOmtL,WAAY,CAE5E,MACMx4L,EAAQ,IACPi4L,EAAW5sL,OAAOrL,SAClB7S,KAAK6yM,sBAAsB/H,EAAWxiM,GAHhBtI,KAAKmwM,gBAKlCnwM,KAAKkzB,SAASN,aAAanD,EAAM,GAAI5c,EACzC,KACK,CACD,MAAMA,EAAQ,IACPi4L,EAAW5sL,OAAOrL,SAClB7S,KAAK6yM,sBAAsB/H,EAAWxiM,GAAItI,KAAKmwM,cAAgB,IAEtEnwM,KAAKkzB,SAASqgF,GAAG9jF,EAAM,GAAI5c,EAC/B,CACJ,CAMAu+L,eAAetG,EAAYgI,GAA2B,GAClD,GAA0C,aAAtC9yM,KAAKowM,6BAA6C,CAClD,MACM2C,EAAqB/yM,KAAKqwM,cADHrwM,KAAKmwM,cAEP,IAAvB4C,EACA/yM,KAAKkzB,SAASo/E,UAAUygG,GAEnB/yM,KAAKypM,iBAAmBzpM,KAAK8xM,wBAAwB7G,UACnC,IAAvB8H,IAIA/yM,KAAKgzM,WAAWlI,GAGhB9qM,KAAKyqM,eAAiBK,EAAWrB,eACjCzpM,KAAKizM,2BAMb,KAC+C,YAAtCjzM,KAAKowM,+BAKN0C,GACA9yM,KAAKgzM,WAAWlI,GAEpB9qM,KAAKizM,2BAEb,CACAD,WAAW5yM,GACPJ,KAAKgxM,YAAc5wM,EAAE6pM,mBACrBjqM,KAAKypM,eAAiBrpM,EAAEqpM,eAMxBzpM,KAAK+wM,WAAa/wM,KAAK6pM,oBAAoB51D,MAAMj0I,KAAKypM,eAAgBrpM,EAAE2pM,OAC5E,CACAkJ,2BACIjzM,KAAKkzB,SAASN,aAAa5yB,KAAKw9L,cAActO,UAAUlvL,KAAK+wM,YAAa,GAAI/wM,KAAK6yM,sBAAsB7yM,KAAK0wM,iBAAkB1wM,KAAKqwM,eACzI,CACAwC,sBAAsBjK,EAAcsK,GAChC,MAA0C,aAAtClzM,KAAKowM,6BACE,CAAExH,eAAc0H,mBAAe4C,GAEnC,CAAEtK,eACb,CAACzoM,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyFg+F,EAAM,EAAoDj+F,SAC5JH,KAAKg0C,WA79JmF/yC,MAAE,CAAAgzC,MA69JYmqD,EAAMr7F,QAANq7F,EAAMp7F,UAAAC,WAAc,SACtI,OAttBKm7F,CAAM,KAouBZ,SAAS8yG,GAAoBh/L,GACzB,QAAUA,aAAaslL,IAA2BtlL,aAAaulL,GACnE,CAEA,IAiGM0b,GAAU,MAAhB,MAAMA,EACFpzM,YAAYupM,EAAQ9zJ,EAAO49J,EAAmBjlF,EAAU9mH,EAAIstG,IACxD30G,KAAKspM,OAASA,EACdtpM,KAAKw1C,MAAQA,EACbx1C,KAAKozM,kBAAoBA,EACzBpzM,KAAKmuH,SAAWA,EAChBnuH,KAAKqH,GAAKA,EACVrH,KAAK20G,iBAAmBA,GAKxB30G,KAAKmzB,KAAO,KACZnzB,KAAKszL,SAAW,KAEhBtzL,KAAKqzM,UAAY,IAAIjvG,KAOrBpkG,KAAKmyM,kBAAmB,EAOxBnyM,KAAKorM,oBAAqB,EAO1BprM,KAAKqrM,YAAa,EAClB,MAAM3jM,EAAUL,EAAGqwG,cAAchwG,SAASI,cAC1C9H,KAAKszM,gBAA8B,MAAZ5rM,GAA+B,SAAZA,EACtC1H,KAAKszM,gBACLtzM,KAAKwkG,aAAe8kG,EAAO90J,OAAO+B,UAAWyT,KACrCA,cAAa9T,IACbl2C,KAAKuzM,YAAW,GAKxBvzM,KAAKwzM,2BAA2B,IAExC,CAKAA,2BAA2BC,GACO,MAA1BzzM,KAAKozM,mBAA+DpzM,KAAKszM,iBAG7EtzM,KAAK0zM,oBAAoB,WAAYD,EACzC,CAEAz4F,YAAYnC,GACJ74G,KAAKszM,iBACLtzM,KAAKuzM,aAITvzM,KAAKqzM,UAAUh/K,KAAKr0B,KACxB,CAQA,cAAI2zM,CAAWrgB,GACK,MAAZA,GACAtzL,KAAKszL,SAAWzsL,MAAMC,QAAQwsL,GAAYA,EAAW,CAACA,GACtDtzL,KAAKwzM,2BAA2B,OAGhCxzM,KAAKszL,SAAW,KAChBtzL,KAAKwzM,2BAA2B,MAExC,CAEAI,QAAQC,EAAQhnH,EAASC,EAAUH,EAAQC,GAIvC,SAHqB,OAAjB5sF,KAAK+4L,SAGL/4L,KAAKszM,kBACU,IAAXO,GAAgBhnH,GAAWC,GAAYH,GAAUC,GAG1B,iBAAhB5sF,KAAKqM,QAAsC,SAAfrM,KAAKqM,WAShDrM,KAAKspM,OAAOiJ,cAAcvyM,KAAK+4L,QALhB,CACXqS,mBAAoBprM,KAAKorM,mBACzBC,WAAYrrM,KAAKqrM,WACjBx4L,MAAO7S,KAAK6S,SAMR7S,KAAKszM,gBACjB,CAEA98J,cACIx2C,KAAKwkG,cAAc/tD,aACvB,CACA88J,aACIvzM,KAAKmzB,KAAwB,OAAjBnzB,KAAK+4L,SAAoB/4L,KAAK20G,iBACtC30G,KAAK20G,kBAAkBP,mBAAmBp0G,KAAKspM,OAAOuI,aAAa7xM,KAAK+4L,UACxE,KACJ,MAAM+a,EAA+B,OAAd9zM,KAAKmzB,KACxB,QAWAikH,OAA2Bp3I,KAAKmzB,KAAMnzB,KAAKqH,GAAGqwG,cAAchwG,QAAQI,cAAe,QACvF9H,KAAK0zM,oBAAoB,OAAQI,EACrC,CACAJ,oBAAoBplF,EAAU+C,GAC1B,MAAMlD,EAAWnuH,KAAKmuH,SAChBzW,EAAgB13G,KAAKqH,GAAGqwG,cACZ,OAAd2Z,EACAlD,EAASn4E,aAAa0hE,EAAe4W,EAAU+C,GAG/ClD,EAAS74D,gBAAgBoiD,EAAe4W,EAEhD,CACA,WAAIyqE,GACA,OAAsB,OAAlB/4L,KAAKszL,SACE,KAEJtzL,KAAKspM,OAAO0I,cAAchyM,KAAKszL,SAAU,CAG5CD,gBAAgC9vL,IAApBvD,KAAKqzL,WAA2BrzL,KAAKqzL,WAAarzL,KAAKw1C,MACnE++D,YAAav0G,KAAKu0G,YAClB1vE,SAAU7kC,KAAK6kC,SACfqtK,oBAAqBlyM,KAAKkyM,oBAC1BC,iBAAkBnyM,KAAKmyM,kBAE/B,CAAChyM,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF+yM,GA9uKVlyM,MA8uKsCm9F,IA9uKtCn9F,MA8uKyDw4L,IA9uKzDx4L,MA8uKoF,YA9uKpFA,MA8uK4HA,OA9uK5HA,MA8uKqJA,OA9uKrJA,MA8uK+K8yM,OAAmB,EAA4C5zM,SACtUH,KAAK43G,UA/uKmF32G,MAAE,CAAAmL,KA+uKJ+mM,EAAU5yM,UAAA,uBAAAmyH,SAAA,EAAAmC,aAAA,SAAA9zH,EAAAC,GAAA,EAAAD,GA/uKRE,MAAE,iBAAA+yM,GAAA,OA+uKJhzM,EAAA4yM,QAAAI,EAAAH,OAAAG,EAAAnnH,QAAAmnH,EAAAlnH,SAAAknH,EAAArnH,OAAAqnH,EAAApnH,QAAkF,KAAA7rF,GA/uKhFE,MAAE,SAAAD,EAAAqL,OAAA,EAAA7L,OAAA,CAAA6L,OAAA,SAAAkoG,YAAA,cAAA1vE,SAAA,WAAAqtK,oBAAA,sBAAAr/L,MAAA,QAAAwgL,WAAA,aAAA8e,iBAAA,uCA+uKqRnyB,OAAgBorB,mBAAA,2CAAoEprB,OAAgBqrB,WAAA,2BAA4CrrB,OAAgB2zB,WAAA,cAAA97F,YAAA,EAAAsD,SAAA,CA/uKvbl6G,eAgvKpG,OA/JKkyM,CAAU,KA8QVc,GAAgB,MAAtB,MAAMA,EACF,YAAIvB,GACA,OAAO1yM,KAAKk0M,SAChB,CACAn0M,YAAYupM,EAAQ7jK,EAAS0oF,EAAUgmF,EAAK96I,GACxCr5D,KAAKspM,OAASA,EACdtpM,KAAKylC,QAAUA,EACfzlC,KAAKmuH,SAAWA,EAChBnuH,KAAKm0M,IAAMA,EACXn0M,KAAKq5D,KAAOA,EACZr5D,KAAKsH,QAAU,GACftH,KAAKk0M,WAAY,EAQjBl0M,KAAKo0M,wBAA0B,CAAE3mB,OAAO,GAiBxCztL,KAAKq0M,eAAiB,IAAIx/F,MAC1B70G,KAAKs0M,yBAA2BhL,EAAO90J,OAAO+B,UAAWyT,KACjDA,cAAa9T,IACbl2C,KAAK6e,QAAO,EAGxB,CAEA6hH,sBAEIpzB,QAAGttG,KAAKu0M,MAAM17F,WAASvL,MAAG,OAAO74D,QAAKs6D,SAAYx4D,UAAUnlC,IACxDpR,KAAK6e,SACL7e,KAAKw0M,8BAA6B,EAE1C,CACAA,+BACIx0M,KAAKy0M,8BAA8Bh+J,cACnC,MAAMi+J,EAAiB,IAAI10M,KAAKu0M,MAAM3rC,UAAW5oK,KAAKq5D,MACjDrxD,OAAQqxD,KAAWA,GACnBlxD,IAAIkxD,GAAQA,EAAKg6I,WACtBrzM,KAAKy0M,gCAA+B/uL,MAAKgvL,GAAgBjgK,QAAKs6D,SAAYx4D,UAAU8iB,IAC5Er5D,KAAKk0M,YAAcl0M,KAAK20M,aAAa30M,KAAKspM,OAAvBtpM,CAA+Bq5D,IAClDr5D,KAAK6e,QAAO,EAGxB,CACA,oBAAI+1L,CAAiBvlM,GACjB,MAAM/H,EAAUT,MAAMC,QAAQuI,GAAQA,EAAOA,EAAK9G,MAAM,KACxDvI,KAAKsH,QAAUA,EAAQU,OAAOqG,KAAOA,EACzC,CAEA2sG,YAAYnC,GACR74G,KAAK6e,QACT,CAEA23B,cACIx2C,KAAKs0M,yBAAyB79J,cAC9Bz2C,KAAKy0M,8BAA8Bh+J,aACvC,CACA53B,UACS7e,KAAKu0M,QAAUv0M,KAAKspM,OAAOqB,WAEhC1nD,eAAe,KACX,MAAM4xD,EAAiB70M,KAAK60M,iBACxB70M,KAAKk0M,YAAcW,IACnB70M,KAAKk0M,UAAYW,EACjB70M,KAAKm0M,IAAIjkD,eACTlwJ,KAAKsH,QAAQc,QAASiG,IACdwmM,EACA70M,KAAKmuH,SAAS1W,SAASz3G,KAAKylC,QAAQiyE,cAAerpG,GAGnDrO,KAAKmuH,SAASxW,YAAY33G,KAAKylC,QAAQiyE,cAAerpG,EAAC,GAG3DwmM,QAAiDtxM,IAA/BvD,KAAK80M,sBACvB90M,KAAKmuH,SAASn4E,aAAah2C,KAAKylC,QAAQiyE,cAAe,eAAgB13G,KAAK80M,sBAAsBvwM,YAGlGvE,KAAKmuH,SAAS74D,gBAAgBt1D,KAAKylC,QAAQiyE,cAAe,gBAG9D13G,KAAKq0M,eAAe/6L,KAAKu7L,GAAc,EAGnD,CACAF,aAAarL,GACT,MAAMpjM,EAqCd,SAAS6uM,GAAqB7uM,GAC1B,QAASA,EAAQsoL,KACrB,CAvCwBumB,CAAqB/0M,KAAKo0M,yBACtCp0M,KAAKo0M,wBAEJp0M,KAAKo0M,wBAAwB3mB,QAAS,EAC3C,OAAQp0H,KAASA,EAAK0/H,SAAUuQ,EAAOoJ,SAASr5I,EAAK0/H,QAAS7yL,EAClE,CACA2uM,iBACI,MAAMG,EAAkBh1M,KAAK20M,aAAa30M,KAAKspM,QAC/C,OAAOtpM,KAAKq5D,MAAQ27I,EAAgBh1M,KAAKq5D,OAASr5D,KAAKu0M,MAAM5pM,KAAKqqM,EACtE,CAAC70M,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF6zM,GAh9KVhzM,MAg9K4Cm9F,IAh9K5Cn9F,MAg9K+DA,OAh9K/DA,MAg9KyFA,OAh9KzFA,MAg9KkHA,OAh9KlHA,MAg9KmJkyM,GAAU,KAA4DhzM,SACjTH,KAAK43G,UAj9KmF32G,MAAE,CAAAmL,KAi9KJ6nM,EAAgB1zM,UAAA,6BAAAwyH,eAAA,SAAAhyH,EAAAC,EAAAqqJ,GAAmT,GAAnT,EAAAtqJ,GAj9KdE,MAAEoqJ,EAi9KqT8nD,GAAU,KAAApyM,EAAA,KAAAk0M,EAj9KjUh0M,MAAEg0M,EAAFh0M,WAAED,EAAAuzM,MAAAU,EAAA,GAAAz0M,OAAA,CAAA4zM,wBAAA,0BAAAU,sBAAA,wBAAAF,iBAAA,oBAAA/hF,QAAA,CAAAwhF,eAAA,kBAAAzhF,SAAA,qBAAA/a,YAAA,EAAAsD,SAAA,CAAFl6G,SAk9KpG,OAnHKgzM,CAAgB,KAuJtB,MAAMiB,IAEN,IAsDMC,GAAe,MAArB,MAAMA,EACFp1M,YAAYupM,EAAQvB,EAAU7sF,EAAUk6F,EAAoBhN,GACxDpoM,KAAKspM,OAASA,EACdtpM,KAAKk7G,SAAWA,EAChBl7G,KAAKo1M,mBAAqBA,EAC1Bp1M,KAAKooM,OAASA,CAClB,CACAiN,kBACIr1M,KAAKwkG,aACDxkG,KAAKspM,OAAO90J,OACPC,QAAKzsC,MAAQkK,GAAMA,aAAagkC,KAAa,EAAGk4D,KAAU,IAAMpuG,KAAKs1M,YACrE/+J,UAAU,OACvB,CACA++J,UACI,OAAOt1M,KAAKu1M,cAAcv1M,KAAKk7G,SAAUl7G,KAAKspM,OAAOn1J,OACzD,CAEAqC,cACQx2C,KAAKwkG,cACLxkG,KAAKwkG,aAAa/tD,aAE1B,CACA8+J,cAAcr6F,EAAU/e,GACpB,MAAMn6E,EAAM,GACZ,UAAWwzB,KAAS2mD,EAAQ,CACpB3mD,EAAMmxE,YAAcnxE,EAAM8xH,YAC1B9xH,EAAM8xH,aACFF,OAA0B5xH,EAAMmxE,UAAWzL,EAAW,UAAS1lE,EAAM/lB,SAE7E,MAAM+lL,EAA0BhgK,EAAM8xH,WAAapsD,EAC7Cu6F,GAAsBjgK,EAAM4oJ,iBAAmBoX,GAShDhgK,EAAM4mD,eAAiB5mD,EAAMmxJ,oBAAmCpjM,IAAlBiyC,EAAMqxJ,SACpDrxJ,EAAMyoJ,gBAAkBzoJ,EAAM6wJ,mBAC/BrkL,EAAI/a,KAAKjH,KAAK01M,cAAcF,EAAyBhgK,KAErDA,EAAMw4I,UAAYx4I,EAAMmxJ,gBACxB3kL,EAAI/a,KAAKjH,KAAKu1M,cAAcE,GAAsBjgK,EAAMw4I,UAAYx4I,EAAMmxJ,eAElF,CACA,SAAOjhL,MAAK1D,GAAKyyB,QAAKs6D,QAC1B,CACA2mG,cAAcx6F,EAAU1lE,GACpB,OAAOx1C,KAAKo1M,mBAAmBE,QAAQ9/J,EAAO,KAC1C,IAAImgK,EAEAA,EADAngK,EAAM4mD,mBAAkC74F,IAAlBiyC,EAAMqxJ,QACV7mM,KAAKooM,OAAOhsG,aAAa8e,EAAU1lE,IAGrDmgK,EAAkBroG,MAAG,MAEzB,MAAMsoG,EAAyBD,EAAgBlhK,QAAK65D,MAAUn6D,GAC3C,OAAXA,GAAW,EACJm5D,WAAG,IAEd93D,EAAMmxJ,cAAgBxyJ,EAAOgoD,OAC7B3mD,EAAM4oJ,gBAAkBjqJ,EAAO+mE,SAGxBl7G,KAAKu1M,cAAcphK,EAAO+mE,UAAYA,EAAU/mE,EAAOgoD,WAElE,GAAI3mD,EAAMyoJ,gBAAkBzoJ,EAAM6wJ,iBAAkB,CAChD,MAAMwP,EAAiB71M,KAAKooM,OAAOnK,cAAczoJ,GACjD,SAAO9vB,MAAK,CAACkwL,EAAwBC,IAAiBphK,QAAKs6D,QAC/D,CAEI,OAAO6mG,GAGnB,CAACz1M,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF+0M,GA3nLVl0M,MA2nL2Cm9F,IA3nL3Cn9F,MA2nL8DA,OA3nL9DA,MA2nLsFA,OA3nLtFA,MA2nLyHi0M,IA3nLzHj0M,MA2nLwJ2mM,IAAkB,EAA6CznM,SAC/SH,KAAKg0C,WA5nLmF/yC,MAAE,CAAAgzC,MA4nLYkhK,EAAepyM,QAAfoyM,EAAenyM,UAAAC,WAAc,SAC/I,OA/EKkyM,CAAe,KAqFrB,MAAMW,GAAkB,IAAI1jG,MAAe,IAAI,IACzC2jG,GAAc,MAApB,MAAMA,EAEFh2M,YAAYy9L,EAAe2L,EAAa6M,EAAkBx1D,EAAMt6I,EAAU,CAAC,GACvElG,KAAKw9L,cAAgBA,EACrBx9L,KAAKmpM,YAAcA,EACnBnpM,KAAKg2M,iBAAmBA,EACxBh2M,KAAKwgJ,KAAOA,EACZxgJ,KAAKkG,QAAUA,EACflG,KAAKi2M,OAAS,EACdj2M,KAAKk2M,WAAa,aAClBl2M,KAAKm2M,WAAa,EAClBn2M,KAAKm7H,MAAQ,CAAC,EAEdj1H,EAAQ82F,0BAA4B92F,EAAQ82F,2BAA6B,WACzE92F,EAAQ+2F,gBAAkB/2F,EAAQ+2F,iBAAmB,UACzD,CACAnpF,OAImD,aAA3C9T,KAAKkG,QAAQ82F,2BACbh9F,KAAKg2M,iBAAiB/4F,4BAA4B,UAEtDj9G,KAAKs0M,yBAA2Bt0M,KAAKo2M,qBACrCp2M,KAAKq2M,yBAA2Br2M,KAAKs2M,qBACzC,CACAF,qBACI,OAAOp2M,KAAKmpM,YAAY30J,OAAO+B,UAAUrkC,IACjCA,aAAawiC,IAEb10C,KAAKm7H,MAAMn7H,KAAKi2M,QAAUj2M,KAAKg2M,iBAAiBl6F,oBAChD97G,KAAKk2M,WAAahkM,EAAEmjC,kBACpBr1C,KAAKm2M,WAAajkM,EAAEukL,cAAgBvkL,EAAEukL,cAAcmS,aAAe,GAE9D12L,aAAagkC,IAClBl2C,KAAKi2M,OAAS/jM,EAAE5J,GAChBtI,KAAKu2M,oBAAoBrkM,EAAGlS,KAAKw9L,cAAc3vJ,MAAM37B,EAAEwkL,mBAAmB7xJ,WAErE3yB,aAAaykL,IACP,IAAXzkL,EAAEyrB,OACF39B,KAAKk2M,gBAAa3yM,EAClBvD,KAAKm2M,WAAa,EAClBn2M,KAAKu2M,oBAAoBrkM,EAAGlS,KAAKw9L,cAAc3vJ,MAAM37B,EAAEiX,KAAK0b,UAAQ,EAGhF,CACAyxK,sBACI,OAAOt2M,KAAKmpM,YAAY30J,OAAO+B,UAAUrkC,IAC/BA,aAAaitD,KAGfjtD,EAAEqvD,SAC6C,QAA3CvhE,KAAKkG,QAAQ82F,0BACbh9F,KAAKg2M,iBAAiBh6F,iBAAiB,CAAC,EAAG,IAEK,YAA3Ch8G,KAAKkG,QAAQ82F,2BAClBh9F,KAAKg2M,iBAAiBh6F,iBAAiB9pG,EAAEqvD,UAKzCrvD,EAAEo6H,QAA2C,YAAjCtsI,KAAKkG,QAAQ+2F,gBACzBj9F,KAAKg2M,iBAAiB95F,eAAehqG,EAAEo6H,QAES,aAA3CtsI,KAAKkG,QAAQ82F,2BAClBh9F,KAAKg2M,iBAAiBh6F,iBAAiB,CAAC,EAAG,IAAE,EAI7D,CACAu6F,oBAAoBhf,EAAajrD,GAC7BtsI,KAAKwgJ,KAAKhuG,kBAAkB,KAIxBnT,WAAW,KACPr/B,KAAKwgJ,KAAKj+H,IAAI,KACVviB,KAAKmpM,YAAY30J,OAAOngB,KAAK,IAAI8qC,GAAOo4H,EAAiC,aAApBv3L,KAAKk2M,WAA4Bl2M,KAAKm7H,MAAMn7H,KAAKm2M,YAAc,KAAM7pE,GAAO,EACpI,EACF,EAAC,EAEZ,CAEA91F,cACIx2C,KAAKs0M,0BAA0B79J,cAC/Bz2C,KAAKq2M,0BAA0B5/J,aACnC,CAACt2C,SACQH,KAAKgD,UAAI,SAAA5C,GA3tL+Ea,MAAE,EA2tLiFd,SAC3KH,KAAKg0C,WA5tLmF/yC,MAAE,CAAAgzC,MA4tLY8hK,EAAchzM,QAAdgzM,EAAc/yM,YAChI,OAzFK+yM,CAAc,KAmJpB,SAASS,GAAcnvG,EAAMsf,GACzB,MAAO,CAAEQ,WAAO9f,EAAMyf,gBAAYH,EACtC,CA+EA,SAAS8vF,KACL,MAAMv7F,KAAW1I,OAAO4rC,OACxB,OAAQs4D,IACJ,MAAMt8E,EAAMlf,EAAS3tG,IAAIyqK,OACzB,GAAI0+B,IAA6Bt8E,EAAIrqG,WAAW,GAC5C,OAEJ,MAAMu5K,EAASpuF,EAAS3tG,IAAI6wF,IACtBu4G,EAAgBz7F,EAAS3tG,IAAIqpM,IACM,IAArC17F,EAAS3tG,IAAIspM,KACbvN,EAAOkI,oBAEXt2F,EAAS3tG,IAAIupM,GAAkB,KAAMxsF,MAAYK,WAAW0qF,kBAC5Dn6F,EAAS3tG,IAAIuoM,GAAiB,KAAMxrF,MAAYK,WAAW72G,OAC3Dw1L,EAAOiI,uBAAuBn3E,EAAIs+C,eAAe,IAC5Ci+B,EAAclyG,SACfkyG,EAActiL,OACdsiL,EAAcphJ,WACdohJ,EAAclgK,cAAY,CAGtC,CAMA,MAAMmgK,GAAiB,IAAIxkG,MAA8F,GAAI,CACzHrvG,QAASA,IACE,IAAIqhG,OAGbyyG,GAAqB,IAAIzkG,MAAwF,GAAI,CAAEnvG,WAAY,OAAQF,QAASA,IAAM,IAuJ1J+zM,GAAmB,IAAI1kG,MAAsF,IA2BnH,SAAS2kG,GAAe3B,GAKpB,OAAOoB,GAAc,EAJH,CACd,CAAE14G,QAASg5G,GAAkBlwF,YAAauuF,IAC1C,CAAEr3G,QAASo3G,GAAoBtuF,YAAawuF,IAGpD,CA4IA,MAIM4B,GAAuB,IAAI5kG,MAC7B,wBAKE6kG,GAAmB,CACrBviG,MACA,CAAE5W,QAAS2xF,GAAezxF,SAAU0xF,IACpCtxF,GACAu5F,GACA,CAAE75F,QAAS27F,GAAgBn7F,WA1c/B,SAAS44G,GAAU5N,GACf,OAAOA,EAAO0H,YAAYv+J,IAC9B,EAwcsD0rD,KAAM,CAACC,KACzDwpG,GAII,IAER,SAASuP,KACL,OAAO,IAAIhiC,MAAa,SAAU/2E,GACtC,CACA,IAqBMtB,GAAY,MAAlB,MAAMA,EACF/8F,YAAYojM,GAAS,CAmBrB,cAAOpmG,CAAQZ,EAAQhoD,GACnB,MAAO,CACHqkG,SAAU17C,EACV6pB,UAAW,CACPswF,GAGI,GACJ,CAAEn5G,QAAS6pG,GAAQ1pG,OAAO,EAAMC,SAAU/B,GAC1C,CACI2B,QAASk5G,GACT14G,WAAY84G,GACZj5G,KAAM,CAAC,CAACC,GAAQ,IAAIusB,MAAY,IAAID,SAExC,CAAE5sB,QAASuxG,GAAsBnxG,SAAU/pD,GAAkB,CAAC,GAC9DA,GAAQkjK,QAuEb,CAAEv5G,QAASgW,MAAkB9V,SAAUyW,OAKvC,CAAE3W,QAASgW,MAAkB9V,SAAU+V,OAvBvC,CACHjW,QAASg4G,GACTx3G,WAAYA,KACR,MAAM03G,KAAmBxjG,OAAOkJ,OAC1B8kC,KAAOhuC,OAAOwsC,OACd7qG,KAASq+D,OAAO68F,IAChBlG,KAAc32F,OAAOk2F,IACrBlL,KAAgBhrF,OAAOi9E,IAC7B,OAAIt7I,EAAOmjK,cACPtB,EAAiBn6F,UAAU1nE,EAAOmjK,cAE/B,IAAIvB,GAAevY,EAAe2L,EAAa6M,EAAkBx1D,EAAMrsG,EAAM,GA9DhFA,GAAQihK,mBAAqB2B,GAAe5iK,EAAOihK,oBAAoBtuF,gBAAa,GACpF,CAAEhpB,QAASq3E,MAAcl3E,OAAO,EAAMK,WAAY64G,IAClDhjK,GAAQq9J,kBAAoB+F,GAAyBpjK,GAAU,GAC/DA,GAAQqjK,sBA5FbhB,GAAc,EAJH,CACd/Z,GACA,CAAE3+F,QAAS29F,GAAc70E,YAAa61E,MA8F8B31E,gBAAa,GAmG9E,CAGH,CAAEhpB,QAAS25G,GAAoBn5G,WAAYm4G,IAC3C,CAAE34G,QAASo3E,KAAwBj3E,OAAO,EAAM2oB,YAAa6wF,MAnGjE,CAiBA,eAAOC,CAASv7G,GACZ,MAAO,CACHq8C,SAAU17C,EACV6pB,UAAW,CAAC,CAAE7oB,QAAS6pG,GAAQ1pG,OAAO,EAAMC,SAAU/B,IAE9D,CAACh8F,SACQH,KAAKgD,UAAI,SAAA5C,GAAA,WAAAA,GAAyF08F,GA7zMV77F,MA6zMwC+1M,GAAoB,KAA2D72M,SAC/MH,KAAKo7G,UA9zMmFn6G,MAAE,CAAAmL,KA8zMS0wF,IAA2K38F,SAC9QH,KAAKq7G,UA/zMmFp6G,MAAE,IAg0MtG,OAtEK67F,CAAY,KAiHlB,SAASs6G,GAAoB9N,GAKzB,MAAO,SACX,CAGA,SAASiO,GAAyBpjK,GAC9B,MAAO,CAC0B,aAA7BA,EAAOq9J,kBAzYJgF,GAAc,EAbH,CACd,CACI14G,QAASO,MACTJ,OAAO,EACPK,WAAYA,KACR,MAAMgrG,KAAS92F,OAAOpU,IACtB,MAAO,KACHkrG,EAAOmI,6BAA4B,CACvC,GAGR,CAAE3zG,QAAS+4G,GAAoB34G,SAAU,KA2YiC4oB,gBAAa,GAC1D,oBAA7B3yE,EAAOq9J,kBApbJgF,GAAc,EAhCH,CACd,CAAE14G,QAAS+4G,GAAoB34G,SAAU,GACzC,CACIJ,QAASO,MACTJ,OAAO,EACPE,KAAM,CAACigD,OACP9/C,WAAa4c,IACT,MAAMy8F,EAAsBz8F,EAAS3tG,IAAImlG,MAAsB/zB,QAAQ1tE,WACvE,MAAO,IACI0mM,EAAoBnyM,KAAK,IACrB,IAAIm5E,QAAQ1tE,IACf,MAAMq4L,EAASpuF,EAAS3tG,IAAI6wF,IACtBu4G,EAAgBz7F,EAAS3tG,IAAIqpM,IACnC9G,GAAoBxG,EAAQ,KAGxBr4L,GAAQ,EAAI,GAEhBiqG,EAAS3tG,IAAIm7L,IAAuBQ,mBAAqB,KAIrDj4L,GAAQ,GACD0lM,EAAclyG,UAAS6I,WAAG,GAAUqpG,GAE/CrN,EAAOkI,mBAAkB,GAEhC,KA0b8B1qF,gBACvC,GAEZ,CAQA,MAAM2wF,GAAqB,IAAIrlG,MAAwF,uBQxyNvH,SAAAwlG,EAAAC,EAAA5mM,GAAAI,GAAAo2F,EAAAqwG,GAAAvwM,GAAA43B,IACA,IACA,IAAA4+C,GAAA85H,EAAAtwM,IAAA43B,IACA90B,GAAA0zE,GAAA1zE,KACA,OAAIqkB,IAEJ,YADArd,GAAAqd,GAEA,CACAqvD,GAAAotB,KACAl6F,GAAA5G,IAEAs0E,QAAA1tE,QAAA5G,IAAA7E,KAAAiiG,EAAAqwG,GAEA,CACe,SAAAr5H,EAAAx4D,GACf,kBACA,IAAAtiB,GAAA3D,KACA4J,GAAAq1B,UACA,WAAA0/C,QAAA,SAAA1tE,EAAAI,IACA,IAAAwmM,GAAA5xL,EAAArC,MAAAjgB,GAAAiG,IACA,SAAA69F,GAAAp9F,IACAutM,EAAAC,GAAA5mM,EAAAI,GAAAo2F,GAAAqwG,GAAA,OAAAztM,GACA,CACA,SAAAytM,GAAAxxL,IACAsxL,EAAAC,GAAA5mM,EAAAI,GAAAo2F,GAAAqwG,GAAA,QAAAxxL,GACA,CACAmhF,QAAA,EACA,EACA,CACA,sCCqFO,SAAA0F,GAAAj/B,GAAA6pI,EAAAC,EAAAC,IAEP,WAAAD,MAAAr5H,UAAA,SAAA1tE,GAAAI,IACA,SAAA6mM,GAAA7tM,IAAkC,IAAM8tM,GAAAF,GAAA5jL,KAAAhqB,IAAA,OAA+B6H,IAAYb,GAAAa,GAAA,EACnF,SAAAkmM,GAAA/tM,IAAiC,IAAM8tM,GAAAF,GAAAI,MAAAhuM,IAAA,OAAmC6H,IAAYb,GAAAa,GAAA,EACtF,SAAAimM,GAAA9lM,IAA8BA,GAAA84F,KAAAl6F,GAAAoB,GAAAhI,OAJ9B,SAAAiuM,GAAAjuM,IAA0B,OAAAA,cAAA2tM,EAAA3tM,GAAA,IAAA2tM,EAAA,SAAA/mM,IAA+DA,GAAA5G,GAAA,EAAiB,CAI5EiuM,CAAAjmM,GAAAhI,OAAA7E,KAAA0yM,GAAAE,GAAA,CAC9BD,IAAAF,MAAAr0L,MAAAsqD,GAAA6pI,GAAA,KAAA1jL,OACA,EACA,CAqGO,SAAAk9E,GAAAroC,IACP,OAAAlpE,gBAAAuxG,IAAAvxG,KAAAkpE,KAAAlpE,MAAA,IAAAuxG,GAAAroC,GACA,CAEO,SAAAkoC,GAAAljC,GAAA6pI,EAAAE,GACP,IAAAhtG,OAAAC,cAAA,UAAAxzB,UAAA,wCACA,IAAAjwE,GAAAitL,GAAAujB,EAAAr0L,MAAAsqD,GAAA6pI,GAAA,IAAA1F,GAAA,GACA,OAAA5qM,GAAA,GAAe8wM,GAAA,QAAAA,GAAA,SAAAA,GAAA,UAAA9wM,GAAAwjG,OAAAC,eAAA,WAAuF,OAAAlrG,IAAA,EAAcyH,GACpH,SAAA8wM,GAAA5uJ,IAAqB+qI,GAAA/qI,MAAAliD,GAAAkiD,IAAA,SAAAuf,IAAgC,WAAAyV,QAAA,SAAA95D,GAAAC,IAAqCutL,GAAAprM,KAAA,CAAA0iD,GAAAuf,GAAArkD,GAAAC,KAAA,GAAAuwE,GAAA1rC,GAAAuf,GAAA,EAA2C,GACrI,SAAAmsB,GAAA1rC,GAAAuf,IAA0B,KAC1B,SAAAivI,GAAA5xI,IAAqBA,GAAAl8D,iBAAAknG,GAAA5yB,QAAA1tE,QAAAs1D,GAAAl8D,MAAA6+D,GAAA1jE,KAAAgzM,GAAAnnM,IAAAonM,GAAApG,GAAA,MAAA9rI,GAAA,CADW4xI,CAAAzjB,GAAA/qI,IAAAuf,IAAA,OAAiBh3D,IAAYumM,GAAApG,GAAA,MAAAngM,GAAA,EAE7D,SAAAsmM,GAAAnuM,IAA4BgrF,GAAA,OAAAhrF,GAAA,CAC5B,SAAAgH,GAAAhH,IAA2BgrF,GAAA,QAAAhrF,GAAA,CAC3B,SAAAouM,GAAAvzC,GAAAh8F,IAA0Bg8F,GAAAh8F,IAAAmpI,GAAAxuI,QAAAwuI,GAAA3rM,QAAA2uF,GAAAg9G,GAAA,MAAAA,GAAA,OAC1B,CAQO,SAAAjlG,GAAApvF,IACP,IAAAitF,OAAAC,cAAA,UAAAxzB,UAAA,wCACA,IAAAjwE,EAAAi9D,EAAA1mD,GAAAitF,OAAAC,eACA,OAAAxmC,IAAAhgE,KAAAsZ,QAhFO,SAAA06L,GAAA16L,IACP,IAAAgsC,EAAA,mBAAAihD,eAAAD,SAAAtmC,EAAA1a,GAAAhsC,GAAAgsC,GAAAviD,GAAA,EACA,GAAAi9D,EAAA,OAAAA,EAAAhgE,KAAAsZ,IACA,GAAAA,IAAA,iBAAAA,GAAAtX,OAAA,OACA2tB,KAAA,WACA,OAAArW,IAAAvW,IAAAuW,GAAAtX,SAAAsX,QAAA,GACA,CAAmB3T,MAAA2T,OAAAvW,MAAA0jG,MAAAntF,GACnB,GAEA,UAAA05D,UAAA1tB,EAAA,4DACA,CAsEA0uJ,CAAA16L,IAAAvW,EAAA,GAAyG8wM,GAAA,QAAAA,GAAA,SAAAA,GAAA,UAAA9wM,EAAAwjG,OAAAC,eAAA,WAAuF,OAAAlrG,IAAA,EAAcyH,GAC9M,SAAA8wM,GAAA5uJ,IAAqBliD,EAAAkiD,IAAA3rC,GAAA2rC,KAAA,SAAAuf,IAA8B,WAAAyV,QAAA,SAAA1tE,GAAAI,KACnD,SAAAonM,GAAAxnM,GAAAI,GAAA+oD,GAAA8O,IAA2CyV,QAAA1tE,QAAAi4D,IAAA1jE,KAAA,SAAA0jE,IAAsCj4D,GAAA,CAAU5G,MAAA6+D,GAAAiiC,KAAA/wC,IAAmB,EAAI/oD,GAAA,CADfonM,CAAAxnM,GAAAI,IAAA63D,GAAAlrD,GAAA2rC,IAAAuf,KAAAiiC,KAAAjiC,GAAA7+D,MAAA,EAAwD,EAE3J,mDAgEA,mBAAAsuM","names":["ExternalLinksComponent","constructor","this","ExternalLinksInfo","gridList","static","t","_angular_core__WEBPACK_IMPORTED_MODULE_0__","Xpm","selectors","inputs","ngContentSelectors","_c0","decls","vars","consts","template","rf","ctx","i0","ExternalLinksModule","oAB","cJS","CommonModule","LogoComponent","LogoInfo","logoMin","LogoModule","ConfigService","APIUrl","environment","apiUrl","azureStorageSASUrl","azureStorageCatalog","_gisAPIUrl","gisApiUrl","_apyKey","apiKey","_WorldStreetThumbnailMapUrl","_arcgisServerUrl","arcgisServerUrl","getAPIUrl","AzureStorageSASUrl","AzureStorageCatalog","gisAPIUrl","WorldStreetThumbnailMapUrl","ApiKey","_angular_core__WEBPACK_IMPORTED_MODULE_1__","Yz7","factory","ɵfac","providedIn","production","sentryEnable","isGlobalObj","obj","Math","undefined","GLOBAL_OBJ","globalThis","window","self","global","getGlobalObject","getGlobalSingleton","name","creator","gbl","__SENTRY__","DEFAULT_ENVIRONMENT","objectToString","Object","prototype","toString","isError","wat","call","isInstanceOf","Error","isBuiltin","className","isErrorEvent","isDOMError","isString","isParameterizedString","isPrimitive","isPlainObject","isEvent","Event","isThenable","then","isNaN","base","isVueViewModel","__isVue","_isVue","WINDOW","DEFAULT_MAX_STRING_LENGTH","htmlTreeAsString","elem","options","currentElem","MAX_TRAVERSE_HEIGHT","out","height","len","separator","sepLength","length","nextStr","keyAttrs","Array","isArray","maxStringLength","_htmlElementAsString","push","parentNode","reverse","join","el","classes","key","attr","i","tagName","HTMLElement","dataset","sentryComponent","toLowerCase","keyAttrPairs","filter","keyAttr","getAttribute","map","forEach","keyAttrPair","id","split","allowedAttrs","getComponentName","DEBUG_BUILD","__SENTRY_DEBUG__","CONSOLE_LEVELS","originalConsoleMethods","consoleSandbox","callback","console","wrappedFuncs","wrappedLevels","keys","level","originalConsoleMethod","logger","makeLogger","enabled","enable","disable","isEnabled","args","truncate","str","max","slice","safeJoin","input","delimiter","output","value","String","stringMatchesSomePattern","testString","patterns","requireExactStringMatch","some","pattern","isMatchingPattern","isRegExp","test","includes","fill","source","replacementFactory","original","wrapped","markFunctionWrapped","addNonEnumerableProperty","defineProperty","writable","configurable","log","getOriginalFunction","func","__sentry_original__","convertToPlainObject","message","stack","getOwnProperties","newObj","type","target","serializeEventTarget","currentTarget","CustomEvent","detail","isElement","Element","extractedProps","property","hasOwnProperty","dropUndefinedKeys","inputValue","_dropUndefinedKeys","Map","memoizationMap","isPojo","getPrototypeOf","memoVal","get","returnValue","set","item","uuid4","crypto","msCrypto","getRandomByte","random","randomUUID","replace","getRandomValues","typedArray","Uint8Array","c","getFirstException","event","exception","values","getEventDescription","event_id","eventId","firstException","addExceptionTypeValue","addExceptionMechanism","newMechanism","currentMechanism","mechanism","handled","mergedData","data","checkOrSetAlreadyCaught","__sentry_captured__","arrayify","maybeArray","ONE_SECOND_IN_MS","dateTimestampInSeconds","Date","now","timestampInSeconds","createUnixTimestampInSecondsFunc","performance","approxStartingTimeOrigin","timeOrigin","_browserPerformanceTimeOriginMode","browserPerformanceTimeOrigin","threshold","performanceNow","dateNow","timeOriginDelta","abs","timeOriginIsReliable","navigationStart","timing","navigationStartDelta","States","resolvedSyncPromise","SyncPromise","resolve","rejectedSyncPromise","reason","_","reject","PENDING","RESOLVED","REJECTED","executor","__init","__init2","__init3","__init4","_state","_handlers","_resolve","_reject","e","onfulfilled","onrejected","result","_executeHandlers","catch","val","finally","onfinally","isRejected","_setResult","state","_value","cachedHandlers","handler","getGlobalEventProcessors","addGlobalEventProcessor","notifyEventProcessors","processors","hint","index","processor","final","makeSession","context","startingTime","session","sid","init","timestamp","started","duration","status","errors","ignoreDuration","toJSON","sessionToJSON","toISOString","did","abnormal_mechanism","attrs","release","ip_address","ipAddress","user_agent","userAgent","updateSession","user","email","username","closeSession","getRootSpan","span","transaction","BAGGAGE_HEADER_NAME","SENTRY_BAGGAGE_KEY_PREFIX","SENTRY_BAGGAGE_KEY_PREFIX_REGEX","MAX_BAGGAGE_STRING_LENGTH","dynamicSamplingContextToSentryBaggageHeader","dynamicSamplingContext","objectToBaggageHeader","object","entries","reduce","baggageHeader","objectKey","objectValue","currentIndex","baggageEntry","encodeURIComponent","newBaggageHeader","warn","acc","dscKey","dscValue","baggageHeaderToObject","keyOrValue","decodeURIComponent","trim","TRACEPARENT_REGEXP","RegExp","generateSentryTraceHeader","traceId","spanId","substring","sampled","sampledString","TRACE_FLAG_SAMPLED","spanToTraceContext","span_id","trace_id","spanContext","op","parent_span_id","tags","origin","spanToJSON","spanToTraceHeader","spanIsSampled","spanTimeInputToSeconds","ensureTimestampInSeconds","getTime","spanIsSpanClass","getSpanJSON","traceFlags","getDynamicSamplingContextFromClient","client","scope","getOptions","publicKey","public_key","getDsn","segment","user_segment","getUser","dsc","emit","getDynamicSamplingContextFromSpan","getClient","getCurrentScope","txn","v7FrozenDsc","_frozenDynamicSamplingContext","sampleRate","maybeSampleRate","metadata","sample_rate","jsonSpan","description","applyScopeDataToEvent","fingerprint","breadcrumbs","sdkProcessingMetadata","propagationContext","applyDataToEvent","extra","contexts","transactionName","cleanedExtra","cleanedTags","cleanedUser","cleanedContexts","applySpanToEvent","trace","rootSpan","applyFingerprintToEvent","concat","applyBreadcrumbsToEvent","mergedBreadcrumbs","applySdkMetadataToEvent","mergeScopeData","mergeData","eventProcessors","attachments","mergeAndOverwriteScopeData","prop","mergeVal","globalScope","Scope","_notifyingListeners","_scopeListeners","_eventProcessors","_breadcrumbs","_attachments","_user","_tags","_extra","_contexts","_sdkProcessingMetadata","_propagationContext","generatePropagationContext","clone","newScope","_level","_span","_session","_transactionName","_fingerprint","_requestSession","_client","setClient","addScopeListener","addEventProcessor","setUser","_notifyScopeListeners","getRequestSession","setRequestSession","requestSession","setTags","setTag","o","setExtras","extras","setExtra","setFingerprint","setLevel","setTransactionName","setContext","setSpan","getSpan","getTransaction","setSession","getSession","update","captureContext","updatedScope","clear","addBreadcrumb","breadcrumb","maxBreadcrumbs","maxCrumbs","mergedBreadcrumb","getLastBreadcrumb","clearBreadcrumbs","addAttachment","attachment","getAttachments","getScopeData","clearAttachments","applyToEvent","additionalEventProcessors","setSDKProcessingMetadata","newData","setPropagationContext","getPropagationContext","captureException","syntheticException","originalException","captureMessage","captureEvent","SDK_VERSION","API_VERSION","parseFloat","DEFAULT_BREADCRUMBS","Hub","isolationScope","_version","assignedScope","assignedIsolationScope","_stack","bindClient","_isolationScope","isOlderThan","version","top","getStackTop","setupIntegrations","pushScope","getScope","getStack","popScope","pop","withScope","maybePromiseResult","res","getIsolationScope","_lastEventId","lastEventId","beforeBreadcrumb","finalBreadcrumb","configureScope","run","oldHub","makeMain","getIntegration","integration","startTransaction","customSamplingContext","_callExtensionMethod","traceHeaders","captureSession","endSession","_sendSessionUpdate","startSession","navigator","currentSession","shouldSendDefaultPii","sendDefaultPii","method","sentry","getMainCarrier","extensions","apply","hub","registry","getHubFromCarrier","setHubOnCarrier","getCurrentHub","acs","getGlobalHub","hasHubOnCarrier","carrier","STACKTRACE_FRAME_LIMIT","WEBPACK_ERROR_REGEXP","STRIP_FRAME_REGEXP","createStackParser","parsers","sortedParsers","sort","a","b","p","skipFirst","frames","lines","line","cleanedLine","match","parser","frame","stripSentryFramesAndReverse","localStack","from","function","filename","stackParserFromStackParserOptions","stackParser","defaultFunctionName","getFunctionName","fn","normalize","depth","maxProperties","visit","err","ERROR","normalizeToSize","maxSize","normalized","jsonSize","utf8Length","encodeURI","JSON","stringify","memo","memoBuilder","hasWeakSet","WeakSet","inner","memoize","has","add","unmemoize","delete","splice","stringified","stringifyValue","_events","document","isSyntheticEvent","objName","getConstructorName","startsWith","__sentry_skip_normalization__","remainingDepth","__sentry_override_normalization_depth__","valueWithToJSON","numAdded","visitable","visitKey","prepareEvent","normalizeDepth","normalizeMaxBreadth","prepared","integrations","applyClientOptions","dist","maxValueLength","request","url","applyIntegrationsMetadata","integrationNames","sdk","applyDebugIds","debugIdMap","_sentryDebugIds","debugIdStackFramesCache","cachedDebugIdStackFrameCache","debugIdStackParserCache","filenameDebugIdMap","debugIdStackTrace","parsedStack","cachedParsedStack","stackFrame","stacktrace","debug_id","finalScope","getFinalScope","clientEventProcessors","getEventProcessors","getGlobalScope","evt","applyDebugMeta","abs_path","debug_meta","images","code_file","normalizeEvent","maxBreadth","spans","WeakMap","captureContextKeys","parseEventHintOrCaptureContext","hintIsScopeOrFunction","hintIsScopeContext","currentScope","end","installedIntegrations","getIntegrationsToSetup","defaultIntegrations","userIntegrations","isDefaultInstance","finalIntegrations","filterDuplicates","integrationsByName","currentInstance","existingInstance","k","debugIndex","findIndex","arr","debugInstance","setupIntegration","integrationIndex","indexOf","setupOnce","setup","on","preprocessEvent","bind","processEvent","assign","convertIntegrationFnToClass","DEFAULT_IGNORE_ERRORS","DEFAULT_IGNORE_TRANSACTIONS","INTEGRATION_NAME","inboundFiltersIntegration","_inboundFiltersIntegration","_hint","clientOptions","mergedOptions","_mergeOptions","internalOptions","allowUrls","denyUrls","ignoreErrors","disableErrorDefaults","ignoreTransactions","disableTransactionDefaults","ignoreInternal","_shouldDropEvent","_isSentryError","_isIgnoredError","_getPossibleEventMessages","possibleMessages","lastException","error","_isIgnoredTransaction","_isDeniedUrl","_getEventFilterUrl","_isAllowedUrl","_getLastValidUrl","originalFunctionToString","functionToStringIntegration","_functionToStringIntegration","Function","DSN_REGEX","dsnToString","dsn","withPassword","host","path","pass","port","projectId","protocol","dsnFromComponents","components","makeDsn","dsnFromString","exec","lastPath","projectMatch","validateDsn","find","component","isValidProtocol","parseInt","SENTRY_API_VERSION","getBaseApiEndpoint","getEnvelopeEndpointWithUrlEncodedAuth","tunnelOrOptions","sdkInfo","_metadata","tunnel","_getIngestEndpoint","_encodedAuth","urlEncode","sentry_key","sentry_version","sentry_client","supportsFetch","Headers","Request","Response","isNativeFetch","handlers","instrumented","addHandler","maybeInstrument","instrumentFn","triggerHandlers","typeHandlers","lastHref","addHistoryInstrumentationHandler","instrumentHistory","supportsHistory","chrome","app","runtime","history","pushState","replaceState","oldOnPopState","onpopstate","historyReplacementFunction","originalHistoryFunction","to","location","href","createEnvelope","headers","items","addItemToEnvelope","envelope","newItem","forEachEnvelopeItem","envelopeItems","envelopeItem","encodeUTF8","textEncoder","TextEncoder","encode","serializeEnvelope","envHeaders","parts","append","next","itemHeaders","payload","stringifiedPayload","concatBuffers","buffers","totalLength","buf","merged","offset","buffer","createAttachmentEnvelopeItem","content_type","contentType","attachment_type","attachmentType","ITEM_TYPE_TO_DATA_CATEGORY_MAP","sessions","client_report","user_report","profile","replay_event","replay_recording","check_in","feedback","statsd","envelopeItemTypeToDataCategory","getSdkMetadataForEnvelopeHeader","metadataOrEvent","createEventEnvelopeHeaders","sent_at","SentryError","logLevel","super","setPrototypeOf","ALREADY_SEEN_ERROR","BaseClient","_options","_integrations","_integrationsInitialized","_numProcessing","_outcomes","_hooks","_dsn","_transport","transport","recordDroppedEvent","transportOptions","_process","eventFromException","_captureEvent","eventMessage","promisedEvent","eventFromMessage","sendSession","getSdkMetadata","getTransport","flush","timeout","metricsAggregator","_isClientDoneProcessing","clientFinished","transportFlushed","close","eventProcessor","forceInitialize","_isEnabled","_setupIntegrations","getIntegrationById","integrationId","getIntegrationByName","integrationName","addIntegration","sendEvent","env","createEventEnvelope","eventType","enhanceEventWithSdkInfo","packages","envelopeHeaders","promise","_sendEnvelope","sendResponse","createSessionEnvelope","category","_event","sendClientReports","captureAggregateMetrics","metricBucketItems","metricsEnvelope","createMetricEnvelope","createMetricEnvelopeItem","serializeMetricBuckets","tagEntries","maybeTags","unit","metric","metricType","hook","rest","_updateSessionFromEvent","crashed","errored","exceptions","ex","sessionNonTerminal","Number","ticked","interval","setInterval","clearInterval","_prepareEvent","parentSpanId","_processEvent","finalEvent","sentryError","isTransaction","isTransactionEvent","beforeSendLabel","dataCategory","__sentry__","processBeforeSend","beforeSend","beforeSendTransaction","_validateBeforeSendResult","beforeSendResult","invalidValueError","processedEvent","transactionInfo","transaction_info","send","_clearOutcomes","outcomes","quantity","applySdkMetadata","names","exceptionFromError","parseStackFrames","extractMessage","eventFromError","popSize","getPopSize","framesToPop","reactMinifiedRegexp","eventFromUnknownInput","attachStacktrace","isUnhandledRejection","isDOMException","domException","eventFromString","code","eventFromPlainObject","getNonErrorObjectExceptionValue","__serialized__","synthetic","__sentry_template_string__","__sentry_template_values__","logentry","params","extractExceptionKeysForMessage","maxLength","includedKeys","serialized","captureType","getObjectClassName","ignoreOnError","shouldIgnoreOnError","wrap","before","wrapper","__sentry_wrapped__","sentryWrapped","arguments","wrappedArguments","arg","ignoreNextOnError","setTimeout","getOwnPropertyDescriptor","BrowserClient","SENTRY_SDK_SOURCE","getSDKSource","addEventListener","visibilityState","_flushOutcomes","captureUserFeedback","createUserFeedbackEnvelope","createUserFeedbackEnvelopeItem","platform","createClientReportEnvelope","discarded_events","instrumentConsole","DEBOUNCE_DURATION","debounceTimerID","lastCapturedEventType","lastCapturedEventTargetId","addClickKeypressInstrumentationHandler","instrumentDOM","triggerDOMHandler","globalDOMEventHandler","makeDOMEventHandler","proto","originalAddEventListener","listener","__sentry_instrumentation_handlers__","handlerForType","refCount","originalRemoveEventListener","globalListener","_sentryCaptured","getEventTarget","shouldSkipDOMEvent","isContentEditable","_sentryId","isSimilarToLastCapturedEvent","clearTimeout","SENTRY_XHR_DATA_KEY","addXhrInstrumentationHandler","instrumentXHR","XMLHttpRequest","xhrproto","originalOpen","startTimestamp","toUpperCase","parseUrl","request_headers","__sentry_own_request__","onreadystatechangeHandler","xhrInfo","readyState","status_code","endTimestamp","xhr","onreadystatechange","readyStateArgs","setRequestHeaderArgs","header","originalSend","sentryXhrData","body","addFetchInstrumentationHandler","instrumentFetch","supportsNativeFetch","EdgeRuntime","fetch","doc","createElement","sandbox","hidden","head","appendChild","contentWindow","removeChild","originalFetch","parseFetchArgs","fetchArgs","getUrlFromResource","hasProp","handlerData","fetchData","response","resource","validSeverityLevels","severityLevelFromString","query","fragment","search","hash","relative","breadcrumbsIntegration","_breadcrumbsIntegration","dom","addConsoleInstrumentationHandler","_getConsoleBreadcrumbHandler","_getDomBreadcrumbHandler","componentName","serializeAttribute","element","_isEvent","_getXhrBreadcrumbHandler","_getFetchBreadcrumbHandler","_getHistoryBreadcrumbHandler","parsedLoc","parsedFrom","parsedTo","_getSentryBreadcrumbHandler","dedupeIntegration","_dedupeIntegration","previousEvent","currentEvent","_isSameMessageEvent","currentMessage","previousMessage","_isSameFingerprint","_isSameStacktrace","_isSameExceptionEvent","previousException","_getExceptionFromEvent","currentException","currentFrames","_getFramesFromEvent","previousFrames","frameA","frameB","lineno","colno","currentFingerprint","previousFingerprint","_oldOnErrorHandler","addGlobalErrorInstrumentationHandler","instrumentError","onerror","msg","column","__SENTRY_LOADER__","__SENTRY_INSTRUMENTED__","_oldOnUnhandledRejectionHandler","addGlobalUnhandledRejectionInstrumentationHandler","instrumentUnhandledRejection","onunhandledrejection","globalHandlersIntegration","_globalHandlersIntegration","stackTraceLimit","_installGlobalOnErrorHandler","_eventFromIncompleteOnError","groups","_enhanceEventWithInitialFrame","globalHandlerLog","_installGlobalOnUnhandledRejectionHandler","_getUnhandledRejectionError","_eventFromRejectionWithPrimitive","ev","ev0","ev0s","ev0sf","getLocationHref","in_app","httpContextIntegration","_httpContextIntegration","referrer","Referer","applyAggregateErrorsToEvent","exceptionFromErrorImplementation","maxValueLimit","limit","truncateAggregateExceptions","aggregateExceptionsFromError","prevExceptions","exceptionId","newExceptions","applyExceptionGroupFieldsForParentException","newException","newExceptionId","applyExceptionGroupFieldsForChildException","childError","is_exception_group","exception_id","parentId","parent_id","linkedErrorsIntegration","_linkedErrorsIntegration","DEFAULT_EVENT_TARGET","browserApiErrorsIntegration","_browserApiErrorsIntegration","eventTarget","requestAnimationFrame","_wrapTimeFunction","_wrapRAF","helpers_WINDOW","_wrapXHR","eventTargetOption","_wrapEventTarget","xmlHttpRequestProps","wrapOptions","originalFunction","eventName","handleEvent","wrappedEventHandler","originalEventHandler","createFrame","chromeRegex","chromeEvalRegex","chromeStackLineParser","subMatch","extractSafariExtensionDetails","geckoREgex","geckoEvalRegex","geckoStackLineParser","winjsRegex","winjsStackLineParser","defaultStackParser","isSafariExtension","isSafariWebExtension","DEFAULT_RETRY_AFTER","isRateLimited","limits","disabledUntil","all","updateRateLimits","statusCode","updatedRateLimits","rateLimitHeader","retryAfterHeader","retryAfter","categories","headerDelay","delay","parseRetryAfterHeader","headerDate","parse","DEFAULT_TRANSPORT_BUFFER_SIZE","createTransport","makeRequest","makePromiseBuffer","remove","task","$","taskProducer","isReady","drain","counter","capturedSetTimeout","bufferSize","rateLimits","filteredEnvelopeItems","envelopeItemDataCategory","getEventForEnvelopeItem","filteredEnvelope","recordEnvelopeLoss","requestTask","__sentry__baseTransport__","cachedFetchImpl","makeFetchTransport","nativeFetch","getNativeFetchImplementation","fetchImpl","pendingBodySize","pendingCount","requestSize","requestOptions","referrerPolicy","keepalive","fetchOptions","clearCachedFetchImplementation","XHR_READYSTATE_DONE","makeXHRTransport","getResponseHeader","open","setRequestHeader","getDefaultIntegrations","__SENTRY_RELEASE__","SENTRY_RELEASE","autoSessionTracking","initAndBind","clientClass","debug","initialScope","setCurrentClient","initializeClient","startSessionTracking","showReportDialog","script","async","crossOrigin","src","getReportDialogEndpoint","dsnLike","dialogOptions","endpoint","encodedOptions","onLoad","onload","onClose","reportDialogClosedMessageHandler","removeEventListener","injectionPoint","SEMANTIC_ATTRIBUTE_SENTRY_SOURCE","SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE","SEMANTIC_ATTRIBUTE_SENTRY_OP","SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN","IS_DEBUG_BUILD","isNgZoneEnabled","Zone","current","runOutsideAngular","root","isErrorOrErrorLikeObject","candidate","instrumentationInitialized","stashedStartTransaction","stashedStartTransactionOnLocationChange","SentryErrorHandler","_registeredAfterSendEventHandler","logErrors","handleError","extractedError","_extractError","Sentry","showDialog","extractor","defaultExtractor","_defaultExtractor","errorCandidate","tryToUnwrapZonejsError","ngOriginalError","HttpErrorResponse","extractHttpModuleError","ErrorEvent","ɵprov","token","createErrorHandler","config","getActiveTransaction","TraceService","_router","navStart$","events","pipe","NavigationStart","tap","navigationEvent","strippedUrl","stripUrlQueryAndFragment","urlPath","activeTransaction","attributes","ai","_routingSpan","startChild","navigationTrigger","resEnd$","ResolveEnd","route","getParameterizedRouteFromSnapshot","currentRoute","firstChild","routeConfig","fullPath","part","updateName","setAttribute","navEnd$","NavigationEnd","NavigationCancel","NavigationError","_subscription","Subscription","subscribe","ngOnDestroy","unsubscribe","i1","SpanRecorder","maxlen","_maxlen","spanRecorder","Span","_traceId","_spanId","_startTime","_attributes","instrumenter","_name","_parentSpanId","_sampled","_status","_endTime","string","startTime","endTime","childSpan","logMessage","_logMessage","setData","setAttributes","setStatus","setHttpStatus","httpStatus","spanStatus","spanStatusfromHttpCode","setName","isSuccess","finish","toTraceparent","toContext","_getData","updateWithContext","getTraceContext","start_timestamp","isRecording","hasData","hasAttributes","Transaction","transactionContext","_measurements","_hub","_trimEnd","trimEnd","incomingDynamicSamplingContext","newName","spanMetadata","initSpanRecorder","setMeasurement","setMetadata","newMetadata","timestampInS","_finishTransaction","getDynamicSamplingContext","setHub","finishedSpans","endTimes","Boolean","prev","measurements","TRACING_DEFAULTS","idleTimeout","finalTimeout","heartbeatInterval","IDLE_TRANSACTION_FINISH_REASONS","IdleTransactionSpanRecorder","_pushActivity","_popActivity","transactionSpanId","originalEnd","IdleTransaction","_idleHub","_idleTimeout","_finalTimeout","_heartbeatInterval","_onScope","delayAutoFinishUntilSignal","activities","_heartbeatCounter","_finished","_idleTimeoutCanceledPermanently","_beforeFinishCallbacks","_finishReason","_autoFinishAllowed","_restartIdleTimeout","endTimestampInS","spanStartedBeforeTransactionFinish","spanEndedBeforeFinalTimeout","stringifiedSpan","registerBeforeFinishCallback","_pingHeartbeat","cancelIdleTimeout","restartOnChildSpanChange","_idleTimeoutID","setFinishReason","sendAutoFinishSignal","_beat","heartbeatString","_prevHeartbeatString","maybeHub","errorsInstrumented","errorCallback","hasTracingEnabled","maybeOptions","__SENTRY_TRACING__","enableTracing","sampleTransaction","samplingContext","tracesSampler","parentSampled","tracesSampleRate","isValidSampleRate","rate","_startTransaction","configInstrumenter","transactionInstrumenter","_experiments","maxSpans","startIdleTransaction","onScope","tag","bindReporter","reportAllChanges","prevValue","delta","forceReport","getNavigationEntry","__WEB_VITALS_POLYFILL__","getEntriesByType","getNavigationEntryFromPerformanceTiming","navigation","navigationEntry","entryType","getActivationStart","navEntry","activationStart","initMetric","navigationType","prerendering","rating","floor","observe","opts","PerformanceObserver","supportedEntryTypes","po","list","getEntries","buffered","onHidden","cb","once","onHiddenOrPageHide","onCLS","onReport","report","sessionValue","sessionEntries","handleEntries","entry","hadRecentInput","stopListening","takeRecords","firstHiddenTime","getVisibilityWatcher","Infinity","timeStamp","onFID","visibilityWatcher","handleEntry","processingStart","disconnect","reportedMetricIDs","onLCP","lastEntry","capture","_previousCls","_previousFid","_previousLcp","addLcpInstrumentationHandler","stopOnCallback","addMetricObserver","instrumentLcp","addPerformanceInstrumentationHandler","instrumentPerformanceObserver","durationThreshold","getCleanupCallback","instrumentCls","instrumentFid","previousValue","isMeasurementValue","isFinite","_startChild","MAX_INT_AS_BYTES","msToSec","time","getBrowserPerformanceAPI","_lcpEntry","_clsEntry","_performanceCursor","_addPerformanceNavigationTiming","eventEnd","start","setResourceEntrySizeData","dataKey","entryVal","startInactiveSpan","normalizeContext","parentSpan","getActiveSpan","DEFAULT_TRACE_PROPAGATION_TARGETS","defaultRequestInstrumentationOptions","traceFetch","traceXHR","enableHTTPTimings","tracingOrigins","tracePropagationTargets","instrumentOutgoingRequests","shouldCreateSpanForRequest","shouldCreateSpan","shouldAttachHeadersWithTargets","shouldAttachHeaders","createdSpan","instrumentFetchRequest","spanOrigin","shouldCreateSpanResult","__span","contentLength","contentLengthNum","addTracingHeadersToFetchRequest","requestSpan","sentryTraceHeader","sentryBaggageHeader","newHeaders","existingBaggageHeader","baggage","newBaggageHeaders","addHTTPTimings","xhrCallback","__sentry_xhr_span_id__","setHeaderOnXhr","cleanup","isPerformanceResourceTiming","nextHopProtocol","initiatorType","endsWith","resourceTimingEntryToSpanData","resourceTiming","extractNetworkProtocol","char","timingSpanData","getAbsoluteTime","redirectStart","fetchStart","domainLookupStart","domainLookupEnd","connectStart","secureConnectionStart","connectEnd","requestStart","responseStart","responseEnd","DEFAULT_BROWSER_TRACING_OPTIONS","markBackgroundTransactions","routingInstrumentation","instrumentRoutingWithDefaults","customStartTransaction","startTransactionOnPageLoad","startTransactionOnLocationChange","startingUrl","pathname","enableLongTask","getMetaContent","metaName","metaTag","getDomElement","selector","querySelector","_optionalChain","ops","lastAccessLHS","removeTrailingSlash","isBrowser","isNodeEnv","isElectronNodeRenderer","process","REPLAY_SESSION_KEY","REPLAY_EVENT_NAME","UNABLE_TO_SEND_REPLAY","RETRY_BASE_INTERVAL","RETRY_MAX_COUNT","NETWORK_BODY_MAX_SIZE","REPLAY_MAX_EVENT_BUFFER_SIZE","_optionalChain$5","NodeType$1","NodeType","Document","DocumentType","Text","CDATA","Comment","isShadowRoot","n","_2","shadowRoot","isNativeShadowDom","stringifyStylesheet","s","rules","cssRules","fixBrowserCompatibilityIssuesInCSS","cssText","stringifyRule","rule","importStringified","isCSSImportRule","styleSheet","escapeImportStatement","statement","layerName","supportsText","media","mediaText","isCSSStyleRule","selectorText","fixSafariColons","cssStringified","Mirror","idNodeMap","nodeMetaMap","getId","_nullishCoalesce$1","lhs","rhsFn","_3","getMeta","_4","_5","getNode","getIds","removeNodeFromMap","childNodes","childNode","hasNode","node","meta","oldNode","reset","shouldMaskInput","maskInputOptions","text","maskInputValue","isMasked","maskInputFn","repeat","ORIGINAL_ATTRIBUTE_NAME","getInputType","hasAttribute","getInputValue","_id","tagNameRegex","IGNORED_NODE","genId","canvasService","canvasCtx","URL_IN_CSS_REF","URL_PROTOCOL_MATCH","URL_WWW_MATCH","DATA_URI","absoluteToStylesheet","quote1","path1","quote2","path2","path3","filePath","maybeQuote","extractOrigin","SRCSET_NOT_SPACES","SRCSET_COMMAS_OR_SPACES","absoluteToDoc","attributeValue","isSVGElement","ownerSVGElement","getHref","transformAttribute","maskAttributeFn","getAbsoluteSrcsetString","pos","collectCharacters","regEx","chars","descriptorsStr","inParens","charAt","ignoreAttribute","distanceToMatch","matchPredicate","distance","nodeType","ELEMENT_NODE","createMatchPredicate","matches","elementClassMatchesRegex","regex","eIndex","classList","needMaskingText","maskTextClass","maskTextSelector","unmaskTextClass","unmaskTextSelector","maskAllText","parentElement","maskDistance","unmaskDistance","lowerIfExists","maybeAttr","serializeNodeWithId","mirror","blockClass","blockSelector","unblockSelector","skipChild","inlineStylesheet","maskTextFn","slimDOMOptions","dataURLOptions","inlineImages","recordCanvas","onSerialize","onIframeLoad","iframeLoadTimeout","onStylesheetLoad","stylesheetLoadTimeout","keepIframeSrcFn","newlyAddedElement","preserveWhiteSpace","_serializedNode","serializeNode","rootId","getRootId","docId","DOCUMENT_NODE","compatMode","DOCUMENT_TYPE_NODE","publicId","systemId","serializeElementNode","needBlock","_isBlockedElement","contains","getValidTagName","HTMLFormElement","processedTagName","stylesheet","styleSheets","rel","_cssText","sheet","innerText","textContent","checked","forceMask","selected","select","__context","is2DCanvasBlank","canvas","getContext","x","width","y","getImageData","Uint32Array","min","pixel","rr_dataURL","toDataURL","quality","canvasDataURL","blankCanvas","image","oldValue","recordInlineImage","naturalWidth","naturalHeight","drawImage","currentSrc","removeAttribute","complete","rr_mediaState","paused","rr_mediaCurrentTime","currentTime","scrollLeft","rr_scrollLeft","scrollTop","rr_scrollTop","getBoundingClientRect","class","rr_width","rr_height","isCustomElement","contentDocument","rr_src","customElements","isSVG","isCustom","TEXT_NODE","serializeTextNode","parentTagName","isStyle","isScript","isTextarea","nextSibling","previousSibling","_6","_7","_8","textarea","CDATA_SECTION_NODE","COMMENT_NODE","slimDOMExcluded","sn","comment","as","headFavicon","headMetaDescKeywords","headMetaSocial","headMetaRobots","headMetaHttpEquiv","headMetaAuthorship","headMetaVerification","serializedNode","recordChild","isShadowHost","headWhitespace","bypassOptions","childN","serializedChildNode","isElement$1","isShadow","onceIframeLoaded","iframeEl","win","fired","timer","blankUrl","iframeDoc","serializedIframeNode","onceStylesheetLoaded","link","styleSheetLoadTimeout","styleSheetLoaded","serializedLinkNode","_optionalChain$4","passive","DEPARTED_MIRROR_ACCESS_WARNING","_mirror","throttle$1","wait","previous","leading","remaining","trailing","hookSetter","d","isRevoked","patch","replacement","defineProperties","__rrweb_original__","enumerable","Proxy","Reflect","receiver","cachedRequestAnimationFrameImplementation","nowTimestamp","getWindowScroll","left","scrollingElement","pageXOffset","documentElement","pageYOffset","_9","_10","_11","_12","_13","_14","getWindowHeight","innerHeight","clientHeight","getWindowWidth","innerWidth","clientWidth","isBlocked","checkAncestors","blockedPredicate","isUnblocked","blockDistance","unblockDistance","isIgnored","isAncestorRemoved","legacy_isTouchEvent","changedTouches","isSerializedIframe","nodeName","isSerializedStylesheet","hasShadowRoot","_18","StyleSheetMirror","styleIDMap","idStyleMap","_nullishCoalesce","newId","getStyle","generateId","getShadowHost","shadowHost","_19","getRootNode","_20","_21","Node","DOCUMENT_FRAGMENT_NODE","inDom","ownerDocument","shadowHostInDom","getRootShadowHost","rootShadowHost","EventType","EventType2","DomContentLoaded","Load","FullSnapshot","IncrementalSnapshot","Meta","Custom","Plugin","IncrementalSource","IncrementalSource2","Mutation","MouseMove","MouseInteraction","Scroll","ViewportResize","Input","TouchMove","MediaInteraction","StyleSheetRule","CanvasMutation","Font","Log","Drag","StyleDeclaration","Selection","AdoptedStyleSheet","CustomElement","MouseInteractions","MouseInteractions2","MouseUp","MouseDown","Click","ContextMenu","DblClick","Focus","Blur","TouchStart","TouchMove_Departed","TouchEnd","TouchCancel","PointerTypes","PointerTypes2","Mouse","Pen","Touch","_optionalChain$3","isNodeInLinkedList","DoubleLinkedList","tail","position","addNode","__ln","removeNode","moveKey","MutationBuffer","frozen","locked","texts","removes","mapRemoves","movedMap","addedSet","Set","movedSet","droppedSet","processMutations","mutations","processMutation","adds","addedIds","addList","getNextId","ns","nextId","pushAdd","currentN","iframeManager","addIframe","stylesheetManager","trackLinkElement","shadowDomManager","addShadowRoot","iframe","childSn","attachIframe","observeAttachShadow","attachLinkElement","shift","isParentRemoved","isAncestorInSet","tailNode","_node","unhandledNode","attribute","style","diffAsStr","styleDiff","unchangedAsStr","_unchangedStyles","mutationCb","m","unattachedDoc","implementation","createHTMLDocument","attributeName","isInputMasked","old","pname","newValue","getPropertyValue","newPriority","getPropertyPriority","addedNodes","genAdds","removedNodes","nodeId","isSerialized","deepDelete","processedNodeManager","inOtherBuffer","targetId","freeze","canvasManager","unfreeze","isFrozen","lock","unlock","addsSet","_isParentRemoved","r","size","_isAncestorInSet","errorHandler","callbackWrapper","rrwebWrapped","_optionalChain$2","mutationBuffers","composedPath","initMutationObserver","rootEl","mutationBuffer","mutationObserverCtor","MutationObserver","__rrMutationObserver","angularZoneSymbol","__symbol__","observer","onMutation","attributeOldValue","characterData","characterDataOldValue","childList","subtree","initScrollObserver","scrollCb","sampling","defaultView","scrollLeftTop","scroll","INPUT_TAGS","lastInputValueMap","initInputObserver","inputCb","ignoreClass","ignoreSelector","userTriggeredOnInput","eventHandler","userTriggered","isTrusted","isChecked","cbWithDedup","querySelectorAll","v","lastInputValue","currentWindow","h","propertyDescriptor","HTMLInputElement","HTMLSelectElement","HTMLTextAreaElement","HTMLOptionElement","getNestedCSSRulePositions","recurse","childRule","hasNestedCSSRule","parentRule","CSSGroupingRule","CSSMediaRule","CSSSupportsRule","CSSConditionRule","unshift","parentStyleSheet","getIdAndStyleId","styleMirror","styleId","ownerNode","initAdoptedStyleSheetObserver","hostId","patchTarget","ShadowRoot","originalPropertyDescriptor","sheets","_15","_16","adoptStyleSheets","initObservers","mutationObserver","mousemoveHandler","initMoveObserver","mousemoveCb","mousemove","callbackThreshold","mousemoveCallback","timeBaseline","positions","wrappedCb","totalOffset","timeOffset","updatePosition","clientX","clientY","DragEvent","MouseEvent","mouseInteractionHandler","initMouseInteractionObserver","mouseInteractionCb","mouseInteraction","disableMap","currentPointerType","eventKey","pointerType","thisEventKey","getHandler","PointerEvent","scrollHandler","viewportResizeHandler","initViewportResizeObserver","viewportResizeCb","lastH","lastW","inputHandler","mediaInteractionHandler","initMediaInteractionObserver","mediaInteractionCb","volume","muted","playbackRate","styleSheetObserver","initStyleSheetObserver","styleSheetRuleCb","CSSStyleSheet","insertRule","thisArg","argumentsList","deleteRule","replaceSync","supportedNestedCSSRuleTypes","canMonkeyPatchNestedCSSRule","unmodifiedFunctions","typeKey","adoptedStyleSheetObserver","styleDeclarationObserver","initStyleDeclarationObserver","styleDeclarationCb","ignoreCSSAttributes","setProperty","CSSStyleDeclaration","priority","_17","removeProperty","fontObserver","collectFonts","initFontObserver","fontCb","fontMap","originalFontFace","FontFace","family","descriptors","fontFace","fontSource","restoreHandler","fonts","selectionObserver","initSelectionObserver","param","selectionCb","collapsed","updateSelection","selection","getSelection","isCollapsed","ranges","count","rangeCount","range","getRangeAt","startContainer","startOffset","endContainer","endOffset","customElementObserver","initCustomElementObserver","customElementCb","define","pluginHandlers","plugin","plugins","CrossOriginIframeMirror","generateIdFn","iframeIdToRemoteIdMap","iframeRemoteIdToIdMap","remoteId","idToRemoteMap","remoteToIdMap","idToRemoteIdMap","getIdToRemoteIdMap","remoteIdToIdMap","getRemoteIdToIdMap","getRemoteId","getRemoteIds","ids","_optionalChain$1","IframeManagerNoop","crossOriginIframeMirror","crossOriginIframeRootIdMap","addLoadListener","IframeManager","iframes","crossOriginIframeMap","wrappedEmit","recordCrossOriginIframes","crossOriginIframeStyleMirror","handleMessage","loadListener","isAttachIframe","adoptedStyleSheets","crossOriginMessageEvent","transformedEvent","transformCrossOriginEvent","isCheckout","replaceIdOnNode","patchRootIdOnNode","replaceIds","replaceStyleIds","styles","iframeMirror","child","ShadowDomManagerNoop","ShadowDomManager","shadowDoms","restoreHandlers","patchAttachShadow","iframeElement","manager","option","CanvasManagerNoop","snapshot","StylesheetManager","trackedLinkElements","adoptedStyleSheetCb","linkEl","trackStylesheetInLinkElement","adoptedStyleSheetData","styleIds","CSSRule","ProcessedNodeManager","nodeMap","loop","periodicallyClear","onRequestAnimationFrame","getRequestAnimationFrameImplementation","requestAnimationFrameImplementation","thisBuffer","destroy","wrapEvent","eWithTime","_takeFullSnapshot","createMirror","record","checkoutEveryNms","checkoutEveryNth","maskAllInputs","_maskInputOptions","_slimDOMOptions","packFn","mousemoveWait","recordAfter","getCanvasManager","registerErrorHandler","inEmittingFrame","parent","passEmitsToParent","color","date","month","number","tel","week","radio","checkbox","polyfill","NodeList","DOMTokenList","TypeError","lastFullSnapshotEvent","incrementalSnapshotCount","postMessage","takeFullSnapshot","wrappedMutationEmit","wrappedScrollEmit","wrappedCanvasMutationEmit","__RRWEB_EXCLUDE_IFRAME__","getMirror","nodeMirror","_getCanvasManager","getCanvasManagerFn","__RRWEB_EXCLUDE_SHADOW_DOM__","slimDOM","initialOffset","canvasMutationCb","unregisterErrorHandler","ReplayEventTypeIncrementalSnapshot","timestampToMs","timestampToS","addBreadcrumbEvent","replay","triggerUserActivity","checkAndHandleExpiredSession","addUpdate","throttledAddEvent","INTERACTIVE_SELECTOR","getClosestInteractive","closest","getClickTargetNode","getTargetNode","isEventWithTarget","ClickDetector","slowClickConfig","_addBreadcrumbEvent","_lastMutation","_lastScroll","_clicks","_timeout","_threshold","_scollTimeout","scrollTimeout","_replay","_ignoreSelector","addListeners","cleanupWindowOpen","onWindowOpen","monkeyPatchWindowOpen","originalWindowOpen","nowInSeconds","_teardown","removeListeners","_checkClickTimeout","handleClick","ignoreElement","SLOW_CLICK_TAGS","isClickBreadcrumb","newClick","clickBreadcrumb","clickCount","click","_scheduleCheckClicks","registerMutation","registerScroll","registerClick","_handleMultiClick","_getClicks","_checkClicks","timedOutClicks","mutationAfter","scrollAfter","_generateBreadcrumbs","isSlowClick","timeAfterClickMs","endReason","getCurrentRoute","createBreadcrumb","ATTRIBUTES_TO_RECORD","getAttributesToRecord","normalizedKey","getBaseDomBreadcrumb","ENTRY_TYPES","createResourceEntry","decodedBodySize","encodedBodySize","responseStatus","transferSize","paint","createPaintEntry","createNavigationEntry","domComplete","domContentLoadedEventStart","domContentLoadedEventEnd","domInteractive","loadEventStart","loadEventEnd","redirectCount","createPerformanceEntry","logInfo","shouldAddBreadcrumb","info","addLogBreadcrumb","logInfoNextTick","EventBufferSizeExceededError","EventBufferArray","_totalSize","hasCheckout","hasEvents","addEvent","_this","_asyncToGenerator","eventSize","Promise","eventsRet","getEarliestTimestamp","WorkerHandler","worker","_worker","ensureReady","_ensureReadyPromise","success","terminate","_getAndIncrementId","EventBufferCompressionWorker","_earliestTimestamp","_sendEventToWorker","_finishRequest","_this2","EventBufferProxy","_fallback","_compression","_used","_ensureWorkerIsLoadedPromise","_ensureWorkerIsLoaded","_this3","ensureWorkerIsLoaded","_this4","_switchToCompressionWorker","_this5","addEventPromises","hasSessionStorage","sessionStorage","isSampled","lastActivity","segmentId","previousSessionId","saveSession","setItem","createSession","sessionSampleRate","allowBuffering","stickySession","getSessionSampleType","isExpired","initialTime","expiry","targetTime","isSessionExpired","maxReplayDuration","sessionIdleExpire","shouldRefreshSession","loadOrCreateSession","traceInternals","sessionOptions","existingSession","fetchSession","sessionStringFromStorage","getItem","sessionObj","addEventSync","shouldAddEvent","_addEvent","_x","_x2","_x3","_addEvent2","eventBuffer","recordingMode","eventAfterPossibleCallback","maybeApplyCallback","isCustomEvent","beforeAddRecordingEvent","stop","isPaused","timestampInMs","timeouts","sessionIdlePause","initialTimestamp","isFeedbackEvent","handleAfterSendEvent","enforceStatusCode","isBaseTransportSend","handleTransactionEvent","replayContext","traceIds","handleErrorEvent","errorIds","replayId","beforeErrorSampling","sendBufferedReplayOrFlush","createPerformanceSpans","addNetworkBreadcrumb","shouldFilterRequest","isSentryRequestUrl","hubOrClient","isHub","checkDsn","checkTunnel","getBodySize","URLSearchParams","FormData","formDataStr","_serializeFormData","Blob","ArrayBuffer","byteLength","parseContentLengthHeader","getBodyString","mergeWarning","warning","_meta","warnings","newMeta","makeNetworkReplayBreadcrumb","buildSkippedNetworkRequestOrResponse","bodySize","buildNetworkRequestOrResponse","normalizedBody","normalizeNetworkBody","exceedsSizeLimit","isProbablyJson","_strIsProbablyJson","first","last","truncatedBody","getAllowedHeaders","allowedHeaders","filteredHeaders","formData","urlMatches","urls","fullUrl","getFullUrl","baseURI","fixedUrl","URL","_captureFetchBreadcrumbToReplay","_prepareFetchData","_x7","_x8","_x9","_prepareFetchData2","request_body_size","requestBodySize","response_body_size","responseBodySize","captureDetails","networkDetailAllowUrls","networkDetailDenyUrls","_getRequestInfo","networkCaptureBodies","networkRequestHeaders","getRequestHeaders","getHeadersFromOptions","requestBody","_getFetchRequestArgBody","bodyStr","_getResponseInfo","_x10","_x11","_x12","_x13","_getResponseInfo2","networkResponseHeaders","getAllHeaders","bodyText","_parseFetchResponseBody","_x14","_parseFetchResponseBody2","getResponseData","_tryCloneResponse","_tryGetResponseText","allHeaders","_getResponseText","_x15","_getResponseText2","txt","_captureXhrBreadcrumbToReplay","_prepareXhrData","getResponseHeaders","getAllResponseHeaders","requestWarning","responseBody","responseWarning","_getXhrResponseBody","responseText","_parseXhrResponse","responseType","outerHTML","handleNetworkBreadcrumbs","beforeAddNetworkBreadcrumb","_isXhrBreadcrumb","_isXhrHint","enrichXhrBreadcrumb","reqSize","resSize","_getBodySize","captureXhrBreadcrumbToReplay","_x16","_x17","_x18","_isFetchBreadcrumb","_isFetchHint","enrichFetchBreadcrumb","captureFetchBreadcrumbToReplay","_x4","_x5","_x6","handleFetchSpanListener","handleFetch","handleXhrSpanListener","handleXhr","_LAST_BREADCRUMB","addGlobalListeners","handleScope","newBreadcrumb","isBreadcrumbWithCategory","normalizeConsoleBreadcrumb","isTruncated","normalizedArgs","normalizedArg","handleScopeListener","handleDom","getDomTarget","isClick","clickDetector","altKey","metaKey","ctrlKey","shiftKey","handleDomListener","handleHistorySpanListener","handleHistory","handleGlobalEventListener","includeAfterSendEventHandling","afterSendHandler","isReplayEvent","replay_id","getSessionId","addFeedbackBreadcrumb","feedbackId","isRrwebError","__rrweb__","captureExceptions","shouldSampleForBufferEvent","errorSampleRate","hasHooks","handleBeforeSendEvent","handleHydrationError","exceptionValue","lastTransaction","feedbackEvent","includeReplay","_addMemoryEntry","createMemoryEntry","memory","memoryEntry","jsHeapSizeLimit","totalJSHeapSize","usedJSHeapSize","getHandleRecordingEmit","hadFirstEvent","_isCheckout","updateClickDetectorForRecordingEvent","isIncrementalEvent","isIncrementalMouseInteraction","setInitialState","addSettingsEvent","createOptionsEvent","shouldRecordCanvas","isRecordingCanvas","useCompressionOption","useCompression","blockAllMedia","networkDetailHasUrls","networkRequestHasHeaders","networkResponseHasHeaders","earliestEvent","_prepareReplayEvent","eventHint","preparedEvent","_sendReplayRequest","recordingData","segment_id","eventContext","preparedRecordingData","prepareRecordingData","payloadWithSequence","replayHeaders","sequence","baseEvent","replay_start_timestamp","error_ids","trace_ids","replay_type","replayEvent","prepareReplayEvent","_x20","createReplayEnvelope","cause","TransportStatusCodeError","RateLimitError","sendReplay","_x22","_sendReplay","replayData","retryConfig","sendReplayRequest","_x21","_retryCount","THROTTLED","ReplayContainer","recordingOptions","__init5","__init6","performanceEntries","replayPerformanceEntries","_lastActivity","_isPaused","_hasInitializedCoreListeners","_context","initialUrl","_recordingOptions","_debouncedFlush","debounce","callbackReturnValue","timerId","maxTimerId","maxWait","invokeFunc","cancelTimers","debounced","cancel","_flush","flushMinDelay","flushMaxDelay","_throttledAddEvent","throttle","maxCount","durationSeconds","isThrottled","_cleanup","wasThrottled","slowClickTimeout","slowClickIgnoreSelectors","_canvas","initializeSampling","_initializeSessionForSampling","_handleException","_initializeRecording","startBuffering","startRecording","canvasOptions","_stopRecording","_onMutationHandler","stopRecording","forceFlush","_this6","_removeListeners","force","clearSession","deleteSession","removeItem","pause","resume","_checkSession","continueRecording","_this7","flushImmediate","activityTime","hasStoppedRecording","_updateUserActivity","_updateSessionActivity","_maybeSaveSession","cbResult","updateUserActivity","conditionalFlush","cancelFlush","_clearContext","createEventBuffer","workerUrl","customWorkerUrl","Worker","_loadWorker","_getWorkerUrl","__SENTRY_EXCLUDE_REPLAY_WORKER__","createObjectURL","_addListeners","_refreshSession","_this8","_handleVisibilityChange","_handleWindowBlur","_handleWindowFocus","_handleKeyboardEvent","_performanceCleanupCallback","setupPerformanceObserver","addPerformanceEntry","onEntries","clearCallbacks","getLargestContentfulPaint","clearCallback","_doChangeToForegroundTasks","_doChangeToBackgroundTasks","handleKeyboardEvent","getKeyboardBreadcrumb","isInputElement","_createCustomBreadcrumb","_addPerformanceEntries","createPerformanceEntries","_updateInitialTimestampFromEventBuffer","_popEventContext","_runFlush","_this9","addMemoryEntry","_x19","_this10","tooShort","minReplayDuration","_flushLock","mutationLimit","overMutationLimit","mutationBreadcrumbLimit","getOption","defaultSelectors","deprecatedClassOption","deprecatedSelectorOption","allSelectors","MEDIA_SELECTORS","DEFAULT_NETWORK_HEADERS","_initialized","Replay","__initStatic","mask","maskAttributes","unmask","block","unblock","ignore","maskFn","privacyOptions","getPrivacyOptions","password","maskAttribute","_initialOptions","_getMergedNetworkHeaders","_isInitialized","_setup","_initialize","getReplayId","_maybeLoadFromReplayCanvasIntegration","finalOptions","loadReplayOptionsFromClient","initialOptions","opt","replaysSessionSampleRate","replaysOnErrorSampleRate","canvasIntegration","NavigationPrimaryComponent","isMenuOpen","toggleMenu","closeMenu","core","HeaderComponent","FooterComponent","SectionConfirmationComponent","_r2","ctx_r1","confirmUser","AppComponent","title","isConfirmed","ngOnInit","localStorage","AppComponent_section_3_Template","routes","loadChildren","__webpack_require__","HomeModule","AboutModule","WebgisModule","LibraryModule","MediaLibraryModule","redirectTo","pathMatch","AppRoutingModule","RouterModule","forRoot","scrollPositionRestoration","anchorScrolling","NavigationModule","HeaderModule","FooterModule","ApiKeyInterceptor","intercept","modifiedRequest","handle","ErrorHandlerService","ErrorHandler","SectionConfirmationModule","AppModule","bootstrap","provide","HTTP_INTERCEPTORS","useClass","multi","useValue","deps","Router","APP_INITIALIZER","useFactory","imports","BrowserModule","HttpClientModule","checkAndSetAngularVersion","angularVersion","VERSION","major","ANGULAR_MINIMUM_VERSION","init$1","BrowserTracing","_hasSetTracePropagationTargets","addTracingExtensions","registerErrorInstrumentation","_collectWebVitals","startTrackingWebVitals","mark","fidCallback","_trackFID","addFidInstrumentationHandler","fid","clsCallback","_trackCLS","addClsInstrumentationHandler","cls","lcpCallback","_trackLCP","lcp","startTrackingLongTasks","enableInteractions","startTrackingInteractions","_getCurrentHub","instrumentRouting","clientOptionsTracePropagationTargets","_createRouteTransaction","onStartRouteTransaction","registerBackgroundTabDetection","statusType","_registerInteractionListener","beforeNavigate","isPageloadTransaction","sentryTrace","traceparentData","tracingContextFromHeaders","extractTraceparentData","traceparent","baggageHeaderToDynamicSamplingContext","baggageObject","curr","currBaggageObject","expandedContext","modifiedContext","finalContext","_latestRouteName","_latestRouteSource","idleTransaction","addPerformanceEntries","responseStartTimestamp","requestStartTimestamp","transactionStartTime","_addNavigationSpans","_addRequest","_addMeasureSpans","measureStartTimestamp","firstHidden","shouldRecord","fp","fcp","_addResourceSpans","resourceUrl","parsedUrl","renderBlockingStatus","_trackNavigator","connection","effectiveType","rtt","deviceMemory","hardwareConcurrency","_addTtfbToMeasurements","ttfb","measurementTimestamp","normalizedValue","fidMark","measurementName","_tagMetricInfo","sources","inflightInteractionTransaction","registerInteractionTransaction","currentTransaction","__NgCli_bootstrap_1","bootstrapModule","isBrowserBundle","__SENTRY_BROWSER_BUNDLE__","BehaviorSubject","Subject","getValue","_subscribe","subscriber","subscription","closed","hasError","thrownError","_throwIfClosed","Observable","lift","operator","observable","observerOrNext","isSubscriber","Subscriber","isObserver","isFunction","isSubscription","SafeSubscriber","errorContext","_trySubscribe","sink","promiseCtor","getPromiseCtor","_a","Symbol_observable","operations","pipeFromArray","toPromise","create","ObjectUnsubscribedError","createErrorClass","_super","currentObservers","observers","isStopped","subject","AnonymousSubject","observed","_checkFinalizedStatuses","_innerSubscribe","EMPTY_SUBSCRIPTION","arrRemove","asObservable","destination","_b","COMPLETE_NOTIFICATION","createNotification","kind","EMPTY_OBSERVER","handleStoppedNotification","nextNotification","_next","errorNotification","_error","_complete","_bind","ConsumerObserver","partialObserver","handleUnhandledError","useDeprecatedNextContext","useDeprecatedSynchronousErrorHandling","captureError","reportUnhandledError","notification","onStoppedNotification","timeoutProvider","noop","defaultErrorHandler","UnsubscriptionError","initialTeardown","_parentage","_finalizers","initialFinalizer","finalizer","execFinalizer","teardown","_hasParent","_addParent","_removeParent","EMPTY","empty","onUnhandledError","combineLatest","scheduler","popScheduler","resultSelector","popResultSelector","observables","argsArgArrayOrObject","combineLatestInit","valueTransform","identity","maybeSchedule","active","remainingFirstValues","hasFirstValue","createOperatorSubscriber","createObject","mapOneOrManyArgs","execute","executeSchedule","observeOn","operate","subscribeOn","schedule","scheduleAsyncIterable","iterator","Symbol","asyncIterator","done","scheduled","isInteropObservable","scheduleObservable","innerFrom","isArrayLike","scheduleArray","isPromise","schedulePromise","isAsyncIterable","isIterable","scheduleIterable","Symbol_iterator","return","isReadableStreamLike","scheduleReadableStreamLike","readableStreamLikeToAsyncGenerator","createInvalidObservableTypeError","fromInteropObservable","obs","fromArrayLike","array","fromPromise","fromAsyncIterable","fromIterable","iterable","fromReadableStreamLike","readableStream","asyncIterable","asyncIterable_1","asyncIterable_1_1","e_1","__awaiter","__asyncValues","e_1_1","of","throwError","errorOrErrorFactory","errorFactory","onNext","onComplete","onError","onFinalize","OperatorSubscriber","shouldUnsubscribe","catchError","handledResult","innerSub","syncUnsub","concatMap","project","mergeMap","distinctUntilChanged","comparator","keySelector","defaultCompare","previousKey","currentKey","predicate","finalize","mergeAll","concurrent","ii","mergeInternals","onBeforeNext","expand","innerSubScheduler","additionalFinalizer","isComplete","checkComplete","outerNext","doInnerSub","innerComplete","innerValue","bufferedValue","switchMap","innerSubscriber","innerIndex","outerIndex","tapObserver","isUnsub","delegate","getSymbolIterator","isScheduler","popNumber","defaultValue","objectProto","getKeys","isPOJO","createImpl","ctorFunc","instance","isRoot","errorThrown","parentSubscription","work","scheduleSubscription","__asyncGenerator","reader","getReader","__await","read","releaseLock","hasLift","liftedSource","callOrApply","fns","_DOM","getDOM","setRootDomAdapter","adapter","DomAdapter","DOCUMENT","InjectionToken","PlatformLocation","historyGo","relativePosition","inject","BrowserPlatformLocation","LOCATION_INITIALIZED","_doc","_location","_history","getBaseHrefFromDOM","getBaseHref","onPopState","getGlobalEventTarget","onHashChange","hostname","newPath","forward","back","go","getState","joinWithSlash","slashes","stripTrailingSlash","pathEndIdx","normalizeQueryParams","LocationStrategy","PathLocationStrategy","APP_BASE_HREF","_platformLocation","_removeListenerFns","_baseHref","prepareExternalUrl","internal","includeHash","queryParams","externalUrl","HashLocationStrategy","Location","locationStrategy","_subject","EventEmitter","_urlChangeListeners","_urlChangeSubscription","_locationStrategy","baseHref","_basePath","_stripOrigin","_stripIndexHtml","isCurrentPathEqualTo","_stripBasePath","basePath","_notifyUrlChangeListeners","onUrlChange","fnIndex","onThrow","onReturn","createLocation","ɵɵinject","parseCookieValue","cookieStr","cookie","eqIndex","cookieName","cookieValue","WS_REGEXP","EMPTY_ARRAY","NgClass","_iterableDiffers","_keyValueDiffers","_ngEl","_renderer","initialClasses","stateMap","klass","ngClass","rawClass","ngDoCheck","_updateState","_applyStateDiff","nextEnabled","changed","touched","stateEntry","_toggleClass","addClass","nativeElement","removeClass","ɵdir","standalone","NgForOfContext","$implicit","ngForOf","even","odd","NgForOf","_ngForOf","_ngForOfDirty","ngForTrackBy","_trackByFn","_viewContainer","_template","_differs","_differ","ngForTemplate","changes","diff","_applyChanges","viewContainer","forEachOperation","adjustedPreviousIndex","previousIndex","createEmbeddedView","view","move","applyViewChange","ilen","forEachIdentityChange","ngTemplateContextGuard","dir","NgIf","templateRef","NgIfContext","_thenTemplateRef","_elseTemplateRef","_thenViewRef","_elseViewRef","ngIf","condition","_updateView","ngIfThen","assertTemplate","ngIfElse","ɵstringify","NgTemplateOutlet","_viewContainerRef","_viewRef","ngTemplateOutletContext","ngTemplateOutlet","ngTemplateOutletInjector","ngOnChanges","viewContainerRef","injector","features","ɵmod","ɵinj","PLATFORM_BROWSER_ID","PLATFORM_SERVER_ID","isPlatformServer","platformId","ViewportScroller","ɵɵdefineInjectable","BrowserViewportScroller","setOffset","getScrollPosition","supportsScrolling","scrollToPosition","scrollTo","scrollToAnchor","elSelected","findAnchorFromDocument","documentResult","getElementById","getElementsByName","createTreeWalker","attachShadow","treeWalker","NodeFilter","SHOW_ELEMENT","currentNode","nextNode","scrollToElement","focus","setHistoryScrollRestoration","scrollRestoration","rect","XhrFactory","HttpHandler","HttpBackend","HttpHeaders","normalizedNames","lazyUpdate","lazyInit","maybeSetNormalizedName","setHeaderEntries","getAll","lcName","copyFrom","applyUpdate","other","toDelete","existing","headerValues","HttpUrlEncodingCodec","encodeKey","standardEncoding","encodeValue","decodeKey","decodeValue","STANDARD_ENCODING_REGEX","STANDARD_ENCODING_REPLACEMENTS","valueToString","HttpParams","updates","cloneFrom","encoder","fromString","fromObject","paramParser","rawParams","codec","eqIdx","appendAll","eKey","idx","HttpContext","isArrayBuffer","isBlob","isFormData","HttpRequest","third","fourth","reportProgress","withCredentials","mightHaveBody","urlWithParams","qIdx","serializeBody","isUrlSearchParams","detectContentTypeHeader","setHeaders","setParams","HttpEventType","Sent","UploadProgress","ResponseHeader","DownloadProgress","User","HttpResponseBase","defaultStatus","defaultStatusText","statusText","ok","HttpHeaderResponse","HttpResponse","addBody","HttpClient","req","events$","res$","jsonp","callbackParam","post","put","interceptorChainEndFn","finalHandlerFn","adaptLegacyInterceptorToChain","chainTailFn","interceptor","initialRequest","downstreamRequest","HTTP_INTERCEPTOR_FNS","HTTP_ROOT_INTERCEPTOR_FNS","legacyInterceptorFnFactory","chain","optional","reduceRight","pendingTasks","ɵInitialRenderPendingTasks","taskId","HttpInterceptorHandler","backend","dedupedInterceptorFns","nextSequencedFn","interceptorFn","chainedInterceptorFn","runInContext","XSSI_PREFIX","HttpXhrBackend","xhrFactory","ɵRuntimeError","ngDevMode","ɵloadImpl","build","detectedType","reqBody","headerResponse","partialFromXhr","getResponseUrl","responseURL","originalBody","sentHeaders","onDownProgress","progressEvent","loaded","lengthComputable","total","partialText","onUpProgress","progress","upload","DONE","abort","XSRF_ENABLED","XSRF_COOKIE_NAME","XSRF_HEADER_NAME","HttpXsrfTokenExtractor","HttpXsrfCookieExtractor","lastCookieString","lastToken","parseCount","getToken","cookieString","ɵparseCookieValue","PLATFORM_ID","xsrfInterceptorFn","lcUrl","headerName","HttpFeatureKind","Interceptors","LegacyInterceptors","CustomXsrfConfiguration","NoXsrfProtection","JsonpSupport","RequestsMadeViaParent","Fetch","provideHttpClient","providers","useExisting","feature","ɵproviders","makeEnvironmentProviders","LEGACY_INTERCEPTOR_FN","withInterceptorsFromDi","makeHttpFeature","ɵkind","share","connector","resetOnError","resetOnComplete","resetOnRefCountZero","wrapperSource","resetConnection","hasCompleted","hasErrored","cancelReset","resetAndUnsubscribe","conn","dest","handleReset","onSubscriber","getClosureSafeProperty","objWithPropertyToExtract","fillProperties","overriddenName","newLineIndex","concatStringsWithSpace","after","__forward_ref__","forwardRef","forwardRefFn","resolveForwardRef","isForwardRef","isEnvironmentProviders","XSS_SECURITY_URL","RuntimeError","formatRuntimeError","renderStringify","throwProviderNotFoundError","injectorName","assertDefined","actual","expected","comparison","ɵɵdefineInjector","getInjectableDef","getOwnDefinition","NG_PROV_DEF","NG_INJECTABLE_DEF","isInjectable","field","getInjectorDef","NG_INJ_DEF","NG_INJECTOR_DEF","ngInjectableDef","ngInjectorDef","InjectFlags","Default","Host","Self","SkipSelf","Optional","_injectImplementation","setInjectImplementation","impl","injectRootLimpMode","notFoundValue","flags","injectableDef","_global","_desc","ngMetadataName","__NG_ELEMENT_ID__","THROW_IF_NOT_FOUND","DI_DECORATOR_FLAG","NG_TEMP_TOKEN_PATH","NEW_LINE","SOURCE","_currentInjector","setCurrentInjector","former","injectInjectorOnly","getInjectImplementation","convertToBitFlags","skipSelf","injectArgs","types","j","flag","getInjectFlag","attachInjectFlag","decorator","noSideEffects","ChangeDetectionStrategy","OnPush","ViewEncapsulation$1","ViewEncapsulation","Emulated","None","ShadowDom","EMPTY_OBJ","NG_COMP_DEF","ɵcmp","NG_DIR_DEF","NG_PIPE_DEF","ɵpipe","NG_MOD_DEF","NG_FACTORY_DEF","NG_ELEMENT_ID","NG_ENV_ID","__NG_ENV_ID__","classIndexOf","classToSearch","startingIndex","foundIndex","charCodeAt","setUpAttributes","renderer","native","namespaceURI","attrName","attrVal","isAnimationProp","isNameOnlyAttributeMarker","marker","mergeHostAttrs","dst","srcMarker","mergeHostAttribute","key1","key2","markerInsertPosition","dstValue","NG_TEMPLATE_SELECTOR","isCssClassMatching","cssClassToMatch","isProjectionMode","isImplicitAttrsSection","isInlineTemplate","tNode","hasTagAndTypeMatch","currentSelector","isNodeMatchingSelector","mode","nodeAttrs","nameOnlyMarkerIdx","getNameOnlyMarkerIndex","skipToNextSelector","isPositive","selectorAttrValue","attrIndexInNode","findAttrIndexInNode","nodeAttrValue","compareAgainstClassName","bindingsMode","maybeAttrName","matchTemplateAttribute","isNodeMatchingSelectorList","isSelectorInSelectorList","selectorListLoop","currentSelectorInList","maybeWrapInNotSelector","isNegativeMode","chunk","stringifyCSSSelector","currentChunk","valueOrMarker","attrValue","ɵɵdefineComponent","componentDefinition","baseDef","getNgDirectiveDef","def","onPush","changeDetection","directiveDefs","pipeDefs","dependencies","getStandaloneInjector","signals","encapsulation","schemas","tView","initFeatures","extractDefListOrFactory","getComponentId","componentDef","hashSelectors","hostVars","hostAttrs","exportAs","outputs","getOwnPropertyNames","contentQueries","viewQuery","imul","extractDirectiveDef","getComponentDef","getDirectiveDef","nonNull","ɵɵdefineNgModule","declarations","exports","transitiveCompileScopes","invertObject","secondary","newLookup","minifiedKey","publicName","declaredName","ɵɵdefineDirective","directiveDefinition","ɵɵdefinePipe","pipeDef","pure","onDestroy","getPipeDef$1","isStandalone","getNgModuleDef","throwNotFound","ngModuleDef","declaredInputs","providersResolver","hostBindings","inputTransforms","inputConfig","setInput","findHostDirectiveDefs","hostDirectives","definition","defExtractor","dep","HOST","TVIEW","FLAGS","PARENT","NEXT","DESCENDANT_VIEWS_TO_REFRESH","T_HOST","CLEANUP","CONTEXT","INJECTOR$1","ENVIRONMENT","RENDERER","CHILD_HEAD","CHILD_TAIL","DECLARATION_VIEW","DECLARATION_COMPONENT_VIEW","DECLARATION_LCONTAINER","PREORDER_HOOK_FLAGS","QUERIES","ID","EMBEDDED_VIEW_INJECTOR","ON_DESTROY_HOOKS","HYDRATION","REACTIVE_TEMPLATE_CONSUMER","REACTIVE_HOST_BINDING_CONSUMER","HEADER_OFFSET","TYPE","HAS_TRANSPLANTED_VIEWS","NATIVE","MOVED_VIEWS","CONTAINER_HEADER_OFFSET","isLView","isLContainer","isContentQueryHost","isComponentHost","componentOffset","isDirectiveHost","isComponentDef","isRootView","getFactoryDef","activeConsumer","inNotificationPhase","setActiveConsumer","consumer","REACTIVE_NODE","dirty","producerNode","producerLastReadVersion","producerIndexOfThis","nextProducerIndex","liveConsumerNode","liveConsumerIndexOfThis","consumerAllowSignalWrites","consumerIsAlwaysLive","producerMustRecompute","producerRecomputeValue","consumerMarkedDirty","producerUpdateValueVersion","consumerIsLive","consumerPollProducersForChange","consumerMarkDirty","producerNotifyConsumers","consumerBeforeComputation","consumerAfterComputation","prevConsumer","producerRemoveLiveConsumerAtIndex","assertConsumerNode","producer","seenVersion","consumerDestroy","assertProducerNode","lastIdx","idxProducer","throwInvalidWriteToSignalErrorFn","untracked","nonReactiveReadsFn","NOOP_CLEANUP_FN","WATCH_NODE","ref","hasRun","cleanupFn","SimpleChange","currentValue","firstChange","isFirstChange","ɵɵNgOnChangesFeature","NgOnChangesFeatureImpl","ngOnChangesSetInput","rememberChangeHistoryAndInvokeOnChangesHook","simpleChangesStore","getSimpleChangesStore","privateName","setSimpleChangesStore","store","SIMPLE_CHANGES_STORE","previousChange","ngInherit","profiler","hookOrListener","SVG_NAMESPACE","unwrapRNode","getNativeByIndex","lView","getNativeByTNode","getTNode","getComponentLViewByIndex","nodeIndex","hostView","slotValue","getConstant","resetPreOrderHookFlags","markViewForRefresh","updateViewsToRefresh","clearViewRefreshFlag","amount","viewOrContainer","instructionState","lFrame","createLFrame","bindingsEnabled","skipHydrationRootTNode","getBindingsEnabled","isInSkipHydrationBlock$1","getLView","getTView","ɵɵrestoreView","viewToRestore","contextLView","ɵɵresetView","getCurrentTNode","currentTNode","getCurrentTNodePlaceholderOk","setCurrentTNode","isParent","isCurrentTNodeParent","setCurrentTNodeAsNotParent","getBindingRoot","bindingRootIndex","bindingStartIndex","nextBindingIndex","bindingIndex","incrementBindingIndex","setBindingRootForHostBindings","currentDirectiveIndex","setCurrentDirectiveIndex","getCurrentQueryIndex","currentQueryIndex","setCurrentQueryIndex","getDeclarationTNode","declTNode","enterDI","parentTNode","parentLView","allocLFrame","enterView","newView","newLFrame","inI18n","currentLFrame","childLFrame","selectedIndex","elementDepthCount","currentNamespace","leaveViewLight","oldLFrame","leaveDI","leaveView","getSelectedIndex","setSelectedIndex","getSelectedTNode","ɵɵnamespaceSVG","ɵɵnamespaceHTML","namespaceHTMLInternal","_wasLastNodeCreated","wasLastNodeCreated","lastNodeWasCreated","registerPostOrderHooks","directiveStart","directiveEnd","lifecycleHooks","ngAfterContentInit","ngAfterContentChecked","ngAfterViewInit","ngAfterViewChecked","contentHooks","contentCheckHooks","viewHooks","viewCheckHooks","destroyHooks","executeCheckHooks","hooks","callHooks","executeInitAndCheckHooks","initPhase","incrementInitPhaseFlags","currentView","currentNodeIndex","nodeIndexLimit","lastNodeIndexFound","callHook","callHookInternal","directive","isInitHook","NO_PARENT_INJECTOR","NodeInjectorFactory","isViewProvider","injectImplementation","resolving","canSeeViewProviders","injectImpl","hasParentInjector","parentLocation","getParentInjectorIndex","getParentInjectorView","startView","viewOffset","getParentInjectorViewOffset","parentView","includeViewProviders","setIncludeViewProviders","BLOOM_MASK","BLOOM_BUCKET_BITS","nextNgElementId","NOT_FOUND","getOrCreateNodeInjectorForNode","existingInjectorIndex","getInjectorIndex","firstCreatePass","injectorIndex","insertBloom","blueprint","parentLoc","getParentInjectorLocation","parentIndex","parentData","footer","declarationViewOffset","lViewCursor","getTNodeFromLView","diPublicInInjector","bloomAdd","bloomHash","notFoundValueOrThrow","lookupTokenUsingModuleInjector","moduleInjector","previousInjectImplementation","getOrCreateInjectable","embeddedInjectorValue","lookupTokenUsingEmbeddedInjector","currentLView","nodeInjectorValue","lookupTokenUsingNodeInjector","embeddedViewInjector","embeddedViewInjectorValue","bloomHashBitOrFactory","tokenId","createNodeInjector","previousTView","hostTElementNode","shouldSearchParent","bloomHasToken","searchTokensOnInjector","currentTView","injectableIdx","locateDirectiveOrProvider","getNodeInjectable","canAccessViewProviders","isHostSpecialCase","nodeProviderIndexes","providerIndexes","tInjectables","injectablesStart","directivesStart","cptViewProvidersCount","endIndex","providerTokenOrDef","dirDef","tData","isFactory","throwCyclicDependencyError","depPath","stringifyForError","previousIncludeViewProviders","registerPreOrderHooks","directiveIndex","directiveDef","wrappedOnChanges","preOrderHooks","preOrderCheckHooks","injectorView","isFirstHostTNode","NodeInjector","_tNode","_lView","ɵɵgetInheritedFactory","ownConstructor","ownFactory","getFactoryOf","objectPrototype","tViewType","ɵɵinjectAttribute","attrNameToInject","injectAttributeImpl","attrsLength","PARAMETERS","makeParamDecorator","props","parentClass","metaCtor","makeMetadataCtor","propName","ParamDecoratorFactory","annotationInstance","ParamDecorator","annotation","unusedKey","parameters","annotationCls","deepForEach","addToArray","removeFromArray","newArray","keyValueArraySet","keyValueArray","keyValueArrayIndexOf","arrayInsert2","value1","value2","keyValueArrayGet","_arrayIndexOfSorted","middle","hasInSkipHydrationBlockFlag","RendererStyleFlags2","Important","DashCase","COMMENT_DISALLOWED","COMMENT_DELIMITER","COMMENT_DELIMITER_ESCAPED","TRACKED_LVIEWS","uniqueIdCounter","MONKEY_PATCH_KEY_NAME","attachPatchData","registerLView","_icuContainerIterate","icuContainerIterate","tIcuContainerNode","getLViewParent","getFirstLContainer","getNearestLContainer","getNextLContainer","container","applyToElementOrContainer","action","lNodeToHandle","beforeNode","lContainer","isComponent","rNode","nativeAppendChild","nativeInsertBefore","nativeRemoveNode","isHostElement","nativeParent","nativeParentNode","nativeRemoveChild","destroyNode","applyContainer","parentRElement","anchor","applyView","createCommentNode","createComment","escapeCommentText","createElementNode","namespace","detachMovedView","declarationContainer","movedViews","declarationViewIndex","detachView","removeIndex","indexInContainer","viewToDetach","declarationLContainer","removedLView","removeViewFromDOM","lQueries","destroyLView","destroyViewTree","rootView","lViewOrLContainer","cleanUpView","firstView","executeOnDestroys","toCall","callContext","processCleanups","tCleanup","lCleanup","targetIdx","destroyHooksFn","unregisterLView","getParentRElement","getClosestRElement","isMove","insertBefore","nativeAppendOrInsertBefore","getInsertInFrontOfRNode","_getInsertInFrontOfRNodeWithI18n","_processI18nInsertBefore","policy$1","policy","getInsertInFrontOfRNodeWithNoI18n","childRNode","childTNode","parentRNode","anchorNode","getFirstNativeNode","tNodeType","getBeforeNodeForView","elIcuContainerChild","rNodeOrLContainer","projectionNodes","getProjectionNodes","projection","viewIndexInContainer","nextViewIndex","firstTNodeOfView","applyNodes","isProjection","rawSlotValue","nextRNode","applyProjectionRecursive","projectionNext","tProjectionNode","componentLView","nodeToProjectOrRNodes","nodeToProject","projectedComponentLView","writeDirectClass","setupStaticAttributes","mergedAttrs","writeDirectStyle","trustedHTMLFromString","html","getPolicy$1","trustedTypes","createPolicy","createHTML","createScript","createScriptURL","setDocument","getDocument","getPolicy","trustedHTMLFromStringBypass","trustedScriptURLFromStringBypass","SafeValueImpl","changingThisBreaksApplicationSecurity","SafeHtmlImpl","getTypeName","SafeStyleImpl","SafeScriptImpl","SafeUrlImpl","SafeResourceUrlImpl","unwrapSafeValue","allowSanitizationBypassAndThrow","actualType","getSanitizationBypassType","bypassSanitizationTrustHtml","trustedHtml","bypassSanitizationTrustStyle","trustedStyle","bypassSanitizationTrustScript","trustedScript","bypassSanitizationTrustUrl","trustedUrl","bypassSanitizationTrustResourceUrl","trustedResourceUrl","DOMParserHelper","inertDocumentHelper","getInertBodyElement","DOMParser","parseFromString","InertDocumentHelper","defaultDoc","inertDocument","templateEl","innerHTML","SAFE_URL_PATTERN","_sanitizeUrl","tagSet","merge","sets","VOID_ELEMENTS","OPTIONAL_END_TAG_BLOCK_ELEMENTS","OPTIONAL_END_TAG_INLINE_ELEMENTS","VALID_ELEMENTS","URI_ATTRS","VALID_ATTRS","SKIP_TRAVERSING_CONTENT_IF_INVALID_ELEMENTS","SanitizingHtmlSerializer","sanitizedSomething","sanitizeChildren","traverseContent","startElement","nodeValue","endElement","checkClobberedElement","elAttrs","elAttr","lower","encodeEntities","compareDocumentPosition","DOCUMENT_POSITION_CONTAINED_BY","SURROGATE_PAIR_REGEXP","NON_ALPHANUMERIC_REGEXP","inertBodyHelper","_sanitizeHtml","unsafeHtmlInput","inertBodyElement","getInertBodyHelper","isDOMParserAvailable","unsafeHtml","mXSSAttempts","parsedHtml","getTemplateContent","isTemplateElement","content","SecurityContext","NONE","HTML","STYLE","SCRIPT","RESOURCE_URL","ɵɵsanitizeHtml","sanitizer","getSanitizer","sanitize","ɵɵsanitizeUrl","unsafeUrl","ɵɵsanitizeResourceUrl","unsafeResourceUrl","ɵɵsanitizeUrlOrResourceUrl","getUrlSanitizer","ENVIRONMENT_INITIALIZER","INJECTOR","INJECTOR_DEF_TYPES","NullInjector","importProvidersFrom","internalImportProvidersFrom","ɵfromNgModule","checkForStandaloneCmp","providersOut","dedup","injectorTypesWithProviders","collectProviders","provider","internalSource","walkProviderTree","processInjectorTypesWithProviders","typesWithProviders","visitor","ngModule","deepForEachProvider","parents","defType","injDef","cmpDef","isDuplicate","importTypesWithProviders","imported","defProviders","injectorType","USE_VALUE$1","isValueProvider","isTypeProvider","INJECTOR_SCOPE","NOT_YET","CIRCULAR","NULL_INJECTOR","getNullInjector","EnvironmentInjector","R3Injector","destroyed","_destroyed","scopes","records","_ngOnDestroyHooks","_onDestroyHooks","forEachSingleProvider","processProvider","makeRecord","injectorDefTypes","assertNotDestroyed","service","onDestroyHooks","removeOnDestroy","previousInjector","couldBeInjectableType","injectableDefInScope","injectableDefOrInjectorDefFactory","hydrate","catchInjectorError","injectorErrorName","tokenPath","formatError","resolveInjectorInitializers","initializers","initializer","tokens","providerToRecord","providerToFactory","multiRecord","hasOnDestroy","destroyCBIdx","getUndecoratedInjectableFactory","paramLength","inheritedInjectableDef","getInheritedInjectableDef","ngModuleType","unwrappedProvider","isFactoryProvider","isExistingProvider","classRef","hasDeps","APP_ID","DEFAULT_APP_ID","PLATFORM_INITIALIZER","CSP_NONCE","_retrieveHydrationInfoImpl","retrieveHydrationInfo","ComponentRef$1","ComponentFactory$1","_NullComponentFactoryResolver","resolveComponentFactory","noComponentFactoryError","ComponentFactoryResolver$1","NULL","injectElementRef","createElementRef","ElementRef","unwrapElementRef","RendererFactory2","Renderer2","injectRenderer2","nodeAtIndex","Sanitizer","Version","full","minor","NOT_FOUND_CHECK_ONLY_ELEMENT_INJECTOR","createInjector","additionalProviders","createInjectorWithoutInjectorInstances","Injector","getOriginalError","_console","originalError","_findOriginalError","_wrapInTimeout","EventEmitter_","isAsync","__isAsync","nextFn","errorFn","completeFn","NgZone","enableLongStackTrace","shouldCoalesceEventChangeDetection","shouldCoalesceRunChangeDetection","hasPendingMacrotasks","hasPendingMicrotasks","isStable","onUnstable","onMicrotaskEmpty","onStable","assertZonePatched","_nesting","_outer","_inner","TaskTrackingZoneSpec","fork","longStackTraceZoneSpec","lastRequestAnimationFrameId","nativeRequestAnimationFrame","getNativeRequestAnimationFrame","nativeCancelAnimationFrame","unpatchedRequestAnimationFrame","unpatchedCancelAnimationFrame","forkInnerZoneWithAngularBehavior","zone","delayChangeDetectionForEventsDelegate","delayChangeDetectionForEvents","isCheckStableRunning","fakeTopEventTask","scheduleEventTask","updateMicroTaskStatus","checkStable","invoke","properties","isAngularZone","onInvokeTask","applyThis","applyArgs","shouldBeIgnoredByZone","__ignore_ng_zone__","invokeTask","onEnter","onLeave","onInvoke","onHasTask","hasTaskState","hasTask","change","_hasPendingMicrotasks","microTask","macroTask","onHandleError","isInAngularZone","assertInAngularZone","assertNotInAngularZone","runTask","EMPTY_PAYLOAD","cancelTask","runGuarded","NoopNgZone","ZONE_IS_STABLE_OBSERVABLE","isStableFactory","_stable","merge$1","stableSub","queueMicrotask","unstableSub","maybeUnwrapFn","AfterRenderEventManager","renderDepth","begin","validateBegin","markViewDirty","PRESERVE_HOST_CONTENT","currentConsumer","getReactiveLViewConsumer","slot","getOrCreateCurrentLViewConsumer","commitLViewConsumerIfHasProducers","createLViewConsumer","REACTIVE_LVIEW_CONSUMER_NODE","NO_CHANGE","ɵɵadvance","selectIndexInternal","checkNoChangesMode","ɵɵdirectiveInject","ɵɵinvalidFactory","createLView","tHostNode","hydrationInfo","getUniqueLViewId","getOrCreateTNode","createTNodeAtIndex","createTNode","tParent","insertBeforeIndex","directiveStylingLast","propertyBindings","localNames","initialInputs","stylesWithoutHost","residualStyles","classesWithoutHost","residualClasses","classBindings","styleBindings","isInI18nBlock","getCurrentParentTNode","allocExpando","numSlotsToAlloc","initialValue","allocIdx","executeTemplate","templateFn","prevSelectedIndex","isUpdatePhase","effectiveConsumer","executeContentQueries","createDirectivesInstances","instantiateAllDirectives","addComponentLogic","hostTNode","getOrCreateComponentTView","lViewFlags","componentView","addToViewTree","rendererFactory","createRenderer","setInputsFromAttrs","invokeDirectivesHostBindings","saveResolvedLocalsInData","viewData","localRefExtractor","localIndex","incompleteFirstPass","createTView","directives","pipes","constsOrFactory","ssrId","initialViewLength","createViewBlueprint","queries","expandoStartIndex","hostBindingOpCodes","firstUpdatePass","staticViewQueries","staticContentQueries","directiveRegistry","pipeRegistry","_applyRootElementTransformImpl","rootElement","generatePropertyAliases","aliasMap","propertyAliases","hostDirectiveAliasMap","internalName","addPropertyAlias","elementPropertyInternal","nativeOnly","dataValue","inputData","setInputsForProperty","markDirtyIfOnPush","viewIndex","childComponentLView","mapPropName","resolveDirectives","localRefs","exportsMap","matchResult","findDirectiveDefMatches","hostDirectiveDefs","hostDirectiveMatches","markAsComponentHost","initializeDirectives","cacheMatchingLocalNames","initTNodeFlags","numberOfDirectives","preOrderHooksFound","preOrderCheckHooksFound","directiveIdx","configureViewWithDirective","saveNameToExportMap","lifeCycleHooks","initializeInputAndOutputAliases","hostDirectiveDefinitionMap","tViewData","tNodeAttrs","inputsFromAttrs","inputsStore","outputsStore","aliasData","aliasedOutputs","generateInitialInputs","elementIndex","getCurrentDirectiveIndex","dirIndex","invokeHostBindingsInCreationMode","directiveFactory","nodeInjectorFactory","registerHostBindingOpCodes","directiveVarsIdx","elementIndx","lastSelectedElementIdx","elementAttributeInternal","setElementAttribute","strValue","initialInputData","writeToDirectiveInput","inputsToStore","createLContainer","hostNative","refreshContentQueries","directiveDefIdx","executeViewQueryFn","viewQueryFn","getOrCreateLViewCleanup","getOrCreateTViewCleanup","textBindingInternal","updateTextNode","setValue","renderComponent","hostLView","componentHostIdx","componentTView","syncViewWithBlueprint","hostRNode","renderView","renderChildComponents","EffectManager","queue","effectFn","destroyRef","allowSignalWrites","w","watch","registerOnCleanup","notify","unregisterOnDestroy","isQueueEmpty","computeStaticStyling","writeToHost","collectNativeNodes","lNode","collectNativeNodesInLContainer","nodesInSlot","lViewInAContainer","lViewFirstChildTNode","detectChangesInternal","notifyErrorHandler","afterRenderEventManager","refreshView","effectManager","setBindingIndex","hooksInitPhaseCompleted","markTransplantedViewsForRefresh","detectChangesInEmbeddedViews","processHostBindingOpCodes","opCode","bindingRootIndx","hostBindingFn","detectChangesInChildComponents","detectChangesInView","detectChangesInComponent","viewAttachedToChangeDetector","ViewRef$1","rootNodes","_cdRefInjectingView","_appRef","_attachedToViewContainer","viewRefs","storeLViewOnDestroy","onDestroyCallback","markForCheck","detach","reattach","detectChanges","checkNoChanges","attachToViewContainerRef","detachFromAppRef","detachViewFromDOM","attachToAppRef","appRef","RootViewRef","_view","ComponentFactoryResolver","ComponentFactory","toRefArray","nonMinified","templateName","ChainedInjector","parentInjector","refArray","transform","componentType","stringifyCSSSelectorList","selectorList","isBoundToModule","projectableNodes","rootSelectorOrNode","environmentInjector","realEnvironmentInjector","rootViewInjector","hostRenderer","elementName","locateHostElement","elementOrSelector","preserveContent","selectRootElement","applyRootElementTransform","getNamespace","rootFlags","rootTView","rootLView","tElementNode","rootComponentDef","rootDirectives","createRootComponentTNode","createRootComponentView","applyRootComponentStyling","viewRenderer","setRootNodeAttributes","extractAttrsAndClassesFromSelector","projectNodes","nodesforSlot","createRootComponent","hostFeatures","rootTNode","LifecycleHooksFeature","ComponentRef","_rootLView","previousInputValues","changeDetectorRef","is","ɵɵInheritDefinitionFeature","superType","getSuperType","shouldInheritFields","inheritanceChain","superDef","writeableDef","maybeUnwrapEmpty","superHostBindings","inheritHostBindings","superViewQuery","superContentQueries","inheritViewQuery","inheritContentQueries","animation","defData","mergeHostAttrsAcrossInheritance","prevViewQuery","prevContentQueries","prevHostBindings","ɵɵInputTransformsFeature","isListLikeIterable","isJsObject","updateBinding","bindingUpdated","ɵɵattribute","interpolation1","prefix","v0","suffix","interpolation2","v1","different","bindingUpdated2","exp1","exp2","getBindingIndex","ɵɵtemplate","attrsIndex","localRefsIndex","adjustedIndex","templateFirstCreatePass","tViewConsts","embeddedTView","_locateOrCreateContainerAnchor","createContainerAnchorImpl","ɵɵreference","load","getContextLView","ɵɵproperty","setDirectiveInputsWhichShadowsStyling","isClassBased","ɵɵelementStart","elementStartFirstCreatePass","elementStart","_locateOrCreateElementNode","hasDirectives","getElementDepthCount","increaseElementDepthCount","ɵɵelementEnd","isSkipHydrationRootTNode","leaveSkipHydrationBlock","decreaseElementDepthCount","elementEnd","hasClassInput","hasStyleInput","ɵɵelement","getNamespace$1","ɵɵelementContainerStart","elementContainerStartFirstCreatePass","_locateOrCreateElementContainerNode","ɵɵelementContainerEnd","ɵɵelementContainer","ɵɵgetCurrentView","isSubscribable","ɵɵlistener","listenerFn","useCapture","eventTargetResolver","listenerInternal","isTNodeDirectiveHost","processOutputs","lCleanupIndex","idxOrTargetGetter","existingListener","findExistingListener","tNodeIdx","cleanupEventName","listenerIdxInLCleanup","__ngLastListenerFn__","__ngNextListenerFn__","wrapListener","listen","propsLength","executeListenerWithErrorHandling","wrapWithPreventDefault","wrapListenerIn_markDirtyAndPreventDefault","nextListenerFn","preventDefault","ɵɵnextContext","nextContextImpl","walkUpViews","nestingLevel","matchingProjectionSlotIndex","projectionSlots","wildcardNgContentIndex","ngProjectAsAttrVal","getProjectAsAttrValue","ngProjectAsAttrIdx","ɵɵprojectionDef","componentNode","projectionHeads","tails","componentChild","slotIndex","ɵɵprojection","selectorIndex","applyProjection","ɵɵpropertyInterpolate","ɵɵpropertyInterpolate1","interpolatedValue","toTStylingRange","getTStylingRangePrev","tStylingRange","setTStylingRangePrevDuplicate","getTStylingRangeNext","setTStylingRangeNext","setTStylingRangeNextDuplicate","markDuplicates","tStylingKey","isPrevDir","isClassBinding","tStylingAtIndex","isMap","cursor","foundDuplicate","tStyleRangeAtCursor","isStylingMatch","tStylingKeyCursor","parserState","textEnd","keyEnd","valueEnd","getLastParsedKey","parseClassNameNext","consumeClassToken","startIndex","consumeWhitespace","ɵɵstyleProp","checkStylingProperty","ɵɵclassProp","ɵɵclassMap","checkStylingMap","stringParser","stylingFirstUpdatePass","hasStylingInputShadow","isInHostBindings","staticPrefix","updateStylingMap","oldKeyValueArray","newKeyValueArray","oldIndex","newIndex","oldKey","newKey","setKey","updateStyling","toStylingKeyValueArray","styleKeyValueArray","unwrappedValue","classKeyValueArraySet","classStringParser","parseClassName","resetParserState","normalizeSuffix","isHostBindings","wrapInStaticStylingKey","stylingKey","hostDirectiveDef","getCurrentDirectiveDef","residual","collectStylingFromTAttrs","collectStylingFromDirectives","templateStylingKey","getTemplateHeadTStylingKey","bindings","setTemplateHeadTStylingKey","collectResidual","insertTStylingBinding","tStylingKeyWithStatic","isHostBinding","tBindings","tmplHead","tmplTail","isKeyDuplicateOfStatic","previousNode","setTStylingRangePrev","markDuplicateOfResidualStyling","currentDirective","desiredMarker","currentMarker","stringKey","tRange","higherPriorityValue","getTStylingRangeNextDuplicate","findStylingValue","isStylingValuePresent","getTStylingRangePrevDuplicate","applyStyling","removeStyle","setStyle","isPrevDirection","rawKey","containsStatics","isStylingMap","valueAtLViewIndex","ɵɵtext","textNative","_locateOrCreateTextNode","createTextNode","createText","ɵɵtextInterpolate","ɵɵtextInterpolate1","interpolated","ɵɵtextInterpolate2","u","localeEn","plural","LOCALE_DATA","findLocaleData","locale","normalizedLocale","normalizeLocale","getLocaleData","parentLocale","getLocalePluralCase","LocaleDataIndex","PluralCase","ng","common","locales","LocaleId","DayPeriodsFormat","DayPeriodsStandalone","DaysFormat","DaysStandalone","MonthsFormat","MonthsStandalone","Eras","FirstDayOfWeek","WeekendRange","DateFormat","TimeFormat","DateTimeFormat","NumberSymbols","NumberFormats","CurrencyCode","CurrencySymbol","CurrencyName","Currencies","Directionality","ExtraData","DEFAULT_LOCALE_ID","LOCALE_ID$1","resolveProvider","lInjectablesBlueprint","providerFactory","beginIndex","existingFactoryIndex","registerDestroyHooksIfSupported","existingProvidersFactoryIndex","existingViewProvidersFactoryIndex","doesViewProvidersFactoryExist","multiFactory","factoryFn","f","componentProviders","multiFactoryAdd","multiViewProvidersFactoryResolver","multiProvidersFactoryResolver","contextIndex","indexInFactory","providerIsTypeProvider","providerIsClassProvider","isClassProvider","existingCallbacksIndex","isComponentProvider","lData","multiResolve","factories","componentCount","multiProviders","ɵɵProvidersFeature","viewProviders","processProvidersFn","NgModuleRef$1","NgModuleFactory$1","createNgModule","NgModuleRef","_parent","_bootstrapComponents","destroyCbs","componentFactoryResolver","_r3Injector","NgModuleFactory","moduleType","EnvironmentNgModuleRefAdapter","debugName","runEnvironmentInitializers","createEnvironmentInjector","StandaloneService","_injector","cachedInjectors","getOrCreateStandaloneInjector","standaloneInjector","ɵɵStandaloneFeature","ɵɵpureFunction0","slotOffset","pureFn","getBinding","ɵɵpureFunction1","exp","pureFunction1Internal","bindingRoot","getPureFunctionReturnValue","returnValueIndex","lastReturnValue","symbolIterator","_results","QueryList","_changes","_emitDistinctChangesOnly","_changesDetected","toArray","resultsTree","identityAccessor","newResultFlat","flatten","flat","POSITIVE_INFINITY","arrayEquals","valueA","valueB","notifyOnChanges","setDirty","addLViewToLContainer","addToDOM","insertView","containerLength","trackMovedView","addViewToDOM","parentNativeNode","TemplateRef","injectTemplateRef","ViewEngineTemplateRef","R3TemplateRef","_declarationLView","_declarationTContainer","elementRef","createEmbeddedViewImpl","embeddedLView","createAndRenderEmbeddedLView","declarationLView","templateTNode","declarationViewLQueries","createTemplateRef","ViewContainerRef","injectViewContainerRef","createContainerRef","VE_ViewContainerRef","R3ViewContainerRef","_lContainer","_hostTNode","_hostLView","getViewRefs","indexOrOptions","viewRef","insertImpl","createComponent","componentFactoryOrType","isComponentFactory","isType","ngModuleRef","componentFactory","contextInjector","componentRef","insert","skipDomInsertion","viewAttachedToContainer","prevIdx","prevLContainer","prevVCRef","adjustedIdx","_adjustIndex","getOrCreateViewRefs","viewRefsArr","detachedView","_locateOrCreateAnchorNode","createAnchorNode","commentNode","insertAnchorNode","nativeNextSibling","LQuery_","queryList","LQueries_","tQueries","noOfInheritedQueries","viewLQueries","tQuery","getByIndex","indexInDeclarationView","dirtyQueriesWithMatches","getTQuery","TQueryMetadata_","TQueries_","queriesForTemplateRef","childQueryIndex","tqueryClone","track","tquery","TQuery_","crossesNgTemplate","_appliesToNextNode","_declarationNodeIndex","isApplyingToNode","matchTNode","addMatch","declarationNodeIdx","matchTNodeWithReadOption","getIdxOfMatchingSelector","nodeMatchIdx","directiveOrProviderIdx","matchIdx","createResultForNode","matchingIdx","createResultByTNodeType","createSpecialToken","materializeViewResults","queryIndex","lQuery","tQueryMatches","matchedNodeIdx","collectQueryResults","lViewResults","embeddedLViews","ɵɵqueryRefresh","isCreationMode","ɵɵviewQuery","createTQuery","createLQuery","ɵɵcontentQuery","saveContentQueryAndDirectiveIndex","tViewContentQueries","ɵɵloadQuery","loadQueryInternal","storeCleanupWithContext","ɵɵtemplateRefExtractor","isNgModule","ApplicationInitStatus","initialized","donePromise","rej","appInits","runInitializers","asyncInitPromises","initResult","observableAsPromise","Console","LOCALE_ID","getGlobalLocale","$localize","DEFAULT_CURRENCY_CODE","InitialRenderPendingTasks","hasPendingTasks","ModuleWithComponentFactories","ngModuleFactory","componentFactories","Compiler","compileModuleSync","compileModuleAsync","compileModuleAndAllComponentsSync","declaration","compileModuleAndAllComponentsAsync","clearCache","clearCacheFor","getModuleId","TESTABILITY","TESTABILITY_GETTER","_testabilityGetter","Testability","_ngZone","testabilityGetter","_pendingCount","_isZoneStable","_didWork","_callbacks","taskTrackingZone","setTestabilityGetter","getter","addToWindow","_watchAngularEvents","_runCallbacksIfReady","increasePendingRequestCount","decreasePendingRequestCount","timeoutId","doneCb","pending","getPendingTasks","updateCb","macroTasks","creationLocation","addCallback","whenStable","getPendingRequestCount","registerApplication","unregisterApplication","findProviders","using","exactMatch","TestabilityRegistry","_applications","testability","unregisterAllApplications","getTestability","getAllTestabilities","getAllRootElements","findTestabilityInTree","findInAncestors","_platformInjector","ALLOW_MULTIPLE_PLATFORMS","PLATFORM_DESTROY_LISTENERS","APP_BOOTSTRAP_LISTENER","NgProbeToken","createPlatformFactory","parentPlatformFactory","desc","extraProviders","getPlatform","platformProviders","createPlatform","publishSignalConfiguration","setThrowInvalidWriteToSignalError","PlatformRef","runPlatformInitializers","createPlatformInjector","assertPlatform","requiredToken","_modules","_destroyListeners","bootstrapModuleFactory","moduleFactory","ngZone","getNgZone","ngZoneToUse","getNgZoneOptions","eventCoalescing","runCoalescing","ngZoneEventCoalescing","ngZoneRunCoalescing","moduleRef","createNgModuleRefWithProviders","internalProvideZoneChangeDetection","ngZoneFactory","ngZoneChangeDetectionScheduler","NgZoneChangeDetectionScheduler","initialize","INTERNAL_APPLICATION_ERROR_HANDLER","ngZoneApplicationErrorHandlerFactory","exceptionHandler","_callAndReportToErrorHandler","initStatus","setLocaleId","localeId","_moduleDoBootstrap","compilerOptions","optionsReducer","compileNgModuleFactory","ApplicationRef","ngDoBootstrap","module","destroyListeners","objs","_bootstrapListeners","_runningTick","_views","internalErrorHandler","zoneIsStable","componentTypes","componentOrFactory","cf","compRef","_loadComponent","tick","attachView","listeners","viewCount","warnIfDestroyed","userErrorHandler","applicationRef","_onMicrotaskEmptySubscription","ChangeDetectorRef","injectChangeDetectorRef","createViewRef","isPipe","DefaultIterableDifferFactory","supports","trackByFn","DefaultIterableDiffer","trackByIdentity","_linkedRecords","_unlinkedRecords","_previousItHead","_itHead","_itTail","_additionsHead","_additionsTail","_movesHead","_movesTail","_removalsHead","_removalsTail","_identityChangesHead","_identityChangesTail","forEachItem","nextIt","nextRemove","addRemoveOffset","moveOffsets","getPreviousIndex","adjPreviousIndex","_nextRemoved","localMovePreviousIndex","localCurrentIndex","forEachPreviousItem","_nextPrevious","forEachAddedItem","_nextAdded","forEachMovedItem","_nextMoved","forEachRemovedItem","_nextIdentityChange","collection","check","_reset","itemTrackBy","mayBeDirty","trackById","_verifyReinsertion","_addIdentityChange","_mismatch","iterateListLike","_truncate","isDirty","previousRecord","_prev","_remove","_reinsertAfter","_moveAfter","_addAfter","IterableChangeRecord_","reinsertRecord","_addToMoves","nextRecord","_addToRemovals","_unlink","prevRecord","_prevRemoved","_insertAfter","_DuplicateMap","toIndex","_prevDup","_nextDup","_DuplicateItemRecordList","_head","_tail","atOrAfterIndex","duplicates","recordList","isEmpty","moveOffset","DefaultKeyValueDifferFactory","DefaultKeyValueDiffer","_records","_mapHead","_appendAfter","_previousMapHead","_changesHead","_changesTail","forEachChangedItem","_nextChanged","_forEach","_maybeAddToChanges","_getOrCreateRecordForKey","_insertBeforeOrAppend","KeyValueChangeRecord_","_addToAdditions","_addToChanges","defaultIterableDiffersFactory","IterableDiffers","copied","extend","defaultKeyValueDiffersFactory","KeyValueDiffers","kv","platformCore","ApplicationModule","booleanAttribute","reflectComponentType","isSignal","GenericBrowserDomAdapter","ɵDomAdapter","supportsDOMEvents","BrowserDomAdapter","makeCurrent","ɵsetRootDomAdapter","onAndCancel","dispatchEvent","getDefaultDocument","createHtmlDocument","isElementNode","DocumentFragment","getBaseElementHref","baseElement","relativePath","urlParsingNode","pathName","resetBaseElement","getUserAgent","getCookie","BrowserXhr","EVENT_MANAGER_PLUGINS","EventManager","_zone","_eventNameToPlugin","_plugins","_findPluginFor","getZone","EventManagerPlugin","APP_ID_ATTRIBUTE_NAME","SharedStylesHost","appId","nonce","styleRef","hostNodes","styleNodesInDOM","collectServerRenderedStyles","platformIsServer","resetHostNodes","addStyles","changeUsageCount","onStyleAdded","removeStyles","onStyleRemoved","getAllStyles","addHost","hostNode","addStyleToHost","removeHost","elements","styleMap","styleRefValue","usage","getStyleElement","styleEl","styleElRef","NAMESPACE_URIS","svg","xhtml","xlink","xml","xmlns","math","COMPONENT_REGEX","REMOVE_STYLES_ON_COMPONENT_DESTROY","shimStylesContent","compId","DomRendererFactory2","eventManager","sharedStylesHost","removeStylesOnCompDestroy","rendererByCompId","defaultRenderer","DefaultDomRenderer2","getOrCreateRenderer","EmulatedEncapsulationDomRenderer2","applyToHost","NoneEncapsulationDomRenderer","applyStyles","ShadowDomRenderer","createElementNS","newChild","isTemplateNode","refChild","oldChild","selectorOrNode","namespaceUri","setAttributeNS","removeAttributeNS","ɵgetDOM","decoratePreventDefault","hostEl","nodeOrShadowRoot","contentAttr","shimContentAttribute","componentShortId","hostAttr","shimHostAttribute","DomEventsPlugin","MODIFIER_KEYS","_keyMap","Del","Esc","Left","Right","Up","Down","Menu","Win","MODIFIER_KEY_GETTERS","alt","control","KeyEventsPlugin","parseEventName","parsedEvent","outsideHandler","eventCallback","fullKey","domEventName","_normalizeKey","codeIX","modifierName","matchEventFullKeyCode","fullKeyCode","keycode","modifierGetter","keyName","platformBrowser","ɵPLATFORM_BROWSER_ID","initDomAdapter","_document","ɵsetDocument","BROWSER_MODULE_PROVIDERS_MARKER","TESTABILITY_PROVIDERS","ɵTESTABILITY_GETTER","BrowserGetTestability","ɵglobal","getAngularTestability","getAllAngularTestabilities","getAllAngularRootElements","frameworkStabilizers","testabilities","didWork","decrement","didWork_","ɵTESTABILITY","BROWSER_MODULE_PROVIDERS","ɵINJECTOR_SCOPE","providersAlreadyPresent","withServerTransition","Title","getTitle","setTitle","newTitle","createTitle","DomSanitizer","DomSanitizerImpl","ɵallowSanitizationBypassAndThrow","ɵunwrapSafeValue","ɵ_sanitizeHtml","ɵ_sanitizeUrl","bypassSecurityTrustHtml","ɵbypassSanitizationTrustHtml","bypassSecurityTrustStyle","ɵbypassSanitizationTrustStyle","bypassSecurityTrustScript","ɵbypassSanitizationTrustScript","bypassSecurityTrustUrl","ɵbypassSanitizationTrustUrl","bypassSecurityTrustResourceUrl","ɵbypassSanitizationTrustResourceUrl","domSanitizerImplFactory","EmptyError","concatAll","defer","observableFactory","_refCount","refCounter","sharedConnection","_connection","connect","ConnectableObservable","subjectFactory","getSubject","higherOrderRefCount","take","seen","defaultIfEmpty","hasValue","throwIfEmpty","defaultErrorFactory","hasDefaultValue","takeLast","PRIMARY_OUTLET","RouteTitleKey","ParamsAsMap","convertToParamMap","defaultUrlMatcher","segments","segmentGroup","hasChildren","posParams","consumed","shallowEqual","k1","k2","equalArraysOrString","aSorted","bSorted","every","wrapIntoObservable","isObservable","ɵisPromise","pathCompareMap","exact","equalSegmentGroups","containee","matrixParams","equalPath","matrixParamsMatch","numberOfChildren","children","subset","containsSegmentGroup","paramCompareMap","equalParams","containsParams","ignored","containsTree","paths","containsSegmentGroupHelper","containeePaths","containerPaths","containeeSegment","UrlTree","UrlSegmentGroup","queryParamMap","_queryParamMap","DEFAULT_SERIALIZER","serialize","serializePaths","UrlSegment","parameterMap","_parameterMap","serializePath","bs","UrlSerializer","DefaultUrlSerializer","UrlParser","parseRootSegment","parseQueryParams","parseFragment","tree","serializeSegment","serializeQueryParams","strParams","encodeUriQuery","encodeUriFragment","primary","mapChildrenIntoArray","childOutlet","encodeUriString","encodeUriSegment","decode","decodeQuery","serializeMatrixParams","SEGMENT_RE","matchSegments","MATRIX_PARAM_SEGMENT_RE","QUERY_PARAM_RE","QUERY_PARAM_VALUE_RE","consumeOptional","peekStartsWith","parseChildren","parseQueryParam","parseSegment","parseParens","parseMatrixParams","parseParam","matchMatrixKeySegments","valueMatch","matchQueryParams","matchUrlQueryParamValue","decodedKey","decodedVal","currentVal","allowPrimary","outletName","createRoot","rootCandidate","Ke","squashSegmentGroup","newChildren","childCandidate","grandChildOutlet","grandChild","mergeTrivialChildren","isUrlTree","createSegmentGroupFromRoute","targetGroup","rootSegmentGroup","createSegmentGroupFromRouteRecursive","childOutlets","childSnapshot","outlet","createUrlTreeFromSegmentGroup","relativeTo","commands","nav","computeNavigation","Navigation","numberOfDoubleDots","isAbsolute","cmd","cmdIdx","outlets","segmentPath","urlPart","partIndex","toRoot","findStartingPositionForTargetGroup","Position","NaN","modifier","isMatrixParams","createPositionApplyingDoubleDots","group","g","ci","dd","newSegmentGroup","processChildren","updateSegmentGroupChildren","updateSegmentGroup","command","isCommandWithOutlets","oldRoot","oldSegmentGroup","qp","replaceSegment","newRoot","oldSegment","newSegment","cmdWithOutlet","prefixedWith","currentCommandIndex","currentPathIndex","noMatch","pathIndex","commandIndex","compare","slicedCommands","createNewSegmentGroup","getOutlets","childrenOfEmptyChild","createNewSegmentChildren","IMPERATIVE_NAVIGATION","RouterEvent","restoredState","urlAfterRedirects","NavigationSkipped","RoutesRecognized","GuardsCheckStart","GuardsCheckEnd","shouldActivate","ResolveStart","RouteConfigLoadStart","RouteConfigLoadEnd","ChildActivationStart","ChildActivationEnd","ActivationStart","ActivationEnd","routerEvent","BeforeActivateRoutes","RedirectRequest","OutletContext","ChildrenOutletContexts","attachRef","onChildOutletCreated","childName","getOrCreateContext","onChildOutletDestroyed","onOutletDeactivated","onOutletReAttached","Tree","_root","pathFromRoot","findNode","siblings","findPath","cc","TreeNode","nodeChildrenAsMap","RouterState","setRouterState","createEmptyState","urlTree","rootComponent","createEmptyStateSnapshot","activated","ActivatedRouteSnapshot","RouterStateSnapshot","emptyUrl","emptyParams","emptyData","emptyQueryParams","ActivatedRoute","urlSubject","paramsSubject","queryParamsSubject","fragmentSubject","dataSubject","futureSnapshot","_futureSnapshot","_routerState","paramMap","_paramMap","inheritedParamsDataResolve","paramsInheritanceStrategy","inheritingStartingFrom","flattenInherited","_resolvedData","advanceActivatedRoute","currentSnapshot","nextSnapshot","shallowEqualArrays","equalParamsAndUrlSegments","equalUrlParams","equalSegments","RouterOutlet","_activatedRoute","activateEvents","deactivateEvents","attachEvents","detachEvents","parentContexts","changeDetector","inputBinder","INPUT_BINDER","supportsBindingToComponentInputs","activatedComponentRef","isTrackedInParentContexts","deactivate","initializeOutletWithName","unsubscribeFromRouteData","attach","activateWith","isActivated","activatedRoute","activatedRouteData","cmp","bindActivatedRouteToOutletComponent","childContexts","OutletInjector","RoutedComponentInputBinder","outletDataSubscriptions","subscribeToRouteData","dataSubscription","createNode","routeReuseStrategy","prevState","shouldReuseRoute","createOrReuseChildren","shouldAttach","detachedRouteHandle","retrieve","createActivatedRoute","NAVIGATION_CANCELING_ERROR","redirectingNavigationError","urlSerializer","redirect","navigationBehaviorOptions","navigationCancelingError","redirectUrl","cancellationCode","isNavigationCancelingError$1","ɵEmptyOutletComponent","standardizeConfig","loadComponent","getOutlet","getClosestRouteInjector","_loadedInjector","ActivateRoutes","futureState","currState","forwardEvent","inputBindingEnabled","activate","futureRoot","currRoot","deactivateChildRoutes","activateChildRoutes","futureNode","currNode","futureChild","childOutletName","deactivateRoutes","deactivateRouteAndItsChildren","parentContext","future","shouldDetach","detachAndStoreRouteSubtree","deactivateRouteAndOutlet","activateRoutes","stored","CanActivate","CanDeactivate","getAllRouteGuards","getChildRouteGuards","getTokenOrFunctionIdentity","tokenOrFunction","ɵisInjectable","futurePath","checks","canDeactivateChecks","canActivateChecks","prevChildren","getRouteGuards","shouldRun","shouldRunGuardsAndResolvers","runGuardsAndResolvers","isEmptyError","INITIAL_VALUE","prioritizedGuardValue","startWith","results","redirectIfUrlTree","NoMatch","AbsoluteRedirect","noMatch$1","absoluteRedirect","newTree","ApplyRedirects","noMatchError","lineralizeSegments","applyRedirectCommands","applyRedirectCreateUrlTree","createSegmentGroup","createQueryParams","redirectToParams","actualParams","sourceName","updatedSegments","createSegments","redirectToSegments","actualSegments","findPosParam","findOrReturn","redirectToUrlSegment","matched","consumedSegments","remainingSegments","positionalParamSegments","matchWithChecks","getOrCreateRouteInjectorIfNeeded","currentInjector","runCanMatchGuards","canMatch","canMatchObservables","injectionToken","guard","isCanMatch","matcher","slicedSegments","containsEmptyPathMatchesWithNamedOutlets","emptyPathMatch","createChildrenForEmptyPaths","containsEmptyPathMatches","addEmptyPathsToChildrenIfNeeded","primarySegment","Recognizer","configLoader","rootComponentType","allowRedirects","applyRedirects","recognize","processSegmentGroup","rootNode","routeState","createUrlTreeFromSnapshot","inheritParamsAndData","routeNode","processSegment","sortedConfig","sortByMatchingOutlets","scan","accumulator","seed","scanInternals","hasSeed","emitOnNext","emitBeforeComplete","hasState","outletChildren","last$1","mergedChildren","mergeEmptyPathMatches","sortActivatedRouteSnapshots","nodes","localeCompare","processSegmentAgainstRoute","noLeftoversInUrl","rawSegment","isImmediateMatch","matchSegmentAgainstRoute","expandSegmentAgainstRouteUsingRedirect","expandWildCardWithParamsAgainstRouteUsingRedirect","expandRegularSegmentAgainstRouteUsingRedirect","newSegments","getData","_loadedComponent","getResolve","getChildConfig","childConfig","childInjector","matchedOnOutlet","_loadedRoutes","runCanLoadGuards","canLoad","canLoadObservables","isCanLoad","shouldLoadResult","cfg","canLoadFails","hasEmptyPathConfig","mergedNodes","duplicateEmptyPathNode","resultNode","mergedNode","hasStaticTitle","switchTap","nextResult","ROUTES","RouterConfigLoader","componentLoaders","childrenLoaders","compiler","onLoadStartListener","loadRunner","maybeUnwrapDefaultExport","onLoadEndListener","loader","factoryOrRoutes","rawRoutes","requireStandaloneComponents","isWrappedDefaultExport","default","NavigationTransitions","hasRequestedNavigation","navigationId","currentNavigation","currentTransition","lastSuccessfulNavigation","transitionAbortSubject","rootContexts","afterPreactivation","transitions","handleNavigationRequest","setupNavigations","router","initialUrlTree","initialRouterState","currentUrlTree","currentRawUrl","currentBrowserUrl","extractedUrl","urlHandlingStrategy","extract","rawUrl","targetSnapshot","currentRouterState","targetRouterState","guards","guardsResult","overallTransitionState","completed","trigger","previousNavigation","browserUrlTree","urlTransition","navigated","onSameUrlNavigation","shouldProcessUrl","transition","serializer","recognize$1","finalUrl","routesRecognized","navStart","skipLocationChange","replaceUrl","guardsStart","checkGuards","runCanDeactivateChecks","futureRSS","currRSS","runCanDeactivate","currARS","canDeactivate","canDeactivateObservables","closestInjector","isCanDeactivate","isBoolean","runCanActivateChecks","fireChildActivationStart","fireActivationStart","runCanActivateChild","futureARS","canActivateChildGuardsMapped","getCanActivateChild","canActivateChild","guardsMapped","isCanActivateChild","runCanActivate","canActivate","canActivateObservables","isCanActivate","guardsEnd","cancelNavigationTransition","resolveStart","dataResolved","resolveData","canActivateChecksResolved","runResolve","resolveNode","getDataKeys","getOwnPropertySymbols","getResolver","resolver","mapTo","resolvedData","resolveEnd","loadComponents","loaders","loadedComponent","createRouterState","titleStrategy","updateTitle","takeUntil","notifier","isRedirectingNavigationCancelingError$1","ee","navCancel","isBrowserTriggeredNavigation","TitleStrategy","buildTitle","pageTitle","getResolvedTitleForRoute","DefaultTitleStrategy","RouteReuseStrategy","DefaultRouteReuseStrategy","BaseRouteReuseStrategy","detachedTree","ɵDefaultRouteReuseStrategy_BaseFactory","ROUTER_CONFIGURATION","UrlHandlingStrategy","DefaultUrlHandlingStrategy","newUrlPart","wholeUrl","NavigationResult","COMPLETE","FAILED","REDIRECTING","afterNextNavigation","defaultMalformedUriErrorHandler","exactMatchOptions","subsetMatchOptions","navigationTransitions","browserPageId","canceledNavigationResolution","currentPageId","ɵrouterPageId","disposed","ɵConsole","malformedUriErrorHandler","lastSuccessfulId","urlUpdateStrategy","componentInputBindingEnabled","eventsSubscription","resetConfig","rawUrlTree","routerState","subscribeToNavigationEvents","isPublicRouterEvent","setBrowserUrl","restoreHistory","mergedTree","scheduleNavigation","resetRootComponentType","initialNavigation","setUpLocationChangeListener","navigateToSyncWithBrowser","locationSubscription","stateCopy","serializeUrl","getCurrentNavigation","dispose","createUrlTree","navigationExtras","queryParamsHandling","preserveFragment","relativeToUrlSegmentGroup","q","removeEmptyProps","navigateByUrl","navigate","validateCommands","isActive","matchOptions","priorPromise","generateNgRouterState","restoringFromCaughtError","targetPagePosition","resetState","resetUrlToCurrentUrlTree","routerPageId","RouterLink","tabIndexAttribute","onChanges","isAnchorElement","updateHref","setTabIndexIfNotOnNativeEl","newTabIndex","applyAttributeValue","routerLink","onClick","button","sanitizedValue","i3","$event","RouterLinkActive","_isActive","cdr","routerLinkActiveOptions","isActiveChange","routerEventsSubscription","links","subscribeToEachLinkOnChanges","linkInputChangesSubscription","allLinkChanges","isLinkActive","routerLinkActive","hasActiveLinks","ariaCurrentWhenActive","isActiveMatchOptions","isActiveCheckFn","_t","PreloadingStrategy","RouterPreloader","preloadingStrategy","setUpPreloading","preload","processRoutes","injectorForCurrentRoute","injectorForChildren","preloadConfig","loadedChildren$","recursiveLoadChildren$","loadComponent$","ROUTER_SCROLLER","RouterScroller","viewportScroller","lastId","lastSource","restoredId","createScrollEvents","scrollEventsSubscription","consumeScrollEvents","scheduleScrollEvent","routerFeature","getBootstrapListener","bootstrappedComponentRef","bootstrapDone","BOOTSTRAP_DONE","INITIAL_NAVIGATION","ROUTER_PRELOADER","withPreloading","ROUTER_FORROOT_GUARD","ROUTER_PROVIDERS","rootRoute","routerNgProbeToken","provideForRootGuard","useHash","scrollOffset","provideInitialNavigation","bindToComponentInputs","ROUTER_INITIALIZER","forChild","locationInitialized","asyncGeneratorStep","gen","_throw","_arguments","P","generator","fulfilled","step","rejected","throw","adopt","verb","fulfill","settle","__values","SuppressedError"],"sourceRoot":"webpack:///","sources":["./src/app/components/external-links/external-links.component.ts","./src/app/components/external-links/external-links.component.html","./src/app/components/external-links/external-links.module.ts","./src/app/components/logo/logo.component.ts","./src/app/components/logo/logo.component.html","./src/app/components/logo/logo.module.ts","./src/app/services/config.service.ts","./src/environments/environment.ts","./node_modules/@sentry/utils/esm/worldwide.js","./node_modules/@sentry/core/esm/constants.js","./node_modules/@sentry/utils/esm/is.js","./node_modules/@sentry/utils/esm/browser.js","./node_modules/@sentry/utils/esm/debug-build.js","./node_modules/@sentry/utils/esm/logger.js","./node_modules/@sentry/utils/esm/string.js","./node_modules/@sentry/utils/esm/object.js","./node_modules/@sentry/utils/esm/misc.js","./node_modules/@sentry/utils/esm/time.js","./node_modules/@sentry/core/esm/debug-build.js","./node_modules/@sentry/utils/esm/syncpromise.js","./node_modules/@sentry/core/esm/eventProcessors.js","./node_modules/@sentry/core/esm/session.js","./node_modules/@sentry/core/esm/utils/getRootSpan.js","./node_modules/@sentry/utils/esm/baggage.js","./node_modules/@sentry/utils/esm/tracing.js","./node_modules/@sentry/core/esm/utils/spanUtils.js","./node_modules/@sentry/core/esm/tracing/dynamicSamplingContext.js","./node_modules/@sentry/core/esm/utils/applyScopeDataToEvent.js","./node_modules/@sentry/core/esm/scope.js","./node_modules/@sentry/core/esm/version.js","./node_modules/@sentry/core/esm/hub.js","./node_modules/@sentry/utils/esm/stacktrace.js","./node_modules/@sentry/utils/esm/normalize.js","./node_modules/@sentry/utils/esm/memo.js","./node_modules/@sentry/core/esm/utils/prepareEvent.js","./node_modules/@sentry/core/esm/exports.js","./node_modules/@sentry/core/esm/integration.js","./node_modules/@sentry/core/esm/integrations/inboundfilters.js","./node_modules/@sentry/core/esm/integrations/functiontostring.js","./node_modules/@sentry/utils/esm/dsn.js","./node_modules/@sentry/core/esm/api.js","./node_modules/@sentry/utils/esm/supports.js","./node_modules/@sentry/utils/esm/vendor/supportsHistory.js","./node_modules/@sentry/utils/esm/instrument/_handlers.js","./node_modules/@sentry/utils/esm/instrument/history.js","./node_modules/@sentry/utils/esm/envelope.js","./node_modules/@sentry/utils/esm/error.js","./node_modules/@sentry/core/esm/baseclient.js","./node_modules/@sentry/core/esm/envelope.js","./node_modules/@sentry/core/esm/metrics/envelope.js","./node_modules/@sentry/core/esm/metrics/utils.js","./node_modules/@sentry/core/esm/utils/sdkMetadata.js","./node_modules/@sentry/browser/esm/debug-build.js","./node_modules/@sentry/browser/esm/eventbuilder.js","./node_modules/@sentry/browser/esm/helpers.js","./node_modules/@sentry/browser/esm/client.js","./node_modules/@sentry/browser/esm/userfeedback.js","./node_modules/@sentry/utils/esm/clientreport.js","./node_modules/@sentry/utils/esm/instrument/console.js","./node_modules/@sentry/utils/esm/instrument/dom.js","./node_modules/@sentry/utils/esm/instrument/xhr.js","./node_modules/@sentry/utils/esm/instrument/fetch.js","./node_modules/@sentry/utils/esm/severity.js","./node_modules/@sentry/utils/esm/url.js","./node_modules/@sentry/browser/esm/integrations/breadcrumbs.js","./node_modules/@sentry/browser/esm/integrations/dedupe.js","./node_modules/@sentry/utils/esm/instrument/globalError.js","./node_modules/@sentry/utils/esm/instrument/globalUnhandledRejection.js","./node_modules/@sentry/browser/esm/integrations/globalhandlers.js","./node_modules/@sentry/browser/esm/integrations/httpcontext.js","./node_modules/@sentry/utils/esm/aggregate-errors.js","./node_modules/@sentry/browser/esm/integrations/linkederrors.js","./node_modules/@sentry/browser/esm/integrations/trycatch.js","./node_modules/@sentry/browser/esm/stack-parsers.js","./node_modules/@sentry/utils/esm/ratelimit.js","./node_modules/@sentry/core/esm/transports/base.js","./node_modules/@sentry/utils/esm/promisebuffer.js","./node_modules/@sentry/browser/esm/transports/utils.js","./node_modules/@sentry/browser/esm/transports/fetch.js","./node_modules/@sentry/browser/esm/transports/xhr.js","./node_modules/@sentry/browser/esm/sdk.js","./node_modules/@sentry/core/esm/sdk.js","./node_modules/@sentry/core/esm/semanticAttributes.js","./node_modules/@sentry/angular-ivy/fesm2015/sentry-angular-ivy.js","./node_modules/@sentry/core/esm/tracing/span.js","./node_modules/@sentry/core/esm/tracing/transaction.js","./node_modules/@sentry/core/esm/tracing/idletransaction.js","./node_modules/@sentry/core/esm/tracing/utils.js","./node_modules/@sentry/core/esm/tracing/errors.js","./node_modules/@sentry/core/esm/utils/hasTracingEnabled.js","./node_modules/@sentry/core/esm/tracing/sampling.js","./node_modules/@sentry/core/esm/tracing/hubextensions.js","./node_modules/@sentry-internal/tracing/esm/common/debug-build.js","./node_modules/@sentry-internal/tracing/esm/browser/types.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/bindReporter.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/getNavigationEntry.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/getActivationStart.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/initMetric.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/generateUniqueID.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/observe.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/onHidden.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/getCLS.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/lib/getVisibilityWatcher.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/getFID.js","./node_modules/@sentry-internal/tracing/esm/browser/web-vitals/getLCP.js","./node_modules/@sentry-internal/tracing/esm/browser/instrument.js","./node_modules/@sentry-internal/tracing/esm/browser/metrics/utils.js","./node_modules/@sentry-internal/tracing/esm/browser/metrics/index.js","./node_modules/@sentry/core/esm/tracing/trace.js","./node_modules/@sentry-internal/tracing/esm/browser/request.js","./node_modules/@sentry-internal/tracing/esm/common/fetch.js","./node_modules/@sentry-internal/tracing/esm/browser/browsertracing.js","./node_modules/@sentry-internal/tracing/esm/browser/router.js","./node_modules/@sentry/utils/esm/buildPolyfills/_optionalChain.js","./node_modules/@sentry/core/esm/utils/isSentryRequestUrl.js","./node_modules/@sentry/utils/esm/isBrowser.js","./node_modules/@sentry/replay/esm/index.js","./node_modules/@sentry/utils/esm/buildPolyfills/_nullishCoalesce.js","./src/app/components/navigation-primary/navigation-primary.component.ts","./src/app/components/navigation-primary/navigation-primary.component.html","./src/app/components/header/header.component.ts","./src/app/components/header/header.component.html","./src/app/components/footer/footer.component.ts","./src/app/components/footer/footer.component.html","./src/app/components/section-confirmation/section-confirmation.component.ts","./src/app/components/section-confirmation/section-confirmation.component.html","./src/app/app.component.html","./src/app/app.component.ts","./src/app/app-routing.module.ts","./src/app/components/navigation-primary/navigation.module.ts","./src/app/components/header/header.module.ts","./src/app/components/footer/footer.module.ts","./src/app/core/interceptors/api-key.interceptor.ts","./src/app/services/error-handler.service.ts","./src/app/components/section-confirmation/section-confirmation.module.ts","./src/app/app.module.ts","./src/main.ts","./node_modules/@sentry-internal/tracing/esm/browser/backgroundtab.js","./node_modules/@sentry/core/esm/tracing/measurement.js","./node_modules/@sentry/utils/esm/env.js","./node_modules/@sentry/utils/esm/node.js","./node_modules/rxjs/dist/esm/internal/BehaviorSubject.js","./node_modules/rxjs/dist/esm/internal/Observable.js","./node_modules/rxjs/dist/esm/internal/util/ObjectUnsubscribedError.js","./node_modules/rxjs/dist/esm/internal/Subject.js","./node_modules/rxjs/dist/esm/internal/NotificationFactories.js","./node_modules/rxjs/dist/esm/internal/Subscriber.js","./node_modules/rxjs/dist/esm/internal/util/UnsubscriptionError.js","./node_modules/rxjs/dist/esm/internal/Subscription.js","./node_modules/rxjs/dist/esm/internal/config.js","./node_modules/rxjs/dist/esm/internal/observable/combineLatest.js","./node_modules/rxjs/dist/esm/internal/observable/empty.js","./node_modules/rxjs/dist/esm/internal/operators/observeOn.js","./node_modules/rxjs/dist/esm/internal/operators/subscribeOn.js","./node_modules/rxjs/dist/esm/internal/scheduled/scheduleAsyncIterable.js","./node_modules/rxjs/dist/esm/internal/observable/from.js","./node_modules/rxjs/dist/esm/internal/scheduled/scheduled.js","./node_modules/rxjs/dist/esm/internal/scheduled/scheduleObservable.js","./node_modules/rxjs/dist/esm/internal/scheduled/scheduleArray.js","./node_modules/rxjs/dist/esm/internal/scheduled/schedulePromise.js","./node_modules/rxjs/dist/esm/internal/scheduled/scheduleIterable.js","./node_modules/rxjs/dist/esm/internal/scheduled/scheduleReadableStreamLike.js","./node_modules/rxjs/dist/esm/internal/observable/innerFrom.js","./node_modules/rxjs/dist/esm/internal/observable/of.js","./node_modules/rxjs/dist/esm/internal/observable/throwError.js","./node_modules/rxjs/dist/esm/internal/operators/OperatorSubscriber.js","./node_modules/rxjs/dist/esm/internal/operators/catchError.js","./node_modules/rxjs/dist/esm/internal/operators/concatMap.js","./node_modules/rxjs/dist/esm/internal/operators/distinctUntilChanged.js","./node_modules/rxjs/dist/esm/internal/operators/filter.js","./node_modules/rxjs/dist/esm/internal/operators/finalize.js","./node_modules/rxjs/dist/esm/internal/operators/map.js","./node_modules/rxjs/dist/esm/internal/operators/mergeAll.js","./node_modules/rxjs/dist/esm/internal/operators/mergeMap.js","./node_modules/rxjs/dist/esm/internal/operators/mergeInternals.js","./node_modules/rxjs/dist/esm/internal/operators/switchMap.js","./node_modules/rxjs/dist/esm/internal/operators/tap.js","./node_modules/rxjs/dist/esm/internal/scheduler/timeoutProvider.js","./node_modules/rxjs/dist/esm/internal/symbol/iterator.js","./node_modules/rxjs/dist/esm/internal/symbol/observable.js","./node_modules/rxjs/dist/esm/internal/util/args.js","./node_modules/rxjs/dist/esm/internal/util/isScheduler.js","./node_modules/rxjs/dist/esm/internal/util/argsArgArrayOrObject.js","./node_modules/rxjs/dist/esm/internal/util/arrRemove.js","./node_modules/rxjs/dist/esm/internal/util/createErrorClass.js","./node_modules/rxjs/dist/esm/internal/util/createObject.js","./node_modules/rxjs/dist/esm/internal/util/errorContext.js","./node_modules/rxjs/dist/esm/internal/util/executeSchedule.js","./node_modules/rxjs/dist/esm/internal/util/identity.js","./node_modules/rxjs/dist/esm/internal/util/isArrayLike.js","./node_modules/rxjs/dist/esm/internal/util/isAsyncIterable.js","./node_modules/rxjs/dist/esm/internal/util/isFunction.js","./node_modules/rxjs/dist/esm/internal/util/isInteropObservable.js","./node_modules/rxjs/dist/esm/internal/util/isIterable.js","./node_modules/rxjs/dist/esm/internal/util/isPromise.js","./node_modules/rxjs/dist/esm/internal/util/isReadableStreamLike.js","./node_modules/rxjs/dist/esm/internal/util/lift.js","./node_modules/rxjs/dist/esm/internal/util/mapOneOrManyArgs.js","./node_modules/rxjs/dist/esm/internal/util/noop.js","./node_modules/rxjs/dist/esm/internal/util/pipe.js","./node_modules/rxjs/dist/esm/internal/util/reportUnhandledError.js","./node_modules/rxjs/dist/esm/internal/util/throwUnobservableError.js","./node_modules/@angular/common/fesm2022/common.mjs","./node_modules/@angular/common/fesm2022/http.mjs","./node_modules/rxjs/dist/esm/internal/operators/share.js","./node_modules/@angular/core/fesm2022/core.mjs","./node_modules/rxjs/dist/esm/internal/observable/merge.js","./node_modules/@angular/platform-browser/fesm2022/platform-browser.mjs","./node_modules/rxjs/dist/esm/internal/util/EmptyError.js","./node_modules/rxjs/dist/esm/internal/observable/concat.js","./node_modules/rxjs/dist/esm/internal/operators/concatAll.js","./node_modules/rxjs/dist/esm/internal/observable/defer.js","./node_modules/rxjs/dist/esm/internal/operators/refCount.js","./node_modules/rxjs/dist/esm/internal/observable/ConnectableObservable.js","./node_modules/rxjs/dist/esm/internal/operators/take.js","./node_modules/rxjs/dist/esm/internal/operators/defaultIfEmpty.js","./node_modules/rxjs/dist/esm/internal/operators/throwIfEmpty.js","./node_modules/rxjs/dist/esm/internal/operators/first.js","./node_modules/rxjs/dist/esm/internal/operators/takeLast.js","./node_modules/@angular/router/fesm2022/router.mjs","./node_modules/rxjs/dist/esm/internal/util/isObservable.js","./node_modules/rxjs/dist/esm/internal/operators/startWith.js","./node_modules/rxjs/dist/esm/internal/operators/scan.js","./node_modules/rxjs/dist/esm/internal/operators/scanInternals.js","./node_modules/rxjs/dist/esm/internal/operators/last.js","./node_modules/rxjs/dist/esm/internal/operators/mapTo.js","./node_modules/rxjs/dist/esm/internal/operators/takeUntil.js","./node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js","./node_modules/tslib/tslib.es6.mjs"],"sourcesContent":["import { Component, Input } from '@angular/core';\r\nimport { ExternalLinksInfo } from './external-links.module';\r\n\r\n@Component({\r\n selector: 'app-external-links',\r\n templateUrl: './external-links.component.html',\r\n styleUrls: ['./external-links.component.css']\r\n})\r\nexport class ExternalLinksComponent {\r\n\r\n @Input() ExternalLinksInfo: ExternalLinksInfo = {\r\n gridList: false,\r\n }\r\n\r\n}\r\n","
\r\n \r\n \r\n \"Міністерство\r\n \r\n \r\n \"Державне\r\n \r\n \r\n \"Global\r\n \r\n \r\n \"United\r\n \r\n \r\n \"Всеукраїнська\r\n \r\n
\r\n","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { ExternalLinksComponent } from './external-links.component';\r\n\r\n\r\n@NgModule({\r\n declarations: [ExternalLinksComponent],\r\n imports: [\r\n CommonModule\r\n ],\r\n exports: [ExternalLinksComponent]\r\n})\r\nexport class ExternalLinksModule { }\r\nexport interface ExternalLinksInfo {\r\n gridList: boolean;\r\n}\r\n","import { Component, Input } from '@angular/core';\r\nimport { LogoInfo } from './logo.module';\r\n\r\n@Component({\r\n selector: 'app-logo',\r\n templateUrl: './logo.component.html',\r\n styleUrls: ['./logo.component.css']\r\n})\r\nexport class LogoComponent {\r\n\r\n @Input() LogoInfo: LogoInfo = {\r\n logoMin: false,\r\n }\r\n\r\n}\r\n","\r\n \"Геоінформаційний\r\n \r\n Чорнобильський
радіаційно-екологічний
біосферний заповідник\r\n
\r\n
","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { LogoComponent } from './logo.component';\r\n\r\n\r\n@NgModule({\r\n declarations: [\r\n LogoComponent\r\n ],\r\n imports: [\r\n CommonModule\r\n ],\r\n exports: [LogoComponent]\r\n})\r\nexport class LogoModule { }\r\nexport interface LogoInfo {\r\n logoMin: boolean;\r\n}\r\n","import { Injectable } from '@angular/core';\r\nimport { environment } from '../../environments/environment';\r\n\r\n@Injectable({\r\n providedIn: 'root'\r\n})\r\nexport class ConfigService {\r\n\r\n private APIUrl = environment.apiUrl;\r\n private azureStorageSASUrl = environment.azureStorageSASUrl;\r\n private azureStorageCatalog = environment.azureStorageCatalog;\r\n private _gisAPIUrl = environment.gisApiUrl;\r\n private _apyKey = environment.apiKey;\r\n private _WorldStreetThumbnailMapUrl = '../../../assets/images/world_street_map.jpg';\r\n /// \r\n private _arcgisServerUrl = environment.arcgisServerUrl;\r\n\r\n constructor() { }\r\n\r\n public getAPIUrl() {\r\n return this.APIUrl;\r\n }\r\n\r\n get AzureStorageSASUrl() {\r\n return this.azureStorageSASUrl;\r\n }\r\n\r\n get AzureStorageCatalog() {\r\n return this.azureStorageCatalog;\r\n }\r\n\r\n get gisAPIUrl() {\r\n return this._gisAPIUrl;\r\n }\r\n\r\n get arcgisServerUrl() {\r\n return this._arcgisServerUrl;\r\n }\r\n\r\n get WorldStreetThumbnailMapUrl() {\r\n return this._WorldStreetThumbnailMapUrl;\r\n }\r\n\r\n get ApiKey() {\r\n return this._apyKey;\r\n }\r\n}\r\n","export const environment = {\r\n production: true,\r\n apiUrl: 'https://api.geo-portal.org.ua/api/',\r\n azureStorageSASUrl: 'https://ecogisstorage.blob.core.windows.net/?',\r\n azureStorageCatalog: 'ecogis-prod',\r\n apiKey: 'J-ehUzzJYm3OwLWMu5kpVHzc81jEKv8TBOUxlthl2vs',\r\n sentryEnable: true,\r\n arcgisServerUrl: 'https://gisserver.webgis.ua/gis/rest/services/',\r\n gisApiUrl: 'https://newapi.webgis.ua/'\r\n};\r\n","/** Internal global with common properties and Sentry extensions */\n\n// The code below for 'isGlobalObj' and 'GLOBAL_OBJ' was copied from core-js before modification\n// https://github.com/zloirock/core-js/blob/1b944df55282cdc99c90db5f49eb0b6eda2cc0a3/packages/core-js/internals/global.js\n// core-js has the following licence:\n//\n// Copyright (c) 2014-2022 Denis Pushkarev\n//\n// Permission is hereby granted, free of charge, to any person obtaining a copy\n// of this software and associated documentation files (the \"Software\"), to deal\n// in the Software without restriction, including without limitation the rights\n// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n// copies of the Software, and to permit persons to whom the Software is\n// furnished to do so, subject to the following conditions:\n//\n// The above copyright notice and this permission notice shall be included in\n// all copies or substantial portions of the Software.\n//\n// THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\n// THE SOFTWARE.\n\n/** Returns 'obj' if it's the global object, otherwise returns undefined */\nfunction isGlobalObj(obj) {\n return obj && obj.Math == Math ? obj : undefined;\n}\n\n/** Get's the global object for the current JavaScript runtime */\nconst GLOBAL_OBJ =\n (typeof globalThis == 'object' && isGlobalObj(globalThis)) ||\n // eslint-disable-next-line no-restricted-globals\n (typeof window == 'object' && isGlobalObj(window)) ||\n (typeof self == 'object' && isGlobalObj(self)) ||\n (typeof global == 'object' && isGlobalObj(global)) ||\n (function () {\n return this;\n })() ||\n {};\n\n/**\n * @deprecated Use GLOBAL_OBJ instead or WINDOW from @sentry/browser. This will be removed in v8\n */\nfunction getGlobalObject() {\n return GLOBAL_OBJ ;\n}\n\n/**\n * Returns a global singleton contained in the global `__SENTRY__` object.\n *\n * If the singleton doesn't already exist in `__SENTRY__`, it will be created using the given factory\n * function and added to the `__SENTRY__` object.\n *\n * @param name name of the global singleton on __SENTRY__\n * @param creator creator Factory function to create the singleton if it doesn't already exist on `__SENTRY__`\n * @param obj (Optional) The global object on which to look for `__SENTRY__`, if not `GLOBAL_OBJ`'s return value\n * @returns the singleton\n */\nfunction getGlobalSingleton(name, creator, obj) {\n const gbl = (obj || GLOBAL_OBJ) ;\n const __SENTRY__ = (gbl.__SENTRY__ = gbl.__SENTRY__ || {});\n const singleton = __SENTRY__[name] || (__SENTRY__[name] = creator());\n return singleton;\n}\n\nexport { GLOBAL_OBJ, getGlobalObject, getGlobalSingleton };\n","const DEFAULT_ENVIRONMENT = 'production';\n\nexport { DEFAULT_ENVIRONMENT };\n","// eslint-disable-next-line @typescript-eslint/unbound-method\nconst objectToString = Object.prototype.toString;\n\n/**\n * Checks whether given value's type is one of a few Error or Error-like\n * {@link isError}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isError(wat) {\n switch (objectToString.call(wat)) {\n case '[object Error]':\n case '[object Exception]':\n case '[object DOMException]':\n return true;\n default:\n return isInstanceOf(wat, Error);\n }\n}\n/**\n * Checks whether given value is an instance of the given built-in class.\n *\n * @param wat The value to be checked\n * @param className\n * @returns A boolean representing the result.\n */\nfunction isBuiltin(wat, className) {\n return objectToString.call(wat) === `[object ${className}]`;\n}\n\n/**\n * Checks whether given value's type is ErrorEvent\n * {@link isErrorEvent}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isErrorEvent(wat) {\n return isBuiltin(wat, 'ErrorEvent');\n}\n\n/**\n * Checks whether given value's type is DOMError\n * {@link isDOMError}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isDOMError(wat) {\n return isBuiltin(wat, 'DOMError');\n}\n\n/**\n * Checks whether given value's type is DOMException\n * {@link isDOMException}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isDOMException(wat) {\n return isBuiltin(wat, 'DOMException');\n}\n\n/**\n * Checks whether given value's type is a string\n * {@link isString}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isString(wat) {\n return isBuiltin(wat, 'String');\n}\n\n/**\n * Checks whether given string is parameterized\n * {@link isParameterizedString}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isParameterizedString(wat) {\n return (\n typeof wat === 'object' &&\n wat !== null &&\n '__sentry_template_string__' in wat &&\n '__sentry_template_values__' in wat\n );\n}\n\n/**\n * Checks whether given value is a primitive (undefined, null, number, boolean, string, bigint, symbol)\n * {@link isPrimitive}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isPrimitive(wat) {\n return wat === null || isParameterizedString(wat) || (typeof wat !== 'object' && typeof wat !== 'function');\n}\n\n/**\n * Checks whether given value's type is an object literal, or a class instance.\n * {@link isPlainObject}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isPlainObject(wat) {\n return isBuiltin(wat, 'Object');\n}\n\n/**\n * Checks whether given value's type is an Event instance\n * {@link isEvent}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isEvent(wat) {\n return typeof Event !== 'undefined' && isInstanceOf(wat, Event);\n}\n\n/**\n * Checks whether given value's type is an Element instance\n * {@link isElement}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isElement(wat) {\n return typeof Element !== 'undefined' && isInstanceOf(wat, Element);\n}\n\n/**\n * Checks whether given value's type is an regexp\n * {@link isRegExp}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isRegExp(wat) {\n return isBuiltin(wat, 'RegExp');\n}\n\n/**\n * Checks whether given value has a then function.\n * @param wat A value to be checked.\n */\nfunction isThenable(wat) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return Boolean(wat && wat.then && typeof wat.then === 'function');\n}\n\n/**\n * Checks whether given value's type is a SyntheticEvent\n * {@link isSyntheticEvent}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isSyntheticEvent(wat) {\n return isPlainObject(wat) && 'nativeEvent' in wat && 'preventDefault' in wat && 'stopPropagation' in wat;\n}\n\n/**\n * Checks whether given value is NaN\n * {@link isNaN}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isNaN(wat) {\n return typeof wat === 'number' && wat !== wat;\n}\n\n/**\n * Checks whether given value's type is an instance of provided constructor.\n * {@link isInstanceOf}.\n *\n * @param wat A value to be checked.\n * @param base A constructor to be used in a check.\n * @returns A boolean representing the result.\n */\nfunction isInstanceOf(wat, base) {\n try {\n return wat instanceof base;\n } catch (_e) {\n return false;\n }\n}\n\n/**\n * Checks whether given value's type is a Vue ViewModel.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isVueViewModel(wat) {\n // Not using Object.prototype.toString because in Vue 3 it would read the instance's Symbol(Symbol.toStringTag) property.\n return !!(typeof wat === 'object' && wat !== null && ((wat ).__isVue || (wat )._isVue));\n}\n\nexport { isDOMError, isDOMException, isElement, isError, isErrorEvent, isEvent, isInstanceOf, isNaN, isParameterizedString, isPlainObject, isPrimitive, isRegExp, isString, isSyntheticEvent, isThenable, isVueViewModel };\n","import { isString } from './is.js';\nimport { getGlobalObject } from './worldwide.js';\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\nconst DEFAULT_MAX_STRING_LENGTH = 80;\n\n/**\n * Given a child DOM element, returns a query-selector statement describing that\n * and its ancestors\n * e.g. [HTMLElement] => body > div > input#foo.btn[name=baz]\n * @returns generated DOM path\n */\nfunction htmlTreeAsString(\n elem,\n options = {},\n) {\n if (!elem) {\n return '';\n }\n\n // try/catch both:\n // - accessing event.target (see getsentry/raven-js#838, #768)\n // - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly\n // - can throw an exception in some circumstances.\n try {\n let currentElem = elem ;\n const MAX_TRAVERSE_HEIGHT = 5;\n const out = [];\n let height = 0;\n let len = 0;\n const separator = ' > ';\n const sepLength = separator.length;\n let nextStr;\n const keyAttrs = Array.isArray(options) ? options : options.keyAttrs;\n const maxStringLength = (!Array.isArray(options) && options.maxStringLength) || DEFAULT_MAX_STRING_LENGTH;\n\n while (currentElem && height++ < MAX_TRAVERSE_HEIGHT) {\n nextStr = _htmlElementAsString(currentElem, keyAttrs);\n // bail out if\n // - nextStr is the 'html' element\n // - the length of the string that would be created exceeds maxStringLength\n // (ignore this limit if we are on the first iteration)\n if (nextStr === 'html' || (height > 1 && len + out.length * sepLength + nextStr.length >= maxStringLength)) {\n break;\n }\n\n out.push(nextStr);\n\n len += nextStr.length;\n currentElem = currentElem.parentNode;\n }\n\n return out.reverse().join(separator);\n } catch (_oO) {\n return '';\n }\n}\n\n/**\n * Returns a simple, query-selector representation of a DOM element\n * e.g. [HTMLElement] => input#foo.btn[name=baz]\n * @returns generated DOM path\n */\nfunction _htmlElementAsString(el, keyAttrs) {\n const elem = el\n\n;\n\n const out = [];\n let className;\n let classes;\n let key;\n let attr;\n let i;\n\n if (!elem || !elem.tagName) {\n return '';\n }\n\n // @ts-expect-error WINDOW has HTMLElement\n if (WINDOW.HTMLElement) {\n // If using the component name annotation plugin, this value may be available on the DOM node\n if (elem instanceof HTMLElement && elem.dataset && elem.dataset['sentryComponent']) {\n return elem.dataset['sentryComponent'];\n }\n }\n\n out.push(elem.tagName.toLowerCase());\n\n // Pairs of attribute keys defined in `serializeAttribute` and their values on element.\n const keyAttrPairs =\n keyAttrs && keyAttrs.length\n ? keyAttrs.filter(keyAttr => elem.getAttribute(keyAttr)).map(keyAttr => [keyAttr, elem.getAttribute(keyAttr)])\n : null;\n\n if (keyAttrPairs && keyAttrPairs.length) {\n keyAttrPairs.forEach(keyAttrPair => {\n out.push(`[${keyAttrPair[0]}=\"${keyAttrPair[1]}\"]`);\n });\n } else {\n if (elem.id) {\n out.push(`#${elem.id}`);\n }\n\n // eslint-disable-next-line prefer-const\n className = elem.className;\n if (className && isString(className)) {\n classes = className.split(/\\s+/);\n for (i = 0; i < classes.length; i++) {\n out.push(`.${classes[i]}`);\n }\n }\n }\n const allowedAttrs = ['aria-label', 'type', 'name', 'title', 'alt'];\n for (i = 0; i < allowedAttrs.length; i++) {\n key = allowedAttrs[i];\n attr = elem.getAttribute(key);\n if (attr) {\n out.push(`[${key}=\"${attr}\"]`);\n }\n }\n return out.join('');\n}\n\n/**\n * A safe form of location.href\n */\nfunction getLocationHref() {\n try {\n return WINDOW.document.location.href;\n } catch (oO) {\n return '';\n }\n}\n\n/**\n * Gets a DOM element by using document.querySelector.\n *\n * This wrapper will first check for the existance of the function before\n * actually calling it so that we don't have to take care of this check,\n * every time we want to access the DOM.\n *\n * Reason: DOM/querySelector is not available in all environments.\n *\n * We have to cast to any because utils can be consumed by a variety of environments,\n * and we don't want to break TS users. If you know what element will be selected by\n * `document.querySelector`, specify it as part of the generic call. For example,\n * `const element = getDomElement('selector');`\n *\n * @param selector the selector string passed on to document.querySelector\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction getDomElement(selector) {\n if (WINDOW.document && WINDOW.document.querySelector) {\n return WINDOW.document.querySelector(selector) ;\n }\n return null;\n}\n\n/**\n * Given a DOM element, traverses up the tree until it finds the first ancestor node\n * that has the `data-sentry-component` attribute. This attribute is added at build-time\n * by projects that have the component name annotation plugin installed.\n *\n * @returns a string representation of the component for the provided DOM element, or `null` if not found\n */\nfunction getComponentName(elem) {\n // @ts-expect-error WINDOW has HTMLElement\n if (!WINDOW.HTMLElement) {\n return null;\n }\n\n let currentElem = elem ;\n const MAX_TRAVERSE_HEIGHT = 5;\n for (let i = 0; i < MAX_TRAVERSE_HEIGHT; i++) {\n if (!currentElem) {\n return null;\n }\n\n if (currentElem instanceof HTMLElement && currentElem.dataset['sentryComponent']) {\n return currentElem.dataset['sentryComponent'];\n }\n\n currentElem = currentElem.parentNode;\n }\n\n return null;\n}\n\nexport { getComponentName, getDomElement, getLocationHref, htmlTreeAsString };\n","/**\n * This serves as a build time flag that will be true by default, but false in non-debug builds or if users replace `__SENTRY_DEBUG__` in their generated code.\n *\n * ATTENTION: This constant must never cross package boundaries (i.e. be exported) to guarantee that it can be used for tree shaking.\n */\nconst DEBUG_BUILD = (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__);\n\nexport { DEBUG_BUILD };\n","import { DEBUG_BUILD } from './debug-build.js';\nimport { GLOBAL_OBJ } from './worldwide.js';\n\n/** Prefix for logging strings */\nconst PREFIX = 'Sentry Logger ';\n\nconst CONSOLE_LEVELS = [\n 'debug',\n 'info',\n 'warn',\n 'error',\n 'log',\n 'assert',\n 'trace',\n] ;\n\n/** This may be mutated by the console instrumentation. */\nconst originalConsoleMethods\n\n = {};\n\n/** JSDoc */\n\n/**\n * Temporarily disable sentry console instrumentations.\n *\n * @param callback The function to run against the original `console` messages\n * @returns The results of the callback\n */\nfunction consoleSandbox(callback) {\n if (!('console' in GLOBAL_OBJ)) {\n return callback();\n }\n\n const console = GLOBAL_OBJ.console ;\n const wrappedFuncs = {};\n\n const wrappedLevels = Object.keys(originalConsoleMethods) ;\n\n // Restore all wrapped console methods\n wrappedLevels.forEach(level => {\n const originalConsoleMethod = originalConsoleMethods[level] ;\n wrappedFuncs[level] = console[level] ;\n console[level] = originalConsoleMethod;\n });\n\n try {\n return callback();\n } finally {\n // Revert restoration to wrapped state\n wrappedLevels.forEach(level => {\n console[level] = wrappedFuncs[level] ;\n });\n }\n}\n\nfunction makeLogger() {\n let enabled = false;\n const logger = {\n enable: () => {\n enabled = true;\n },\n disable: () => {\n enabled = false;\n },\n isEnabled: () => enabled,\n };\n\n if (DEBUG_BUILD) {\n CONSOLE_LEVELS.forEach(name => {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n logger[name] = (...args) => {\n if (enabled) {\n consoleSandbox(() => {\n GLOBAL_OBJ.console[name](`${PREFIX}[${name}]:`, ...args);\n });\n }\n };\n });\n } else {\n CONSOLE_LEVELS.forEach(name => {\n logger[name] = () => undefined;\n });\n }\n\n return logger ;\n}\n\nconst logger = makeLogger();\n\nexport { CONSOLE_LEVELS, consoleSandbox, logger, originalConsoleMethods };\n","import { isVueViewModel, isString, isRegExp } from './is.js';\n\n/**\n * Truncates given string to the maximum characters count\n *\n * @param str An object that contains serializable values\n * @param max Maximum number of characters in truncated string (0 = unlimited)\n * @returns string Encoded\n */\nfunction truncate(str, max = 0) {\n if (typeof str !== 'string' || max === 0) {\n return str;\n }\n return str.length <= max ? str : `${str.slice(0, max)}...`;\n}\n\n/**\n * This is basically just `trim_line` from\n * https://github.com/getsentry/sentry/blob/master/src/sentry/lang/javascript/processor.py#L67\n *\n * @param str An object that contains serializable values\n * @param max Maximum number of characters in truncated string\n * @returns string Encoded\n */\nfunction snipLine(line, colno) {\n let newLine = line;\n const lineLength = newLine.length;\n if (lineLength <= 150) {\n return newLine;\n }\n if (colno > lineLength) {\n // eslint-disable-next-line no-param-reassign\n colno = lineLength;\n }\n\n let start = Math.max(colno - 60, 0);\n if (start < 5) {\n start = 0;\n }\n\n let end = Math.min(start + 140, lineLength);\n if (end > lineLength - 5) {\n end = lineLength;\n }\n if (end === lineLength) {\n start = Math.max(end - 140, 0);\n }\n\n newLine = newLine.slice(start, end);\n if (start > 0) {\n newLine = `'{snip} ${newLine}`;\n }\n if (end < lineLength) {\n newLine += ' {snip}';\n }\n\n return newLine;\n}\n\n/**\n * Join values in array\n * @param input array of values to be joined together\n * @param delimiter string to be placed in-between values\n * @returns Joined values\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction safeJoin(input, delimiter) {\n if (!Array.isArray(input)) {\n return '';\n }\n\n const output = [];\n // eslint-disable-next-line @typescript-eslint/prefer-for-of\n for (let i = 0; i < input.length; i++) {\n const value = input[i];\n try {\n // This is a hack to fix a Vue3-specific bug that causes an infinite loop of\n // console warnings. This happens when a Vue template is rendered with\n // an undeclared variable, which we try to stringify, ultimately causing\n // Vue to issue another warning which repeats indefinitely.\n // see: https://github.com/getsentry/sentry-javascript/pull/8981\n if (isVueViewModel(value)) {\n output.push('[VueViewModel]');\n } else {\n output.push(String(value));\n }\n } catch (e) {\n output.push('[value cannot be serialized]');\n }\n }\n\n return output.join(delimiter);\n}\n\n/**\n * Checks if the given value matches a regex or string\n *\n * @param value The string to test\n * @param pattern Either a regex or a string against which `value` will be matched\n * @param requireExactStringMatch If true, `value` must match `pattern` exactly. If false, `value` will match\n * `pattern` if it contains `pattern`. Only applies to string-type patterns.\n */\nfunction isMatchingPattern(\n value,\n pattern,\n requireExactStringMatch = false,\n) {\n if (!isString(value)) {\n return false;\n }\n\n if (isRegExp(pattern)) {\n return pattern.test(value);\n }\n if (isString(pattern)) {\n return requireExactStringMatch ? value === pattern : value.includes(pattern);\n }\n\n return false;\n}\n\n/**\n * Test the given string against an array of strings and regexes. By default, string matching is done on a\n * substring-inclusion basis rather than a strict equality basis\n *\n * @param testString The string to test\n * @param patterns The patterns against which to test the string\n * @param requireExactStringMatch If true, `testString` must match one of the given string patterns exactly in order to\n * count. If false, `testString` will match a string pattern if it contains that pattern.\n * @returns\n */\nfunction stringMatchesSomePattern(\n testString,\n patterns = [],\n requireExactStringMatch = false,\n) {\n return patterns.some(pattern => isMatchingPattern(testString, pattern, requireExactStringMatch));\n}\n\nexport { isMatchingPattern, safeJoin, snipLine, stringMatchesSomePattern, truncate };\n","import { htmlTreeAsString } from './browser.js';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { isError, isEvent, isInstanceOf, isElement, isPlainObject, isPrimitive } from './is.js';\nimport { logger } from './logger.js';\nimport { truncate } from './string.js';\n\n/**\n * Replace a method in an object with a wrapped version of itself.\n *\n * @param source An object that contains a method to be wrapped.\n * @param name The name of the method to be wrapped.\n * @param replacementFactory A higher-order function that takes the original version of the given method and returns a\n * wrapped version. Note: The function returned by `replacementFactory` needs to be a non-arrow function, in order to\n * preserve the correct value of `this`, and the original method must be called using `origMethod.call(this, )` or `origMethod.apply(this, [])` (rather than being called directly), again to preserve `this`.\n * @returns void\n */\nfunction fill(source, name, replacementFactory) {\n if (!(name in source)) {\n return;\n }\n\n const original = source[name] ;\n const wrapped = replacementFactory(original) ;\n\n // Make sure it's a function first, as we need to attach an empty prototype for `defineProperties` to work\n // otherwise it'll throw \"TypeError: Object.defineProperties called on non-object\"\n if (typeof wrapped === 'function') {\n markFunctionWrapped(wrapped, original);\n }\n\n source[name] = wrapped;\n}\n\n/**\n * Defines a non-enumerable property on the given object.\n *\n * @param obj The object on which to set the property\n * @param name The name of the property to be set\n * @param value The value to which to set the property\n */\nfunction addNonEnumerableProperty(obj, name, value) {\n try {\n Object.defineProperty(obj, name, {\n // enumerable: false, // the default, so we can save on bundle size by not explicitly setting it\n value: value,\n writable: true,\n configurable: true,\n });\n } catch (o_O) {\n DEBUG_BUILD && logger.log(`Failed to add non-enumerable property \"${name}\" to object`, obj);\n }\n}\n\n/**\n * Remembers the original function on the wrapped function and\n * patches up the prototype.\n *\n * @param wrapped the wrapper function\n * @param original the original function that gets wrapped\n */\nfunction markFunctionWrapped(wrapped, original) {\n try {\n const proto = original.prototype || {};\n wrapped.prototype = original.prototype = proto;\n addNonEnumerableProperty(wrapped, '__sentry_original__', original);\n } catch (o_O) {} // eslint-disable-line no-empty\n}\n\n/**\n * This extracts the original function if available. See\n * `markFunctionWrapped` for more information.\n *\n * @param func the function to unwrap\n * @returns the unwrapped version of the function if available.\n */\nfunction getOriginalFunction(func) {\n return func.__sentry_original__;\n}\n\n/**\n * Encodes given object into url-friendly format\n *\n * @param object An object that contains serializable values\n * @returns string Encoded\n */\nfunction urlEncode(object) {\n return Object.keys(object)\n .map(key => `${encodeURIComponent(key)}=${encodeURIComponent(object[key])}`)\n .join('&');\n}\n\n/**\n * Transforms any `Error` or `Event` into a plain object with all of their enumerable properties, and some of their\n * non-enumerable properties attached.\n *\n * @param value Initial source that we have to transform in order for it to be usable by the serializer\n * @returns An Event or Error turned into an object - or the value argurment itself, when value is neither an Event nor\n * an Error.\n */\nfunction convertToPlainObject(\n value,\n)\n\n {\n if (isError(value)) {\n return {\n message: value.message,\n name: value.name,\n stack: value.stack,\n ...getOwnProperties(value),\n };\n } else if (isEvent(value)) {\n const newObj\n\n = {\n type: value.type,\n target: serializeEventTarget(value.target),\n currentTarget: serializeEventTarget(value.currentTarget),\n ...getOwnProperties(value),\n };\n\n if (typeof CustomEvent !== 'undefined' && isInstanceOf(value, CustomEvent)) {\n newObj.detail = value.detail;\n }\n\n return newObj;\n } else {\n return value;\n }\n}\n\n/** Creates a string representation of the target of an `Event` object */\nfunction serializeEventTarget(target) {\n try {\n return isElement(target) ? htmlTreeAsString(target) : Object.prototype.toString.call(target);\n } catch (_oO) {\n return '';\n }\n}\n\n/** Filters out all but an object's own properties */\nfunction getOwnProperties(obj) {\n if (typeof obj === 'object' && obj !== null) {\n const extractedProps = {};\n for (const property in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, property)) {\n extractedProps[property] = (obj )[property];\n }\n }\n return extractedProps;\n } else {\n return {};\n }\n}\n\n/**\n * Given any captured exception, extract its keys and create a sorted\n * and truncated list that will be used inside the event message.\n * eg. `Non-error exception captured with keys: foo, bar, baz`\n */\nfunction extractExceptionKeysForMessage(exception, maxLength = 40) {\n const keys = Object.keys(convertToPlainObject(exception));\n keys.sort();\n\n if (!keys.length) {\n return '[object has no keys]';\n }\n\n if (keys[0].length >= maxLength) {\n return truncate(keys[0], maxLength);\n }\n\n for (let includedKeys = keys.length; includedKeys > 0; includedKeys--) {\n const serialized = keys.slice(0, includedKeys).join(', ');\n if (serialized.length > maxLength) {\n continue;\n }\n if (includedKeys === keys.length) {\n return serialized;\n }\n return truncate(serialized, maxLength);\n }\n\n return '';\n}\n\n/**\n * Given any object, return a new object having removed all fields whose value was `undefined`.\n * Works recursively on objects and arrays.\n *\n * Attention: This function keeps circular references in the returned object.\n */\nfunction dropUndefinedKeys(inputValue) {\n // This map keeps track of what already visited nodes map to.\n // Our Set - based memoBuilder doesn't work here because we want to the output object to have the same circular\n // references as the input object.\n const memoizationMap = new Map();\n\n // This function just proxies `_dropUndefinedKeys` to keep the `memoBuilder` out of this function's API\n return _dropUndefinedKeys(inputValue, memoizationMap);\n}\n\nfunction _dropUndefinedKeys(inputValue, memoizationMap) {\n if (isPojo(inputValue)) {\n // If this node has already been visited due to a circular reference, return the object it was mapped to in the new object\n const memoVal = memoizationMap.get(inputValue);\n if (memoVal !== undefined) {\n return memoVal ;\n }\n\n const returnValue = {};\n // Store the mapping of this value in case we visit it again, in case of circular data\n memoizationMap.set(inputValue, returnValue);\n\n for (const key of Object.keys(inputValue)) {\n if (typeof inputValue[key] !== 'undefined') {\n returnValue[key] = _dropUndefinedKeys(inputValue[key], memoizationMap);\n }\n }\n\n return returnValue ;\n }\n\n if (Array.isArray(inputValue)) {\n // If this node has already been visited due to a circular reference, return the array it was mapped to in the new object\n const memoVal = memoizationMap.get(inputValue);\n if (memoVal !== undefined) {\n return memoVal ;\n }\n\n const returnValue = [];\n // Store the mapping of this value in case we visit it again, in case of circular data\n memoizationMap.set(inputValue, returnValue);\n\n inputValue.forEach((item) => {\n returnValue.push(_dropUndefinedKeys(item, memoizationMap));\n });\n\n return returnValue ;\n }\n\n return inputValue;\n}\n\nfunction isPojo(input) {\n if (!isPlainObject(input)) {\n return false;\n }\n\n try {\n const name = (Object.getPrototypeOf(input) ).constructor.name;\n return !name || name === 'Object';\n } catch (e) {\n return true;\n }\n}\n\n/**\n * Ensure that something is an object.\n *\n * Turns `undefined` and `null` into `String`s and all other primitives into instances of their respective wrapper\n * classes (String, Boolean, Number, etc.). Acts as the identity function on non-primitives.\n *\n * @param wat The subject of the objectification\n * @returns A version of `wat` which can safely be used with `Object` class methods\n */\nfunction objectify(wat) {\n let objectified;\n switch (true) {\n case wat === undefined || wat === null:\n objectified = new String(wat);\n break;\n\n // Though symbols and bigints do have wrapper classes (`Symbol` and `BigInt`, respectively), for whatever reason\n // those classes don't have constructors which can be used with the `new` keyword. We therefore need to cast each as\n // an object in order to wrap it.\n case typeof wat === 'symbol' || typeof wat === 'bigint':\n objectified = Object(wat);\n break;\n\n // this will catch the remaining primitives: `String`, `Number`, and `Boolean`\n case isPrimitive(wat):\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n objectified = new (wat ).constructor(wat);\n break;\n\n // by process of elimination, at this point we know that `wat` must already be an object\n default:\n objectified = wat;\n break;\n }\n return objectified;\n}\n\nexport { addNonEnumerableProperty, convertToPlainObject, dropUndefinedKeys, extractExceptionKeysForMessage, fill, getOriginalFunction, markFunctionWrapped, objectify, urlEncode };\n","import { addNonEnumerableProperty } from './object.js';\nimport { snipLine } from './string.js';\nimport { GLOBAL_OBJ } from './worldwide.js';\n\n/**\n * UUID4 generator\n *\n * @returns string Generated UUID4.\n */\nfunction uuid4() {\n const gbl = GLOBAL_OBJ ;\n const crypto = gbl.crypto || gbl.msCrypto;\n\n let getRandomByte = () => Math.random() * 16;\n try {\n if (crypto && crypto.randomUUID) {\n return crypto.randomUUID().replace(/-/g, '');\n }\n if (crypto && crypto.getRandomValues) {\n getRandomByte = () => {\n // crypto.getRandomValues might return undefined instead of the typed array\n // in old Chromium versions (e.g. 23.0.1235.0 (151422))\n // However, `typedArray` is still filled in-place.\n // @see https://developer.mozilla.org/en-US/docs/Web/API/Crypto/getRandomValues#typedarray\n const typedArray = new Uint8Array(1);\n crypto.getRandomValues(typedArray);\n return typedArray[0];\n };\n }\n } catch (_) {\n // some runtimes can crash invoking crypto\n // https://github.com/getsentry/sentry-javascript/issues/8935\n }\n\n // http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523\n // Concatenating the following numbers as strings results in '10000000100040008000100000000000'\n return (([1e7] ) + 1e3 + 4e3 + 8e3 + 1e11).replace(/[018]/g, c =>\n // eslint-disable-next-line no-bitwise\n ((c ) ^ ((getRandomByte() & 15) >> ((c ) / 4))).toString(16),\n );\n}\n\nfunction getFirstException(event) {\n return event.exception && event.exception.values ? event.exception.values[0] : undefined;\n}\n\n/**\n * Extracts either message or type+value from an event that can be used for user-facing logs\n * @returns event's description\n */\nfunction getEventDescription(event) {\n const { message, event_id: eventId } = event;\n if (message) {\n return message;\n }\n\n const firstException = getFirstException(event);\n if (firstException) {\n if (firstException.type && firstException.value) {\n return `${firstException.type}: ${firstException.value}`;\n }\n return firstException.type || firstException.value || eventId || '';\n }\n return eventId || '';\n}\n\n/**\n * Adds exception values, type and value to an synthetic Exception.\n * @param event The event to modify.\n * @param value Value of the exception.\n * @param type Type of the exception.\n * @hidden\n */\nfunction addExceptionTypeValue(event, value, type) {\n const exception = (event.exception = event.exception || {});\n const values = (exception.values = exception.values || []);\n const firstException = (values[0] = values[0] || {});\n if (!firstException.value) {\n firstException.value = value || '';\n }\n if (!firstException.type) {\n firstException.type = type || 'Error';\n }\n}\n\n/**\n * Adds exception mechanism data to a given event. Uses defaults if the second parameter is not passed.\n *\n * @param event The event to modify.\n * @param newMechanism Mechanism data to add to the event.\n * @hidden\n */\nfunction addExceptionMechanism(event, newMechanism) {\n const firstException = getFirstException(event);\n if (!firstException) {\n return;\n }\n\n const defaultMechanism = { type: 'generic', handled: true };\n const currentMechanism = firstException.mechanism;\n firstException.mechanism = { ...defaultMechanism, ...currentMechanism, ...newMechanism };\n\n if (newMechanism && 'data' in newMechanism) {\n const mergedData = { ...(currentMechanism && currentMechanism.data), ...newMechanism.data };\n firstException.mechanism.data = mergedData;\n }\n}\n\n// https://semver.org/#is-there-a-suggested-regular-expression-regex-to-check-a-semver-string\nconst SEMVER_REGEXP =\n /^(0|[1-9]\\d*)\\.(0|[1-9]\\d*)\\.(0|[1-9]\\d*)(?:-((?:0|[1-9]\\d*|\\d*[a-zA-Z-][0-9a-zA-Z-]*)(?:\\.(?:0|[1-9]\\d*|\\d*[a-zA-Z-][0-9a-zA-Z-]*))*))?(?:\\+([0-9a-zA-Z-]+(?:\\.[0-9a-zA-Z-]+)*))?$/;\n\n/**\n * Represents Semantic Versioning object\n */\n\n/**\n * Parses input into a SemVer interface\n * @param input string representation of a semver version\n */\nfunction parseSemver(input) {\n const match = input.match(SEMVER_REGEXP) || [];\n const major = parseInt(match[1], 10);\n const minor = parseInt(match[2], 10);\n const patch = parseInt(match[3], 10);\n return {\n buildmetadata: match[5],\n major: isNaN(major) ? undefined : major,\n minor: isNaN(minor) ? undefined : minor,\n patch: isNaN(patch) ? undefined : patch,\n prerelease: match[4],\n };\n}\n\n/**\n * This function adds context (pre/post/line) lines to the provided frame\n *\n * @param lines string[] containing all lines\n * @param frame StackFrame that will be mutated\n * @param linesOfContext number of context lines we want to add pre/post\n */\nfunction addContextToFrame(lines, frame, linesOfContext = 5) {\n // When there is no line number in the frame, attaching context is nonsensical and will even break grouping\n if (frame.lineno === undefined) {\n return;\n }\n\n const maxLines = lines.length;\n const sourceLine = Math.max(Math.min(maxLines - 1, frame.lineno - 1), 0);\n\n frame.pre_context = lines\n .slice(Math.max(0, sourceLine - linesOfContext), sourceLine)\n .map((line) => snipLine(line, 0));\n\n frame.context_line = snipLine(lines[Math.min(maxLines - 1, sourceLine)], frame.colno || 0);\n\n frame.post_context = lines\n .slice(Math.min(sourceLine + 1, maxLines), sourceLine + 1 + linesOfContext)\n .map((line) => snipLine(line, 0));\n}\n\n/**\n * Checks whether or not we've already captured the given exception (note: not an identical exception - the very object\n * in question), and marks it captured if not.\n *\n * This is useful because it's possible for an error to get captured by more than one mechanism. After we intercept and\n * record an error, we rethrow it (assuming we've intercepted it before it's reached the top-level global handlers), so\n * that we don't interfere with whatever effects the error might have had were the SDK not there. At that point, because\n * the error has been rethrown, it's possible for it to bubble up to some other code we've instrumented. If it's not\n * caught after that, it will bubble all the way up to the global handlers (which of course we also instrument). This\n * function helps us ensure that even if we encounter the same error more than once, we only record it the first time we\n * see it.\n *\n * Note: It will ignore primitives (always return `false` and not mark them as seen), as properties can't be set on\n * them. {@link: Object.objectify} can be used on exceptions to convert any that are primitives into their equivalent\n * object wrapper forms so that this check will always work. However, because we need to flag the exact object which\n * will get rethrown, and because that rethrowing happens outside of the event processing pipeline, the objectification\n * must be done before the exception captured.\n *\n * @param A thrown exception to check or flag as having been seen\n * @returns `true` if the exception has already been captured, `false` if not (with the side effect of marking it seen)\n */\nfunction checkOrSetAlreadyCaught(exception) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n if (exception && (exception ).__sentry_captured__) {\n return true;\n }\n\n try {\n // set it this way rather than by assignment so that it's not ennumerable and therefore isn't recorded by the\n // `ExtraErrorData` integration\n addNonEnumerableProperty(exception , '__sentry_captured__', true);\n } catch (err) {\n // `exception` is a primitive, so we can't mark it seen\n }\n\n return false;\n}\n\n/**\n * Checks whether the given input is already an array, and if it isn't, wraps it in one.\n *\n * @param maybeArray Input to turn into an array, if necessary\n * @returns The input, if already an array, or an array with the input as the only element, if not\n */\nfunction arrayify(maybeArray) {\n return Array.isArray(maybeArray) ? maybeArray : [maybeArray];\n}\n\nexport { addContextToFrame, addExceptionMechanism, addExceptionTypeValue, arrayify, checkOrSetAlreadyCaught, getEventDescription, parseSemver, uuid4 };\n","import { GLOBAL_OBJ } from './worldwide.js';\n\nconst ONE_SECOND_IN_MS = 1000;\n\n/**\n * A partial definition of the [Performance Web API]{@link https://developer.mozilla.org/en-US/docs/Web/API/Performance}\n * for accessing a high-resolution monotonic clock.\n */\n\n/**\n * Returns a timestamp in seconds since the UNIX epoch using the Date API.\n *\n * TODO(v8): Return type should be rounded.\n */\nfunction dateTimestampInSeconds() {\n return Date.now() / ONE_SECOND_IN_MS;\n}\n\n/**\n * Returns a wrapper around the native Performance API browser implementation, or undefined for browsers that do not\n * support the API.\n *\n * Wrapping the native API works around differences in behavior from different browsers.\n */\nfunction createUnixTimestampInSecondsFunc() {\n const { performance } = GLOBAL_OBJ ;\n if (!performance || !performance.now) {\n return dateTimestampInSeconds;\n }\n\n // Some browser and environments don't have a timeOrigin, so we fallback to\n // using Date.now() to compute the starting time.\n const approxStartingTimeOrigin = Date.now() - performance.now();\n const timeOrigin = performance.timeOrigin == undefined ? approxStartingTimeOrigin : performance.timeOrigin;\n\n // performance.now() is a monotonic clock, which means it starts at 0 when the process begins. To get the current\n // wall clock time (actual UNIX timestamp), we need to add the starting time origin and the current time elapsed.\n //\n // TODO: This does not account for the case where the monotonic clock that powers performance.now() drifts from the\n // wall clock time, which causes the returned timestamp to be inaccurate. We should investigate how to detect and\n // correct for this.\n // See: https://github.com/getsentry/sentry-javascript/issues/2590\n // See: https://github.com/mdn/content/issues/4713\n // See: https://dev.to/noamr/when-a-millisecond-is-not-a-millisecond-3h6\n return () => {\n return (timeOrigin + performance.now()) / ONE_SECOND_IN_MS;\n };\n}\n\n/**\n * Returns a timestamp in seconds since the UNIX epoch using either the Performance or Date APIs, depending on the\n * availability of the Performance API.\n *\n * BUG: Note that because of how browsers implement the Performance API, the clock might stop when the computer is\n * asleep. This creates a skew between `dateTimestampInSeconds` and `timestampInSeconds`. The\n * skew can grow to arbitrary amounts like days, weeks or months.\n * See https://github.com/getsentry/sentry-javascript/issues/2590.\n */\nconst timestampInSeconds = createUnixTimestampInSecondsFunc();\n\n/**\n * Re-exported with an old name for backwards-compatibility.\n * TODO (v8): Remove this\n *\n * @deprecated Use `timestampInSeconds` instead.\n */\nconst timestampWithMs = timestampInSeconds;\n\n/**\n * Internal helper to store what is the source of browserPerformanceTimeOrigin below. For debugging only.\n */\nlet _browserPerformanceTimeOriginMode;\n\n/**\n * The number of milliseconds since the UNIX epoch. This value is only usable in a browser, and only when the\n * performance API is available.\n */\nconst browserPerformanceTimeOrigin = (() => {\n // Unfortunately browsers may report an inaccurate time origin data, through either performance.timeOrigin or\n // performance.timing.navigationStart, which results in poor results in performance data. We only treat time origin\n // data as reliable if they are within a reasonable threshold of the current time.\n\n const { performance } = GLOBAL_OBJ ;\n if (!performance || !performance.now) {\n _browserPerformanceTimeOriginMode = 'none';\n return undefined;\n }\n\n const threshold = 3600 * 1000;\n const performanceNow = performance.now();\n const dateNow = Date.now();\n\n // if timeOrigin isn't available set delta to threshold so it isn't used\n const timeOriginDelta = performance.timeOrigin\n ? Math.abs(performance.timeOrigin + performanceNow - dateNow)\n : threshold;\n const timeOriginIsReliable = timeOriginDelta < threshold;\n\n // While performance.timing.navigationStart is deprecated in favor of performance.timeOrigin, performance.timeOrigin\n // is not as widely supported. Namely, performance.timeOrigin is undefined in Safari as of writing.\n // Also as of writing, performance.timing is not available in Web Workers in mainstream browsers, so it is not always\n // a valid fallback. In the absence of an initial time provided by the browser, fallback to the current time from the\n // Date API.\n // eslint-disable-next-line deprecation/deprecation\n const navigationStart = performance.timing && performance.timing.navigationStart;\n const hasNavigationStart = typeof navigationStart === 'number';\n // if navigationStart isn't available set delta to threshold so it isn't used\n const navigationStartDelta = hasNavigationStart ? Math.abs(navigationStart + performanceNow - dateNow) : threshold;\n const navigationStartIsReliable = navigationStartDelta < threshold;\n\n if (timeOriginIsReliable || navigationStartIsReliable) {\n // Use the more reliable time origin\n if (timeOriginDelta <= navigationStartDelta) {\n _browserPerformanceTimeOriginMode = 'timeOrigin';\n return performance.timeOrigin;\n } else {\n _browserPerformanceTimeOriginMode = 'navigationStart';\n return navigationStart;\n }\n }\n\n // Either both timeOrigin and navigationStart are skewed or neither is available, fallback to Date.\n _browserPerformanceTimeOriginMode = 'dateNow';\n return dateNow;\n})();\n\nexport { _browserPerformanceTimeOriginMode, browserPerformanceTimeOrigin, dateTimestampInSeconds, timestampInSeconds, timestampWithMs };\n","/**\n * This serves as a build time flag that will be true by default, but false in non-debug builds or if users replace `__SENTRY_DEBUG__` in their generated code.\n *\n * ATTENTION: This constant must never cross package boundaries (i.e. be exported) to guarantee that it can be used for tree shaking.\n */\nconst DEBUG_BUILD = (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__);\n\nexport { DEBUG_BUILD };\n","import { isThenable } from './is.js';\n\n/* eslint-disable @typescript-eslint/explicit-function-return-type */\n\n/** SyncPromise internal states */\nvar States; (function (States) {\n /** Pending */\n const PENDING = 0; States[States[\"PENDING\"] = PENDING] = \"PENDING\";\n /** Resolved / OK */\n const RESOLVED = 1; States[States[\"RESOLVED\"] = RESOLVED] = \"RESOLVED\";\n /** Rejected / Error */\n const REJECTED = 2; States[States[\"REJECTED\"] = REJECTED] = \"REJECTED\";\n})(States || (States = {}));\n\n// Overloads so we can call resolvedSyncPromise without arguments and generic argument\n\n/**\n * Creates a resolved sync promise.\n *\n * @param value the value to resolve the promise with\n * @returns the resolved sync promise\n */\nfunction resolvedSyncPromise(value) {\n return new SyncPromise(resolve => {\n resolve(value);\n });\n}\n\n/**\n * Creates a rejected sync promise.\n *\n * @param value the value to reject the promise with\n * @returns the rejected sync promise\n */\nfunction rejectedSyncPromise(reason) {\n return new SyncPromise((_, reject) => {\n reject(reason);\n });\n}\n\n/**\n * Thenable class that behaves like a Promise and follows it's interface\n * but is not async internally\n */\nclass SyncPromise {\n\n constructor(\n executor,\n ) {SyncPromise.prototype.__init.call(this);SyncPromise.prototype.__init2.call(this);SyncPromise.prototype.__init3.call(this);SyncPromise.prototype.__init4.call(this);\n this._state = States.PENDING;\n this._handlers = [];\n\n try {\n executor(this._resolve, this._reject);\n } catch (e) {\n this._reject(e);\n }\n }\n\n /** JSDoc */\n then(\n onfulfilled,\n onrejected,\n ) {\n return new SyncPromise((resolve, reject) => {\n this._handlers.push([\n false,\n result => {\n if (!onfulfilled) {\n // TODO: ¯\\_(ツ)_/¯\n // TODO: FIXME\n resolve(result );\n } else {\n try {\n resolve(onfulfilled(result));\n } catch (e) {\n reject(e);\n }\n }\n },\n reason => {\n if (!onrejected) {\n reject(reason);\n } else {\n try {\n resolve(onrejected(reason));\n } catch (e) {\n reject(e);\n }\n }\n },\n ]);\n this._executeHandlers();\n });\n }\n\n /** JSDoc */\n catch(\n onrejected,\n ) {\n return this.then(val => val, onrejected);\n }\n\n /** JSDoc */\n finally(onfinally) {\n return new SyncPromise((resolve, reject) => {\n let val;\n let isRejected;\n\n return this.then(\n value => {\n isRejected = false;\n val = value;\n if (onfinally) {\n onfinally();\n }\n },\n reason => {\n isRejected = true;\n val = reason;\n if (onfinally) {\n onfinally();\n }\n },\n ).then(() => {\n if (isRejected) {\n reject(val);\n return;\n }\n\n resolve(val );\n });\n });\n }\n\n /** JSDoc */\n __init() {this._resolve = (value) => {\n this._setResult(States.RESOLVED, value);\n };}\n\n /** JSDoc */\n __init2() {this._reject = (reason) => {\n this._setResult(States.REJECTED, reason);\n };}\n\n /** JSDoc */\n __init3() {this._setResult = (state, value) => {\n if (this._state !== States.PENDING) {\n return;\n }\n\n if (isThenable(value)) {\n void (value ).then(this._resolve, this._reject);\n return;\n }\n\n this._state = state;\n this._value = value;\n\n this._executeHandlers();\n };}\n\n /** JSDoc */\n __init4() {this._executeHandlers = () => {\n if (this._state === States.PENDING) {\n return;\n }\n\n const cachedHandlers = this._handlers.slice();\n this._handlers = [];\n\n cachedHandlers.forEach(handler => {\n if (handler[0]) {\n return;\n }\n\n if (this._state === States.RESOLVED) {\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n handler[1](this._value );\n }\n\n if (this._state === States.REJECTED) {\n handler[2](this._value);\n }\n\n handler[0] = true;\n });\n };}\n}\n\nexport { SyncPromise, rejectedSyncPromise, resolvedSyncPromise };\n","import { SyncPromise, logger, isThenable, getGlobalSingleton } from '@sentry/utils';\nimport { DEBUG_BUILD } from './debug-build.js';\n\n/**\n * Returns the global event processors.\n * @deprecated Global event processors will be removed in v8.\n */\nfunction getGlobalEventProcessors() {\n return getGlobalSingleton('globalEventProcessors', () => []);\n}\n\n/**\n * Add a EventProcessor to be kept globally.\n * @deprecated Use `addEventProcessor` instead. Global event processors will be removed in v8.\n */\nfunction addGlobalEventProcessor(callback) {\n // eslint-disable-next-line deprecation/deprecation\n getGlobalEventProcessors().push(callback);\n}\n\n/**\n * Process an array of event processors, returning the processed event (or `null` if the event was dropped).\n */\nfunction notifyEventProcessors(\n processors,\n event,\n hint,\n index = 0,\n) {\n return new SyncPromise((resolve, reject) => {\n const processor = processors[index];\n if (event === null || typeof processor !== 'function') {\n resolve(event);\n } else {\n const result = processor({ ...event }, hint) ;\n\n DEBUG_BUILD && processor.id && result === null && logger.log(`Event processor \"${processor.id}\" dropped event`);\n\n if (isThenable(result)) {\n void result\n .then(final => notifyEventProcessors(processors, final, hint, index + 1).then(resolve))\n .then(null, reject);\n } else {\n void notifyEventProcessors(processors, result, hint, index + 1)\n .then(resolve)\n .then(null, reject);\n }\n }\n });\n}\n\nexport { addGlobalEventProcessor, getGlobalEventProcessors, notifyEventProcessors };\n","import { timestampInSeconds, uuid4, dropUndefinedKeys } from '@sentry/utils';\n\n/**\n * Creates a new `Session` object by setting certain default parameters. If optional @param context\n * is passed, the passed properties are applied to the session object.\n *\n * @param context (optional) additional properties to be applied to the returned session object\n *\n * @returns a new `Session` object\n */\nfunction makeSession(context) {\n // Both timestamp and started are in seconds since the UNIX epoch.\n const startingTime = timestampInSeconds();\n\n const session = {\n sid: uuid4(),\n init: true,\n timestamp: startingTime,\n started: startingTime,\n duration: 0,\n status: 'ok',\n errors: 0,\n ignoreDuration: false,\n toJSON: () => sessionToJSON(session),\n };\n\n if (context) {\n updateSession(session, context);\n }\n\n return session;\n}\n\n/**\n * Updates a session object with the properties passed in the context.\n *\n * Note that this function mutates the passed object and returns void.\n * (Had to do this instead of returning a new and updated session because closing and sending a session\n * makes an update to the session after it was passed to the sending logic.\n * @see BaseClient.captureSession )\n *\n * @param session the `Session` to update\n * @param context the `SessionContext` holding the properties that should be updated in @param session\n */\n// eslint-disable-next-line complexity\nfunction updateSession(session, context = {}) {\n if (context.user) {\n if (!session.ipAddress && context.user.ip_address) {\n session.ipAddress = context.user.ip_address;\n }\n\n if (!session.did && !context.did) {\n session.did = context.user.id || context.user.email || context.user.username;\n }\n }\n\n session.timestamp = context.timestamp || timestampInSeconds();\n\n if (context.abnormal_mechanism) {\n session.abnormal_mechanism = context.abnormal_mechanism;\n }\n\n if (context.ignoreDuration) {\n session.ignoreDuration = context.ignoreDuration;\n }\n if (context.sid) {\n // Good enough uuid validation. — Kamil\n session.sid = context.sid.length === 32 ? context.sid : uuid4();\n }\n if (context.init !== undefined) {\n session.init = context.init;\n }\n if (!session.did && context.did) {\n session.did = `${context.did}`;\n }\n if (typeof context.started === 'number') {\n session.started = context.started;\n }\n if (session.ignoreDuration) {\n session.duration = undefined;\n } else if (typeof context.duration === 'number') {\n session.duration = context.duration;\n } else {\n const duration = session.timestamp - session.started;\n session.duration = duration >= 0 ? duration : 0;\n }\n if (context.release) {\n session.release = context.release;\n }\n if (context.environment) {\n session.environment = context.environment;\n }\n if (!session.ipAddress && context.ipAddress) {\n session.ipAddress = context.ipAddress;\n }\n if (!session.userAgent && context.userAgent) {\n session.userAgent = context.userAgent;\n }\n if (typeof context.errors === 'number') {\n session.errors = context.errors;\n }\n if (context.status) {\n session.status = context.status;\n }\n}\n\n/**\n * Closes a session by setting its status and updating the session object with it.\n * Internally calls `updateSession` to update the passed session object.\n *\n * Note that this function mutates the passed session (@see updateSession for explanation).\n *\n * @param session the `Session` object to be closed\n * @param status the `SessionStatus` with which the session was closed. If you don't pass a status,\n * this function will keep the previously set status, unless it was `'ok'` in which case\n * it is changed to `'exited'`.\n */\nfunction closeSession(session, status) {\n let context = {};\n if (status) {\n context = { status };\n } else if (session.status === 'ok') {\n context = { status: 'exited' };\n }\n\n updateSession(session, context);\n}\n\n/**\n * Serializes a passed session object to a JSON object with a slightly different structure.\n * This is necessary because the Sentry backend requires a slightly different schema of a session\n * than the one the JS SDKs use internally.\n *\n * @param session the session to be converted\n *\n * @returns a JSON object of the passed session\n */\nfunction sessionToJSON(session) {\n return dropUndefinedKeys({\n sid: `${session.sid}`,\n init: session.init,\n // Make sure that sec is converted to ms for date constructor\n started: new Date(session.started * 1000).toISOString(),\n timestamp: new Date(session.timestamp * 1000).toISOString(),\n status: session.status,\n errors: session.errors,\n did: typeof session.did === 'number' || typeof session.did === 'string' ? `${session.did}` : undefined,\n duration: session.duration,\n abnormal_mechanism: session.abnormal_mechanism,\n attrs: {\n release: session.release,\n environment: session.environment,\n ip_address: session.ipAddress,\n user_agent: session.userAgent,\n },\n });\n}\n\nexport { closeSession, makeSession, updateSession };\n","/**\n * Returns the root span of a given span.\n *\n * As long as we use `Transaction`s internally, the returned root span\n * will be a `Transaction` but be aware that this might change in the future.\n *\n * If the given span has no root span or transaction, `undefined` is returned.\n */\nfunction getRootSpan(span) {\n // TODO (v8): Remove this check and just return span\n // eslint-disable-next-line deprecation/deprecation\n return span.transaction;\n}\n\nexport { getRootSpan };\n","import { DEBUG_BUILD } from './debug-build.js';\nimport { isString } from './is.js';\nimport { logger } from './logger.js';\n\nconst BAGGAGE_HEADER_NAME = 'baggage';\n\nconst SENTRY_BAGGAGE_KEY_PREFIX = 'sentry-';\n\nconst SENTRY_BAGGAGE_KEY_PREFIX_REGEX = /^sentry-/;\n\n/**\n * Max length of a serialized baggage string\n *\n * https://www.w3.org/TR/baggage/#limits\n */\nconst MAX_BAGGAGE_STRING_LENGTH = 8192;\n\n/**\n * Takes a baggage header and turns it into Dynamic Sampling Context, by extracting all the \"sentry-\" prefixed values\n * from it.\n *\n * @param baggageHeader A very bread definition of a baggage header as it might appear in various frameworks.\n * @returns The Dynamic Sampling Context that was found on `baggageHeader`, if there was any, `undefined` otherwise.\n */\nfunction baggageHeaderToDynamicSamplingContext(\n // Very liberal definition of what any incoming header might look like\n baggageHeader,\n) {\n if (!isString(baggageHeader) && !Array.isArray(baggageHeader)) {\n return undefined;\n }\n\n // Intermediary object to store baggage key value pairs of incoming baggage headers on.\n // It is later used to read Sentry-DSC-values from.\n let baggageObject = {};\n\n if (Array.isArray(baggageHeader)) {\n // Combine all baggage headers into one object containing the baggage values so we can later read the Sentry-DSC-values from it\n baggageObject = baggageHeader.reduce((acc, curr) => {\n const currBaggageObject = baggageHeaderToObject(curr);\n for (const key of Object.keys(currBaggageObject)) {\n acc[key] = currBaggageObject[key];\n }\n return acc;\n }, {});\n } else {\n // Return undefined if baggage header is an empty string (technically an empty baggage header is not spec conform but\n // this is how we choose to handle it)\n if (!baggageHeader) {\n return undefined;\n }\n\n baggageObject = baggageHeaderToObject(baggageHeader);\n }\n\n // Read all \"sentry-\" prefixed values out of the baggage object and put it onto a dynamic sampling context object.\n const dynamicSamplingContext = Object.entries(baggageObject).reduce((acc, [key, value]) => {\n if (key.match(SENTRY_BAGGAGE_KEY_PREFIX_REGEX)) {\n const nonPrefixedKey = key.slice(SENTRY_BAGGAGE_KEY_PREFIX.length);\n acc[nonPrefixedKey] = value;\n }\n return acc;\n }, {});\n\n // Only return a dynamic sampling context object if there are keys in it.\n // A keyless object means there were no sentry values on the header, which means that there is no DSC.\n if (Object.keys(dynamicSamplingContext).length > 0) {\n return dynamicSamplingContext ;\n } else {\n return undefined;\n }\n}\n\n/**\n * Turns a Dynamic Sampling Object into a baggage header by prefixing all the keys on the object with \"sentry-\".\n *\n * @param dynamicSamplingContext The Dynamic Sampling Context to turn into a header. For convenience and compatibility\n * with the `getDynamicSamplingContext` method on the Transaction class ,this argument can also be `undefined`. If it is\n * `undefined` the function will return `undefined`.\n * @returns a baggage header, created from `dynamicSamplingContext`, or `undefined` either if `dynamicSamplingContext`\n * was `undefined`, or if `dynamicSamplingContext` didn't contain any values.\n */\nfunction dynamicSamplingContextToSentryBaggageHeader(\n // this also takes undefined for convenience and bundle size in other places\n dynamicSamplingContext,\n) {\n if (!dynamicSamplingContext) {\n return undefined;\n }\n\n // Prefix all DSC keys with \"sentry-\" and put them into a new object\n const sentryPrefixedDSC = Object.entries(dynamicSamplingContext).reduce(\n (acc, [dscKey, dscValue]) => {\n if (dscValue) {\n acc[`${SENTRY_BAGGAGE_KEY_PREFIX}${dscKey}`] = dscValue;\n }\n return acc;\n },\n {},\n );\n\n return objectToBaggageHeader(sentryPrefixedDSC);\n}\n\n/**\n * Will parse a baggage header, which is a simple key-value map, into a flat object.\n *\n * @param baggageHeader The baggage header to parse.\n * @returns a flat object containing all the key-value pairs from `baggageHeader`.\n */\nfunction baggageHeaderToObject(baggageHeader) {\n return baggageHeader\n .split(',')\n .map(baggageEntry => baggageEntry.split('=').map(keyOrValue => decodeURIComponent(keyOrValue.trim())))\n .reduce((acc, [key, value]) => {\n acc[key] = value;\n return acc;\n }, {});\n}\n\n/**\n * Turns a flat object (key-value pairs) into a baggage header, which is also just key-value pairs.\n *\n * @param object The object to turn into a baggage header.\n * @returns a baggage header string, or `undefined` if the object didn't have any values, since an empty baggage header\n * is not spec compliant.\n */\nfunction objectToBaggageHeader(object) {\n if (Object.keys(object).length === 0) {\n // An empty baggage header is not spec compliant: We return undefined.\n return undefined;\n }\n\n return Object.entries(object).reduce((baggageHeader, [objectKey, objectValue], currentIndex) => {\n const baggageEntry = `${encodeURIComponent(objectKey)}=${encodeURIComponent(objectValue)}`;\n const newBaggageHeader = currentIndex === 0 ? baggageEntry : `${baggageHeader},${baggageEntry}`;\n if (newBaggageHeader.length > MAX_BAGGAGE_STRING_LENGTH) {\n DEBUG_BUILD &&\n logger.warn(\n `Not adding key: ${objectKey} with val: ${objectValue} to baggage header due to exceeding baggage size limits.`,\n );\n return baggageHeader;\n } else {\n return newBaggageHeader;\n }\n }, '');\n}\n\nexport { BAGGAGE_HEADER_NAME, MAX_BAGGAGE_STRING_LENGTH, SENTRY_BAGGAGE_KEY_PREFIX, SENTRY_BAGGAGE_KEY_PREFIX_REGEX, baggageHeaderToDynamicSamplingContext, dynamicSamplingContextToSentryBaggageHeader };\n","import { baggageHeaderToDynamicSamplingContext } from './baggage.js';\nimport { uuid4 } from './misc.js';\n\n// eslint-disable-next-line @sentry-internal/sdk/no-regexp-constructor -- RegExp is used for readability here\nconst TRACEPARENT_REGEXP = new RegExp(\n '^[ \\\\t]*' + // whitespace\n '([0-9a-f]{32})?' + // trace_id\n '-?([0-9a-f]{16})?' + // span_id\n '-?([01])?' + // sampled\n '[ \\\\t]*$', // whitespace\n);\n\n/**\n * Extract transaction context data from a `sentry-trace` header.\n *\n * @param traceparent Traceparent string\n *\n * @returns Object containing data from the header, or undefined if traceparent string is malformed\n */\nfunction extractTraceparentData(traceparent) {\n if (!traceparent) {\n return undefined;\n }\n\n const matches = traceparent.match(TRACEPARENT_REGEXP);\n if (!matches) {\n return undefined;\n }\n\n let parentSampled;\n if (matches[3] === '1') {\n parentSampled = true;\n } else if (matches[3] === '0') {\n parentSampled = false;\n }\n\n return {\n traceId: matches[1],\n parentSampled,\n parentSpanId: matches[2],\n };\n}\n\n/**\n * Create tracing context from incoming headers.\n */\nfunction tracingContextFromHeaders(\n sentryTrace,\n baggage,\n)\n\n {\n const traceparentData = extractTraceparentData(sentryTrace);\n const dynamicSamplingContext = baggageHeaderToDynamicSamplingContext(baggage);\n\n const { traceId, parentSpanId, parentSampled } = traceparentData || {};\n\n const propagationContext = {\n traceId: traceId || uuid4(),\n spanId: uuid4().substring(16),\n sampled: parentSampled,\n };\n\n if (parentSpanId) {\n propagationContext.parentSpanId = parentSpanId;\n }\n\n if (dynamicSamplingContext) {\n propagationContext.dsc = dynamicSamplingContext ;\n }\n\n return {\n traceparentData,\n dynamicSamplingContext,\n propagationContext,\n };\n}\n\n/**\n * Create sentry-trace header from span context values.\n */\nfunction generateSentryTraceHeader(\n traceId = uuid4(),\n spanId = uuid4().substring(16),\n sampled,\n) {\n let sampledString = '';\n if (sampled !== undefined) {\n sampledString = sampled ? '-1' : '-0';\n }\n return `${traceId}-${spanId}${sampledString}`;\n}\n\nexport { TRACEPARENT_REGEXP, extractTraceparentData, generateSentryTraceHeader, tracingContextFromHeaders };\n","import { generateSentryTraceHeader, dropUndefinedKeys, timestampInSeconds } from '@sentry/utils';\n\n// These are aligned with OpenTelemetry trace flags\nconst TRACE_FLAG_NONE = 0x0;\nconst TRACE_FLAG_SAMPLED = 0x1;\n\n/**\n * Convert a span to a trace context, which can be sent as the `trace` context in an event.\n */\nfunction spanToTraceContext(span) {\n const { spanId: span_id, traceId: trace_id } = span.spanContext();\n const { data, op, parent_span_id, status, tags, origin } = spanToJSON(span);\n\n return dropUndefinedKeys({\n data,\n op,\n parent_span_id,\n span_id,\n status,\n tags,\n trace_id,\n origin,\n });\n}\n\n/**\n * Convert a Span to a Sentry trace header.\n */\nfunction spanToTraceHeader(span) {\n const { traceId, spanId } = span.spanContext();\n const sampled = spanIsSampled(span);\n return generateSentryTraceHeader(traceId, spanId, sampled);\n}\n\n/**\n * Convert a span time input intp a timestamp in seconds.\n */\nfunction spanTimeInputToSeconds(input) {\n if (typeof input === 'number') {\n return ensureTimestampInSeconds(input);\n }\n\n if (Array.isArray(input)) {\n // See {@link HrTime} for the array-based time format\n return input[0] + input[1] / 1e9;\n }\n\n if (input instanceof Date) {\n return ensureTimestampInSeconds(input.getTime());\n }\n\n return timestampInSeconds();\n}\n\n/**\n * Converts a timestamp to second, if it was in milliseconds, or keeps it as second.\n */\nfunction ensureTimestampInSeconds(timestamp) {\n const isMs = timestamp > 9999999999;\n return isMs ? timestamp / 1000 : timestamp;\n}\n\n/**\n * Convert a span to a JSON representation.\n * Note that all fields returned here are optional and need to be guarded against.\n *\n * Note: Because of this, we currently have a circular type dependency (which we opted out of in package.json).\n * This is not avoidable as we need `spanToJSON` in `spanUtils.ts`, which in turn is needed by `span.ts` for backwards compatibility.\n * And `spanToJSON` needs the Span class from `span.ts` to check here.\n * TODO v8: When we remove the deprecated stuff from `span.ts`, we can remove the circular dependency again.\n */\nfunction spanToJSON(span) {\n if (spanIsSpanClass(span)) {\n return span.getSpanJSON();\n }\n\n // Fallback: We also check for `.toJSON()` here...\n // eslint-disable-next-line deprecation/deprecation\n if (typeof span.toJSON === 'function') {\n // eslint-disable-next-line deprecation/deprecation\n return span.toJSON();\n }\n\n return {};\n}\n\n/**\n * Sadly, due to circular dependency checks we cannot actually import the Span class here and check for instanceof.\n * :( So instead we approximate this by checking if it has the `getSpanJSON` method.\n */\nfunction spanIsSpanClass(span) {\n return typeof (span ).getSpanJSON === 'function';\n}\n\n/**\n * Returns true if a span is sampled.\n * In most cases, you should just use `span.isRecording()` instead.\n * However, this has a slightly different semantic, as it also returns false if the span is finished.\n * So in the case where this distinction is important, use this method.\n */\nfunction spanIsSampled(span) {\n // We align our trace flags with the ones OpenTelemetry use\n // So we also check for sampled the same way they do.\n const { traceFlags } = span.spanContext();\n // eslint-disable-next-line no-bitwise\n return Boolean(traceFlags & TRACE_FLAG_SAMPLED);\n}\n\nexport { TRACE_FLAG_NONE, TRACE_FLAG_SAMPLED, spanIsSampled, spanTimeInputToSeconds, spanToJSON, spanToTraceContext, spanToTraceHeader };\n","import { dropUndefinedKeys } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from '../constants.js';\nimport { getClient, getCurrentScope } from '../exports.js';\nimport { getRootSpan } from '../utils/getRootSpan.js';\nimport { spanToJSON, spanIsSampled } from '../utils/spanUtils.js';\n\n/**\n * Creates a dynamic sampling context from a client.\n *\n * Dispatches the `createDsc` lifecycle hook as a side effect.\n */\nfunction getDynamicSamplingContextFromClient(\n trace_id,\n client,\n scope,\n) {\n const options = client.getOptions();\n\n const { publicKey: public_key } = client.getDsn() || {};\n // TODO(v8): Remove segment from User\n // eslint-disable-next-line deprecation/deprecation\n const { segment: user_segment } = (scope && scope.getUser()) || {};\n\n const dsc = dropUndefinedKeys({\n environment: options.environment || DEFAULT_ENVIRONMENT,\n release: options.release,\n user_segment,\n public_key,\n trace_id,\n }) ;\n\n client.emit && client.emit('createDsc', dsc);\n\n return dsc;\n}\n\n/**\n * A Span with a frozen dynamic sampling context.\n */\n\n/**\n * Creates a dynamic sampling context from a span (and client and scope)\n *\n * @param span the span from which a few values like the root span name and sample rate are extracted.\n *\n * @returns a dynamic sampling context\n */\nfunction getDynamicSamplingContextFromSpan(span) {\n const client = getClient();\n if (!client) {\n return {};\n }\n\n // passing emit=false here to only emit later once the DSC is actually populated\n const dsc = getDynamicSamplingContextFromClient(spanToJSON(span).trace_id || '', client, getCurrentScope());\n\n // TODO (v8): Remove v7FrozenDsc as a Transaction will no longer have _frozenDynamicSamplingContext\n const txn = getRootSpan(span) ;\n if (!txn) {\n return dsc;\n }\n\n // TODO (v8): Remove v7FrozenDsc as a Transaction will no longer have _frozenDynamicSamplingContext\n // For now we need to avoid breaking users who directly created a txn with a DSC, where this field is still set.\n // @see Transaction class constructor\n const v7FrozenDsc = txn && txn._frozenDynamicSamplingContext;\n if (v7FrozenDsc) {\n return v7FrozenDsc;\n }\n\n // TODO (v8): Replace txn.metadata with txn.attributes[]\n // We can't do this yet because attributes aren't always set yet.\n // eslint-disable-next-line deprecation/deprecation\n const { sampleRate: maybeSampleRate, source } = txn.metadata;\n if (maybeSampleRate != null) {\n dsc.sample_rate = `${maybeSampleRate}`;\n }\n\n // We don't want to have a transaction name in the DSC if the source is \"url\" because URLs might contain PII\n const jsonSpan = spanToJSON(txn);\n\n // after JSON conversion, txn.name becomes jsonSpan.description\n if (source && source !== 'url') {\n dsc.transaction = jsonSpan.description;\n }\n\n dsc.sampled = String(spanIsSampled(txn));\n\n client.emit && client.emit('createDsc', dsc);\n\n return dsc;\n}\n\nexport { getDynamicSamplingContextFromClient, getDynamicSamplingContextFromSpan };\n","import { dropUndefinedKeys, arrayify } from '@sentry/utils';\nimport { getDynamicSamplingContextFromSpan } from '../tracing/dynamicSamplingContext.js';\nimport { getRootSpan } from './getRootSpan.js';\nimport { spanToTraceContext, spanToJSON } from './spanUtils.js';\n\n/**\n * Applies data from the scope to the event and runs all event processors on it.\n */\nfunction applyScopeDataToEvent(event, data) {\n const { fingerprint, span, breadcrumbs, sdkProcessingMetadata, propagationContext } = data;\n\n // Apply general data\n applyDataToEvent(event, data);\n\n // We want to set the trace context for normal events only if there isn't already\n // a trace context on the event. There is a product feature in place where we link\n // errors with transaction and it relies on that.\n if (span) {\n applySpanToEvent(event, span);\n }\n\n applyFingerprintToEvent(event, fingerprint);\n applyBreadcrumbsToEvent(event, breadcrumbs);\n applySdkMetadataToEvent(event, sdkProcessingMetadata, propagationContext);\n}\n\n/** Merge data of two scopes together. */\nfunction mergeScopeData(data, mergeData) {\n const {\n extra,\n tags,\n user,\n contexts,\n level,\n sdkProcessingMetadata,\n breadcrumbs,\n fingerprint,\n eventProcessors,\n attachments,\n propagationContext,\n // eslint-disable-next-line deprecation/deprecation\n transactionName,\n span,\n } = mergeData;\n\n mergeAndOverwriteScopeData(data, 'extra', extra);\n mergeAndOverwriteScopeData(data, 'tags', tags);\n mergeAndOverwriteScopeData(data, 'user', user);\n mergeAndOverwriteScopeData(data, 'contexts', contexts);\n mergeAndOverwriteScopeData(data, 'sdkProcessingMetadata', sdkProcessingMetadata);\n\n if (level) {\n data.level = level;\n }\n\n if (transactionName) {\n // eslint-disable-next-line deprecation/deprecation\n data.transactionName = transactionName;\n }\n\n if (span) {\n data.span = span;\n }\n\n if (breadcrumbs.length) {\n data.breadcrumbs = [...data.breadcrumbs, ...breadcrumbs];\n }\n\n if (fingerprint.length) {\n data.fingerprint = [...data.fingerprint, ...fingerprint];\n }\n\n if (eventProcessors.length) {\n data.eventProcessors = [...data.eventProcessors, ...eventProcessors];\n }\n\n if (attachments.length) {\n data.attachments = [...data.attachments, ...attachments];\n }\n\n data.propagationContext = { ...data.propagationContext, ...propagationContext };\n}\n\n/**\n * Merges certain scope data. Undefined values will overwrite any existing values.\n * Exported only for tests.\n */\nfunction mergeAndOverwriteScopeData\n\n(data, prop, mergeVal) {\n if (mergeVal && Object.keys(mergeVal).length) {\n // Clone object\n data[prop] = { ...data[prop] };\n for (const key in mergeVal) {\n if (Object.prototype.hasOwnProperty.call(mergeVal, key)) {\n data[prop][key] = mergeVal[key];\n }\n }\n }\n}\n\nfunction applyDataToEvent(event, data) {\n const {\n extra,\n tags,\n user,\n contexts,\n level,\n // eslint-disable-next-line deprecation/deprecation\n transactionName,\n } = data;\n\n const cleanedExtra = dropUndefinedKeys(extra);\n if (cleanedExtra && Object.keys(cleanedExtra).length) {\n event.extra = { ...cleanedExtra, ...event.extra };\n }\n\n const cleanedTags = dropUndefinedKeys(tags);\n if (cleanedTags && Object.keys(cleanedTags).length) {\n event.tags = { ...cleanedTags, ...event.tags };\n }\n\n const cleanedUser = dropUndefinedKeys(user);\n if (cleanedUser && Object.keys(cleanedUser).length) {\n event.user = { ...cleanedUser, ...event.user };\n }\n\n const cleanedContexts = dropUndefinedKeys(contexts);\n if (cleanedContexts && Object.keys(cleanedContexts).length) {\n event.contexts = { ...cleanedContexts, ...event.contexts };\n }\n\n if (level) {\n event.level = level;\n }\n\n if (transactionName) {\n event.transaction = transactionName;\n }\n}\n\nfunction applyBreadcrumbsToEvent(event, breadcrumbs) {\n const mergedBreadcrumbs = [...(event.breadcrumbs || []), ...breadcrumbs];\n event.breadcrumbs = mergedBreadcrumbs.length ? mergedBreadcrumbs : undefined;\n}\n\nfunction applySdkMetadataToEvent(\n event,\n sdkProcessingMetadata,\n propagationContext,\n) {\n event.sdkProcessingMetadata = {\n ...event.sdkProcessingMetadata,\n ...sdkProcessingMetadata,\n propagationContext: propagationContext,\n };\n}\n\nfunction applySpanToEvent(event, span) {\n event.contexts = { trace: spanToTraceContext(span), ...event.contexts };\n const rootSpan = getRootSpan(span);\n if (rootSpan) {\n event.sdkProcessingMetadata = {\n dynamicSamplingContext: getDynamicSamplingContextFromSpan(span),\n ...event.sdkProcessingMetadata,\n };\n const transactionName = spanToJSON(rootSpan).description;\n if (transactionName) {\n event.tags = { transaction: transactionName, ...event.tags };\n }\n }\n}\n\n/**\n * Applies fingerprint from the scope to the event if there's one,\n * uses message if there's one instead or get rid of empty fingerprint\n */\nfunction applyFingerprintToEvent(event, fingerprint) {\n // Make sure it's an array first and we actually have something in place\n event.fingerprint = event.fingerprint ? arrayify(event.fingerprint) : [];\n\n // If we have something on the scope, then merge it with event\n if (fingerprint) {\n event.fingerprint = event.fingerprint.concat(fingerprint);\n }\n\n // If we have no data at all, remove empty array default\n if (event.fingerprint && !event.fingerprint.length) {\n delete event.fingerprint;\n }\n}\n\nexport { applyScopeDataToEvent, mergeAndOverwriteScopeData, mergeScopeData };\n","import { isPlainObject, dateTimestampInSeconds, uuid4, logger } from '@sentry/utils';\nimport { getGlobalEventProcessors, notifyEventProcessors } from './eventProcessors.js';\nimport { updateSession } from './session.js';\nimport { applyScopeDataToEvent } from './utils/applyScopeDataToEvent.js';\n\n/**\n * Default value for maximum number of breadcrumbs added to an event.\n */\nconst DEFAULT_MAX_BREADCRUMBS = 100;\n\n/**\n * The global scope is kept in this module.\n * When accessing this via `getGlobalScope()` we'll make sure to set one if none is currently present.\n */\nlet globalScope;\n\n/**\n * Holds additional event information. {@link Scope.applyToEvent} will be\n * called by the client before an event will be sent.\n */\nclass Scope {\n /** Flag if notifying is happening. */\n\n /** Callback for client to receive scope changes. */\n\n /** Callback list that will be called after {@link applyToEvent}. */\n\n /** Array of breadcrumbs. */\n\n /** User */\n\n /** Tags */\n\n /** Extra */\n\n /** Contexts */\n\n /** Attachments */\n\n /** Propagation Context for distributed tracing */\n\n /**\n * A place to stash data which is needed at some point in the SDK's event processing pipeline but which shouldn't get\n * sent to Sentry\n */\n\n /** Fingerprint */\n\n /** Severity */\n // eslint-disable-next-line deprecation/deprecation\n\n /**\n * Transaction Name\n */\n\n /** Span */\n\n /** Session */\n\n /** Request Mode Session Status */\n\n /** The client on this scope */\n\n // NOTE: Any field which gets added here should get added not only to the constructor but also to the `clone` method.\n\n constructor() {\n this._notifyingListeners = false;\n this._scopeListeners = [];\n this._eventProcessors = [];\n this._breadcrumbs = [];\n this._attachments = [];\n this._user = {};\n this._tags = {};\n this._extra = {};\n this._contexts = {};\n this._sdkProcessingMetadata = {};\n this._propagationContext = generatePropagationContext();\n }\n\n /**\n * Inherit values from the parent scope.\n * @deprecated Use `scope.clone()` and `new Scope()` instead.\n */\n static clone(scope) {\n return scope ? scope.clone() : new Scope();\n }\n\n /**\n * Clone this scope instance.\n */\n clone() {\n const newScope = new Scope();\n newScope._breadcrumbs = [...this._breadcrumbs];\n newScope._tags = { ...this._tags };\n newScope._extra = { ...this._extra };\n newScope._contexts = { ...this._contexts };\n newScope._user = this._user;\n newScope._level = this._level;\n newScope._span = this._span;\n newScope._session = this._session;\n newScope._transactionName = this._transactionName;\n newScope._fingerprint = this._fingerprint;\n newScope._eventProcessors = [...this._eventProcessors];\n newScope._requestSession = this._requestSession;\n newScope._attachments = [...this._attachments];\n newScope._sdkProcessingMetadata = { ...this._sdkProcessingMetadata };\n newScope._propagationContext = { ...this._propagationContext };\n newScope._client = this._client;\n\n return newScope;\n }\n\n /** Update the client on the scope. */\n setClient(client) {\n this._client = client;\n }\n\n /**\n * Get the client assigned to this scope.\n *\n * It is generally recommended to use the global function `Sentry.getClient()` instead, unless you know what you are doing.\n */\n getClient() {\n return this._client;\n }\n\n /**\n * Add internal on change listener. Used for sub SDKs that need to store the scope.\n * @hidden\n */\n addScopeListener(callback) {\n this._scopeListeners.push(callback);\n }\n\n /**\n * @inheritDoc\n */\n addEventProcessor(callback) {\n this._eventProcessors.push(callback);\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setUser(user) {\n // If null is passed we want to unset everything, but still define keys,\n // so that later down in the pipeline any existing values are cleared.\n this._user = user || {\n email: undefined,\n id: undefined,\n ip_address: undefined,\n segment: undefined,\n username: undefined,\n };\n\n if (this._session) {\n updateSession(this._session, { user });\n }\n\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getUser() {\n return this._user;\n }\n\n /**\n * @inheritDoc\n */\n getRequestSession() {\n return this._requestSession;\n }\n\n /**\n * @inheritDoc\n */\n setRequestSession(requestSession) {\n this._requestSession = requestSession;\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setTags(tags) {\n this._tags = {\n ...this._tags,\n ...tags,\n };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setTag(key, value) {\n this._tags = { ...this._tags, [key]: value };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setExtras(extras) {\n this._extra = {\n ...this._extra,\n ...extras,\n };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setExtra(key, extra) {\n this._extra = { ...this._extra, [key]: extra };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setFingerprint(fingerprint) {\n this._fingerprint = fingerprint;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setLevel(\n // eslint-disable-next-line deprecation/deprecation\n level,\n ) {\n this._level = level;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * Sets the transaction name on the scope for future events.\n * @deprecated Use extra or tags instead.\n */\n setTransactionName(name) {\n this._transactionName = name;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setContext(key, context) {\n if (context === null) {\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete this._contexts[key];\n } else {\n this._contexts[key] = context;\n }\n\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * Sets the Span on the scope.\n * @param span Span\n * @deprecated Instead of setting a span on a scope, use `startSpan()`/`startSpanManual()` instead.\n */\n setSpan(span) {\n this._span = span;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * Returns the `Span` if there is one.\n * @deprecated Use `getActiveSpan()` instead.\n */\n getSpan() {\n return this._span;\n }\n\n /**\n * Returns the `Transaction` attached to the scope (if there is one).\n * @deprecated You should not rely on the transaction, but just use `startSpan()` APIs instead.\n */\n getTransaction() {\n // Often, this span (if it exists at all) will be a transaction, but it's not guaranteed to be. Regardless, it will\n // have a pointer to the currently-active transaction.\n const span = this._span;\n // Cannot replace with getRootSpan because getRootSpan returns a span, not a transaction\n // Also, this method will be removed anyway.\n // eslint-disable-next-line deprecation/deprecation\n return span && span.transaction;\n }\n\n /**\n * @inheritDoc\n */\n setSession(session) {\n if (!session) {\n delete this._session;\n } else {\n this._session = session;\n }\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getSession() {\n return this._session;\n }\n\n /**\n * @inheritDoc\n */\n update(captureContext) {\n if (!captureContext) {\n return this;\n }\n\n if (typeof captureContext === 'function') {\n const updatedScope = (captureContext )(this);\n return updatedScope instanceof Scope ? updatedScope : this;\n }\n\n if (captureContext instanceof Scope) {\n this._tags = { ...this._tags, ...captureContext._tags };\n this._extra = { ...this._extra, ...captureContext._extra };\n this._contexts = { ...this._contexts, ...captureContext._contexts };\n if (captureContext._user && Object.keys(captureContext._user).length) {\n this._user = captureContext._user;\n }\n if (captureContext._level) {\n this._level = captureContext._level;\n }\n if (captureContext._fingerprint) {\n this._fingerprint = captureContext._fingerprint;\n }\n if (captureContext._requestSession) {\n this._requestSession = captureContext._requestSession;\n }\n if (captureContext._propagationContext) {\n this._propagationContext = captureContext._propagationContext;\n }\n } else if (isPlainObject(captureContext)) {\n // eslint-disable-next-line no-param-reassign\n captureContext = captureContext ;\n this._tags = { ...this._tags, ...captureContext.tags };\n this._extra = { ...this._extra, ...captureContext.extra };\n this._contexts = { ...this._contexts, ...captureContext.contexts };\n if (captureContext.user) {\n this._user = captureContext.user;\n }\n if (captureContext.level) {\n this._level = captureContext.level;\n }\n if (captureContext.fingerprint) {\n this._fingerprint = captureContext.fingerprint;\n }\n if (captureContext.requestSession) {\n this._requestSession = captureContext.requestSession;\n }\n if (captureContext.propagationContext) {\n this._propagationContext = captureContext.propagationContext;\n }\n }\n\n return this;\n }\n\n /**\n * @inheritDoc\n */\n clear() {\n this._breadcrumbs = [];\n this._tags = {};\n this._extra = {};\n this._user = {};\n this._contexts = {};\n this._level = undefined;\n this._transactionName = undefined;\n this._fingerprint = undefined;\n this._requestSession = undefined;\n this._span = undefined;\n this._session = undefined;\n this._notifyScopeListeners();\n this._attachments = [];\n this._propagationContext = generatePropagationContext();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n addBreadcrumb(breadcrumb, maxBreadcrumbs) {\n const maxCrumbs = typeof maxBreadcrumbs === 'number' ? maxBreadcrumbs : DEFAULT_MAX_BREADCRUMBS;\n\n // No data has been changed, so don't notify scope listeners\n if (maxCrumbs <= 0) {\n return this;\n }\n\n const mergedBreadcrumb = {\n timestamp: dateTimestampInSeconds(),\n ...breadcrumb,\n };\n\n const breadcrumbs = this._breadcrumbs;\n breadcrumbs.push(mergedBreadcrumb);\n this._breadcrumbs = breadcrumbs.length > maxCrumbs ? breadcrumbs.slice(-maxCrumbs) : breadcrumbs;\n\n this._notifyScopeListeners();\n\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getLastBreadcrumb() {\n return this._breadcrumbs[this._breadcrumbs.length - 1];\n }\n\n /**\n * @inheritDoc\n */\n clearBreadcrumbs() {\n this._breadcrumbs = [];\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n addAttachment(attachment) {\n this._attachments.push(attachment);\n return this;\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `getScopeData()` instead.\n */\n getAttachments() {\n const data = this.getScopeData();\n\n return data.attachments;\n }\n\n /**\n * @inheritDoc\n */\n clearAttachments() {\n this._attachments = [];\n return this;\n }\n\n /** @inheritDoc */\n getScopeData() {\n const {\n _breadcrumbs,\n _attachments,\n _contexts,\n _tags,\n _extra,\n _user,\n _level,\n _fingerprint,\n _eventProcessors,\n _propagationContext,\n _sdkProcessingMetadata,\n _transactionName,\n _span,\n } = this;\n\n return {\n breadcrumbs: _breadcrumbs,\n attachments: _attachments,\n contexts: _contexts,\n tags: _tags,\n extra: _extra,\n user: _user,\n level: _level,\n fingerprint: _fingerprint || [],\n eventProcessors: _eventProcessors,\n propagationContext: _propagationContext,\n sdkProcessingMetadata: _sdkProcessingMetadata,\n transactionName: _transactionName,\n span: _span,\n };\n }\n\n /**\n * Applies data from the scope to the event and runs all event processors on it.\n *\n * @param event Event\n * @param hint Object containing additional information about the original exception, for use by the event processors.\n * @hidden\n * @deprecated Use `applyScopeDataToEvent()` directly\n */\n applyToEvent(\n event,\n hint = {},\n additionalEventProcessors = [],\n ) {\n applyScopeDataToEvent(event, this.getScopeData());\n\n // TODO (v8): Update this order to be: Global > Client > Scope\n const eventProcessors = [\n ...additionalEventProcessors,\n // eslint-disable-next-line deprecation/deprecation\n ...getGlobalEventProcessors(),\n ...this._eventProcessors,\n ];\n\n return notifyEventProcessors(eventProcessors, event, hint);\n }\n\n /**\n * Add data which will be accessible during event processing but won't get sent to Sentry\n */\n setSDKProcessingMetadata(newData) {\n this._sdkProcessingMetadata = { ...this._sdkProcessingMetadata, ...newData };\n\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setPropagationContext(context) {\n this._propagationContext = context;\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getPropagationContext() {\n return this._propagationContext;\n }\n\n /**\n * Capture an exception for this scope.\n *\n * @param exception The exception to capture.\n * @param hint Optinal additional data to attach to the Sentry event.\n * @returns the id of the captured Sentry event.\n */\n captureException(exception, hint) {\n const eventId = hint && hint.event_id ? hint.event_id : uuid4();\n\n if (!this._client) {\n logger.warn('No client configured on scope - will not capture exception!');\n return eventId;\n }\n\n const syntheticException = new Error('Sentry syntheticException');\n\n this._client.captureException(\n exception,\n {\n originalException: exception,\n syntheticException,\n ...hint,\n event_id: eventId,\n },\n this,\n );\n\n return eventId;\n }\n\n /**\n * Capture a message for this scope.\n *\n * @param message The message to capture.\n * @param level An optional severity level to report the message with.\n * @param hint Optional additional data to attach to the Sentry event.\n * @returns the id of the captured message.\n */\n captureMessage(message, level, hint) {\n const eventId = hint && hint.event_id ? hint.event_id : uuid4();\n\n if (!this._client) {\n logger.warn('No client configured on scope - will not capture message!');\n return eventId;\n }\n\n const syntheticException = new Error(message);\n\n this._client.captureMessage(\n message,\n level,\n {\n originalException: message,\n syntheticException,\n ...hint,\n event_id: eventId,\n },\n this,\n );\n\n return eventId;\n }\n\n /**\n * Captures a manually created event for this scope and sends it to Sentry.\n *\n * @param exception The event to capture.\n * @param hint Optional additional data to attach to the Sentry event.\n * @returns the id of the captured event.\n */\n captureEvent(event, hint) {\n const eventId = hint && hint.event_id ? hint.event_id : uuid4();\n\n if (!this._client) {\n logger.warn('No client configured on scope - will not capture event!');\n return eventId;\n }\n\n this._client.captureEvent(event, { ...hint, event_id: eventId }, this);\n\n return eventId;\n }\n\n /**\n * This will be called on every set call.\n */\n _notifyScopeListeners() {\n // We need this check for this._notifyingListeners to be able to work on scope during updates\n // If this check is not here we'll produce endless recursion when something is done with the scope\n // during the callback.\n if (!this._notifyingListeners) {\n this._notifyingListeners = true;\n this._scopeListeners.forEach(callback => {\n callback(this);\n });\n this._notifyingListeners = false;\n }\n }\n}\n\n/**\n * Get the global scope.\n * This scope is applied to _all_ events.\n */\nfunction getGlobalScope() {\n if (!globalScope) {\n globalScope = new Scope();\n }\n\n return globalScope;\n}\n\n/**\n * This is mainly needed for tests.\n * DO NOT USE this, as this is an internal API and subject to change.\n * @hidden\n */\nfunction setGlobalScope(scope) {\n globalScope = scope;\n}\n\nfunction generatePropagationContext() {\n return {\n traceId: uuid4(),\n spanId: uuid4().substring(16),\n };\n}\n\nexport { Scope, getGlobalScope, setGlobalScope };\n","const SDK_VERSION = '7.98.0';\n\nexport { SDK_VERSION };\n","import { isThenable, uuid4, dateTimestampInSeconds, consoleSandbox, logger, GLOBAL_OBJ, getGlobalSingleton } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from './constants.js';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { Scope } from './scope.js';\nimport { closeSession, makeSession, updateSession } from './session.js';\nimport { SDK_VERSION } from './version.js';\n\n/**\n * API compatibility version of this hub.\n *\n * WARNING: This number should only be increased when the global interface\n * changes and new methods are introduced.\n *\n * @hidden\n */\nconst API_VERSION = parseFloat(SDK_VERSION);\n\n/**\n * Default maximum number of breadcrumbs added to an event. Can be overwritten\n * with {@link Options.maxBreadcrumbs}.\n */\nconst DEFAULT_BREADCRUMBS = 100;\n\n/**\n * @inheritDoc\n */\nclass Hub {\n /** Is a {@link Layer}[] containing the client and scope */\n\n /** Contains the last event id of a captured event. */\n\n /**\n * Creates a new instance of the hub, will push one {@link Layer} into the\n * internal stack on creation.\n *\n * @param client bound to the hub.\n * @param scope bound to the hub.\n * @param version number, higher number means higher priority.\n */\n constructor(\n client,\n scope,\n isolationScope,\n _version = API_VERSION,\n ) {this._version = _version;\n let assignedScope;\n if (!scope) {\n assignedScope = new Scope();\n assignedScope.setClient(client);\n } else {\n assignedScope = scope;\n }\n\n let assignedIsolationScope;\n if (!isolationScope) {\n assignedIsolationScope = new Scope();\n assignedIsolationScope.setClient(client);\n } else {\n assignedIsolationScope = isolationScope;\n }\n\n this._stack = [{ scope: assignedScope }];\n\n if (client) {\n // eslint-disable-next-line deprecation/deprecation\n this.bindClient(client);\n }\n\n this._isolationScope = assignedIsolationScope;\n }\n\n /**\n * Checks if this hub's version is older than the given version.\n *\n * @param version A version number to compare to.\n * @return True if the given version is newer; otherwise false.\n *\n * @deprecated This will be removed in v8.\n */\n isOlderThan(version) {\n return this._version < version;\n }\n\n /**\n * This binds the given client to the current scope.\n * @param client An SDK client (client) instance.\n *\n * @deprecated Use `initAndBind()` directly, or `setCurrentClient()` and/or `client.init()` instead.\n */\n bindClient(client) {\n // eslint-disable-next-line deprecation/deprecation\n const top = this.getStackTop();\n top.client = client;\n top.scope.setClient(client);\n // eslint-disable-next-line deprecation/deprecation\n if (client && client.setupIntegrations) {\n // eslint-disable-next-line deprecation/deprecation\n client.setupIntegrations();\n }\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `withScope` instead.\n */\n pushScope() {\n // We want to clone the content of prev scope\n // eslint-disable-next-line deprecation/deprecation\n const scope = this.getScope().clone();\n // eslint-disable-next-line deprecation/deprecation\n this.getStack().push({\n // eslint-disable-next-line deprecation/deprecation\n client: this.getClient(),\n scope,\n });\n return scope;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `withScope` instead.\n */\n popScope() {\n // eslint-disable-next-line deprecation/deprecation\n if (this.getStack().length <= 1) return false;\n // eslint-disable-next-line deprecation/deprecation\n return !!this.getStack().pop();\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `Sentry.withScope()` instead.\n */\n withScope(callback) {\n // eslint-disable-next-line deprecation/deprecation\n const scope = this.pushScope();\n\n let maybePromiseResult;\n try {\n maybePromiseResult = callback(scope);\n } catch (e) {\n // eslint-disable-next-line deprecation/deprecation\n this.popScope();\n throw e;\n }\n\n if (isThenable(maybePromiseResult)) {\n // @ts-expect-error - isThenable returns the wrong type\n return maybePromiseResult.then(\n res => {\n // eslint-disable-next-line deprecation/deprecation\n this.popScope();\n return res;\n },\n e => {\n // eslint-disable-next-line deprecation/deprecation\n this.popScope();\n throw e;\n },\n );\n }\n\n // eslint-disable-next-line deprecation/deprecation\n this.popScope();\n return maybePromiseResult;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `Sentry.getClient()` instead.\n */\n getClient() {\n // eslint-disable-next-line deprecation/deprecation\n return this.getStackTop().client ;\n }\n\n /**\n * Returns the scope of the top stack.\n *\n * @deprecated Use `Sentry.getCurrentScope()` instead.\n */\n getScope() {\n // eslint-disable-next-line deprecation/deprecation\n return this.getStackTop().scope;\n }\n\n /**\n * @deprecated Use `Sentry.getIsolationScope()` instead.\n */\n getIsolationScope() {\n return this._isolationScope;\n }\n\n /**\n * Returns the scope stack for domains or the process.\n * @deprecated This will be removed in v8.\n */\n getStack() {\n return this._stack;\n }\n\n /**\n * Returns the topmost scope layer in the order domain > local > process.\n * @deprecated This will be removed in v8.\n */\n getStackTop() {\n return this._stack[this._stack.length - 1];\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `Sentry.captureException()` instead.\n */\n captureException(exception, hint) {\n const eventId = (this._lastEventId = hint && hint.event_id ? hint.event_id : uuid4());\n const syntheticException = new Error('Sentry syntheticException');\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().captureException(exception, {\n originalException: exception,\n syntheticException,\n ...hint,\n event_id: eventId,\n });\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `Sentry.captureMessage()` instead.\n */\n captureMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n level,\n hint,\n ) {\n const eventId = (this._lastEventId = hint && hint.event_id ? hint.event_id : uuid4());\n const syntheticException = new Error(message);\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().captureMessage(message, level, {\n originalException: message,\n syntheticException,\n ...hint,\n event_id: eventId,\n });\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `Sentry.captureEvent()` instead.\n */\n captureEvent(event, hint) {\n const eventId = hint && hint.event_id ? hint.event_id : uuid4();\n if (!event.type) {\n this._lastEventId = eventId;\n }\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().captureEvent(event, { ...hint, event_id: eventId });\n return eventId;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated This will be removed in v8.\n */\n lastEventId() {\n return this._lastEventId;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `Sentry.addBreadcrumb()` instead.\n */\n addBreadcrumb(breadcrumb, hint) {\n // eslint-disable-next-line deprecation/deprecation\n const { scope, client } = this.getStackTop();\n\n if (!client) return;\n\n const { beforeBreadcrumb = null, maxBreadcrumbs = DEFAULT_BREADCRUMBS } =\n (client.getOptions && client.getOptions()) || {};\n\n if (maxBreadcrumbs <= 0) return;\n\n const timestamp = dateTimestampInSeconds();\n const mergedBreadcrumb = { timestamp, ...breadcrumb };\n const finalBreadcrumb = beforeBreadcrumb\n ? (consoleSandbox(() => beforeBreadcrumb(mergedBreadcrumb, hint)) )\n : mergedBreadcrumb;\n\n if (finalBreadcrumb === null) return;\n\n if (client.emit) {\n client.emit('beforeAddBreadcrumb', finalBreadcrumb, hint);\n }\n\n // TODO(v8): I know this comment doesn't make much sense because the hub will be deprecated but I still wanted to\n // write it down. In theory, we would have to add the breadcrumbs to the isolation scope here, however, that would\n // duplicate all of the breadcrumbs. There was the possibility of adding breadcrumbs to both, the isolation scope\n // and the normal scope, and deduplicating it down the line in the event processing pipeline. However, that would\n // have been very fragile, because the breadcrumb objects would have needed to keep their identity all throughout\n // the event processing pipeline.\n // In the new implementation, the top level `Sentry.addBreadcrumb()` should ONLY write to the isolation scope.\n\n scope.addBreadcrumb(finalBreadcrumb, maxBreadcrumbs);\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.setUser()` instead.\n */\n setUser(user) {\n // TODO(v8): The top level `Sentry.setUser()` function should write ONLY to the isolation scope.\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().setUser(user);\n // eslint-disable-next-line deprecation/deprecation\n this.getIsolationScope().setUser(user);\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.setTags()` instead.\n */\n setTags(tags) {\n // TODO(v8): The top level `Sentry.setTags()` function should write ONLY to the isolation scope.\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().setTags(tags);\n // eslint-disable-next-line deprecation/deprecation\n this.getIsolationScope().setTags(tags);\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.setExtras()` instead.\n */\n setExtras(extras) {\n // TODO(v8): The top level `Sentry.setExtras()` function should write ONLY to the isolation scope.\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().setExtras(extras);\n // eslint-disable-next-line deprecation/deprecation\n this.getIsolationScope().setExtras(extras);\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.setTag()` instead.\n */\n setTag(key, value) {\n // TODO(v8): The top level `Sentry.setTag()` function should write ONLY to the isolation scope.\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().setTag(key, value);\n // eslint-disable-next-line deprecation/deprecation\n this.getIsolationScope().setTag(key, value);\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.setExtra()` instead.\n */\n setExtra(key, extra) {\n // TODO(v8): The top level `Sentry.setExtra()` function should write ONLY to the isolation scope.\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().setExtra(key, extra);\n // eslint-disable-next-line deprecation/deprecation\n this.getIsolationScope().setExtra(key, extra);\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.setContext()` instead.\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n setContext(name, context) {\n // TODO(v8): The top level `Sentry.setContext()` function should write ONLY to the isolation scope.\n // eslint-disable-next-line deprecation/deprecation\n this.getScope().setContext(name, context);\n // eslint-disable-next-line deprecation/deprecation\n this.getIsolationScope().setContext(name, context);\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `getScope()` directly.\n */\n configureScope(callback) {\n // eslint-disable-next-line deprecation/deprecation\n const { scope, client } = this.getStackTop();\n if (client) {\n callback(scope);\n }\n }\n\n /**\n * @inheritDoc\n */\n run(callback) {\n // eslint-disable-next-line deprecation/deprecation\n const oldHub = makeMain(this);\n try {\n callback(this);\n } finally {\n // eslint-disable-next-line deprecation/deprecation\n makeMain(oldHub);\n }\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `Sentry.getClient().getIntegrationByName()` instead.\n */\n getIntegration(integration) {\n // eslint-disable-next-line deprecation/deprecation\n const client = this.getClient();\n if (!client) return null;\n try {\n // eslint-disable-next-line deprecation/deprecation\n return client.getIntegration(integration);\n } catch (_oO) {\n DEBUG_BUILD && logger.warn(`Cannot retrieve integration ${integration.id} from the current Hub`);\n return null;\n }\n }\n\n /**\n * Starts a new `Transaction` and returns it. This is the entry point to manual tracing instrumentation.\n *\n * A tree structure can be built by adding child spans to the transaction, and child spans to other spans. To start a\n * new child span within the transaction or any span, call the respective `.startChild()` method.\n *\n * Every child span must be finished before the transaction is finished, otherwise the unfinished spans are discarded.\n *\n * The transaction must be finished with a call to its `.end()` method, at which point the transaction with all its\n * finished child spans will be sent to Sentry.\n *\n * @param context Properties of the new `Transaction`.\n * @param customSamplingContext Information given to the transaction sampling function (along with context-dependent\n * default values). See {@link Options.tracesSampler}.\n *\n * @returns The transaction which was just started\n *\n * @deprecated Use `startSpan()`, `startSpanManual()` or `startInactiveSpan()` instead.\n */\n startTransaction(context, customSamplingContext) {\n const result = this._callExtensionMethod('startTransaction', context, customSamplingContext);\n\n if (DEBUG_BUILD && !result) {\n // eslint-disable-next-line deprecation/deprecation\n const client = this.getClient();\n if (!client) {\n logger.warn(\n \"Tracing extension 'startTransaction' is missing. You should 'init' the SDK before calling 'startTransaction'\",\n );\n } else {\n logger.warn(`Tracing extension 'startTransaction' has not been added. Call 'addTracingExtensions' before calling 'init':\nSentry.addTracingExtensions();\nSentry.init({...});\n`);\n }\n }\n\n return result;\n }\n\n /**\n * @inheritDoc\n * @deprecated Use `spanToTraceHeader()` instead.\n */\n traceHeaders() {\n return this._callExtensionMethod('traceHeaders');\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use top level `captureSession` instead.\n */\n captureSession(endSession = false) {\n // both send the update and pull the session from the scope\n if (endSession) {\n // eslint-disable-next-line deprecation/deprecation\n return this.endSession();\n }\n\n // only send the update\n this._sendSessionUpdate();\n }\n\n /**\n * @inheritDoc\n * @deprecated Use top level `endSession` instead.\n */\n endSession() {\n // eslint-disable-next-line deprecation/deprecation\n const layer = this.getStackTop();\n const scope = layer.scope;\n const session = scope.getSession();\n if (session) {\n closeSession(session);\n }\n this._sendSessionUpdate();\n\n // the session is over; take it off of the scope\n scope.setSession();\n }\n\n /**\n * @inheritDoc\n * @deprecated Use top level `startSession` instead.\n */\n startSession(context) {\n // eslint-disable-next-line deprecation/deprecation\n const { scope, client } = this.getStackTop();\n const { release, environment = DEFAULT_ENVIRONMENT } = (client && client.getOptions()) || {};\n\n // Will fetch userAgent if called from browser sdk\n const { userAgent } = GLOBAL_OBJ.navigator || {};\n\n const session = makeSession({\n release,\n environment,\n user: scope.getUser(),\n ...(userAgent && { userAgent }),\n ...context,\n });\n\n // End existing session if there's one\n const currentSession = scope.getSession && scope.getSession();\n if (currentSession && currentSession.status === 'ok') {\n updateSession(currentSession, { status: 'exited' });\n }\n // eslint-disable-next-line deprecation/deprecation\n this.endSession();\n\n // Afterwards we set the new session on the scope\n scope.setSession(session);\n\n return session;\n }\n\n /**\n * Returns if default PII should be sent to Sentry and propagated in ourgoing requests\n * when Tracing is used.\n *\n * @deprecated Use top-level `getClient().getOptions().sendDefaultPii` instead. This function\n * only unnecessarily increased API surface but only wrapped accessing the option.\n */\n shouldSendDefaultPii() {\n // eslint-disable-next-line deprecation/deprecation\n const client = this.getClient();\n const options = client && client.getOptions();\n return Boolean(options && options.sendDefaultPii);\n }\n\n /**\n * Sends the current Session on the scope\n */\n _sendSessionUpdate() {\n // eslint-disable-next-line deprecation/deprecation\n const { scope, client } = this.getStackTop();\n\n const session = scope.getSession();\n if (session && client && client.captureSession) {\n client.captureSession(session);\n }\n }\n\n /**\n * Calls global extension method and binding current instance to the function call\n */\n // @ts-expect-error Function lacks ending return statement and return type does not include 'undefined'. ts(2366)\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n _callExtensionMethod(method, ...args) {\n const carrier = getMainCarrier();\n const sentry = carrier.__SENTRY__;\n if (sentry && sentry.extensions && typeof sentry.extensions[method] === 'function') {\n return sentry.extensions[method].apply(this, args);\n }\n DEBUG_BUILD && logger.warn(`Extension method ${method} couldn't be found, doing nothing.`);\n }\n}\n\n/**\n * Returns the global shim registry.\n *\n * FIXME: This function is problematic, because despite always returning a valid Carrier,\n * it has an optional `__SENTRY__` property, which then in turn requires us to always perform an unnecessary check\n * at the call-site. We always access the carrier through this function, so we can guarantee that `__SENTRY__` is there.\n **/\nfunction getMainCarrier() {\n GLOBAL_OBJ.__SENTRY__ = GLOBAL_OBJ.__SENTRY__ || {\n extensions: {},\n hub: undefined,\n };\n return GLOBAL_OBJ;\n}\n\n/**\n * Replaces the current main hub with the passed one on the global object\n *\n * @returns The old replaced hub\n *\n * @deprecated Use `setCurrentClient()` instead.\n */\nfunction makeMain(hub) {\n const registry = getMainCarrier();\n const oldHub = getHubFromCarrier(registry);\n setHubOnCarrier(registry, hub);\n return oldHub;\n}\n\n/**\n * Returns the default hub instance.\n *\n * If a hub is already registered in the global carrier but this module\n * contains a more recent version, it replaces the registered version.\n * Otherwise, the currently registered hub will be returned.\n *\n * @deprecated Use the respective replacement method directly instead.\n */\nfunction getCurrentHub() {\n // Get main carrier (global for every environment)\n const registry = getMainCarrier();\n\n if (registry.__SENTRY__ && registry.__SENTRY__.acs) {\n const hub = registry.__SENTRY__.acs.getCurrentHub();\n\n if (hub) {\n return hub;\n }\n }\n\n // Return hub that lives on a global object\n return getGlobalHub(registry);\n}\n\n/**\n * Get the currently active isolation scope.\n * The isolation scope is active for the current exection context,\n * meaning that it will remain stable for the same Hub.\n */\nfunction getIsolationScope() {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().getIsolationScope();\n}\n\nfunction getGlobalHub(registry = getMainCarrier()) {\n // If there's no hub, or its an old API, assign a new one\n\n if (\n !hasHubOnCarrier(registry) ||\n // eslint-disable-next-line deprecation/deprecation\n getHubFromCarrier(registry).isOlderThan(API_VERSION)\n ) {\n setHubOnCarrier(registry, new Hub());\n }\n\n // Return hub that lives on a global object\n return getHubFromCarrier(registry);\n}\n\n/**\n * @private Private API with no semver guarantees!\n *\n * If the carrier does not contain a hub, a new hub is created with the global hub client and scope.\n */\nfunction ensureHubOnCarrier(carrier, parent = getGlobalHub()) {\n // If there's no hub on current domain, or it's an old API, assign a new one\n if (\n !hasHubOnCarrier(carrier) ||\n // eslint-disable-next-line deprecation/deprecation\n getHubFromCarrier(carrier).isOlderThan(API_VERSION)\n ) {\n // eslint-disable-next-line deprecation/deprecation\n const client = parent.getClient();\n // eslint-disable-next-line deprecation/deprecation\n const scope = parent.getScope();\n // eslint-disable-next-line deprecation/deprecation\n const isolationScope = parent.getIsolationScope();\n setHubOnCarrier(carrier, new Hub(client, scope.clone(), isolationScope.clone()));\n }\n}\n\n/**\n * @private Private API with no semver guarantees!\n *\n * Sets the global async context strategy\n */\nfunction setAsyncContextStrategy(strategy) {\n // Get main carrier (global for every environment)\n const registry = getMainCarrier();\n registry.__SENTRY__ = registry.__SENTRY__ || {};\n registry.__SENTRY__.acs = strategy;\n}\n\n/**\n * Runs the supplied callback in its own async context. Async Context strategies are defined per SDK.\n *\n * @param callback The callback to run in its own async context\n * @param options Options to pass to the async context strategy\n * @returns The result of the callback\n */\nfunction runWithAsyncContext(callback, options = {}) {\n const registry = getMainCarrier();\n\n if (registry.__SENTRY__ && registry.__SENTRY__.acs) {\n return registry.__SENTRY__.acs.runWithAsyncContext(callback, options);\n }\n\n // if there was no strategy, fallback to just calling the callback\n return callback();\n}\n\n/**\n * This will tell whether a carrier has a hub on it or not\n * @param carrier object\n */\nfunction hasHubOnCarrier(carrier) {\n return !!(carrier && carrier.__SENTRY__ && carrier.__SENTRY__.hub);\n}\n\n/**\n * This will create a new {@link Hub} and add to the passed object on\n * __SENTRY__.hub.\n * @param carrier object\n * @hidden\n */\nfunction getHubFromCarrier(carrier) {\n return getGlobalSingleton('hub', () => new Hub(), carrier);\n}\n\n/**\n * This will set passed {@link Hub} on the passed object's __SENTRY__.hub attribute\n * @param carrier object\n * @param hub Hub\n * @returns A boolean indicating success or failure\n */\nfunction setHubOnCarrier(carrier, hub) {\n if (!carrier) return false;\n const __SENTRY__ = (carrier.__SENTRY__ = carrier.__SENTRY__ || {});\n __SENTRY__.hub = hub;\n return true;\n}\n\nexport { API_VERSION, Hub, ensureHubOnCarrier, getCurrentHub, getHubFromCarrier, getIsolationScope, getMainCarrier, makeMain, runWithAsyncContext, setAsyncContextStrategy, setHubOnCarrier };\n","import { node } from './node-stack-trace.js';\nexport { filenameIsInApp } from './node-stack-trace.js';\n\nconst STACKTRACE_FRAME_LIMIT = 50;\n// Used to sanitize webpack (error: *) wrapped stack errors\nconst WEBPACK_ERROR_REGEXP = /\\(error: (.*)\\)/;\nconst STRIP_FRAME_REGEXP = /captureMessage|captureException/;\n\n/**\n * Creates a stack parser with the supplied line parsers\n *\n * StackFrames are returned in the correct order for Sentry Exception\n * frames and with Sentry SDK internal frames removed from the top and bottom\n *\n */\nfunction createStackParser(...parsers) {\n const sortedParsers = parsers.sort((a, b) => a[0] - b[0]).map(p => p[1]);\n\n return (stack, skipFirst = 0) => {\n const frames = [];\n const lines = stack.split('\\n');\n\n for (let i = skipFirst; i < lines.length; i++) {\n const line = lines[i];\n // Ignore lines over 1kb as they are unlikely to be stack frames.\n // Many of the regular expressions use backtracking which results in run time that increases exponentially with\n // input size. Huge strings can result in hangs/Denial of Service:\n // https://github.com/getsentry/sentry-javascript/issues/2286\n if (line.length > 1024) {\n continue;\n }\n\n // https://github.com/getsentry/sentry-javascript/issues/5459\n // Remove webpack (error: *) wrappers\n const cleanedLine = WEBPACK_ERROR_REGEXP.test(line) ? line.replace(WEBPACK_ERROR_REGEXP, '$1') : line;\n\n // https://github.com/getsentry/sentry-javascript/issues/7813\n // Skip Error: lines\n if (cleanedLine.match(/\\S*Error: /)) {\n continue;\n }\n\n for (const parser of sortedParsers) {\n const frame = parser(cleanedLine);\n\n if (frame) {\n frames.push(frame);\n break;\n }\n }\n\n if (frames.length >= STACKTRACE_FRAME_LIMIT) {\n break;\n }\n }\n\n return stripSentryFramesAndReverse(frames);\n };\n}\n\n/**\n * Gets a stack parser implementation from Options.stackParser\n * @see Options\n *\n * If options contains an array of line parsers, it is converted into a parser\n */\nfunction stackParserFromStackParserOptions(stackParser) {\n if (Array.isArray(stackParser)) {\n return createStackParser(...stackParser);\n }\n return stackParser;\n}\n\n/**\n * Removes Sentry frames from the top and bottom of the stack if present and enforces a limit of max number of frames.\n * Assumes stack input is ordered from top to bottom and returns the reverse representation so call site of the\n * function that caused the crash is the last frame in the array.\n * @hidden\n */\nfunction stripSentryFramesAndReverse(stack) {\n if (!stack.length) {\n return [];\n }\n\n const localStack = Array.from(stack);\n\n // If stack starts with one of our API calls, remove it (starts, meaning it's the top of the stack - aka last call)\n if (/sentryWrapped/.test(localStack[localStack.length - 1].function || '')) {\n localStack.pop();\n }\n\n // Reversing in the middle of the procedure allows us to just pop the values off the stack\n localStack.reverse();\n\n // If stack ends with one of our internal API calls, remove it (ends, meaning it's the bottom of the stack - aka top-most call)\n if (STRIP_FRAME_REGEXP.test(localStack[localStack.length - 1].function || '')) {\n localStack.pop();\n\n // When using synthetic events, we will have a 2 levels deep stack, as `new Error('Sentry syntheticException')`\n // is produced within the hub itself, making it:\n //\n // Sentry.captureException()\n // getCurrentHub().captureException()\n //\n // instead of just the top `Sentry` call itself.\n // This forces us to possibly strip an additional frame in the exact same was as above.\n if (STRIP_FRAME_REGEXP.test(localStack[localStack.length - 1].function || '')) {\n localStack.pop();\n }\n }\n\n return localStack.slice(0, STACKTRACE_FRAME_LIMIT).map(frame => ({\n ...frame,\n filename: frame.filename || localStack[localStack.length - 1].filename,\n function: frame.function || '?',\n }));\n}\n\nconst defaultFunctionName = '';\n\n/**\n * Safely extract function name from itself\n */\nfunction getFunctionName(fn) {\n try {\n if (!fn || typeof fn !== 'function') {\n return defaultFunctionName;\n }\n return fn.name || defaultFunctionName;\n } catch (e) {\n // Just accessing custom props in some Selenium environments\n // can cause a \"Permission denied\" exception (see raven-js#495).\n return defaultFunctionName;\n }\n}\n\n/**\n * Node.js stack line parser\n *\n * This is in @sentry/utils so it can be used from the Electron SDK in the browser for when `nodeIntegration == true`.\n * This allows it to be used without referencing or importing any node specific code which causes bundlers to complain\n */\nfunction nodeStackLineParser(getModule) {\n return [90, node(getModule)];\n}\n\nexport { createStackParser, getFunctionName, nodeStackLineParser, stackParserFromStackParserOptions, stripSentryFramesAndReverse };\n","import { isNaN, isVueViewModel, isSyntheticEvent } from './is.js';\nimport { memoBuilder } from './memo.js';\nimport { convertToPlainObject } from './object.js';\nimport { getFunctionName } from './stacktrace.js';\n\n/**\n * Recursively normalizes the given object.\n *\n * - Creates a copy to prevent original input mutation\n * - Skips non-enumerable properties\n * - When stringifying, calls `toJSON` if implemented\n * - Removes circular references\n * - Translates non-serializable values (`undefined`/`NaN`/functions) to serializable format\n * - Translates known global objects/classes to a string representations\n * - Takes care of `Error` object serialization\n * - Optionally limits depth of final output\n * - Optionally limits number of properties/elements included in any single object/array\n *\n * @param input The object to be normalized.\n * @param depth The max depth to which to normalize the object. (Anything deeper stringified whole.)\n * @param maxProperties The max number of elements or properties to be included in any single array or\n * object in the normallized output.\n * @returns A normalized version of the object, or `\"**non-serializable**\"` if any errors are thrown during normalization.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction normalize(input, depth = 100, maxProperties = +Infinity) {\n try {\n // since we're at the outermost level, we don't provide a key\n return visit('', input, depth, maxProperties);\n } catch (err) {\n return { ERROR: `**non-serializable** (${err})` };\n }\n}\n\n/** JSDoc */\nfunction normalizeToSize(\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n object,\n // Default Node.js REPL depth\n depth = 3,\n // 100kB, as 200kB is max payload size, so half sounds reasonable\n maxSize = 100 * 1024,\n) {\n const normalized = normalize(object, depth);\n\n if (jsonSize(normalized) > maxSize) {\n return normalizeToSize(object, depth - 1, maxSize);\n }\n\n return normalized ;\n}\n\n/**\n * Visits a node to perform normalization on it\n *\n * @param key The key corresponding to the given node\n * @param value The node to be visited\n * @param depth Optional number indicating the maximum recursion depth\n * @param maxProperties Optional maximum number of properties/elements included in any single object/array\n * @param memo Optional Memo class handling decycling\n */\nfunction visit(\n key,\n value,\n depth = +Infinity,\n maxProperties = +Infinity,\n memo = memoBuilder(),\n) {\n const [memoize, unmemoize] = memo;\n\n // Get the simple cases out of the way first\n if (\n value == null || // this matches null and undefined -> eqeq not eqeqeq\n (['number', 'boolean', 'string'].includes(typeof value) && !isNaN(value))\n ) {\n return value ;\n }\n\n const stringified = stringifyValue(key, value);\n\n // Anything we could potentially dig into more (objects or arrays) will have come back as `\"[object XXXX]\"`.\n // Everything else will have already been serialized, so if we don't see that pattern, we're done.\n if (!stringified.startsWith('[object ')) {\n return stringified;\n }\n\n // From here on, we can assert that `value` is either an object or an array.\n\n // Do not normalize objects that we know have already been normalized. As a general rule, the\n // \"__sentry_skip_normalization__\" property should only be used sparingly and only should only be set on objects that\n // have already been normalized.\n if ((value )['__sentry_skip_normalization__']) {\n return value ;\n }\n\n // We can set `__sentry_override_normalization_depth__` on an object to ensure that from there\n // We keep a certain amount of depth.\n // This should be used sparingly, e.g. we use it for the redux integration to ensure we get a certain amount of state.\n const remainingDepth =\n typeof (value )['__sentry_override_normalization_depth__'] === 'number'\n ? ((value )['__sentry_override_normalization_depth__'] )\n : depth;\n\n // We're also done if we've reached the max depth\n if (remainingDepth === 0) {\n // At this point we know `serialized` is a string of the form `\"[object XXXX]\"`. Clean it up so it's just `\"[XXXX]\"`.\n return stringified.replace('object ', '');\n }\n\n // If we've already visited this branch, bail out, as it's circular reference. If not, note that we're seeing it now.\n if (memoize(value)) {\n return '[Circular ~]';\n }\n\n // If the value has a `toJSON` method, we call it to extract more information\n const valueWithToJSON = value ;\n if (valueWithToJSON && typeof valueWithToJSON.toJSON === 'function') {\n try {\n const jsonValue = valueWithToJSON.toJSON();\n // We need to normalize the return value of `.toJSON()` in case it has circular references\n return visit('', jsonValue, remainingDepth - 1, maxProperties, memo);\n } catch (err) {\n // pass (The built-in `toJSON` failed, but we can still try to do it ourselves)\n }\n }\n\n // At this point we know we either have an object or an array, we haven't seen it before, and we're going to recurse\n // because we haven't yet reached the max depth. Create an accumulator to hold the results of visiting each\n // property/entry, and keep track of the number of items we add to it.\n const normalized = (Array.isArray(value) ? [] : {}) ;\n let numAdded = 0;\n\n // Before we begin, convert`Error` and`Event` instances into plain objects, since some of each of their relevant\n // properties are non-enumerable and otherwise would get missed.\n const visitable = convertToPlainObject(value );\n\n for (const visitKey in visitable) {\n // Avoid iterating over fields in the prototype if they've somehow been exposed to enumeration.\n if (!Object.prototype.hasOwnProperty.call(visitable, visitKey)) {\n continue;\n }\n\n if (numAdded >= maxProperties) {\n normalized[visitKey] = '[MaxProperties ~]';\n break;\n }\n\n // Recursively visit all the child nodes\n const visitValue = visitable[visitKey];\n normalized[visitKey] = visit(visitKey, visitValue, remainingDepth - 1, maxProperties, memo);\n\n numAdded++;\n }\n\n // Once we've visited all the branches, remove the parent from memo storage\n unmemoize(value);\n\n // Return accumulated values\n return normalized;\n}\n\n/* eslint-disable complexity */\n/**\n * Stringify the given value. Handles various known special values and types.\n *\n * Not meant to be used on simple primitives which already have a string representation, as it will, for example, turn\n * the number 1231 into \"[Object Number]\", nor on `null`, as it will throw.\n *\n * @param value The value to stringify\n * @returns A stringified representation of the given value\n */\nfunction stringifyValue(\n key,\n // this type is a tiny bit of a cheat, since this function does handle NaN (which is technically a number), but for\n // our internal use, it'll do\n value,\n) {\n try {\n if (key === 'domain' && value && typeof value === 'object' && (value )._events) {\n return '[Domain]';\n }\n\n if (key === 'domainEmitter') {\n return '[DomainEmitter]';\n }\n\n // It's safe to use `global`, `window`, and `document` here in this manner, as we are asserting using `typeof` first\n // which won't throw if they are not present.\n\n if (typeof global !== 'undefined' && value === global) {\n return '[Global]';\n }\n\n // eslint-disable-next-line no-restricted-globals\n if (typeof window !== 'undefined' && value === window) {\n return '[Window]';\n }\n\n // eslint-disable-next-line no-restricted-globals\n if (typeof document !== 'undefined' && value === document) {\n return '[Document]';\n }\n\n if (isVueViewModel(value)) {\n return '[VueViewModel]';\n }\n\n // React's SyntheticEvent thingy\n if (isSyntheticEvent(value)) {\n return '[SyntheticEvent]';\n }\n\n if (typeof value === 'number' && value !== value) {\n return '[NaN]';\n }\n\n if (typeof value === 'function') {\n return `[Function: ${getFunctionName(value)}]`;\n }\n\n if (typeof value === 'symbol') {\n return `[${String(value)}]`;\n }\n\n // stringified BigInts are indistinguishable from regular numbers, so we need to label them to avoid confusion\n if (typeof value === 'bigint') {\n return `[BigInt: ${String(value)}]`;\n }\n\n // Now that we've knocked out all the special cases and the primitives, all we have left are objects. Simply casting\n // them to strings means that instances of classes which haven't defined their `toStringTag` will just come out as\n // `\"[object Object]\"`. If we instead look at the constructor's name (which is the same as the name of the class),\n // we can make sure that only plain objects come out that way.\n const objName = getConstructorName(value);\n\n // Handle HTML Elements\n if (/^HTML(\\w*)Element$/.test(objName)) {\n return `[HTMLElement: ${objName}]`;\n }\n\n return `[object ${objName}]`;\n } catch (err) {\n return `**non-serializable** (${err})`;\n }\n}\n/* eslint-enable complexity */\n\nfunction getConstructorName(value) {\n const prototype = Object.getPrototypeOf(value);\n\n return prototype ? prototype.constructor.name : 'null prototype';\n}\n\n/** Calculates bytes size of input string */\nfunction utf8Length(value) {\n // eslint-disable-next-line no-bitwise\n return ~-encodeURI(value).split(/%..|./).length;\n}\n\n/** Calculates bytes size of input object */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction jsonSize(value) {\n return utf8Length(JSON.stringify(value));\n}\n\n/**\n * Normalizes URLs in exceptions and stacktraces to a base path so Sentry can fingerprint\n * across platforms and working directory.\n *\n * @param url The URL to be normalized.\n * @param basePath The application base path.\n * @returns The normalized URL.\n */\nfunction normalizeUrlToBase(url, basePath) {\n const escapedBase = basePath\n // Backslash to forward\n .replace(/\\\\/g, '/')\n // Escape RegExp special characters\n .replace(/[|\\\\{}()[\\]^$+*?.]/g, '\\\\$&');\n\n let newUrl = url;\n try {\n newUrl = decodeURI(url);\n } catch (_Oo) {\n // Sometime this breaks\n }\n return (\n newUrl\n .replace(/\\\\/g, '/')\n .replace(/webpack:\\/?/g, '') // Remove intermediate base path\n // eslint-disable-next-line @sentry-internal/sdk/no-regexp-constructor\n .replace(new RegExp(`(file://)?/*${escapedBase}/*`, 'ig'), 'app:///')\n );\n}\n\nexport { normalize, normalizeToSize, normalizeUrlToBase, visit as walk };\n","/* eslint-disable @typescript-eslint/no-unsafe-member-access */\n/* eslint-disable @typescript-eslint/no-explicit-any */\n\n/**\n * Helper to decycle json objects\n */\nfunction memoBuilder() {\n const hasWeakSet = typeof WeakSet === 'function';\n const inner = hasWeakSet ? new WeakSet() : [];\n function memoize(obj) {\n if (hasWeakSet) {\n if (inner.has(obj)) {\n return true;\n }\n inner.add(obj);\n return false;\n }\n // eslint-disable-next-line @typescript-eslint/prefer-for-of\n for (let i = 0; i < inner.length; i++) {\n const value = inner[i];\n if (value === obj) {\n return true;\n }\n }\n inner.push(obj);\n return false;\n }\n\n function unmemoize(obj) {\n if (hasWeakSet) {\n inner.delete(obj);\n } else {\n for (let i = 0; i < inner.length; i++) {\n if (inner[i] === obj) {\n inner.splice(i, 1);\n break;\n }\n }\n }\n }\n return [memoize, unmemoize];\n}\n\nexport { memoBuilder };\n","import { uuid4, dateTimestampInSeconds, addExceptionMechanism, truncate, GLOBAL_OBJ, normalize } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from '../constants.js';\nimport { getGlobalEventProcessors, notifyEventProcessors } from '../eventProcessors.js';\nimport { getGlobalScope, Scope } from '../scope.js';\nimport { mergeScopeData, applyScopeDataToEvent } from './applyScopeDataToEvent.js';\nimport { spanToJSON } from './spanUtils.js';\n\n/**\n * This type makes sure that we get either a CaptureContext, OR an EventHint.\n * It does not allow mixing them, which could lead to unexpected outcomes, e.g. this is disallowed:\n * { user: { id: '123' }, mechanism: { handled: false } }\n */\n\n/**\n * Adds common information to events.\n *\n * The information includes release and environment from `options`,\n * breadcrumbs and context (extra, tags and user) from the scope.\n *\n * Information that is already present in the event is never overwritten. For\n * nested objects, such as the context, keys are merged.\n *\n * Note: This also triggers callbacks for `addGlobalEventProcessor`, but not `beforeSend`.\n *\n * @param event The original event.\n * @param hint May contain additional information about the original exception.\n * @param scope A scope containing event metadata.\n * @returns A new event with more information.\n * @hidden\n */\nfunction prepareEvent(\n options,\n event,\n hint,\n scope,\n client,\n isolationScope,\n) {\n const { normalizeDepth = 3, normalizeMaxBreadth = 1000 } = options;\n const prepared = {\n ...event,\n event_id: event.event_id || hint.event_id || uuid4(),\n timestamp: event.timestamp || dateTimestampInSeconds(),\n };\n const integrations = hint.integrations || options.integrations.map(i => i.name);\n\n applyClientOptions(prepared, options);\n applyIntegrationsMetadata(prepared, integrations);\n\n // Only put debug IDs onto frames for error events.\n if (event.type === undefined) {\n applyDebugIds(prepared, options.stackParser);\n }\n\n // If we have scope given to us, use it as the base for further modifications.\n // This allows us to prevent unnecessary copying of data if `captureContext` is not provided.\n const finalScope = getFinalScope(scope, hint.captureContext);\n\n if (hint.mechanism) {\n addExceptionMechanism(prepared, hint.mechanism);\n }\n\n const clientEventProcessors = client && client.getEventProcessors ? client.getEventProcessors() : [];\n\n // This should be the last thing called, since we want that\n // {@link Hub.addEventProcessor} gets the finished prepared event.\n // Merge scope data together\n const data = getGlobalScope().getScopeData();\n\n if (isolationScope) {\n const isolationData = isolationScope.getScopeData();\n mergeScopeData(data, isolationData);\n }\n\n if (finalScope) {\n const finalScopeData = finalScope.getScopeData();\n mergeScopeData(data, finalScopeData);\n }\n\n const attachments = [...(hint.attachments || []), ...data.attachments];\n if (attachments.length) {\n hint.attachments = attachments;\n }\n\n applyScopeDataToEvent(prepared, data);\n\n // TODO (v8): Update this order to be: Global > Client > Scope\n const eventProcessors = [\n ...clientEventProcessors,\n // eslint-disable-next-line deprecation/deprecation\n ...getGlobalEventProcessors(),\n // Run scope event processors _after_ all other processors\n ...data.eventProcessors,\n ];\n\n const result = notifyEventProcessors(eventProcessors, prepared, hint);\n\n return result.then(evt => {\n if (evt) {\n // We apply the debug_meta field only after all event processors have ran, so that if any event processors modified\n // file names (e.g.the RewriteFrames integration) the filename -> debug ID relationship isn't destroyed.\n // This should not cause any PII issues, since we're only moving data that is already on the event and not adding\n // any new data\n applyDebugMeta(evt);\n }\n\n if (typeof normalizeDepth === 'number' && normalizeDepth > 0) {\n return normalizeEvent(evt, normalizeDepth, normalizeMaxBreadth);\n }\n return evt;\n });\n}\n\n/**\n * Enhances event using the client configuration.\n * It takes care of all \"static\" values like environment, release and `dist`,\n * as well as truncating overly long values.\n * @param event event instance to be enhanced\n */\nfunction applyClientOptions(event, options) {\n const { environment, release, dist, maxValueLength = 250 } = options;\n\n if (!('environment' in event)) {\n event.environment = 'environment' in options ? environment : DEFAULT_ENVIRONMENT;\n }\n\n if (event.release === undefined && release !== undefined) {\n event.release = release;\n }\n\n if (event.dist === undefined && dist !== undefined) {\n event.dist = dist;\n }\n\n if (event.message) {\n event.message = truncate(event.message, maxValueLength);\n }\n\n const exception = event.exception && event.exception.values && event.exception.values[0];\n if (exception && exception.value) {\n exception.value = truncate(exception.value, maxValueLength);\n }\n\n const request = event.request;\n if (request && request.url) {\n request.url = truncate(request.url, maxValueLength);\n }\n}\n\nconst debugIdStackParserCache = new WeakMap();\n\n/**\n * Puts debug IDs into the stack frames of an error event.\n */\nfunction applyDebugIds(event, stackParser) {\n const debugIdMap = GLOBAL_OBJ._sentryDebugIds;\n\n if (!debugIdMap) {\n return;\n }\n\n let debugIdStackFramesCache;\n const cachedDebugIdStackFrameCache = debugIdStackParserCache.get(stackParser);\n if (cachedDebugIdStackFrameCache) {\n debugIdStackFramesCache = cachedDebugIdStackFrameCache;\n } else {\n debugIdStackFramesCache = new Map();\n debugIdStackParserCache.set(stackParser, debugIdStackFramesCache);\n }\n\n // Build a map of filename -> debug_id\n const filenameDebugIdMap = Object.keys(debugIdMap).reduce((acc, debugIdStackTrace) => {\n let parsedStack;\n const cachedParsedStack = debugIdStackFramesCache.get(debugIdStackTrace);\n if (cachedParsedStack) {\n parsedStack = cachedParsedStack;\n } else {\n parsedStack = stackParser(debugIdStackTrace);\n debugIdStackFramesCache.set(debugIdStackTrace, parsedStack);\n }\n\n for (let i = parsedStack.length - 1; i >= 0; i--) {\n const stackFrame = parsedStack[i];\n if (stackFrame.filename) {\n acc[stackFrame.filename] = debugIdMap[debugIdStackTrace];\n break;\n }\n }\n return acc;\n }, {});\n\n try {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n event.exception.values.forEach(exception => {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n exception.stacktrace.frames.forEach(frame => {\n if (frame.filename) {\n frame.debug_id = filenameDebugIdMap[frame.filename];\n }\n });\n });\n } catch (e) {\n // To save bundle size we're just try catching here instead of checking for the existence of all the different objects.\n }\n}\n\n/**\n * Moves debug IDs from the stack frames of an error event into the debug_meta field.\n */\nfunction applyDebugMeta(event) {\n // Extract debug IDs and filenames from the stack frames on the event.\n const filenameDebugIdMap = {};\n try {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n event.exception.values.forEach(exception => {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n exception.stacktrace.frames.forEach(frame => {\n if (frame.debug_id) {\n if (frame.abs_path) {\n filenameDebugIdMap[frame.abs_path] = frame.debug_id;\n } else if (frame.filename) {\n filenameDebugIdMap[frame.filename] = frame.debug_id;\n }\n delete frame.debug_id;\n }\n });\n });\n } catch (e) {\n // To save bundle size we're just try catching here instead of checking for the existence of all the different objects.\n }\n\n if (Object.keys(filenameDebugIdMap).length === 0) {\n return;\n }\n\n // Fill debug_meta information\n event.debug_meta = event.debug_meta || {};\n event.debug_meta.images = event.debug_meta.images || [];\n const images = event.debug_meta.images;\n Object.keys(filenameDebugIdMap).forEach(filename => {\n images.push({\n type: 'sourcemap',\n code_file: filename,\n debug_id: filenameDebugIdMap[filename],\n });\n });\n}\n\n/**\n * This function adds all used integrations to the SDK info in the event.\n * @param event The event that will be filled with all integrations.\n */\nfunction applyIntegrationsMetadata(event, integrationNames) {\n if (integrationNames.length > 0) {\n event.sdk = event.sdk || {};\n event.sdk.integrations = [...(event.sdk.integrations || []), ...integrationNames];\n }\n}\n\n/**\n * Applies `normalize` function on necessary `Event` attributes to make them safe for serialization.\n * Normalized keys:\n * - `breadcrumbs.data`\n * - `user`\n * - `contexts`\n * - `extra`\n * @param event Event\n * @returns Normalized event\n */\nfunction normalizeEvent(event, depth, maxBreadth) {\n if (!event) {\n return null;\n }\n\n const normalized = {\n ...event,\n ...(event.breadcrumbs && {\n breadcrumbs: event.breadcrumbs.map(b => ({\n ...b,\n ...(b.data && {\n data: normalize(b.data, depth, maxBreadth),\n }),\n })),\n }),\n ...(event.user && {\n user: normalize(event.user, depth, maxBreadth),\n }),\n ...(event.contexts && {\n contexts: normalize(event.contexts, depth, maxBreadth),\n }),\n ...(event.extra && {\n extra: normalize(event.extra, depth, maxBreadth),\n }),\n };\n\n // event.contexts.trace stores information about a Transaction. Similarly,\n // event.spans[] stores information about child Spans. Given that a\n // Transaction is conceptually a Span, normalization should apply to both\n // Transactions and Spans consistently.\n // For now the decision is to skip normalization of Transactions and Spans,\n // so this block overwrites the normalized event to add back the original\n // Transaction information prior to normalization.\n if (event.contexts && event.contexts.trace && normalized.contexts) {\n normalized.contexts.trace = event.contexts.trace;\n\n // event.contexts.trace.data may contain circular/dangerous data so we need to normalize it\n if (event.contexts.trace.data) {\n normalized.contexts.trace.data = normalize(event.contexts.trace.data, depth, maxBreadth);\n }\n }\n\n // event.spans[].data may contain circular/dangerous data so we need to normalize it\n if (event.spans) {\n normalized.spans = event.spans.map(span => {\n const data = spanToJSON(span).data;\n\n if (data) {\n // This is a bit weird, as we generally have `Span` instances here, but to be safe we do not assume so\n // eslint-disable-next-line deprecation/deprecation\n span.data = normalize(data, depth, maxBreadth);\n }\n\n return span;\n });\n }\n\n return normalized;\n}\n\nfunction getFinalScope(scope, captureContext) {\n if (!captureContext) {\n return scope;\n }\n\n const finalScope = scope ? scope.clone() : new Scope();\n finalScope.update(captureContext);\n return finalScope;\n}\n\n/**\n * Parse either an `EventHint` directly, or convert a `CaptureContext` to an `EventHint`.\n * This is used to allow to update method signatures that used to accept a `CaptureContext` but should now accept an `EventHint`.\n */\nfunction parseEventHintOrCaptureContext(\n hint,\n) {\n if (!hint) {\n return undefined;\n }\n\n // If you pass a Scope or `() => Scope` as CaptureContext, we just return this as captureContext\n if (hintIsScopeOrFunction(hint)) {\n return { captureContext: hint };\n }\n\n if (hintIsScopeContext(hint)) {\n return {\n captureContext: hint,\n };\n }\n\n return hint;\n}\n\nfunction hintIsScopeOrFunction(\n hint,\n) {\n return hint instanceof Scope || typeof hint === 'function';\n}\n\nconst captureContextKeys = [\n 'user',\n 'level',\n 'extra',\n 'contexts',\n 'tags',\n 'fingerprint',\n 'requestSession',\n 'propagationContext',\n] ;\n\nfunction hintIsScopeContext(hint) {\n return Object.keys(hint).some(key => captureContextKeys.includes(key ));\n}\n\nexport { applyDebugIds, applyDebugMeta, parseEventHintOrCaptureContext, prepareEvent };\n","import { logger, uuid4, timestampInSeconds, isThenable, GLOBAL_OBJ } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from './constants.js';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { getCurrentHub, runWithAsyncContext, getIsolationScope } from './hub.js';\nimport { makeSession, updateSession, closeSession } from './session.js';\nimport { parseEventHintOrCaptureContext } from './utils/prepareEvent.js';\n\n/**\n * Captures an exception event and sends it to Sentry.\n *\n * @param exception The exception to capture.\n * @param hint Optional additional data to attach to the Sentry event.\n * @returns the id of the captured Sentry event.\n */\nfunction captureException(\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n exception,\n hint,\n) {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().captureException(exception, parseEventHintOrCaptureContext(hint));\n}\n\n/**\n * Captures a message event and sends it to Sentry.\n *\n * @param exception The exception to capture.\n * @param captureContext Define the level of the message or pass in additional data to attach to the message.\n * @returns the id of the captured message.\n */\nfunction captureMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n captureContext,\n) {\n // This is necessary to provide explicit scopes upgrade, without changing the original\n // arity of the `captureMessage(message, level)` method.\n const level = typeof captureContext === 'string' ? captureContext : undefined;\n const context = typeof captureContext !== 'string' ? { captureContext } : undefined;\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().captureMessage(message, level, context);\n}\n\n/**\n * Captures a manually created event and sends it to Sentry.\n *\n * @param exception The event to send to Sentry.\n * @param hint Optional additional data to attach to the Sentry event.\n * @returns the id of the captured event.\n */\nfunction captureEvent(event, hint) {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().captureEvent(event, hint);\n}\n\n/**\n * Callback to set context information onto the scope.\n * @param callback Callback function that receives Scope.\n *\n * @deprecated Use getCurrentScope() directly.\n */\nfunction configureScope(callback) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().configureScope(callback);\n}\n\n/**\n * Records a new breadcrumb which will be attached to future events.\n *\n * Breadcrumbs will be added to subsequent events to provide more context on\n * user's actions prior to an error or crash.\n *\n * @param breadcrumb The breadcrumb to record.\n */\nfunction addBreadcrumb(breadcrumb, hint) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().addBreadcrumb(breadcrumb, hint);\n}\n\n/**\n * Sets context data with the given name.\n * @param name of the context\n * @param context Any kind of data. This data will be normalized.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction setContext(name, context) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().setContext(name, context);\n}\n\n/**\n * Set an object that will be merged sent as extra data with the event.\n * @param extras Extras object to merge into current context.\n */\nfunction setExtras(extras) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().setExtras(extras);\n}\n\n/**\n * Set key:value that will be sent as extra data with the event.\n * @param key String of extra\n * @param extra Any kind of data. This data will be normalized.\n */\nfunction setExtra(key, extra) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().setExtra(key, extra);\n}\n\n/**\n * Set an object that will be merged sent as tags data with the event.\n * @param tags Tags context object to merge into current context.\n */\nfunction setTags(tags) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().setTags(tags);\n}\n\n/**\n * Set key:value that will be sent as tags data with the event.\n *\n * Can also be used to unset a tag, by passing `undefined`.\n *\n * @param key String key of tag\n * @param value Value of tag\n */\nfunction setTag(key, value) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().setTag(key, value);\n}\n\n/**\n * Updates user context information for future events.\n *\n * @param user User context object to be set in the current context. Pass `null` to unset the user.\n */\nfunction setUser(user) {\n // eslint-disable-next-line deprecation/deprecation\n getCurrentHub().setUser(user);\n}\n\n/**\n * Creates a new scope with and executes the given operation within.\n * The scope is automatically removed once the operation\n * finishes or throws.\n *\n * This is essentially a convenience function for:\n *\n * pushScope();\n * callback();\n * popScope();\n */\n\n/**\n * Either creates a new active scope, or sets the given scope as active scope in the given callback.\n */\nfunction withScope(\n ...rest\n) {\n // eslint-disable-next-line deprecation/deprecation\n const hub = getCurrentHub();\n\n // If a scope is defined, we want to make this the active scope instead of the default one\n if (rest.length === 2) {\n const [scope, callback] = rest;\n if (!scope) {\n // eslint-disable-next-line deprecation/deprecation\n return hub.withScope(callback);\n }\n\n // eslint-disable-next-line deprecation/deprecation\n return hub.withScope(() => {\n // eslint-disable-next-line deprecation/deprecation\n hub.getStackTop().scope = scope ;\n return callback(scope );\n });\n }\n\n // eslint-disable-next-line deprecation/deprecation\n return hub.withScope(rest[0]);\n}\n\n/**\n * Attempts to fork the current isolation scope and the current scope based on the current async context strategy. If no\n * async context strategy is set, the isolation scope and the current scope will not be forked (this is currently the\n * case, for example, in the browser).\n *\n * Usage of this function in environments without async context strategy is discouraged and may lead to unexpected behaviour.\n *\n * This function is intended for Sentry SDK and SDK integration development. It is not recommended to be used in \"normal\"\n * applications directly because it comes with pitfalls. Use at your own risk!\n *\n * @param callback The callback in which the passed isolation scope is active. (Note: In environments without async\n * context strategy, the currently active isolation scope may change within execution of the callback.)\n * @returns The same value that `callback` returns.\n */\nfunction withIsolationScope(callback) {\n return runWithAsyncContext(() => {\n return callback(getIsolationScope());\n });\n}\n\n/**\n * Forks the current scope and sets the provided span as active span in the context of the provided callback.\n *\n * @param span Spans started in the context of the provided callback will be children of this span.\n * @param callback Execution context in which the provided span will be active. Is passed the newly forked scope.\n * @returns the value returned from the provided callback function.\n */\nfunction withActiveSpan(span, callback) {\n return withScope(scope => {\n // eslint-disable-next-line deprecation/deprecation\n scope.setSpan(span);\n return callback(scope);\n });\n}\n\n/**\n * Starts a new `Transaction` and returns it. This is the entry point to manual tracing instrumentation.\n *\n * A tree structure can be built by adding child spans to the transaction, and child spans to other spans. To start a\n * new child span within the transaction or any span, call the respective `.startChild()` method.\n *\n * Every child span must be finished before the transaction is finished, otherwise the unfinished spans are discarded.\n *\n * The transaction must be finished with a call to its `.end()` method, at which point the transaction with all its\n * finished child spans will be sent to Sentry.\n *\n * NOTE: This function should only be used for *manual* instrumentation. Auto-instrumentation should call\n * `startTransaction` directly on the hub.\n *\n * @param context Properties of the new `Transaction`.\n * @param customSamplingContext Information given to the transaction sampling function (along with context-dependent\n * default values). See {@link Options.tracesSampler}.\n *\n * @returns The transaction which was just started\n *\n * @deprecated Use `startSpan()`, `startSpanManual()` or `startInactiveSpan()` instead.\n */\nfunction startTransaction(\n context,\n customSamplingContext,\n) {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().startTransaction({ ...context }, customSamplingContext);\n}\n\n/**\n * Create a cron monitor check in and send it to Sentry.\n *\n * @param checkIn An object that describes a check in.\n * @param upsertMonitorConfig An optional object that describes a monitor config. Use this if you want\n * to create a monitor automatically when sending a check in.\n */\nfunction captureCheckIn(checkIn, upsertMonitorConfig) {\n const scope = getCurrentScope();\n const client = getClient();\n if (!client) {\n DEBUG_BUILD && logger.warn('Cannot capture check-in. No client defined.');\n } else if (!client.captureCheckIn) {\n DEBUG_BUILD && logger.warn('Cannot capture check-in. Client does not support sending check-ins.');\n } else {\n return client.captureCheckIn(checkIn, upsertMonitorConfig, scope);\n }\n\n return uuid4();\n}\n\n/**\n * Wraps a callback with a cron monitor check in. The check in will be sent to Sentry when the callback finishes.\n *\n * @param monitorSlug The distinct slug of the monitor.\n * @param upsertMonitorConfig An optional object that describes a monitor config. Use this if you want\n * to create a monitor automatically when sending a check in.\n */\nfunction withMonitor(\n monitorSlug,\n callback,\n upsertMonitorConfig,\n) {\n const checkInId = captureCheckIn({ monitorSlug, status: 'in_progress' }, upsertMonitorConfig);\n const now = timestampInSeconds();\n\n function finishCheckIn(status) {\n captureCheckIn({ monitorSlug, status, checkInId, duration: timestampInSeconds() - now });\n }\n\n let maybePromiseResult;\n try {\n maybePromiseResult = callback();\n } catch (e) {\n finishCheckIn('error');\n throw e;\n }\n\n if (isThenable(maybePromiseResult)) {\n Promise.resolve(maybePromiseResult).then(\n () => {\n finishCheckIn('ok');\n },\n () => {\n finishCheckIn('error');\n },\n );\n } else {\n finishCheckIn('ok');\n }\n\n return maybePromiseResult;\n}\n\n/**\n * Call `flush()` on the current client, if there is one. See {@link Client.flush}.\n *\n * @param timeout Maximum time in ms the client should wait to flush its event queue. Omitting this parameter will cause\n * the client to wait until all events are sent before resolving the promise.\n * @returns A promise which resolves to `true` if the queue successfully drains before the timeout, or `false` if it\n * doesn't (or if there's no client defined).\n */\nasync function flush(timeout) {\n const client = getClient();\n if (client) {\n return client.flush(timeout);\n }\n DEBUG_BUILD && logger.warn('Cannot flush events. No client defined.');\n return Promise.resolve(false);\n}\n\n/**\n * Call `close()` on the current client, if there is one. See {@link Client.close}.\n *\n * @param timeout Maximum time in ms the client should wait to flush its event queue before shutting down. Omitting this\n * parameter will cause the client to wait until all events are sent before disabling itself.\n * @returns A promise which resolves to `true` if the queue successfully drains before the timeout, or `false` if it\n * doesn't (or if there's no client defined).\n */\nasync function close(timeout) {\n const client = getClient();\n if (client) {\n return client.close(timeout);\n }\n DEBUG_BUILD && logger.warn('Cannot flush events and disable SDK. No client defined.');\n return Promise.resolve(false);\n}\n\n/**\n * This is the getter for lastEventId.\n *\n * @returns The last event id of a captured event.\n * @deprecated This function will be removed in the next major version of the Sentry SDK.\n */\nfunction lastEventId() {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().lastEventId();\n}\n\n/**\n * Get the currently active client.\n */\nfunction getClient() {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().getClient();\n}\n\n/**\n * Returns true if Sentry has been properly initialized.\n */\nfunction isInitialized() {\n return !!getClient();\n}\n\n/**\n * Get the currently active scope.\n */\nfunction getCurrentScope() {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentHub().getScope();\n}\n\n/**\n * Start a session on the current isolation scope.\n *\n * @param context (optional) additional properties to be applied to the returned session object\n *\n * @returns the new active session\n */\nfunction startSession(context) {\n const client = getClient();\n const isolationScope = getIsolationScope();\n const currentScope = getCurrentScope();\n\n const { release, environment = DEFAULT_ENVIRONMENT } = (client && client.getOptions()) || {};\n\n // Will fetch userAgent if called from browser sdk\n const { userAgent } = GLOBAL_OBJ.navigator || {};\n\n const session = makeSession({\n release,\n environment,\n user: currentScope.getUser() || isolationScope.getUser(),\n ...(userAgent && { userAgent }),\n ...context,\n });\n\n // End existing session if there's one\n const currentSession = isolationScope.getSession();\n if (currentSession && currentSession.status === 'ok') {\n updateSession(currentSession, { status: 'exited' });\n }\n\n endSession();\n\n // Afterwards we set the new session on the scope\n isolationScope.setSession(session);\n\n // TODO (v8): Remove this and only use the isolation scope(?).\n // For v7 though, we can't \"soft-break\" people using getCurrentHub().getScope().setSession()\n currentScope.setSession(session);\n\n return session;\n}\n\n/**\n * End the session on the current isolation scope.\n */\nfunction endSession() {\n const isolationScope = getIsolationScope();\n const currentScope = getCurrentScope();\n\n const session = currentScope.getSession() || isolationScope.getSession();\n if (session) {\n closeSession(session);\n }\n _sendSessionUpdate();\n\n // the session is over; take it off of the scope\n isolationScope.setSession();\n\n // TODO (v8): Remove this and only use the isolation scope(?).\n // For v7 though, we can't \"soft-break\" people using getCurrentHub().getScope().setSession()\n currentScope.setSession();\n}\n\n/**\n * Sends the current Session on the scope\n */\nfunction _sendSessionUpdate() {\n const isolationScope = getIsolationScope();\n const currentScope = getCurrentScope();\n const client = getClient();\n // TODO (v8): Remove currentScope and only use the isolation scope(?).\n // For v7 though, we can't \"soft-break\" people using getCurrentHub().getScope().setSession()\n const session = currentScope.getSession() || isolationScope.getSession();\n if (session && client && client.captureSession) {\n client.captureSession(session);\n }\n}\n\n/**\n * Sends the current session on the scope to Sentry\n *\n * @param end If set the session will be marked as exited and removed from the scope.\n * Defaults to `false`.\n */\nfunction captureSession(end = false) {\n // both send the update and pull the session from the scope\n if (end) {\n endSession();\n return;\n }\n\n // only send the update\n _sendSessionUpdate();\n}\n\nexport { addBreadcrumb, captureCheckIn, captureEvent, captureException, captureMessage, captureSession, close, configureScope, endSession, flush, getClient, getCurrentScope, isInitialized, lastEventId, setContext, setExtra, setExtras, setTag, setTags, setUser, startSession, startTransaction, withActiveSpan, withIsolationScope, withMonitor, withScope };\n","import { arrayify, logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { addGlobalEventProcessor } from './eventProcessors.js';\nimport { getClient } from './exports.js';\nimport { getCurrentHub } from './hub.js';\n\nconst installedIntegrations = [];\n\n/** Map of integrations assigned to a client */\n\n/**\n * Remove duplicates from the given array, preferring the last instance of any duplicate. Not guaranteed to\n * preseve the order of integrations in the array.\n *\n * @private\n */\nfunction filterDuplicates(integrations) {\n const integrationsByName = {};\n\n integrations.forEach(currentInstance => {\n const { name } = currentInstance;\n\n const existingInstance = integrationsByName[name];\n\n // We want integrations later in the array to overwrite earlier ones of the same type, except that we never want a\n // default instance to overwrite an existing user instance\n if (existingInstance && !existingInstance.isDefaultInstance && currentInstance.isDefaultInstance) {\n return;\n }\n\n integrationsByName[name] = currentInstance;\n });\n\n return Object.keys(integrationsByName).map(k => integrationsByName[k]);\n}\n\n/** Gets integrations to install */\nfunction getIntegrationsToSetup(options) {\n const defaultIntegrations = options.defaultIntegrations || [];\n const userIntegrations = options.integrations;\n\n // We flag default instances, so that later we can tell them apart from any user-created instances of the same class\n defaultIntegrations.forEach(integration => {\n integration.isDefaultInstance = true;\n });\n\n let integrations;\n\n if (Array.isArray(userIntegrations)) {\n integrations = [...defaultIntegrations, ...userIntegrations];\n } else if (typeof userIntegrations === 'function') {\n integrations = arrayify(userIntegrations(defaultIntegrations));\n } else {\n integrations = defaultIntegrations;\n }\n\n const finalIntegrations = filterDuplicates(integrations);\n\n // The `Debug` integration prints copies of the `event` and `hint` which will be passed to `beforeSend` or\n // `beforeSendTransaction`. It therefore has to run after all other integrations, so that the changes of all event\n // processors will be reflected in the printed values. For lack of a more elegant way to guarantee that, we therefore\n // locate it and, assuming it exists, pop it out of its current spot and shove it onto the end of the array.\n const debugIndex = findIndex(finalIntegrations, integration => integration.name === 'Debug');\n if (debugIndex !== -1) {\n const [debugInstance] = finalIntegrations.splice(debugIndex, 1);\n finalIntegrations.push(debugInstance);\n }\n\n return finalIntegrations;\n}\n\n/**\n * Given a list of integration instances this installs them all. When `withDefaults` is set to `true` then all default\n * integrations are added unless they were already provided before.\n * @param integrations array of integration instances\n * @param withDefault should enable default integrations\n */\nfunction setupIntegrations(client, integrations) {\n const integrationIndex = {};\n\n integrations.forEach(integration => {\n // guard against empty provided integrations\n if (integration) {\n setupIntegration(client, integration, integrationIndex);\n }\n });\n\n return integrationIndex;\n}\n\n/** Setup a single integration. */\nfunction setupIntegration(client, integration, integrationIndex) {\n if (integrationIndex[integration.name]) {\n DEBUG_BUILD && logger.log(`Integration skipped because it was already installed: ${integration.name}`);\n return;\n }\n integrationIndex[integration.name] = integration;\n\n // `setupOnce` is only called the first time\n if (installedIntegrations.indexOf(integration.name) === -1) {\n // eslint-disable-next-line deprecation/deprecation\n integration.setupOnce(addGlobalEventProcessor, getCurrentHub);\n installedIntegrations.push(integration.name);\n }\n\n // `setup` is run for each client\n if (integration.setup && typeof integration.setup === 'function') {\n integration.setup(client);\n }\n\n if (client.on && typeof integration.preprocessEvent === 'function') {\n const callback = integration.preprocessEvent.bind(integration) ;\n client.on('preprocessEvent', (event, hint) => callback(event, hint, client));\n }\n\n if (client.addEventProcessor && typeof integration.processEvent === 'function') {\n const callback = integration.processEvent.bind(integration) ;\n\n const processor = Object.assign((event, hint) => callback(event, hint, client), {\n id: integration.name,\n });\n\n client.addEventProcessor(processor);\n }\n\n DEBUG_BUILD && logger.log(`Integration installed: ${integration.name}`);\n}\n\n/** Add an integration to the current hub's client. */\nfunction addIntegration(integration) {\n const client = getClient();\n\n if (!client || !client.addIntegration) {\n DEBUG_BUILD && logger.warn(`Cannot add integration \"${integration.name}\" because no SDK Client is available.`);\n return;\n }\n\n client.addIntegration(integration);\n}\n\n// Polyfill for Array.findIndex(), which is not supported in ES5\nfunction findIndex(arr, callback) {\n for (let i = 0; i < arr.length; i++) {\n if (callback(arr[i]) === true) {\n return i;\n }\n }\n\n return -1;\n}\n\n/**\n * Convert a new integration function to the legacy class syntax.\n * In v8, we can remove this and instead export the integration functions directly.\n *\n * @deprecated This will be removed in v8!\n */\nfunction convertIntegrationFnToClass(\n name,\n fn,\n) {\n return Object.assign(\n function ConvertedIntegration(...args) {\n return fn(...args);\n },\n { id: name },\n ) ;\n}\n\n/**\n * Define an integration function that can be used to create an integration instance.\n * Note that this by design hides the implementation details of the integration, as they are considered internal.\n */\nfunction defineIntegration(fn) {\n return fn;\n}\n\nexport { addIntegration, convertIntegrationFnToClass, defineIntegration, getIntegrationsToSetup, installedIntegrations, setupIntegration, setupIntegrations };\n","import { logger, getEventDescription, stringMatchesSomePattern } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { convertIntegrationFnToClass, defineIntegration } from '../integration.js';\n\n// \"Script error.\" is hard coded into browsers for errors that it can't read.\n// this is the result of a script being pulled in from an external domain and CORS.\nconst DEFAULT_IGNORE_ERRORS = [/^Script error\\.?$/, /^Javascript error: Script error\\.? on line 0$/];\n\nconst DEFAULT_IGNORE_TRANSACTIONS = [\n /^.*\\/healthcheck$/,\n /^.*\\/healthy$/,\n /^.*\\/live$/,\n /^.*\\/ready$/,\n /^.*\\/heartbeat$/,\n /^.*\\/health$/,\n /^.*\\/healthz$/,\n];\n\n/** Options for the InboundFilters integration */\n\nconst INTEGRATION_NAME = 'InboundFilters';\nconst _inboundFiltersIntegration = ((options = {}) => {\n return {\n name: INTEGRATION_NAME,\n // TODO v8: Remove this\n setupOnce() {}, // eslint-disable-line @typescript-eslint/no-empty-function\n processEvent(event, _hint, client) {\n const clientOptions = client.getOptions();\n const mergedOptions = _mergeOptions(options, clientOptions);\n return _shouldDropEvent(event, mergedOptions) ? null : event;\n },\n };\n}) ;\n\nconst inboundFiltersIntegration = defineIntegration(_inboundFiltersIntegration);\n\n/**\n * Inbound filters configurable by the user.\n * @deprecated Use `inboundFiltersIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst InboundFilters = convertIntegrationFnToClass(\n INTEGRATION_NAME,\n inboundFiltersIntegration,\n)\n\n;\n\nfunction _mergeOptions(\n internalOptions = {},\n clientOptions = {},\n) {\n return {\n allowUrls: [...(internalOptions.allowUrls || []), ...(clientOptions.allowUrls || [])],\n denyUrls: [...(internalOptions.denyUrls || []), ...(clientOptions.denyUrls || [])],\n ignoreErrors: [\n ...(internalOptions.ignoreErrors || []),\n ...(clientOptions.ignoreErrors || []),\n ...(internalOptions.disableErrorDefaults ? [] : DEFAULT_IGNORE_ERRORS),\n ],\n ignoreTransactions: [\n ...(internalOptions.ignoreTransactions || []),\n ...(clientOptions.ignoreTransactions || []),\n ...(internalOptions.disableTransactionDefaults ? [] : DEFAULT_IGNORE_TRANSACTIONS),\n ],\n ignoreInternal: internalOptions.ignoreInternal !== undefined ? internalOptions.ignoreInternal : true,\n };\n}\n\nfunction _shouldDropEvent(event, options) {\n if (options.ignoreInternal && _isSentryError(event)) {\n DEBUG_BUILD &&\n logger.warn(`Event dropped due to being internal Sentry Error.\\nEvent: ${getEventDescription(event)}`);\n return true;\n }\n if (_isIgnoredError(event, options.ignoreErrors)) {\n DEBUG_BUILD &&\n logger.warn(\n `Event dropped due to being matched by \\`ignoreErrors\\` option.\\nEvent: ${getEventDescription(event)}`,\n );\n return true;\n }\n if (_isIgnoredTransaction(event, options.ignoreTransactions)) {\n DEBUG_BUILD &&\n logger.warn(\n `Event dropped due to being matched by \\`ignoreTransactions\\` option.\\nEvent: ${getEventDescription(event)}`,\n );\n return true;\n }\n if (_isDeniedUrl(event, options.denyUrls)) {\n DEBUG_BUILD &&\n logger.warn(\n `Event dropped due to being matched by \\`denyUrls\\` option.\\nEvent: ${getEventDescription(\n event,\n )}.\\nUrl: ${_getEventFilterUrl(event)}`,\n );\n return true;\n }\n if (!_isAllowedUrl(event, options.allowUrls)) {\n DEBUG_BUILD &&\n logger.warn(\n `Event dropped due to not being matched by \\`allowUrls\\` option.\\nEvent: ${getEventDescription(\n event,\n )}.\\nUrl: ${_getEventFilterUrl(event)}`,\n );\n return true;\n }\n return false;\n}\n\nfunction _isIgnoredError(event, ignoreErrors) {\n // If event.type, this is not an error\n if (event.type || !ignoreErrors || !ignoreErrors.length) {\n return false;\n }\n\n return _getPossibleEventMessages(event).some(message => stringMatchesSomePattern(message, ignoreErrors));\n}\n\nfunction _isIgnoredTransaction(event, ignoreTransactions) {\n if (event.type !== 'transaction' || !ignoreTransactions || !ignoreTransactions.length) {\n return false;\n }\n\n const name = event.transaction;\n return name ? stringMatchesSomePattern(name, ignoreTransactions) : false;\n}\n\nfunction _isDeniedUrl(event, denyUrls) {\n // TODO: Use Glob instead?\n if (!denyUrls || !denyUrls.length) {\n return false;\n }\n const url = _getEventFilterUrl(event);\n return !url ? false : stringMatchesSomePattern(url, denyUrls);\n}\n\nfunction _isAllowedUrl(event, allowUrls) {\n // TODO: Use Glob instead?\n if (!allowUrls || !allowUrls.length) {\n return true;\n }\n const url = _getEventFilterUrl(event);\n return !url ? true : stringMatchesSomePattern(url, allowUrls);\n}\n\nfunction _getPossibleEventMessages(event) {\n const possibleMessages = [];\n\n if (event.message) {\n possibleMessages.push(event.message);\n }\n\n let lastException;\n try {\n // @ts-expect-error Try catching to save bundle size\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n lastException = event.exception.values[event.exception.values.length - 1];\n } catch (e) {\n // try catching to save bundle size checking existence of variables\n }\n\n if (lastException) {\n if (lastException.value) {\n possibleMessages.push(lastException.value);\n if (lastException.type) {\n possibleMessages.push(`${lastException.type}: ${lastException.value}`);\n }\n }\n }\n\n if (DEBUG_BUILD && possibleMessages.length === 0) {\n logger.error(`Could not extract message for event ${getEventDescription(event)}`);\n }\n\n return possibleMessages;\n}\n\nfunction _isSentryError(event) {\n try {\n // @ts-expect-error can't be a sentry error if undefined\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return event.exception.values[0].type === 'SentryError';\n } catch (e) {\n // ignore\n }\n return false;\n}\n\nfunction _getLastValidUrl(frames = []) {\n for (let i = frames.length - 1; i >= 0; i--) {\n const frame = frames[i];\n\n if (frame && frame.filename !== '' && frame.filename !== '[native code]') {\n return frame.filename || null;\n }\n }\n\n return null;\n}\n\nfunction _getEventFilterUrl(event) {\n try {\n let frames;\n try {\n // @ts-expect-error we only care about frames if the whole thing here is defined\n frames = event.exception.values[0].stacktrace.frames;\n } catch (e) {\n // ignore\n }\n return frames ? _getLastValidUrl(frames) : null;\n } catch (oO) {\n DEBUG_BUILD && logger.error(`Cannot extract url for event ${getEventDescription(event)}`);\n return null;\n }\n}\n\nexport { InboundFilters, inboundFiltersIntegration };\n","import { getOriginalFunction } from '@sentry/utils';\nimport { convertIntegrationFnToClass, defineIntegration } from '../integration.js';\n\nlet originalFunctionToString;\n\nconst INTEGRATION_NAME = 'FunctionToString';\n\nconst _functionToStringIntegration = (() => {\n return {\n name: INTEGRATION_NAME,\n setupOnce() {\n // eslint-disable-next-line @typescript-eslint/unbound-method\n originalFunctionToString = Function.prototype.toString;\n\n // intrinsics (like Function.prototype) might be immutable in some environments\n // e.g. Node with --frozen-intrinsics, XS (an embedded JavaScript engine) or SES (a JavaScript proposal)\n try {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n Function.prototype.toString = function ( ...args) {\n const context = getOriginalFunction(this) || this;\n return originalFunctionToString.apply(context, args);\n };\n } catch (e) {\n // ignore errors here, just don't patch this\n }\n },\n };\n}) ;\n\nconst functionToStringIntegration = defineIntegration(_functionToStringIntegration);\n\n/**\n * Patch toString calls to return proper name for wrapped functions.\n * @deprecated Use `functionToStringIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst FunctionToString = convertIntegrationFnToClass(\n INTEGRATION_NAME,\n functionToStringIntegration,\n) ;\n\nexport { FunctionToString, functionToStringIntegration };\n","import { DEBUG_BUILD } from './debug-build.js';\nimport { consoleSandbox, logger } from './logger.js';\n\n/** Regular expression used to parse a Dsn. */\nconst DSN_REGEX = /^(?:(\\w+):)\\/\\/(?:(\\w+)(?::(\\w+)?)?@)([\\w.-]+)(?::(\\d+))?\\/(.+)/;\n\nfunction isValidProtocol(protocol) {\n return protocol === 'http' || protocol === 'https';\n}\n\n/**\n * Renders the string representation of this Dsn.\n *\n * By default, this will render the public representation without the password\n * component. To get the deprecated private representation, set `withPassword`\n * to true.\n *\n * @param withPassword When set to true, the password will be included.\n */\nfunction dsnToString(dsn, withPassword = false) {\n const { host, path, pass, port, projectId, protocol, publicKey } = dsn;\n return (\n `${protocol}://${publicKey}${withPassword && pass ? `:${pass}` : ''}` +\n `@${host}${port ? `:${port}` : ''}/${path ? `${path}/` : path}${projectId}`\n );\n}\n\n/**\n * Parses a Dsn from a given string.\n *\n * @param str A Dsn as string\n * @returns Dsn as DsnComponents or undefined if @param str is not a valid DSN string\n */\nfunction dsnFromString(str) {\n const match = DSN_REGEX.exec(str);\n\n if (!match) {\n // This should be logged to the console\n consoleSandbox(() => {\n // eslint-disable-next-line no-console\n console.error(`Invalid Sentry Dsn: ${str}`);\n });\n return undefined;\n }\n\n const [protocol, publicKey, pass = '', host, port = '', lastPath] = match.slice(1);\n let path = '';\n let projectId = lastPath;\n\n const split = projectId.split('/');\n if (split.length > 1) {\n path = split.slice(0, -1).join('/');\n projectId = split.pop() ;\n }\n\n if (projectId) {\n const projectMatch = projectId.match(/^\\d+/);\n if (projectMatch) {\n projectId = projectMatch[0];\n }\n }\n\n return dsnFromComponents({ host, pass, path, projectId, port, protocol: protocol , publicKey });\n}\n\nfunction dsnFromComponents(components) {\n return {\n protocol: components.protocol,\n publicKey: components.publicKey || '',\n pass: components.pass || '',\n host: components.host,\n port: components.port || '',\n path: components.path || '',\n projectId: components.projectId,\n };\n}\n\nfunction validateDsn(dsn) {\n if (!DEBUG_BUILD) {\n return true;\n }\n\n const { port, projectId, protocol } = dsn;\n\n const requiredComponents = ['protocol', 'publicKey', 'host', 'projectId'];\n const hasMissingRequiredComponent = requiredComponents.find(component => {\n if (!dsn[component]) {\n logger.error(`Invalid Sentry Dsn: ${component} missing`);\n return true;\n }\n return false;\n });\n\n if (hasMissingRequiredComponent) {\n return false;\n }\n\n if (!projectId.match(/^\\d+$/)) {\n logger.error(`Invalid Sentry Dsn: Invalid projectId ${projectId}`);\n return false;\n }\n\n if (!isValidProtocol(protocol)) {\n logger.error(`Invalid Sentry Dsn: Invalid protocol ${protocol}`);\n return false;\n }\n\n if (port && isNaN(parseInt(port, 10))) {\n logger.error(`Invalid Sentry Dsn: Invalid port ${port}`);\n return false;\n }\n\n return true;\n}\n\n/**\n * Creates a valid Sentry Dsn object, identifying a Sentry instance and project.\n * @returns a valid DsnComponents object or `undefined` if @param from is an invalid DSN source\n */\nfunction makeDsn(from) {\n const components = typeof from === 'string' ? dsnFromString(from) : dsnFromComponents(from);\n if (!components || !validateDsn(components)) {\n return undefined;\n }\n return components;\n}\n\nexport { dsnFromString, dsnToString, makeDsn };\n","import { makeDsn, dsnToString, urlEncode } from '@sentry/utils';\n\nconst SENTRY_API_VERSION = '7';\n\n/** Returns the prefix to construct Sentry ingestion API endpoints. */\nfunction getBaseApiEndpoint(dsn) {\n const protocol = dsn.protocol ? `${dsn.protocol}:` : '';\n const port = dsn.port ? `:${dsn.port}` : '';\n return `${protocol}//${dsn.host}${port}${dsn.path ? `/${dsn.path}` : ''}/api/`;\n}\n\n/** Returns the ingest API endpoint for target. */\nfunction _getIngestEndpoint(dsn) {\n return `${getBaseApiEndpoint(dsn)}${dsn.projectId}/envelope/`;\n}\n\n/** Returns a URL-encoded string with auth config suitable for a query string. */\nfunction _encodedAuth(dsn, sdkInfo) {\n return urlEncode({\n // We send only the minimum set of required information. See\n // https://github.com/getsentry/sentry-javascript/issues/2572.\n sentry_key: dsn.publicKey,\n sentry_version: SENTRY_API_VERSION,\n ...(sdkInfo && { sentry_client: `${sdkInfo.name}/${sdkInfo.version}` }),\n });\n}\n\n/**\n * Returns the envelope endpoint URL with auth in the query string.\n *\n * Sending auth as part of the query string and not as custom HTTP headers avoids CORS preflight requests.\n */\nfunction getEnvelopeEndpointWithUrlEncodedAuth(\n dsn,\n // TODO (v8): Remove `tunnelOrOptions` in favor of `options`, and use the substitute code below\n // options: ClientOptions = {} as ClientOptions,\n tunnelOrOptions = {} ,\n) {\n // TODO (v8): Use this code instead\n // const { tunnel, _metadata = {} } = options;\n // return tunnel ? tunnel : `${_getIngestEndpoint(dsn)}?${_encodedAuth(dsn, _metadata.sdk)}`;\n\n const tunnel = typeof tunnelOrOptions === 'string' ? tunnelOrOptions : tunnelOrOptions.tunnel;\n const sdkInfo =\n typeof tunnelOrOptions === 'string' || !tunnelOrOptions._metadata ? undefined : tunnelOrOptions._metadata.sdk;\n\n return tunnel ? tunnel : `${_getIngestEndpoint(dsn)}?${_encodedAuth(dsn, sdkInfo)}`;\n}\n\n/** Returns the url to the report dialog endpoint. */\nfunction getReportDialogEndpoint(\n dsnLike,\n dialogOptions\n\n,\n) {\n const dsn = makeDsn(dsnLike);\n if (!dsn) {\n return '';\n }\n\n const endpoint = `${getBaseApiEndpoint(dsn)}embed/error-page/`;\n\n let encodedOptions = `dsn=${dsnToString(dsn)}`;\n for (const key in dialogOptions) {\n if (key === 'dsn') {\n continue;\n }\n\n if (key === 'onClose') {\n continue;\n }\n\n if (key === 'user') {\n const user = dialogOptions.user;\n if (!user) {\n continue;\n }\n if (user.name) {\n encodedOptions += `&name=${encodeURIComponent(user.name)}`;\n }\n if (user.email) {\n encodedOptions += `&email=${encodeURIComponent(user.email)}`;\n }\n } else {\n encodedOptions += `&${encodeURIComponent(key)}=${encodeURIComponent(dialogOptions[key] )}`;\n }\n }\n\n return `${endpoint}?${encodedOptions}`;\n}\n\nexport { getEnvelopeEndpointWithUrlEncodedAuth, getReportDialogEndpoint };\n","import { DEBUG_BUILD } from './debug-build.js';\nimport { logger } from './logger.js';\nimport { getGlobalObject } from './worldwide.js';\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\n/**\n * Tells whether current environment supports ErrorEvent objects\n * {@link supportsErrorEvent}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsErrorEvent() {\n try {\n new ErrorEvent('');\n return true;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Tells whether current environment supports DOMError objects\n * {@link supportsDOMError}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsDOMError() {\n try {\n // Chrome: VM89:1 Uncaught TypeError: Failed to construct 'DOMError':\n // 1 argument required, but only 0 present.\n // @ts-expect-error It really needs 1 argument, not 0.\n new DOMError('');\n return true;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Tells whether current environment supports DOMException objects\n * {@link supportsDOMException}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsDOMException() {\n try {\n new DOMException('');\n return true;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Tells whether current environment supports Fetch API\n * {@link supportsFetch}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsFetch() {\n if (!('fetch' in WINDOW)) {\n return false;\n }\n\n try {\n new Headers();\n new Request('http://www.example.com');\n new Response();\n return true;\n } catch (e) {\n return false;\n }\n}\n/**\n * isNativeFetch checks if the given function is a native implementation of fetch()\n */\n// eslint-disable-next-line @typescript-eslint/ban-types\nfunction isNativeFetch(func) {\n return func && /^function fetch\\(\\)\\s+\\{\\s+\\[native code\\]\\s+\\}$/.test(func.toString());\n}\n\n/**\n * Tells whether current environment supports Fetch API natively\n * {@link supportsNativeFetch}.\n *\n * @returns true if `window.fetch` is natively implemented, false otherwise\n */\nfunction supportsNativeFetch() {\n if (typeof EdgeRuntime === 'string') {\n return true;\n }\n\n if (!supportsFetch()) {\n return false;\n }\n\n // Fast path to avoid DOM I/O\n // eslint-disable-next-line @typescript-eslint/unbound-method\n if (isNativeFetch(WINDOW.fetch)) {\n return true;\n }\n\n // window.fetch is implemented, but is polyfilled or already wrapped (e.g: by a chrome extension)\n // so create a \"pure\" iframe to see if that has native fetch\n let result = false;\n const doc = WINDOW.document;\n // eslint-disable-next-line deprecation/deprecation\n if (doc && typeof (doc.createElement ) === 'function') {\n try {\n const sandbox = doc.createElement('iframe');\n sandbox.hidden = true;\n doc.head.appendChild(sandbox);\n if (sandbox.contentWindow && sandbox.contentWindow.fetch) {\n // eslint-disable-next-line @typescript-eslint/unbound-method\n result = isNativeFetch(sandbox.contentWindow.fetch);\n }\n doc.head.removeChild(sandbox);\n } catch (err) {\n DEBUG_BUILD &&\n logger.warn('Could not create sandbox iframe for pure fetch check, bailing to window.fetch: ', err);\n }\n }\n\n return result;\n}\n\n/**\n * Tells whether current environment supports ReportingObserver API\n * {@link supportsReportingObserver}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsReportingObserver() {\n return 'ReportingObserver' in WINDOW;\n}\n\n/**\n * Tells whether current environment supports Referrer Policy API\n * {@link supportsReferrerPolicy}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsReferrerPolicy() {\n // Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default'\n // (see https://caniuse.com/#feat=referrer-policy),\n // it doesn't. And it throws an exception instead of ignoring this parameter...\n // REF: https://github.com/getsentry/raven-js/issues/1233\n\n if (!supportsFetch()) {\n return false;\n }\n\n try {\n new Request('_', {\n referrerPolicy: 'origin' ,\n });\n return true;\n } catch (e) {\n return false;\n }\n}\n\nexport { isNativeFetch, supportsDOMError, supportsDOMException, supportsErrorEvent, supportsFetch, supportsNativeFetch, supportsReferrerPolicy, supportsReportingObserver };\n","import { getGlobalObject } from '../worldwide.js';\n\n// Based on https://github.com/angular/angular.js/pull/13945/files\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\n/**\n * Tells whether current environment supports History API\n * {@link supportsHistory}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsHistory() {\n // NOTE: in Chrome App environment, touching history.pushState, *even inside\n // a try/catch block*, will cause Chrome to output an error to console.error\n // borrowed from: https://github.com/angular/angular.js/pull/13945/files\n /* eslint-disable @typescript-eslint/no-unsafe-member-access */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const chrome = (WINDOW ).chrome;\n const isChromePackagedApp = chrome && chrome.app && chrome.app.runtime;\n /* eslint-enable @typescript-eslint/no-unsafe-member-access */\n const hasHistoryApi = 'history' in WINDOW && !!WINDOW.history.pushState && !!WINDOW.history.replaceState;\n\n return !isChromePackagedApp && hasHistoryApi;\n}\n\nexport { supportsHistory };\n","import { DEBUG_BUILD } from '../debug-build.js';\nimport { logger } from '../logger.js';\nimport { getFunctionName } from '../stacktrace.js';\n\n// We keep the handlers globally\nconst handlers = {};\nconst instrumented = {};\n\n/** Add a handler function. */\nfunction addHandler(type, handler) {\n handlers[type] = handlers[type] || [];\n (handlers[type] ).push(handler);\n}\n\n/**\n * Reset all instrumentation handlers.\n * This can be used by tests to ensure we have a clean slate of instrumentation handlers.\n */\nfunction resetInstrumentationHandlers() {\n Object.keys(handlers).forEach(key => {\n handlers[key ] = undefined;\n });\n}\n\n/** Maybe run an instrumentation function, unless it was already called. */\nfunction maybeInstrument(type, instrumentFn) {\n if (!instrumented[type]) {\n instrumentFn();\n instrumented[type] = true;\n }\n}\n\n/** Trigger handlers for a given instrumentation type. */\nfunction triggerHandlers(type, data) {\n const typeHandlers = type && handlers[type];\n if (!typeHandlers) {\n return;\n }\n\n for (const handler of typeHandlers) {\n try {\n handler(data);\n } catch (e) {\n DEBUG_BUILD &&\n logger.error(\n `Error while triggering instrumentation handler.\\nType: ${type}\\nName: ${getFunctionName(handler)}\\nError:`,\n e,\n );\n }\n }\n}\n\nexport { addHandler, maybeInstrument, resetInstrumentationHandlers, triggerHandlers };\n","import { fill } from '../object.js';\nimport '../debug-build.js';\nimport '../logger.js';\nimport { GLOBAL_OBJ } from '../worldwide.js';\nimport { supportsHistory } from '../vendor/supportsHistory.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\nconst WINDOW = GLOBAL_OBJ ;\n\nlet lastHref;\n\n/**\n * Add an instrumentation handler for when a fetch request happens.\n * The handler function is called once when the request starts and once when it ends,\n * which can be identified by checking if it has an `endTimestamp`.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addHistoryInstrumentationHandler(handler) {\n const type = 'history';\n addHandler(type, handler);\n maybeInstrument(type, instrumentHistory);\n}\n\nfunction instrumentHistory() {\n if (!supportsHistory()) {\n return;\n }\n\n const oldOnPopState = WINDOW.onpopstate;\n WINDOW.onpopstate = function ( ...args) {\n const to = WINDOW.location.href;\n // keep track of the current URL state, as we always receive only the updated state\n const from = lastHref;\n lastHref = to;\n const handlerData = { from, to };\n triggerHandlers('history', handlerData);\n if (oldOnPopState) {\n // Apparently this can throw in Firefox when incorrectly implemented plugin is installed.\n // https://github.com/getsentry/sentry-javascript/issues/3344\n // https://github.com/bugsnag/bugsnag-js/issues/469\n try {\n return oldOnPopState.apply(this, args);\n } catch (_oO) {\n // no-empty\n }\n }\n };\n\n function historyReplacementFunction(originalHistoryFunction) {\n return function ( ...args) {\n const url = args.length > 2 ? args[2] : undefined;\n if (url) {\n // coerce to string (this is what pushState does)\n const from = lastHref;\n const to = String(url);\n // keep track of the current URL state, as we always receive only the updated state\n lastHref = to;\n const handlerData = { from, to };\n triggerHandlers('history', handlerData);\n }\n return originalHistoryFunction.apply(this, args);\n };\n }\n\n fill(WINDOW.history, 'pushState', historyReplacementFunction);\n fill(WINDOW.history, 'replaceState', historyReplacementFunction);\n}\n\nexport { addHistoryInstrumentationHandler };\n","import { dsnToString } from './dsn.js';\nimport { normalize } from './normalize.js';\nimport { dropUndefinedKeys } from './object.js';\n\n/**\n * Creates an envelope.\n * Make sure to always explicitly provide the generic to this function\n * so that the envelope types resolve correctly.\n */\nfunction createEnvelope(headers, items = []) {\n return [headers, items] ;\n}\n\n/**\n * Add an item to an envelope.\n * Make sure to always explicitly provide the generic to this function\n * so that the envelope types resolve correctly.\n */\nfunction addItemToEnvelope(envelope, newItem) {\n const [headers, items] = envelope;\n return [headers, [...items, newItem]] ;\n}\n\n/**\n * Convenience function to loop through the items and item types of an envelope.\n * (This function was mostly created because working with envelope types is painful at the moment)\n *\n * If the callback returns true, the rest of the items will be skipped.\n */\nfunction forEachEnvelopeItem(\n envelope,\n callback,\n) {\n const envelopeItems = envelope[1];\n\n for (const envelopeItem of envelopeItems) {\n const envelopeItemType = envelopeItem[0].type;\n const result = callback(envelopeItem, envelopeItemType);\n\n if (result) {\n return true;\n }\n }\n\n return false;\n}\n\n/**\n * Returns true if the envelope contains any of the given envelope item types\n */\nfunction envelopeContainsItemType(envelope, types) {\n return forEachEnvelopeItem(envelope, (_, type) => types.includes(type));\n}\n\n/**\n * Encode a string to UTF8.\n */\nfunction encodeUTF8(input, textEncoder) {\n const utf8 = textEncoder || new TextEncoder();\n return utf8.encode(input);\n}\n\n/**\n * Serializes an envelope.\n */\nfunction serializeEnvelope(envelope, textEncoder) {\n const [envHeaders, items] = envelope;\n\n // Initially we construct our envelope as a string and only convert to binary chunks if we encounter binary data\n let parts = JSON.stringify(envHeaders);\n\n function append(next) {\n if (typeof parts === 'string') {\n parts = typeof next === 'string' ? parts + next : [encodeUTF8(parts, textEncoder), next];\n } else {\n parts.push(typeof next === 'string' ? encodeUTF8(next, textEncoder) : next);\n }\n }\n\n for (const item of items) {\n const [itemHeaders, payload] = item;\n\n append(`\\n${JSON.stringify(itemHeaders)}\\n`);\n\n if (typeof payload === 'string' || payload instanceof Uint8Array) {\n append(payload);\n } else {\n let stringifiedPayload;\n try {\n stringifiedPayload = JSON.stringify(payload);\n } catch (e) {\n // In case, despite all our efforts to keep `payload` circular-dependency-free, `JSON.strinify()` still\n // fails, we try again after normalizing it again with infinite normalization depth. This of course has a\n // performance impact but in this case a performance hit is better than throwing.\n stringifiedPayload = JSON.stringify(normalize(payload));\n }\n append(stringifiedPayload);\n }\n }\n\n return typeof parts === 'string' ? parts : concatBuffers(parts);\n}\n\nfunction concatBuffers(buffers) {\n const totalLength = buffers.reduce((acc, buf) => acc + buf.length, 0);\n\n const merged = new Uint8Array(totalLength);\n let offset = 0;\n for (const buffer of buffers) {\n merged.set(buffer, offset);\n offset += buffer.length;\n }\n\n return merged;\n}\n\n/**\n * Parses an envelope\n */\nfunction parseEnvelope(\n env,\n textEncoder,\n textDecoder,\n) {\n let buffer = typeof env === 'string' ? textEncoder.encode(env) : env;\n\n function readBinary(length) {\n const bin = buffer.subarray(0, length);\n // Replace the buffer with the remaining data excluding trailing newline\n buffer = buffer.subarray(length + 1);\n return bin;\n }\n\n function readJson() {\n let i = buffer.indexOf(0xa);\n // If we couldn't find a newline, we must have found the end of the buffer\n if (i < 0) {\n i = buffer.length;\n }\n\n return JSON.parse(textDecoder.decode(readBinary(i))) ;\n }\n\n const envelopeHeader = readJson();\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const items = [];\n\n while (buffer.length) {\n const itemHeader = readJson();\n const binaryLength = typeof itemHeader.length === 'number' ? itemHeader.length : undefined;\n\n items.push([itemHeader, binaryLength ? readBinary(binaryLength) : readJson()]);\n }\n\n return [envelopeHeader, items];\n}\n\n/**\n * Creates attachment envelope items\n */\nfunction createAttachmentEnvelopeItem(\n attachment,\n textEncoder,\n) {\n const buffer = typeof attachment.data === 'string' ? encodeUTF8(attachment.data, textEncoder) : attachment.data;\n\n return [\n dropUndefinedKeys({\n type: 'attachment',\n length: buffer.length,\n filename: attachment.filename,\n content_type: attachment.contentType,\n attachment_type: attachment.attachmentType,\n }),\n buffer,\n ];\n}\n\nconst ITEM_TYPE_TO_DATA_CATEGORY_MAP = {\n session: 'session',\n sessions: 'session',\n attachment: 'attachment',\n transaction: 'transaction',\n event: 'error',\n client_report: 'internal',\n user_report: 'default',\n profile: 'profile',\n replay_event: 'replay',\n replay_recording: 'replay',\n check_in: 'monitor',\n feedback: 'feedback',\n // TODO: This is a temporary workaround until we have a proper data category for metrics\n statsd: 'unknown',\n};\n\n/**\n * Maps the type of an envelope item to a data category.\n */\nfunction envelopeItemTypeToDataCategory(type) {\n return ITEM_TYPE_TO_DATA_CATEGORY_MAP[type];\n}\n\n/** Extracts the minimal SDK info from from the metadata or an events */\nfunction getSdkMetadataForEnvelopeHeader(metadataOrEvent) {\n if (!metadataOrEvent || !metadataOrEvent.sdk) {\n return;\n }\n const { name, version } = metadataOrEvent.sdk;\n return { name, version };\n}\n\n/**\n * Creates event envelope headers, based on event, sdk info and tunnel\n * Note: This function was extracted from the core package to make it available in Replay\n */\nfunction createEventEnvelopeHeaders(\n event,\n sdkInfo,\n tunnel,\n dsn,\n) {\n const dynamicSamplingContext = event.sdkProcessingMetadata && event.sdkProcessingMetadata.dynamicSamplingContext;\n return {\n event_id: event.event_id ,\n sent_at: new Date().toISOString(),\n ...(sdkInfo && { sdk: sdkInfo }),\n ...(!!tunnel && dsn && { dsn: dsnToString(dsn) }),\n ...(dynamicSamplingContext && {\n trace: dropUndefinedKeys({ ...dynamicSamplingContext }),\n }),\n };\n}\n\nexport { addItemToEnvelope, createAttachmentEnvelopeItem, createEnvelope, createEventEnvelopeHeaders, envelopeContainsItemType, envelopeItemTypeToDataCategory, forEachEnvelopeItem, getSdkMetadataForEnvelopeHeader, parseEnvelope, serializeEnvelope };\n","/** An error emitted by Sentry SDKs and related utilities. */\nclass SentryError extends Error {\n /** Display name of this error instance. */\n\n constructor( message, logLevel = 'warn') {\n super(message);this.message = message;\n this.name = new.target.prototype.constructor.name;\n // This sets the prototype to be `Error`, not `SentryError`. It's unclear why we do this, but commenting this line\n // out causes various (seemingly totally unrelated) playwright tests consistently time out. FYI, this makes\n // instances of `SentryError` fail `obj instanceof SentryError` checks.\n Object.setPrototypeOf(this, new.target.prototype);\n this.logLevel = logLevel;\n }\n}\n\nexport { SentryError };\n","import { makeDsn, logger, checkOrSetAlreadyCaught, isParameterizedString, isPrimitive, resolvedSyncPromise, addItemToEnvelope, createAttachmentEnvelopeItem, SyncPromise, rejectedSyncPromise, SentryError, isThenable, isPlainObject } from '@sentry/utils';\nimport { getEnvelopeEndpointWithUrlEncodedAuth } from './api.js';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { createEventEnvelope, createSessionEnvelope } from './envelope.js';\nimport { getClient } from './exports.js';\nimport { getIsolationScope } from './hub.js';\nimport { setupIntegration, setupIntegrations } from './integration.js';\nimport { createMetricEnvelope } from './metrics/envelope.js';\nimport { updateSession } from './session.js';\nimport { getDynamicSamplingContextFromClient } from './tracing/dynamicSamplingContext.js';\nimport { prepareEvent } from './utils/prepareEvent.js';\n\nconst ALREADY_SEEN_ERROR = \"Not capturing exception because it's already been captured.\";\n\n/**\n * Base implementation for all JavaScript SDK clients.\n *\n * Call the constructor with the corresponding options\n * specific to the client subclass. To access these options later, use\n * {@link Client.getOptions}.\n *\n * If a Dsn is specified in the options, it will be parsed and stored. Use\n * {@link Client.getDsn} to retrieve the Dsn at any moment. In case the Dsn is\n * invalid, the constructor will throw a {@link SentryException}. Note that\n * without a valid Dsn, the SDK will not send any events to Sentry.\n *\n * Before sending an event, it is passed through\n * {@link BaseClient._prepareEvent} to add SDK information and scope data\n * (breadcrumbs and context). To add more custom information, override this\n * method and extend the resulting prepared event.\n *\n * To issue automatically created events (e.g. via instrumentation), use\n * {@link Client.captureEvent}. It will prepare the event and pass it through\n * the callback lifecycle. To issue auto-breadcrumbs, use\n * {@link Client.addBreadcrumb}.\n *\n * @example\n * class NodeClient extends BaseClient {\n * public constructor(options: NodeOptions) {\n * super(options);\n * }\n *\n * // ...\n * }\n */\nclass BaseClient {\n /**\n * A reference to a metrics aggregator\n *\n * @experimental Note this is alpha API. It may experience breaking changes in the future.\n */\n\n /** Options passed to the SDK. */\n\n /** The client Dsn, if specified in options. Without this Dsn, the SDK will be disabled. */\n\n /** Array of set up integrations. */\n\n /** Indicates whether this client's integrations have been set up. */\n\n /** Number of calls being processed */\n\n /** Holds flushable */\n\n // eslint-disable-next-line @typescript-eslint/ban-types\n\n /**\n * Initializes this client instance.\n *\n * @param options Options for the client.\n */\n constructor(options) {\n this._options = options;\n this._integrations = {};\n this._integrationsInitialized = false;\n this._numProcessing = 0;\n this._outcomes = {};\n this._hooks = {};\n this._eventProcessors = [];\n\n if (options.dsn) {\n this._dsn = makeDsn(options.dsn);\n } else {\n DEBUG_BUILD && logger.warn('No DSN provided, client will not send events.');\n }\n\n if (this._dsn) {\n const url = getEnvelopeEndpointWithUrlEncodedAuth(this._dsn, options);\n this._transport = options.transport({\n recordDroppedEvent: this.recordDroppedEvent.bind(this),\n ...options.transportOptions,\n url,\n });\n }\n }\n\n /**\n * @inheritDoc\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types\n captureException(exception, hint, scope) {\n // ensure we haven't captured this very object before\n if (checkOrSetAlreadyCaught(exception)) {\n DEBUG_BUILD && logger.log(ALREADY_SEEN_ERROR);\n return;\n }\n\n let eventId = hint && hint.event_id;\n\n this._process(\n this.eventFromException(exception, hint)\n .then(event => this._captureEvent(event, hint, scope))\n .then(result => {\n eventId = result;\n }),\n );\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n level,\n hint,\n scope,\n ) {\n let eventId = hint && hint.event_id;\n\n const eventMessage = isParameterizedString(message) ? message : String(message);\n\n const promisedEvent = isPrimitive(message)\n ? this.eventFromMessage(eventMessage, level, hint)\n : this.eventFromException(message, hint);\n\n this._process(\n promisedEvent\n .then(event => this._captureEvent(event, hint, scope))\n .then(result => {\n eventId = result;\n }),\n );\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureEvent(event, hint, scope) {\n // ensure we haven't captured this very object before\n if (hint && hint.originalException && checkOrSetAlreadyCaught(hint.originalException)) {\n DEBUG_BUILD && logger.log(ALREADY_SEEN_ERROR);\n return;\n }\n\n let eventId = hint && hint.event_id;\n\n this._process(\n this._captureEvent(event, hint, scope).then(result => {\n eventId = result;\n }),\n );\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureSession(session) {\n if (!(typeof session.release === 'string')) {\n DEBUG_BUILD && logger.warn('Discarded session because of missing or non-string release');\n } else {\n this.sendSession(session);\n // After sending, we set init false to indicate it's not the first occurrence\n updateSession(session, { init: false });\n }\n }\n\n /**\n * @inheritDoc\n */\n getDsn() {\n return this._dsn;\n }\n\n /**\n * @inheritDoc\n */\n getOptions() {\n return this._options;\n }\n\n /**\n * @see SdkMetadata in @sentry/types\n *\n * @return The metadata of the SDK\n */\n getSdkMetadata() {\n return this._options._metadata;\n }\n\n /**\n * @inheritDoc\n */\n getTransport() {\n return this._transport;\n }\n\n /**\n * @inheritDoc\n */\n flush(timeout) {\n const transport = this._transport;\n if (transport) {\n if (this.metricsAggregator) {\n this.metricsAggregator.flush();\n }\n return this._isClientDoneProcessing(timeout).then(clientFinished => {\n return transport.flush(timeout).then(transportFlushed => clientFinished && transportFlushed);\n });\n } else {\n return resolvedSyncPromise(true);\n }\n }\n\n /**\n * @inheritDoc\n */\n close(timeout) {\n return this.flush(timeout).then(result => {\n this.getOptions().enabled = false;\n if (this.metricsAggregator) {\n this.metricsAggregator.close();\n }\n return result;\n });\n }\n\n /** Get all installed event processors. */\n getEventProcessors() {\n return this._eventProcessors;\n }\n\n /** @inheritDoc */\n addEventProcessor(eventProcessor) {\n this._eventProcessors.push(eventProcessor);\n }\n\n /**\n * This is an internal function to setup all integrations that should run on the client.\n * @deprecated Use `client.init()` instead.\n */\n setupIntegrations(forceInitialize) {\n if ((forceInitialize && !this._integrationsInitialized) || (this._isEnabled() && !this._integrationsInitialized)) {\n this._setupIntegrations();\n }\n }\n\n /** @inheritdoc */\n init() {\n if (this._isEnabled()) {\n this._setupIntegrations();\n }\n }\n\n /**\n * Gets an installed integration by its `id`.\n *\n * @returns The installed integration or `undefined` if no integration with that `id` was installed.\n * @deprecated Use `getIntegrationByName()` instead.\n */\n getIntegrationById(integrationId) {\n return this.getIntegrationByName(integrationId);\n }\n\n /**\n * Gets an installed integration by its name.\n *\n * @returns The installed integration or `undefined` if no integration with that `name` was installed.\n */\n getIntegrationByName(integrationName) {\n return this._integrations[integrationName] ;\n }\n\n /**\n * Returns the client's instance of the given integration class, it any.\n * @deprecated Use `getIntegrationByName()` instead.\n */\n getIntegration(integration) {\n try {\n return (this._integrations[integration.id] ) || null;\n } catch (_oO) {\n DEBUG_BUILD && logger.warn(`Cannot retrieve integration ${integration.id} from the current Client`);\n return null;\n }\n }\n\n /**\n * @inheritDoc\n */\n addIntegration(integration) {\n setupIntegration(this, integration, this._integrations);\n }\n\n /**\n * @inheritDoc\n */\n sendEvent(event, hint = {}) {\n this.emit('beforeSendEvent', event, hint);\n\n let env = createEventEnvelope(event, this._dsn, this._options._metadata, this._options.tunnel);\n\n for (const attachment of hint.attachments || []) {\n env = addItemToEnvelope(\n env,\n createAttachmentEnvelopeItem(\n attachment,\n this._options.transportOptions && this._options.transportOptions.textEncoder,\n ),\n );\n }\n\n const promise = this._sendEnvelope(env);\n if (promise) {\n promise.then(sendResponse => this.emit('afterSendEvent', event, sendResponse), null);\n }\n }\n\n /**\n * @inheritDoc\n */\n sendSession(session) {\n const env = createSessionEnvelope(session, this._dsn, this._options._metadata, this._options.tunnel);\n\n // _sendEnvelope should not throw\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this._sendEnvelope(env);\n }\n\n /**\n * @inheritDoc\n */\n recordDroppedEvent(reason, category, _event) {\n // Note: we use `event` in replay, where we overwrite this hook.\n\n if (this._options.sendClientReports) {\n // We want to track each category (error, transaction, session, replay_event) separately\n // but still keep the distinction between different type of outcomes.\n // We could use nested maps, but it's much easier to read and type this way.\n // A correct type for map-based implementation if we want to go that route\n // would be `Partial>>>`\n // With typescript 4.1 we could even use template literal types\n const key = `${reason}:${category}`;\n DEBUG_BUILD && logger.log(`Adding outcome: \"${key}\"`);\n\n // The following works because undefined + 1 === NaN and NaN is falsy\n this._outcomes[key] = this._outcomes[key] + 1 || 1;\n }\n }\n\n /**\n * @inheritDoc\n */\n captureAggregateMetrics(metricBucketItems) {\n DEBUG_BUILD && logger.log(`Flushing aggregated metrics, number of metrics: ${metricBucketItems.length}`);\n const metricsEnvelope = createMetricEnvelope(\n metricBucketItems,\n this._dsn,\n this._options._metadata,\n this._options.tunnel,\n );\n\n // _sendEnvelope should not throw\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this._sendEnvelope(metricsEnvelope);\n }\n\n // Keep on() & emit() signatures in sync with types' client.ts interface\n /* eslint-disable @typescript-eslint/unified-signatures */\n\n /** @inheritdoc */\n\n /** @inheritdoc */\n on(hook, callback) {\n if (!this._hooks[hook]) {\n this._hooks[hook] = [];\n }\n\n // @ts-expect-error We assue the types are correct\n this._hooks[hook].push(callback);\n }\n\n /** @inheritdoc */\n\n /** @inheritdoc */\n emit(hook, ...rest) {\n if (this._hooks[hook]) {\n this._hooks[hook].forEach(callback => callback(...rest));\n }\n }\n\n /* eslint-enable @typescript-eslint/unified-signatures */\n\n /** Setup integrations for this client. */\n _setupIntegrations() {\n this._integrations = setupIntegrations(this, this._options.integrations);\n // TODO v8: We don't need this flag anymore\n this._integrationsInitialized = true;\n }\n\n /** Updates existing session based on the provided event */\n _updateSessionFromEvent(session, event) {\n let crashed = false;\n let errored = false;\n const exceptions = event.exception && event.exception.values;\n\n if (exceptions) {\n errored = true;\n\n for (const ex of exceptions) {\n const mechanism = ex.mechanism;\n if (mechanism && mechanism.handled === false) {\n crashed = true;\n break;\n }\n }\n }\n\n // A session is updated and that session update is sent in only one of the two following scenarios:\n // 1. Session with non terminal status and 0 errors + an error occurred -> Will set error count to 1 and send update\n // 2. Session with non terminal status and 1 error + a crash occurred -> Will set status crashed and send update\n const sessionNonTerminal = session.status === 'ok';\n const shouldUpdateAndSend = (sessionNonTerminal && session.errors === 0) || (sessionNonTerminal && crashed);\n\n if (shouldUpdateAndSend) {\n updateSession(session, {\n ...(crashed && { status: 'crashed' }),\n errors: session.errors || Number(errored || crashed),\n });\n this.captureSession(session);\n }\n }\n\n /**\n * Determine if the client is finished processing. Returns a promise because it will wait `timeout` ms before saying\n * \"no\" (resolving to `false`) in order to give the client a chance to potentially finish first.\n *\n * @param timeout The time, in ms, after which to resolve to `false` if the client is still busy. Passing `0` (or not\n * passing anything) will make the promise wait as long as it takes for processing to finish before resolving to\n * `true`.\n * @returns A promise which will resolve to `true` if processing is already done or finishes before the timeout, and\n * `false` otherwise\n */\n _isClientDoneProcessing(timeout) {\n return new SyncPromise(resolve => {\n let ticked = 0;\n const tick = 1;\n\n const interval = setInterval(() => {\n if (this._numProcessing == 0) {\n clearInterval(interval);\n resolve(true);\n } else {\n ticked += tick;\n if (timeout && ticked >= timeout) {\n clearInterval(interval);\n resolve(false);\n }\n }\n }, tick);\n });\n }\n\n /** Determines whether this SDK is enabled and a transport is present. */\n _isEnabled() {\n return this.getOptions().enabled !== false && this._transport !== undefined;\n }\n\n /**\n * Adds common information to events.\n *\n * The information includes release and environment from `options`,\n * breadcrumbs and context (extra, tags and user) from the scope.\n *\n * Information that is already present in the event is never overwritten. For\n * nested objects, such as the context, keys are merged.\n *\n * @param event The original event.\n * @param hint May contain additional information about the original exception.\n * @param scope A scope containing event metadata.\n * @returns A new event with more information.\n */\n _prepareEvent(\n event,\n hint,\n scope,\n isolationScope = getIsolationScope(),\n ) {\n const options = this.getOptions();\n const integrations = Object.keys(this._integrations);\n if (!hint.integrations && integrations.length > 0) {\n hint.integrations = integrations;\n }\n\n this.emit('preprocessEvent', event, hint);\n\n return prepareEvent(options, event, hint, scope, this, isolationScope).then(evt => {\n if (evt === null) {\n return evt;\n }\n\n // If a trace context is not set on the event, we use the propagationContext set on the event to\n // generate a trace context. If the propagationContext does not have a dynamic sampling context, we\n // also generate one for it.\n const { propagationContext } = evt.sdkProcessingMetadata || {};\n const trace = evt.contexts && evt.contexts.trace;\n if (!trace && propagationContext) {\n const { traceId: trace_id, spanId, parentSpanId, dsc } = propagationContext ;\n evt.contexts = {\n trace: {\n trace_id,\n span_id: spanId,\n parent_span_id: parentSpanId,\n },\n ...evt.contexts,\n };\n\n const dynamicSamplingContext = dsc ? dsc : getDynamicSamplingContextFromClient(trace_id, this, scope);\n\n evt.sdkProcessingMetadata = {\n dynamicSamplingContext,\n ...evt.sdkProcessingMetadata,\n };\n }\n return evt;\n });\n }\n\n /**\n * Processes the event and logs an error in case of rejection\n * @param event\n * @param hint\n * @param scope\n */\n _captureEvent(event, hint = {}, scope) {\n return this._processEvent(event, hint, scope).then(\n finalEvent => {\n return finalEvent.event_id;\n },\n reason => {\n if (DEBUG_BUILD) {\n // If something's gone wrong, log the error as a warning. If it's just us having used a `SentryError` for\n // control flow, log just the message (no stack) as a log-level log.\n const sentryError = reason ;\n if (sentryError.logLevel === 'log') {\n logger.log(sentryError.message);\n } else {\n logger.warn(sentryError);\n }\n }\n return undefined;\n },\n );\n }\n\n /**\n * Processes an event (either error or message) and sends it to Sentry.\n *\n * This also adds breadcrumbs and context information to the event. However,\n * platform specific meta data (such as the User's IP address) must be added\n * by the SDK implementor.\n *\n *\n * @param event The event to send to Sentry.\n * @param hint May contain additional information about the original exception.\n * @param scope A scope containing event metadata.\n * @returns A SyncPromise that resolves with the event or rejects in case event was/will not be send.\n */\n _processEvent(event, hint, scope) {\n const options = this.getOptions();\n const { sampleRate } = options;\n\n const isTransaction = isTransactionEvent(event);\n const isError = isErrorEvent(event);\n const eventType = event.type || 'error';\n const beforeSendLabel = `before send for type \\`${eventType}\\``;\n\n // 1.0 === 100% events are sent\n // 0.0 === 0% events are sent\n // Sampling for transaction happens somewhere else\n if (isError && typeof sampleRate === 'number' && Math.random() > sampleRate) {\n this.recordDroppedEvent('sample_rate', 'error', event);\n return rejectedSyncPromise(\n new SentryError(\n `Discarding event because it's not included in the random sample (sampling rate = ${sampleRate})`,\n 'log',\n ),\n );\n }\n\n const dataCategory = eventType === 'replay_event' ? 'replay' : eventType;\n\n return this._prepareEvent(event, hint, scope)\n .then(prepared => {\n if (prepared === null) {\n this.recordDroppedEvent('event_processor', dataCategory, event);\n throw new SentryError('An event processor returned `null`, will not send event.', 'log');\n }\n\n const isInternalException = hint.data && (hint.data ).__sentry__ === true;\n if (isInternalException) {\n return prepared;\n }\n\n const result = processBeforeSend(options, prepared, hint);\n return _validateBeforeSendResult(result, beforeSendLabel);\n })\n .then(processedEvent => {\n if (processedEvent === null) {\n this.recordDroppedEvent('before_send', dataCategory, event);\n throw new SentryError(`${beforeSendLabel} returned \\`null\\`, will not send event.`, 'log');\n }\n\n const session = scope && scope.getSession();\n if (!isTransaction && session) {\n this._updateSessionFromEvent(session, processedEvent);\n }\n\n // None of the Sentry built event processor will update transaction name,\n // so if the transaction name has been changed by an event processor, we know\n // it has to come from custom event processor added by a user\n const transactionInfo = processedEvent.transaction_info;\n if (isTransaction && transactionInfo && processedEvent.transaction !== event.transaction) {\n const source = 'custom';\n processedEvent.transaction_info = {\n ...transactionInfo,\n source,\n };\n }\n\n this.sendEvent(processedEvent, hint);\n return processedEvent;\n })\n .then(null, reason => {\n if (reason instanceof SentryError) {\n throw reason;\n }\n\n this.captureException(reason, {\n data: {\n __sentry__: true,\n },\n originalException: reason,\n });\n throw new SentryError(\n `Event processing pipeline threw an error, original event will not be sent. Details have been sent as a new event.\\nReason: ${reason}`,\n );\n });\n }\n\n /**\n * Occupies the client with processing and event\n */\n _process(promise) {\n this._numProcessing++;\n void promise.then(\n value => {\n this._numProcessing--;\n return value;\n },\n reason => {\n this._numProcessing--;\n return reason;\n },\n );\n }\n\n /**\n * @inheritdoc\n */\n _sendEnvelope(envelope) {\n this.emit('beforeEnvelope', envelope);\n\n if (this._isEnabled() && this._transport) {\n return this._transport.send(envelope).then(null, reason => {\n DEBUG_BUILD && logger.error('Error while sending event:', reason);\n });\n } else {\n DEBUG_BUILD && logger.error('Transport disabled');\n }\n }\n\n /**\n * Clears outcomes on this client and returns them.\n */\n _clearOutcomes() {\n const outcomes = this._outcomes;\n this._outcomes = {};\n return Object.keys(outcomes).map(key => {\n const [reason, category] = key.split(':') ;\n return {\n reason,\n category,\n quantity: outcomes[key],\n };\n });\n }\n\n /**\n * @inheritDoc\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types\n\n}\n\n/**\n * Verifies that return value of configured `beforeSend` or `beforeSendTransaction` is of expected type, and returns the value if so.\n */\nfunction _validateBeforeSendResult(\n beforeSendResult,\n beforeSendLabel,\n) {\n const invalidValueError = `${beforeSendLabel} must return \\`null\\` or a valid event.`;\n if (isThenable(beforeSendResult)) {\n return beforeSendResult.then(\n event => {\n if (!isPlainObject(event) && event !== null) {\n throw new SentryError(invalidValueError);\n }\n return event;\n },\n e => {\n throw new SentryError(`${beforeSendLabel} rejected with ${e}`);\n },\n );\n } else if (!isPlainObject(beforeSendResult) && beforeSendResult !== null) {\n throw new SentryError(invalidValueError);\n }\n return beforeSendResult;\n}\n\n/**\n * Process the matching `beforeSendXXX` callback.\n */\nfunction processBeforeSend(\n options,\n event,\n hint,\n) {\n const { beforeSend, beforeSendTransaction } = options;\n\n if (isErrorEvent(event) && beforeSend) {\n return beforeSend(event, hint);\n }\n\n if (isTransactionEvent(event) && beforeSendTransaction) {\n return beforeSendTransaction(event, hint);\n }\n\n return event;\n}\n\nfunction isErrorEvent(event) {\n return event.type === undefined;\n}\n\nfunction isTransactionEvent(event) {\n return event.type === 'transaction';\n}\n\n/**\n * Add an event processor to the current client.\n * This event processor will run for all events processed by this client.\n */\nfunction addEventProcessor(callback) {\n const client = getClient();\n\n if (!client || !client.addEventProcessor) {\n return;\n }\n\n client.addEventProcessor(callback);\n}\n\nexport { BaseClient, addEventProcessor };\n","import { getSdkMetadataForEnvelopeHeader, dsnToString, createEnvelope, createEventEnvelopeHeaders } from '@sentry/utils';\n\n/**\n * Apply SdkInfo (name, version, packages, integrations) to the corresponding event key.\n * Merge with existing data if any.\n **/\nfunction enhanceEventWithSdkInfo(event, sdkInfo) {\n if (!sdkInfo) {\n return event;\n }\n event.sdk = event.sdk || {};\n event.sdk.name = event.sdk.name || sdkInfo.name;\n event.sdk.version = event.sdk.version || sdkInfo.version;\n event.sdk.integrations = [...(event.sdk.integrations || []), ...(sdkInfo.integrations || [])];\n event.sdk.packages = [...(event.sdk.packages || []), ...(sdkInfo.packages || [])];\n return event;\n}\n\n/** Creates an envelope from a Session */\nfunction createSessionEnvelope(\n session,\n dsn,\n metadata,\n tunnel,\n) {\n const sdkInfo = getSdkMetadataForEnvelopeHeader(metadata);\n const envelopeHeaders = {\n sent_at: new Date().toISOString(),\n ...(sdkInfo && { sdk: sdkInfo }),\n ...(!!tunnel && dsn && { dsn: dsnToString(dsn) }),\n };\n\n const envelopeItem =\n 'aggregates' in session ? [{ type: 'sessions' }, session] : [{ type: 'session' }, session.toJSON()];\n\n return createEnvelope(envelopeHeaders, [envelopeItem]);\n}\n\n/**\n * Create an Envelope from an event.\n */\nfunction createEventEnvelope(\n event,\n dsn,\n metadata,\n tunnel,\n) {\n const sdkInfo = getSdkMetadataForEnvelopeHeader(metadata);\n\n /*\n Note: Due to TS, event.type may be `replay_event`, theoretically.\n In practice, we never call `createEventEnvelope` with `replay_event` type,\n and we'd have to adjut a looot of types to make this work properly.\n We want to avoid casting this around, as that could lead to bugs (e.g. when we add another type)\n So the safe choice is to really guard against the replay_event type here.\n */\n const eventType = event.type && event.type !== 'replay_event' ? event.type : 'event';\n\n enhanceEventWithSdkInfo(event, metadata && metadata.sdk);\n\n const envelopeHeaders = createEventEnvelopeHeaders(event, sdkInfo, tunnel, dsn);\n\n // Prevent this data (which, if it exists, was used in earlier steps in the processing pipeline) from being sent to\n // sentry. (Note: Our use of this property comes and goes with whatever we might be debugging, whatever hacks we may\n // have temporarily added, etc. Even if we don't happen to be using it at some point in the future, let's not get rid\n // of this `delete`, lest we miss putting it back in the next time the property is in use.)\n delete event.sdkProcessingMetadata;\n\n const eventItem = [{ type: eventType }, event];\n return createEnvelope(envelopeHeaders, [eventItem]);\n}\n\nexport { createEventEnvelope, createSessionEnvelope };\n","import { dsnToString, createEnvelope } from '@sentry/utils';\nimport { serializeMetricBuckets } from './utils.js';\n\n/**\n * Create envelope from a metric aggregate.\n */\nfunction createMetricEnvelope(\n metricBucketItems,\n dsn,\n metadata,\n tunnel,\n) {\n const headers = {\n sent_at: new Date().toISOString(),\n };\n\n if (metadata && metadata.sdk) {\n headers.sdk = {\n name: metadata.sdk.name,\n version: metadata.sdk.version,\n };\n }\n\n if (!!tunnel && dsn) {\n headers.dsn = dsnToString(dsn);\n }\n\n const item = createMetricEnvelopeItem(metricBucketItems);\n return createEnvelope(headers, [item]);\n}\n\nfunction createMetricEnvelopeItem(metricBucketItems) {\n const payload = serializeMetricBuckets(metricBucketItems);\n const metricHeaders = {\n type: 'statsd',\n length: payload.length,\n };\n return [metricHeaders, payload];\n}\n\nexport { createMetricEnvelope };\n","import { dropUndefinedKeys } from '@sentry/utils';\nimport { NAME_AND_TAG_KEY_NORMALIZATION_REGEX, TAG_VALUE_NORMALIZATION_REGEX } from './constants.js';\n\n/**\n * Generate bucket key from metric properties.\n */\nfunction getBucketKey(\n metricType,\n name,\n unit,\n tags,\n) {\n const stringifiedTags = Object.entries(dropUndefinedKeys(tags)).sort((a, b) => a[0].localeCompare(b[0]));\n return `${metricType}${name}${unit}${stringifiedTags}`;\n}\n\n/* eslint-disable no-bitwise */\n/**\n * Simple hash function for strings.\n */\nfunction simpleHash(s) {\n let rv = 0;\n for (let i = 0; i < s.length; i++) {\n const c = s.charCodeAt(i);\n rv = (rv << 5) - rv + c;\n rv &= rv;\n }\n return rv >>> 0;\n}\n/* eslint-enable no-bitwise */\n\n/**\n * Serialize metrics buckets into a string based on statsd format.\n *\n * Example of format:\n * metric.name@second:1:1.2|d|#a:value,b:anothervalue|T12345677\n * Segments:\n * name: metric.name\n * unit: second\n * value: [1, 1.2]\n * type of metric: d (distribution)\n * tags: { a: value, b: anothervalue }\n * timestamp: 12345677\n */\nfunction serializeMetricBuckets(metricBucketItems) {\n let out = '';\n for (const item of metricBucketItems) {\n const tagEntries = Object.entries(item.tags);\n const maybeTags = tagEntries.length > 0 ? `|#${tagEntries.map(([key, value]) => `${key}:${value}`).join(',')}` : '';\n out += `${item.name}@${item.unit}:${item.metric}|${item.metricType}${maybeTags}|T${item.timestamp}\\n`;\n }\n return out;\n}\n\n/**\n * Sanitizes tags.\n */\nfunction sanitizeTags(unsanitizedTags) {\n const tags = {};\n for (const key in unsanitizedTags) {\n if (Object.prototype.hasOwnProperty.call(unsanitizedTags, key)) {\n const sanitizedKey = key.replace(NAME_AND_TAG_KEY_NORMALIZATION_REGEX, '_');\n tags[sanitizedKey] = String(unsanitizedTags[key]).replace(TAG_VALUE_NORMALIZATION_REGEX, '_');\n }\n }\n return tags;\n}\n\nexport { getBucketKey, sanitizeTags, serializeMetricBuckets, simpleHash };\n","import { SDK_VERSION } from '../version.js';\n\n/**\n * A builder for the SDK metadata in the options for the SDK initialization.\n *\n * Note: This function is identical to `buildMetadata` in Remix and NextJS and SvelteKit.\n * We don't extract it for bundle size reasons.\n * @see https://github.com/getsentry/sentry-javascript/pull/7404\n * @see https://github.com/getsentry/sentry-javascript/pull/4196\n *\n * If you make changes to this function consider updating the others as well.\n *\n * @param options SDK options object that gets mutated\n * @param names list of package names\n */\nfunction applySdkMetadata(options, name, names = [name], source = 'npm') {\n const metadata = options._metadata || {};\n\n if (!metadata.sdk) {\n metadata.sdk = {\n name: `sentry.javascript.${name}`,\n packages: names.map(name => ({\n name: `${source}:@sentry/${name}`,\n version: SDK_VERSION,\n })),\n version: SDK_VERSION,\n };\n }\n\n options._metadata = metadata;\n}\n\nexport { applySdkMetadata };\n","/**\n * This serves as a build time flag that will be true by default, but false in non-debug builds or if users replace `__SENTRY_DEBUG__` in their generated code.\n *\n * ATTENTION: This constant must never cross package boundaries (i.e. be exported) to guarantee that it can be used for tree shaking.\n */\nconst DEBUG_BUILD = (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__);\n\nexport { DEBUG_BUILD };\n","import { getClient } from '@sentry/core';\nimport { addExceptionMechanism, resolvedSyncPromise, isErrorEvent, isDOMError, isDOMException, addExceptionTypeValue, isError, isPlainObject, isEvent, isParameterizedString, normalizeToSize, extractExceptionKeysForMessage } from '@sentry/utils';\n\n/**\n * This function creates an exception from a JavaScript Error\n */\nfunction exceptionFromError(stackParser, ex) {\n // Get the frames first since Opera can lose the stack if we touch anything else first\n const frames = parseStackFrames(stackParser, ex);\n\n const exception = {\n type: ex && ex.name,\n value: extractMessage(ex),\n };\n\n if (frames.length) {\n exception.stacktrace = { frames };\n }\n\n if (exception.type === undefined && exception.value === '') {\n exception.value = 'Unrecoverable error caught';\n }\n\n return exception;\n}\n\n/**\n * @hidden\n */\nfunction eventFromPlainObject(\n stackParser,\n exception,\n syntheticException,\n isUnhandledRejection,\n) {\n const client = getClient();\n const normalizeDepth = client && client.getOptions().normalizeDepth;\n\n const event = {\n exception: {\n values: [\n {\n type: isEvent(exception) ? exception.constructor.name : isUnhandledRejection ? 'UnhandledRejection' : 'Error',\n value: getNonErrorObjectExceptionValue(exception, { isUnhandledRejection }),\n },\n ],\n },\n extra: {\n __serialized__: normalizeToSize(exception, normalizeDepth),\n },\n };\n\n if (syntheticException) {\n const frames = parseStackFrames(stackParser, syntheticException);\n if (frames.length) {\n // event.exception.values[0] has been set above\n (event.exception ).values[0].stacktrace = { frames };\n }\n }\n\n return event;\n}\n\n/**\n * @hidden\n */\nfunction eventFromError(stackParser, ex) {\n return {\n exception: {\n values: [exceptionFromError(stackParser, ex)],\n },\n };\n}\n\n/** Parses stack frames from an error */\nfunction parseStackFrames(\n stackParser,\n ex,\n) {\n // Access and store the stacktrace property before doing ANYTHING\n // else to it because Opera is not very good at providing it\n // reliably in other circumstances.\n const stacktrace = ex.stacktrace || ex.stack || '';\n\n const popSize = getPopSize(ex);\n\n try {\n return stackParser(stacktrace, popSize);\n } catch (e) {\n // no-empty\n }\n\n return [];\n}\n\n// Based on our own mapping pattern - https://github.com/getsentry/sentry/blob/9f08305e09866c8bd6d0c24f5b0aabdd7dd6c59c/src/sentry/lang/javascript/errormapping.py#L83-L108\nconst reactMinifiedRegexp = /Minified React error #\\d+;/i;\n\nfunction getPopSize(ex) {\n if (ex) {\n if (typeof ex.framesToPop === 'number') {\n return ex.framesToPop;\n }\n\n if (reactMinifiedRegexp.test(ex.message)) {\n return 1;\n }\n }\n\n return 0;\n}\n\n/**\n * There are cases where stacktrace.message is an Event object\n * https://github.com/getsentry/sentry-javascript/issues/1949\n * In this specific case we try to extract stacktrace.message.error.message\n */\nfunction extractMessage(ex) {\n const message = ex && ex.message;\n if (!message) {\n return 'No error message';\n }\n if (message.error && typeof message.error.message === 'string') {\n return message.error.message;\n }\n return message;\n}\n\n/**\n * Creates an {@link Event} from all inputs to `captureException` and non-primitive inputs to `captureMessage`.\n * @hidden\n */\nfunction eventFromException(\n stackParser,\n exception,\n hint,\n attachStacktrace,\n) {\n const syntheticException = (hint && hint.syntheticException) || undefined;\n const event = eventFromUnknownInput(stackParser, exception, syntheticException, attachStacktrace);\n addExceptionMechanism(event); // defaults to { type: 'generic', handled: true }\n event.level = 'error';\n if (hint && hint.event_id) {\n event.event_id = hint.event_id;\n }\n return resolvedSyncPromise(event);\n}\n\n/**\n * Builds and Event from a Message\n * @hidden\n */\nfunction eventFromMessage(\n stackParser,\n message,\n // eslint-disable-next-line deprecation/deprecation\n level = 'info',\n hint,\n attachStacktrace,\n) {\n const syntheticException = (hint && hint.syntheticException) || undefined;\n const event = eventFromString(stackParser, message, syntheticException, attachStacktrace);\n event.level = level;\n if (hint && hint.event_id) {\n event.event_id = hint.event_id;\n }\n return resolvedSyncPromise(event);\n}\n\n/**\n * @hidden\n */\nfunction eventFromUnknownInput(\n stackParser,\n exception,\n syntheticException,\n attachStacktrace,\n isUnhandledRejection,\n) {\n let event;\n\n if (isErrorEvent(exception ) && (exception ).error) {\n // If it is an ErrorEvent with `error` property, extract it to get actual Error\n const errorEvent = exception ;\n return eventFromError(stackParser, errorEvent.error );\n }\n\n // If it is a `DOMError` (which is a legacy API, but still supported in some browsers) then we just extract the name\n // and message, as it doesn't provide anything else. According to the spec, all `DOMExceptions` should also be\n // `Error`s, but that's not the case in IE11, so in that case we treat it the same as we do a `DOMError`.\n //\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMError\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMException\n // https://webidl.spec.whatwg.org/#es-DOMException-specialness\n if (isDOMError(exception) || isDOMException(exception )) {\n const domException = exception ;\n\n if ('stack' in (exception )) {\n event = eventFromError(stackParser, exception );\n } else {\n const name = domException.name || (isDOMError(domException) ? 'DOMError' : 'DOMException');\n const message = domException.message ? `${name}: ${domException.message}` : name;\n event = eventFromString(stackParser, message, syntheticException, attachStacktrace);\n addExceptionTypeValue(event, message);\n }\n if ('code' in domException) {\n // eslint-disable-next-line deprecation/deprecation\n event.tags = { ...event.tags, 'DOMException.code': `${domException.code}` };\n }\n\n return event;\n }\n if (isError(exception)) {\n // we have a real Error object, do nothing\n return eventFromError(stackParser, exception);\n }\n if (isPlainObject(exception) || isEvent(exception)) {\n // If it's a plain object or an instance of `Event` (the built-in JS kind, not this SDK's `Event` type), serialize\n // it manually. This will allow us to group events based on top-level keys which is much better than creating a new\n // group on any key/value change.\n const objectException = exception ;\n event = eventFromPlainObject(stackParser, objectException, syntheticException, isUnhandledRejection);\n addExceptionMechanism(event, {\n synthetic: true,\n });\n return event;\n }\n\n // If none of previous checks were valid, then it means that it's not:\n // - an instance of DOMError\n // - an instance of DOMException\n // - an instance of Event\n // - an instance of Error\n // - a valid ErrorEvent (one with an error property)\n // - a plain Object\n //\n // So bail out and capture it as a simple message:\n event = eventFromString(stackParser, exception , syntheticException, attachStacktrace);\n addExceptionTypeValue(event, `${exception}`, undefined);\n addExceptionMechanism(event, {\n synthetic: true,\n });\n\n return event;\n}\n\n/**\n * @hidden\n */\nfunction eventFromString(\n stackParser,\n message,\n syntheticException,\n attachStacktrace,\n) {\n const event = {};\n\n if (attachStacktrace && syntheticException) {\n const frames = parseStackFrames(stackParser, syntheticException);\n if (frames.length) {\n event.exception = {\n values: [{ value: message, stacktrace: { frames } }],\n };\n }\n }\n\n if (isParameterizedString(message)) {\n const { __sentry_template_string__, __sentry_template_values__ } = message;\n\n event.logentry = {\n message: __sentry_template_string__,\n params: __sentry_template_values__,\n };\n return event;\n }\n\n event.message = message;\n return event;\n}\n\nfunction getNonErrorObjectExceptionValue(\n exception,\n { isUnhandledRejection },\n) {\n const keys = extractExceptionKeysForMessage(exception);\n const captureType = isUnhandledRejection ? 'promise rejection' : 'exception';\n\n // Some ErrorEvent instances do not have an `error` property, which is why they are not handled before\n // We still want to try to get a decent message for these cases\n if (isErrorEvent(exception)) {\n return `Event \\`ErrorEvent\\` captured as ${captureType} with message \\`${exception.message}\\``;\n }\n\n if (isEvent(exception)) {\n const className = getObjectClassName(exception);\n return `Event \\`${className}\\` (type=${exception.type}) captured as ${captureType}`;\n }\n\n return `Object captured as ${captureType} with keys: ${keys}`;\n}\n\nfunction getObjectClassName(obj) {\n try {\n const prototype = Object.getPrototypeOf(obj);\n return prototype ? prototype.constructor.name : undefined;\n } catch (e) {\n // ignore errors here\n }\n}\n\nexport { eventFromError, eventFromException, eventFromMessage, eventFromPlainObject, eventFromString, eventFromUnknownInput, exceptionFromError, parseStackFrames };\n","import { withScope, captureException } from '@sentry/core';\nimport { GLOBAL_OBJ, getOriginalFunction, markFunctionWrapped, addNonEnumerableProperty, addExceptionTypeValue, addExceptionMechanism } from '@sentry/utils';\n\nconst WINDOW = GLOBAL_OBJ ;\n\nlet ignoreOnError = 0;\n\n/**\n * @hidden\n */\nfunction shouldIgnoreOnError() {\n return ignoreOnError > 0;\n}\n\n/**\n * @hidden\n */\nfunction ignoreNextOnError() {\n // onerror should trigger before setTimeout\n ignoreOnError++;\n setTimeout(() => {\n ignoreOnError--;\n });\n}\n\n/**\n * Instruments the given function and sends an event to Sentry every time the\n * function throws an exception.\n *\n * @param fn A function to wrap. It is generally safe to pass an unbound function, because the returned wrapper always\n * has a correct `this` context.\n * @returns The wrapped function.\n * @hidden\n */\nfunction wrap(\n fn,\n options\n\n = {},\n before,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n) {\n // for future readers what this does is wrap a function and then create\n // a bi-directional wrapping between them.\n //\n // example: wrapped = wrap(original);\n // original.__sentry_wrapped__ -> wrapped\n // wrapped.__sentry_original__ -> original\n\n if (typeof fn !== 'function') {\n return fn;\n }\n\n try {\n // if we're dealing with a function that was previously wrapped, return\n // the original wrapper.\n const wrapper = fn.__sentry_wrapped__;\n if (wrapper) {\n return wrapper;\n }\n\n // We don't wanna wrap it twice\n if (getOriginalFunction(fn)) {\n return fn;\n }\n } catch (e) {\n // Just accessing custom props in some Selenium environments\n // can cause a \"Permission denied\" exception (see raven-js#495).\n // Bail on wrapping and return the function as-is (defers to window.onerror).\n return fn;\n }\n\n /* eslint-disable prefer-rest-params */\n // It is important that `sentryWrapped` is not an arrow function to preserve the context of `this`\n const sentryWrapped = function () {\n const args = Array.prototype.slice.call(arguments);\n\n try {\n if (before && typeof before === 'function') {\n before.apply(this, arguments);\n }\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/no-unsafe-member-access\n const wrappedArguments = args.map((arg) => wrap(arg, options));\n\n // Attempt to invoke user-land function\n // NOTE: If you are a Sentry user, and you are seeing this stack frame, it\n // means the sentry.javascript SDK caught an error invoking your application code. This\n // is expected behavior and NOT indicative of a bug with sentry.javascript.\n return fn.apply(this, wrappedArguments);\n } catch (ex) {\n ignoreNextOnError();\n\n withScope(scope => {\n scope.addEventProcessor(event => {\n if (options.mechanism) {\n addExceptionTypeValue(event, undefined, undefined);\n addExceptionMechanism(event, options.mechanism);\n }\n\n event.extra = {\n ...event.extra,\n arguments: args,\n };\n\n return event;\n });\n\n captureException(ex);\n });\n\n throw ex;\n }\n };\n /* eslint-enable prefer-rest-params */\n\n // Accessing some objects may throw\n // ref: https://github.com/getsentry/sentry-javascript/issues/1168\n try {\n for (const property in fn) {\n if (Object.prototype.hasOwnProperty.call(fn, property)) {\n sentryWrapped[property] = fn[property];\n }\n }\n } catch (_oO) {} // eslint-disable-line no-empty\n\n // Signal that this function has been wrapped/filled already\n // for both debugging and to prevent it to being wrapped/filled twice\n markFunctionWrapped(sentryWrapped, fn);\n\n addNonEnumerableProperty(fn, '__sentry_wrapped__', sentryWrapped);\n\n // Restore original function name (not all browsers allow that)\n try {\n const descriptor = Object.getOwnPropertyDescriptor(sentryWrapped, 'name') ;\n if (descriptor.configurable) {\n Object.defineProperty(sentryWrapped, 'name', {\n get() {\n return fn.name;\n },\n });\n }\n // eslint-disable-next-line no-empty\n } catch (_oO) {}\n\n return sentryWrapped;\n}\n\n/**\n * All properties the report dialog supports\n *\n * @deprecated This type will be removed in the next major version of the Sentry SDK. `showReportDialog` will still be around, however the `eventId` option will now be required.\n */\n\nexport { WINDOW, ignoreNextOnError, shouldIgnoreOnError, wrap };\n","import { BaseClient, applySdkMetadata } from '@sentry/core';\nimport { getSDKSource, logger, createClientReportEnvelope, dsnToString } from '@sentry/utils';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { eventFromException, eventFromMessage } from './eventbuilder.js';\nimport { WINDOW } from './helpers.js';\nimport { createUserFeedbackEnvelope } from './userfeedback.js';\n\n/**\n * Configuration options for the Sentry Browser SDK.\n * @see @sentry/types Options for more information.\n */\n\n/**\n * The Sentry Browser SDK Client.\n *\n * @see BrowserOptions for documentation on configuration options.\n * @see SentryClient for usage documentation.\n */\nclass BrowserClient extends BaseClient {\n /**\n * Creates a new Browser SDK instance.\n *\n * @param options Configuration options for this SDK.\n */\n constructor(options) {\n const sdkSource = WINDOW.SENTRY_SDK_SOURCE || getSDKSource();\n applySdkMetadata(options, 'browser', ['browser'], sdkSource);\n\n super(options);\n\n if (options.sendClientReports && WINDOW.document) {\n WINDOW.document.addEventListener('visibilitychange', () => {\n if (WINDOW.document.visibilityState === 'hidden') {\n this._flushOutcomes();\n }\n });\n }\n }\n\n /**\n * @inheritDoc\n */\n eventFromException(exception, hint) {\n return eventFromException(this._options.stackParser, exception, hint, this._options.attachStacktrace);\n }\n\n /**\n * @inheritDoc\n */\n eventFromMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n level = 'info',\n hint,\n ) {\n return eventFromMessage(this._options.stackParser, message, level, hint, this._options.attachStacktrace);\n }\n\n /**\n * Sends user feedback to Sentry.\n */\n captureUserFeedback(feedback) {\n if (!this._isEnabled()) {\n DEBUG_BUILD && logger.warn('SDK not enabled, will not capture user feedback.');\n return;\n }\n\n const envelope = createUserFeedbackEnvelope(feedback, {\n metadata: this.getSdkMetadata(),\n dsn: this.getDsn(),\n tunnel: this.getOptions().tunnel,\n });\n\n // _sendEnvelope should not throw\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this._sendEnvelope(envelope);\n }\n\n /**\n * @inheritDoc\n */\n _prepareEvent(event, hint, scope) {\n event.platform = event.platform || 'javascript';\n return super._prepareEvent(event, hint, scope);\n }\n\n /**\n * Sends client reports as an envelope.\n */\n _flushOutcomes() {\n const outcomes = this._clearOutcomes();\n\n if (outcomes.length === 0) {\n DEBUG_BUILD && logger.log('No outcomes to send');\n return;\n }\n\n // This is really the only place where we want to check for a DSN and only send outcomes then\n if (!this._dsn) {\n DEBUG_BUILD && logger.log('No dsn provided, will not send outcomes');\n return;\n }\n\n DEBUG_BUILD && logger.log('Sending outcomes:', outcomes);\n\n const envelope = createClientReportEnvelope(outcomes, this._options.tunnel && dsnToString(this._dsn));\n\n // _sendEnvelope should not throw\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this._sendEnvelope(envelope);\n }\n}\n\nexport { BrowserClient };\n","import { dsnToString, createEnvelope } from '@sentry/utils';\n\n/**\n * Creates an envelope from a user feedback.\n */\nfunction createUserFeedbackEnvelope(\n feedback,\n {\n metadata,\n tunnel,\n dsn,\n }\n\n,\n) {\n const headers = {\n event_id: feedback.event_id,\n sent_at: new Date().toISOString(),\n ...(metadata &&\n metadata.sdk && {\n sdk: {\n name: metadata.sdk.name,\n version: metadata.sdk.version,\n },\n }),\n ...(!!tunnel && !!dsn && { dsn: dsnToString(dsn) }),\n };\n const item = createUserFeedbackEnvelopeItem(feedback);\n\n return createEnvelope(headers, [item]);\n}\n\nfunction createUserFeedbackEnvelopeItem(feedback) {\n const feedbackHeaders = {\n type: 'user_report',\n };\n return [feedbackHeaders, feedback];\n}\n\nexport { createUserFeedbackEnvelope };\n","import { createEnvelope } from './envelope.js';\nimport { dateTimestampInSeconds } from './time.js';\n\n/**\n * Creates client report envelope\n * @param discarded_events An array of discard events\n * @param dsn A DSN that can be set on the header. Optional.\n */\nfunction createClientReportEnvelope(\n discarded_events,\n dsn,\n timestamp,\n) {\n const clientReportItem = [\n { type: 'client_report' },\n {\n timestamp: timestamp || dateTimestampInSeconds(),\n discarded_events,\n },\n ];\n return createEnvelope(dsn ? { dsn } : {}, [clientReportItem]);\n}\n\nexport { createClientReportEnvelope };\n","import { CONSOLE_LEVELS, originalConsoleMethods } from '../logger.js';\nimport { fill } from '../object.js';\nimport { GLOBAL_OBJ } from '../worldwide.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\n/**\n * Add an instrumentation handler for when a console.xxx method is called.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addConsoleInstrumentationHandler(handler) {\n const type = 'console';\n addHandler(type, handler);\n maybeInstrument(type, instrumentConsole);\n}\n\nfunction instrumentConsole() {\n if (!('console' in GLOBAL_OBJ)) {\n return;\n }\n\n CONSOLE_LEVELS.forEach(function (level) {\n if (!(level in GLOBAL_OBJ.console)) {\n return;\n }\n\n fill(GLOBAL_OBJ.console, level, function (originalConsoleMethod) {\n originalConsoleMethods[level] = originalConsoleMethod;\n\n return function (...args) {\n const handlerData = { args, level };\n triggerHandlers('console', handlerData);\n\n const log = originalConsoleMethods[level];\n log && log.apply(GLOBAL_OBJ.console, args);\n };\n });\n });\n}\n\nexport { addConsoleInstrumentationHandler };\n","import { uuid4 } from '../misc.js';\nimport { fill, addNonEnumerableProperty } from '../object.js';\nimport { GLOBAL_OBJ } from '../worldwide.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\nconst WINDOW = GLOBAL_OBJ ;\nconst DEBOUNCE_DURATION = 1000;\n\nlet debounceTimerID;\nlet lastCapturedEventType;\nlet lastCapturedEventTargetId;\n\n/**\n * Add an instrumentation handler for when a click or a keypress happens.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addClickKeypressInstrumentationHandler(handler) {\n const type = 'dom';\n addHandler(type, handler);\n maybeInstrument(type, instrumentDOM);\n}\n\n/** Exported for tests only. */\nfunction instrumentDOM() {\n if (!WINDOW.document) {\n return;\n }\n\n // Make it so that any click or keypress that is unhandled / bubbled up all the way to the document triggers our dom\n // handlers. (Normally we have only one, which captures a breadcrumb for each click or keypress.) Do this before\n // we instrument `addEventListener` so that we don't end up attaching this handler twice.\n const triggerDOMHandler = triggerHandlers.bind(null, 'dom');\n const globalDOMEventHandler = makeDOMEventHandler(triggerDOMHandler, true);\n WINDOW.document.addEventListener('click', globalDOMEventHandler, false);\n WINDOW.document.addEventListener('keypress', globalDOMEventHandler, false);\n\n // After hooking into click and keypress events bubbled up to `document`, we also hook into user-handled\n // clicks & keypresses, by adding an event listener of our own to any element to which they add a listener. That\n // way, whenever one of their handlers is triggered, ours will be, too. (This is needed because their handler\n // could potentially prevent the event from bubbling up to our global listeners. This way, our handler are still\n // guaranteed to fire at least once.)\n ['EventTarget', 'Node'].forEach((target) => {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n const proto = (WINDOW )[target] && (WINDOW )[target].prototype;\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, no-prototype-builtins\n if (!proto || !proto.hasOwnProperty || !proto.hasOwnProperty('addEventListener')) {\n return;\n }\n\n fill(proto, 'addEventListener', function (originalAddEventListener) {\n return function (\n\n type,\n listener,\n options,\n ) {\n if (type === 'click' || type == 'keypress') {\n try {\n const el = this ;\n const handlers = (el.__sentry_instrumentation_handlers__ = el.__sentry_instrumentation_handlers__ || {});\n const handlerForType = (handlers[type] = handlers[type] || { refCount: 0 });\n\n if (!handlerForType.handler) {\n const handler = makeDOMEventHandler(triggerDOMHandler);\n handlerForType.handler = handler;\n originalAddEventListener.call(this, type, handler, options);\n }\n\n handlerForType.refCount++;\n } catch (e) {\n // Accessing dom properties is always fragile.\n // Also allows us to skip `addEventListenrs` calls with no proper `this` context.\n }\n }\n\n return originalAddEventListener.call(this, type, listener, options);\n };\n });\n\n fill(\n proto,\n 'removeEventListener',\n function (originalRemoveEventListener) {\n return function (\n\n type,\n listener,\n options,\n ) {\n if (type === 'click' || type == 'keypress') {\n try {\n const el = this ;\n const handlers = el.__sentry_instrumentation_handlers__ || {};\n const handlerForType = handlers[type];\n\n if (handlerForType) {\n handlerForType.refCount--;\n // If there are no longer any custom handlers of the current type on this element, we can remove ours, too.\n if (handlerForType.refCount <= 0) {\n originalRemoveEventListener.call(this, type, handlerForType.handler, options);\n handlerForType.handler = undefined;\n delete handlers[type]; // eslint-disable-line @typescript-eslint/no-dynamic-delete\n }\n\n // If there are no longer any custom handlers of any type on this element, cleanup everything.\n if (Object.keys(handlers).length === 0) {\n delete el.__sentry_instrumentation_handlers__;\n }\n }\n } catch (e) {\n // Accessing dom properties is always fragile.\n // Also allows us to skip `addEventListenrs` calls with no proper `this` context.\n }\n }\n\n return originalRemoveEventListener.call(this, type, listener, options);\n };\n },\n );\n });\n}\n\n/**\n * Check whether the event is similar to the last captured one. For example, two click events on the same button.\n */\nfunction isSimilarToLastCapturedEvent(event) {\n // If both events have different type, then user definitely performed two separate actions. e.g. click + keypress.\n if (event.type !== lastCapturedEventType) {\n return false;\n }\n\n try {\n // If both events have the same type, it's still possible that actions were performed on different targets.\n // e.g. 2 clicks on different buttons.\n if (!event.target || (event.target )._sentryId !== lastCapturedEventTargetId) {\n return false;\n }\n } catch (e) {\n // just accessing `target` property can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/sentry-javascript/issues/838\n }\n\n // If both events have the same type _and_ same `target` (an element which triggered an event, _not necessarily_\n // to which an event listener was attached), we treat them as the same action, as we want to capture\n // only one breadcrumb. e.g. multiple clicks on the same button, or typing inside a user input box.\n return true;\n}\n\n/**\n * Decide whether an event should be captured.\n * @param event event to be captured\n */\nfunction shouldSkipDOMEvent(eventType, target) {\n // We are only interested in filtering `keypress` events for now.\n if (eventType !== 'keypress') {\n return false;\n }\n\n if (!target || !target.tagName) {\n return true;\n }\n\n // Only consider keypress events on actual input elements. This will disregard keypresses targeting body\n // e.g.tabbing through elements, hotkeys, etc.\n if (target.tagName === 'INPUT' || target.tagName === 'TEXTAREA' || target.isContentEditable) {\n return false;\n }\n\n return true;\n}\n\n/**\n * Wraps addEventListener to capture UI breadcrumbs\n */\nfunction makeDOMEventHandler(\n handler,\n globalListener = false,\n) {\n return (event) => {\n // It's possible this handler might trigger multiple times for the same\n // event (e.g. event propagation through node ancestors).\n // Ignore if we've already captured that event.\n if (!event || event['_sentryCaptured']) {\n return;\n }\n\n const target = getEventTarget(event);\n\n // We always want to skip _some_ events.\n if (shouldSkipDOMEvent(event.type, target)) {\n return;\n }\n\n // Mark event as \"seen\"\n addNonEnumerableProperty(event, '_sentryCaptured', true);\n\n if (target && !target._sentryId) {\n // Add UUID to event target so we can identify if\n addNonEnumerableProperty(target, '_sentryId', uuid4());\n }\n\n const name = event.type === 'keypress' ? 'input' : event.type;\n\n // If there is no last captured event, it means that we can safely capture the new event and store it for future comparisons.\n // If there is a last captured event, see if the new event is different enough to treat it as a unique one.\n // If that's the case, emit the previous event and store locally the newly-captured DOM event.\n if (!isSimilarToLastCapturedEvent(event)) {\n const handlerData = { event, name, global: globalListener };\n handler(handlerData);\n lastCapturedEventType = event.type;\n lastCapturedEventTargetId = target ? target._sentryId : undefined;\n }\n\n // Start a new debounce timer that will prevent us from capturing multiple events that should be grouped together.\n clearTimeout(debounceTimerID);\n debounceTimerID = WINDOW.setTimeout(() => {\n lastCapturedEventTargetId = undefined;\n lastCapturedEventType = undefined;\n }, DEBOUNCE_DURATION);\n };\n}\n\nfunction getEventTarget(event) {\n try {\n return event.target ;\n } catch (e) {\n // just accessing `target` property can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/sentry-javascript/issues/838\n return null;\n }\n}\n\nexport { addClickKeypressInstrumentationHandler, instrumentDOM };\n","import { isString } from '../is.js';\nimport { fill } from '../object.js';\nimport { GLOBAL_OBJ } from '../worldwide.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\nconst WINDOW = GLOBAL_OBJ ;\n\nconst SENTRY_XHR_DATA_KEY = '__sentry_xhr_v3__';\n\n/**\n * Add an instrumentation handler for when an XHR request happens.\n * The handler function is called once when the request starts and once when it ends,\n * which can be identified by checking if it has an `endTimestamp`.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addXhrInstrumentationHandler(handler) {\n const type = 'xhr';\n addHandler(type, handler);\n maybeInstrument(type, instrumentXHR);\n}\n\n/** Exported only for tests. */\nfunction instrumentXHR() {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n if (!(WINDOW ).XMLHttpRequest) {\n return;\n }\n\n const xhrproto = XMLHttpRequest.prototype;\n\n fill(xhrproto, 'open', function (originalOpen) {\n return function ( ...args) {\n const startTimestamp = Date.now();\n\n // open() should always be called with two or more arguments\n // But to be on the safe side, we actually validate this and bail out if we don't have a method & url\n const method = isString(args[0]) ? args[0].toUpperCase() : undefined;\n const url = parseUrl(args[1]);\n\n if (!method || !url) {\n return originalOpen.apply(this, args);\n }\n\n this[SENTRY_XHR_DATA_KEY] = {\n method,\n url,\n request_headers: {},\n };\n\n // if Sentry key appears in URL, don't capture it as a request\n if (method === 'POST' && url.match(/sentry_key/)) {\n this.__sentry_own_request__ = true;\n }\n\n const onreadystatechangeHandler = () => {\n // For whatever reason, this is not the same instance here as from the outer method\n const xhrInfo = this[SENTRY_XHR_DATA_KEY];\n\n if (!xhrInfo) {\n return;\n }\n\n if (this.readyState === 4) {\n try {\n // touching statusCode in some platforms throws\n // an exception\n xhrInfo.status_code = this.status;\n } catch (e) {\n /* do nothing */\n }\n\n const handlerData = {\n args: [method, url],\n endTimestamp: Date.now(),\n startTimestamp,\n xhr: this,\n };\n triggerHandlers('xhr', handlerData);\n }\n };\n\n if ('onreadystatechange' in this && typeof this.onreadystatechange === 'function') {\n fill(this, 'onreadystatechange', function (original) {\n return function ( ...readyStateArgs) {\n onreadystatechangeHandler();\n return original.apply(this, readyStateArgs);\n };\n });\n } else {\n this.addEventListener('readystatechange', onreadystatechangeHandler);\n }\n\n // Intercepting `setRequestHeader` to access the request headers of XHR instance.\n // This will only work for user/library defined headers, not for the default/browser-assigned headers.\n // Request cookies are also unavailable for XHR, as `Cookie` header can't be defined by `setRequestHeader`.\n fill(this, 'setRequestHeader', function (original) {\n return function ( ...setRequestHeaderArgs) {\n const [header, value] = setRequestHeaderArgs;\n\n const xhrInfo = this[SENTRY_XHR_DATA_KEY];\n\n if (xhrInfo && isString(header) && isString(value)) {\n xhrInfo.request_headers[header.toLowerCase()] = value;\n }\n\n return original.apply(this, setRequestHeaderArgs);\n };\n });\n\n return originalOpen.apply(this, args);\n };\n });\n\n fill(xhrproto, 'send', function (originalSend) {\n return function ( ...args) {\n const sentryXhrData = this[SENTRY_XHR_DATA_KEY];\n\n if (!sentryXhrData) {\n return originalSend.apply(this, args);\n }\n\n if (args[0] !== undefined) {\n sentryXhrData.body = args[0];\n }\n\n const handlerData = {\n args: [sentryXhrData.method, sentryXhrData.url],\n startTimestamp: Date.now(),\n xhr: this,\n };\n triggerHandlers('xhr', handlerData);\n\n return originalSend.apply(this, args);\n };\n });\n}\n\nfunction parseUrl(url) {\n if (isString(url)) {\n return url;\n }\n\n try {\n // url can be a string or URL\n // but since URL is not available in IE11, we do not check for it,\n // but simply assume it is an URL and return `toString()` from it (which returns the full URL)\n // If that fails, we just return undefined\n return (url ).toString();\n } catch (e2) {} // eslint-disable-line no-empty\n\n return undefined;\n}\n\nexport { SENTRY_XHR_DATA_KEY, addXhrInstrumentationHandler, instrumentXHR };\n","import { fill } from '../object.js';\nimport { supportsNativeFetch } from '../supports.js';\nimport { GLOBAL_OBJ } from '../worldwide.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\n/**\n * Add an instrumentation handler for when a fetch request happens.\n * The handler function is called once when the request starts and once when it ends,\n * which can be identified by checking if it has an `endTimestamp`.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addFetchInstrumentationHandler(handler) {\n const type = 'fetch';\n addHandler(type, handler);\n maybeInstrument(type, instrumentFetch);\n}\n\nfunction instrumentFetch() {\n if (!supportsNativeFetch()) {\n return;\n }\n\n fill(GLOBAL_OBJ, 'fetch', function (originalFetch) {\n return function (...args) {\n const { method, url } = parseFetchArgs(args);\n\n const handlerData = {\n args,\n fetchData: {\n method,\n url,\n },\n startTimestamp: Date.now(),\n };\n\n triggerHandlers('fetch', {\n ...handlerData,\n });\n\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return originalFetch.apply(GLOBAL_OBJ, args).then(\n (response) => {\n const finishedHandlerData = {\n ...handlerData,\n endTimestamp: Date.now(),\n response,\n };\n\n triggerHandlers('fetch', finishedHandlerData);\n return response;\n },\n (error) => {\n const erroredHandlerData = {\n ...handlerData,\n endTimestamp: Date.now(),\n error,\n };\n\n triggerHandlers('fetch', erroredHandlerData);\n // NOTE: If you are a Sentry user, and you are seeing this stack frame,\n // it means the sentry.javascript SDK caught an error invoking your application code.\n // This is expected behavior and NOT indicative of a bug with sentry.javascript.\n throw error;\n },\n );\n };\n });\n}\n\nfunction hasProp(obj, prop) {\n return !!obj && typeof obj === 'object' && !!(obj )[prop];\n}\n\nfunction getUrlFromResource(resource) {\n if (typeof resource === 'string') {\n return resource;\n }\n\n if (!resource) {\n return '';\n }\n\n if (hasProp(resource, 'url')) {\n return resource.url;\n }\n\n if (resource.toString) {\n return resource.toString();\n }\n\n return '';\n}\n\n/**\n * Parses the fetch arguments to find the used Http method and the url of the request.\n * Exported for tests only.\n */\nfunction parseFetchArgs(fetchArgs) {\n if (fetchArgs.length === 0) {\n return { method: 'GET', url: '' };\n }\n\n if (fetchArgs.length === 2) {\n const [url, options] = fetchArgs ;\n\n return {\n url: getUrlFromResource(url),\n method: hasProp(options, 'method') ? String(options.method).toUpperCase() : 'GET',\n };\n }\n\n const arg = fetchArgs[0];\n return {\n url: getUrlFromResource(arg ),\n method: hasProp(arg, 'method') ? String(arg.method).toUpperCase() : 'GET',\n };\n}\n\nexport { addFetchInstrumentationHandler, parseFetchArgs };\n","// Note: Ideally the `SeverityLevel` type would be derived from `validSeverityLevels`, but that would mean either\n//\n// a) moving `validSeverityLevels` to `@sentry/types`,\n// b) moving the`SeverityLevel` type here, or\n// c) importing `validSeverityLevels` from here into `@sentry/types`.\n//\n// Option A would make `@sentry/types` a runtime dependency of `@sentry/utils` (not good), and options B and C would\n// create a circular dependency between `@sentry/types` and `@sentry/utils` (also not good). So a TODO accompanying the\n// type, reminding anyone who changes it to change this list also, will have to do.\n\nconst validSeverityLevels = ['fatal', 'error', 'warning', 'log', 'info', 'debug'];\n\n/**\n * Converts a string-based level into a member of the deprecated {@link Severity} enum.\n *\n * @deprecated `severityFromString` is deprecated. Please use `severityLevelFromString` instead.\n *\n * @param level String representation of Severity\n * @returns Severity\n */\nfunction severityFromString(level) {\n return severityLevelFromString(level) ;\n}\n\n/**\n * Converts a string-based level into a `SeverityLevel`, normalizing it along the way.\n *\n * @param level String representation of desired `SeverityLevel`.\n * @returns The `SeverityLevel` corresponding to the given string, or 'log' if the string isn't a valid level.\n */\nfunction severityLevelFromString(level) {\n return (level === 'warn' ? 'warning' : validSeverityLevels.includes(level) ? level : 'log') ;\n}\n\nexport { severityFromString, severityLevelFromString, validSeverityLevels };\n","/**\n * Parses string form of URL into an object\n * // borrowed from https://tools.ietf.org/html/rfc3986#appendix-B\n * // intentionally using regex and not href parsing trick because React Native and other\n * // environments where DOM might not be available\n * @returns parsed URL object\n */\nfunction parseUrl(url) {\n if (!url) {\n return {};\n }\n\n const match = url.match(/^(([^:/?#]+):)?(\\/\\/([^/?#]*))?([^?#]*)(\\?([^#]*))?(#(.*))?$/);\n\n if (!match) {\n return {};\n }\n\n // coerce to undefined values to empty string so we don't get 'undefined'\n const query = match[6] || '';\n const fragment = match[8] || '';\n return {\n host: match[4],\n path: match[5],\n protocol: match[2],\n search: query,\n hash: fragment,\n relative: match[5] + query + fragment, // everything minus origin\n };\n}\n\n/**\n * Strip the query string and fragment off of a given URL or path (if present)\n *\n * @param urlPath Full URL or path, including possible query string and/or fragment\n * @returns URL or path without query string or fragment\n */\nfunction stripUrlQueryAndFragment(urlPath) {\n // eslint-disable-next-line no-useless-escape\n return urlPath.split(/[\\?#]/, 1)[0];\n}\n\n/**\n * Returns number of URL segments of a passed string URL.\n */\nfunction getNumberOfUrlSegments(url) {\n // split at '/' or at '\\/' to split regex urls correctly\n return url.split(/\\\\?\\//).filter(s => s.length > 0 && s !== ',').length;\n}\n\n/**\n * Takes a URL object and returns a sanitized string which is safe to use as span description\n * see: https://develop.sentry.dev/sdk/data-handling/#structuring-data\n */\nfunction getSanitizedUrlString(url) {\n const { protocol, host, path } = url;\n\n const filteredHost =\n (host &&\n host\n // Always filter out authority\n .replace(/^.*@/, '[filtered]:[filtered]@')\n // Don't show standard :80 (http) and :443 (https) ports to reduce the noise\n // TODO: Use new URL global if it exists\n .replace(/(:80)$/, '')\n .replace(/(:443)$/, '')) ||\n '';\n\n return `${protocol ? `${protocol}://` : ''}${filteredHost}${path}`;\n}\n\nexport { getNumberOfUrlSegments, getSanitizedUrlString, parseUrl, stripUrlQueryAndFragment };\n","import { defineIntegration, convertIntegrationFnToClass, getClient, addBreadcrumb } from '@sentry/core';\nimport { addConsoleInstrumentationHandler, addClickKeypressInstrumentationHandler, addXhrInstrumentationHandler, addFetchInstrumentationHandler, addHistoryInstrumentationHandler, getEventDescription, logger, htmlTreeAsString, getComponentName, severityLevelFromString, safeJoin, SENTRY_XHR_DATA_KEY, parseUrl } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { WINDOW } from '../helpers.js';\n\n/* eslint-disable max-lines */\n\n/** maxStringLength gets capped to prevent 100 breadcrumbs exceeding 1MB event payload size */\nconst MAX_ALLOWED_STRING_LENGTH = 1024;\n\nconst INTEGRATION_NAME = 'Breadcrumbs';\n\nconst _breadcrumbsIntegration = ((options = {}) => {\n const _options = {\n console: true,\n dom: true,\n fetch: true,\n history: true,\n sentry: true,\n xhr: true,\n ...options,\n };\n\n return {\n name: INTEGRATION_NAME,\n // TODO v8: Remove this\n setupOnce() {}, // eslint-disable-line @typescript-eslint/no-empty-function\n setup(client) {\n if (_options.console) {\n addConsoleInstrumentationHandler(_getConsoleBreadcrumbHandler(client));\n }\n if (_options.dom) {\n addClickKeypressInstrumentationHandler(_getDomBreadcrumbHandler(client, _options.dom));\n }\n if (_options.xhr) {\n addXhrInstrumentationHandler(_getXhrBreadcrumbHandler(client));\n }\n if (_options.fetch) {\n addFetchInstrumentationHandler(_getFetchBreadcrumbHandler(client));\n }\n if (_options.history) {\n addHistoryInstrumentationHandler(_getHistoryBreadcrumbHandler(client));\n }\n if (_options.sentry && client.on) {\n client.on('beforeSendEvent', _getSentryBreadcrumbHandler(client));\n }\n },\n };\n}) ;\n\nconst breadcrumbsIntegration = defineIntegration(_breadcrumbsIntegration);\n\n/**\n * Default Breadcrumbs instrumentations\n *\n * @deprecated Use `breadcrumbsIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst Breadcrumbs = convertIntegrationFnToClass(INTEGRATION_NAME, breadcrumbsIntegration)\n\n;\n\n/**\n * Adds a breadcrumb for Sentry events or transactions if this option is enabled.\n */\nfunction _getSentryBreadcrumbHandler(client) {\n return function addSentryBreadcrumb(event) {\n if (getClient() !== client) {\n return;\n }\n\n addBreadcrumb(\n {\n category: `sentry.${event.type === 'transaction' ? 'transaction' : 'event'}`,\n event_id: event.event_id,\n level: event.level,\n message: getEventDescription(event),\n },\n {\n event,\n },\n );\n };\n}\n\n/**\n * A HOC that creaes a function that creates breadcrumbs from DOM API calls.\n * This is a HOC so that we get access to dom options in the closure.\n */\nfunction _getDomBreadcrumbHandler(\n client,\n dom,\n) {\n return function _innerDomBreadcrumb(handlerData) {\n if (getClient() !== client) {\n return;\n }\n\n let target;\n let componentName;\n let keyAttrs = typeof dom === 'object' ? dom.serializeAttribute : undefined;\n\n let maxStringLength =\n typeof dom === 'object' && typeof dom.maxStringLength === 'number' ? dom.maxStringLength : undefined;\n if (maxStringLength && maxStringLength > MAX_ALLOWED_STRING_LENGTH) {\n DEBUG_BUILD &&\n logger.warn(\n `\\`dom.maxStringLength\\` cannot exceed ${MAX_ALLOWED_STRING_LENGTH}, but a value of ${maxStringLength} was configured. Sentry will use ${MAX_ALLOWED_STRING_LENGTH} instead.`,\n );\n maxStringLength = MAX_ALLOWED_STRING_LENGTH;\n }\n\n if (typeof keyAttrs === 'string') {\n keyAttrs = [keyAttrs];\n }\n\n // Accessing event.target can throw (see getsentry/raven-js#838, #768)\n try {\n const event = handlerData.event ;\n const element = _isEvent(event) ? event.target : event;\n\n target = htmlTreeAsString(element, { keyAttrs, maxStringLength });\n componentName = getComponentName(element);\n } catch (e) {\n target = '';\n }\n\n if (target.length === 0) {\n return;\n }\n\n const breadcrumb = {\n category: `ui.${handlerData.name}`,\n message: target,\n };\n\n if (componentName) {\n breadcrumb.data = { 'ui.component_name': componentName };\n }\n\n addBreadcrumb(breadcrumb, {\n event: handlerData.event,\n name: handlerData.name,\n global: handlerData.global,\n });\n };\n}\n\n/**\n * Creates breadcrumbs from console API calls\n */\nfunction _getConsoleBreadcrumbHandler(client) {\n return function _consoleBreadcrumb(handlerData) {\n if (getClient() !== client) {\n return;\n }\n\n const breadcrumb = {\n category: 'console',\n data: {\n arguments: handlerData.args,\n logger: 'console',\n },\n level: severityLevelFromString(handlerData.level),\n message: safeJoin(handlerData.args, ' '),\n };\n\n if (handlerData.level === 'assert') {\n if (handlerData.args[0] === false) {\n breadcrumb.message = `Assertion failed: ${safeJoin(handlerData.args.slice(1), ' ') || 'console.assert'}`;\n breadcrumb.data.arguments = handlerData.args.slice(1);\n } else {\n // Don't capture a breadcrumb for passed assertions\n return;\n }\n }\n\n addBreadcrumb(breadcrumb, {\n input: handlerData.args,\n level: handlerData.level,\n });\n };\n}\n\n/**\n * Creates breadcrumbs from XHR API calls\n */\nfunction _getXhrBreadcrumbHandler(client) {\n return function _xhrBreadcrumb(handlerData) {\n if (getClient() !== client) {\n return;\n }\n\n const { startTimestamp, endTimestamp } = handlerData;\n\n const sentryXhrData = handlerData.xhr[SENTRY_XHR_DATA_KEY];\n\n // We only capture complete, non-sentry requests\n if (!startTimestamp || !endTimestamp || !sentryXhrData) {\n return;\n }\n\n const { method, url, status_code, body } = sentryXhrData;\n\n const data = {\n method,\n url,\n status_code,\n };\n\n const hint = {\n xhr: handlerData.xhr,\n input: body,\n startTimestamp,\n endTimestamp,\n };\n\n addBreadcrumb(\n {\n category: 'xhr',\n data,\n type: 'http',\n },\n hint,\n );\n };\n}\n\n/**\n * Creates breadcrumbs from fetch API calls\n */\nfunction _getFetchBreadcrumbHandler(client) {\n return function _fetchBreadcrumb(handlerData) {\n if (getClient() !== client) {\n return;\n }\n\n const { startTimestamp, endTimestamp } = handlerData;\n\n // We only capture complete fetch requests\n if (!endTimestamp) {\n return;\n }\n\n if (handlerData.fetchData.url.match(/sentry_key/) && handlerData.fetchData.method === 'POST') {\n // We will not create breadcrumbs for fetch requests that contain `sentry_key` (internal sentry requests)\n return;\n }\n\n if (handlerData.error) {\n const data = handlerData.fetchData;\n const hint = {\n data: handlerData.error,\n input: handlerData.args,\n startTimestamp,\n endTimestamp,\n };\n\n addBreadcrumb(\n {\n category: 'fetch',\n data,\n level: 'error',\n type: 'http',\n },\n hint,\n );\n } else {\n const response = handlerData.response ;\n const data = {\n ...handlerData.fetchData,\n status_code: response && response.status,\n };\n const hint = {\n input: handlerData.args,\n response,\n startTimestamp,\n endTimestamp,\n };\n addBreadcrumb(\n {\n category: 'fetch',\n data,\n type: 'http',\n },\n hint,\n );\n }\n };\n}\n\n/**\n * Creates breadcrumbs from history API calls\n */\nfunction _getHistoryBreadcrumbHandler(client) {\n return function _historyBreadcrumb(handlerData) {\n if (getClient() !== client) {\n return;\n }\n\n let from = handlerData.from;\n let to = handlerData.to;\n const parsedLoc = parseUrl(WINDOW.location.href);\n let parsedFrom = from ? parseUrl(from) : undefined;\n const parsedTo = parseUrl(to);\n\n // Initial pushState doesn't provide `from` information\n if (!parsedFrom || !parsedFrom.path) {\n parsedFrom = parsedLoc;\n }\n\n // Use only the path component of the URL if the URL matches the current\n // document (almost all the time when using pushState)\n if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host) {\n to = parsedTo.relative;\n }\n if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host) {\n from = parsedFrom.relative;\n }\n\n addBreadcrumb({\n category: 'navigation',\n data: {\n from,\n to,\n },\n });\n };\n}\n\nfunction _isEvent(event) {\n return !!event && !!(event ).target;\n}\n\nexport { Breadcrumbs, breadcrumbsIntegration };\n","import { defineIntegration, convertIntegrationFnToClass } from '@sentry/core';\nimport { logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\n\nconst INTEGRATION_NAME = 'Dedupe';\n\nconst _dedupeIntegration = (() => {\n let previousEvent;\n\n return {\n name: INTEGRATION_NAME,\n // TODO v8: Remove this\n setupOnce() {}, // eslint-disable-line @typescript-eslint/no-empty-function\n processEvent(currentEvent) {\n // We want to ignore any non-error type events, e.g. transactions or replays\n // These should never be deduped, and also not be compared against as _previousEvent.\n if (currentEvent.type) {\n return currentEvent;\n }\n\n // Juuust in case something goes wrong\n try {\n if (_shouldDropEvent(currentEvent, previousEvent)) {\n DEBUG_BUILD && logger.warn('Event dropped due to being a duplicate of previously captured event.');\n return null;\n }\n } catch (_oO) {} // eslint-disable-line no-empty\n\n return (previousEvent = currentEvent);\n },\n };\n}) ;\n\nconst dedupeIntegration = defineIntegration(_dedupeIntegration);\n\n/**\n * Deduplication filter.\n * @deprecated Use `dedupeIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst Dedupe = convertIntegrationFnToClass(INTEGRATION_NAME, dedupeIntegration)\n\n;\n\nfunction _shouldDropEvent(currentEvent, previousEvent) {\n if (!previousEvent) {\n return false;\n }\n\n if (_isSameMessageEvent(currentEvent, previousEvent)) {\n return true;\n }\n\n if (_isSameExceptionEvent(currentEvent, previousEvent)) {\n return true;\n }\n\n return false;\n}\n\nfunction _isSameMessageEvent(currentEvent, previousEvent) {\n const currentMessage = currentEvent.message;\n const previousMessage = previousEvent.message;\n\n // If neither event has a message property, they were both exceptions, so bail out\n if (!currentMessage && !previousMessage) {\n return false;\n }\n\n // If only one event has a stacktrace, but not the other one, they are not the same\n if ((currentMessage && !previousMessage) || (!currentMessage && previousMessage)) {\n return false;\n }\n\n if (currentMessage !== previousMessage) {\n return false;\n }\n\n if (!_isSameFingerprint(currentEvent, previousEvent)) {\n return false;\n }\n\n if (!_isSameStacktrace(currentEvent, previousEvent)) {\n return false;\n }\n\n return true;\n}\n\nfunction _isSameExceptionEvent(currentEvent, previousEvent) {\n const previousException = _getExceptionFromEvent(previousEvent);\n const currentException = _getExceptionFromEvent(currentEvent);\n\n if (!previousException || !currentException) {\n return false;\n }\n\n if (previousException.type !== currentException.type || previousException.value !== currentException.value) {\n return false;\n }\n\n if (!_isSameFingerprint(currentEvent, previousEvent)) {\n return false;\n }\n\n if (!_isSameStacktrace(currentEvent, previousEvent)) {\n return false;\n }\n\n return true;\n}\n\nfunction _isSameStacktrace(currentEvent, previousEvent) {\n let currentFrames = _getFramesFromEvent(currentEvent);\n let previousFrames = _getFramesFromEvent(previousEvent);\n\n // If neither event has a stacktrace, they are assumed to be the same\n if (!currentFrames && !previousFrames) {\n return true;\n }\n\n // If only one event has a stacktrace, but not the other one, they are not the same\n if ((currentFrames && !previousFrames) || (!currentFrames && previousFrames)) {\n return false;\n }\n\n currentFrames = currentFrames ;\n previousFrames = previousFrames ;\n\n // If number of frames differ, they are not the same\n if (previousFrames.length !== currentFrames.length) {\n return false;\n }\n\n // Otherwise, compare the two\n for (let i = 0; i < previousFrames.length; i++) {\n const frameA = previousFrames[i];\n const frameB = currentFrames[i];\n\n if (\n frameA.filename !== frameB.filename ||\n frameA.lineno !== frameB.lineno ||\n frameA.colno !== frameB.colno ||\n frameA.function !== frameB.function\n ) {\n return false;\n }\n }\n\n return true;\n}\n\nfunction _isSameFingerprint(currentEvent, previousEvent) {\n let currentFingerprint = currentEvent.fingerprint;\n let previousFingerprint = previousEvent.fingerprint;\n\n // If neither event has a fingerprint, they are assumed to be the same\n if (!currentFingerprint && !previousFingerprint) {\n return true;\n }\n\n // If only one event has a fingerprint, but not the other one, they are not the same\n if ((currentFingerprint && !previousFingerprint) || (!currentFingerprint && previousFingerprint)) {\n return false;\n }\n\n currentFingerprint = currentFingerprint ;\n previousFingerprint = previousFingerprint ;\n\n // Otherwise, compare the two\n try {\n return !!(currentFingerprint.join('') === previousFingerprint.join(''));\n } catch (_oO) {\n return false;\n }\n}\n\nfunction _getExceptionFromEvent(event) {\n return event.exception && event.exception.values && event.exception.values[0];\n}\n\nfunction _getFramesFromEvent(event) {\n const exception = event.exception;\n\n if (exception) {\n try {\n // @ts-expect-error Object could be undefined\n return exception.values[0].stacktrace.frames;\n } catch (_oO) {\n return undefined;\n }\n }\n return undefined;\n}\n\nexport { Dedupe, dedupeIntegration };\n","import { GLOBAL_OBJ } from '../worldwide.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\nlet _oldOnErrorHandler = null;\n\n/**\n * Add an instrumentation handler for when an error is captured by the global error handler.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addGlobalErrorInstrumentationHandler(handler) {\n const type = 'error';\n addHandler(type, handler);\n maybeInstrument(type, instrumentError);\n}\n\nfunction instrumentError() {\n _oldOnErrorHandler = GLOBAL_OBJ.onerror;\n\n GLOBAL_OBJ.onerror = function (\n msg,\n url,\n line,\n column,\n error,\n ) {\n const handlerData = {\n column,\n error,\n line,\n msg,\n url,\n };\n triggerHandlers('error', handlerData);\n\n if (_oldOnErrorHandler && !_oldOnErrorHandler.__SENTRY_LOADER__) {\n // eslint-disable-next-line prefer-rest-params\n return _oldOnErrorHandler.apply(this, arguments);\n }\n\n return false;\n };\n\n GLOBAL_OBJ.onerror.__SENTRY_INSTRUMENTED__ = true;\n}\n\nexport { addGlobalErrorInstrumentationHandler };\n","import { GLOBAL_OBJ } from '../worldwide.js';\nimport { addHandler, maybeInstrument, triggerHandlers } from './_handlers.js';\n\nlet _oldOnUnhandledRejectionHandler = null;\n\n/**\n * Add an instrumentation handler for when an unhandled promise rejection is captured.\n *\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addGlobalUnhandledRejectionInstrumentationHandler(\n handler,\n) {\n const type = 'unhandledrejection';\n addHandler(type, handler);\n maybeInstrument(type, instrumentUnhandledRejection);\n}\n\nfunction instrumentUnhandledRejection() {\n _oldOnUnhandledRejectionHandler = GLOBAL_OBJ.onunhandledrejection;\n\n GLOBAL_OBJ.onunhandledrejection = function (e) {\n const handlerData = e;\n triggerHandlers('unhandledrejection', handlerData);\n\n if (_oldOnUnhandledRejectionHandler && !_oldOnUnhandledRejectionHandler.__SENTRY_LOADER__) {\n // eslint-disable-next-line prefer-rest-params\n return _oldOnUnhandledRejectionHandler.apply(this, arguments);\n }\n\n return true;\n };\n\n GLOBAL_OBJ.onunhandledrejection.__SENTRY_INSTRUMENTED__ = true;\n}\n\nexport { addGlobalUnhandledRejectionInstrumentationHandler };\n","import { defineIntegration, convertIntegrationFnToClass, getClient, captureEvent } from '@sentry/core';\nimport { addGlobalErrorInstrumentationHandler, isString, addGlobalUnhandledRejectionInstrumentationHandler, isPrimitive, isErrorEvent, getLocationHref, logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { eventFromUnknownInput } from '../eventbuilder.js';\nimport { shouldIgnoreOnError } from '../helpers.js';\n\n/* eslint-disable @typescript-eslint/no-unsafe-member-access */\n\nconst INTEGRATION_NAME = 'GlobalHandlers';\n\nconst _globalHandlersIntegration = ((options = {}) => {\n const _options = {\n onerror: true,\n onunhandledrejection: true,\n ...options,\n };\n\n return {\n name: INTEGRATION_NAME,\n setupOnce() {\n Error.stackTraceLimit = 50;\n },\n setup(client) {\n if (_options.onerror) {\n _installGlobalOnErrorHandler(client);\n globalHandlerLog('onerror');\n }\n if (_options.onunhandledrejection) {\n _installGlobalOnUnhandledRejectionHandler(client);\n globalHandlerLog('onunhandledrejection');\n }\n },\n };\n}) ;\n\nconst globalHandlersIntegration = defineIntegration(_globalHandlersIntegration);\n\n/**\n * Global handlers.\n * @deprecated Use `globalHandlersIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst GlobalHandlers = convertIntegrationFnToClass(\n INTEGRATION_NAME,\n globalHandlersIntegration,\n)\n\n;\n\nfunction _installGlobalOnErrorHandler(client) {\n addGlobalErrorInstrumentationHandler(data => {\n const { stackParser, attachStacktrace } = getOptions();\n\n if (getClient() !== client || shouldIgnoreOnError()) {\n return;\n }\n\n const { msg, url, line, column, error } = data;\n\n const event =\n error === undefined && isString(msg)\n ? _eventFromIncompleteOnError(msg, url, line, column)\n : _enhanceEventWithInitialFrame(\n eventFromUnknownInput(stackParser, error || msg, undefined, attachStacktrace, false),\n url,\n line,\n column,\n );\n\n event.level = 'error';\n\n captureEvent(event, {\n originalException: error,\n mechanism: {\n handled: false,\n type: 'onerror',\n },\n });\n });\n}\n\nfunction _installGlobalOnUnhandledRejectionHandler(client) {\n addGlobalUnhandledRejectionInstrumentationHandler(e => {\n const { stackParser, attachStacktrace } = getOptions();\n\n if (getClient() !== client || shouldIgnoreOnError()) {\n return;\n }\n\n const error = _getUnhandledRejectionError(e );\n\n const event = isPrimitive(error)\n ? _eventFromRejectionWithPrimitive(error)\n : eventFromUnknownInput(stackParser, error, undefined, attachStacktrace, true);\n\n event.level = 'error';\n\n captureEvent(event, {\n originalException: error,\n mechanism: {\n handled: false,\n type: 'onunhandledrejection',\n },\n });\n });\n}\n\nfunction _getUnhandledRejectionError(error) {\n if (isPrimitive(error)) {\n return error;\n }\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const e = error ;\n\n // dig the object of the rejection out of known event types\n try {\n // PromiseRejectionEvents store the object of the rejection under 'reason'\n // see https://developer.mozilla.org/en-US/docs/Web/API/PromiseRejectionEvent\n if ('reason' in e) {\n return e.reason;\n }\n\n // something, somewhere, (likely a browser extension) effectively casts PromiseRejectionEvents\n // to CustomEvents, moving the `promise` and `reason` attributes of the PRE into\n // the CustomEvent's `detail` attribute, since they're not part of CustomEvent's spec\n // see https://developer.mozilla.org/en-US/docs/Web/API/CustomEvent and\n // https://github.com/getsentry/sentry-javascript/issues/2380\n else if ('detail' in e && 'reason' in e.detail) {\n return e.detail.reason;\n }\n } catch (e2) {} // eslint-disable-line no-empty\n\n return error;\n}\n\n/**\n * Create an event from a promise rejection where the `reason` is a primitive.\n *\n * @param reason: The `reason` property of the promise rejection\n * @returns An Event object with an appropriate `exception` value\n */\nfunction _eventFromRejectionWithPrimitive(reason) {\n return {\n exception: {\n values: [\n {\n type: 'UnhandledRejection',\n // String() is needed because the Primitive type includes symbols (which can't be automatically stringified)\n value: `Non-Error promise rejection captured with value: ${String(reason)}`,\n },\n ],\n },\n };\n}\n\n/**\n * This function creates a stack from an old, error-less onerror handler.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _eventFromIncompleteOnError(msg, url, line, column) {\n const ERROR_TYPES_RE =\n /^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/i;\n\n // If 'message' is ErrorEvent, get real message from inside\n let message = isErrorEvent(msg) ? msg.message : msg;\n let name = 'Error';\n\n const groups = message.match(ERROR_TYPES_RE);\n if (groups) {\n name = groups[1];\n message = groups[2];\n }\n\n const event = {\n exception: {\n values: [\n {\n type: name,\n value: message,\n },\n ],\n },\n };\n\n return _enhanceEventWithInitialFrame(event, url, line, column);\n}\n\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _enhanceEventWithInitialFrame(event, url, line, column) {\n // event.exception\n const e = (event.exception = event.exception || {});\n // event.exception.values\n const ev = (e.values = e.values || []);\n // event.exception.values[0]\n const ev0 = (ev[0] = ev[0] || {});\n // event.exception.values[0].stacktrace\n const ev0s = (ev0.stacktrace = ev0.stacktrace || {});\n // event.exception.values[0].stacktrace.frames\n const ev0sf = (ev0s.frames = ev0s.frames || []);\n\n const colno = isNaN(parseInt(column, 10)) ? undefined : column;\n const lineno = isNaN(parseInt(line, 10)) ? undefined : line;\n const filename = isString(url) && url.length > 0 ? url : getLocationHref();\n\n // event.exception.values[0].stacktrace.frames\n if (ev0sf.length === 0) {\n ev0sf.push({\n colno,\n filename,\n function: '?',\n in_app: true,\n lineno,\n });\n }\n\n return event;\n}\n\nfunction globalHandlerLog(type) {\n DEBUG_BUILD && logger.log(`Global Handler attached: ${type}`);\n}\n\nfunction getOptions() {\n const client = getClient();\n const options = (client && client.getOptions()) || {\n stackParser: () => [],\n attachStacktrace: false,\n };\n return options;\n}\n\nexport { GlobalHandlers, globalHandlersIntegration };\n","import { defineIntegration, convertIntegrationFnToClass } from '@sentry/core';\nimport { WINDOW } from '../helpers.js';\n\nconst INTEGRATION_NAME = 'HttpContext';\n\nconst _httpContextIntegration = (() => {\n return {\n name: INTEGRATION_NAME,\n // TODO v8: Remove this\n setupOnce() {}, // eslint-disable-line @typescript-eslint/no-empty-function\n preprocessEvent(event) {\n // if none of the information we want exists, don't bother\n if (!WINDOW.navigator && !WINDOW.location && !WINDOW.document) {\n return;\n }\n\n // grab as much info as exists and add it to the event\n const url = (event.request && event.request.url) || (WINDOW.location && WINDOW.location.href);\n const { referrer } = WINDOW.document || {};\n const { userAgent } = WINDOW.navigator || {};\n\n const headers = {\n ...(event.request && event.request.headers),\n ...(referrer && { Referer: referrer }),\n ...(userAgent && { 'User-Agent': userAgent }),\n };\n const request = { ...event.request, ...(url && { url }), headers };\n\n event.request = request;\n },\n };\n}) ;\n\nconst httpContextIntegration = defineIntegration(_httpContextIntegration);\n\n/**\n * HttpContext integration collects information about HTTP request headers.\n * @deprecated Use `httpContextIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst HttpContext = convertIntegrationFnToClass(INTEGRATION_NAME, httpContextIntegration)\n\n;\n\nexport { HttpContext, httpContextIntegration };\n","import { isInstanceOf } from './is.js';\nimport { truncate } from './string.js';\n\n/**\n * Creates exceptions inside `event.exception.values` for errors that are nested on properties based on the `key` parameter.\n */\nfunction applyAggregateErrorsToEvent(\n exceptionFromErrorImplementation,\n parser,\n maxValueLimit = 250,\n key,\n limit,\n event,\n hint,\n) {\n if (!event.exception || !event.exception.values || !hint || !isInstanceOf(hint.originalException, Error)) {\n return;\n }\n\n // Generally speaking the last item in `event.exception.values` is the exception originating from the original Error\n const originalException =\n event.exception.values.length > 0 ? event.exception.values[event.exception.values.length - 1] : undefined;\n\n // We only create exception grouping if there is an exception in the event.\n if (originalException) {\n event.exception.values = truncateAggregateExceptions(\n aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n hint.originalException ,\n key,\n event.exception.values,\n originalException,\n 0,\n ),\n maxValueLimit,\n );\n }\n}\n\nfunction aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n error,\n key,\n prevExceptions,\n exception,\n exceptionId,\n) {\n if (prevExceptions.length >= limit + 1) {\n return prevExceptions;\n }\n\n let newExceptions = [...prevExceptions];\n\n if (isInstanceOf(error[key], Error)) {\n applyExceptionGroupFieldsForParentException(exception, exceptionId);\n const newException = exceptionFromErrorImplementation(parser, error[key]);\n const newExceptionId = newExceptions.length;\n applyExceptionGroupFieldsForChildException(newException, key, newExceptionId, exceptionId);\n newExceptions = aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n error[key],\n key,\n [newException, ...newExceptions],\n newException,\n newExceptionId,\n );\n }\n\n // This will create exception grouping for AggregateErrors\n // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/AggregateError\n if (Array.isArray(error.errors)) {\n error.errors.forEach((childError, i) => {\n if (isInstanceOf(childError, Error)) {\n applyExceptionGroupFieldsForParentException(exception, exceptionId);\n const newException = exceptionFromErrorImplementation(parser, childError);\n const newExceptionId = newExceptions.length;\n applyExceptionGroupFieldsForChildException(newException, `errors[${i}]`, newExceptionId, exceptionId);\n newExceptions = aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n childError,\n key,\n [newException, ...newExceptions],\n newException,\n newExceptionId,\n );\n }\n });\n }\n\n return newExceptions;\n}\n\nfunction applyExceptionGroupFieldsForParentException(exception, exceptionId) {\n // Don't know if this default makes sense. The protocol requires us to set these values so we pick *some* default.\n exception.mechanism = exception.mechanism || { type: 'generic', handled: true };\n\n exception.mechanism = {\n ...exception.mechanism,\n is_exception_group: true,\n exception_id: exceptionId,\n };\n}\n\nfunction applyExceptionGroupFieldsForChildException(\n exception,\n source,\n exceptionId,\n parentId,\n) {\n // Don't know if this default makes sense. The protocol requires us to set these values so we pick *some* default.\n exception.mechanism = exception.mechanism || { type: 'generic', handled: true };\n\n exception.mechanism = {\n ...exception.mechanism,\n type: 'chained',\n source,\n exception_id: exceptionId,\n parent_id: parentId,\n };\n}\n\n/**\n * Truncate the message (exception.value) of all exceptions in the event.\n * Because this event processor is ran after `applyClientOptions`,\n * we need to truncate the message of the added exceptions here.\n */\nfunction truncateAggregateExceptions(exceptions, maxValueLength) {\n return exceptions.map(exception => {\n if (exception.value) {\n exception.value = truncate(exception.value, maxValueLength);\n }\n return exception;\n });\n}\n\nexport { applyAggregateErrorsToEvent };\n","import { defineIntegration, convertIntegrationFnToClass } from '@sentry/core';\nimport { applyAggregateErrorsToEvent } from '@sentry/utils';\nimport { exceptionFromError } from '../eventbuilder.js';\n\nconst DEFAULT_KEY = 'cause';\nconst DEFAULT_LIMIT = 5;\n\nconst INTEGRATION_NAME = 'LinkedErrors';\n\nconst _linkedErrorsIntegration = ((options = {}) => {\n const limit = options.limit || DEFAULT_LIMIT;\n const key = options.key || DEFAULT_KEY;\n\n return {\n name: INTEGRATION_NAME,\n // TODO v8: Remove this\n setupOnce() {}, // eslint-disable-line @typescript-eslint/no-empty-function\n preprocessEvent(event, hint, client) {\n const options = client.getOptions();\n\n applyAggregateErrorsToEvent(\n // This differs from the LinkedErrors integration in core by using a different exceptionFromError function\n exceptionFromError,\n options.stackParser,\n options.maxValueLength,\n key,\n limit,\n event,\n hint,\n );\n },\n };\n}) ;\n\nconst linkedErrorsIntegration = defineIntegration(_linkedErrorsIntegration);\n\n/**\n * Aggregrate linked errors in an event.\n * @deprecated Use `linkedErrorsIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst LinkedErrors = convertIntegrationFnToClass(INTEGRATION_NAME, linkedErrorsIntegration)\n\n;\n\nexport { LinkedErrors, linkedErrorsIntegration };\n","import { defineIntegration, convertIntegrationFnToClass } from '@sentry/core';\nimport { fill, getFunctionName, getOriginalFunction } from '@sentry/utils';\nimport { WINDOW, wrap } from '../helpers.js';\n\nconst DEFAULT_EVENT_TARGET = [\n 'EventTarget',\n 'Window',\n 'Node',\n 'ApplicationCache',\n 'AudioTrackList',\n 'BroadcastChannel',\n 'ChannelMergerNode',\n 'CryptoOperation',\n 'EventSource',\n 'FileReader',\n 'HTMLUnknownElement',\n 'IDBDatabase',\n 'IDBRequest',\n 'IDBTransaction',\n 'KeyOperation',\n 'MediaController',\n 'MessagePort',\n 'ModalWindow',\n 'Notification',\n 'SVGElementInstance',\n 'Screen',\n 'SharedWorker',\n 'TextTrack',\n 'TextTrackCue',\n 'TextTrackList',\n 'WebSocket',\n 'WebSocketWorker',\n 'Worker',\n 'XMLHttpRequest',\n 'XMLHttpRequestEventTarget',\n 'XMLHttpRequestUpload',\n];\n\nconst INTEGRATION_NAME = 'TryCatch';\n\nconst _browserApiErrorsIntegration = ((options = {}) => {\n const _options = {\n XMLHttpRequest: true,\n eventTarget: true,\n requestAnimationFrame: true,\n setInterval: true,\n setTimeout: true,\n ...options,\n };\n\n return {\n name: INTEGRATION_NAME,\n // TODO: This currently only works for the first client this is setup\n // We may want to adjust this to check for client etc.\n setupOnce() {\n if (_options.setTimeout) {\n fill(WINDOW, 'setTimeout', _wrapTimeFunction);\n }\n\n if (_options.setInterval) {\n fill(WINDOW, 'setInterval', _wrapTimeFunction);\n }\n\n if (_options.requestAnimationFrame) {\n fill(WINDOW, 'requestAnimationFrame', _wrapRAF);\n }\n\n if (_options.XMLHttpRequest && 'XMLHttpRequest' in WINDOW) {\n fill(XMLHttpRequest.prototype, 'send', _wrapXHR);\n }\n\n const eventTargetOption = _options.eventTarget;\n if (eventTargetOption) {\n const eventTarget = Array.isArray(eventTargetOption) ? eventTargetOption : DEFAULT_EVENT_TARGET;\n eventTarget.forEach(_wrapEventTarget);\n }\n },\n };\n}) ;\n\nconst browserApiErrorsIntegration = defineIntegration(_browserApiErrorsIntegration);\n\n/**\n * Wrap timer functions and event targets to catch errors and provide better meta data.\n * @deprecated Use `browserApiErrorsIntegration()` instead.\n */\n// eslint-disable-next-line deprecation/deprecation\nconst TryCatch = convertIntegrationFnToClass(\n INTEGRATION_NAME,\n browserApiErrorsIntegration,\n)\n\n;\n\nfunction _wrapTimeFunction(original) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n return function ( ...args) {\n const originalCallback = args[0];\n args[0] = wrap(originalCallback, {\n mechanism: {\n data: { function: getFunctionName(original) },\n handled: false,\n type: 'instrument',\n },\n });\n return original.apply(this, args);\n };\n}\n\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _wrapRAF(original) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n return function ( callback) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return original.apply(this, [\n wrap(callback, {\n mechanism: {\n data: {\n function: 'requestAnimationFrame',\n handler: getFunctionName(original),\n },\n handled: false,\n type: 'instrument',\n },\n }),\n ]);\n };\n}\n\nfunction _wrapXHR(originalSend) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n return function ( ...args) {\n // eslint-disable-next-line @typescript-eslint/no-this-alias\n const xhr = this;\n const xmlHttpRequestProps = ['onload', 'onerror', 'onprogress', 'onreadystatechange'];\n\n xmlHttpRequestProps.forEach(prop => {\n if (prop in xhr && typeof xhr[prop] === 'function') {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n fill(xhr, prop, function (original) {\n const wrapOptions = {\n mechanism: {\n data: {\n function: prop,\n handler: getFunctionName(original),\n },\n handled: false,\n type: 'instrument',\n },\n };\n\n // If Instrument integration has been called before TryCatch, get the name of original function\n const originalFunction = getOriginalFunction(original);\n if (originalFunction) {\n wrapOptions.mechanism.data.handler = getFunctionName(originalFunction);\n }\n\n // Otherwise wrap directly\n return wrap(original, wrapOptions);\n });\n }\n });\n\n return originalSend.apply(this, args);\n };\n}\n\nfunction _wrapEventTarget(target) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const globalObject = WINDOW ;\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n const proto = globalObject[target] && globalObject[target].prototype;\n\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, no-prototype-builtins\n if (!proto || !proto.hasOwnProperty || !proto.hasOwnProperty('addEventListener')) {\n return;\n }\n\n fill(proto, 'addEventListener', function (original,)\n\n {\n return function (\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n\n eventName,\n fn,\n options,\n ) {\n try {\n if (typeof fn.handleEvent === 'function') {\n // ESlint disable explanation:\n // First, it is generally safe to call `wrap` with an unbound function. Furthermore, using `.bind()` would\n // introduce a bug here, because bind returns a new function that doesn't have our\n // flags(like __sentry_original__) attached. `wrap` checks for those flags to avoid unnecessary wrapping.\n // Without those flags, every call to addEventListener wraps the function again, causing a memory leak.\n // eslint-disable-next-line @typescript-eslint/unbound-method\n fn.handleEvent = wrap(fn.handleEvent, {\n mechanism: {\n data: {\n function: 'handleEvent',\n handler: getFunctionName(fn),\n target,\n },\n handled: false,\n type: 'instrument',\n },\n });\n }\n } catch (err) {\n // can sometimes get 'Permission denied to access property \"handle Event'\n }\n\n return original.apply(this, [\n eventName,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n wrap(fn , {\n mechanism: {\n data: {\n function: 'addEventListener',\n handler: getFunctionName(fn),\n target,\n },\n handled: false,\n type: 'instrument',\n },\n }),\n options,\n ]);\n };\n });\n\n fill(\n proto,\n 'removeEventListener',\n function (\n originalRemoveEventListener,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n ) {\n return function (\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n\n eventName,\n fn,\n options,\n ) {\n /**\n * There are 2 possible scenarios here:\n *\n * 1. Someone passes a callback, which was attached prior to Sentry initialization, or by using unmodified\n * method, eg. `document.addEventListener.call(el, name, handler). In this case, we treat this function\n * as a pass-through, and call original `removeEventListener` with it.\n *\n * 2. Someone passes a callback, which was attached after Sentry was initialized, which means that it was using\n * our wrapped version of `addEventListener`, which internally calls `wrap` helper.\n * This helper \"wraps\" whole callback inside a try/catch statement, and attached appropriate metadata to it,\n * in order for us to make a distinction between wrapped/non-wrapped functions possible.\n * If a function was wrapped, it has additional property of `__sentry_wrapped__`, holding the handler.\n *\n * When someone adds a handler prior to initialization, and then do it again, but after,\n * then we have to detach both of them. Otherwise, if we'd detach only wrapped one, it'd be impossible\n * to get rid of the initial handler and it'd stick there forever.\n */\n const wrappedEventHandler = fn ;\n try {\n const originalEventHandler = wrappedEventHandler && wrappedEventHandler.__sentry_wrapped__;\n if (originalEventHandler) {\n originalRemoveEventListener.call(this, eventName, originalEventHandler, options);\n }\n } catch (e) {\n // ignore, accessing __sentry_wrapped__ will throw in some Selenium environments\n }\n return originalRemoveEventListener.call(this, eventName, wrappedEventHandler, options);\n };\n },\n );\n}\n\nexport { TryCatch, browserApiErrorsIntegration };\n","import { createStackParser } from '@sentry/utils';\n\n// global reference to slice\nconst UNKNOWN_FUNCTION = '?';\n\nconst OPERA10_PRIORITY = 10;\nconst OPERA11_PRIORITY = 20;\nconst CHROME_PRIORITY = 30;\nconst WINJS_PRIORITY = 40;\nconst GECKO_PRIORITY = 50;\n\nfunction createFrame(filename, func, lineno, colno) {\n const frame = {\n filename,\n function: func,\n in_app: true, // All browser frames are considered in_app\n };\n\n if (lineno !== undefined) {\n frame.lineno = lineno;\n }\n\n if (colno !== undefined) {\n frame.colno = colno;\n }\n\n return frame;\n}\n\n// Chromium based browsers: Chrome, Brave, new Opera, new Edge\nconst chromeRegex =\n /^\\s*at (?:(.+?\\)(?: \\[.+\\])?|.*?) ?\\((?:address at )?)?(?:async )?((?:|[-a-z]+:|.*bundle|\\/)?.*?)(?::(\\d+))?(?::(\\d+))?\\)?\\s*$/i;\nconst chromeEvalRegex = /\\((\\S*)(?::(\\d+))(?::(\\d+))\\)/;\n\nconst chrome = line => {\n const parts = chromeRegex.exec(line);\n\n if (parts) {\n const isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line\n\n if (isEval) {\n const subMatch = chromeEvalRegex.exec(parts[2]);\n\n if (subMatch) {\n // throw out eval line/column and use top-most line/column number\n parts[2] = subMatch[1]; // url\n parts[3] = subMatch[2]; // line\n parts[4] = subMatch[3]; // column\n }\n }\n\n // Kamil: One more hack won't hurt us right? Understanding and adding more rules on top of these regexps right now\n // would be way too time consuming. (TODO: Rewrite whole RegExp to be more readable)\n const [func, filename] = extractSafariExtensionDetails(parts[1] || UNKNOWN_FUNCTION, parts[2]);\n\n return createFrame(filename, func, parts[3] ? +parts[3] : undefined, parts[4] ? +parts[4] : undefined);\n }\n\n return;\n};\n\nconst chromeStackLineParser = [CHROME_PRIORITY, chrome];\n\n// gecko regex: `(?:bundle|\\d+\\.js)`: `bundle` is for react native, `\\d+\\.js` also but specifically for ram bundles because it\n// generates filenames without a prefix like `file://` the filenames in the stacktrace are just 42.js\n// We need this specific case for now because we want no other regex to match.\nconst geckoREgex =\n /^\\s*(.*?)(?:\\((.*?)\\))?(?:^|@)?((?:[-a-z]+)?:\\/.*?|\\[native code\\]|[^@]*(?:bundle|\\d+\\.js)|\\/[\\w\\-. /=]+)(?::(\\d+))?(?::(\\d+))?\\s*$/i;\nconst geckoEvalRegex = /(\\S+) line (\\d+)(?: > eval line \\d+)* > eval/i;\n\nconst gecko = line => {\n const parts = geckoREgex.exec(line);\n\n if (parts) {\n const isEval = parts[3] && parts[3].indexOf(' > eval') > -1;\n if (isEval) {\n const subMatch = geckoEvalRegex.exec(parts[3]);\n\n if (subMatch) {\n // throw out eval line/column and use top-most line number\n parts[1] = parts[1] || 'eval';\n parts[3] = subMatch[1];\n parts[4] = subMatch[2];\n parts[5] = ''; // no column when eval\n }\n }\n\n let filename = parts[3];\n let func = parts[1] || UNKNOWN_FUNCTION;\n [func, filename] = extractSafariExtensionDetails(func, filename);\n\n return createFrame(filename, func, parts[4] ? +parts[4] : undefined, parts[5] ? +parts[5] : undefined);\n }\n\n return;\n};\n\nconst geckoStackLineParser = [GECKO_PRIORITY, gecko];\n\nconst winjsRegex = /^\\s*at (?:((?:\\[object object\\])?.+) )?\\(?((?:[-a-z]+):.*?):(\\d+)(?::(\\d+))?\\)?\\s*$/i;\n\nconst winjs = line => {\n const parts = winjsRegex.exec(line);\n\n return parts\n ? createFrame(parts[2], parts[1] || UNKNOWN_FUNCTION, +parts[3], parts[4] ? +parts[4] : undefined)\n : undefined;\n};\n\nconst winjsStackLineParser = [WINJS_PRIORITY, winjs];\n\nconst opera10Regex = / line (\\d+).*script (?:in )?(\\S+)(?:: in function (\\S+))?$/i;\n\nconst opera10 = line => {\n const parts = opera10Regex.exec(line);\n return parts ? createFrame(parts[2], parts[3] || UNKNOWN_FUNCTION, +parts[1]) : undefined;\n};\n\nconst opera10StackLineParser = [OPERA10_PRIORITY, opera10];\n\nconst opera11Regex =\n / line (\\d+), column (\\d+)\\s*(?:in (?:]+)>|([^)]+))\\(.*\\))? in (.*):\\s*$/i;\n\nconst opera11 = line => {\n const parts = opera11Regex.exec(line);\n return parts ? createFrame(parts[5], parts[3] || parts[4] || UNKNOWN_FUNCTION, +parts[1], +parts[2]) : undefined;\n};\n\nconst opera11StackLineParser = [OPERA11_PRIORITY, opera11];\n\nconst defaultStackLineParsers = [chromeStackLineParser, geckoStackLineParser, winjsStackLineParser];\n\nconst defaultStackParser = createStackParser(...defaultStackLineParsers);\n\n/**\n * Safari web extensions, starting version unknown, can produce \"frames-only\" stacktraces.\n * What it means, is that instead of format like:\n *\n * Error: wat\n * at function@url:row:col\n * at function@url:row:col\n * at function@url:row:col\n *\n * it produces something like:\n *\n * function@url:row:col\n * function@url:row:col\n * function@url:row:col\n *\n * Because of that, it won't be captured by `chrome` RegExp and will fall into `Gecko` branch.\n * This function is extracted so that we can use it in both places without duplicating the logic.\n * Unfortunately \"just\" changing RegExp is too complicated now and making it pass all tests\n * and fix this case seems like an impossible, or at least way too time-consuming task.\n */\nconst extractSafariExtensionDetails = (func, filename) => {\n const isSafariExtension = func.indexOf('safari-extension') !== -1;\n const isSafariWebExtension = func.indexOf('safari-web-extension') !== -1;\n\n return isSafariExtension || isSafariWebExtension\n ? [\n func.indexOf('@') !== -1 ? func.split('@')[0] : UNKNOWN_FUNCTION,\n isSafariExtension ? `safari-extension:${filename}` : `safari-web-extension:${filename}`,\n ]\n : [func, filename];\n};\n\nexport { chromeStackLineParser, defaultStackLineParsers, defaultStackParser, geckoStackLineParser, opera10StackLineParser, opera11StackLineParser, winjsStackLineParser };\n","// Intentionally keeping the key broad, as we don't know for sure what rate limit headers get returned from backend\n\nconst DEFAULT_RETRY_AFTER = 60 * 1000; // 60 seconds\n\n/**\n * Extracts Retry-After value from the request header or returns default value\n * @param header string representation of 'Retry-After' header\n * @param now current unix timestamp\n *\n */\nfunction parseRetryAfterHeader(header, now = Date.now()) {\n const headerDelay = parseInt(`${header}`, 10);\n if (!isNaN(headerDelay)) {\n return headerDelay * 1000;\n }\n\n const headerDate = Date.parse(`${header}`);\n if (!isNaN(headerDate)) {\n return headerDate - now;\n }\n\n return DEFAULT_RETRY_AFTER;\n}\n\n/**\n * Gets the time that the given category is disabled until for rate limiting.\n * In case no category-specific limit is set but a general rate limit across all categories is active,\n * that time is returned.\n *\n * @return the time in ms that the category is disabled until or 0 if there's no active rate limit.\n */\nfunction disabledUntil(limits, category) {\n return limits[category] || limits.all || 0;\n}\n\n/**\n * Checks if a category is rate limited\n */\nfunction isRateLimited(limits, category, now = Date.now()) {\n return disabledUntil(limits, category) > now;\n}\n\n/**\n * Update ratelimits from incoming headers.\n *\n * @return the updated RateLimits object.\n */\nfunction updateRateLimits(\n limits,\n { statusCode, headers },\n now = Date.now(),\n) {\n const updatedRateLimits = {\n ...limits,\n };\n\n // \"The name is case-insensitive.\"\n // https://developer.mozilla.org/en-US/docs/Web/API/Headers/get\n const rateLimitHeader = headers && headers['x-sentry-rate-limits'];\n const retryAfterHeader = headers && headers['retry-after'];\n\n if (rateLimitHeader) {\n /**\n * rate limit headers are of the form\n *
,
,..\n * where each
is of the form\n * : : : \n * where\n * is a delay in seconds\n * is the event type(s) (error, transaction, etc) being rate limited and is of the form\n * ;;...\n * is what's being limited (org, project, or key) - ignored by SDK\n * is an arbitrary string like \"org_quota\" - ignored by SDK\n */\n for (const limit of rateLimitHeader.trim().split(',')) {\n const [retryAfter, categories] = limit.split(':', 2);\n const headerDelay = parseInt(retryAfter, 10);\n const delay = (!isNaN(headerDelay) ? headerDelay : 60) * 1000; // 60sec default\n if (!categories) {\n updatedRateLimits.all = now + delay;\n } else {\n for (const category of categories.split(';')) {\n updatedRateLimits[category] = now + delay;\n }\n }\n }\n } else if (retryAfterHeader) {\n updatedRateLimits.all = now + parseRetryAfterHeader(retryAfterHeader, now);\n } else if (statusCode === 429) {\n updatedRateLimits.all = now + 60 * 1000;\n }\n\n return updatedRateLimits;\n}\n\nexport { DEFAULT_RETRY_AFTER, disabledUntil, isRateLimited, parseRetryAfterHeader, updateRateLimits };\n","import { makePromiseBuffer, forEachEnvelopeItem, envelopeItemTypeToDataCategory, isRateLimited, resolvedSyncPromise, createEnvelope, SentryError, logger, serializeEnvelope, updateRateLimits } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\n\nconst DEFAULT_TRANSPORT_BUFFER_SIZE = 30;\n\n/**\n * Creates an instance of a Sentry `Transport`\n *\n * @param options\n * @param makeRequest\n */\nfunction createTransport(\n options,\n makeRequest,\n buffer = makePromiseBuffer(\n options.bufferSize || DEFAULT_TRANSPORT_BUFFER_SIZE,\n ),\n) {\n let rateLimits = {};\n const flush = (timeout) => buffer.drain(timeout);\n\n function send(envelope) {\n const filteredEnvelopeItems = [];\n\n // Drop rate limited items from envelope\n forEachEnvelopeItem(envelope, (item, type) => {\n const envelopeItemDataCategory = envelopeItemTypeToDataCategory(type);\n if (isRateLimited(rateLimits, envelopeItemDataCategory)) {\n const event = getEventForEnvelopeItem(item, type);\n options.recordDroppedEvent('ratelimit_backoff', envelopeItemDataCategory, event);\n } else {\n filteredEnvelopeItems.push(item);\n }\n });\n\n // Skip sending if envelope is empty after filtering out rate limited events\n if (filteredEnvelopeItems.length === 0) {\n return resolvedSyncPromise();\n }\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const filteredEnvelope = createEnvelope(envelope[0], filteredEnvelopeItems );\n\n // Creates client report for each item in an envelope\n const recordEnvelopeLoss = (reason) => {\n forEachEnvelopeItem(filteredEnvelope, (item, type) => {\n const event = getEventForEnvelopeItem(item, type);\n options.recordDroppedEvent(reason, envelopeItemTypeToDataCategory(type), event);\n });\n };\n\n const requestTask = () =>\n makeRequest({ body: serializeEnvelope(filteredEnvelope, options.textEncoder) }).then(\n response => {\n // We don't want to throw on NOK responses, but we want to at least log them\n if (response.statusCode !== undefined && (response.statusCode < 200 || response.statusCode >= 300)) {\n DEBUG_BUILD && logger.warn(`Sentry responded with status code ${response.statusCode} to sent event.`);\n }\n\n rateLimits = updateRateLimits(rateLimits, response);\n return response;\n },\n error => {\n recordEnvelopeLoss('network_error');\n throw error;\n },\n );\n\n return buffer.add(requestTask).then(\n result => result,\n error => {\n if (error instanceof SentryError) {\n DEBUG_BUILD && logger.error('Skipped sending event because buffer is full.');\n recordEnvelopeLoss('queue_overflow');\n return resolvedSyncPromise();\n } else {\n throw error;\n }\n },\n );\n }\n\n // We use this to identifify if the transport is the base transport\n // TODO (v8): Remove this again as we'll no longer need it\n send.__sentry__baseTransport__ = true;\n\n return {\n send,\n flush,\n };\n}\n\nfunction getEventForEnvelopeItem(item, type) {\n if (type !== 'event' && type !== 'transaction') {\n return undefined;\n }\n\n return Array.isArray(item) ? (item )[1] : undefined;\n}\n\nexport { DEFAULT_TRANSPORT_BUFFER_SIZE, createTransport };\n","import { SentryError } from './error.js';\nimport { rejectedSyncPromise, SyncPromise, resolvedSyncPromise } from './syncpromise.js';\n\n/**\n * Creates an new PromiseBuffer object with the specified limit\n * @param limit max number of promises that can be stored in the buffer\n */\nfunction makePromiseBuffer(limit) {\n const buffer = [];\n\n function isReady() {\n return limit === undefined || buffer.length < limit;\n }\n\n /**\n * Remove a promise from the queue.\n *\n * @param task Can be any PromiseLike\n * @returns Removed promise.\n */\n function remove(task) {\n return buffer.splice(buffer.indexOf(task), 1)[0];\n }\n\n /**\n * Add a promise (representing an in-flight action) to the queue, and set it to remove itself on fulfillment.\n *\n * @param taskProducer A function producing any PromiseLike; In previous versions this used to be `task:\n * PromiseLike`, but under that model, Promises were instantly created on the call-site and their executor\n * functions therefore ran immediately. Thus, even if the buffer was full, the action still happened. By\n * requiring the promise to be wrapped in a function, we can defer promise creation until after the buffer\n * limit check.\n * @returns The original promise.\n */\n function add(taskProducer) {\n if (!isReady()) {\n return rejectedSyncPromise(new SentryError('Not adding Promise because buffer limit was reached.'));\n }\n\n // start the task and add its promise to the queue\n const task = taskProducer();\n if (buffer.indexOf(task) === -1) {\n buffer.push(task);\n }\n void task\n .then(() => remove(task))\n // Use `then(null, rejectionHandler)` rather than `catch(rejectionHandler)` so that we can use `PromiseLike`\n // rather than `Promise`. `PromiseLike` doesn't have a `.catch` method, making its polyfill smaller. (ES5 didn't\n // have promises, so TS has to polyfill when down-compiling.)\n .then(null, () =>\n remove(task).then(null, () => {\n // We have to add another catch here because `remove()` starts a new promise chain.\n }),\n );\n return task;\n }\n\n /**\n * Wait for all promises in the queue to resolve or for timeout to expire, whichever comes first.\n *\n * @param timeout The time, in ms, after which to resolve to `false` if the queue is still non-empty. Passing `0` (or\n * not passing anything) will make the promise wait as long as it takes for the queue to drain before resolving to\n * `true`.\n * @returns A promise which will resolve to `true` if the queue is already empty or drains before the timeout, and\n * `false` otherwise\n */\n function drain(timeout) {\n return new SyncPromise((resolve, reject) => {\n let counter = buffer.length;\n\n if (!counter) {\n return resolve(true);\n }\n\n // wait for `timeout` ms and then resolve to `false` (if not cancelled first)\n const capturedSetTimeout = setTimeout(() => {\n if (timeout && timeout > 0) {\n resolve(false);\n }\n }, timeout);\n\n // if all promises resolve in time, cancel the timer and resolve to `true`\n buffer.forEach(item => {\n void resolvedSyncPromise(item).then(() => {\n if (!--counter) {\n clearTimeout(capturedSetTimeout);\n resolve(true);\n }\n }, reject);\n });\n });\n }\n\n return {\n $: buffer,\n add,\n drain,\n };\n}\n\nexport { makePromiseBuffer };\n","import { isNativeFetch, logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { WINDOW } from '../helpers.js';\n\nlet cachedFetchImpl = undefined;\n\n/**\n * A special usecase for incorrectly wrapped Fetch APIs in conjunction with ad-blockers.\n * Whenever someone wraps the Fetch API and returns the wrong promise chain,\n * this chain becomes orphaned and there is no possible way to capture it's rejections\n * other than allowing it bubble up to this very handler. eg.\n *\n * const f = window.fetch;\n * window.fetch = function () {\n * const p = f.apply(this, arguments);\n *\n * p.then(function() {\n * console.log('hi.');\n * });\n *\n * return p;\n * }\n *\n * `p.then(function () { ... })` is producing a completely separate promise chain,\n * however, what's returned is `p` - the result of original `fetch` call.\n *\n * This mean, that whenever we use the Fetch API to send our own requests, _and_\n * some ad-blocker blocks it, this orphaned chain will _always_ reject,\n * effectively causing another event to be captured.\n * This makes a whole process become an infinite loop, which we need to somehow\n * deal with, and break it in one way or another.\n *\n * To deal with this issue, we are making sure that we _always_ use the real\n * browser Fetch API, instead of relying on what `window.fetch` exposes.\n * The only downside to this would be missing our own requests as breadcrumbs,\n * but because we are already not doing this, it should be just fine.\n *\n * Possible failed fetch error messages per-browser:\n *\n * Chrome: Failed to fetch\n * Edge: Failed to Fetch\n * Firefox: NetworkError when attempting to fetch resource\n * Safari: resource blocked by content blocker\n */\nfunction getNativeFetchImplementation() {\n if (cachedFetchImpl) {\n return cachedFetchImpl;\n }\n\n /* eslint-disable @typescript-eslint/unbound-method */\n\n // Fast path to avoid DOM I/O\n if (isNativeFetch(WINDOW.fetch)) {\n return (cachedFetchImpl = WINDOW.fetch.bind(WINDOW));\n }\n\n const document = WINDOW.document;\n let fetchImpl = WINDOW.fetch;\n // eslint-disable-next-line deprecation/deprecation\n if (document && typeof document.createElement === 'function') {\n try {\n const sandbox = document.createElement('iframe');\n sandbox.hidden = true;\n document.head.appendChild(sandbox);\n const contentWindow = sandbox.contentWindow;\n if (contentWindow && contentWindow.fetch) {\n fetchImpl = contentWindow.fetch;\n }\n document.head.removeChild(sandbox);\n } catch (e) {\n DEBUG_BUILD && logger.warn('Could not create sandbox iframe for pure fetch check, bailing to window.fetch: ', e);\n }\n }\n\n return (cachedFetchImpl = fetchImpl.bind(WINDOW));\n /* eslint-enable @typescript-eslint/unbound-method */\n}\n\n/** Clears cached fetch impl */\nfunction clearCachedFetchImplementation() {\n cachedFetchImpl = undefined;\n}\n\nexport { clearCachedFetchImplementation, getNativeFetchImplementation };\n","import { createTransport } from '@sentry/core';\nimport { rejectedSyncPromise } from '@sentry/utils';\nimport { getNativeFetchImplementation, clearCachedFetchImplementation } from './utils.js';\n\n/**\n * Creates a Transport that uses the Fetch API to send events to Sentry.\n */\nfunction makeFetchTransport(\n options,\n nativeFetch = getNativeFetchImplementation(),\n) {\n let pendingBodySize = 0;\n let pendingCount = 0;\n\n function makeRequest(request) {\n const requestSize = request.body.length;\n pendingBodySize += requestSize;\n pendingCount++;\n\n const requestOptions = {\n body: request.body,\n method: 'POST',\n referrerPolicy: 'origin',\n headers: options.headers,\n // Outgoing requests are usually cancelled when navigating to a different page, causing a \"TypeError: Failed to\n // fetch\" error and sending a \"network_error\" client-outcome - in Chrome, the request status shows \"(cancelled)\".\n // The `keepalive` flag keeps outgoing requests alive, even when switching pages. We want this since we're\n // frequently sending events right before the user is switching pages (eg. whenfinishing navigation transactions).\n // Gotchas:\n // - `keepalive` isn't supported by Firefox\n // - As per spec (https://fetch.spec.whatwg.org/#http-network-or-cache-fetch):\n // If the sum of contentLength and inflightKeepaliveBytes is greater than 64 kibibytes, then return a network error.\n // We will therefore only activate the flag when we're below that limit.\n // There is also a limit of requests that can be open at the same time, so we also limit this to 15\n // See https://github.com/getsentry/sentry-javascript/pull/7553 for details\n keepalive: pendingBodySize <= 60000 && pendingCount < 15,\n ...options.fetchOptions,\n };\n\n try {\n return nativeFetch(options.url, requestOptions).then(response => {\n pendingBodySize -= requestSize;\n pendingCount--;\n return {\n statusCode: response.status,\n headers: {\n 'x-sentry-rate-limits': response.headers.get('X-Sentry-Rate-Limits'),\n 'retry-after': response.headers.get('Retry-After'),\n },\n };\n });\n } catch (e) {\n clearCachedFetchImplementation();\n pendingBodySize -= requestSize;\n pendingCount--;\n return rejectedSyncPromise(e);\n }\n }\n\n return createTransport(options, makeRequest);\n}\n\nexport { makeFetchTransport };\n","import { createTransport } from '@sentry/core';\nimport { SyncPromise } from '@sentry/utils';\n\n/**\n * The DONE ready state for XmlHttpRequest\n *\n * Defining it here as a constant b/c XMLHttpRequest.DONE is not always defined\n * (e.g. during testing, it is `undefined`)\n *\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest/readyState}\n */\nconst XHR_READYSTATE_DONE = 4;\n\n/**\n * Creates a Transport that uses the XMLHttpRequest API to send events to Sentry.\n */\nfunction makeXHRTransport(options) {\n function makeRequest(request) {\n return new SyncPromise((resolve, reject) => {\n const xhr = new XMLHttpRequest();\n\n xhr.onerror = reject;\n\n xhr.onreadystatechange = () => {\n if (xhr.readyState === XHR_READYSTATE_DONE) {\n resolve({\n statusCode: xhr.status,\n headers: {\n 'x-sentry-rate-limits': xhr.getResponseHeader('X-Sentry-Rate-Limits'),\n 'retry-after': xhr.getResponseHeader('Retry-After'),\n },\n });\n }\n };\n\n xhr.open('POST', options.url);\n\n for (const header in options.headers) {\n if (Object.prototype.hasOwnProperty.call(options.headers, header)) {\n xhr.setRequestHeader(header, options.headers[header]);\n }\n }\n\n xhr.send(request.body);\n });\n }\n\n return createTransport(options, makeRequest);\n}\n\nexport { makeXHRTransport };\n","import { inboundFiltersIntegration, functionToStringIntegration, getIntegrationsToSetup, initAndBind, getReportDialogEndpoint, getCurrentHub, startSession, captureSession, getClient } from '@sentry/core';\nimport { stackParserFromStackParserOptions, supportsFetch, logger, addHistoryInstrumentationHandler } from '@sentry/utils';\nimport { BrowserClient } from './client.js';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { WINDOW, wrap as wrap$1 } from './helpers.js';\nimport { breadcrumbsIntegration } from './integrations/breadcrumbs.js';\nimport { dedupeIntegration } from './integrations/dedupe.js';\nimport { globalHandlersIntegration } from './integrations/globalhandlers.js';\nimport { httpContextIntegration } from './integrations/httpcontext.js';\nimport { linkedErrorsIntegration } from './integrations/linkederrors.js';\nimport { browserApiErrorsIntegration } from './integrations/trycatch.js';\nimport { defaultStackParser } from './stack-parsers.js';\nimport { makeFetchTransport } from './transports/fetch.js';\nimport { makeXHRTransport } from './transports/xhr.js';\n\n/** @deprecated Use `getDefaultIntegrations(options)` instead. */\nconst defaultIntegrations = [\n inboundFiltersIntegration(),\n functionToStringIntegration(),\n browserApiErrorsIntegration(),\n breadcrumbsIntegration(),\n globalHandlersIntegration(),\n linkedErrorsIntegration(),\n dedupeIntegration(),\n httpContextIntegration(),\n];\n\n/** Get the default integrations for the browser SDK. */\nfunction getDefaultIntegrations(_options) {\n // We return a copy of the defaultIntegrations here to avoid mutating this\n return [\n // eslint-disable-next-line deprecation/deprecation\n ...defaultIntegrations,\n ];\n}\n\n/**\n * A magic string that build tooling can leverage in order to inject a release value into the SDK.\n */\n\n/**\n * The Sentry Browser SDK Client.\n *\n * To use this SDK, call the {@link init} function as early as possible when\n * loading the web page. To set context information or send manual events, use\n * the provided methods.\n *\n * @example\n *\n * ```\n *\n * import { init } from '@sentry/browser';\n *\n * init({\n * dsn: '__DSN__',\n * // ...\n * });\n * ```\n *\n * @example\n * ```\n *\n * import { configureScope } from '@sentry/browser';\n * configureScope((scope: Scope) => {\n * scope.setExtra({ battery: 0.7 });\n * scope.setTag({ user_mode: 'admin' });\n * scope.setUser({ id: '4711' });\n * });\n * ```\n *\n * @example\n * ```\n *\n * import { addBreadcrumb } from '@sentry/browser';\n * addBreadcrumb({\n * message: 'My Breadcrumb',\n * // ...\n * });\n * ```\n *\n * @example\n *\n * ```\n *\n * import * as Sentry from '@sentry/browser';\n * Sentry.captureMessage('Hello, world!');\n * Sentry.captureException(new Error('Good bye'));\n * Sentry.captureEvent({\n * message: 'Manual',\n * stacktrace: [\n * // ...\n * ],\n * });\n * ```\n *\n * @see {@link BrowserOptions} for documentation on configuration options.\n */\nfunction init(options = {}) {\n if (options.defaultIntegrations === undefined) {\n options.defaultIntegrations = getDefaultIntegrations();\n }\n if (options.release === undefined) {\n // This allows build tooling to find-and-replace __SENTRY_RELEASE__ to inject a release value\n if (typeof __SENTRY_RELEASE__ === 'string') {\n options.release = __SENTRY_RELEASE__;\n }\n\n // This supports the variable that sentry-webpack-plugin injects\n if (WINDOW.SENTRY_RELEASE && WINDOW.SENTRY_RELEASE.id) {\n options.release = WINDOW.SENTRY_RELEASE.id;\n }\n }\n if (options.autoSessionTracking === undefined) {\n options.autoSessionTracking = true;\n }\n if (options.sendClientReports === undefined) {\n options.sendClientReports = true;\n }\n\n const clientOptions = {\n ...options,\n stackParser: stackParserFromStackParserOptions(options.stackParser || defaultStackParser),\n integrations: getIntegrationsToSetup(options),\n transport: options.transport || (supportsFetch() ? makeFetchTransport : makeXHRTransport),\n };\n\n initAndBind(BrowserClient, clientOptions);\n\n if (options.autoSessionTracking) {\n startSessionTracking();\n }\n}\n\nconst showReportDialog = (\n // eslint-disable-next-line deprecation/deprecation\n options = {},\n // eslint-disable-next-line deprecation/deprecation\n hub = getCurrentHub(),\n) => {\n // doesn't work without a document (React Native)\n if (!WINDOW.document) {\n DEBUG_BUILD && logger.error('Global document not defined in showReportDialog call');\n return;\n }\n\n // eslint-disable-next-line deprecation/deprecation\n const { client, scope } = hub.getStackTop();\n const dsn = options.dsn || (client && client.getDsn());\n if (!dsn) {\n DEBUG_BUILD && logger.error('DSN not configured for showReportDialog call');\n return;\n }\n\n if (scope) {\n options.user = {\n ...scope.getUser(),\n ...options.user,\n };\n }\n\n // TODO(v8): Remove this entire if statement. `eventId` will be a required option.\n // eslint-disable-next-line deprecation/deprecation\n if (!options.eventId) {\n // eslint-disable-next-line deprecation/deprecation\n options.eventId = hub.lastEventId();\n }\n\n const script = WINDOW.document.createElement('script');\n script.async = true;\n script.crossOrigin = 'anonymous';\n script.src = getReportDialogEndpoint(dsn, options);\n\n if (options.onLoad) {\n script.onload = options.onLoad;\n }\n\n const { onClose } = options;\n if (onClose) {\n const reportDialogClosedMessageHandler = (event) => {\n if (event.data === '__sentry_reportdialog_closed__') {\n try {\n onClose();\n } finally {\n WINDOW.removeEventListener('message', reportDialogClosedMessageHandler);\n }\n }\n };\n WINDOW.addEventListener('message', reportDialogClosedMessageHandler);\n }\n\n const injectionPoint = WINDOW.document.head || WINDOW.document.body;\n if (injectionPoint) {\n injectionPoint.appendChild(script);\n } else {\n DEBUG_BUILD && logger.error('Not injecting report dialog. No injection point found in HTML');\n }\n};\n\n/**\n * This function is here to be API compatible with the loader.\n * @hidden\n */\nfunction forceLoad() {\n // Noop\n}\n\n/**\n * This function is here to be API compatible with the loader.\n * @hidden\n */\nfunction onLoad(callback) {\n callback();\n}\n\n/**\n * Wrap code within a try/catch block so the SDK is able to capture errors.\n *\n * @deprecated This function will be removed in v8.\n * It is not part of Sentry's official API and it's easily replaceable by using a try/catch block\n * and calling Sentry.captureException.\n *\n * @param fn A function to wrap.\n *\n * @returns The result of wrapped function call.\n */\n// TODO(v8): Remove this function\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction wrap(fn) {\n return wrap$1(fn)();\n}\n\n/**\n * Enable automatic Session Tracking for the initial page load.\n */\nfunction startSessionTracking() {\n if (typeof WINDOW.document === 'undefined') {\n DEBUG_BUILD && logger.warn('Session tracking in non-browser environment with @sentry/browser is not supported.');\n return;\n }\n\n // The session duration for browser sessions does not track a meaningful\n // concept that can be used as a metric.\n // Automatically captured sessions are akin to page views, and thus we\n // discard their duration.\n startSession({ ignoreDuration: true });\n captureSession();\n\n // We want to create a session for every navigation as well\n addHistoryInstrumentationHandler(({ from, to }) => {\n // Don't create an additional session for the initial route or if the location did not change\n if (from !== undefined && from !== to) {\n startSession({ ignoreDuration: true });\n captureSession();\n }\n });\n}\n\n/**\n * Captures user feedback and sends it to Sentry.\n */\nfunction captureUserFeedback(feedback) {\n const client = getClient();\n if (client) {\n client.captureUserFeedback(feedback);\n }\n}\n\nexport { captureUserFeedback, defaultIntegrations, forceLoad, getDefaultIntegrations, init, onLoad, showReportDialog, wrap };\n","import { logger, consoleSandbox } from '@sentry/utils';\nimport { DEBUG_BUILD } from './debug-build.js';\nimport { getCurrentScope } from './exports.js';\nimport { getCurrentHub } from './hub.js';\n\n/** A class object that can instantiate Client objects. */\n\n/**\n * Internal function to create a new SDK client instance. The client is\n * installed and then bound to the current scope.\n *\n * @param clientClass The client class to instantiate.\n * @param options Options to pass to the client.\n */\nfunction initAndBind(\n clientClass,\n options,\n) {\n if (options.debug === true) {\n if (DEBUG_BUILD) {\n logger.enable();\n } else {\n // use `console.warn` rather than `logger.warn` since by non-debug bundles have all `logger.x` statements stripped\n consoleSandbox(() => {\n // eslint-disable-next-line no-console\n console.warn('[Sentry] Cannot initialize SDK with `debug` option using a non-debug bundle.');\n });\n }\n }\n const scope = getCurrentScope();\n scope.update(options.initialScope);\n\n const client = new clientClass(options);\n setCurrentClient(client);\n initializeClient(client);\n}\n\n/**\n * Make the given client the current client.\n */\nfunction setCurrentClient(client) {\n // eslint-disable-next-line deprecation/deprecation\n const hub = getCurrentHub();\n // eslint-disable-next-line deprecation/deprecation\n const top = hub.getStackTop();\n top.client = client;\n top.scope.setClient(client);\n}\n\n/**\n * Initialize the client for the current scope.\n * Make sure to call this after `setCurrentClient()`.\n */\nfunction initializeClient(client) {\n if (client.init) {\n client.init();\n // TODO v8: Remove this fallback\n // eslint-disable-next-line deprecation/deprecation\n } else if (client.setupIntegrations) {\n // eslint-disable-next-line deprecation/deprecation\n client.setupIntegrations();\n }\n}\n\nexport { initAndBind, setCurrentClient };\n","/**\n * Use this attribute to represent the source of a span.\n * Should be one of: custom, url, route, view, component, task, unknown\n *\n */\nconst SEMANTIC_ATTRIBUTE_SENTRY_SOURCE = 'sentry.source';\n\n/**\n * Use this attribute to represent the sample rate used for a span.\n */\nconst SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE = 'sentry.sample_rate';\n\n/**\n * Use this attribute to represent the operation of a span.\n */\nconst SEMANTIC_ATTRIBUTE_SENTRY_OP = 'sentry.op';\n\n/**\n * Use this attribute to represent the origin of a span.\n */\nconst SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN = 'sentry.origin';\n\nexport { SEMANTIC_ATTRIBUTE_SENTRY_OP, SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN, SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE, SEMANTIC_ATTRIBUTE_SENTRY_SOURCE };\n","import * as Sentry from '@sentry/browser';\nimport { getDefaultIntegrations, init as init$1, setContext, WINDOW, getCurrentScope } from '@sentry/browser';\nexport * from '@sentry/browser';\nimport * as i0 from '@angular/core';\nimport { VERSION, Injectable, Inject, Directive, Input, NgModule } from '@angular/core';\nimport { applySdkMetadata, SEMANTIC_ATTRIBUTE_SENTRY_SOURCE, spanToJSON } from '@sentry/core';\nimport { logger, isString, stripUrlQueryAndFragment, timestampInSeconds } from '@sentry/utils';\nimport { HttpErrorResponse } from '@angular/common/http';\nimport * as i1 from '@angular/router';\nimport { NavigationStart, ResolveEnd, NavigationEnd, NavigationCancel, NavigationError } from '@angular/router';\nimport { Subscription } from 'rxjs';\nimport { filter, tap } from 'rxjs/operators';\n\n/*\n * This file defines flags and constants that can be modified during compile time in order to facilitate tree shaking\n * for users.\n *\n * We define \"magic strings\" like `__SENTRY_DEBUG__` that may get replaced with actual values during our, or the user's\n * build process. Take care when introducing new flags - they must not throw if they are not replaced. See the Debug\n * Build Flags section in CONTRIBUTING.md.\n */\n/** Flag that is true for debug builds, false otherwise. */\nconst IS_DEBUG_BUILD = typeof __SENTRY_DEBUG__ === 'undefined' ? true : __SENTRY_DEBUG__;\n\n/**\n * Inits the Angular SDK\n */\nfunction init(options) {\n const opts = Object.assign({ \n // Filter out TryCatch integration as it interferes with our Angular `ErrorHandler`:\n // TryCatch would catch certain errors before they reach the `ErrorHandler` and thus provide a\n // lower fidelity error than what `SentryErrorHandler` (see errorhandler.ts) would provide.\n // see:\n // - https://github.com/getsentry/sentry-javascript/issues/5417#issuecomment-1453407097\n // - https://github.com/getsentry/sentry-javascript/issues/2744\n defaultIntegrations: getDefaultIntegrations(options).filter(integration => {\n return integration.name !== 'TryCatch';\n }) }, options);\n applySdkMetadata(opts, 'angular-ivy');\n checkAndSetAngularVersion();\n init$1(opts);\n}\nfunction checkAndSetAngularVersion() {\n const ANGULAR_MINIMUM_VERSION = 12;\n const angularVersion = VERSION && VERSION.major ? parseInt(VERSION.major, 10) : undefined;\n if (angularVersion) {\n if (angularVersion < ANGULAR_MINIMUM_VERSION) {\n IS_DEBUG_BUILD &&\n logger.warn(`This Sentry SDK does not officially support Angular ${angularVersion}.`, `This SDK only supports Angular ${ANGULAR_MINIMUM_VERSION} and above.`, \"If you're using Angular 10 or 11, please use `@sentry/angular` instead.\", 'Otherwise, please consider upgrading your Angular version.');\n }\n setContext('angular', { version: angularVersion });\n }\n}\n\n// There're 2 types of Angular applications:\n// 1) zone-full (by default)\n// 2) zone-less\n// The developer can avoid importing the `zone.js` package and tells Angular that\n// he is responsible for running the change detection by himself. This is done by\n// \"nooping\" the zone through `CompilerOptions` when bootstrapping the root module.\n// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\nconst isNgZoneEnabled = typeof Zone !== 'undefined' && !!Zone.current;\n/**\n * The function that does the same job as `NgZone.runOutsideAngular`.\n */\nfunction runOutsideAngular(callback) {\n // The `Zone.root.run` basically will run the `callback` in the most parent zone.\n // Any asynchronous API used inside the `callback` won't catch Angular's zone\n // since `Zone.current` will reference `Zone.root`.\n // The Angular's zone is forked from the `Zone.root`. In this case, `zone.js` won't\n // trigger change detection, and `ApplicationRef.tick()` will not be run.\n // Caretaker note: we're using `Zone.root` except `NgZone.runOutsideAngular` since this\n // will require injecting the `NgZone` facade. That will create a breaking change for\n // projects already using the `@sentry/angular`.\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return isNgZoneEnabled ? Zone.root.run(callback) : callback();\n}\n\n// https://github.com/angular/angular/blob/master/packages/core/src/util/errors.ts\nfunction tryToUnwrapZonejsError(error) {\n // TODO: once Angular14 is the minimum requirement ERROR_ORIGINAL_ERROR and\n // getOriginalError from error.ts can be used directly.\n return error && error.ngOriginalError\n ? error.ngOriginalError\n : error;\n}\nfunction extractHttpModuleError(error) {\n // The `error` property of http exception can be either an `Error` object, which we can use directly...\n if (isErrorOrErrorLikeObject(error.error)) {\n return error.error;\n }\n // ... or an`ErrorEvent`, which can provide us with the message but no stack...\n if (error.error instanceof ErrorEvent && error.error.message) {\n return error.error.message;\n }\n // ...or the request body itself, which we can use as a message instead.\n if (typeof error.error === 'string') {\n return `Server returned code ${error.status} with body \"${error.error}\"`;\n }\n // If we don't have any detailed information, fallback to the request message itself.\n return error.message;\n}\nfunction isErrorOrErrorLikeObject(value) {\n if (value instanceof Error) {\n return true;\n }\n if (value === null || typeof value !== 'object') {\n return false;\n }\n const candidate = value;\n return (isString(candidate.name) &&\n isString(candidate.message) &&\n (undefined === candidate.stack || isString(candidate.stack)));\n}\n/**\n * Implementation of Angular's ErrorHandler provider that can be used as a drop-in replacement for the stock one.\n */\nclass SentryErrorHandler {\n constructor(options) {\n this._registeredAfterSendEventHandler = false;\n this._options = Object.assign({ logErrors: true }, options);\n }\n /**\n * Method called for every value captured through the ErrorHandler\n */\n handleError(error) {\n const extractedError = this._extractError(error) || 'Handled unknown error';\n // Capture handled exception and send it to Sentry.\n const eventId = runOutsideAngular(() => Sentry.captureException(extractedError, {\n mechanism: { type: 'angular', handled: false },\n }));\n // When in development mode, log the error to console for immediate feedback.\n if (this._options.logErrors) {\n // eslint-disable-next-line no-console\n console.error(extractedError);\n }\n // Optionally show user dialog to provide details on what happened.\n if (this._options.showDialog) {\n const client = Sentry.getClient();\n if (client && client.on && !this._registeredAfterSendEventHandler) {\n client.on('afterSendEvent', (event) => {\n if (!event.type) {\n // eslint-disable-next-line deprecation/deprecation\n Sentry.showReportDialog(Object.assign(Object.assign({}, this._options.dialogOptions), { eventId: event.event_id }));\n }\n });\n // We only want to register this hook once in the lifetime of the error handler\n this._registeredAfterSendEventHandler = true;\n }\n else if (!client || !client.on) {\n Sentry.showReportDialog(Object.assign(Object.assign({}, this._options.dialogOptions), { eventId }));\n }\n }\n }\n /**\n * Used to pull a desired value that will be used to capture an event out of the raw value captured by ErrorHandler.\n */\n _extractError(error) {\n // Allow custom overrides of extracting function\n if (this._options.extractor) {\n const defaultExtractor = this._defaultExtractor.bind(this);\n return this._options.extractor(error, defaultExtractor);\n }\n return this._defaultExtractor(error);\n }\n /**\n * Default implementation of error extraction that handles default error wrapping, HTTP responses, ErrorEvent and few other known cases.\n */\n _defaultExtractor(errorCandidate) {\n const error = tryToUnwrapZonejsError(errorCandidate);\n // If it's http module error, extract as much information from it as we can.\n if (error instanceof HttpErrorResponse) {\n return extractHttpModuleError(error);\n }\n // We can handle messages and Error objects directly.\n if (typeof error === 'string' || isErrorOrErrorLikeObject(error)) {\n return error;\n }\n // Nothing was extracted, fallback to default error message.\n return null;\n }\n}\nSentryErrorHandler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: SentryErrorHandler, deps: [{ token: 'errorHandlerOptions' }], target: i0.ɵɵFactoryTarget.Injectable });\nSentryErrorHandler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: SentryErrorHandler, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: SentryErrorHandler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: ['errorHandlerOptions']\n }] }]; } });\n/**\n * Factory function that creates an instance of a preconfigured ErrorHandler provider.\n */\nfunction createErrorHandler(config) {\n return new SentryErrorHandler(config);\n}\n\nconst ANGULAR_ROUTING_OP = 'ui.angular.routing';\nconst ANGULAR_INIT_OP = 'ui.angular.init';\nconst ANGULAR_OP = 'ui.angular';\n\nlet instrumentationInitialized;\nlet stashedStartTransaction;\nlet stashedStartTransactionOnLocationChange;\n/**\n * Creates routing instrumentation for Angular Router.\n */\nfunction routingInstrumentation(customStartTransaction, startTransactionOnPageLoad = true, startTransactionOnLocationChange = true) {\n instrumentationInitialized = true;\n stashedStartTransaction = customStartTransaction;\n stashedStartTransactionOnLocationChange = startTransactionOnLocationChange;\n if (startTransactionOnPageLoad && WINDOW && WINDOW.location) {\n customStartTransaction({\n name: WINDOW.location.pathname,\n op: 'pageload',\n origin: 'auto.pageload.angular',\n attributes: {\n [SEMANTIC_ATTRIBUTE_SENTRY_SOURCE]: 'url',\n },\n });\n }\n}\nconst instrumentAngularRouting = routingInstrumentation;\n/**\n * Grabs active transaction off scope.\n *\n * @deprecated You should not rely on the transaction, but just use `startSpan()` APIs instead.\n */\nfunction getActiveTransaction() {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentScope().getTransaction();\n}\n/**\n * Angular's Service responsible for hooking into Angular Router and tracking current navigation process.\n * Creates a new transaction for every route change and measures a duration of routing process.\n */\nclass TraceService {\n constructor(_router) {\n this._router = _router;\n this.navStart$ = this._router.events.pipe(filter((event) => event instanceof NavigationStart), tap(navigationEvent => {\n if (!instrumentationInitialized) {\n IS_DEBUG_BUILD &&\n logger.error('Angular integration has tracing enabled, but Tracing integration is not configured');\n return;\n }\n const strippedUrl = stripUrlQueryAndFragment(navigationEvent.url);\n // eslint-disable-next-line deprecation/deprecation\n let activeTransaction = getActiveTransaction();\n if (!activeTransaction && stashedStartTransactionOnLocationChange) {\n activeTransaction = stashedStartTransaction({\n name: strippedUrl,\n op: 'navigation',\n origin: 'auto.navigation.angular',\n attributes: {\n [SEMANTIC_ATTRIBUTE_SENTRY_SOURCE]: 'url',\n },\n });\n }\n if (activeTransaction) {\n if (this._routingSpan) {\n this._routingSpan.end();\n }\n // eslint-disable-next-line deprecation/deprecation\n this._routingSpan = activeTransaction.startChild({\n description: `${navigationEvent.url}`,\n op: ANGULAR_ROUTING_OP,\n origin: 'auto.ui.angular',\n tags: Object.assign({ 'routing.instrumentation': '@sentry/angular', url: strippedUrl }, (navigationEvent.navigationTrigger && {\n navigationTrigger: navigationEvent.navigationTrigger,\n })),\n });\n }\n }));\n // The ResolveEnd event is fired when the Angular router has resolved the URL and\n // the parameter<->value mapping. It holds the new resolved router state with\n // the mapping and the new URL.\n // Only After this event, the route is activated, meaning that the transaction\n // can be updated with the parameterized route name before e.g. the route's root\n // component is initialized. This should be early enough before outgoing requests\n // are made from the new route, with the exceptions of requests being made during\n // a navigation.\n this.resEnd$ = this._router.events.pipe(filter((event) => event instanceof ResolveEnd), tap(event => {\n const route = getParameterizedRouteFromSnapshot(event.state.root);\n // eslint-disable-next-line deprecation/deprecation\n const transaction = getActiveTransaction();\n // TODO (v8 / #5416): revisit the source condition. Do we want to make the parameterized route the default?\n const attributes = (transaction && spanToJSON(transaction).data) || {};\n if (transaction && attributes[SEMANTIC_ATTRIBUTE_SENTRY_SOURCE] === 'url') {\n transaction.updateName(route);\n transaction.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_SOURCE, 'route');\n }\n }));\n this.navEnd$ = this._router.events.pipe(filter(event => event instanceof NavigationEnd || event instanceof NavigationCancel || event instanceof NavigationError), tap(() => {\n if (this._routingSpan) {\n runOutsideAngular(() => {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n this._routingSpan.end();\n });\n this._routingSpan = null;\n }\n }));\n this._routingSpan = null;\n this._subscription = new Subscription();\n this._subscription.add(this.navStart$.subscribe());\n this._subscription.add(this.resEnd$.subscribe());\n this._subscription.add(this.navEnd$.subscribe());\n }\n /**\n * This is used to prevent memory leaks when the root view is created and destroyed multiple times,\n * since `subscribe` callbacks capture `this` and prevent many resources from being GC'd.\n */\n ngOnDestroy() {\n this._subscription.unsubscribe();\n }\n}\nTraceService.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceService, deps: [{ token: i1.Router }], target: i0.ɵɵFactoryTarget.Injectable });\nTraceService.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceService, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceService, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Router }]; } });\nconst UNKNOWN_COMPONENT = 'unknown';\n/**\n * A directive that can be used to capture initialization lifecycle of the whole component.\n */\nclass TraceDirective {\n /**\n * Implementation of OnInit lifecycle method\n * @inheritdoc\n */\n ngOnInit() {\n if (!this.componentName) {\n this.componentName = UNKNOWN_COMPONENT;\n }\n // eslint-disable-next-line deprecation/deprecation\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n // eslint-disable-next-line deprecation/deprecation\n this._tracingSpan = activeTransaction.startChild({\n description: `<${this.componentName}>`,\n op: ANGULAR_INIT_OP,\n origin: 'auto.ui.angular.trace_directive',\n });\n }\n }\n /**\n * Implementation of AfterViewInit lifecycle method\n * @inheritdoc\n */\n ngAfterViewInit() {\n if (this._tracingSpan) {\n this._tracingSpan.end();\n }\n }\n}\nTraceDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceDirective, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nTraceDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"12.2.17\", type: TraceDirective, selector: \"[trace]\", inputs: { componentName: [\"trace\", \"componentName\"] }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceDirective, decorators: [{\n type: Directive,\n args: [{ selector: '[trace]' }]\n }], propDecorators: { componentName: [{\n type: Input,\n args: ['trace']\n }] } });\n/**\n * A module serves as a single compilation unit for the `TraceDirective` and can be re-used by any other module.\n */\nclass TraceModule {\n}\nTraceModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nTraceModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule, declarations: [TraceDirective], exports: [TraceDirective] });\nTraceModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [TraceDirective],\n exports: [TraceDirective],\n }]\n }] });\n/**\n * Decorator function that can be used to capture initialization lifecycle of the whole component.\n */\nfunction TraceClassDecorator() {\n let tracingSpan;\n /* eslint-disable @typescript-eslint/no-unsafe-member-access */\n // eslint-disable-next-line @typescript-eslint/explicit-function-return-type\n return target => {\n const originalOnInit = target.prototype.ngOnInit;\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n target.prototype.ngOnInit = function (...args) {\n // eslint-disable-next-line deprecation/deprecation\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n // eslint-disable-next-line deprecation/deprecation\n tracingSpan = activeTransaction.startChild({\n description: `<${target.name}>`,\n op: ANGULAR_INIT_OP,\n origin: 'auto.ui.angular.trace_class_decorator',\n });\n }\n if (originalOnInit) {\n return originalOnInit.apply(this, args);\n }\n };\n const originalAfterViewInit = target.prototype.ngAfterViewInit;\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n target.prototype.ngAfterViewInit = function (...args) {\n if (tracingSpan) {\n tracingSpan.end();\n }\n if (originalAfterViewInit) {\n return originalAfterViewInit.apply(this, args);\n }\n };\n };\n /* eslint-enable @typescript-eslint/no-unsafe-member-access */\n}\n/**\n * Decorator function that can be used to capture a single lifecycle methods of the component.\n */\nfunction TraceMethodDecorator() {\n // eslint-disable-next-line @typescript-eslint/explicit-function-return-type, @typescript-eslint/ban-types\n return (target, propertyKey, descriptor) => {\n const originalMethod = descriptor.value;\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n descriptor.value = function (...args) {\n const now = timestampInSeconds();\n // eslint-disable-next-line deprecation/deprecation\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n // eslint-disable-next-line deprecation/deprecation\n activeTransaction.startChild({\n description: `<${target.constructor.name}>`,\n endTimestamp: now,\n op: `${ANGULAR_OP}.${String(propertyKey)}`,\n origin: 'auto.ui.angular.trace_method_decorator',\n startTimestamp: now,\n });\n }\n if (originalMethod) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return originalMethod.apply(this, args);\n }\n };\n return descriptor;\n };\n}\n/**\n * Takes the parameterized route from a given ActivatedRouteSnapshot and concatenates the snapshot's\n * child route with its parent to produce the complete parameterized URL of the activated route.\n * This happens recursively until the last child (i.e. the end of the URL) is reached.\n *\n * @param route the ActivatedRouteSnapshot of which its path and its child's path is concatenated\n *\n * @returns the concatenated parameterized route string\n */\nfunction getParameterizedRouteFromSnapshot(route) {\n const parts = [];\n let currentRoute = route && route.firstChild;\n while (currentRoute) {\n const path = currentRoute && currentRoute.routeConfig && currentRoute.routeConfig.path;\n if (path === null || path === undefined) {\n break;\n }\n parts.push(path);\n currentRoute = currentRoute.firstChild;\n }\n const fullPath = parts.filter(part => part).join('/');\n return fullPath ? `/${fullPath}/` : '/';\n}\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { SentryErrorHandler, TraceClassDecorator, TraceDirective, TraceMethodDecorator, TraceModule, TraceService, createErrorHandler, getActiveTransaction, init, instrumentAngularRouting, routingInstrumentation };\n","import { uuid4, timestampInSeconds, logger, dropUndefinedKeys } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN, SEMANTIC_ATTRIBUTE_SENTRY_OP } from '../semanticAttributes.js';\nimport { getRootSpan } from '../utils/getRootSpan.js';\nimport { TRACE_FLAG_SAMPLED, TRACE_FLAG_NONE, spanToJSON, spanTimeInputToSeconds, spanToTraceHeader, spanToTraceContext } from '../utils/spanUtils.js';\n\n/**\n * Keeps track of finished spans for a given transaction\n * @internal\n * @hideconstructor\n * @hidden\n */\nclass SpanRecorder {\n\n constructor(maxlen = 1000) {\n this._maxlen = maxlen;\n this.spans = [];\n }\n\n /**\n * This is just so that we don't run out of memory while recording a lot\n * of spans. At some point we just stop and flush out the start of the\n * trace tree (i.e.the first n spans with the smallest\n * start_timestamp).\n */\n add(span) {\n if (this.spans.length > this._maxlen) {\n // eslint-disable-next-line deprecation/deprecation\n span.spanRecorder = undefined;\n } else {\n this.spans.push(span);\n }\n }\n}\n\n/**\n * Span contains all data about a span\n */\nclass Span {\n /**\n * Tags for the span.\n * @deprecated Use `getSpanAttributes(span)` instead.\n */\n\n /**\n * Data for the span.\n * @deprecated Use `getSpanAttributes(span)` instead.\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n\n /**\n * List of spans that were finalized\n *\n * @deprecated This property will no longer be public. Span recording will be handled internally.\n */\n\n /**\n * @inheritDoc\n * @deprecated Use top level `Sentry.getRootSpan()` instead\n */\n\n /**\n * The instrumenter that created this span.\n *\n * TODO (v8): This can probably be replaced by an `instanceOf` check of the span class.\n * the instrumenter can only be sentry or otel so we can check the span instance\n * to verify which one it is and remove this field entirely.\n *\n * @deprecated This field will be removed.\n */\n\n /** Epoch timestamp in seconds when the span started. */\n\n /** Epoch timestamp in seconds when the span ended. */\n\n /** Internal keeper of the status */\n\n /**\n * You should never call the constructor manually, always use `Sentry.startTransaction()`\n * or call `startChild()` on an existing span.\n * @internal\n * @hideconstructor\n * @hidden\n */\n constructor(spanContext = {}) {\n this._traceId = spanContext.traceId || uuid4();\n this._spanId = spanContext.spanId || uuid4().substring(16);\n this._startTime = spanContext.startTimestamp || timestampInSeconds();\n // eslint-disable-next-line deprecation/deprecation\n this.tags = spanContext.tags ? { ...spanContext.tags } : {};\n // eslint-disable-next-line deprecation/deprecation\n this.data = spanContext.data ? { ...spanContext.data } : {};\n this._attributes = spanContext.attributes ? { ...spanContext.attributes } : {};\n // eslint-disable-next-line deprecation/deprecation\n this.instrumenter = spanContext.instrumenter || 'sentry';\n\n this.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN, spanContext.origin || 'manual');\n\n // eslint-disable-next-line deprecation/deprecation\n this._name = spanContext.name || spanContext.description;\n\n if (spanContext.parentSpanId) {\n this._parentSpanId = spanContext.parentSpanId;\n }\n // We want to include booleans as well here\n if ('sampled' in spanContext) {\n this._sampled = spanContext.sampled;\n }\n if (spanContext.op) {\n this.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_OP, spanContext.op);\n }\n if (spanContext.status) {\n this._status = spanContext.status;\n }\n if (spanContext.endTimestamp) {\n this._endTime = spanContext.endTimestamp;\n }\n }\n\n // This rule conflicts with another eslint rule :(\n /* eslint-disable @typescript-eslint/member-ordering */\n\n /**\n * An alias for `description` of the Span.\n * @deprecated Use `spanToJSON(span).description` instead.\n */\n get name() {\n return this._name || '';\n }\n\n /**\n * Update the name of the span.\n * @deprecated Use `spanToJSON(span).description` instead.\n */\n set name(name) {\n this.updateName(name);\n }\n\n /**\n * Get the description of the Span.\n * @deprecated Use `spanToJSON(span).description` instead.\n */\n get description() {\n return this._name;\n }\n\n /**\n * Get the description of the Span.\n * @deprecated Use `spanToJSON(span).description` instead.\n */\n set description(description) {\n this._name = description;\n }\n\n /**\n * The ID of the trace.\n * @deprecated Use `spanContext().traceId` instead.\n */\n get traceId() {\n return this._traceId;\n }\n\n /**\n * The ID of the trace.\n * @deprecated You cannot update the traceId of a span after span creation.\n */\n set traceId(traceId) {\n this._traceId = traceId;\n }\n\n /**\n * The ID of the span.\n * @deprecated Use `spanContext().spanId` instead.\n */\n get spanId() {\n return this._spanId;\n }\n\n /**\n * The ID of the span.\n * @deprecated You cannot update the spanId of a span after span creation.\n */\n set spanId(spanId) {\n this._spanId = spanId;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `startSpan` functions instead.\n */\n set parentSpanId(string) {\n this._parentSpanId = string;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `spanToJSON(span).parent_span_id` instead.\n */\n get parentSpanId() {\n return this._parentSpanId;\n }\n\n /**\n * Was this span chosen to be sent as part of the sample?\n * @deprecated Use `isRecording()` instead.\n */\n get sampled() {\n return this._sampled;\n }\n\n /**\n * Was this span chosen to be sent as part of the sample?\n * @deprecated You cannot update the sampling decision of a span after span creation.\n */\n set sampled(sampled) {\n this._sampled = sampled;\n }\n\n /**\n * Attributes for the span.\n * @deprecated Use `getSpanAttributes(span)` instead.\n */\n get attributes() {\n return this._attributes;\n }\n\n /**\n * Attributes for the span.\n * @deprecated Use `setAttributes()` instead.\n */\n set attributes(attributes) {\n this._attributes = attributes;\n }\n\n /**\n * Timestamp in seconds (epoch time) indicating when the span started.\n * @deprecated Use `spanToJSON()` instead.\n */\n get startTimestamp() {\n return this._startTime;\n }\n\n /**\n * Timestamp in seconds (epoch time) indicating when the span started.\n * @deprecated In v8, you will not be able to update the span start time after creation.\n */\n set startTimestamp(startTime) {\n this._startTime = startTime;\n }\n\n /**\n * Timestamp in seconds when the span ended.\n * @deprecated Use `spanToJSON()` instead.\n */\n get endTimestamp() {\n return this._endTime;\n }\n\n /**\n * Timestamp in seconds when the span ended.\n * @deprecated Set the end time via `span.end()` instead.\n */\n set endTimestamp(endTime) {\n this._endTime = endTime;\n }\n\n /**\n * The status of the span.\n *\n * @deprecated Use `spanToJSON().status` instead to get the status.\n */\n get status() {\n return this._status;\n }\n\n /**\n * The status of the span.\n *\n * @deprecated Use `.setStatus()` instead to set or update the status.\n */\n set status(status) {\n this._status = status;\n }\n\n /**\n * Operation of the span\n *\n * @deprecated Use `spanToJSON().op` to read the op instead.\n */\n get op() {\n return this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_OP] ;\n }\n\n /**\n * Operation of the span\n *\n * @deprecated Use `startSpan()` functions to set or `span.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_OP, 'op')\n * to update the span instead.\n */\n set op(op) {\n this.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_OP, op);\n }\n\n /**\n * The origin of the span, giving context about what created the span.\n *\n * @deprecated Use `spanToJSON().origin` to read the origin instead.\n */\n get origin() {\n return this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN] ;\n }\n\n /**\n * The origin of the span, giving context about what created the span.\n *\n * @deprecated Use `startSpan()` functions to set the origin instead.\n */\n set origin(origin) {\n this.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN, origin);\n }\n\n /* eslint-enable @typescript-eslint/member-ordering */\n\n /** @inheritdoc */\n spanContext() {\n const { _spanId: spanId, _traceId: traceId, _sampled: sampled } = this;\n return {\n spanId,\n traceId,\n traceFlags: sampled ? TRACE_FLAG_SAMPLED : TRACE_FLAG_NONE,\n };\n }\n\n /**\n * Creates a new `Span` while setting the current `Span.id` as `parentSpanId`.\n * Also the `sampled` decision will be inherited.\n *\n * @deprecated Use `startSpan()`, `startSpanManual()` or `startInactiveSpan()` instead.\n */\n startChild(\n spanContext,\n ) {\n const childSpan = new Span({\n ...spanContext,\n parentSpanId: this._spanId,\n sampled: this._sampled,\n traceId: this._traceId,\n });\n\n // eslint-disable-next-line deprecation/deprecation\n childSpan.spanRecorder = this.spanRecorder;\n // eslint-disable-next-line deprecation/deprecation\n if (childSpan.spanRecorder) {\n // eslint-disable-next-line deprecation/deprecation\n childSpan.spanRecorder.add(childSpan);\n }\n\n const rootSpan = getRootSpan(this);\n // TODO: still set span.transaction here until we have a more permanent solution\n // Probably similarly to the weakmap we hold in node-experimental\n // eslint-disable-next-line deprecation/deprecation\n childSpan.transaction = rootSpan ;\n\n if (DEBUG_BUILD && rootSpan) {\n const opStr = (spanContext && spanContext.op) || '< unknown op >';\n const nameStr = spanToJSON(childSpan).description || '< unknown name >';\n const idStr = rootSpan.spanContext().spanId;\n\n const logMessage = `[Tracing] Starting '${opStr}' span on transaction '${nameStr}' (${idStr}).`;\n logger.log(logMessage);\n this._logMessage = logMessage;\n }\n\n return childSpan;\n }\n\n /**\n * Sets the tag attribute on the current span.\n *\n * Can also be used to unset a tag, by passing `undefined`.\n *\n * @param key Tag key\n * @param value Tag value\n * @deprecated Use `setAttribute()` instead.\n */\n setTag(key, value) {\n // eslint-disable-next-line deprecation/deprecation\n this.tags = { ...this.tags, [key]: value };\n return this;\n }\n\n /**\n * Sets the data attribute on the current span\n * @param key Data key\n * @param value Data value\n * @deprecated Use `setAttribute()` instead.\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n setData(key, value) {\n // eslint-disable-next-line deprecation/deprecation\n this.data = { ...this.data, [key]: value };\n return this;\n }\n\n /** @inheritdoc */\n setAttribute(key, value) {\n if (value === undefined) {\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete this._attributes[key];\n } else {\n this._attributes[key] = value;\n }\n }\n\n /** @inheritdoc */\n setAttributes(attributes) {\n Object.keys(attributes).forEach(key => this.setAttribute(key, attributes[key]));\n }\n\n /**\n * @inheritDoc\n */\n setStatus(value) {\n this._status = value;\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setHttpStatus(httpStatus) {\n // eslint-disable-next-line deprecation/deprecation\n this.setTag('http.status_code', String(httpStatus));\n // eslint-disable-next-line deprecation/deprecation\n this.setData('http.response.status_code', httpStatus);\n const spanStatus = spanStatusfromHttpCode(httpStatus);\n if (spanStatus !== 'unknown_error') {\n this.setStatus(spanStatus);\n }\n return this;\n }\n\n /**\n * @inheritdoc\n *\n * @deprecated Use `.updateName()` instead.\n */\n setName(name) {\n this.updateName(name);\n }\n\n /**\n * @inheritDoc\n */\n updateName(name) {\n this._name = name;\n return this;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `spanToJSON(span).status === 'ok'` instead.\n */\n isSuccess() {\n return this._status === 'ok';\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `.end()` instead.\n */\n finish(endTimestamp) {\n return this.end(endTimestamp);\n }\n\n /** @inheritdoc */\n end(endTimestamp) {\n // If already ended, skip\n if (this._endTime) {\n return;\n }\n const rootSpan = getRootSpan(this);\n if (\n DEBUG_BUILD &&\n // Don't call this for transactions\n rootSpan &&\n rootSpan.spanContext().spanId !== this._spanId\n ) {\n const logMessage = this._logMessage;\n if (logMessage) {\n logger.log((logMessage ).replace('Starting', 'Finishing'));\n }\n }\n\n this._endTime = spanTimeInputToSeconds(endTimestamp);\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `spanToTraceHeader()` instead.\n */\n toTraceparent() {\n return spanToTraceHeader(this);\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `spanToJSON()` or access the fields directly instead.\n */\n toContext() {\n return dropUndefinedKeys({\n data: this._getData(),\n description: this._name,\n endTimestamp: this._endTime,\n // eslint-disable-next-line deprecation/deprecation\n op: this.op,\n parentSpanId: this._parentSpanId,\n sampled: this._sampled,\n spanId: this._spanId,\n startTimestamp: this._startTime,\n status: this._status,\n // eslint-disable-next-line deprecation/deprecation\n tags: this.tags,\n traceId: this._traceId,\n });\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Update the fields directly instead.\n */\n updateWithContext(spanContext) {\n // eslint-disable-next-line deprecation/deprecation\n this.data = spanContext.data || {};\n // eslint-disable-next-line deprecation/deprecation\n this._name = spanContext.name || spanContext.description;\n this._endTime = spanContext.endTimestamp;\n // eslint-disable-next-line deprecation/deprecation\n this.op = spanContext.op;\n this._parentSpanId = spanContext.parentSpanId;\n this._sampled = spanContext.sampled;\n this._spanId = spanContext.spanId || this._spanId;\n this._startTime = spanContext.startTimestamp || this._startTime;\n this._status = spanContext.status;\n // eslint-disable-next-line deprecation/deprecation\n this.tags = spanContext.tags || {};\n this._traceId = spanContext.traceId || this._traceId;\n\n return this;\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use `spanToTraceContext()` util function instead.\n */\n getTraceContext() {\n return spanToTraceContext(this);\n }\n\n /**\n * Get JSON representation of this span.\n *\n * @hidden\n * @internal This method is purely for internal purposes and should not be used outside\n * of SDK code. If you need to get a JSON representation of a span,\n * use `spanToJSON(span)` instead.\n */\n getSpanJSON() {\n return dropUndefinedKeys({\n data: this._getData(),\n description: this._name,\n op: this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_OP] ,\n parent_span_id: this._parentSpanId,\n span_id: this._spanId,\n start_timestamp: this._startTime,\n status: this._status,\n // eslint-disable-next-line deprecation/deprecation\n tags: Object.keys(this.tags).length > 0 ? this.tags : undefined,\n timestamp: this._endTime,\n trace_id: this._traceId,\n origin: this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_ORIGIN] ,\n });\n }\n\n /** @inheritdoc */\n isRecording() {\n return !this._endTime && !!this._sampled;\n }\n\n /**\n * Convert the object to JSON.\n * @deprecated Use `spanToJSON(span)` instead.\n */\n toJSON() {\n return this.getSpanJSON();\n }\n\n /**\n * Get the merged data for this span.\n * For now, this combines `data` and `attributes` together,\n * until eventually we can ingest `attributes` directly.\n */\n _getData()\n\n {\n // eslint-disable-next-line deprecation/deprecation\n const { data, _attributes: attributes } = this;\n\n const hasData = Object.keys(data).length > 0;\n const hasAttributes = Object.keys(attributes).length > 0;\n\n if (!hasData && !hasAttributes) {\n return undefined;\n }\n\n if (hasData && hasAttributes) {\n return {\n ...data,\n ...attributes,\n };\n }\n\n return hasData ? data : attributes;\n }\n}\n\n/**\n * Converts a HTTP status code into a {@link SpanStatusType}.\n *\n * @param httpStatus The HTTP response status code.\n * @returns The span status or unknown_error.\n */\nfunction spanStatusfromHttpCode(httpStatus) {\n if (httpStatus < 400 && httpStatus >= 100) {\n return 'ok';\n }\n\n if (httpStatus >= 400 && httpStatus < 500) {\n switch (httpStatus) {\n case 401:\n return 'unauthenticated';\n case 403:\n return 'permission_denied';\n case 404:\n return 'not_found';\n case 409:\n return 'already_exists';\n case 413:\n return 'failed_precondition';\n case 429:\n return 'resource_exhausted';\n default:\n return 'invalid_argument';\n }\n }\n\n if (httpStatus >= 500 && httpStatus < 600) {\n switch (httpStatus) {\n case 501:\n return 'unimplemented';\n case 503:\n return 'unavailable';\n case 504:\n return 'deadline_exceeded';\n default:\n return 'internal_error';\n }\n }\n\n return 'unknown_error';\n}\n\nexport { Span, SpanRecorder, spanStatusfromHttpCode };\n","import { dropUndefinedKeys, logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { getCurrentHub } from '../hub.js';\nimport { SEMANTIC_ATTRIBUTE_SENTRY_SOURCE, SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE } from '../semanticAttributes.js';\nimport { spanTimeInputToSeconds, spanToJSON, spanToTraceContext } from '../utils/spanUtils.js';\nimport { getDynamicSamplingContextFromSpan } from './dynamicSamplingContext.js';\nimport { Span, SpanRecorder } from './span.js';\n\n/** JSDoc */\nclass Transaction extends Span {\n /**\n * The reference to the current hub.\n */\n\n // DO NOT yet remove this property, it is used in a hack for v7 backwards compatibility.\n\n /**\n * This constructor should never be called manually. Those instrumenting tracing should use\n * `Sentry.startTransaction()`, and internal methods should use `hub.startTransaction()`.\n * @internal\n * @hideconstructor\n * @hidden\n *\n * @deprecated Transactions will be removed in v8. Use spans instead.\n */\n constructor(transactionContext, hub) {\n super(transactionContext);\n this._measurements = {};\n this._contexts = {};\n\n // eslint-disable-next-line deprecation/deprecation\n this._hub = hub || getCurrentHub();\n\n this._name = transactionContext.name || '';\n\n this._metadata = {\n // eslint-disable-next-line deprecation/deprecation\n ...transactionContext.metadata,\n };\n\n this._trimEnd = transactionContext.trimEnd;\n\n // this is because transactions are also spans, and spans have a transaction pointer\n // TODO (v8): Replace this with another way to set the root span\n // eslint-disable-next-line deprecation/deprecation\n this.transaction = this;\n\n // If Dynamic Sampling Context is provided during the creation of the transaction, we freeze it as it usually means\n // there is incoming Dynamic Sampling Context. (Either through an incoming request, a baggage meta-tag, or other means)\n const incomingDynamicSamplingContext = this._metadata.dynamicSamplingContext;\n if (incomingDynamicSamplingContext) {\n // We shallow copy this in case anything writes to the original reference of the passed in `dynamicSamplingContext`\n this._frozenDynamicSamplingContext = { ...incomingDynamicSamplingContext };\n }\n }\n\n // This sadly conflicts with the getter/setter ordering :(\n /* eslint-disable @typescript-eslint/member-ordering */\n\n /**\n * Getter for `name` property.\n * @deprecated Use `spanToJSON(span).description` instead.\n */\n get name() {\n return this._name;\n }\n\n /**\n * Setter for `name` property, which also sets `source` as custom.\n * @deprecated Use `updateName()` and `setMetadata()` instead.\n */\n set name(newName) {\n // eslint-disable-next-line deprecation/deprecation\n this.setName(newName);\n }\n\n /**\n * Get the metadata for this transaction.\n * @deprecated Use `spanGetMetadata(transaction)` instead.\n */\n get metadata() {\n // We merge attributes in for backwards compatibility\n return {\n // Defaults\n // eslint-disable-next-line deprecation/deprecation\n source: 'custom',\n spanMetadata: {},\n\n // Legacy metadata\n ...this._metadata,\n\n // From attributes\n ...(this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_SOURCE] && {\n source: this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_SOURCE] ,\n }),\n ...(this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE] && {\n sampleRate: this._attributes[SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE] ,\n }),\n };\n }\n\n /**\n * Update the metadata for this transaction.\n * @deprecated Use `spanGetMetadata(transaction)` instead.\n */\n set metadata(metadata) {\n this._metadata = metadata;\n }\n\n /* eslint-enable @typescript-eslint/member-ordering */\n\n /**\n * Setter for `name` property, which also sets `source` on the metadata.\n *\n * @deprecated Use `.updateName()` and `.setAttribute()` instead.\n */\n setName(name, source = 'custom') {\n this._name = name;\n this.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_SOURCE, source);\n }\n\n /** @inheritdoc */\n updateName(name) {\n this._name = name;\n return this;\n }\n\n /**\n * Attaches SpanRecorder to the span itself\n * @param maxlen maximum number of spans that can be recorded\n */\n initSpanRecorder(maxlen = 1000) {\n // eslint-disable-next-line deprecation/deprecation\n if (!this.spanRecorder) {\n // eslint-disable-next-line deprecation/deprecation\n this.spanRecorder = new SpanRecorder(maxlen);\n }\n // eslint-disable-next-line deprecation/deprecation\n this.spanRecorder.add(this);\n }\n\n /**\n * Set the context of a transaction event.\n * @deprecated Use either `.setAttribute()`, or set the context on the scope before creating the transaction.\n */\n setContext(key, context) {\n if (context === null) {\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete this._contexts[key];\n } else {\n this._contexts[key] = context;\n }\n }\n\n /**\n * @inheritDoc\n *\n * @deprecated Use top-level `setMeasurement()` instead.\n */\n setMeasurement(name, value, unit = '') {\n this._measurements[name] = { value, unit };\n }\n\n /**\n * Store metadata on this transaction.\n * @deprecated Use attributes or store data on the scope instead.\n */\n setMetadata(newMetadata) {\n this._metadata = { ...this._metadata, ...newMetadata };\n }\n\n /**\n * @inheritDoc\n */\n end(endTimestamp) {\n const timestampInS = spanTimeInputToSeconds(endTimestamp);\n const transaction = this._finishTransaction(timestampInS);\n if (!transaction) {\n return undefined;\n }\n // eslint-disable-next-line deprecation/deprecation\n return this._hub.captureEvent(transaction);\n }\n\n /**\n * @inheritDoc\n */\n toContext() {\n // eslint-disable-next-line deprecation/deprecation\n const spanContext = super.toContext();\n\n return dropUndefinedKeys({\n ...spanContext,\n name: this._name,\n trimEnd: this._trimEnd,\n });\n }\n\n /**\n * @inheritDoc\n */\n updateWithContext(transactionContext) {\n // eslint-disable-next-line deprecation/deprecation\n super.updateWithContext(transactionContext);\n\n this._name = transactionContext.name || '';\n this._trimEnd = transactionContext.trimEnd;\n\n return this;\n }\n\n /**\n * @inheritdoc\n *\n * @experimental\n *\n * @deprecated Use top-level `getDynamicSamplingContextFromSpan` instead.\n */\n getDynamicSamplingContext() {\n return getDynamicSamplingContextFromSpan(this);\n }\n\n /**\n * Override the current hub with a new one.\n * Used if you want another hub to finish the transaction.\n *\n * @internal\n */\n setHub(hub) {\n this._hub = hub;\n }\n\n /**\n * Finish the transaction & prepare the event to send to Sentry.\n */\n _finishTransaction(endTimestamp) {\n // This transaction is already finished, so we should not flush it again.\n if (this._endTime !== undefined) {\n return undefined;\n }\n\n if (!this._name) {\n DEBUG_BUILD && logger.warn('Transaction has no name, falling back to ``.');\n this._name = '';\n }\n\n // just sets the end timestamp\n super.end(endTimestamp);\n\n // eslint-disable-next-line deprecation/deprecation\n const client = this._hub.getClient();\n if (client && client.emit) {\n client.emit('finishTransaction', this);\n }\n\n if (this._sampled !== true) {\n // At this point if `sampled !== true` we want to discard the transaction.\n DEBUG_BUILD && logger.log('[Tracing] Discarding transaction because its trace was not chosen to be sampled.');\n\n if (client) {\n client.recordDroppedEvent('sample_rate', 'transaction');\n }\n\n return undefined;\n }\n\n // eslint-disable-next-line deprecation/deprecation\n const finishedSpans = this.spanRecorder\n ? // eslint-disable-next-line deprecation/deprecation\n this.spanRecorder.spans.filter(span => span !== this && spanToJSON(span).timestamp)\n : [];\n\n if (this._trimEnd && finishedSpans.length > 0) {\n const endTimes = finishedSpans.map(span => spanToJSON(span).timestamp).filter(Boolean) ;\n this._endTime = endTimes.reduce((prev, current) => {\n return prev > current ? prev : current;\n });\n }\n\n // eslint-disable-next-line deprecation/deprecation\n const { metadata } = this;\n // eslint-disable-next-line deprecation/deprecation\n const { source } = metadata;\n\n const transaction = {\n contexts: {\n ...this._contexts,\n // We don't want to override trace context\n trace: spanToTraceContext(this),\n },\n // TODO: Pass spans serialized via `spanToJSON()` here instead in v8.\n spans: finishedSpans,\n start_timestamp: this._startTime,\n // eslint-disable-next-line deprecation/deprecation\n tags: this.tags,\n timestamp: this._endTime,\n transaction: this._name,\n type: 'transaction',\n sdkProcessingMetadata: {\n ...metadata,\n dynamicSamplingContext: getDynamicSamplingContextFromSpan(this),\n },\n ...(source && {\n transaction_info: {\n source,\n },\n }),\n };\n\n const hasMeasurements = Object.keys(this._measurements).length > 0;\n\n if (hasMeasurements) {\n DEBUG_BUILD &&\n logger.log(\n '[Measurements] Adding measurements to transaction',\n JSON.stringify(this._measurements, undefined, 2),\n );\n transaction.measurements = this._measurements;\n }\n\n // eslint-disable-next-line deprecation/deprecation\n DEBUG_BUILD && logger.log(`[Tracing] Finishing ${this.op} transaction: ${this._name}.`);\n\n return transaction;\n }\n}\n\nexport { Transaction };\n","import { logger, timestampInSeconds } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { spanTimeInputToSeconds, spanToJSON } from '../utils/spanUtils.js';\nimport { SpanRecorder } from './span.js';\nimport { Transaction } from './transaction.js';\n\nconst TRACING_DEFAULTS = {\n idleTimeout: 1000,\n finalTimeout: 30000,\n heartbeatInterval: 5000,\n};\n\nconst FINISH_REASON_TAG = 'finishReason';\n\nconst IDLE_TRANSACTION_FINISH_REASONS = [\n 'heartbeatFailed',\n 'idleTimeout',\n 'documentHidden',\n 'finalTimeout',\n 'externalFinish',\n 'cancelled',\n];\n\n/**\n * @inheritDoc\n */\nclass IdleTransactionSpanRecorder extends SpanRecorder {\n constructor(\n _pushActivity,\n _popActivity,\n transactionSpanId,\n maxlen,\n ) {\n super(maxlen);this._pushActivity = _pushActivity;this._popActivity = _popActivity;this.transactionSpanId = transactionSpanId; }\n\n /**\n * @inheritDoc\n */\n add(span) {\n // We should make sure we do not push and pop activities for\n // the transaction that this span recorder belongs to.\n if (span.spanContext().spanId !== this.transactionSpanId) {\n // We patch span.end() to pop an activity after setting an endTimestamp.\n // eslint-disable-next-line @typescript-eslint/unbound-method\n const originalEnd = span.end;\n span.end = (...rest) => {\n this._popActivity(span.spanContext().spanId);\n return originalEnd.apply(span, rest);\n };\n\n // We should only push new activities if the span does not have an end timestamp.\n if (spanToJSON(span).timestamp === undefined) {\n this._pushActivity(span.spanContext().spanId);\n }\n }\n\n super.add(span);\n }\n}\n\n/**\n * An IdleTransaction is a transaction that automatically finishes. It does this by tracking child spans as activities.\n * You can have multiple IdleTransactions active, but if the `onScope` option is specified, the idle transaction will\n * put itself on the scope on creation.\n */\nclass IdleTransaction extends Transaction {\n // Activities store a list of active spans\n\n // Track state of activities in previous heartbeat\n\n // Amount of times heartbeat has counted. Will cause transaction to finish after 3 beats.\n\n // We should not use heartbeat if we finished a transaction\n\n // Idle timeout was canceled and we should finish the transaction with the last span end.\n\n /**\n * Timer that tracks Transaction idleTimeout\n */\n\n /**\n * @deprecated Transactions will be removed in v8. Use spans instead.\n */\n constructor(\n transactionContext,\n _idleHub,\n /**\n * The time to wait in ms until the idle transaction will be finished. This timer is started each time\n * there are no active spans on this transaction.\n */\n _idleTimeout = TRACING_DEFAULTS.idleTimeout,\n /**\n * The final value in ms that a transaction cannot exceed\n */\n _finalTimeout = TRACING_DEFAULTS.finalTimeout,\n _heartbeatInterval = TRACING_DEFAULTS.heartbeatInterval,\n // Whether or not the transaction should put itself on the scope when it starts and pop itself off when it ends\n _onScope = false,\n /**\n * When set to `true`, will disable the idle timeout (`_idleTimeout` option) and heartbeat mechanisms (`_heartbeatInterval`\n * option) until the `sendAutoFinishSignal()` method is called. The final timeout mechanism (`_finalTimeout` option)\n * will not be affected by this option, meaning the transaction will definitely be finished when the final timeout is\n * reached, no matter what this option is configured to.\n *\n * Defaults to `false`.\n */\n delayAutoFinishUntilSignal = false,\n ) {\n super(transactionContext, _idleHub);this._idleHub = _idleHub;this._idleTimeout = _idleTimeout;this._finalTimeout = _finalTimeout;this._heartbeatInterval = _heartbeatInterval;this._onScope = _onScope;\n this.activities = {};\n this._heartbeatCounter = 0;\n this._finished = false;\n this._idleTimeoutCanceledPermanently = false;\n this._beforeFinishCallbacks = [];\n this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[4];\n this._autoFinishAllowed = !delayAutoFinishUntilSignal;\n\n if (_onScope) {\n // We set the transaction here on the scope so error events pick up the trace\n // context and attach it to the error.\n DEBUG_BUILD && logger.log(`Setting idle transaction on scope. Span ID: ${this.spanContext().spanId}`);\n // eslint-disable-next-line deprecation/deprecation\n _idleHub.getScope().setSpan(this);\n }\n\n if (!delayAutoFinishUntilSignal) {\n this._restartIdleTimeout();\n }\n\n setTimeout(() => {\n if (!this._finished) {\n this.setStatus('deadline_exceeded');\n this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[3];\n this.end();\n }\n }, this._finalTimeout);\n }\n\n /** {@inheritDoc} */\n end(endTimestamp) {\n const endTimestampInS = spanTimeInputToSeconds(endTimestamp);\n\n this._finished = true;\n this.activities = {};\n\n // eslint-disable-next-line deprecation/deprecation\n if (this.op === 'ui.action.click') {\n this.setAttribute(FINISH_REASON_TAG, this._finishReason);\n }\n\n // eslint-disable-next-line deprecation/deprecation\n if (this.spanRecorder) {\n DEBUG_BUILD &&\n // eslint-disable-next-line deprecation/deprecation\n logger.log('[Tracing] finishing IdleTransaction', new Date(endTimestampInS * 1000).toISOString(), this.op);\n\n for (const callback of this._beforeFinishCallbacks) {\n callback(this, endTimestampInS);\n }\n\n // eslint-disable-next-line deprecation/deprecation\n this.spanRecorder.spans = this.spanRecorder.spans.filter((span) => {\n // If we are dealing with the transaction itself, we just return it\n if (span.spanContext().spanId === this.spanContext().spanId) {\n return true;\n }\n\n // We cancel all pending spans with status \"cancelled\" to indicate the idle transaction was finished early\n if (!spanToJSON(span).timestamp) {\n span.setStatus('cancelled');\n span.end(endTimestampInS);\n DEBUG_BUILD &&\n logger.log('[Tracing] cancelling span since transaction ended early', JSON.stringify(span, undefined, 2));\n }\n\n const { start_timestamp: startTime, timestamp: endTime } = spanToJSON(span);\n const spanStartedBeforeTransactionFinish = startTime && startTime < endTimestampInS;\n\n // Add a delta with idle timeout so that we prevent false positives\n const timeoutWithMarginOfError = (this._finalTimeout + this._idleTimeout) / 1000;\n const spanEndedBeforeFinalTimeout = endTime && startTime && endTime - startTime < timeoutWithMarginOfError;\n\n if (DEBUG_BUILD) {\n const stringifiedSpan = JSON.stringify(span, undefined, 2);\n if (!spanStartedBeforeTransactionFinish) {\n logger.log('[Tracing] discarding Span since it happened after Transaction was finished', stringifiedSpan);\n } else if (!spanEndedBeforeFinalTimeout) {\n logger.log('[Tracing] discarding Span since it finished after Transaction final timeout', stringifiedSpan);\n }\n }\n\n return spanStartedBeforeTransactionFinish && spanEndedBeforeFinalTimeout;\n });\n\n DEBUG_BUILD && logger.log('[Tracing] flushing IdleTransaction');\n } else {\n DEBUG_BUILD && logger.log('[Tracing] No active IdleTransaction');\n }\n\n // if `this._onScope` is `true`, the transaction put itself on the scope when it started\n if (this._onScope) {\n // eslint-disable-next-line deprecation/deprecation\n const scope = this._idleHub.getScope();\n // eslint-disable-next-line deprecation/deprecation\n if (scope.getTransaction() === this) {\n // eslint-disable-next-line deprecation/deprecation\n scope.setSpan(undefined);\n }\n }\n\n return super.end(endTimestamp);\n }\n\n /**\n * Register a callback function that gets executed before the transaction finishes.\n * Useful for cleanup or if you want to add any additional spans based on current context.\n *\n * This is exposed because users have no other way of running something before an idle transaction\n * finishes.\n */\n registerBeforeFinishCallback(callback) {\n this._beforeFinishCallbacks.push(callback);\n }\n\n /**\n * @inheritDoc\n */\n initSpanRecorder(maxlen) {\n // eslint-disable-next-line deprecation/deprecation\n if (!this.spanRecorder) {\n const pushActivity = (id) => {\n if (this._finished) {\n return;\n }\n this._pushActivity(id);\n };\n const popActivity = (id) => {\n if (this._finished) {\n return;\n }\n this._popActivity(id);\n };\n\n // eslint-disable-next-line deprecation/deprecation\n this.spanRecorder = new IdleTransactionSpanRecorder(pushActivity, popActivity, this.spanContext().spanId, maxlen);\n\n // Start heartbeat so that transactions do not run forever.\n DEBUG_BUILD && logger.log('Starting heartbeat');\n this._pingHeartbeat();\n }\n // eslint-disable-next-line deprecation/deprecation\n this.spanRecorder.add(this);\n }\n\n /**\n * Cancels the existing idle timeout, if there is one.\n * @param restartOnChildSpanChange Default is `true`.\n * If set to false the transaction will end\n * with the last child span.\n */\n cancelIdleTimeout(\n endTimestamp,\n {\n restartOnChildSpanChange,\n }\n\n = {\n restartOnChildSpanChange: true,\n },\n ) {\n this._idleTimeoutCanceledPermanently = restartOnChildSpanChange === false;\n if (this._idleTimeoutID) {\n clearTimeout(this._idleTimeoutID);\n this._idleTimeoutID = undefined;\n\n if (Object.keys(this.activities).length === 0 && this._idleTimeoutCanceledPermanently) {\n this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[5];\n this.end(endTimestamp);\n }\n }\n }\n\n /**\n * Temporary method used to externally set the transaction's `finishReason`\n *\n * ** WARNING**\n * This is for the purpose of experimentation only and will be removed in the near future, do not use!\n *\n * @internal\n *\n */\n setFinishReason(reason) {\n this._finishReason = reason;\n }\n\n /**\n * Permits the IdleTransaction to automatically end itself via the idle timeout and heartbeat mechanisms when the `delayAutoFinishUntilSignal` option was set to `true`.\n */\n sendAutoFinishSignal() {\n if (!this._autoFinishAllowed) {\n DEBUG_BUILD && logger.log('[Tracing] Received finish signal for idle transaction.');\n this._restartIdleTimeout();\n this._autoFinishAllowed = true;\n }\n }\n\n /**\n * Restarts idle timeout, if there is no running idle timeout it will start one.\n */\n _restartIdleTimeout(endTimestamp) {\n this.cancelIdleTimeout();\n this._idleTimeoutID = setTimeout(() => {\n if (!this._finished && Object.keys(this.activities).length === 0) {\n this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[1];\n this.end(endTimestamp);\n }\n }, this._idleTimeout);\n }\n\n /**\n * Start tracking a specific activity.\n * @param spanId The span id that represents the activity\n */\n _pushActivity(spanId) {\n this.cancelIdleTimeout(undefined, { restartOnChildSpanChange: !this._idleTimeoutCanceledPermanently });\n DEBUG_BUILD && logger.log(`[Tracing] pushActivity: ${spanId}`);\n this.activities[spanId] = true;\n DEBUG_BUILD && logger.log('[Tracing] new activities count', Object.keys(this.activities).length);\n }\n\n /**\n * Remove an activity from usage\n * @param spanId The span id that represents the activity\n */\n _popActivity(spanId) {\n if (this.activities[spanId]) {\n DEBUG_BUILD && logger.log(`[Tracing] popActivity ${spanId}`);\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete this.activities[spanId];\n DEBUG_BUILD && logger.log('[Tracing] new activities count', Object.keys(this.activities).length);\n }\n\n if (Object.keys(this.activities).length === 0) {\n const endTimestamp = timestampInSeconds();\n if (this._idleTimeoutCanceledPermanently) {\n if (this._autoFinishAllowed) {\n this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[5];\n this.end(endTimestamp);\n }\n } else {\n // We need to add the timeout here to have the real endtimestamp of the transaction\n // Remember timestampInSeconds is in seconds, timeout is in ms\n this._restartIdleTimeout(endTimestamp + this._idleTimeout / 1000);\n }\n }\n }\n\n /**\n * Checks when entries of this.activities are not changing for 3 beats.\n * If this occurs we finish the transaction.\n */\n _beat() {\n // We should not be running heartbeat if the idle transaction is finished.\n if (this._finished) {\n return;\n }\n\n const heartbeatString = Object.keys(this.activities).join('');\n\n if (heartbeatString === this._prevHeartbeatString) {\n this._heartbeatCounter++;\n } else {\n this._heartbeatCounter = 1;\n }\n\n this._prevHeartbeatString = heartbeatString;\n\n if (this._heartbeatCounter >= 3) {\n if (this._autoFinishAllowed) {\n DEBUG_BUILD && logger.log('[Tracing] Transaction finished because of no change for 3 heart beats');\n this.setStatus('deadline_exceeded');\n this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[0];\n this.end();\n }\n } else {\n this._pingHeartbeat();\n }\n }\n\n /**\n * Pings the heartbeat\n */\n _pingHeartbeat() {\n DEBUG_BUILD && logger.log(`pinging Heartbeat -> current counter: ${this._heartbeatCounter}`);\n setTimeout(() => {\n this._beat();\n }, this._heartbeatInterval);\n }\n}\n\nexport { IdleTransaction, IdleTransactionSpanRecorder, TRACING_DEFAULTS };\n","import { extractTraceparentData as extractTraceparentData$1 } from '@sentry/utils';\nexport { stripUrlQueryAndFragment } from '@sentry/utils';\nimport { getCurrentHub } from '../hub.js';\n\n/**\n * Grabs active transaction off scope.\n *\n * @deprecated You should not rely on the transaction, but just use `startSpan()` APIs instead.\n */\nfunction getActiveTransaction(maybeHub) {\n // eslint-disable-next-line deprecation/deprecation\n const hub = maybeHub || getCurrentHub();\n // eslint-disable-next-line deprecation/deprecation\n const scope = hub.getScope();\n // eslint-disable-next-line deprecation/deprecation\n return scope.getTransaction() ;\n}\n\n/**\n * The `extractTraceparentData` function and `TRACEPARENT_REGEXP` constant used\n * to be declared in this file. It was later moved into `@sentry/utils` as part of a\n * move to remove `@sentry/tracing` dependencies from `@sentry/node` (`extractTraceparentData`\n * is the only tracing function used by `@sentry/node`).\n *\n * These exports are kept here for backwards compatability's sake.\n *\n * See https://github.com/getsentry/sentry-javascript/issues/4642 for more details.\n *\n * @deprecated Import this function from `@sentry/utils` instead\n */\nconst extractTraceparentData = extractTraceparentData$1;\n\nexport { extractTraceparentData, getActiveTransaction };\n","import { addGlobalErrorInstrumentationHandler, addGlobalUnhandledRejectionInstrumentationHandler, logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { getActiveTransaction } from './utils.js';\n\nlet errorsInstrumented = false;\n\n/**\n * Configures global error listeners\n */\nfunction registerErrorInstrumentation() {\n if (errorsInstrumented) {\n return;\n }\n\n errorsInstrumented = true;\n addGlobalErrorInstrumentationHandler(errorCallback);\n addGlobalUnhandledRejectionInstrumentationHandler(errorCallback);\n}\n\n/**\n * If an error or unhandled promise occurs, we mark the active transaction as failed\n */\nfunction errorCallback() {\n // eslint-disable-next-line deprecation/deprecation\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n const status = 'internal_error';\n DEBUG_BUILD && logger.log(`[Tracing] Transaction: ${status} -> Global error occured`);\n activeTransaction.setStatus(status);\n }\n}\n\n// The function name will be lost when bundling but we need to be able to identify this listener later to maintain the\n// node.js default exit behaviour\nerrorCallback.tag = 'sentry_tracingErrorCallback';\n\nexport { registerErrorInstrumentation };\n","import { getClient } from '../exports.js';\n\n// Treeshakable guard to remove all code related to tracing\n\n/**\n * Determines if tracing is currently enabled.\n *\n * Tracing is enabled when at least one of `tracesSampleRate` and `tracesSampler` is defined in the SDK config.\n */\nfunction hasTracingEnabled(\n maybeOptions,\n) {\n if (typeof __SENTRY_TRACING__ === 'boolean' && !__SENTRY_TRACING__) {\n return false;\n }\n\n const client = getClient();\n const options = maybeOptions || (client && client.getOptions());\n return !!options && (options.enableTracing || 'tracesSampleRate' in options || 'tracesSampler' in options);\n}\n\nexport { hasTracingEnabled };\n","import { logger, isNaN } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE } from '../semanticAttributes.js';\nimport { hasTracingEnabled } from '../utils/hasTracingEnabled.js';\nimport { spanToJSON } from '../utils/spanUtils.js';\n\n/**\n * Makes a sampling decision for the given transaction and stores it on the transaction.\n *\n * Called every time a transaction is created. Only transactions which emerge with a `sampled` value of `true` will be\n * sent to Sentry.\n *\n * This method muttes the given `transaction` and will set the `sampled` value on it.\n * It returns the same transaction, for convenience.\n */\nfunction sampleTransaction(\n transaction,\n options,\n samplingContext,\n) {\n // nothing to do if tracing is not enabled\n if (!hasTracingEnabled(options)) {\n // eslint-disable-next-line deprecation/deprecation\n transaction.sampled = false;\n return transaction;\n }\n\n // if the user has forced a sampling decision by passing a `sampled` value in their transaction context, go with that\n // eslint-disable-next-line deprecation/deprecation\n if (transaction.sampled !== undefined) {\n // eslint-disable-next-line deprecation/deprecation\n transaction.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE, Number(transaction.sampled));\n return transaction;\n }\n\n // we would have bailed already if neither `tracesSampler` nor `tracesSampleRate` nor `enableTracing` were defined, so one of these should\n // work; prefer the hook if so\n let sampleRate;\n if (typeof options.tracesSampler === 'function') {\n sampleRate = options.tracesSampler(samplingContext);\n transaction.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE, Number(sampleRate));\n } else if (samplingContext.parentSampled !== undefined) {\n sampleRate = samplingContext.parentSampled;\n } else if (typeof options.tracesSampleRate !== 'undefined') {\n sampleRate = options.tracesSampleRate;\n transaction.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE, Number(sampleRate));\n } else {\n // When `enableTracing === true`, we use a sample rate of 100%\n sampleRate = 1;\n transaction.setAttribute(SEMANTIC_ATTRIBUTE_SENTRY_SAMPLE_RATE, sampleRate);\n }\n\n // Since this is coming from the user (or from a function provided by the user), who knows what we might get. (The\n // only valid values are booleans or numbers between 0 and 1.)\n if (!isValidSampleRate(sampleRate)) {\n DEBUG_BUILD && logger.warn('[Tracing] Discarding transaction because of invalid sample rate.');\n // eslint-disable-next-line deprecation/deprecation\n transaction.sampled = false;\n return transaction;\n }\n\n // if the function returned 0 (or false), or if `tracesSampleRate` is 0, it's a sign the transaction should be dropped\n if (!sampleRate) {\n DEBUG_BUILD &&\n logger.log(\n `[Tracing] Discarding transaction because ${\n typeof options.tracesSampler === 'function'\n ? 'tracesSampler returned 0 or false'\n : 'a negative sampling decision was inherited or tracesSampleRate is set to 0'\n }`,\n );\n // eslint-disable-next-line deprecation/deprecation\n transaction.sampled = false;\n return transaction;\n }\n\n // Now we roll the dice. Math.random is inclusive of 0, but not of 1, so strict < is safe here. In case sampleRate is\n // a boolean, the < comparison will cause it to be automatically cast to 1 if it's true and 0 if it's false.\n // eslint-disable-next-line deprecation/deprecation\n transaction.sampled = Math.random() < (sampleRate );\n\n // if we're not going to keep it, we're done\n // eslint-disable-next-line deprecation/deprecation\n if (!transaction.sampled) {\n DEBUG_BUILD &&\n logger.log(\n `[Tracing] Discarding transaction because it's not included in the random sample (sampling rate = ${Number(\n sampleRate,\n )})`,\n );\n return transaction;\n }\n\n DEBUG_BUILD &&\n // eslint-disable-next-line deprecation/deprecation\n logger.log(`[Tracing] starting ${transaction.op} transaction - ${spanToJSON(transaction).description}`);\n return transaction;\n}\n\n/**\n * Checks the given sample rate to make sure it is valid type and value (a boolean, or a number between 0 and 1).\n */\nfunction isValidSampleRate(rate) {\n // we need to check NaN explicitly because it's of type 'number' and therefore wouldn't get caught by this typecheck\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n if (isNaN(rate) || !(typeof rate === 'number' || typeof rate === 'boolean')) {\n DEBUG_BUILD &&\n logger.warn(\n `[Tracing] Given sample rate is invalid. Sample rate must be a boolean or a number between 0 and 1. Got ${JSON.stringify(\n rate,\n )} of type ${JSON.stringify(typeof rate)}.`,\n );\n return false;\n }\n\n // in case sampleRate is a boolean, it will get automatically cast to 1 if it's true and 0 if it's false\n if (rate < 0 || rate > 1) {\n DEBUG_BUILD &&\n logger.warn(`[Tracing] Given sample rate is invalid. Sample rate must be between 0 and 1. Got ${rate}.`);\n return false;\n }\n return true;\n}\n\nexport { sampleTransaction };\n","import { logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { getMainCarrier } from '../hub.js';\nimport { spanToTraceHeader } from '../utils/spanUtils.js';\nimport { registerErrorInstrumentation } from './errors.js';\nimport { IdleTransaction } from './idletransaction.js';\nimport { sampleTransaction } from './sampling.js';\nimport { Transaction } from './transaction.js';\n\n/** Returns all trace headers that are currently on the top scope. */\nfunction traceHeaders() {\n // eslint-disable-next-line deprecation/deprecation\n const scope = this.getScope();\n // eslint-disable-next-line deprecation/deprecation\n const span = scope.getSpan();\n\n return span\n ? {\n 'sentry-trace': spanToTraceHeader(span),\n }\n : {};\n}\n\n/**\n * Creates a new transaction and adds a sampling decision if it doesn't yet have one.\n *\n * The Hub.startTransaction method delegates to this method to do its work, passing the Hub instance in as `this`, as if\n * it had been called on the hub directly. Exists as a separate function so that it can be injected into the class as an\n * \"extension method.\"\n *\n * @param this: The Hub starting the transaction\n * @param transactionContext: Data used to configure the transaction\n * @param CustomSamplingContext: Optional data to be provided to the `tracesSampler` function (if any)\n *\n * @returns The new transaction\n *\n * @see {@link Hub.startTransaction}\n */\nfunction _startTransaction(\n\n transactionContext,\n customSamplingContext,\n) {\n // eslint-disable-next-line deprecation/deprecation\n const client = this.getClient();\n const options = (client && client.getOptions()) || {};\n\n const configInstrumenter = options.instrumenter || 'sentry';\n const transactionInstrumenter = transactionContext.instrumenter || 'sentry';\n\n if (configInstrumenter !== transactionInstrumenter) {\n DEBUG_BUILD &&\n logger.error(\n `A transaction was started with instrumenter=\\`${transactionInstrumenter}\\`, but the SDK is configured with the \\`${configInstrumenter}\\` instrumenter.\nThe transaction will not be sampled. Please use the ${configInstrumenter} instrumentation to start transactions.`,\n );\n\n // eslint-disable-next-line deprecation/deprecation\n transactionContext.sampled = false;\n }\n\n // eslint-disable-next-line deprecation/deprecation\n let transaction = new Transaction(transactionContext, this);\n transaction = sampleTransaction(transaction, options, {\n parentSampled: transactionContext.parentSampled,\n transactionContext,\n ...customSamplingContext,\n });\n if (transaction.isRecording()) {\n transaction.initSpanRecorder(options._experiments && (options._experiments.maxSpans ));\n }\n if (client && client.emit) {\n client.emit('startTransaction', transaction);\n }\n return transaction;\n}\n\n/**\n * Create new idle transaction.\n */\nfunction startIdleTransaction(\n hub,\n transactionContext,\n idleTimeout,\n finalTimeout,\n onScope,\n customSamplingContext,\n heartbeatInterval,\n delayAutoFinishUntilSignal = false,\n) {\n // eslint-disable-next-line deprecation/deprecation\n const client = hub.getClient();\n const options = (client && client.getOptions()) || {};\n\n // eslint-disable-next-line deprecation/deprecation\n let transaction = new IdleTransaction(\n transactionContext,\n hub,\n idleTimeout,\n finalTimeout,\n heartbeatInterval,\n onScope,\n delayAutoFinishUntilSignal,\n );\n transaction = sampleTransaction(transaction, options, {\n parentSampled: transactionContext.parentSampled,\n transactionContext,\n ...customSamplingContext,\n });\n if (transaction.isRecording()) {\n transaction.initSpanRecorder(options._experiments && (options._experiments.maxSpans ));\n }\n if (client && client.emit) {\n client.emit('startTransaction', transaction);\n }\n return transaction;\n}\n\n/**\n * Adds tracing extensions to the global hub.\n */\nfunction addTracingExtensions() {\n const carrier = getMainCarrier();\n if (!carrier.__SENTRY__) {\n return;\n }\n carrier.__SENTRY__.extensions = carrier.__SENTRY__.extensions || {};\n if (!carrier.__SENTRY__.extensions.startTransaction) {\n carrier.__SENTRY__.extensions.startTransaction = _startTransaction;\n }\n if (!carrier.__SENTRY__.extensions.traceHeaders) {\n carrier.__SENTRY__.extensions.traceHeaders = traceHeaders;\n }\n\n registerErrorInstrumentation();\n}\n\nexport { addTracingExtensions, startIdleTransaction };\n","/**\n * This serves as a build time flag that will be true by default, but false in non-debug builds or if users replace `__SENTRY_DEBUG__` in their generated code.\n *\n * ATTENTION: This constant must never cross package boundaries (i.e. be exported) to guarantee that it can be used for tree shaking.\n */\nconst DEBUG_BUILD = (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__);\n\nexport { DEBUG_BUILD };\n","import { GLOBAL_OBJ } from '@sentry/utils';\n\nconst WINDOW = GLOBAL_OBJ ;\n\nexport { WINDOW };\n","const bindReporter = (\n callback,\n metric,\n reportAllChanges,\n) => {\n let prevValue;\n let delta;\n return (forceReport) => {\n if (metric.value >= 0) {\n if (forceReport || reportAllChanges) {\n delta = metric.value - (prevValue || 0);\n\n // Report the metric if there's a non-zero delta or if no previous\n // value exists (which can happen in the case of the document becoming\n // hidden when the metric value is 0).\n // See: https://github.com/GoogleChrome/web-vitals/issues/14\n if (delta || prevValue === undefined) {\n prevValue = metric.value;\n metric.delta = delta;\n callback(metric);\n }\n }\n }\n };\n};\n\nexport { bindReporter };\n","import { WINDOW } from '../../types.js';\n\n/*\n * Copyright 2022 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\nconst getNavigationEntryFromPerformanceTiming = () => {\n // eslint-disable-next-line deprecation/deprecation\n const timing = WINDOW.performance.timing;\n // eslint-disable-next-line deprecation/deprecation\n const type = WINDOW.performance.navigation.type;\n\n const navigationEntry = {\n entryType: 'navigation',\n startTime: 0,\n type: type == 2 ? 'back_forward' : type === 1 ? 'reload' : 'navigate',\n };\n\n for (const key in timing) {\n if (key !== 'navigationStart' && key !== 'toJSON') {\n // eslint-disable-next-line deprecation/deprecation\n navigationEntry[key] = Math.max((timing[key ] ) - timing.navigationStart, 0);\n }\n }\n return navigationEntry ;\n};\n\nconst getNavigationEntry = () => {\n if (WINDOW.__WEB_VITALS_POLYFILL__) {\n return (\n WINDOW.performance &&\n ((performance.getEntriesByType && performance.getEntriesByType('navigation')[0]) ||\n getNavigationEntryFromPerformanceTiming())\n );\n } else {\n return WINDOW.performance && performance.getEntriesByType && performance.getEntriesByType('navigation')[0];\n }\n};\n\nexport { getNavigationEntry };\n","import { getNavigationEntry } from './getNavigationEntry.js';\n\n/*\n * Copyright 2022 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\nconst getActivationStart = () => {\n const navEntry = getNavigationEntry();\n return (navEntry && navEntry.activationStart) || 0;\n};\n\nexport { getActivationStart };\n","import { WINDOW } from '../../types.js';\nimport { generateUniqueID } from './generateUniqueID.js';\nimport { getActivationStart } from './getActivationStart.js';\nimport { getNavigationEntry } from './getNavigationEntry.js';\n\n/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\nconst initMetric = (name, value) => {\n const navEntry = getNavigationEntry();\n let navigationType = 'navigate';\n\n if (navEntry) {\n if (WINDOW.document.prerendering || getActivationStart() > 0) {\n navigationType = 'prerender';\n } else {\n navigationType = navEntry.type.replace(/_/g, '-') ;\n }\n }\n\n return {\n name,\n value: typeof value === 'undefined' ? -1 : value,\n rating: 'good', // Will be updated if the value changes.\n delta: 0,\n entries: [],\n id: generateUniqueID(),\n navigationType,\n };\n};\n\nexport { initMetric };\n","/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\n/**\n * Performantly generate a unique, 30-char string by combining a version\n * number, the current timestamp with a 13-digit number integer.\n * @return {string}\n */\nconst generateUniqueID = () => {\n return `v3-${Date.now()}-${Math.floor(Math.random() * (9e12 - 1)) + 1e12}`;\n};\n\nexport { generateUniqueID };\n","/**\n * Takes a performance entry type and a callback function, and creates a\n * `PerformanceObserver` instance that will observe the specified entry type\n * with buffering enabled and call the callback _for each entry_.\n *\n * This function also feature-detects entry support and wraps the logic in a\n * try/catch to avoid errors in unsupporting browsers.\n */\nconst observe = (\n type,\n callback,\n opts,\n) => {\n try {\n if (PerformanceObserver.supportedEntryTypes.includes(type)) {\n const po = new PerformanceObserver(list => {\n callback(list.getEntries() );\n });\n po.observe(\n Object.assign(\n {\n type,\n buffered: true,\n },\n opts || {},\n ) ,\n );\n return po;\n }\n } catch (e) {\n // Do nothing.\n }\n return;\n};\n\nexport { observe };\n","import { WINDOW } from '../../types.js';\n\n/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\nconst onHidden = (cb, once) => {\n const onHiddenOrPageHide = (event) => {\n if (event.type === 'pagehide' || WINDOW.document.visibilityState === 'hidden') {\n cb(event);\n if (once) {\n removeEventListener('visibilitychange', onHiddenOrPageHide, true);\n removeEventListener('pagehide', onHiddenOrPageHide, true);\n }\n }\n };\n addEventListener('visibilitychange', onHiddenOrPageHide, true);\n // Some browsers have buggy implementations of visibilitychange,\n // so we use pagehide in addition, just to be safe.\n addEventListener('pagehide', onHiddenOrPageHide, true);\n};\n\nexport { onHidden };\n","import { bindReporter } from './lib/bindReporter.js';\nimport { initMetric } from './lib/initMetric.js';\nimport { observe } from './lib/observe.js';\nimport { onHidden } from './lib/onHidden.js';\n\n/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\n/**\n * Calculates the [CLS](https://web.dev/cls/) value for the current page and\n * calls the `callback` function once the value is ready to be reported, along\n * with all `layout-shift` performance entries that were used in the metric\n * value calculation. The reported value is a `double` (corresponding to a\n * [layout shift score](https://web.dev/cls/#layout-shift-score)).\n *\n * If the `reportAllChanges` configuration option is set to `true`, the\n * `callback` function will be called as soon as the value is initially\n * determined as well as any time the value changes throughout the page\n * lifespan.\n *\n * _**Important:** CLS should be continually monitored for changes throughout\n * the entire lifespan of a page—including if the user returns to the page after\n * it's been hidden/backgrounded. However, since browsers often [will not fire\n * additional callbacks once the user has backgrounded a\n * page](https://developer.chrome.com/blog/page-lifecycle-api/#advice-hidden),\n * `callback` is always called when the page's visibility state changes to\n * hidden. As a result, the `callback` function might be called multiple times\n * during the same page load._\n */\nconst onCLS = (onReport) => {\n const metric = initMetric('CLS', 0);\n let report;\n\n let sessionValue = 0;\n let sessionEntries = [];\n\n // const handleEntries = (entries: Metric['entries']) => {\n const handleEntries = (entries) => {\n entries.forEach(entry => {\n // Only count layout shifts without recent user input.\n if (!entry.hadRecentInput) {\n const firstSessionEntry = sessionEntries[0];\n const lastSessionEntry = sessionEntries[sessionEntries.length - 1];\n\n // If the entry occurred less than 1 second after the previous entry and\n // less than 5 seconds after the first entry in the session, include the\n // entry in the current session. Otherwise, start a new session.\n if (\n sessionValue &&\n sessionEntries.length !== 0 &&\n entry.startTime - lastSessionEntry.startTime < 1000 &&\n entry.startTime - firstSessionEntry.startTime < 5000\n ) {\n sessionValue += entry.value;\n sessionEntries.push(entry);\n } else {\n sessionValue = entry.value;\n sessionEntries = [entry];\n }\n\n // If the current session value is larger than the current CLS value,\n // update CLS and the entries contributing to it.\n if (sessionValue > metric.value) {\n metric.value = sessionValue;\n metric.entries = sessionEntries;\n if (report) {\n report();\n }\n }\n }\n });\n };\n\n const po = observe('layout-shift', handleEntries);\n if (po) {\n report = bindReporter(onReport, metric);\n\n const stopListening = () => {\n handleEntries(po.takeRecords() );\n report(true);\n };\n\n onHidden(stopListening);\n\n return stopListening;\n }\n\n return;\n};\n\nexport { onCLS };\n","import { WINDOW } from '../../types.js';\nimport { onHidden } from './onHidden.js';\n\n/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\nlet firstHiddenTime = -1;\n\nconst initHiddenTime = () => {\n // If the document is hidden and not prerendering, assume it was always\n // hidden and the page was loaded in the background.\n return WINDOW.document.visibilityState === 'hidden' && !WINDOW.document.prerendering ? 0 : Infinity;\n};\n\nconst trackChanges = () => {\n // Update the time if/when the document becomes hidden.\n onHidden(({ timeStamp }) => {\n firstHiddenTime = timeStamp;\n }, true);\n};\n\nconst getVisibilityWatcher = (\n\n) => {\n if (firstHiddenTime < 0) {\n // If the document is hidden when this code runs, assume it was hidden\n // since navigation start. This isn't a perfect heuristic, but it's the\n // best we can do until an API is available to support querying past\n // visibilityState.\n firstHiddenTime = initHiddenTime();\n trackChanges();\n }\n return {\n get firstHiddenTime() {\n return firstHiddenTime;\n },\n };\n};\n\nexport { getVisibilityWatcher };\n","import { bindReporter } from './lib/bindReporter.js';\nimport { getVisibilityWatcher } from './lib/getVisibilityWatcher.js';\nimport { initMetric } from './lib/initMetric.js';\nimport { observe } from './lib/observe.js';\nimport { onHidden } from './lib/onHidden.js';\n\n/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\n/**\n * Calculates the [FID](https://web.dev/fid/) value for the current page and\n * calls the `callback` function once the value is ready, along with the\n * relevant `first-input` performance entry used to determine the value. The\n * reported value is a `DOMHighResTimeStamp`.\n *\n * _**Important:** since FID is only reported after the user interacts with the\n * page, it's possible that it will not be reported for some page loads._\n */\nconst onFID = (onReport) => {\n const visibilityWatcher = getVisibilityWatcher();\n const metric = initMetric('FID');\n // eslint-disable-next-line prefer-const\n let report;\n\n const handleEntry = (entry) => {\n // Only report if the page wasn't hidden prior to the first input.\n if (entry.startTime < visibilityWatcher.firstHiddenTime) {\n metric.value = entry.processingStart - entry.startTime;\n metric.entries.push(entry);\n report(true);\n }\n };\n\n const handleEntries = (entries) => {\n (entries ).forEach(handleEntry);\n };\n\n const po = observe('first-input', handleEntries);\n report = bindReporter(onReport, metric);\n\n if (po) {\n onHidden(() => {\n handleEntries(po.takeRecords() );\n po.disconnect();\n }, true);\n }\n};\n\nexport { onFID };\n","import { bindReporter } from './lib/bindReporter.js';\nimport { getActivationStart } from './lib/getActivationStart.js';\nimport { getVisibilityWatcher } from './lib/getVisibilityWatcher.js';\nimport { initMetric } from './lib/initMetric.js';\nimport { observe } from './lib/observe.js';\nimport { onHidden } from './lib/onHidden.js';\n\n/*\n * Copyright 2020 Google LLC\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * https://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n */\n\nconst reportedMetricIDs = {};\n\n/**\n * Calculates the [LCP](https://web.dev/lcp/) value for the current page and\n * calls the `callback` function once the value is ready (along with the\n * relevant `largest-contentful-paint` performance entry used to determine the\n * value). The reported value is a `DOMHighResTimeStamp`.\n */\nconst onLCP = (onReport) => {\n const visibilityWatcher = getVisibilityWatcher();\n const metric = initMetric('LCP');\n let report;\n\n const handleEntries = (entries) => {\n const lastEntry = entries[entries.length - 1] ;\n if (lastEntry) {\n // The startTime attribute returns the value of the renderTime if it is\n // not 0, and the value of the loadTime otherwise. The activationStart\n // reference is used because LCP should be relative to page activation\n // rather than navigation start if the page was prerendered.\n const value = Math.max(lastEntry.startTime - getActivationStart(), 0);\n\n // Only report if the page wasn't hidden prior to LCP.\n if (value < visibilityWatcher.firstHiddenTime) {\n metric.value = value;\n metric.entries = [lastEntry];\n report();\n }\n }\n };\n\n const po = observe('largest-contentful-paint', handleEntries);\n\n if (po) {\n report = bindReporter(onReport, metric);\n\n const stopListening = () => {\n if (!reportedMetricIDs[metric.id]) {\n handleEntries(po.takeRecords() );\n po.disconnect();\n reportedMetricIDs[metric.id] = true;\n report(true);\n }\n };\n\n // Stop listening after input. Note: while scrolling is an input that\n // stop LCP observation, it's unreliable since it can be programmatically\n // generated. See: https://github.com/GoogleChrome/web-vitals/issues/75\n ['keydown', 'click'].forEach(type => {\n addEventListener(type, stopListening, { once: true, capture: true });\n });\n\n onHidden(stopListening, true);\n\n return stopListening;\n }\n\n return;\n};\n\nexport { onLCP };\n","import { logger, getFunctionName } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../common/debug-build.js';\nimport { onCLS } from './web-vitals/getCLS.js';\nimport { onFID } from './web-vitals/getFID.js';\nimport { onLCP } from './web-vitals/getLCP.js';\nimport { observe } from './web-vitals/lib/observe.js';\n\nconst handlers = {};\nconst instrumented = {};\n\nlet _previousCls;\nlet _previousFid;\nlet _previousLcp;\n\n/**\n * Add a callback that will be triggered when a CLS metric is available.\n * Returns a cleanup callback which can be called to remove the instrumentation handler.\n *\n * Pass `stopOnCallback = true` to stop listening for CLS when the cleanup callback is called.\n * This will lead to the CLS being finalized and frozen.\n */\nfunction addClsInstrumentationHandler(\n callback,\n stopOnCallback = false,\n) {\n return addMetricObserver('cls', callback, instrumentCls, _previousCls, stopOnCallback);\n}\n\n/**\n * Add a callback that will be triggered when a LCP metric is available.\n * Returns a cleanup callback which can be called to remove the instrumentation handler.\n *\n * Pass `stopOnCallback = true` to stop listening for LCP when the cleanup callback is called.\n * This will lead to the LCP being finalized and frozen.\n */\nfunction addLcpInstrumentationHandler(\n callback,\n stopOnCallback = false,\n) {\n return addMetricObserver('lcp', callback, instrumentLcp, _previousLcp, stopOnCallback);\n}\n\n/**\n * Add a callback that will be triggered when a FID metric is available.\n * Returns a cleanup callback which can be called to remove the instrumentation handler.\n */\nfunction addFidInstrumentationHandler(callback) {\n return addMetricObserver('fid', callback, instrumentFid, _previousFid);\n}\n\n/**\n * Add a callback that will be triggered when a performance observer is triggered,\n * and receives the entries of the observer.\n * Returns a cleanup callback which can be called to remove the instrumentation handler.\n */\nfunction addPerformanceInstrumentationHandler(\n type,\n callback,\n) {\n addHandler(type, callback);\n\n if (!instrumented[type]) {\n instrumentPerformanceObserver(type);\n instrumented[type] = true;\n }\n\n return getCleanupCallback(type, callback);\n}\n\n/** Trigger all handlers of a given type. */\nfunction triggerHandlers(type, data) {\n const typeHandlers = handlers[type];\n\n if (!typeHandlers || !typeHandlers.length) {\n return;\n }\n\n for (const handler of typeHandlers) {\n try {\n handler(data);\n } catch (e) {\n DEBUG_BUILD &&\n logger.error(\n `Error while triggering instrumentation handler.\\nType: ${type}\\nName: ${getFunctionName(handler)}\\nError:`,\n e,\n );\n }\n }\n}\n\nfunction instrumentCls() {\n return onCLS(metric => {\n triggerHandlers('cls', {\n metric,\n });\n _previousCls = metric;\n });\n}\n\nfunction instrumentFid() {\n return onFID(metric => {\n triggerHandlers('fid', {\n metric,\n });\n _previousFid = metric;\n });\n}\n\nfunction instrumentLcp() {\n return onLCP(metric => {\n triggerHandlers('lcp', {\n metric,\n });\n _previousLcp = metric;\n });\n}\n\nfunction addMetricObserver(\n type,\n callback,\n instrumentFn,\n previousValue,\n stopOnCallback = false,\n) {\n addHandler(type, callback);\n\n let stopListening;\n\n if (!instrumented[type]) {\n stopListening = instrumentFn();\n instrumented[type] = true;\n }\n\n if (previousValue) {\n callback({ metric: previousValue });\n }\n\n return getCleanupCallback(type, callback, stopOnCallback ? stopListening : undefined);\n}\n\nfunction instrumentPerformanceObserver(type) {\n const options = {};\n\n // Special per-type options we want to use\n if (type === 'event') {\n options.durationThreshold = 0;\n }\n\n observe(\n type,\n entries => {\n triggerHandlers(type, { entries });\n },\n options,\n );\n}\n\nfunction addHandler(type, handler) {\n handlers[type] = handlers[type] || [];\n (handlers[type] ).push(handler);\n}\n\n// Get a callback which can be called to remove the instrumentation handler\nfunction getCleanupCallback(\n type,\n callback,\n stopListening,\n) {\n return () => {\n if (stopListening) {\n stopListening();\n }\n\n const typeHandlers = handlers[type];\n\n if (!typeHandlers) {\n return;\n }\n\n const index = typeHandlers.indexOf(callback);\n if (index !== -1) {\n typeHandlers.splice(index, 1);\n }\n };\n}\n\nexport { addClsInstrumentationHandler, addFidInstrumentationHandler, addLcpInstrumentationHandler, addPerformanceInstrumentationHandler };\n","/**\n * Checks if a given value is a valid measurement value.\n */\nfunction isMeasurementValue(value) {\n return typeof value === 'number' && isFinite(value);\n}\n\n/**\n * Helper function to start child on transactions. This function will make sure that the transaction will\n * use the start timestamp of the created child span if it is earlier than the transactions actual\n * start timestamp.\n *\n * Note: this will not be possible anymore in v8,\n * unless we do some special handling for browser here...\n */\nfunction _startChild(transaction, { startTimestamp, ...ctx }) {\n // eslint-disable-next-line deprecation/deprecation\n if (startTimestamp && transaction.startTimestamp > startTimestamp) {\n // eslint-disable-next-line deprecation/deprecation\n transaction.startTimestamp = startTimestamp;\n }\n\n // eslint-disable-next-line deprecation/deprecation\n return transaction.startChild({\n startTimestamp,\n ...ctx,\n });\n}\n\nexport { _startChild, isMeasurementValue };\n","import { getActiveTransaction, spanToJSON, setMeasurement } from '@sentry/core';\nimport { browserPerformanceTimeOrigin, htmlTreeAsString, getComponentName, logger, parseUrl } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../../common/debug-build.js';\nimport { addPerformanceInstrumentationHandler, addClsInstrumentationHandler, addLcpInstrumentationHandler, addFidInstrumentationHandler } from '../instrument.js';\nimport { WINDOW } from '../types.js';\nimport { getVisibilityWatcher } from '../web-vitals/lib/getVisibilityWatcher.js';\nimport { _startChild, isMeasurementValue } from './utils.js';\n\nconst MAX_INT_AS_BYTES = 2147483647;\n\n/**\n * Converts from milliseconds to seconds\n * @param time time in ms\n */\nfunction msToSec(time) {\n return time / 1000;\n}\n\nfunction getBrowserPerformanceAPI() {\n // @ts-expect-error we want to make sure all of these are available, even if TS is sure they are\n return WINDOW && WINDOW.addEventListener && WINDOW.performance;\n}\n\nlet _performanceCursor = 0;\n\nlet _measurements = {};\nlet _lcpEntry;\nlet _clsEntry;\n\n/**\n * Start tracking web vitals.\n * The callback returned by this function can be used to stop tracking & ensure all measurements are final & captured.\n *\n * @returns A function that forces web vitals collection\n */\nfunction startTrackingWebVitals() {\n const performance = getBrowserPerformanceAPI();\n if (performance && browserPerformanceTimeOrigin) {\n // @ts-expect-error we want to make sure all of these are available, even if TS is sure they are\n if (performance.mark) {\n WINDOW.performance.mark('sentry-tracing-init');\n }\n const fidCallback = _trackFID();\n const clsCallback = _trackCLS();\n const lcpCallback = _trackLCP();\n\n return () => {\n fidCallback();\n clsCallback();\n lcpCallback();\n };\n }\n\n return () => undefined;\n}\n\n/**\n * Start tracking long tasks.\n */\nfunction startTrackingLongTasks() {\n addPerformanceInstrumentationHandler('longtask', ({ entries }) => {\n for (const entry of entries) {\n // eslint-disable-next-line deprecation/deprecation\n const transaction = getActiveTransaction() ;\n if (!transaction) {\n return;\n }\n const startTime = msToSec((browserPerformanceTimeOrigin ) + entry.startTime);\n const duration = msToSec(entry.duration);\n\n // eslint-disable-next-line deprecation/deprecation\n transaction.startChild({\n description: 'Main UI thread blocked',\n op: 'ui.long-task',\n origin: 'auto.ui.browser.metrics',\n startTimestamp: startTime,\n endTimestamp: startTime + duration,\n });\n }\n });\n}\n\n/**\n * Start tracking interaction events.\n */\nfunction startTrackingInteractions() {\n addPerformanceInstrumentationHandler('event', ({ entries }) => {\n for (const entry of entries) {\n // eslint-disable-next-line deprecation/deprecation\n const transaction = getActiveTransaction() ;\n if (!transaction) {\n return;\n }\n\n if (entry.name === 'click') {\n const startTime = msToSec((browserPerformanceTimeOrigin ) + entry.startTime);\n const duration = msToSec(entry.duration);\n\n const span = {\n description: htmlTreeAsString(entry.target),\n op: `ui.interaction.${entry.name}`,\n origin: 'auto.ui.browser.metrics',\n startTimestamp: startTime,\n endTimestamp: startTime + duration,\n };\n\n const componentName = getComponentName(entry.target);\n if (componentName) {\n span.attributes = { 'ui.component_name': componentName };\n }\n\n // eslint-disable-next-line deprecation/deprecation\n transaction.startChild(span);\n }\n }\n });\n}\n\n/** Starts tracking the Cumulative Layout Shift on the current page. */\nfunction _trackCLS() {\n return addClsInstrumentationHandler(({ metric }) => {\n const entry = metric.entries[metric.entries.length - 1];\n if (!entry) {\n return;\n }\n\n DEBUG_BUILD && logger.log('[Measurements] Adding CLS');\n _measurements['cls'] = { value: metric.value, unit: '' };\n _clsEntry = entry ;\n }, true);\n}\n\n/** Starts tracking the Largest Contentful Paint on the current page. */\nfunction _trackLCP() {\n return addLcpInstrumentationHandler(({ metric }) => {\n const entry = metric.entries[metric.entries.length - 1];\n if (!entry) {\n return;\n }\n\n DEBUG_BUILD && logger.log('[Measurements] Adding LCP');\n _measurements['lcp'] = { value: metric.value, unit: 'millisecond' };\n _lcpEntry = entry ;\n }, true);\n}\n\n/** Starts tracking the First Input Delay on the current page. */\nfunction _trackFID() {\n return addFidInstrumentationHandler(({ metric }) => {\n const entry = metric.entries[metric.entries.length - 1];\n if (!entry) {\n return;\n }\n\n const timeOrigin = msToSec(browserPerformanceTimeOrigin );\n const startTime = msToSec(entry.startTime);\n DEBUG_BUILD && logger.log('[Measurements] Adding FID');\n _measurements['fid'] = { value: metric.value, unit: 'millisecond' };\n _measurements['mark.fid'] = { value: timeOrigin + startTime, unit: 'second' };\n });\n}\n\n/** Add performance related spans to a transaction */\nfunction addPerformanceEntries(transaction) {\n const performance = getBrowserPerformanceAPI();\n if (!performance || !WINDOW.performance.getEntries || !browserPerformanceTimeOrigin) {\n // Gatekeeper if performance API not available\n return;\n }\n\n DEBUG_BUILD && logger.log('[Tracing] Adding & adjusting spans using Performance API');\n const timeOrigin = msToSec(browserPerformanceTimeOrigin);\n\n const performanceEntries = performance.getEntries();\n\n let responseStartTimestamp;\n let requestStartTimestamp;\n\n const { op, start_timestamp: transactionStartTime } = spanToJSON(transaction);\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n performanceEntries.slice(_performanceCursor).forEach((entry) => {\n const startTime = msToSec(entry.startTime);\n const duration = msToSec(entry.duration);\n\n // eslint-disable-next-line deprecation/deprecation\n if (transaction.op === 'navigation' && transactionStartTime && timeOrigin + startTime < transactionStartTime) {\n return;\n }\n\n switch (entry.entryType) {\n case 'navigation': {\n _addNavigationSpans(transaction, entry, timeOrigin);\n responseStartTimestamp = timeOrigin + msToSec(entry.responseStart);\n requestStartTimestamp = timeOrigin + msToSec(entry.requestStart);\n break;\n }\n case 'mark':\n case 'paint':\n case 'measure': {\n _addMeasureSpans(transaction, entry, startTime, duration, timeOrigin);\n\n // capture web vitals\n const firstHidden = getVisibilityWatcher();\n // Only report if the page wasn't hidden prior to the web vital.\n const shouldRecord = entry.startTime < firstHidden.firstHiddenTime;\n\n if (entry.name === 'first-paint' && shouldRecord) {\n DEBUG_BUILD && logger.log('[Measurements] Adding FP');\n _measurements['fp'] = { value: entry.startTime, unit: 'millisecond' };\n }\n if (entry.name === 'first-contentful-paint' && shouldRecord) {\n DEBUG_BUILD && logger.log('[Measurements] Adding FCP');\n _measurements['fcp'] = { value: entry.startTime, unit: 'millisecond' };\n }\n break;\n }\n case 'resource': {\n _addResourceSpans(transaction, entry, entry.name , startTime, duration, timeOrigin);\n break;\n }\n // Ignore other entry types.\n }\n });\n\n _performanceCursor = Math.max(performanceEntries.length - 1, 0);\n\n _trackNavigator(transaction);\n\n // Measurements are only available for pageload transactions\n if (op === 'pageload') {\n _addTtfbToMeasurements(_measurements, responseStartTimestamp, requestStartTimestamp, transactionStartTime);\n\n ['fcp', 'fp', 'lcp'].forEach(name => {\n if (!_measurements[name] || !transactionStartTime || timeOrigin >= transactionStartTime) {\n return;\n }\n // The web vitals, fcp, fp, lcp, and ttfb, all measure relative to timeOrigin.\n // Unfortunately, timeOrigin is not captured within the transaction span data, so these web vitals will need\n // to be adjusted to be relative to transaction.startTimestamp.\n const oldValue = _measurements[name].value;\n const measurementTimestamp = timeOrigin + msToSec(oldValue);\n\n // normalizedValue should be in milliseconds\n const normalizedValue = Math.abs((measurementTimestamp - transactionStartTime) * 1000);\n const delta = normalizedValue - oldValue;\n\n DEBUG_BUILD && logger.log(`[Measurements] Normalized ${name} from ${oldValue} to ${normalizedValue} (${delta})`);\n _measurements[name].value = normalizedValue;\n });\n\n const fidMark = _measurements['mark.fid'];\n if (fidMark && _measurements['fid']) {\n // create span for FID\n _startChild(transaction, {\n description: 'first input delay',\n endTimestamp: fidMark.value + msToSec(_measurements['fid'].value),\n op: 'ui.action',\n origin: 'auto.ui.browser.metrics',\n startTimestamp: fidMark.value,\n });\n\n // Delete mark.fid as we don't want it to be part of final payload\n delete _measurements['mark.fid'];\n }\n\n // If FCP is not recorded we should not record the cls value\n // according to the new definition of CLS.\n if (!('fcp' in _measurements)) {\n delete _measurements.cls;\n }\n\n Object.keys(_measurements).forEach(measurementName => {\n setMeasurement(measurementName, _measurements[measurementName].value, _measurements[measurementName].unit);\n });\n\n _tagMetricInfo(transaction);\n }\n\n _lcpEntry = undefined;\n _clsEntry = undefined;\n _measurements = {};\n}\n\n/** Create measure related spans */\nfunction _addMeasureSpans(\n transaction,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n entry,\n startTime,\n duration,\n timeOrigin,\n) {\n const measureStartTimestamp = timeOrigin + startTime;\n const measureEndTimestamp = measureStartTimestamp + duration;\n\n _startChild(transaction, {\n description: entry.name ,\n endTimestamp: measureEndTimestamp,\n op: entry.entryType ,\n origin: 'auto.resource.browser.metrics',\n startTimestamp: measureStartTimestamp,\n });\n\n return measureStartTimestamp;\n}\n\n/** Instrument navigation entries */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _addNavigationSpans(transaction, entry, timeOrigin) {\n ['unloadEvent', 'redirect', 'domContentLoadedEvent', 'loadEvent', 'connect'].forEach(event => {\n _addPerformanceNavigationTiming(transaction, entry, event, timeOrigin);\n });\n _addPerformanceNavigationTiming(transaction, entry, 'secureConnection', timeOrigin, 'TLS/SSL', 'connectEnd');\n _addPerformanceNavigationTiming(transaction, entry, 'fetch', timeOrigin, 'cache', 'domainLookupStart');\n _addPerformanceNavigationTiming(transaction, entry, 'domainLookup', timeOrigin, 'DNS');\n _addRequest(transaction, entry, timeOrigin);\n}\n\n/** Create performance navigation related spans */\nfunction _addPerformanceNavigationTiming(\n transaction,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n entry,\n event,\n timeOrigin,\n description,\n eventEnd,\n) {\n const end = eventEnd ? (entry[eventEnd] ) : (entry[`${event}End`] );\n const start = entry[`${event}Start`] ;\n if (!start || !end) {\n return;\n }\n _startChild(transaction, {\n op: 'browser',\n origin: 'auto.browser.browser.metrics',\n description: description || event,\n startTimestamp: timeOrigin + msToSec(start),\n endTimestamp: timeOrigin + msToSec(end),\n });\n}\n\n/** Create request and response related spans */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _addRequest(transaction, entry, timeOrigin) {\n if (entry.responseEnd) {\n // It is possible that we are collecting these metrics when the page hasn't finished loading yet, for example when the HTML slowly streams in.\n // In this case, ie. when the document request hasn't finished yet, `entry.responseEnd` will be 0.\n // In order not to produce faulty spans, where the end timestamp is before the start timestamp, we will only collect\n // these spans when the responseEnd value is available. The backend (Relay) would drop the entire transaction if it contained faulty spans.\n _startChild(transaction, {\n op: 'browser',\n origin: 'auto.browser.browser.metrics',\n description: 'request',\n startTimestamp: timeOrigin + msToSec(entry.requestStart ),\n endTimestamp: timeOrigin + msToSec(entry.responseEnd ),\n });\n\n _startChild(transaction, {\n op: 'browser',\n origin: 'auto.browser.browser.metrics',\n description: 'response',\n startTimestamp: timeOrigin + msToSec(entry.responseStart ),\n endTimestamp: timeOrigin + msToSec(entry.responseEnd ),\n });\n }\n}\n\n/** Create resource-related spans */\nfunction _addResourceSpans(\n transaction,\n entry,\n resourceUrl,\n startTime,\n duration,\n timeOrigin,\n) {\n // we already instrument based on fetch and xhr, so we don't need to\n // duplicate spans here.\n if (entry.initiatorType === 'xmlhttprequest' || entry.initiatorType === 'fetch') {\n return;\n }\n\n const parsedUrl = parseUrl(resourceUrl);\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const data = {};\n setResourceEntrySizeData(data, entry, 'transferSize', 'http.response_transfer_size');\n setResourceEntrySizeData(data, entry, 'encodedBodySize', 'http.response_content_length');\n setResourceEntrySizeData(data, entry, 'decodedBodySize', 'http.decoded_response_content_length');\n\n if ('renderBlockingStatus' in entry) {\n data['resource.render_blocking_status'] = entry.renderBlockingStatus;\n }\n if (parsedUrl.protocol) {\n data['url.scheme'] = parsedUrl.protocol.split(':').pop(); // the protocol returned by parseUrl includes a :, but OTEL spec does not, so we remove it.\n }\n\n if (parsedUrl.host) {\n data['server.address'] = parsedUrl.host;\n }\n\n data['url.same_origin'] = resourceUrl.includes(WINDOW.location.origin);\n\n const startTimestamp = timeOrigin + startTime;\n const endTimestamp = startTimestamp + duration;\n\n _startChild(transaction, {\n description: resourceUrl.replace(WINDOW.location.origin, ''),\n endTimestamp,\n op: entry.initiatorType ? `resource.${entry.initiatorType}` : 'resource.other',\n origin: 'auto.resource.browser.metrics',\n startTimestamp,\n data,\n });\n}\n\n/**\n * Capture the information of the user agent.\n */\nfunction _trackNavigator(transaction) {\n const navigator = WINDOW.navigator ;\n if (!navigator) {\n return;\n }\n\n // track network connectivity\n const connection = navigator.connection;\n if (connection) {\n if (connection.effectiveType) {\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('effectiveConnectionType', connection.effectiveType);\n }\n\n if (connection.type) {\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('connectionType', connection.type);\n }\n\n if (isMeasurementValue(connection.rtt)) {\n _measurements['connection.rtt'] = { value: connection.rtt, unit: 'millisecond' };\n }\n }\n\n if (isMeasurementValue(navigator.deviceMemory)) {\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('deviceMemory', `${navigator.deviceMemory} GB`);\n }\n\n if (isMeasurementValue(navigator.hardwareConcurrency)) {\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('hardwareConcurrency', String(navigator.hardwareConcurrency));\n }\n}\n\n/** Add LCP / CLS data to transaction to allow debugging */\nfunction _tagMetricInfo(transaction) {\n if (_lcpEntry) {\n DEBUG_BUILD && logger.log('[Measurements] Adding LCP Data');\n\n // Capture Properties of the LCP element that contributes to the LCP.\n\n if (_lcpEntry.element) {\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('lcp.element', htmlTreeAsString(_lcpEntry.element));\n }\n\n if (_lcpEntry.id) {\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('lcp.id', _lcpEntry.id);\n }\n\n if (_lcpEntry.url) {\n // Trim URL to the first 200 characters.\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('lcp.url', _lcpEntry.url.trim().slice(0, 200));\n }\n\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag('lcp.size', _lcpEntry.size);\n }\n\n // See: https://developer.mozilla.org/en-US/docs/Web/API/LayoutShift\n if (_clsEntry && _clsEntry.sources) {\n DEBUG_BUILD && logger.log('[Measurements] Adding CLS Data');\n _clsEntry.sources.forEach((source, index) =>\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n transaction.setTag(`cls.source.${index + 1}`, htmlTreeAsString(source.node)),\n );\n }\n}\n\nfunction setResourceEntrySizeData(\n data,\n entry,\n key,\n dataKey,\n) {\n const entryVal = entry[key];\n if (entryVal != null && entryVal < MAX_INT_AS_BYTES) {\n data[dataKey] = entryVal;\n }\n}\n\n/**\n * Add ttfb information to measurements\n *\n * Exported for tests\n */\nfunction _addTtfbToMeasurements(\n _measurements,\n responseStartTimestamp,\n requestStartTimestamp,\n transactionStartTime,\n) {\n // Generate TTFB (Time to First Byte), which measured as the time between the beginning of the transaction and the\n // start of the response in milliseconds\n if (typeof responseStartTimestamp === 'number' && transactionStartTime) {\n DEBUG_BUILD && logger.log('[Measurements] Adding TTFB');\n _measurements['ttfb'] = {\n // As per https://developer.mozilla.org/en-US/docs/Web/API/PerformanceResourceTiming/responseStart,\n // responseStart can be 0 if the request is coming straight from the cache.\n // This might lead us to calculate a negative ttfb if we don't use Math.max here.\n //\n // This logic is the same as what is in the web-vitals library to calculate ttfb\n // https://github.com/GoogleChrome/web-vitals/blob/2301de5015e82b09925238a228a0893635854587/src/onTTFB.ts#L92\n // TODO(abhi): We should use the web-vitals library instead of this custom calculation.\n value: Math.max(responseStartTimestamp - transactionStartTime, 0) * 1000,\n unit: 'millisecond',\n };\n\n if (typeof requestStartTimestamp === 'number' && requestStartTimestamp <= responseStartTimestamp) {\n // Capture the time spent making the request and receiving the first byte of the response.\n // This is the time between the start of the request and the start of the response in milliseconds.\n _measurements['ttfb.requestTime'] = {\n value: (responseStartTimestamp - requestStartTimestamp) * 1000,\n unit: 'millisecond',\n };\n }\n }\n}\n\nexport { _addMeasureSpans, _addResourceSpans, _addTtfbToMeasurements, addPerformanceEntries, startTrackingInteractions, startTrackingLongTasks, startTrackingWebVitals };\n","import { tracingContextFromHeaders, logger, dropUndefinedKeys } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../debug-build.js';\nimport { getCurrentScope, withScope } from '../exports.js';\nimport { getCurrentHub } from '../hub.js';\nimport { handleCallbackErrors } from '../utils/handleCallbackErrors.js';\nimport { hasTracingEnabled } from '../utils/hasTracingEnabled.js';\nimport { spanToJSON, spanTimeInputToSeconds } from '../utils/spanUtils.js';\n\n/**\n * Wraps a function with a transaction/span and finishes the span after the function is done.\n *\n * Note that if you have not enabled tracing extensions via `addTracingExtensions`\n * or you didn't set `tracesSampleRate`, this function will not generate spans\n * and the `span` returned from the callback will be undefined.\n *\n * This function is meant to be used internally and may break at any time. Use at your own risk.\n *\n * @internal\n * @private\n *\n * @deprecated Use `startSpan` instead.\n */\nfunction trace(\n context,\n callback,\n // eslint-disable-next-line @typescript-eslint/no-empty-function\n onError = () => {},\n // eslint-disable-next-line @typescript-eslint/no-empty-function\n afterFinish = () => {},\n) {\n // eslint-disable-next-line deprecation/deprecation\n const hub = getCurrentHub();\n const scope = getCurrentScope();\n // eslint-disable-next-line deprecation/deprecation\n const parentSpan = scope.getSpan();\n\n const ctx = normalizeContext(context);\n const activeSpan = createChildSpanOrTransaction(hub, parentSpan, ctx);\n\n // eslint-disable-next-line deprecation/deprecation\n scope.setSpan(activeSpan);\n\n return handleCallbackErrors(\n () => callback(activeSpan),\n error => {\n activeSpan && activeSpan.setStatus('internal_error');\n onError(error, activeSpan);\n },\n () => {\n activeSpan && activeSpan.end();\n // eslint-disable-next-line deprecation/deprecation\n scope.setSpan(parentSpan);\n afterFinish();\n },\n );\n}\n\n/**\n * Wraps a function with a transaction/span and finishes the span after the function is done.\n * The created span is the active span and will be used as parent by other spans created inside the function\n * and can be accessed via `Sentry.getSpan()`, as long as the function is executed while the scope is active.\n *\n * If you want to create a span that is not set as active, use {@link startInactiveSpan}.\n *\n * Note that if you have not enabled tracing extensions via `addTracingExtensions`\n * or you didn't set `tracesSampleRate`, this function will not generate spans\n * and the `span` returned from the callback will be undefined.\n */\nfunction startSpan(context, callback) {\n const ctx = normalizeContext(context);\n\n return withScope(context.scope, scope => {\n // eslint-disable-next-line deprecation/deprecation\n const hub = getCurrentHub();\n // eslint-disable-next-line deprecation/deprecation\n const parentSpan = scope.getSpan();\n\n const activeSpan = createChildSpanOrTransaction(hub, parentSpan, ctx);\n // eslint-disable-next-line deprecation/deprecation\n scope.setSpan(activeSpan);\n\n return handleCallbackErrors(\n () => callback(activeSpan),\n () => {\n // Only update the span status if it hasn't been changed yet\n if (activeSpan) {\n const { status } = spanToJSON(activeSpan);\n if (!status || status === 'ok') {\n activeSpan.setStatus('internal_error');\n }\n }\n },\n () => activeSpan && activeSpan.end(),\n );\n });\n}\n\n/**\n * @deprecated Use {@link startSpan} instead.\n */\nconst startActiveSpan = startSpan;\n\n/**\n * Similar to `Sentry.startSpan`. Wraps a function with a transaction/span, but does not finish the span\n * after the function is done automatically. You'll have to call `span.end()` manually.\n *\n * The created span is the active span and will be used as parent by other spans created inside the function\n * and can be accessed via `Sentry.getActiveSpan()`, as long as the function is executed while the scope is active.\n *\n * Note that if you have not enabled tracing extensions via `addTracingExtensions`\n * or you didn't set `tracesSampleRate`, this function will not generate spans\n * and the `span` returned from the callback will be undefined.\n */\nfunction startSpanManual(\n context,\n callback,\n) {\n const ctx = normalizeContext(context);\n\n return withScope(context.scope, scope => {\n // eslint-disable-next-line deprecation/deprecation\n const hub = getCurrentHub();\n // eslint-disable-next-line deprecation/deprecation\n const parentSpan = scope.getSpan();\n\n const activeSpan = createChildSpanOrTransaction(hub, parentSpan, ctx);\n // eslint-disable-next-line deprecation/deprecation\n scope.setSpan(activeSpan);\n\n function finishAndSetSpan() {\n activeSpan && activeSpan.end();\n }\n\n return handleCallbackErrors(\n () => callback(activeSpan, finishAndSetSpan),\n () => {\n // Only update the span status if it hasn't been changed yet, and the span is not yet finished\n if (activeSpan && activeSpan.isRecording()) {\n const { status } = spanToJSON(activeSpan);\n if (!status || status === 'ok') {\n activeSpan.setStatus('internal_error');\n }\n }\n },\n );\n });\n}\n\n/**\n * Creates a span. This span is not set as active, so will not get automatic instrumentation spans\n * as children or be able to be accessed via `Sentry.getSpan()`.\n *\n * If you want to create a span that is set as active, use {@link startSpan}.\n *\n * Note that if you have not enabled tracing extensions via `addTracingExtensions`\n * or you didn't set `tracesSampleRate` or `tracesSampler`, this function will not generate spans\n * and the `span` returned from the callback will be undefined.\n */\nfunction startInactiveSpan(context) {\n if (!hasTracingEnabled()) {\n return undefined;\n }\n\n const ctx = normalizeContext(context);\n // eslint-disable-next-line deprecation/deprecation\n const hub = getCurrentHub();\n const parentSpan = context.scope\n ? // eslint-disable-next-line deprecation/deprecation\n context.scope.getSpan()\n : getActiveSpan();\n return parentSpan\n ? // eslint-disable-next-line deprecation/deprecation\n parentSpan.startChild(ctx)\n : // eslint-disable-next-line deprecation/deprecation\n hub.startTransaction(ctx);\n}\n\n/**\n * Returns the currently active span.\n */\nfunction getActiveSpan() {\n // eslint-disable-next-line deprecation/deprecation\n return getCurrentScope().getSpan();\n}\n\n/**\n * Continue a trace from `sentry-trace` and `baggage` values.\n * These values can be obtained from incoming request headers,\n * or in the browser from `` and `` HTML tags.\n *\n * The callback receives a transactionContext that may be used for `startTransaction` or `startSpan`.\n */\nfunction continueTrace(\n {\n sentryTrace,\n baggage,\n }\n\n,\n callback,\n) {\n const currentScope = getCurrentScope();\n\n const { traceparentData, dynamicSamplingContext, propagationContext } = tracingContextFromHeaders(\n sentryTrace,\n baggage,\n );\n\n currentScope.setPropagationContext(propagationContext);\n\n if (DEBUG_BUILD && traceparentData) {\n logger.log(`[Tracing] Continuing trace ${traceparentData.traceId}.`);\n }\n\n const transactionContext = {\n ...traceparentData,\n metadata: dropUndefinedKeys({\n dynamicSamplingContext: traceparentData && !dynamicSamplingContext ? {} : dynamicSamplingContext,\n }),\n };\n\n if (!callback) {\n return transactionContext;\n }\n\n return callback(transactionContext);\n}\n\nfunction createChildSpanOrTransaction(\n hub,\n parentSpan,\n ctx,\n) {\n if (!hasTracingEnabled()) {\n return undefined;\n }\n return parentSpan\n ? // eslint-disable-next-line deprecation/deprecation\n parentSpan.startChild(ctx)\n : // eslint-disable-next-line deprecation/deprecation\n hub.startTransaction(ctx);\n}\n\n/**\n * This converts StartSpanOptions to TransactionContext.\n * For the most part (for now) we accept the same options,\n * but some of them need to be transformed.\n *\n * Eventually the StartSpanOptions will be more aligned with OpenTelemetry.\n */\nfunction normalizeContext(context) {\n if (context.startTime) {\n const ctx = { ...context };\n ctx.startTimestamp = spanTimeInputToSeconds(context.startTime);\n delete ctx.startTime;\n return ctx;\n }\n\n return context;\n}\n\nexport { continueTrace, getActiveSpan, startActiveSpan, startInactiveSpan, startSpan, startSpanManual, trace };\n","import { spanToJSON, hasTracingEnabled, getCurrentScope, startInactiveSpan, getRootSpan, getDynamicSamplingContextFromSpan, spanToTraceHeader, getClient, getDynamicSamplingContextFromClient } from '@sentry/core';\nimport { addFetchInstrumentationHandler, addXhrInstrumentationHandler, SENTRY_XHR_DATA_KEY, dynamicSamplingContextToSentryBaggageHeader, generateSentryTraceHeader, BAGGAGE_HEADER_NAME, browserPerformanceTimeOrigin, stringMatchesSomePattern } from '@sentry/utils';\nimport { instrumentFetchRequest } from '../common/fetch.js';\nimport { addPerformanceInstrumentationHandler } from './instrument.js';\n\n/* eslint-disable max-lines */\n\nconst DEFAULT_TRACE_PROPAGATION_TARGETS = ['localhost', /^\\/(?!\\/)/];\n\n/** Options for Request Instrumentation */\n\nconst defaultRequestInstrumentationOptions = {\n traceFetch: true,\n traceXHR: true,\n enableHTTPTimings: true,\n // TODO (v8): Remove this property\n tracingOrigins: DEFAULT_TRACE_PROPAGATION_TARGETS,\n tracePropagationTargets: DEFAULT_TRACE_PROPAGATION_TARGETS,\n};\n\n/** Registers span creators for xhr and fetch requests */\nfunction instrumentOutgoingRequests(_options) {\n const {\n traceFetch,\n traceXHR,\n // eslint-disable-next-line deprecation/deprecation\n tracePropagationTargets,\n // eslint-disable-next-line deprecation/deprecation\n tracingOrigins,\n shouldCreateSpanForRequest,\n enableHTTPTimings,\n } = {\n traceFetch: defaultRequestInstrumentationOptions.traceFetch,\n traceXHR: defaultRequestInstrumentationOptions.traceXHR,\n ..._options,\n };\n\n const shouldCreateSpan =\n typeof shouldCreateSpanForRequest === 'function' ? shouldCreateSpanForRequest : (_) => true;\n\n // TODO(v8) Remove tracingOrigins here\n // The only reason we're passing it in here is because this instrumentOutgoingRequests function is publicly exported\n // and we don't want to break the API. We can remove it in v8.\n const shouldAttachHeadersWithTargets = (url) =>\n shouldAttachHeaders(url, tracePropagationTargets || tracingOrigins);\n\n const spans = {};\n\n if (traceFetch) {\n addFetchInstrumentationHandler(handlerData => {\n const createdSpan = instrumentFetchRequest(handlerData, shouldCreateSpan, shouldAttachHeadersWithTargets, spans);\n if (enableHTTPTimings && createdSpan) {\n addHTTPTimings(createdSpan);\n }\n });\n }\n\n if (traceXHR) {\n addXhrInstrumentationHandler(handlerData => {\n const createdSpan = xhrCallback(handlerData, shouldCreateSpan, shouldAttachHeadersWithTargets, spans);\n if (enableHTTPTimings && createdSpan) {\n addHTTPTimings(createdSpan);\n }\n });\n }\n}\n\nfunction isPerformanceResourceTiming(entry) {\n return (\n entry.entryType === 'resource' &&\n 'initiatorType' in entry &&\n typeof (entry ).nextHopProtocol === 'string' &&\n (entry.initiatorType === 'fetch' || entry.initiatorType === 'xmlhttprequest')\n );\n}\n\n/**\n * Creates a temporary observer to listen to the next fetch/xhr resourcing timings,\n * so that when timings hit their per-browser limit they don't need to be removed.\n *\n * @param span A span that has yet to be finished, must contain `url` on data.\n */\nfunction addHTTPTimings(span) {\n const { url } = spanToJSON(span).data || {};\n\n if (!url || typeof url !== 'string') {\n return;\n }\n\n const cleanup = addPerformanceInstrumentationHandler('resource', ({ entries }) => {\n entries.forEach(entry => {\n if (isPerformanceResourceTiming(entry) && entry.name.endsWith(url)) {\n const spanData = resourceTimingEntryToSpanData(entry);\n spanData.forEach(data => span.setAttribute(...data));\n // In the next tick, clean this handler up\n // We have to wait here because otherwise this cleans itself up before it is fully done\n setTimeout(cleanup);\n }\n });\n });\n}\n\n/**\n * Converts ALPN protocol ids to name and version.\n *\n * (https://www.iana.org/assignments/tls-extensiontype-values/tls-extensiontype-values.xhtml#alpn-protocol-ids)\n * @param nextHopProtocol PerformanceResourceTiming.nextHopProtocol\n */\nfunction extractNetworkProtocol(nextHopProtocol) {\n let name = 'unknown';\n let version = 'unknown';\n let _name = '';\n for (const char of nextHopProtocol) {\n // http/1.1 etc.\n if (char === '/') {\n [name, version] = nextHopProtocol.split('/');\n break;\n }\n // h2, h3 etc.\n if (!isNaN(Number(char))) {\n name = _name === 'h' ? 'http' : _name;\n version = nextHopProtocol.split(_name)[1];\n break;\n }\n _name += char;\n }\n if (_name === nextHopProtocol) {\n // webrtc, ftp, etc.\n name = _name;\n }\n return { name, version };\n}\n\nfunction getAbsoluteTime(time = 0) {\n return ((browserPerformanceTimeOrigin || performance.timeOrigin) + time) / 1000;\n}\n\nfunction resourceTimingEntryToSpanData(resourceTiming) {\n const { name, version } = extractNetworkProtocol(resourceTiming.nextHopProtocol);\n\n const timingSpanData = [];\n\n timingSpanData.push(['network.protocol.version', version], ['network.protocol.name', name]);\n\n if (!browserPerformanceTimeOrigin) {\n return timingSpanData;\n }\n return [\n ...timingSpanData,\n ['http.request.redirect_start', getAbsoluteTime(resourceTiming.redirectStart)],\n ['http.request.fetch_start', getAbsoluteTime(resourceTiming.fetchStart)],\n ['http.request.domain_lookup_start', getAbsoluteTime(resourceTiming.domainLookupStart)],\n ['http.request.domain_lookup_end', getAbsoluteTime(resourceTiming.domainLookupEnd)],\n ['http.request.connect_start', getAbsoluteTime(resourceTiming.connectStart)],\n ['http.request.secure_connection_start', getAbsoluteTime(resourceTiming.secureConnectionStart)],\n ['http.request.connection_end', getAbsoluteTime(resourceTiming.connectEnd)],\n ['http.request.request_start', getAbsoluteTime(resourceTiming.requestStart)],\n ['http.request.response_start', getAbsoluteTime(resourceTiming.responseStart)],\n ['http.request.response_end', getAbsoluteTime(resourceTiming.responseEnd)],\n ];\n}\n\n/**\n * A function that determines whether to attach tracing headers to a request.\n * This was extracted from `instrumentOutgoingRequests` to make it easier to test shouldAttachHeaders.\n * We only export this fuction for testing purposes.\n */\nfunction shouldAttachHeaders(url, tracePropagationTargets) {\n return stringMatchesSomePattern(url, tracePropagationTargets || DEFAULT_TRACE_PROPAGATION_TARGETS);\n}\n\n/**\n * Create and track xhr request spans\n *\n * @returns Span if a span was created, otherwise void.\n */\n// eslint-disable-next-line complexity\nfunction xhrCallback(\n handlerData,\n shouldCreateSpan,\n shouldAttachHeaders,\n spans,\n) {\n const xhr = handlerData.xhr;\n const sentryXhrData = xhr && xhr[SENTRY_XHR_DATA_KEY];\n\n if (!hasTracingEnabled() || !xhr || xhr.__sentry_own_request__ || !sentryXhrData) {\n return undefined;\n }\n\n const shouldCreateSpanResult = shouldCreateSpan(sentryXhrData.url);\n\n // check first if the request has finished and is tracked by an existing span which should now end\n if (handlerData.endTimestamp && shouldCreateSpanResult) {\n const spanId = xhr.__sentry_xhr_span_id__;\n if (!spanId) return;\n\n const span = spans[spanId];\n if (span && sentryXhrData.status_code !== undefined) {\n span.setHttpStatus(sentryXhrData.status_code);\n span.end();\n\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete spans[spanId];\n }\n return undefined;\n }\n\n const scope = getCurrentScope();\n\n const span = shouldCreateSpanResult\n ? startInactiveSpan({\n attributes: {\n type: 'xhr',\n 'http.method': sentryXhrData.method,\n url: sentryXhrData.url,\n },\n name: `${sentryXhrData.method} ${sentryXhrData.url}`,\n op: 'http.client',\n origin: 'auto.http.browser',\n })\n : undefined;\n\n if (span) {\n xhr.__sentry_xhr_span_id__ = span.spanContext().spanId;\n spans[xhr.__sentry_xhr_span_id__] = span;\n }\n\n if (xhr.setRequestHeader && shouldAttachHeaders(sentryXhrData.url)) {\n if (span) {\n const transaction = span && getRootSpan(span);\n const dynamicSamplingContext = transaction && getDynamicSamplingContextFromSpan(transaction);\n const sentryBaggageHeader = dynamicSamplingContextToSentryBaggageHeader(dynamicSamplingContext);\n setHeaderOnXhr(xhr, spanToTraceHeader(span), sentryBaggageHeader);\n } else {\n const client = getClient();\n const { traceId, sampled, dsc } = scope.getPropagationContext();\n const sentryTraceHeader = generateSentryTraceHeader(traceId, undefined, sampled);\n const dynamicSamplingContext =\n dsc || (client ? getDynamicSamplingContextFromClient(traceId, client, scope) : undefined);\n const sentryBaggageHeader = dynamicSamplingContextToSentryBaggageHeader(dynamicSamplingContext);\n setHeaderOnXhr(xhr, sentryTraceHeader, sentryBaggageHeader);\n }\n }\n\n return span;\n}\n\nfunction setHeaderOnXhr(\n xhr,\n sentryTraceHeader,\n sentryBaggageHeader,\n) {\n try {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n xhr.setRequestHeader('sentry-trace', sentryTraceHeader);\n if (sentryBaggageHeader) {\n // From MDN: \"If this method is called several times with the same header, the values are merged into one single request header.\"\n // We can therefore simply set a baggage header without checking what was there before\n // https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest/setRequestHeader\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n xhr.setRequestHeader(BAGGAGE_HEADER_NAME, sentryBaggageHeader);\n }\n } catch (_) {\n // Error: InvalidStateError: Failed to execute 'setRequestHeader' on 'XMLHttpRequest': The object's state must be OPENED.\n }\n}\n\nexport { DEFAULT_TRACE_PROPAGATION_TARGETS, defaultRequestInstrumentationOptions, extractNetworkProtocol, instrumentOutgoingRequests, shouldAttachHeaders, xhrCallback };\n","import { hasTracingEnabled, getCurrentScope, getClient, startInactiveSpan, getRootSpan, spanToTraceHeader, getDynamicSamplingContextFromSpan, getDynamicSamplingContextFromClient } from '@sentry/core';\nimport { generateSentryTraceHeader, dynamicSamplingContextToSentryBaggageHeader, isInstanceOf, BAGGAGE_HEADER_NAME } from '@sentry/utils';\n\n/**\n * Create and track fetch request spans for usage in combination with `addInstrumentationHandler`.\n *\n * @returns Span if a span was created, otherwise void.\n */\nfunction instrumentFetchRequest(\n handlerData,\n shouldCreateSpan,\n shouldAttachHeaders,\n spans,\n spanOrigin = 'auto.http.browser',\n) {\n if (!hasTracingEnabled() || !handlerData.fetchData) {\n return undefined;\n }\n\n const shouldCreateSpanResult = shouldCreateSpan(handlerData.fetchData.url);\n\n if (handlerData.endTimestamp && shouldCreateSpanResult) {\n const spanId = handlerData.fetchData.__span;\n if (!spanId) return;\n\n const span = spans[spanId];\n if (span) {\n if (handlerData.response) {\n span.setHttpStatus(handlerData.response.status);\n\n const contentLength =\n handlerData.response && handlerData.response.headers && handlerData.response.headers.get('content-length');\n\n if (contentLength) {\n const contentLengthNum = parseInt(contentLength);\n if (contentLengthNum > 0) {\n span.setAttribute('http.response_content_length', contentLengthNum);\n }\n }\n } else if (handlerData.error) {\n span.setStatus('internal_error');\n }\n span.end();\n\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete spans[spanId];\n }\n return undefined;\n }\n\n const scope = getCurrentScope();\n const client = getClient();\n\n const { method, url } = handlerData.fetchData;\n\n const span = shouldCreateSpanResult\n ? startInactiveSpan({\n attributes: {\n url,\n type: 'fetch',\n 'http.method': method,\n },\n name: `${method} ${url}`,\n op: 'http.client',\n origin: spanOrigin,\n })\n : undefined;\n\n if (span) {\n handlerData.fetchData.__span = span.spanContext().spanId;\n spans[span.spanContext().spanId] = span;\n }\n\n if (shouldAttachHeaders(handlerData.fetchData.url) && client) {\n const request = handlerData.args[0];\n\n // In case the user hasn't set the second argument of a fetch call we default it to `{}`.\n handlerData.args[1] = handlerData.args[1] || {};\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const options = handlerData.args[1];\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/no-unsafe-member-access\n options.headers = addTracingHeadersToFetchRequest(request, client, scope, options, span);\n }\n\n return span;\n}\n\n/**\n * Adds sentry-trace and baggage headers to the various forms of fetch headers\n */\nfunction addTracingHeadersToFetchRequest(\n request, // unknown is actually type Request but we can't export DOM types from this package,\n client,\n scope,\n options\n\n,\n requestSpan,\n) {\n // eslint-disable-next-line deprecation/deprecation\n const span = requestSpan || scope.getSpan();\n\n const transaction = span && getRootSpan(span);\n\n const { traceId, sampled, dsc } = scope.getPropagationContext();\n\n const sentryTraceHeader = span ? spanToTraceHeader(span) : generateSentryTraceHeader(traceId, undefined, sampled);\n const dynamicSamplingContext = transaction\n ? getDynamicSamplingContextFromSpan(transaction)\n : dsc\n ? dsc\n : getDynamicSamplingContextFromClient(traceId, client, scope);\n\n const sentryBaggageHeader = dynamicSamplingContextToSentryBaggageHeader(dynamicSamplingContext);\n\n const headers =\n options.headers ||\n (typeof Request !== 'undefined' && isInstanceOf(request, Request) ? (request ).headers : undefined);\n\n if (!headers) {\n return { 'sentry-trace': sentryTraceHeader, baggage: sentryBaggageHeader };\n } else if (typeof Headers !== 'undefined' && isInstanceOf(headers, Headers)) {\n const newHeaders = new Headers(headers );\n\n newHeaders.append('sentry-trace', sentryTraceHeader);\n\n if (sentryBaggageHeader) {\n // If the same header is appended multiple times the browser will merge the values into a single request header.\n // Its therefore safe to simply push a \"baggage\" entry, even though there might already be another baggage header.\n newHeaders.append(BAGGAGE_HEADER_NAME, sentryBaggageHeader);\n }\n\n return newHeaders ;\n } else if (Array.isArray(headers)) {\n const newHeaders = [...headers, ['sentry-trace', sentryTraceHeader]];\n\n if (sentryBaggageHeader) {\n // If there are multiple entries with the same key, the browser will merge the values into a single request header.\n // Its therefore safe to simply push a \"baggage\" entry, even though there might already be another baggage header.\n newHeaders.push([BAGGAGE_HEADER_NAME, sentryBaggageHeader]);\n }\n\n return newHeaders ;\n } else {\n const existingBaggageHeader = 'baggage' in headers ? headers.baggage : undefined;\n const newBaggageHeaders = [];\n\n if (Array.isArray(existingBaggageHeader)) {\n newBaggageHeaders.push(...existingBaggageHeader);\n } else if (existingBaggageHeader) {\n newBaggageHeaders.push(existingBaggageHeader);\n }\n\n if (sentryBaggageHeader) {\n newBaggageHeaders.push(sentryBaggageHeader);\n }\n\n return {\n ...(headers ),\n 'sentry-trace': sentryTraceHeader,\n baggage: newBaggageHeaders.length > 0 ? newBaggageHeaders.join(',') : undefined,\n };\n }\n}\n\nexport { addTracingHeadersToFetchRequest, instrumentFetchRequest };\n","import { TRACING_DEFAULTS, addTracingExtensions, SEMANTIC_ATTRIBUTE_SENTRY_SOURCE, startIdleTransaction, spanToJSON, spanIsSampled, getActiveTransaction } from '@sentry/core';\nimport { logger, tracingContextFromHeaders, getDomElement } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../common/debug-build.js';\nimport { registerBackgroundTabDetection } from './backgroundtab.js';\nimport { startTrackingWebVitals, startTrackingLongTasks, startTrackingInteractions, addPerformanceEntries } from './metrics/index.js';\nimport { defaultRequestInstrumentationOptions, instrumentOutgoingRequests } from './request.js';\nimport { instrumentRoutingWithDefaults } from './router.js';\nimport { WINDOW } from './types.js';\n\nconst BROWSER_TRACING_INTEGRATION_ID = 'BrowserTracing';\n\n/** Options for Browser Tracing integration */\n\nconst DEFAULT_BROWSER_TRACING_OPTIONS = {\n ...TRACING_DEFAULTS,\n markBackgroundTransactions: true,\n routingInstrumentation: instrumentRoutingWithDefaults,\n startTransactionOnLocationChange: true,\n startTransactionOnPageLoad: true,\n enableLongTask: true,\n _experiments: {},\n ...defaultRequestInstrumentationOptions,\n};\n\n/**\n * The Browser Tracing integration automatically instruments browser pageload/navigation\n * actions as transactions, and captures requests, metrics and errors as spans.\n *\n * The integration can be configured with a variety of options, and can be extended to use\n * any routing library. This integration uses {@see IdleTransaction} to create transactions.\n */\nclass BrowserTracing {\n // This class currently doesn't have a static `id` field like the other integration classes, because it prevented\n // @sentry/tracing from being treeshaken. Tree shakers do not like static fields, because they behave like side effects.\n // TODO: Come up with a better plan, than using static fields on integration classes, and use that plan on all\n // integrations.\n\n /** Browser Tracing integration options */\n\n /**\n * @inheritDoc\n */\n\n constructor(_options) {\n this.name = BROWSER_TRACING_INTEGRATION_ID;\n this._hasSetTracePropagationTargets = false;\n\n addTracingExtensions();\n\n if (DEBUG_BUILD) {\n this._hasSetTracePropagationTargets = !!(\n _options &&\n // eslint-disable-next-line deprecation/deprecation\n (_options.tracePropagationTargets || _options.tracingOrigins)\n );\n }\n\n this.options = {\n ...DEFAULT_BROWSER_TRACING_OPTIONS,\n ..._options,\n };\n\n // Special case: enableLongTask can be set in _experiments\n // TODO (v8): Remove this in v8\n if (this.options._experiments.enableLongTask !== undefined) {\n this.options.enableLongTask = this.options._experiments.enableLongTask;\n }\n\n // TODO (v8): remove this block after tracingOrigins is removed\n // Set tracePropagationTargets to tracingOrigins if specified by the user\n // In case both are specified, tracePropagationTargets takes precedence\n // eslint-disable-next-line deprecation/deprecation\n if (_options && !_options.tracePropagationTargets && _options.tracingOrigins) {\n // eslint-disable-next-line deprecation/deprecation\n this.options.tracePropagationTargets = _options.tracingOrigins;\n }\n\n this._collectWebVitals = startTrackingWebVitals();\n if (this.options.enableLongTask) {\n startTrackingLongTasks();\n }\n if (this.options._experiments.enableInteractions) {\n startTrackingInteractions();\n }\n }\n\n /**\n * @inheritDoc\n */\n setupOnce(_, getCurrentHub) {\n this._getCurrentHub = getCurrentHub;\n const hub = getCurrentHub();\n // eslint-disable-next-line deprecation/deprecation\n const client = hub.getClient();\n const clientOptions = client && client.getOptions();\n\n const {\n routingInstrumentation: instrumentRouting,\n startTransactionOnLocationChange,\n startTransactionOnPageLoad,\n markBackgroundTransactions,\n traceFetch,\n traceXHR,\n shouldCreateSpanForRequest,\n enableHTTPTimings,\n _experiments,\n } = this.options;\n\n const clientOptionsTracePropagationTargets = clientOptions && clientOptions.tracePropagationTargets;\n // There are three ways to configure tracePropagationTargets:\n // 1. via top level client option `tracePropagationTargets`\n // 2. via BrowserTracing option `tracePropagationTargets`\n // 3. via BrowserTracing option `tracingOrigins` (deprecated)\n //\n // To avoid confusion, favour top level client option `tracePropagationTargets`, and fallback to\n // BrowserTracing option `tracePropagationTargets` and then `tracingOrigins` (deprecated).\n // This is done as it minimizes bundle size (we don't have to have undefined checks).\n //\n // If both 1 and either one of 2 or 3 are set (from above), we log out a warning.\n // eslint-disable-next-line deprecation/deprecation\n const tracePropagationTargets = clientOptionsTracePropagationTargets || this.options.tracePropagationTargets;\n if (DEBUG_BUILD && this._hasSetTracePropagationTargets && clientOptionsTracePropagationTargets) {\n logger.warn(\n '[Tracing] The `tracePropagationTargets` option was set in the BrowserTracing integration and top level `Sentry.init`. The top level `Sentry.init` value is being used.',\n );\n }\n\n instrumentRouting(\n (context) => {\n const transaction = this._createRouteTransaction(context);\n\n this.options._experiments.onStartRouteTransaction &&\n this.options._experiments.onStartRouteTransaction(transaction, context, getCurrentHub);\n\n return transaction;\n },\n startTransactionOnPageLoad,\n startTransactionOnLocationChange,\n );\n\n if (markBackgroundTransactions) {\n registerBackgroundTabDetection();\n }\n\n if (_experiments.enableInteractions) {\n this._registerInteractionListener();\n }\n\n instrumentOutgoingRequests({\n traceFetch,\n traceXHR,\n tracePropagationTargets,\n shouldCreateSpanForRequest,\n enableHTTPTimings,\n });\n }\n\n /** Create routing idle transaction. */\n _createRouteTransaction(context) {\n if (!this._getCurrentHub) {\n DEBUG_BUILD &&\n logger.warn(`[Tracing] Did not create ${context.op} transaction because _getCurrentHub is invalid.`);\n return undefined;\n }\n\n const hub = this._getCurrentHub();\n\n const { beforeNavigate, idleTimeout, finalTimeout, heartbeatInterval } = this.options;\n\n const isPageloadTransaction = context.op === 'pageload';\n\n const sentryTrace = isPageloadTransaction ? getMetaContent('sentry-trace') : '';\n const baggage = isPageloadTransaction ? getMetaContent('baggage') : '';\n const { traceparentData, dynamicSamplingContext, propagationContext } = tracingContextFromHeaders(\n sentryTrace,\n baggage,\n );\n\n const expandedContext = {\n ...context,\n ...traceparentData,\n metadata: {\n // eslint-disable-next-line deprecation/deprecation\n ...context.metadata,\n dynamicSamplingContext: traceparentData && !dynamicSamplingContext ? {} : dynamicSamplingContext,\n },\n trimEnd: true,\n };\n\n const modifiedContext = typeof beforeNavigate === 'function' ? beforeNavigate(expandedContext) : expandedContext;\n\n // For backwards compatibility reasons, beforeNavigate can return undefined to \"drop\" the transaction (prevent it\n // from being sent to Sentry).\n const finalContext = modifiedContext === undefined ? { ...expandedContext, sampled: false } : modifiedContext;\n\n // If `beforeNavigate` set a custom name, record that fact\n // eslint-disable-next-line deprecation/deprecation\n finalContext.metadata =\n finalContext.name !== expandedContext.name\n ? // eslint-disable-next-line deprecation/deprecation\n { ...finalContext.metadata, source: 'custom' }\n : // eslint-disable-next-line deprecation/deprecation\n finalContext.metadata;\n\n this._latestRouteName = finalContext.name;\n\n // eslint-disable-next-line deprecation/deprecation\n const sourceFromData = context.data && context.data[SEMANTIC_ATTRIBUTE_SENTRY_SOURCE];\n // eslint-disable-next-line deprecation/deprecation\n const sourceFromMetadata = finalContext.metadata && finalContext.metadata.source;\n\n this._latestRouteSource = sourceFromData || sourceFromMetadata;\n\n // eslint-disable-next-line deprecation/deprecation\n if (finalContext.sampled === false) {\n DEBUG_BUILD && logger.log(`[Tracing] Will not send ${finalContext.op} transaction because of beforeNavigate.`);\n }\n\n DEBUG_BUILD && logger.log(`[Tracing] Starting ${finalContext.op} transaction on scope`);\n\n const { location } = WINDOW;\n\n const idleTransaction = startIdleTransaction(\n hub,\n finalContext,\n idleTimeout,\n finalTimeout,\n true,\n { location }, // for use in the tracesSampler\n heartbeatInterval,\n isPageloadTransaction, // should wait for finish signal if it's a pageload transaction\n );\n\n if (isPageloadTransaction) {\n WINDOW.document.addEventListener('readystatechange', () => {\n if (['interactive', 'complete'].includes(WINDOW.document.readyState)) {\n idleTransaction.sendAutoFinishSignal();\n }\n });\n\n if (['interactive', 'complete'].includes(WINDOW.document.readyState)) {\n idleTransaction.sendAutoFinishSignal();\n }\n }\n\n // eslint-disable-next-line deprecation/deprecation\n const scope = hub.getScope();\n\n // If it's a pageload and there is a meta tag set\n // use the traceparentData as the propagation context\n if (isPageloadTransaction && traceparentData) {\n scope.setPropagationContext(propagationContext);\n } else {\n // Navigation transactions should set a new propagation context based on the\n // created idle transaction.\n scope.setPropagationContext({\n traceId: idleTransaction.spanContext().traceId,\n spanId: idleTransaction.spanContext().spanId,\n parentSpanId: spanToJSON(idleTransaction).parent_span_id,\n sampled: spanIsSampled(idleTransaction),\n });\n }\n\n idleTransaction.registerBeforeFinishCallback(transaction => {\n this._collectWebVitals();\n addPerformanceEntries(transaction);\n });\n\n return idleTransaction ;\n }\n\n /** Start listener for interaction transactions */\n _registerInteractionListener() {\n let inflightInteractionTransaction;\n const registerInteractionTransaction = () => {\n const { idleTimeout, finalTimeout, heartbeatInterval } = this.options;\n const op = 'ui.action.click';\n\n // eslint-disable-next-line deprecation/deprecation\n const currentTransaction = getActiveTransaction();\n if (currentTransaction && currentTransaction.op && ['navigation', 'pageload'].includes(currentTransaction.op)) {\n DEBUG_BUILD &&\n logger.warn(\n `[Tracing] Did not create ${op} transaction because a pageload or navigation transaction is in progress.`,\n );\n return undefined;\n }\n\n if (inflightInteractionTransaction) {\n inflightInteractionTransaction.setFinishReason('interactionInterrupted');\n inflightInteractionTransaction.end();\n inflightInteractionTransaction = undefined;\n }\n\n if (!this._getCurrentHub) {\n DEBUG_BUILD && logger.warn(`[Tracing] Did not create ${op} transaction because _getCurrentHub is invalid.`);\n return undefined;\n }\n\n if (!this._latestRouteName) {\n DEBUG_BUILD && logger.warn(`[Tracing] Did not create ${op} transaction because _latestRouteName is missing.`);\n return undefined;\n }\n\n const hub = this._getCurrentHub();\n const { location } = WINDOW;\n\n const context = {\n name: this._latestRouteName,\n op,\n trimEnd: true,\n data: {\n [SEMANTIC_ATTRIBUTE_SENTRY_SOURCE]: this._latestRouteSource || 'url',\n },\n };\n\n inflightInteractionTransaction = startIdleTransaction(\n hub,\n context,\n idleTimeout,\n finalTimeout,\n true,\n { location }, // for use in the tracesSampler\n heartbeatInterval,\n );\n };\n\n ['click'].forEach(type => {\n addEventListener(type, registerInteractionTransaction, { once: false, capture: true });\n });\n }\n}\n\n/** Returns the value of a meta tag */\nfunction getMetaContent(metaName) {\n // Can't specify generic to `getDomElement` because tracing can be used\n // in a variety of environments, have to disable `no-unsafe-member-access`\n // as a result.\n const metaTag = getDomElement(`meta[name=${metaName}]`);\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return metaTag ? metaTag.getAttribute('content') : undefined;\n}\n\nexport { BROWSER_TRACING_INTEGRATION_ID, BrowserTracing, getMetaContent };\n","import { logger, browserPerformanceTimeOrigin, addHistoryInstrumentationHandler } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../common/debug-build.js';\nimport { WINDOW } from './types.js';\n\n/**\n * Default function implementing pageload and navigation transactions\n */\nfunction instrumentRoutingWithDefaults(\n customStartTransaction,\n startTransactionOnPageLoad = true,\n startTransactionOnLocationChange = true,\n) {\n if (!WINDOW || !WINDOW.location) {\n DEBUG_BUILD && logger.warn('Could not initialize routing instrumentation due to invalid location');\n return;\n }\n\n let startingUrl = WINDOW.location.href;\n\n let activeTransaction;\n if (startTransactionOnPageLoad) {\n activeTransaction = customStartTransaction({\n name: WINDOW.location.pathname,\n // pageload should always start at timeOrigin (and needs to be in s, not ms)\n startTimestamp: browserPerformanceTimeOrigin ? browserPerformanceTimeOrigin / 1000 : undefined,\n op: 'pageload',\n origin: 'auto.pageload.browser',\n metadata: { source: 'url' },\n });\n }\n\n if (startTransactionOnLocationChange) {\n addHistoryInstrumentationHandler(({ to, from }) => {\n /**\n * This early return is there to account for some cases where a navigation transaction starts right after\n * long-running pageload. We make sure that if `from` is undefined and a valid `startingURL` exists, we don't\n * create an uneccessary navigation transaction.\n *\n * This was hard to duplicate, but this behavior stopped as soon as this fix was applied. This issue might also\n * only be caused in certain development environments where the usage of a hot module reloader is causing\n * errors.\n */\n if (from === undefined && startingUrl && startingUrl.indexOf(to) !== -1) {\n startingUrl = undefined;\n return;\n }\n\n if (from !== to) {\n startingUrl = undefined;\n if (activeTransaction) {\n DEBUG_BUILD && logger.log(`[Tracing] Finishing current transaction with op: ${activeTransaction.op}`);\n // If there's an open transaction on the scope, we need to finish it before creating an new one.\n activeTransaction.end();\n }\n activeTransaction = customStartTransaction({\n name: WINDOW.location.pathname,\n op: 'navigation',\n origin: 'auto.navigation.browser',\n metadata: { source: 'url' },\n });\n }\n });\n }\n}\n\nexport { instrumentRoutingWithDefaults };\n","/**\n * Polyfill for the optional chain operator, `?.`, given previous conversion of the expression into an array of values,\n * descriptors, and functions.\n *\n * Adapted from Sucrase (https://github.com/alangpierce/sucrase)\n * See https://github.com/alangpierce/sucrase/blob/265887868966917f3b924ce38dfad01fbab1329f/src/transformers/OptionalChainingNullishTransformer.ts#L15\n *\n * @param ops Array result of expression conversion\n * @returns The value of the expression\n */\nfunction _optionalChain(ops) {\n let lastAccessLHS = undefined;\n let value = ops[0];\n let i = 1;\n while (i < ops.length) {\n const op = ops[i] ;\n const fn = ops[i + 1] ;\n i += 2;\n // by checking for loose equality to `null`, we catch both `null` and `undefined`\n if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) {\n // really we're meaning to return `undefined` as an actual value here, but it saves bytes not to write it\n return;\n }\n if (op === 'access' || op === 'optionalAccess') {\n lastAccessLHS = value;\n value = fn(value);\n } else if (op === 'call' || op === 'optionalCall') {\n value = fn((...args) => (value ).call(lastAccessLHS, ...args));\n lastAccessLHS = undefined;\n }\n }\n return value;\n}\n\n// Sucrase version\n// function _optionalChain(ops) {\n// let lastAccessLHS = undefined;\n// let value = ops[0];\n// let i = 1;\n// while (i < ops.length) {\n// const op = ops[i];\n// const fn = ops[i + 1];\n// i += 2;\n// if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) {\n// return undefined;\n// }\n// if (op === 'access' || op === 'optionalAccess') {\n// lastAccessLHS = value;\n// value = fn(value);\n// } else if (op === 'call' || op === 'optionalCall') {\n// value = fn((...args) => value.call(lastAccessLHS, ...args));\n// lastAccessLHS = undefined;\n// }\n// }\n// return value;\n// }\n\nexport { _optionalChain };\n","/**\n * Checks whether given url points to Sentry server\n * @param url url to verify\n *\n * TODO(v8): Remove Hub fallback type\n */\nfunction isSentryRequestUrl(url, hubOrClient) {\n const client =\n hubOrClient && isHub(hubOrClient)\n ? // eslint-disable-next-line deprecation/deprecation\n hubOrClient.getClient()\n : hubOrClient;\n const dsn = client && client.getDsn();\n const tunnel = client && client.getOptions().tunnel;\n\n return checkDsn(url, dsn) || checkTunnel(url, tunnel);\n}\n\nfunction checkTunnel(url, tunnel) {\n if (!tunnel) {\n return false;\n }\n\n return removeTrailingSlash(url) === removeTrailingSlash(tunnel);\n}\n\nfunction checkDsn(url, dsn) {\n return dsn ? url.includes(dsn.host) : false;\n}\n\nfunction removeTrailingSlash(str) {\n return str[str.length - 1] === '/' ? str.slice(0, -1) : str;\n}\n\nfunction isHub(hubOrClient) {\n // eslint-disable-next-line deprecation/deprecation\n return (hubOrClient ).getClient !== undefined;\n}\n\nexport { isSentryRequestUrl };\n","import { isNodeEnv } from './node.js';\nimport { GLOBAL_OBJ } from './worldwide.js';\n\n/**\n * Returns true if we are in the browser.\n */\nfunction isBrowser() {\n // eslint-disable-next-line no-restricted-globals\n return typeof window !== 'undefined' && (!isNodeEnv() || isElectronNodeRenderer());\n}\n\n// Electron renderers with nodeIntegration enabled are detected as Node.js so we specifically test for them\nfunction isElectronNodeRenderer() {\n return (\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, @typescript-eslint/no-explicit-any\n (GLOBAL_OBJ ).process !== undefined && ((GLOBAL_OBJ ).process ).type === 'renderer'\n );\n}\n\nexport { isBrowser };\n","import { _nullishCoalesce, _optionalChain } from '@sentry/utils';\nimport { addBreadcrumb, getClient, isSentryRequestUrl, getCurrentScope, addEventProcessor, prepareEvent, getIsolationScope, setContext, captureException, spanToJSON, SEMANTIC_ATTRIBUTE_SENTRY_SOURCE } from '@sentry/core';\nimport { GLOBAL_OBJ, normalize, fill, htmlTreeAsString, browserPerformanceTimeOrigin, logger, uuid4, SENTRY_XHR_DATA_KEY, dropUndefinedKeys, stringMatchesSomePattern, addFetchInstrumentationHandler, addXhrInstrumentationHandler, addClickKeypressInstrumentationHandler, addHistoryInstrumentationHandler, createEnvelope, createEventEnvelopeHeaders, getSdkMetadataForEnvelopeHeader, updateRateLimits, isRateLimited, consoleSandbox, isBrowser } from '@sentry/utils';\nimport { addPerformanceInstrumentationHandler, addLcpInstrumentationHandler } from '@sentry-internal/tracing';\n\n// exporting a separate copy of `WINDOW` rather than exporting the one from `@sentry/browser`\n// prevents the browser package from being bundled in the CDN bundle, and avoids a\n// circular dependency between the browser and replay packages should `@sentry/browser` import\n// from `@sentry/replay` in the future\nconst WINDOW = GLOBAL_OBJ ;\n\nconst REPLAY_SESSION_KEY = 'sentryReplaySession';\nconst REPLAY_EVENT_NAME = 'replay_event';\nconst UNABLE_TO_SEND_REPLAY = 'Unable to send Replay';\n\n// The idle limit for a session after which recording is paused.\nconst SESSION_IDLE_PAUSE_DURATION = 300000; // 5 minutes in ms\n\n// The idle limit for a session after which the session expires.\nconst SESSION_IDLE_EXPIRE_DURATION = 900000; // 15 minutes in ms\n\n/** Default flush delays */\nconst DEFAULT_FLUSH_MIN_DELAY = 5000;\n// XXX: Temp fix for our debounce logic where `maxWait` would never occur if it\n// was the same as `wait`\nconst DEFAULT_FLUSH_MAX_DELAY = 5500;\n\n/* How long to wait for error checkouts */\nconst BUFFER_CHECKOUT_TIME = 60000;\n\nconst RETRY_BASE_INTERVAL = 5000;\nconst RETRY_MAX_COUNT = 3;\n\n/* The max (uncompressed) size in bytes of a network body. Any body larger than this will be truncated. */\nconst NETWORK_BODY_MAX_SIZE = 150000;\n\n/* The max size of a single console arg that is captured. Any arg larger than this will be truncated. */\nconst CONSOLE_ARG_MAX_SIZE = 5000;\n\n/* Min. time to wait before we consider something a slow click. */\nconst SLOW_CLICK_THRESHOLD = 3000;\n/* For scroll actions after a click, we only look for a very short time period to detect programmatic scrolling. */\nconst SLOW_CLICK_SCROLL_TIMEOUT = 300;\n\n/** When encountering a total segment size exceeding this size, stop the replay (as we cannot properly ingest it). */\nconst REPLAY_MAX_EVENT_BUFFER_SIZE = 20000000; // ~20MB\n\n/** Replays must be min. 5s long before we send them. */\nconst MIN_REPLAY_DURATION = 4999;\n/* The max. allowed value that the minReplayDuration can be set to. */\nconst MIN_REPLAY_DURATION_LIMIT = 15000;\n\n/** The max. length of a replay. */\nconst MAX_REPLAY_DURATION = 3600000; // 60 minutes in ms;\n\nfunction _nullishCoalesce$1(lhs, rhsFn) { if (lhs != null) { return lhs; } else { return rhsFn(); } }function _optionalChain$5(ops) { let lastAccessLHS = undefined; let value = ops[0]; let i = 1; while (i < ops.length) { const op = ops[i]; const fn = ops[i + 1]; i += 2; if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) { return undefined; } if (op === 'access' || op === 'optionalAccess') { lastAccessLHS = value; value = fn(value); } else if (op === 'call' || op === 'optionalCall') { value = fn((...args) => value.call(lastAccessLHS, ...args)); lastAccessLHS = undefined; } } return value; }var NodeType$1;\n(function (NodeType) {\n NodeType[NodeType[\"Document\"] = 0] = \"Document\";\n NodeType[NodeType[\"DocumentType\"] = 1] = \"DocumentType\";\n NodeType[NodeType[\"Element\"] = 2] = \"Element\";\n NodeType[NodeType[\"Text\"] = 3] = \"Text\";\n NodeType[NodeType[\"CDATA\"] = 4] = \"CDATA\";\n NodeType[NodeType[\"Comment\"] = 5] = \"Comment\";\n})(NodeType$1 || (NodeType$1 = {}));\n\nfunction isElement$1(n) {\n return n.nodeType === n.ELEMENT_NODE;\n}\nfunction isShadowRoot(n) {\n const host = _optionalChain$5([n, 'optionalAccess', _ => _.host]);\n return Boolean(_optionalChain$5([host, 'optionalAccess', _2 => _2.shadowRoot]) === n);\n}\nfunction isNativeShadowDom(shadowRoot) {\n return Object.prototype.toString.call(shadowRoot) === '[object ShadowRoot]';\n}\nfunction fixBrowserCompatibilityIssuesInCSS(cssText) {\n if (cssText.includes(' background-clip: text;') &&\n !cssText.includes(' -webkit-background-clip: text;')) {\n cssText = cssText.replace(' background-clip: text;', ' -webkit-background-clip: text; background-clip: text;');\n }\n return cssText;\n}\nfunction escapeImportStatement(rule) {\n const { cssText } = rule;\n if (cssText.split('\"').length < 3)\n return cssText;\n const statement = ['@import', `url(${JSON.stringify(rule.href)})`];\n if (rule.layerName === '') {\n statement.push(`layer`);\n }\n else if (rule.layerName) {\n statement.push(`layer(${rule.layerName})`);\n }\n if (rule.supportsText) {\n statement.push(`supports(${rule.supportsText})`);\n }\n if (rule.media.length) {\n statement.push(rule.media.mediaText);\n }\n return statement.join(' ') + ';';\n}\nfunction stringifyStylesheet(s) {\n try {\n const rules = s.rules || s.cssRules;\n return rules\n ? fixBrowserCompatibilityIssuesInCSS(Array.from(rules, stringifyRule).join(''))\n : null;\n }\n catch (error) {\n return null;\n }\n}\nfunction stringifyRule(rule) {\n let importStringified;\n if (isCSSImportRule(rule)) {\n try {\n importStringified =\n stringifyStylesheet(rule.styleSheet) ||\n escapeImportStatement(rule);\n }\n catch (error) {\n }\n }\n else if (isCSSStyleRule(rule) && rule.selectorText.includes(':')) {\n return fixSafariColons(rule.cssText);\n }\n return importStringified || rule.cssText;\n}\nfunction fixSafariColons(cssStringified) {\n const regex = /(\\[(?:[\\w-]+)[^\\\\])(:(?:[\\w-]+)\\])/gm;\n return cssStringified.replace(regex, '$1\\\\$2');\n}\nfunction isCSSImportRule(rule) {\n return 'styleSheet' in rule;\n}\nfunction isCSSStyleRule(rule) {\n return 'selectorText' in rule;\n}\nclass Mirror {\n constructor() {\n this.idNodeMap = new Map();\n this.nodeMetaMap = new WeakMap();\n }\n getId(n) {\n if (!n)\n return -1;\n const id = _optionalChain$5([this, 'access', _3 => _3.getMeta, 'call', _4 => _4(n), 'optionalAccess', _5 => _5.id]);\n return _nullishCoalesce$1(id, () => ( -1));\n }\n getNode(id) {\n return this.idNodeMap.get(id) || null;\n }\n getIds() {\n return Array.from(this.idNodeMap.keys());\n }\n getMeta(n) {\n return this.nodeMetaMap.get(n) || null;\n }\n removeNodeFromMap(n) {\n const id = this.getId(n);\n this.idNodeMap.delete(id);\n if (n.childNodes) {\n n.childNodes.forEach((childNode) => this.removeNodeFromMap(childNode));\n }\n }\n has(id) {\n return this.idNodeMap.has(id);\n }\n hasNode(node) {\n return this.nodeMetaMap.has(node);\n }\n add(n, meta) {\n const id = meta.id;\n this.idNodeMap.set(id, n);\n this.nodeMetaMap.set(n, meta);\n }\n replace(id, n) {\n const oldNode = this.getNode(id);\n if (oldNode) {\n const meta = this.nodeMetaMap.get(oldNode);\n if (meta)\n this.nodeMetaMap.set(n, meta);\n }\n this.idNodeMap.set(id, n);\n }\n reset() {\n this.idNodeMap = new Map();\n this.nodeMetaMap = new WeakMap();\n }\n}\nfunction createMirror() {\n return new Mirror();\n}\nfunction shouldMaskInput({ maskInputOptions, tagName, type, }) {\n if (tagName === 'OPTION') {\n tagName = 'SELECT';\n }\n return Boolean(maskInputOptions[tagName.toLowerCase()] ||\n (type && maskInputOptions[type]) ||\n type === 'password' ||\n (tagName === 'INPUT' && !type && maskInputOptions['text']));\n}\nfunction maskInputValue({ isMasked, element, value, maskInputFn, }) {\n let text = value || '';\n if (!isMasked) {\n return text;\n }\n if (maskInputFn) {\n text = maskInputFn(text, element);\n }\n return '*'.repeat(text.length);\n}\nfunction toLowerCase(str) {\n return str.toLowerCase();\n}\nfunction toUpperCase(str) {\n return str.toUpperCase();\n}\nconst ORIGINAL_ATTRIBUTE_NAME = '__rrweb_original__';\nfunction is2DCanvasBlank(canvas) {\n const ctx = canvas.getContext('2d');\n if (!ctx)\n return true;\n const chunkSize = 50;\n for (let x = 0; x < canvas.width; x += chunkSize) {\n for (let y = 0; y < canvas.height; y += chunkSize) {\n const getImageData = ctx.getImageData;\n const originalGetImageData = ORIGINAL_ATTRIBUTE_NAME in getImageData\n ? getImageData[ORIGINAL_ATTRIBUTE_NAME]\n : getImageData;\n const pixelBuffer = new Uint32Array(originalGetImageData.call(ctx, x, y, Math.min(chunkSize, canvas.width - x), Math.min(chunkSize, canvas.height - y)).data.buffer);\n if (pixelBuffer.some((pixel) => pixel !== 0))\n return false;\n }\n }\n return true;\n}\nfunction getInputType(element) {\n const type = element.type;\n return element.hasAttribute('data-rr-is-password')\n ? 'password'\n : type\n ?\n toLowerCase(type)\n : null;\n}\nfunction getInputValue(el, tagName, type) {\n if (tagName === 'INPUT' && (type === 'radio' || type === 'checkbox')) {\n return el.getAttribute('value') || '';\n }\n return el.value;\n}\n\nlet _id = 1;\nconst tagNameRegex = new RegExp('[^a-z0-9-_:]');\nconst IGNORED_NODE = -2;\nfunction genId() {\n return _id++;\n}\nfunction getValidTagName(element) {\n if (element instanceof HTMLFormElement) {\n return 'form';\n }\n const processedTagName = toLowerCase(element.tagName);\n if (tagNameRegex.test(processedTagName)) {\n return 'div';\n }\n return processedTagName;\n}\nfunction extractOrigin(url) {\n let origin = '';\n if (url.indexOf('//') > -1) {\n origin = url.split('/').slice(0, 3).join('/');\n }\n else {\n origin = url.split('/')[0];\n }\n origin = origin.split('?')[0];\n return origin;\n}\nlet canvasService;\nlet canvasCtx;\nconst URL_IN_CSS_REF = /url\\((?:(')([^']*)'|(\")(.*?)\"|([^)]*))\\)/gm;\nconst URL_PROTOCOL_MATCH = /^(?:[a-z+]+:)?\\/\\//i;\nconst URL_WWW_MATCH = /^www\\..*/i;\nconst DATA_URI = /^(data:)([^,]*),(.*)/i;\nfunction absoluteToStylesheet(cssText, href) {\n return (cssText || '').replace(URL_IN_CSS_REF, (origin, quote1, path1, quote2, path2, path3) => {\n const filePath = path1 || path2 || path3;\n const maybeQuote = quote1 || quote2 || '';\n if (!filePath) {\n return origin;\n }\n if (URL_PROTOCOL_MATCH.test(filePath) || URL_WWW_MATCH.test(filePath)) {\n return `url(${maybeQuote}${filePath}${maybeQuote})`;\n }\n if (DATA_URI.test(filePath)) {\n return `url(${maybeQuote}${filePath}${maybeQuote})`;\n }\n if (filePath[0] === '/') {\n return `url(${maybeQuote}${extractOrigin(href) + filePath}${maybeQuote})`;\n }\n const stack = href.split('/');\n const parts = filePath.split('/');\n stack.pop();\n for (const part of parts) {\n if (part === '.') {\n continue;\n }\n else if (part === '..') {\n stack.pop();\n }\n else {\n stack.push(part);\n }\n }\n return `url(${maybeQuote}${stack.join('/')}${maybeQuote})`;\n });\n}\nconst SRCSET_NOT_SPACES = /^[^ \\t\\n\\r\\u000c]+/;\nconst SRCSET_COMMAS_OR_SPACES = /^[, \\t\\n\\r\\u000c]+/;\nfunction getAbsoluteSrcsetString(doc, attributeValue) {\n if (attributeValue.trim() === '') {\n return attributeValue;\n }\n let pos = 0;\n function collectCharacters(regEx) {\n let chars;\n const match = regEx.exec(attributeValue.substring(pos));\n if (match) {\n chars = match[0];\n pos += chars.length;\n return chars;\n }\n return '';\n }\n const output = [];\n while (true) {\n collectCharacters(SRCSET_COMMAS_OR_SPACES);\n if (pos >= attributeValue.length) {\n break;\n }\n let url = collectCharacters(SRCSET_NOT_SPACES);\n if (url.slice(-1) === ',') {\n url = absoluteToDoc(doc, url.substring(0, url.length - 1));\n output.push(url);\n }\n else {\n let descriptorsStr = '';\n url = absoluteToDoc(doc, url);\n let inParens = false;\n while (true) {\n const c = attributeValue.charAt(pos);\n if (c === '') {\n output.push((url + descriptorsStr).trim());\n break;\n }\n else if (!inParens) {\n if (c === ',') {\n pos += 1;\n output.push((url + descriptorsStr).trim());\n break;\n }\n else if (c === '(') {\n inParens = true;\n }\n }\n else {\n if (c === ')') {\n inParens = false;\n }\n }\n descriptorsStr += c;\n pos += 1;\n }\n }\n }\n return output.join(', ');\n}\nfunction absoluteToDoc(doc, attributeValue) {\n if (!attributeValue || attributeValue.trim() === '') {\n return attributeValue;\n }\n const a = doc.createElement('a');\n a.href = attributeValue;\n return a.href;\n}\nfunction isSVGElement(el) {\n return Boolean(el.tagName === 'svg' || el.ownerSVGElement);\n}\nfunction getHref() {\n const a = document.createElement('a');\n a.href = '';\n return a.href;\n}\nfunction transformAttribute(doc, tagName, name, value, element, maskAttributeFn) {\n if (!value) {\n return value;\n }\n if (name === 'src' ||\n (name === 'href' && !(tagName === 'use' && value[0] === '#'))) {\n return absoluteToDoc(doc, value);\n }\n else if (name === 'xlink:href' && value[0] !== '#') {\n return absoluteToDoc(doc, value);\n }\n else if (name === 'background' &&\n (tagName === 'table' || tagName === 'td' || tagName === 'th')) {\n return absoluteToDoc(doc, value);\n }\n else if (name === 'srcset') {\n return getAbsoluteSrcsetString(doc, value);\n }\n else if (name === 'style') {\n return absoluteToStylesheet(value, getHref());\n }\n else if (tagName === 'object' && name === 'data') {\n return absoluteToDoc(doc, value);\n }\n if (typeof maskAttributeFn === 'function') {\n return maskAttributeFn(name, value, element);\n }\n return value;\n}\nfunction ignoreAttribute(tagName, name, _value) {\n return (tagName === 'video' || tagName === 'audio') && name === 'autoplay';\n}\nfunction _isBlockedElement(element, blockClass, blockSelector, unblockSelector) {\n try {\n if (unblockSelector && element.matches(unblockSelector)) {\n return false;\n }\n if (typeof blockClass === 'string') {\n if (element.classList.contains(blockClass)) {\n return true;\n }\n }\n else {\n for (let eIndex = element.classList.length; eIndex--;) {\n const className = element.classList[eIndex];\n if (blockClass.test(className)) {\n return true;\n }\n }\n }\n if (blockSelector) {\n return element.matches(blockSelector);\n }\n }\n catch (e) {\n }\n return false;\n}\nfunction elementClassMatchesRegex(el, regex) {\n for (let eIndex = el.classList.length; eIndex--;) {\n const className = el.classList[eIndex];\n if (regex.test(className)) {\n return true;\n }\n }\n return false;\n}\nfunction distanceToMatch(node, matchPredicate, limit = Infinity, distance = 0) {\n if (!node)\n return -1;\n if (node.nodeType !== node.ELEMENT_NODE)\n return -1;\n if (distance > limit)\n return -1;\n if (matchPredicate(node))\n return distance;\n return distanceToMatch(node.parentNode, matchPredicate, limit, distance + 1);\n}\nfunction createMatchPredicate(className, selector) {\n return (node) => {\n const el = node;\n if (el === null)\n return false;\n try {\n if (className) {\n if (typeof className === 'string') {\n if (el.matches(`.${className}`))\n return true;\n }\n else if (elementClassMatchesRegex(el, className)) {\n return true;\n }\n }\n if (selector && el.matches(selector))\n return true;\n return false;\n }\n catch (e2) {\n return false;\n }\n };\n}\nfunction needMaskingText(node, maskTextClass, maskTextSelector, unmaskTextClass, unmaskTextSelector, maskAllText) {\n try {\n const el = node.nodeType === node.ELEMENT_NODE\n ? node\n : node.parentElement;\n if (el === null)\n return false;\n let maskDistance = -1;\n let unmaskDistance = -1;\n if (maskAllText) {\n unmaskDistance = distanceToMatch(el, createMatchPredicate(unmaskTextClass, unmaskTextSelector));\n if (unmaskDistance < 0) {\n return true;\n }\n maskDistance = distanceToMatch(el, createMatchPredicate(maskTextClass, maskTextSelector), unmaskDistance >= 0 ? unmaskDistance : Infinity);\n }\n else {\n maskDistance = distanceToMatch(el, createMatchPredicate(maskTextClass, maskTextSelector));\n if (maskDistance < 0) {\n return false;\n }\n unmaskDistance = distanceToMatch(el, createMatchPredicate(unmaskTextClass, unmaskTextSelector), maskDistance >= 0 ? maskDistance : Infinity);\n }\n return maskDistance >= 0\n ? unmaskDistance >= 0\n ? maskDistance <= unmaskDistance\n : true\n : unmaskDistance >= 0\n ? false\n : !!maskAllText;\n }\n catch (e) {\n }\n return !!maskAllText;\n}\nfunction onceIframeLoaded(iframeEl, listener, iframeLoadTimeout) {\n const win = iframeEl.contentWindow;\n if (!win) {\n return;\n }\n let fired = false;\n let readyState;\n try {\n readyState = win.document.readyState;\n }\n catch (error) {\n return;\n }\n if (readyState !== 'complete') {\n const timer = setTimeout(() => {\n if (!fired) {\n listener();\n fired = true;\n }\n }, iframeLoadTimeout);\n iframeEl.addEventListener('load', () => {\n clearTimeout(timer);\n fired = true;\n listener();\n });\n return;\n }\n const blankUrl = 'about:blank';\n if (win.location.href !== blankUrl ||\n iframeEl.src === blankUrl ||\n iframeEl.src === '') {\n setTimeout(listener, 0);\n return iframeEl.addEventListener('load', listener);\n }\n iframeEl.addEventListener('load', listener);\n}\nfunction onceStylesheetLoaded(link, listener, styleSheetLoadTimeout) {\n let fired = false;\n let styleSheetLoaded;\n try {\n styleSheetLoaded = link.sheet;\n }\n catch (error) {\n return;\n }\n if (styleSheetLoaded)\n return;\n const timer = setTimeout(() => {\n if (!fired) {\n listener();\n fired = true;\n }\n }, styleSheetLoadTimeout);\n link.addEventListener('load', () => {\n clearTimeout(timer);\n fired = true;\n listener();\n });\n}\nfunction serializeNode(n, options) {\n const { doc, mirror, blockClass, blockSelector, unblockSelector, maskAllText, maskAttributeFn, maskTextClass, unmaskTextClass, maskTextSelector, unmaskTextSelector, inlineStylesheet, maskInputOptions = {}, maskTextFn, maskInputFn, dataURLOptions = {}, inlineImages, recordCanvas, keepIframeSrcFn, newlyAddedElement = false, } = options;\n const rootId = getRootId(doc, mirror);\n switch (n.nodeType) {\n case n.DOCUMENT_NODE:\n if (n.compatMode !== 'CSS1Compat') {\n return {\n type: NodeType$1.Document,\n childNodes: [],\n compatMode: n.compatMode,\n };\n }\n else {\n return {\n type: NodeType$1.Document,\n childNodes: [],\n };\n }\n case n.DOCUMENT_TYPE_NODE:\n return {\n type: NodeType$1.DocumentType,\n name: n.name,\n publicId: n.publicId,\n systemId: n.systemId,\n rootId,\n };\n case n.ELEMENT_NODE:\n return serializeElementNode(n, {\n doc,\n blockClass,\n blockSelector,\n unblockSelector,\n inlineStylesheet,\n maskAttributeFn,\n maskInputOptions,\n maskInputFn,\n dataURLOptions,\n inlineImages,\n recordCanvas,\n keepIframeSrcFn,\n newlyAddedElement,\n rootId,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n });\n case n.TEXT_NODE:\n return serializeTextNode(n, {\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n maskTextFn,\n maskInputOptions,\n maskInputFn,\n rootId,\n });\n case n.CDATA_SECTION_NODE:\n return {\n type: NodeType$1.CDATA,\n textContent: '',\n rootId,\n };\n case n.COMMENT_NODE:\n return {\n type: NodeType$1.Comment,\n textContent: n.textContent || '',\n rootId,\n };\n default:\n return false;\n }\n}\nfunction getRootId(doc, mirror) {\n if (!mirror.hasNode(doc))\n return undefined;\n const docId = mirror.getId(doc);\n return docId === 1 ? undefined : docId;\n}\nfunction serializeTextNode(n, options) {\n const { maskAllText, maskTextClass, unmaskTextClass, maskTextSelector, unmaskTextSelector, maskTextFn, maskInputOptions, maskInputFn, rootId, } = options;\n const parentTagName = n.parentNode && n.parentNode.tagName;\n let textContent = n.textContent;\n const isStyle = parentTagName === 'STYLE' ? true : undefined;\n const isScript = parentTagName === 'SCRIPT' ? true : undefined;\n const isTextarea = parentTagName === 'TEXTAREA' ? true : undefined;\n if (isStyle && textContent) {\n try {\n if (n.nextSibling || n.previousSibling) {\n }\n else if (_optionalChain$5([n, 'access', _6 => _6.parentNode, 'access', _7 => _7.sheet, 'optionalAccess', _8 => _8.cssRules])) {\n textContent = stringifyStylesheet(n.parentNode.sheet);\n }\n }\n catch (err) {\n console.warn(`Cannot get CSS styles from text's parentNode. Error: ${err}`, n);\n }\n textContent = absoluteToStylesheet(textContent, getHref());\n }\n if (isScript) {\n textContent = 'SCRIPT_PLACEHOLDER';\n }\n const forceMask = needMaskingText(n, maskTextClass, maskTextSelector, unmaskTextClass, unmaskTextSelector, maskAllText);\n if (!isStyle && !isScript && !isTextarea && textContent && forceMask) {\n textContent = maskTextFn\n ? maskTextFn(textContent)\n : textContent.replace(/[\\S]/g, '*');\n }\n if (isTextarea && textContent && (maskInputOptions.textarea || forceMask)) {\n textContent = maskInputFn\n ? maskInputFn(textContent, n.parentNode)\n : textContent.replace(/[\\S]/g, '*');\n }\n if (parentTagName === 'OPTION' && textContent) {\n const isInputMasked = shouldMaskInput({\n type: null,\n tagName: parentTagName,\n maskInputOptions,\n });\n textContent = maskInputValue({\n isMasked: needMaskingText(n, maskTextClass, maskTextSelector, unmaskTextClass, unmaskTextSelector, isInputMasked),\n element: n,\n value: textContent,\n maskInputFn,\n });\n }\n return {\n type: NodeType$1.Text,\n textContent: textContent || '',\n isStyle,\n rootId,\n };\n}\nfunction serializeElementNode(n, options) {\n const { doc, blockClass, blockSelector, unblockSelector, inlineStylesheet, maskInputOptions = {}, maskAttributeFn, maskInputFn, dataURLOptions = {}, inlineImages, recordCanvas, keepIframeSrcFn, newlyAddedElement = false, rootId, maskAllText, maskTextClass, unmaskTextClass, maskTextSelector, unmaskTextSelector, } = options;\n const needBlock = _isBlockedElement(n, blockClass, blockSelector, unblockSelector);\n const tagName = getValidTagName(n);\n let attributes = {};\n const len = n.attributes.length;\n for (let i = 0; i < len; i++) {\n const attr = n.attributes[i];\n if (!ignoreAttribute(tagName, attr.name, attr.value)) {\n attributes[attr.name] = transformAttribute(doc, tagName, toLowerCase(attr.name), attr.value, n, maskAttributeFn);\n }\n }\n if (tagName === 'link' && inlineStylesheet) {\n const stylesheet = Array.from(doc.styleSheets).find((s) => {\n return s.href === n.href;\n });\n let cssText = null;\n if (stylesheet) {\n cssText = stringifyStylesheet(stylesheet);\n }\n if (cssText) {\n delete attributes.rel;\n delete attributes.href;\n attributes._cssText = absoluteToStylesheet(cssText, stylesheet.href);\n }\n }\n if (tagName === 'style' &&\n n.sheet &&\n !(n.innerText || n.textContent || '').trim().length) {\n const cssText = stringifyStylesheet(n.sheet);\n if (cssText) {\n attributes._cssText = absoluteToStylesheet(cssText, getHref());\n }\n }\n if (tagName === 'input' ||\n tagName === 'textarea' ||\n tagName === 'select' ||\n tagName === 'option') {\n const el = n;\n const type = getInputType(el);\n const value = getInputValue(el, toUpperCase(tagName), type);\n const checked = el.checked;\n if (type !== 'submit' && type !== 'button' && value) {\n const forceMask = needMaskingText(el, maskTextClass, maskTextSelector, unmaskTextClass, unmaskTextSelector, shouldMaskInput({\n type,\n tagName: toUpperCase(tagName),\n maskInputOptions,\n }));\n attributes.value = maskInputValue({\n isMasked: forceMask,\n element: el,\n value,\n maskInputFn,\n });\n }\n if (checked) {\n attributes.checked = checked;\n }\n }\n if (tagName === 'option') {\n if (n.selected && !maskInputOptions['select']) {\n attributes.selected = true;\n }\n else {\n delete attributes.selected;\n }\n }\n if (tagName === 'canvas' && recordCanvas) {\n if (n.__context === '2d') {\n if (!is2DCanvasBlank(n)) {\n attributes.rr_dataURL = n.toDataURL(dataURLOptions.type, dataURLOptions.quality);\n }\n }\n else if (!('__context' in n)) {\n const canvasDataURL = n.toDataURL(dataURLOptions.type, dataURLOptions.quality);\n const blankCanvas = document.createElement('canvas');\n blankCanvas.width = n.width;\n blankCanvas.height = n.height;\n const blankCanvasDataURL = blankCanvas.toDataURL(dataURLOptions.type, dataURLOptions.quality);\n if (canvasDataURL !== blankCanvasDataURL) {\n attributes.rr_dataURL = canvasDataURL;\n }\n }\n }\n if (tagName === 'img' && inlineImages) {\n if (!canvasService) {\n canvasService = doc.createElement('canvas');\n canvasCtx = canvasService.getContext('2d');\n }\n const image = n;\n const oldValue = image.crossOrigin;\n image.crossOrigin = 'anonymous';\n const recordInlineImage = () => {\n image.removeEventListener('load', recordInlineImage);\n try {\n canvasService.width = image.naturalWidth;\n canvasService.height = image.naturalHeight;\n canvasCtx.drawImage(image, 0, 0);\n attributes.rr_dataURL = canvasService.toDataURL(dataURLOptions.type, dataURLOptions.quality);\n }\n catch (err) {\n console.warn(`Cannot inline img src=${image.currentSrc}! Error: ${err}`);\n }\n oldValue\n ? (attributes.crossOrigin = oldValue)\n : image.removeAttribute('crossorigin');\n };\n if (image.complete && image.naturalWidth !== 0)\n recordInlineImage();\n else\n image.addEventListener('load', recordInlineImage);\n }\n if (tagName === 'audio' || tagName === 'video') {\n attributes.rr_mediaState = n.paused\n ? 'paused'\n : 'played';\n attributes.rr_mediaCurrentTime = n.currentTime;\n }\n if (!newlyAddedElement) {\n if (n.scrollLeft) {\n attributes.rr_scrollLeft = n.scrollLeft;\n }\n if (n.scrollTop) {\n attributes.rr_scrollTop = n.scrollTop;\n }\n }\n if (needBlock) {\n const { width, height } = n.getBoundingClientRect();\n attributes = {\n class: attributes.class,\n rr_width: `${width}px`,\n rr_height: `${height}px`,\n };\n }\n if (tagName === 'iframe' && !keepIframeSrcFn(attributes.src)) {\n if (!n.contentDocument) {\n attributes.rr_src = attributes.src;\n }\n delete attributes.src;\n }\n let isCustomElement;\n try {\n if (customElements.get(tagName))\n isCustomElement = true;\n }\n catch (e) {\n }\n return {\n type: NodeType$1.Element,\n tagName,\n attributes,\n childNodes: [],\n isSVG: isSVGElement(n) || undefined,\n needBlock,\n rootId,\n isCustom: isCustomElement,\n };\n}\nfunction lowerIfExists(maybeAttr) {\n if (maybeAttr === undefined || maybeAttr === null) {\n return '';\n }\n else {\n return maybeAttr.toLowerCase();\n }\n}\nfunction slimDOMExcluded(sn, slimDOMOptions) {\n if (slimDOMOptions.comment && sn.type === NodeType$1.Comment) {\n return true;\n }\n else if (sn.type === NodeType$1.Element) {\n if (slimDOMOptions.script &&\n (sn.tagName === 'script' ||\n (sn.tagName === 'link' &&\n (sn.attributes.rel === 'preload' ||\n sn.attributes.rel === 'modulepreload') &&\n sn.attributes.as === 'script') ||\n (sn.tagName === 'link' &&\n sn.attributes.rel === 'prefetch' &&\n typeof sn.attributes.href === 'string' &&\n sn.attributes.href.endsWith('.js')))) {\n return true;\n }\n else if (slimDOMOptions.headFavicon &&\n ((sn.tagName === 'link' && sn.attributes.rel === 'shortcut icon') ||\n (sn.tagName === 'meta' &&\n (lowerIfExists(sn.attributes.name).match(/^msapplication-tile(image|color)$/) ||\n lowerIfExists(sn.attributes.name) === 'application-name' ||\n lowerIfExists(sn.attributes.rel) === 'icon' ||\n lowerIfExists(sn.attributes.rel) === 'apple-touch-icon' ||\n lowerIfExists(sn.attributes.rel) === 'shortcut icon')))) {\n return true;\n }\n else if (sn.tagName === 'meta') {\n if (slimDOMOptions.headMetaDescKeywords &&\n lowerIfExists(sn.attributes.name).match(/^description|keywords$/)) {\n return true;\n }\n else if (slimDOMOptions.headMetaSocial &&\n (lowerIfExists(sn.attributes.property).match(/^(og|twitter|fb):/) ||\n lowerIfExists(sn.attributes.name).match(/^(og|twitter):/) ||\n lowerIfExists(sn.attributes.name) === 'pinterest')) {\n return true;\n }\n else if (slimDOMOptions.headMetaRobots &&\n (lowerIfExists(sn.attributes.name) === 'robots' ||\n lowerIfExists(sn.attributes.name) === 'googlebot' ||\n lowerIfExists(sn.attributes.name) === 'bingbot')) {\n return true;\n }\n else if (slimDOMOptions.headMetaHttpEquiv &&\n sn.attributes['http-equiv'] !== undefined) {\n return true;\n }\n else if (slimDOMOptions.headMetaAuthorship &&\n (lowerIfExists(sn.attributes.name) === 'author' ||\n lowerIfExists(sn.attributes.name) === 'generator' ||\n lowerIfExists(sn.attributes.name) === 'framework' ||\n lowerIfExists(sn.attributes.name) === 'publisher' ||\n lowerIfExists(sn.attributes.name) === 'progid' ||\n lowerIfExists(sn.attributes.property).match(/^article:/) ||\n lowerIfExists(sn.attributes.property).match(/^product:/))) {\n return true;\n }\n else if (slimDOMOptions.headMetaVerification &&\n (lowerIfExists(sn.attributes.name) === 'google-site-verification' ||\n lowerIfExists(sn.attributes.name) === 'yandex-verification' ||\n lowerIfExists(sn.attributes.name) === 'csrf-token' ||\n lowerIfExists(sn.attributes.name) === 'p:domain_verify' ||\n lowerIfExists(sn.attributes.name) === 'verify-v1' ||\n lowerIfExists(sn.attributes.name) === 'verification' ||\n lowerIfExists(sn.attributes.name) === 'shopify-checkout-api-token')) {\n return true;\n }\n }\n }\n return false;\n}\nfunction serializeNodeWithId(n, options) {\n const { doc, mirror, blockClass, blockSelector, unblockSelector, maskAllText, maskTextClass, unmaskTextClass, maskTextSelector, unmaskTextSelector, skipChild = false, inlineStylesheet = true, maskInputOptions = {}, maskAttributeFn, maskTextFn, maskInputFn, slimDOMOptions, dataURLOptions = {}, inlineImages = false, recordCanvas = false, onSerialize, onIframeLoad, iframeLoadTimeout = 5000, onStylesheetLoad, stylesheetLoadTimeout = 5000, keepIframeSrcFn = () => false, newlyAddedElement = false, } = options;\n let { preserveWhiteSpace = true } = options;\n const _serializedNode = serializeNode(n, {\n doc,\n mirror,\n blockClass,\n blockSelector,\n maskAllText,\n unblockSelector,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n inlineStylesheet,\n maskInputOptions,\n maskAttributeFn,\n maskTextFn,\n maskInputFn,\n dataURLOptions,\n inlineImages,\n recordCanvas,\n keepIframeSrcFn,\n newlyAddedElement,\n });\n if (!_serializedNode) {\n console.warn(n, 'not serialized');\n return null;\n }\n let id;\n if (mirror.hasNode(n)) {\n id = mirror.getId(n);\n }\n else if (slimDOMExcluded(_serializedNode, slimDOMOptions) ||\n (!preserveWhiteSpace &&\n _serializedNode.type === NodeType$1.Text &&\n !_serializedNode.isStyle &&\n !_serializedNode.textContent.replace(/^\\s+|\\s+$/gm, '').length)) {\n id = IGNORED_NODE;\n }\n else {\n id = genId();\n }\n const serializedNode = Object.assign(_serializedNode, { id });\n mirror.add(n, serializedNode);\n if (id === IGNORED_NODE) {\n return null;\n }\n if (onSerialize) {\n onSerialize(n);\n }\n let recordChild = !skipChild;\n if (serializedNode.type === NodeType$1.Element) {\n recordChild = recordChild && !serializedNode.needBlock;\n delete serializedNode.needBlock;\n const shadowRoot = n.shadowRoot;\n if (shadowRoot && isNativeShadowDom(shadowRoot))\n serializedNode.isShadowHost = true;\n }\n if ((serializedNode.type === NodeType$1.Document ||\n serializedNode.type === NodeType$1.Element) &&\n recordChild) {\n if (slimDOMOptions.headWhitespace &&\n serializedNode.type === NodeType$1.Element &&\n serializedNode.tagName === 'head') {\n preserveWhiteSpace = false;\n }\n const bypassOptions = {\n doc,\n mirror,\n blockClass,\n blockSelector,\n maskAllText,\n unblockSelector,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n skipChild,\n inlineStylesheet,\n maskInputOptions,\n maskAttributeFn,\n maskTextFn,\n maskInputFn,\n slimDOMOptions,\n dataURLOptions,\n inlineImages,\n recordCanvas,\n preserveWhiteSpace,\n onSerialize,\n onIframeLoad,\n iframeLoadTimeout,\n onStylesheetLoad,\n stylesheetLoadTimeout,\n keepIframeSrcFn,\n };\n for (const childN of Array.from(n.childNodes)) {\n const serializedChildNode = serializeNodeWithId(childN, bypassOptions);\n if (serializedChildNode) {\n serializedNode.childNodes.push(serializedChildNode);\n }\n }\n if (isElement$1(n) && n.shadowRoot) {\n for (const childN of Array.from(n.shadowRoot.childNodes)) {\n const serializedChildNode = serializeNodeWithId(childN, bypassOptions);\n if (serializedChildNode) {\n isNativeShadowDom(n.shadowRoot) &&\n (serializedChildNode.isShadow = true);\n serializedNode.childNodes.push(serializedChildNode);\n }\n }\n }\n }\n if (n.parentNode &&\n isShadowRoot(n.parentNode) &&\n isNativeShadowDom(n.parentNode)) {\n serializedNode.isShadow = true;\n }\n if (serializedNode.type === NodeType$1.Element &&\n serializedNode.tagName === 'iframe') {\n onceIframeLoaded(n, () => {\n const iframeDoc = n.contentDocument;\n if (iframeDoc && onIframeLoad) {\n const serializedIframeNode = serializeNodeWithId(iframeDoc, {\n doc: iframeDoc,\n mirror,\n blockClass,\n blockSelector,\n unblockSelector,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n skipChild: false,\n inlineStylesheet,\n maskInputOptions,\n maskAttributeFn,\n maskTextFn,\n maskInputFn,\n slimDOMOptions,\n dataURLOptions,\n inlineImages,\n recordCanvas,\n preserveWhiteSpace,\n onSerialize,\n onIframeLoad,\n iframeLoadTimeout,\n onStylesheetLoad,\n stylesheetLoadTimeout,\n keepIframeSrcFn,\n });\n if (serializedIframeNode) {\n onIframeLoad(n, serializedIframeNode);\n }\n }\n }, iframeLoadTimeout);\n }\n if (serializedNode.type === NodeType$1.Element &&\n serializedNode.tagName === 'link' &&\n serializedNode.attributes.rel === 'stylesheet') {\n onceStylesheetLoaded(n, () => {\n if (onStylesheetLoad) {\n const serializedLinkNode = serializeNodeWithId(n, {\n doc,\n mirror,\n blockClass,\n blockSelector,\n unblockSelector,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n skipChild: false,\n inlineStylesheet,\n maskInputOptions,\n maskAttributeFn,\n maskTextFn,\n maskInputFn,\n slimDOMOptions,\n dataURLOptions,\n inlineImages,\n recordCanvas,\n preserveWhiteSpace,\n onSerialize,\n onIframeLoad,\n iframeLoadTimeout,\n onStylesheetLoad,\n stylesheetLoadTimeout,\n keepIframeSrcFn,\n });\n if (serializedLinkNode) {\n onStylesheetLoad(n, serializedLinkNode);\n }\n }\n }, stylesheetLoadTimeout);\n }\n return serializedNode;\n}\nfunction snapshot(n, options) {\n const { mirror = new Mirror(), blockClass = 'rr-block', blockSelector = null, unblockSelector = null, maskAllText = false, maskTextClass = 'rr-mask', unmaskTextClass = null, maskTextSelector = null, unmaskTextSelector = null, inlineStylesheet = true, inlineImages = false, recordCanvas = false, maskAllInputs = false, maskAttributeFn, maskTextFn, maskInputFn, slimDOM = false, dataURLOptions, preserveWhiteSpace, onSerialize, onIframeLoad, iframeLoadTimeout, onStylesheetLoad, stylesheetLoadTimeout, keepIframeSrcFn = () => false, } = options || {};\n const maskInputOptions = maskAllInputs === true\n ? {\n color: true,\n date: true,\n 'datetime-local': true,\n email: true,\n month: true,\n number: true,\n range: true,\n search: true,\n tel: true,\n text: true,\n time: true,\n url: true,\n week: true,\n textarea: true,\n select: true,\n }\n : maskAllInputs === false\n ? {}\n : maskAllInputs;\n const slimDOMOptions = slimDOM === true || slimDOM === 'all'\n ?\n {\n script: true,\n comment: true,\n headFavicon: true,\n headWhitespace: true,\n headMetaDescKeywords: slimDOM === 'all',\n headMetaSocial: true,\n headMetaRobots: true,\n headMetaHttpEquiv: true,\n headMetaAuthorship: true,\n headMetaVerification: true,\n }\n : slimDOM === false\n ? {}\n : slimDOM;\n return serializeNodeWithId(n, {\n doc: n,\n mirror,\n blockClass,\n blockSelector,\n unblockSelector,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n skipChild: false,\n inlineStylesheet,\n maskInputOptions,\n maskAttributeFn,\n maskTextFn,\n maskInputFn,\n slimDOMOptions,\n dataURLOptions,\n inlineImages,\n recordCanvas,\n preserveWhiteSpace,\n onSerialize,\n onIframeLoad,\n iframeLoadTimeout,\n onStylesheetLoad,\n stylesheetLoadTimeout,\n keepIframeSrcFn,\n newlyAddedElement: false,\n });\n}\n\nfunction _optionalChain$4(ops) { let lastAccessLHS = undefined; let value = ops[0]; let i = 1; while (i < ops.length) { const op = ops[i]; const fn = ops[i + 1]; i += 2; if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) { return undefined; } if (op === 'access' || op === 'optionalAccess') { lastAccessLHS = value; value = fn(value); } else if (op === 'call' || op === 'optionalCall') { value = fn((...args) => value.call(lastAccessLHS, ...args)); lastAccessLHS = undefined; } } return value; }\nfunction on(type, fn, target = document) {\n const options = { capture: true, passive: true };\n target.addEventListener(type, fn, options);\n return () => target.removeEventListener(type, fn, options);\n}\nconst DEPARTED_MIRROR_ACCESS_WARNING = 'Please stop import mirror directly. Instead of that,' +\n '\\r\\n' +\n 'now you can use replayer.getMirror() to access the mirror instance of a replayer,' +\n '\\r\\n' +\n 'or you can use record.mirror to access the mirror instance during recording.';\nlet _mirror = {\n map: {},\n getId() {\n console.error(DEPARTED_MIRROR_ACCESS_WARNING);\n return -1;\n },\n getNode() {\n console.error(DEPARTED_MIRROR_ACCESS_WARNING);\n return null;\n },\n removeNodeFromMap() {\n console.error(DEPARTED_MIRROR_ACCESS_WARNING);\n },\n has() {\n console.error(DEPARTED_MIRROR_ACCESS_WARNING);\n return false;\n },\n reset() {\n console.error(DEPARTED_MIRROR_ACCESS_WARNING);\n },\n};\nif (typeof window !== 'undefined' && window.Proxy && window.Reflect) {\n _mirror = new Proxy(_mirror, {\n get(target, prop, receiver) {\n if (prop === 'map') {\n console.error(DEPARTED_MIRROR_ACCESS_WARNING);\n }\n return Reflect.get(target, prop, receiver);\n },\n });\n}\nfunction throttle$1(func, wait, options = {}) {\n let timeout = null;\n let previous = 0;\n return function (...args) {\n const now = Date.now();\n if (!previous && options.leading === false) {\n previous = now;\n }\n const remaining = wait - (now - previous);\n const context = this;\n if (remaining <= 0 || remaining > wait) {\n if (timeout) {\n clearTimeout(timeout);\n timeout = null;\n }\n previous = now;\n func.apply(context, args);\n }\n else if (!timeout && options.trailing !== false) {\n timeout = setTimeout(() => {\n previous = options.leading === false ? 0 : Date.now();\n timeout = null;\n func.apply(context, args);\n }, remaining);\n }\n };\n}\nfunction hookSetter(target, key, d, isRevoked, win = window) {\n const original = win.Object.getOwnPropertyDescriptor(target, key);\n win.Object.defineProperty(target, key, isRevoked\n ? d\n : {\n set(value) {\n setTimeout(() => {\n d.set.call(this, value);\n }, 0);\n if (original && original.set) {\n original.set.call(this, value);\n }\n },\n });\n return () => hookSetter(target, key, original || {}, true);\n}\nfunction patch(source, name, replacement) {\n try {\n if (!(name in source)) {\n return () => {\n };\n }\n const original = source[name];\n const wrapped = replacement(original);\n if (typeof wrapped === 'function') {\n wrapped.prototype = wrapped.prototype || {};\n Object.defineProperties(wrapped, {\n __rrweb_original__: {\n enumerable: false,\n value: original,\n },\n });\n }\n source[name] = wrapped;\n return () => {\n source[name] = original;\n };\n }\n catch (e2) {\n return () => {\n };\n }\n}\nlet nowTimestamp = Date.now;\nif (!(/[1-9][0-9]{12}/.test(Date.now().toString()))) {\n nowTimestamp = () => new Date().getTime();\n}\nfunction getWindowScroll(win) {\n const doc = win.document;\n return {\n left: doc.scrollingElement\n ? doc.scrollingElement.scrollLeft\n : win.pageXOffset !== undefined\n ? win.pageXOffset\n : _optionalChain$4([doc, 'optionalAccess', _ => _.documentElement, 'access', _2 => _2.scrollLeft]) ||\n _optionalChain$4([doc, 'optionalAccess', _3 => _3.body, 'optionalAccess', _4 => _4.parentElement, 'optionalAccess', _5 => _5.scrollLeft]) ||\n _optionalChain$4([doc, 'optionalAccess', _6 => _6.body, 'optionalAccess', _7 => _7.scrollLeft]) ||\n 0,\n top: doc.scrollingElement\n ? doc.scrollingElement.scrollTop\n : win.pageYOffset !== undefined\n ? win.pageYOffset\n : _optionalChain$4([doc, 'optionalAccess', _8 => _8.documentElement, 'access', _9 => _9.scrollTop]) ||\n _optionalChain$4([doc, 'optionalAccess', _10 => _10.body, 'optionalAccess', _11 => _11.parentElement, 'optionalAccess', _12 => _12.scrollTop]) ||\n _optionalChain$4([doc, 'optionalAccess', _13 => _13.body, 'optionalAccess', _14 => _14.scrollTop]) ||\n 0,\n };\n}\nfunction getWindowHeight() {\n return (window.innerHeight ||\n (document.documentElement && document.documentElement.clientHeight) ||\n (document.body && document.body.clientHeight));\n}\nfunction getWindowWidth() {\n return (window.innerWidth ||\n (document.documentElement && document.documentElement.clientWidth) ||\n (document.body && document.body.clientWidth));\n}\nfunction isBlocked(node, blockClass, blockSelector, unblockSelector, checkAncestors) {\n if (!node) {\n return false;\n }\n const el = node.nodeType === node.ELEMENT_NODE\n ? node\n : node.parentElement;\n if (!el)\n return false;\n const blockedPredicate = createMatchPredicate(blockClass, blockSelector);\n if (!checkAncestors) {\n const isUnblocked = unblockSelector && el.matches(unblockSelector);\n return blockedPredicate(el) && !isUnblocked;\n }\n const blockDistance = distanceToMatch(el, blockedPredicate);\n let unblockDistance = -1;\n if (blockDistance < 0) {\n return false;\n }\n if (unblockSelector) {\n unblockDistance = distanceToMatch(el, createMatchPredicate(null, unblockSelector));\n }\n if (blockDistance > -1 && unblockDistance < 0) {\n return true;\n }\n return blockDistance < unblockDistance;\n}\nfunction isSerialized(n, mirror) {\n return mirror.getId(n) !== -1;\n}\nfunction isIgnored(n, mirror) {\n return mirror.getId(n) === IGNORED_NODE;\n}\nfunction isAncestorRemoved(target, mirror) {\n if (isShadowRoot(target)) {\n return false;\n }\n const id = mirror.getId(target);\n if (!mirror.has(id)) {\n return true;\n }\n if (target.parentNode &&\n target.parentNode.nodeType === target.DOCUMENT_NODE) {\n return false;\n }\n if (!target.parentNode) {\n return true;\n }\n return isAncestorRemoved(target.parentNode, mirror);\n}\nfunction legacy_isTouchEvent(event) {\n return Boolean(event.changedTouches);\n}\nfunction polyfill(win = window) {\n if ('NodeList' in win && !win.NodeList.prototype.forEach) {\n win.NodeList.prototype.forEach = Array.prototype\n .forEach;\n }\n if ('DOMTokenList' in win && !win.DOMTokenList.prototype.forEach) {\n win.DOMTokenList.prototype.forEach = Array.prototype\n .forEach;\n }\n if (!Node.prototype.contains) {\n Node.prototype.contains = (...args) => {\n let node = args[0];\n if (!(0 in args)) {\n throw new TypeError('1 argument is required');\n }\n do {\n if (this === node) {\n return true;\n }\n } while ((node = node && node.parentNode));\n return false;\n };\n }\n}\nfunction isSerializedIframe(n, mirror) {\n return Boolean(n.nodeName === 'IFRAME' && mirror.getMeta(n));\n}\nfunction isSerializedStylesheet(n, mirror) {\n return Boolean(n.nodeName === 'LINK' &&\n n.nodeType === n.ELEMENT_NODE &&\n n.getAttribute &&\n n.getAttribute('rel') === 'stylesheet' &&\n mirror.getMeta(n));\n}\nfunction hasShadowRoot(n) {\n return Boolean(_optionalChain$4([n, 'optionalAccess', _18 => _18.shadowRoot]));\n}\nclass StyleSheetMirror {\n constructor() {\n this.id = 1;\n this.styleIDMap = new WeakMap();\n this.idStyleMap = new Map();\n }\n getId(stylesheet) {\n return _nullishCoalesce(this.styleIDMap.get(stylesheet), () => ( -1));\n }\n has(stylesheet) {\n return this.styleIDMap.has(stylesheet);\n }\n add(stylesheet, id) {\n if (this.has(stylesheet))\n return this.getId(stylesheet);\n let newId;\n if (id === undefined) {\n newId = this.id++;\n }\n else\n newId = id;\n this.styleIDMap.set(stylesheet, newId);\n this.idStyleMap.set(newId, stylesheet);\n return newId;\n }\n getStyle(id) {\n return this.idStyleMap.get(id) || null;\n }\n reset() {\n this.styleIDMap = new WeakMap();\n this.idStyleMap = new Map();\n this.id = 1;\n }\n generateId() {\n return this.id++;\n }\n}\nfunction getShadowHost(n) {\n let shadowHost = null;\n if (_optionalChain$4([n, 'access', _19 => _19.getRootNode, 'optionalCall', _20 => _20(), 'optionalAccess', _21 => _21.nodeType]) === Node.DOCUMENT_FRAGMENT_NODE &&\n n.getRootNode().host)\n shadowHost = n.getRootNode().host;\n return shadowHost;\n}\nfunction getRootShadowHost(n) {\n let rootShadowHost = n;\n let shadowHost;\n while ((shadowHost = getShadowHost(rootShadowHost)))\n rootShadowHost = shadowHost;\n return rootShadowHost;\n}\nfunction shadowHostInDom(n) {\n const doc = n.ownerDocument;\n if (!doc)\n return false;\n const shadowHost = getRootShadowHost(n);\n return doc.contains(shadowHost);\n}\nfunction inDom(n) {\n const doc = n.ownerDocument;\n if (!doc)\n return false;\n return doc.contains(n) || shadowHostInDom(n);\n}\nlet cachedRequestAnimationFrameImplementation;\nfunction getRequestAnimationFrameImplementation() {\n if (cachedRequestAnimationFrameImplementation) {\n return cachedRequestAnimationFrameImplementation;\n }\n const document = window.document;\n let requestAnimationFrameImplementation = window.requestAnimationFrame;\n if (document && typeof document.createElement === 'function') {\n try {\n const sandbox = document.createElement('iframe');\n sandbox.hidden = true;\n document.head.appendChild(sandbox);\n const contentWindow = sandbox.contentWindow;\n if (contentWindow && contentWindow.requestAnimationFrame) {\n requestAnimationFrameImplementation =\n contentWindow.requestAnimationFrame;\n }\n document.head.removeChild(sandbox);\n }\n catch (e) {\n }\n }\n return (cachedRequestAnimationFrameImplementation =\n requestAnimationFrameImplementation.bind(window));\n}\nfunction onRequestAnimationFrame(...rest) {\n return getRequestAnimationFrameImplementation()(...rest);\n}\n\nvar EventType = /* @__PURE__ */ ((EventType2) => {\n EventType2[EventType2[\"DomContentLoaded\"] = 0] = \"DomContentLoaded\";\n EventType2[EventType2[\"Load\"] = 1] = \"Load\";\n EventType2[EventType2[\"FullSnapshot\"] = 2] = \"FullSnapshot\";\n EventType2[EventType2[\"IncrementalSnapshot\"] = 3] = \"IncrementalSnapshot\";\n EventType2[EventType2[\"Meta\"] = 4] = \"Meta\";\n EventType2[EventType2[\"Custom\"] = 5] = \"Custom\";\n EventType2[EventType2[\"Plugin\"] = 6] = \"Plugin\";\n return EventType2;\n})(EventType || {});\nvar IncrementalSource = /* @__PURE__ */ ((IncrementalSource2) => {\n IncrementalSource2[IncrementalSource2[\"Mutation\"] = 0] = \"Mutation\";\n IncrementalSource2[IncrementalSource2[\"MouseMove\"] = 1] = \"MouseMove\";\n IncrementalSource2[IncrementalSource2[\"MouseInteraction\"] = 2] = \"MouseInteraction\";\n IncrementalSource2[IncrementalSource2[\"Scroll\"] = 3] = \"Scroll\";\n IncrementalSource2[IncrementalSource2[\"ViewportResize\"] = 4] = \"ViewportResize\";\n IncrementalSource2[IncrementalSource2[\"Input\"] = 5] = \"Input\";\n IncrementalSource2[IncrementalSource2[\"TouchMove\"] = 6] = \"TouchMove\";\n IncrementalSource2[IncrementalSource2[\"MediaInteraction\"] = 7] = \"MediaInteraction\";\n IncrementalSource2[IncrementalSource2[\"StyleSheetRule\"] = 8] = \"StyleSheetRule\";\n IncrementalSource2[IncrementalSource2[\"CanvasMutation\"] = 9] = \"CanvasMutation\";\n IncrementalSource2[IncrementalSource2[\"Font\"] = 10] = \"Font\";\n IncrementalSource2[IncrementalSource2[\"Log\"] = 11] = \"Log\";\n IncrementalSource2[IncrementalSource2[\"Drag\"] = 12] = \"Drag\";\n IncrementalSource2[IncrementalSource2[\"StyleDeclaration\"] = 13] = \"StyleDeclaration\";\n IncrementalSource2[IncrementalSource2[\"Selection\"] = 14] = \"Selection\";\n IncrementalSource2[IncrementalSource2[\"AdoptedStyleSheet\"] = 15] = \"AdoptedStyleSheet\";\n IncrementalSource2[IncrementalSource2[\"CustomElement\"] = 16] = \"CustomElement\";\n return IncrementalSource2;\n})(IncrementalSource || {});\nvar MouseInteractions = /* @__PURE__ */ ((MouseInteractions2) => {\n MouseInteractions2[MouseInteractions2[\"MouseUp\"] = 0] = \"MouseUp\";\n MouseInteractions2[MouseInteractions2[\"MouseDown\"] = 1] = \"MouseDown\";\n MouseInteractions2[MouseInteractions2[\"Click\"] = 2] = \"Click\";\n MouseInteractions2[MouseInteractions2[\"ContextMenu\"] = 3] = \"ContextMenu\";\n MouseInteractions2[MouseInteractions2[\"DblClick\"] = 4] = \"DblClick\";\n MouseInteractions2[MouseInteractions2[\"Focus\"] = 5] = \"Focus\";\n MouseInteractions2[MouseInteractions2[\"Blur\"] = 6] = \"Blur\";\n MouseInteractions2[MouseInteractions2[\"TouchStart\"] = 7] = \"TouchStart\";\n MouseInteractions2[MouseInteractions2[\"TouchMove_Departed\"] = 8] = \"TouchMove_Departed\";\n MouseInteractions2[MouseInteractions2[\"TouchEnd\"] = 9] = \"TouchEnd\";\n MouseInteractions2[MouseInteractions2[\"TouchCancel\"] = 10] = \"TouchCancel\";\n return MouseInteractions2;\n})(MouseInteractions || {});\nvar PointerTypes = /* @__PURE__ */ ((PointerTypes2) => {\n PointerTypes2[PointerTypes2[\"Mouse\"] = 0] = \"Mouse\";\n PointerTypes2[PointerTypes2[\"Pen\"] = 1] = \"Pen\";\n PointerTypes2[PointerTypes2[\"Touch\"] = 2] = \"Touch\";\n return PointerTypes2;\n})(PointerTypes || {});\n\nfunction _optionalChain$3(ops) { let lastAccessLHS = undefined; let value = ops[0]; let i = 1; while (i < ops.length) { const op = ops[i]; const fn = ops[i + 1]; i += 2; if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) { return undefined; } if (op === 'access' || op === 'optionalAccess') { lastAccessLHS = value; value = fn(value); } else if (op === 'call' || op === 'optionalCall') { value = fn((...args) => value.call(lastAccessLHS, ...args)); lastAccessLHS = undefined; } } return value; }\nfunction isNodeInLinkedList(n) {\n return '__ln' in n;\n}\nclass DoubleLinkedList {\n constructor() {\n this.length = 0;\n this.head = null;\n this.tail = null;\n }\n get(position) {\n if (position >= this.length) {\n throw new Error('Position outside of list range');\n }\n let current = this.head;\n for (let index = 0; index < position; index++) {\n current = _optionalChain$3([current, 'optionalAccess', _ => _.next]) || null;\n }\n return current;\n }\n addNode(n) {\n const node = {\n value: n,\n previous: null,\n next: null,\n };\n n.__ln = node;\n if (n.previousSibling && isNodeInLinkedList(n.previousSibling)) {\n const current = n.previousSibling.__ln.next;\n node.next = current;\n node.previous = n.previousSibling.__ln;\n n.previousSibling.__ln.next = node;\n if (current) {\n current.previous = node;\n }\n }\n else if (n.nextSibling &&\n isNodeInLinkedList(n.nextSibling) &&\n n.nextSibling.__ln.previous) {\n const current = n.nextSibling.__ln.previous;\n node.previous = current;\n node.next = n.nextSibling.__ln;\n n.nextSibling.__ln.previous = node;\n if (current) {\n current.next = node;\n }\n }\n else {\n if (this.head) {\n this.head.previous = node;\n }\n node.next = this.head;\n this.head = node;\n }\n if (node.next === null) {\n this.tail = node;\n }\n this.length++;\n }\n removeNode(n) {\n const current = n.__ln;\n if (!this.head) {\n return;\n }\n if (!current.previous) {\n this.head = current.next;\n if (this.head) {\n this.head.previous = null;\n }\n else {\n this.tail = null;\n }\n }\n else {\n current.previous.next = current.next;\n if (current.next) {\n current.next.previous = current.previous;\n }\n else {\n this.tail = current.previous;\n }\n }\n if (n.__ln) {\n delete n.__ln;\n }\n this.length--;\n }\n}\nconst moveKey = (id, parentId) => `${id}@${parentId}`;\nclass MutationBuffer {\n constructor() {\n this.frozen = false;\n this.locked = false;\n this.texts = [];\n this.attributes = [];\n this.removes = [];\n this.mapRemoves = [];\n this.movedMap = {};\n this.addedSet = new Set();\n this.movedSet = new Set();\n this.droppedSet = new Set();\n this.processMutations = (mutations) => {\n mutations.forEach(this.processMutation);\n this.emit();\n };\n this.emit = () => {\n if (this.frozen || this.locked) {\n return;\n }\n const adds = [];\n const addedIds = new Set();\n const addList = new DoubleLinkedList();\n const getNextId = (n) => {\n let ns = n;\n let nextId = IGNORED_NODE;\n while (nextId === IGNORED_NODE) {\n ns = ns && ns.nextSibling;\n nextId = ns && this.mirror.getId(ns);\n }\n return nextId;\n };\n const pushAdd = (n) => {\n if (!n.parentNode || !inDom(n)) {\n return;\n }\n const parentId = isShadowRoot(n.parentNode)\n ? this.mirror.getId(getShadowHost(n))\n : this.mirror.getId(n.parentNode);\n const nextId = getNextId(n);\n if (parentId === -1 || nextId === -1) {\n return addList.addNode(n);\n }\n const sn = serializeNodeWithId(n, {\n doc: this.doc,\n mirror: this.mirror,\n blockClass: this.blockClass,\n blockSelector: this.blockSelector,\n maskAllText: this.maskAllText,\n unblockSelector: this.unblockSelector,\n maskTextClass: this.maskTextClass,\n unmaskTextClass: this.unmaskTextClass,\n maskTextSelector: this.maskTextSelector,\n unmaskTextSelector: this.unmaskTextSelector,\n skipChild: true,\n newlyAddedElement: true,\n inlineStylesheet: this.inlineStylesheet,\n maskInputOptions: this.maskInputOptions,\n maskAttributeFn: this.maskAttributeFn,\n maskTextFn: this.maskTextFn,\n maskInputFn: this.maskInputFn,\n slimDOMOptions: this.slimDOMOptions,\n dataURLOptions: this.dataURLOptions,\n recordCanvas: this.recordCanvas,\n inlineImages: this.inlineImages,\n onSerialize: (currentN) => {\n if (isSerializedIframe(currentN, this.mirror)) {\n this.iframeManager.addIframe(currentN);\n }\n if (isSerializedStylesheet(currentN, this.mirror)) {\n this.stylesheetManager.trackLinkElement(currentN);\n }\n if (hasShadowRoot(n)) {\n this.shadowDomManager.addShadowRoot(n.shadowRoot, this.doc);\n }\n },\n onIframeLoad: (iframe, childSn) => {\n this.iframeManager.attachIframe(iframe, childSn);\n this.shadowDomManager.observeAttachShadow(iframe);\n },\n onStylesheetLoad: (link, childSn) => {\n this.stylesheetManager.attachLinkElement(link, childSn);\n },\n });\n if (sn) {\n adds.push({\n parentId,\n nextId,\n node: sn,\n });\n addedIds.add(sn.id);\n }\n };\n while (this.mapRemoves.length) {\n this.mirror.removeNodeFromMap(this.mapRemoves.shift());\n }\n for (const n of this.movedSet) {\n if (isParentRemoved(this.removes, n, this.mirror) &&\n !this.movedSet.has(n.parentNode)) {\n continue;\n }\n pushAdd(n);\n }\n for (const n of this.addedSet) {\n if (!isAncestorInSet(this.droppedSet, n) &&\n !isParentRemoved(this.removes, n, this.mirror)) {\n pushAdd(n);\n }\n else if (isAncestorInSet(this.movedSet, n)) {\n pushAdd(n);\n }\n else {\n this.droppedSet.add(n);\n }\n }\n let candidate = null;\n while (addList.length) {\n let node = null;\n if (candidate) {\n const parentId = this.mirror.getId(candidate.value.parentNode);\n const nextId = getNextId(candidate.value);\n if (parentId !== -1 && nextId !== -1) {\n node = candidate;\n }\n }\n if (!node) {\n let tailNode = addList.tail;\n while (tailNode) {\n const _node = tailNode;\n tailNode = tailNode.previous;\n if (_node) {\n const parentId = this.mirror.getId(_node.value.parentNode);\n const nextId = getNextId(_node.value);\n if (nextId === -1)\n continue;\n else if (parentId !== -1) {\n node = _node;\n break;\n }\n else {\n const unhandledNode = _node.value;\n if (unhandledNode.parentNode &&\n unhandledNode.parentNode.nodeType ===\n Node.DOCUMENT_FRAGMENT_NODE) {\n const shadowHost = unhandledNode.parentNode\n .host;\n const parentId = this.mirror.getId(shadowHost);\n if (parentId !== -1) {\n node = _node;\n break;\n }\n }\n }\n }\n }\n }\n if (!node) {\n while (addList.head) {\n addList.removeNode(addList.head.value);\n }\n break;\n }\n candidate = node.previous;\n addList.removeNode(node.value);\n pushAdd(node.value);\n }\n const payload = {\n texts: this.texts\n .map((text) => ({\n id: this.mirror.getId(text.node),\n value: text.value,\n }))\n .filter((text) => !addedIds.has(text.id))\n .filter((text) => this.mirror.has(text.id)),\n attributes: this.attributes\n .map((attribute) => {\n const { attributes } = attribute;\n if (typeof attributes.style === 'string') {\n const diffAsStr = JSON.stringify(attribute.styleDiff);\n const unchangedAsStr = JSON.stringify(attribute._unchangedStyles);\n if (diffAsStr.length < attributes.style.length) {\n if ((diffAsStr + unchangedAsStr).split('var(').length ===\n attributes.style.split('var(').length) {\n attributes.style = attribute.styleDiff;\n }\n }\n }\n return {\n id: this.mirror.getId(attribute.node),\n attributes: attributes,\n };\n })\n .filter((attribute) => !addedIds.has(attribute.id))\n .filter((attribute) => this.mirror.has(attribute.id)),\n removes: this.removes,\n adds,\n };\n if (!payload.texts.length &&\n !payload.attributes.length &&\n !payload.removes.length &&\n !payload.adds.length) {\n return;\n }\n this.texts = [];\n this.attributes = [];\n this.removes = [];\n this.addedSet = new Set();\n this.movedSet = new Set();\n this.droppedSet = new Set();\n this.movedMap = {};\n this.mutationCb(payload);\n };\n this.processMutation = (m) => {\n if (isIgnored(m.target, this.mirror)) {\n return;\n }\n let unattachedDoc;\n try {\n unattachedDoc = document.implementation.createHTMLDocument();\n }\n catch (e) {\n unattachedDoc = this.doc;\n }\n switch (m.type) {\n case 'characterData': {\n const value = m.target.textContent;\n if (!isBlocked(m.target, this.blockClass, this.blockSelector, this.unblockSelector, false) &&\n value !== m.oldValue) {\n this.texts.push({\n value: needMaskingText(m.target, this.maskTextClass, this.maskTextSelector, this.unmaskTextClass, this.unmaskTextSelector, this.maskAllText) && value\n ? this.maskTextFn\n ? this.maskTextFn(value)\n : value.replace(/[\\S]/g, '*')\n : value,\n node: m.target,\n });\n }\n break;\n }\n case 'attributes': {\n const target = m.target;\n let attributeName = m.attributeName;\n let value = m.target.getAttribute(attributeName);\n if (attributeName === 'value') {\n const type = getInputType(target);\n const tagName = target.tagName;\n value = getInputValue(target, tagName, type);\n const isInputMasked = shouldMaskInput({\n maskInputOptions: this.maskInputOptions,\n tagName,\n type,\n });\n const forceMask = needMaskingText(m.target, this.maskTextClass, this.maskTextSelector, this.unmaskTextClass, this.unmaskTextSelector, isInputMasked);\n value = maskInputValue({\n isMasked: forceMask,\n element: target,\n value,\n maskInputFn: this.maskInputFn,\n });\n }\n if (isBlocked(m.target, this.blockClass, this.blockSelector, this.unblockSelector, false) ||\n value === m.oldValue) {\n return;\n }\n let item = this.attributes.find((a) => a.node === m.target);\n if (target.tagName === 'IFRAME' &&\n attributeName === 'src' &&\n !this.keepIframeSrcFn(value)) {\n if (!target.contentDocument) {\n attributeName = 'rr_src';\n }\n else {\n return;\n }\n }\n if (!item) {\n item = {\n node: m.target,\n attributes: {},\n styleDiff: {},\n _unchangedStyles: {},\n };\n this.attributes.push(item);\n }\n if (attributeName === 'type' &&\n target.tagName === 'INPUT' &&\n (m.oldValue || '').toLowerCase() === 'password') {\n target.setAttribute('data-rr-is-password', 'true');\n }\n if (!ignoreAttribute(target.tagName, attributeName)) {\n item.attributes[attributeName] = transformAttribute(this.doc, toLowerCase(target.tagName), toLowerCase(attributeName), value, target, this.maskAttributeFn);\n if (attributeName === 'style') {\n const old = unattachedDoc.createElement('span');\n if (m.oldValue) {\n old.setAttribute('style', m.oldValue);\n }\n for (const pname of Array.from(target.style)) {\n const newValue = target.style.getPropertyValue(pname);\n const newPriority = target.style.getPropertyPriority(pname);\n if (newValue !== old.style.getPropertyValue(pname) ||\n newPriority !== old.style.getPropertyPriority(pname)) {\n if (newPriority === '') {\n item.styleDiff[pname] = newValue;\n }\n else {\n item.styleDiff[pname] = [newValue, newPriority];\n }\n }\n else {\n item._unchangedStyles[pname] = [newValue, newPriority];\n }\n }\n for (const pname of Array.from(old.style)) {\n if (target.style.getPropertyValue(pname) === '') {\n item.styleDiff[pname] = false;\n }\n }\n }\n }\n break;\n }\n case 'childList': {\n if (isBlocked(m.target, this.blockClass, this.blockSelector, this.unblockSelector, true)) {\n return;\n }\n m.addedNodes.forEach((n) => this.genAdds(n, m.target));\n m.removedNodes.forEach((n) => {\n const nodeId = this.mirror.getId(n);\n const parentId = isShadowRoot(m.target)\n ? this.mirror.getId(m.target.host)\n : this.mirror.getId(m.target);\n if (isBlocked(m.target, this.blockClass, this.blockSelector, this.unblockSelector, false) ||\n isIgnored(n, this.mirror) ||\n !isSerialized(n, this.mirror)) {\n return;\n }\n if (this.addedSet.has(n)) {\n deepDelete(this.addedSet, n);\n this.droppedSet.add(n);\n }\n else if (this.addedSet.has(m.target) && nodeId === -1) ;\n else if (isAncestorRemoved(m.target, this.mirror)) ;\n else if (this.movedSet.has(n) &&\n this.movedMap[moveKey(nodeId, parentId)]) {\n deepDelete(this.movedSet, n);\n }\n else {\n this.removes.push({\n parentId,\n id: nodeId,\n isShadow: isShadowRoot(m.target) && isNativeShadowDom(m.target)\n ? true\n : undefined,\n });\n }\n this.mapRemoves.push(n);\n });\n break;\n }\n }\n };\n this.genAdds = (n, target) => {\n if (this.processedNodeManager.inOtherBuffer(n, this))\n return;\n if (this.addedSet.has(n) || this.movedSet.has(n))\n return;\n if (this.mirror.hasNode(n)) {\n if (isIgnored(n, this.mirror)) {\n return;\n }\n this.movedSet.add(n);\n let targetId = null;\n if (target && this.mirror.hasNode(target)) {\n targetId = this.mirror.getId(target);\n }\n if (targetId && targetId !== -1) {\n this.movedMap[moveKey(this.mirror.getId(n), targetId)] = true;\n }\n }\n else {\n this.addedSet.add(n);\n this.droppedSet.delete(n);\n }\n if (!isBlocked(n, this.blockClass, this.blockSelector, this.unblockSelector, false)) {\n n.childNodes.forEach((childN) => this.genAdds(childN));\n if (hasShadowRoot(n)) {\n n.shadowRoot.childNodes.forEach((childN) => {\n this.processedNodeManager.add(childN, this);\n this.genAdds(childN, n);\n });\n }\n }\n };\n }\n init(options) {\n [\n 'mutationCb',\n 'blockClass',\n 'blockSelector',\n 'unblockSelector',\n 'maskAllText',\n 'maskTextClass',\n 'unmaskTextClass',\n 'maskTextSelector',\n 'unmaskTextSelector',\n 'inlineStylesheet',\n 'maskInputOptions',\n 'maskAttributeFn',\n 'maskTextFn',\n 'maskInputFn',\n 'keepIframeSrcFn',\n 'recordCanvas',\n 'inlineImages',\n 'slimDOMOptions',\n 'dataURLOptions',\n 'doc',\n 'mirror',\n 'iframeManager',\n 'stylesheetManager',\n 'shadowDomManager',\n 'canvasManager',\n 'processedNodeManager',\n ].forEach((key) => {\n this[key] = options[key];\n });\n }\n freeze() {\n this.frozen = true;\n this.canvasManager.freeze();\n }\n unfreeze() {\n this.frozen = false;\n this.canvasManager.unfreeze();\n this.emit();\n }\n isFrozen() {\n return this.frozen;\n }\n lock() {\n this.locked = true;\n this.canvasManager.lock();\n }\n unlock() {\n this.locked = false;\n this.canvasManager.unlock();\n this.emit();\n }\n reset() {\n this.shadowDomManager.reset();\n this.canvasManager.reset();\n }\n}\nfunction deepDelete(addsSet, n) {\n addsSet.delete(n);\n n.childNodes.forEach((childN) => deepDelete(addsSet, childN));\n}\nfunction isParentRemoved(removes, n, mirror) {\n if (removes.length === 0)\n return false;\n return _isParentRemoved(removes, n, mirror);\n}\nfunction _isParentRemoved(removes, n, mirror) {\n const { parentNode } = n;\n if (!parentNode) {\n return false;\n }\n const parentId = mirror.getId(parentNode);\n if (removes.some((r) => r.id === parentId)) {\n return true;\n }\n return _isParentRemoved(removes, parentNode, mirror);\n}\nfunction isAncestorInSet(set, n) {\n if (set.size === 0)\n return false;\n return _isAncestorInSet(set, n);\n}\nfunction _isAncestorInSet(set, n) {\n const { parentNode } = n;\n if (!parentNode) {\n return false;\n }\n if (set.has(parentNode)) {\n return true;\n }\n return _isAncestorInSet(set, parentNode);\n}\n\nlet errorHandler;\nfunction registerErrorHandler(handler) {\n errorHandler = handler;\n}\nfunction unregisterErrorHandler() {\n errorHandler = undefined;\n}\nconst callbackWrapper = (cb) => {\n if (!errorHandler) {\n return cb;\n }\n const rrwebWrapped = ((...rest) => {\n try {\n return cb(...rest);\n }\n catch (error) {\n if (errorHandler && errorHandler(error) === true) {\n return () => {\n };\n }\n throw error;\n }\n });\n return rrwebWrapped;\n};\n\nfunction _optionalChain$2(ops) { let lastAccessLHS = undefined; let value = ops[0]; let i = 1; while (i < ops.length) { const op = ops[i]; const fn = ops[i + 1]; i += 2; if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) { return undefined; } if (op === 'access' || op === 'optionalAccess') { lastAccessLHS = value; value = fn(value); } else if (op === 'call' || op === 'optionalCall') { value = fn((...args) => value.call(lastAccessLHS, ...args)); lastAccessLHS = undefined; } } return value; }\nconst mutationBuffers = [];\nfunction getEventTarget(event) {\n try {\n if ('composedPath' in event) {\n const path = event.composedPath();\n if (path.length) {\n return path[0];\n }\n }\n else if ('path' in event && event.path.length) {\n return event.path[0];\n }\n }\n catch (e2) {\n }\n return event && event.target;\n}\nfunction initMutationObserver(options, rootEl) {\n const mutationBuffer = new MutationBuffer();\n mutationBuffers.push(mutationBuffer);\n mutationBuffer.init(options);\n let mutationObserverCtor = window.MutationObserver ||\n window.__rrMutationObserver;\n const angularZoneSymbol = _optionalChain$2([window, 'optionalAccess', _ => _.Zone, 'optionalAccess', _2 => _2.__symbol__, 'optionalCall', _3 => _3('MutationObserver')]);\n if (angularZoneSymbol &&\n window[angularZoneSymbol]) {\n mutationObserverCtor = window[angularZoneSymbol];\n }\n const observer = new mutationObserverCtor(callbackWrapper((mutations) => {\n if (options.onMutation && options.onMutation(mutations) === false) {\n return;\n }\n mutationBuffer.processMutations.bind(mutationBuffer)(mutations);\n }));\n observer.observe(rootEl, {\n attributes: true,\n attributeOldValue: true,\n characterData: true,\n characterDataOldValue: true,\n childList: true,\n subtree: true,\n });\n return observer;\n}\nfunction initMoveObserver({ mousemoveCb, sampling, doc, mirror, }) {\n if (sampling.mousemove === false) {\n return () => {\n };\n }\n const threshold = typeof sampling.mousemove === 'number' ? sampling.mousemove : 50;\n const callbackThreshold = typeof sampling.mousemoveCallback === 'number'\n ? sampling.mousemoveCallback\n : 500;\n let positions = [];\n let timeBaseline;\n const wrappedCb = throttle$1(callbackWrapper((source) => {\n const totalOffset = Date.now() - timeBaseline;\n mousemoveCb(positions.map((p) => {\n p.timeOffset -= totalOffset;\n return p;\n }), source);\n positions = [];\n timeBaseline = null;\n }), callbackThreshold);\n const updatePosition = callbackWrapper(throttle$1(callbackWrapper((evt) => {\n const target = getEventTarget(evt);\n const { clientX, clientY } = legacy_isTouchEvent(evt)\n ? evt.changedTouches[0]\n : evt;\n if (!timeBaseline) {\n timeBaseline = nowTimestamp();\n }\n positions.push({\n x: clientX,\n y: clientY,\n id: mirror.getId(target),\n timeOffset: nowTimestamp() - timeBaseline,\n });\n wrappedCb(typeof DragEvent !== 'undefined' && evt instanceof DragEvent\n ? IncrementalSource.Drag\n : evt instanceof MouseEvent\n ? IncrementalSource.MouseMove\n : IncrementalSource.TouchMove);\n }), threshold, {\n trailing: false,\n }));\n const handlers = [\n on('mousemove', updatePosition, doc),\n on('touchmove', updatePosition, doc),\n on('drag', updatePosition, doc),\n ];\n return callbackWrapper(() => {\n handlers.forEach((h) => h());\n });\n}\nfunction initMouseInteractionObserver({ mouseInteractionCb, doc, mirror, blockClass, blockSelector, unblockSelector, sampling, }) {\n if (sampling.mouseInteraction === false) {\n return () => {\n };\n }\n const disableMap = sampling.mouseInteraction === true ||\n sampling.mouseInteraction === undefined\n ? {}\n : sampling.mouseInteraction;\n const handlers = [];\n let currentPointerType = null;\n const getHandler = (eventKey) => {\n return (event) => {\n const target = getEventTarget(event);\n if (isBlocked(target, blockClass, blockSelector, unblockSelector, true)) {\n return;\n }\n let pointerType = null;\n let thisEventKey = eventKey;\n if ('pointerType' in event) {\n switch (event.pointerType) {\n case 'mouse':\n pointerType = PointerTypes.Mouse;\n break;\n case 'touch':\n pointerType = PointerTypes.Touch;\n break;\n case 'pen':\n pointerType = PointerTypes.Pen;\n break;\n }\n if (pointerType === PointerTypes.Touch) {\n if (MouseInteractions[eventKey] === MouseInteractions.MouseDown) {\n thisEventKey = 'TouchStart';\n }\n else if (MouseInteractions[eventKey] === MouseInteractions.MouseUp) {\n thisEventKey = 'TouchEnd';\n }\n }\n else if (pointerType === PointerTypes.Pen) ;\n }\n else if (legacy_isTouchEvent(event)) {\n pointerType = PointerTypes.Touch;\n }\n if (pointerType !== null) {\n currentPointerType = pointerType;\n if ((thisEventKey.startsWith('Touch') &&\n pointerType === PointerTypes.Touch) ||\n (thisEventKey.startsWith('Mouse') &&\n pointerType === PointerTypes.Mouse)) {\n pointerType = null;\n }\n }\n else if (MouseInteractions[eventKey] === MouseInteractions.Click) {\n pointerType = currentPointerType;\n currentPointerType = null;\n }\n const e = legacy_isTouchEvent(event) ? event.changedTouches[0] : event;\n if (!e) {\n return;\n }\n const id = mirror.getId(target);\n const { clientX, clientY } = e;\n callbackWrapper(mouseInteractionCb)({\n type: MouseInteractions[thisEventKey],\n id,\n x: clientX,\n y: clientY,\n ...(pointerType !== null && { pointerType }),\n });\n };\n };\n Object.keys(MouseInteractions)\n .filter((key) => Number.isNaN(Number(key)) &&\n !key.endsWith('_Departed') &&\n disableMap[key] !== false)\n .forEach((eventKey) => {\n let eventName = toLowerCase(eventKey);\n const handler = getHandler(eventKey);\n if (window.PointerEvent) {\n switch (MouseInteractions[eventKey]) {\n case MouseInteractions.MouseDown:\n case MouseInteractions.MouseUp:\n eventName = eventName.replace('mouse', 'pointer');\n break;\n case MouseInteractions.TouchStart:\n case MouseInteractions.TouchEnd:\n return;\n }\n }\n handlers.push(on(eventName, handler, doc));\n });\n return callbackWrapper(() => {\n handlers.forEach((h) => h());\n });\n}\nfunction initScrollObserver({ scrollCb, doc, mirror, blockClass, blockSelector, unblockSelector, sampling, }) {\n const updatePosition = callbackWrapper(throttle$1(callbackWrapper((evt) => {\n const target = getEventTarget(evt);\n if (!target ||\n isBlocked(target, blockClass, blockSelector, unblockSelector, true)) {\n return;\n }\n const id = mirror.getId(target);\n if (target === doc && doc.defaultView) {\n const scrollLeftTop = getWindowScroll(doc.defaultView);\n scrollCb({\n id,\n x: scrollLeftTop.left,\n y: scrollLeftTop.top,\n });\n }\n else {\n scrollCb({\n id,\n x: target.scrollLeft,\n y: target.scrollTop,\n });\n }\n }), sampling.scroll || 100));\n return on('scroll', updatePosition, doc);\n}\nfunction initViewportResizeObserver({ viewportResizeCb }, { win }) {\n let lastH = -1;\n let lastW = -1;\n const updateDimension = callbackWrapper(throttle$1(callbackWrapper(() => {\n const height = getWindowHeight();\n const width = getWindowWidth();\n if (lastH !== height || lastW !== width) {\n viewportResizeCb({\n width: Number(width),\n height: Number(height),\n });\n lastH = height;\n lastW = width;\n }\n }), 200));\n return on('resize', updateDimension, win);\n}\nconst INPUT_TAGS = ['INPUT', 'TEXTAREA', 'SELECT'];\nconst lastInputValueMap = new WeakMap();\nfunction initInputObserver({ inputCb, doc, mirror, blockClass, blockSelector, unblockSelector, ignoreClass, ignoreSelector, maskInputOptions, maskInputFn, sampling, userTriggeredOnInput, maskTextClass, unmaskTextClass, maskTextSelector, unmaskTextSelector, }) {\n function eventHandler(event) {\n let target = getEventTarget(event);\n const userTriggered = event.isTrusted;\n const tagName = target && toUpperCase(target.tagName);\n if (tagName === 'OPTION')\n target = target.parentElement;\n if (!target ||\n !tagName ||\n INPUT_TAGS.indexOf(tagName) < 0 ||\n isBlocked(target, blockClass, blockSelector, unblockSelector, true)) {\n return;\n }\n const el = target;\n if (el.classList.contains(ignoreClass) ||\n (ignoreSelector && el.matches(ignoreSelector))) {\n return;\n }\n const type = getInputType(target);\n let text = getInputValue(el, tagName, type);\n let isChecked = false;\n const isInputMasked = shouldMaskInput({\n maskInputOptions,\n tagName,\n type,\n });\n const forceMask = needMaskingText(target, maskTextClass, maskTextSelector, unmaskTextClass, unmaskTextSelector, isInputMasked);\n if (type === 'radio' || type === 'checkbox') {\n isChecked = target.checked;\n }\n text = maskInputValue({\n isMasked: forceMask,\n element: target,\n value: text,\n maskInputFn,\n });\n cbWithDedup(target, userTriggeredOnInput\n ? { text, isChecked, userTriggered }\n : { text, isChecked });\n const name = target.name;\n if (type === 'radio' && name && isChecked) {\n doc\n .querySelectorAll(`input[type=\"radio\"][name=\"${name}\"]`)\n .forEach((el) => {\n if (el !== target) {\n const text = maskInputValue({\n isMasked: forceMask,\n element: el,\n value: getInputValue(el, tagName, type),\n maskInputFn,\n });\n cbWithDedup(el, userTriggeredOnInput\n ? { text, isChecked: !isChecked, userTriggered: false }\n : { text, isChecked: !isChecked });\n }\n });\n }\n }\n function cbWithDedup(target, v) {\n const lastInputValue = lastInputValueMap.get(target);\n if (!lastInputValue ||\n lastInputValue.text !== v.text ||\n lastInputValue.isChecked !== v.isChecked) {\n lastInputValueMap.set(target, v);\n const id = mirror.getId(target);\n callbackWrapper(inputCb)({\n ...v,\n id,\n });\n }\n }\n const events = sampling.input === 'last' ? ['change'] : ['input', 'change'];\n const handlers = events.map((eventName) => on(eventName, callbackWrapper(eventHandler), doc));\n const currentWindow = doc.defaultView;\n if (!currentWindow) {\n return () => {\n handlers.forEach((h) => h());\n };\n }\n const propertyDescriptor = currentWindow.Object.getOwnPropertyDescriptor(currentWindow.HTMLInputElement.prototype, 'value');\n const hookProperties = [\n [currentWindow.HTMLInputElement.prototype, 'value'],\n [currentWindow.HTMLInputElement.prototype, 'checked'],\n [currentWindow.HTMLSelectElement.prototype, 'value'],\n [currentWindow.HTMLTextAreaElement.prototype, 'value'],\n [currentWindow.HTMLSelectElement.prototype, 'selectedIndex'],\n [currentWindow.HTMLOptionElement.prototype, 'selected'],\n ];\n if (propertyDescriptor && propertyDescriptor.set) {\n handlers.push(...hookProperties.map((p) => hookSetter(p[0], p[1], {\n set() {\n callbackWrapper(eventHandler)({\n target: this,\n isTrusted: false,\n });\n },\n }, false, currentWindow)));\n }\n return callbackWrapper(() => {\n handlers.forEach((h) => h());\n });\n}\nfunction getNestedCSSRulePositions(rule) {\n const positions = [];\n function recurse(childRule, pos) {\n if ((hasNestedCSSRule('CSSGroupingRule') &&\n childRule.parentRule instanceof CSSGroupingRule) ||\n (hasNestedCSSRule('CSSMediaRule') &&\n childRule.parentRule instanceof CSSMediaRule) ||\n (hasNestedCSSRule('CSSSupportsRule') &&\n childRule.parentRule instanceof CSSSupportsRule) ||\n (hasNestedCSSRule('CSSConditionRule') &&\n childRule.parentRule instanceof CSSConditionRule)) {\n const rules = Array.from(childRule.parentRule.cssRules);\n const index = rules.indexOf(childRule);\n pos.unshift(index);\n }\n else if (childRule.parentStyleSheet) {\n const rules = Array.from(childRule.parentStyleSheet.cssRules);\n const index = rules.indexOf(childRule);\n pos.unshift(index);\n }\n return pos;\n }\n return recurse(rule, positions);\n}\nfunction getIdAndStyleId(sheet, mirror, styleMirror) {\n let id, styleId;\n if (!sheet)\n return {};\n if (sheet.ownerNode)\n id = mirror.getId(sheet.ownerNode);\n else\n styleId = styleMirror.getId(sheet);\n return {\n styleId,\n id,\n };\n}\nfunction initStyleSheetObserver({ styleSheetRuleCb, mirror, stylesheetManager }, { win }) {\n if (!win.CSSStyleSheet || !win.CSSStyleSheet.prototype) {\n return () => {\n };\n }\n const insertRule = win.CSSStyleSheet.prototype.insertRule;\n win.CSSStyleSheet.prototype.insertRule = new Proxy(insertRule, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [rule, index] = argumentsList;\n const { id, styleId } = getIdAndStyleId(thisArg, mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleSheetRuleCb({\n id,\n styleId,\n adds: [{ rule, index }],\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n const deleteRule = win.CSSStyleSheet.prototype.deleteRule;\n win.CSSStyleSheet.prototype.deleteRule = new Proxy(deleteRule, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [index] = argumentsList;\n const { id, styleId } = getIdAndStyleId(thisArg, mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleSheetRuleCb({\n id,\n styleId,\n removes: [{ index }],\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n let replace;\n if (win.CSSStyleSheet.prototype.replace) {\n replace = win.CSSStyleSheet.prototype.replace;\n win.CSSStyleSheet.prototype.replace = new Proxy(replace, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [text] = argumentsList;\n const { id, styleId } = getIdAndStyleId(thisArg, mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleSheetRuleCb({\n id,\n styleId,\n replace: text,\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n }\n let replaceSync;\n if (win.CSSStyleSheet.prototype.replaceSync) {\n replaceSync = win.CSSStyleSheet.prototype.replaceSync;\n win.CSSStyleSheet.prototype.replaceSync = new Proxy(replaceSync, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [text] = argumentsList;\n const { id, styleId } = getIdAndStyleId(thisArg, mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleSheetRuleCb({\n id,\n styleId,\n replaceSync: text,\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n }\n const supportedNestedCSSRuleTypes = {};\n if (canMonkeyPatchNestedCSSRule('CSSGroupingRule')) {\n supportedNestedCSSRuleTypes.CSSGroupingRule = win.CSSGroupingRule;\n }\n else {\n if (canMonkeyPatchNestedCSSRule('CSSMediaRule')) {\n supportedNestedCSSRuleTypes.CSSMediaRule = win.CSSMediaRule;\n }\n if (canMonkeyPatchNestedCSSRule('CSSConditionRule')) {\n supportedNestedCSSRuleTypes.CSSConditionRule = win.CSSConditionRule;\n }\n if (canMonkeyPatchNestedCSSRule('CSSSupportsRule')) {\n supportedNestedCSSRuleTypes.CSSSupportsRule = win.CSSSupportsRule;\n }\n }\n const unmodifiedFunctions = {};\n Object.entries(supportedNestedCSSRuleTypes).forEach(([typeKey, type]) => {\n unmodifiedFunctions[typeKey] = {\n insertRule: type.prototype.insertRule,\n deleteRule: type.prototype.deleteRule,\n };\n type.prototype.insertRule = new Proxy(unmodifiedFunctions[typeKey].insertRule, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [rule, index] = argumentsList;\n const { id, styleId } = getIdAndStyleId(thisArg.parentStyleSheet, mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleSheetRuleCb({\n id,\n styleId,\n adds: [\n {\n rule,\n index: [\n ...getNestedCSSRulePositions(thisArg),\n index || 0,\n ],\n },\n ],\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n type.prototype.deleteRule = new Proxy(unmodifiedFunctions[typeKey].deleteRule, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [index] = argumentsList;\n const { id, styleId } = getIdAndStyleId(thisArg.parentStyleSheet, mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleSheetRuleCb({\n id,\n styleId,\n removes: [\n { index: [...getNestedCSSRulePositions(thisArg), index] },\n ],\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n });\n return callbackWrapper(() => {\n win.CSSStyleSheet.prototype.insertRule = insertRule;\n win.CSSStyleSheet.prototype.deleteRule = deleteRule;\n replace && (win.CSSStyleSheet.prototype.replace = replace);\n replaceSync && (win.CSSStyleSheet.prototype.replaceSync = replaceSync);\n Object.entries(supportedNestedCSSRuleTypes).forEach(([typeKey, type]) => {\n type.prototype.insertRule = unmodifiedFunctions[typeKey].insertRule;\n type.prototype.deleteRule = unmodifiedFunctions[typeKey].deleteRule;\n });\n });\n}\nfunction initAdoptedStyleSheetObserver({ mirror, stylesheetManager, }, host) {\n let hostId = null;\n if (host.nodeName === '#document')\n hostId = mirror.getId(host);\n else\n hostId = mirror.getId(host.host);\n const patchTarget = host.nodeName === '#document'\n ? _optionalChain$2([host, 'access', _4 => _4.defaultView, 'optionalAccess', _5 => _5.Document])\n : _optionalChain$2([host, 'access', _6 => _6.ownerDocument, 'optionalAccess', _7 => _7.defaultView, 'optionalAccess', _8 => _8.ShadowRoot]);\n const originalPropertyDescriptor = _optionalChain$2([patchTarget, 'optionalAccess', _9 => _9.prototype])\n ? Object.getOwnPropertyDescriptor(_optionalChain$2([patchTarget, 'optionalAccess', _10 => _10.prototype]), 'adoptedStyleSheets')\n : undefined;\n if (hostId === null ||\n hostId === -1 ||\n !patchTarget ||\n !originalPropertyDescriptor)\n return () => {\n };\n Object.defineProperty(host, 'adoptedStyleSheets', {\n configurable: originalPropertyDescriptor.configurable,\n enumerable: originalPropertyDescriptor.enumerable,\n get() {\n return _optionalChain$2([originalPropertyDescriptor, 'access', _11 => _11.get, 'optionalAccess', _12 => _12.call, 'call', _13 => _13(this)]);\n },\n set(sheets) {\n const result = _optionalChain$2([originalPropertyDescriptor, 'access', _14 => _14.set, 'optionalAccess', _15 => _15.call, 'call', _16 => _16(this, sheets)]);\n if (hostId !== null && hostId !== -1) {\n try {\n stylesheetManager.adoptStyleSheets(sheets, hostId);\n }\n catch (e) {\n }\n }\n return result;\n },\n });\n return callbackWrapper(() => {\n Object.defineProperty(host, 'adoptedStyleSheets', {\n configurable: originalPropertyDescriptor.configurable,\n enumerable: originalPropertyDescriptor.enumerable,\n get: originalPropertyDescriptor.get,\n set: originalPropertyDescriptor.set,\n });\n });\n}\nfunction initStyleDeclarationObserver({ styleDeclarationCb, mirror, ignoreCSSAttributes, stylesheetManager, }, { win }) {\n const setProperty = win.CSSStyleDeclaration.prototype.setProperty;\n win.CSSStyleDeclaration.prototype.setProperty = new Proxy(setProperty, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [property, value, priority] = argumentsList;\n if (ignoreCSSAttributes.has(property)) {\n return setProperty.apply(thisArg, [property, value, priority]);\n }\n const { id, styleId } = getIdAndStyleId(_optionalChain$2([thisArg, 'access', _17 => _17.parentRule, 'optionalAccess', _18 => _18.parentStyleSheet]), mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleDeclarationCb({\n id,\n styleId,\n set: {\n property,\n value,\n priority,\n },\n index: getNestedCSSRulePositions(thisArg.parentRule),\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n const removeProperty = win.CSSStyleDeclaration.prototype.removeProperty;\n win.CSSStyleDeclaration.prototype.removeProperty = new Proxy(removeProperty, {\n apply: callbackWrapper((target, thisArg, argumentsList) => {\n const [property] = argumentsList;\n if (ignoreCSSAttributes.has(property)) {\n return removeProperty.apply(thisArg, [property]);\n }\n const { id, styleId } = getIdAndStyleId(_optionalChain$2([thisArg, 'access', _19 => _19.parentRule, 'optionalAccess', _20 => _20.parentStyleSheet]), mirror, stylesheetManager.styleMirror);\n if ((id && id !== -1) || (styleId && styleId !== -1)) {\n styleDeclarationCb({\n id,\n styleId,\n remove: {\n property,\n },\n index: getNestedCSSRulePositions(thisArg.parentRule),\n });\n }\n return target.apply(thisArg, argumentsList);\n }),\n });\n return callbackWrapper(() => {\n win.CSSStyleDeclaration.prototype.setProperty = setProperty;\n win.CSSStyleDeclaration.prototype.removeProperty = removeProperty;\n });\n}\nfunction initMediaInteractionObserver({ mediaInteractionCb, blockClass, blockSelector, unblockSelector, mirror, sampling, doc, }) {\n const handler = callbackWrapper((type) => throttle$1(callbackWrapper((event) => {\n const target = getEventTarget(event);\n if (!target ||\n isBlocked(target, blockClass, blockSelector, unblockSelector, true)) {\n return;\n }\n const { currentTime, volume, muted, playbackRate } = target;\n mediaInteractionCb({\n type,\n id: mirror.getId(target),\n currentTime,\n volume,\n muted,\n playbackRate,\n });\n }), sampling.media || 500));\n const handlers = [\n on('play', handler(0), doc),\n on('pause', handler(1), doc),\n on('seeked', handler(2), doc),\n on('volumechange', handler(3), doc),\n on('ratechange', handler(4), doc),\n ];\n return callbackWrapper(() => {\n handlers.forEach((h) => h());\n });\n}\nfunction initFontObserver({ fontCb, doc }) {\n const win = doc.defaultView;\n if (!win) {\n return () => {\n };\n }\n const handlers = [];\n const fontMap = new WeakMap();\n const originalFontFace = win.FontFace;\n win.FontFace = function FontFace(family, source, descriptors) {\n const fontFace = new originalFontFace(family, source, descriptors);\n fontMap.set(fontFace, {\n family,\n buffer: typeof source !== 'string',\n descriptors,\n fontSource: typeof source === 'string'\n ? source\n : JSON.stringify(Array.from(new Uint8Array(source))),\n });\n return fontFace;\n };\n const restoreHandler = patch(doc.fonts, 'add', function (original) {\n return function (fontFace) {\n setTimeout(callbackWrapper(() => {\n const p = fontMap.get(fontFace);\n if (p) {\n fontCb(p);\n fontMap.delete(fontFace);\n }\n }), 0);\n return original.apply(this, [fontFace]);\n };\n });\n handlers.push(() => {\n win.FontFace = originalFontFace;\n });\n handlers.push(restoreHandler);\n return callbackWrapper(() => {\n handlers.forEach((h) => h());\n });\n}\nfunction initSelectionObserver(param) {\n const { doc, mirror, blockClass, blockSelector, unblockSelector, selectionCb, } = param;\n let collapsed = true;\n const updateSelection = callbackWrapper(() => {\n const selection = doc.getSelection();\n if (!selection || (collapsed && _optionalChain$2([selection, 'optionalAccess', _21 => _21.isCollapsed])))\n return;\n collapsed = selection.isCollapsed || false;\n const ranges = [];\n const count = selection.rangeCount || 0;\n for (let i = 0; i < count; i++) {\n const range = selection.getRangeAt(i);\n const { startContainer, startOffset, endContainer, endOffset } = range;\n const blocked = isBlocked(startContainer, blockClass, blockSelector, unblockSelector, true) ||\n isBlocked(endContainer, blockClass, blockSelector, unblockSelector, true);\n if (blocked)\n continue;\n ranges.push({\n start: mirror.getId(startContainer),\n startOffset,\n end: mirror.getId(endContainer),\n endOffset,\n });\n }\n selectionCb({ ranges });\n });\n updateSelection();\n return on('selectionchange', updateSelection);\n}\nfunction initCustomElementObserver({ doc, customElementCb, }) {\n const win = doc.defaultView;\n if (!win || !win.customElements) {\n return () => {\n };\n }\n const restoreHandler = patch(win.customElements, 'define', function (original) {\n return function (name, constructor, options) {\n try {\n customElementCb({\n define: {\n name,\n },\n });\n }\n catch (e) {\n }\n return original.apply(this, [name, constructor, options]);\n };\n });\n return restoreHandler;\n}\nfunction initObservers(o, _hooks = {}) {\n const currentWindow = o.doc.defaultView;\n if (!currentWindow) {\n return () => {\n };\n }\n const mutationObserver = initMutationObserver(o, o.doc);\n const mousemoveHandler = initMoveObserver(o);\n const mouseInteractionHandler = initMouseInteractionObserver(o);\n const scrollHandler = initScrollObserver(o);\n const viewportResizeHandler = initViewportResizeObserver(o, {\n win: currentWindow,\n });\n const inputHandler = initInputObserver(o);\n const mediaInteractionHandler = initMediaInteractionObserver(o);\n const styleSheetObserver = initStyleSheetObserver(o, { win: currentWindow });\n const adoptedStyleSheetObserver = initAdoptedStyleSheetObserver(o, o.doc);\n const styleDeclarationObserver = initStyleDeclarationObserver(o, {\n win: currentWindow,\n });\n const fontObserver = o.collectFonts\n ? initFontObserver(o)\n : () => {\n };\n const selectionObserver = initSelectionObserver(o);\n const customElementObserver = initCustomElementObserver(o);\n const pluginHandlers = [];\n for (const plugin of o.plugins) {\n pluginHandlers.push(plugin.observer(plugin.callback, currentWindow, plugin.options));\n }\n return callbackWrapper(() => {\n mutationBuffers.forEach((b) => b.reset());\n mutationObserver.disconnect();\n mousemoveHandler();\n mouseInteractionHandler();\n scrollHandler();\n viewportResizeHandler();\n inputHandler();\n mediaInteractionHandler();\n styleSheetObserver();\n adoptedStyleSheetObserver();\n styleDeclarationObserver();\n fontObserver();\n selectionObserver();\n customElementObserver();\n pluginHandlers.forEach((h) => h());\n });\n}\nfunction hasNestedCSSRule(prop) {\n return typeof window[prop] !== 'undefined';\n}\nfunction canMonkeyPatchNestedCSSRule(prop) {\n return Boolean(typeof window[prop] !== 'undefined' &&\n window[prop].prototype &&\n 'insertRule' in window[prop].prototype &&\n 'deleteRule' in window[prop].prototype);\n}\n\nclass CrossOriginIframeMirror {\n constructor(generateIdFn) {\n this.generateIdFn = generateIdFn;\n this.iframeIdToRemoteIdMap = new WeakMap();\n this.iframeRemoteIdToIdMap = new WeakMap();\n }\n getId(iframe, remoteId, idToRemoteMap, remoteToIdMap) {\n const idToRemoteIdMap = idToRemoteMap || this.getIdToRemoteIdMap(iframe);\n const remoteIdToIdMap = remoteToIdMap || this.getRemoteIdToIdMap(iframe);\n let id = idToRemoteIdMap.get(remoteId);\n if (!id) {\n id = this.generateIdFn();\n idToRemoteIdMap.set(remoteId, id);\n remoteIdToIdMap.set(id, remoteId);\n }\n return id;\n }\n getIds(iframe, remoteId) {\n const idToRemoteIdMap = this.getIdToRemoteIdMap(iframe);\n const remoteIdToIdMap = this.getRemoteIdToIdMap(iframe);\n return remoteId.map((id) => this.getId(iframe, id, idToRemoteIdMap, remoteIdToIdMap));\n }\n getRemoteId(iframe, id, map) {\n const remoteIdToIdMap = map || this.getRemoteIdToIdMap(iframe);\n if (typeof id !== 'number')\n return id;\n const remoteId = remoteIdToIdMap.get(id);\n if (!remoteId)\n return -1;\n return remoteId;\n }\n getRemoteIds(iframe, ids) {\n const remoteIdToIdMap = this.getRemoteIdToIdMap(iframe);\n return ids.map((id) => this.getRemoteId(iframe, id, remoteIdToIdMap));\n }\n reset(iframe) {\n if (!iframe) {\n this.iframeIdToRemoteIdMap = new WeakMap();\n this.iframeRemoteIdToIdMap = new WeakMap();\n return;\n }\n this.iframeIdToRemoteIdMap.delete(iframe);\n this.iframeRemoteIdToIdMap.delete(iframe);\n }\n getIdToRemoteIdMap(iframe) {\n let idToRemoteIdMap = this.iframeIdToRemoteIdMap.get(iframe);\n if (!idToRemoteIdMap) {\n idToRemoteIdMap = new Map();\n this.iframeIdToRemoteIdMap.set(iframe, idToRemoteIdMap);\n }\n return idToRemoteIdMap;\n }\n getRemoteIdToIdMap(iframe) {\n let remoteIdToIdMap = this.iframeRemoteIdToIdMap.get(iframe);\n if (!remoteIdToIdMap) {\n remoteIdToIdMap = new Map();\n this.iframeRemoteIdToIdMap.set(iframe, remoteIdToIdMap);\n }\n return remoteIdToIdMap;\n }\n}\n\nfunction _optionalChain$1(ops) { let lastAccessLHS = undefined; let value = ops[0]; let i = 1; while (i < ops.length) { const op = ops[i]; const fn = ops[i + 1]; i += 2; if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) { return undefined; } if (op === 'access' || op === 'optionalAccess') { lastAccessLHS = value; value = fn(value); } else if (op === 'call' || op === 'optionalCall') { value = fn((...args) => value.call(lastAccessLHS, ...args)); lastAccessLHS = undefined; } } return value; }\nclass IframeManagerNoop {\n constructor() {\n this.crossOriginIframeMirror = new CrossOriginIframeMirror(genId);\n this.crossOriginIframeRootIdMap = new WeakMap();\n }\n addIframe() {\n }\n addLoadListener() {\n }\n attachIframe() {\n }\n}\nclass IframeManager {\n constructor(options) {\n this.iframes = new WeakMap();\n this.crossOriginIframeMap = new WeakMap();\n this.crossOriginIframeMirror = new CrossOriginIframeMirror(genId);\n this.crossOriginIframeRootIdMap = new WeakMap();\n this.mutationCb = options.mutationCb;\n this.wrappedEmit = options.wrappedEmit;\n this.stylesheetManager = options.stylesheetManager;\n this.recordCrossOriginIframes = options.recordCrossOriginIframes;\n this.crossOriginIframeStyleMirror = new CrossOriginIframeMirror(this.stylesheetManager.styleMirror.generateId.bind(this.stylesheetManager.styleMirror));\n this.mirror = options.mirror;\n if (this.recordCrossOriginIframes) {\n window.addEventListener('message', this.handleMessage.bind(this));\n }\n }\n addIframe(iframeEl) {\n this.iframes.set(iframeEl, true);\n if (iframeEl.contentWindow)\n this.crossOriginIframeMap.set(iframeEl.contentWindow, iframeEl);\n }\n addLoadListener(cb) {\n this.loadListener = cb;\n }\n attachIframe(iframeEl, childSn) {\n this.mutationCb({\n adds: [\n {\n parentId: this.mirror.getId(iframeEl),\n nextId: null,\n node: childSn,\n },\n ],\n removes: [],\n texts: [],\n attributes: [],\n isAttachIframe: true,\n });\n _optionalChain$1([this, 'access', _ => _.loadListener, 'optionalCall', _2 => _2(iframeEl)]);\n if (iframeEl.contentDocument &&\n iframeEl.contentDocument.adoptedStyleSheets &&\n iframeEl.contentDocument.adoptedStyleSheets.length > 0)\n this.stylesheetManager.adoptStyleSheets(iframeEl.contentDocument.adoptedStyleSheets, this.mirror.getId(iframeEl.contentDocument));\n }\n handleMessage(message) {\n const crossOriginMessageEvent = message;\n if (crossOriginMessageEvent.data.type !== 'rrweb' ||\n crossOriginMessageEvent.origin !== crossOriginMessageEvent.data.origin)\n return;\n const iframeSourceWindow = message.source;\n if (!iframeSourceWindow)\n return;\n const iframeEl = this.crossOriginIframeMap.get(message.source);\n if (!iframeEl)\n return;\n const transformedEvent = this.transformCrossOriginEvent(iframeEl, crossOriginMessageEvent.data.event);\n if (transformedEvent)\n this.wrappedEmit(transformedEvent, crossOriginMessageEvent.data.isCheckout);\n }\n transformCrossOriginEvent(iframeEl, e) {\n switch (e.type) {\n case EventType.FullSnapshot: {\n this.crossOriginIframeMirror.reset(iframeEl);\n this.crossOriginIframeStyleMirror.reset(iframeEl);\n this.replaceIdOnNode(e.data.node, iframeEl);\n const rootId = e.data.node.id;\n this.crossOriginIframeRootIdMap.set(iframeEl, rootId);\n this.patchRootIdOnNode(e.data.node, rootId);\n return {\n timestamp: e.timestamp,\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.Mutation,\n adds: [\n {\n parentId: this.mirror.getId(iframeEl),\n nextId: null,\n node: e.data.node,\n },\n ],\n removes: [],\n texts: [],\n attributes: [],\n isAttachIframe: true,\n },\n };\n }\n case EventType.Meta:\n case EventType.Load:\n case EventType.DomContentLoaded: {\n return false;\n }\n case EventType.Plugin: {\n return e;\n }\n case EventType.Custom: {\n this.replaceIds(e.data.payload, iframeEl, ['id', 'parentId', 'previousId', 'nextId']);\n return e;\n }\n case EventType.IncrementalSnapshot: {\n switch (e.data.source) {\n case IncrementalSource.Mutation: {\n e.data.adds.forEach((n) => {\n this.replaceIds(n, iframeEl, [\n 'parentId',\n 'nextId',\n 'previousId',\n ]);\n this.replaceIdOnNode(n.node, iframeEl);\n const rootId = this.crossOriginIframeRootIdMap.get(iframeEl);\n rootId && this.patchRootIdOnNode(n.node, rootId);\n });\n e.data.removes.forEach((n) => {\n this.replaceIds(n, iframeEl, ['parentId', 'id']);\n });\n e.data.attributes.forEach((n) => {\n this.replaceIds(n, iframeEl, ['id']);\n });\n e.data.texts.forEach((n) => {\n this.replaceIds(n, iframeEl, ['id']);\n });\n return e;\n }\n case IncrementalSource.Drag:\n case IncrementalSource.TouchMove:\n case IncrementalSource.MouseMove: {\n e.data.positions.forEach((p) => {\n this.replaceIds(p, iframeEl, ['id']);\n });\n return e;\n }\n case IncrementalSource.ViewportResize: {\n return false;\n }\n case IncrementalSource.MediaInteraction:\n case IncrementalSource.MouseInteraction:\n case IncrementalSource.Scroll:\n case IncrementalSource.CanvasMutation:\n case IncrementalSource.Input: {\n this.replaceIds(e.data, iframeEl, ['id']);\n return e;\n }\n case IncrementalSource.StyleSheetRule:\n case IncrementalSource.StyleDeclaration: {\n this.replaceIds(e.data, iframeEl, ['id']);\n this.replaceStyleIds(e.data, iframeEl, ['styleId']);\n return e;\n }\n case IncrementalSource.Font: {\n return e;\n }\n case IncrementalSource.Selection: {\n e.data.ranges.forEach((range) => {\n this.replaceIds(range, iframeEl, ['start', 'end']);\n });\n return e;\n }\n case IncrementalSource.AdoptedStyleSheet: {\n this.replaceIds(e.data, iframeEl, ['id']);\n this.replaceStyleIds(e.data, iframeEl, ['styleIds']);\n _optionalChain$1([e, 'access', _3 => _3.data, 'access', _4 => _4.styles, 'optionalAccess', _5 => _5.forEach, 'call', _6 => _6((style) => {\n this.replaceStyleIds(style, iframeEl, ['styleId']);\n })]);\n return e;\n }\n }\n }\n }\n return false;\n }\n replace(iframeMirror, obj, iframeEl, keys) {\n for (const key of keys) {\n if (!Array.isArray(obj[key]) && typeof obj[key] !== 'number')\n continue;\n if (Array.isArray(obj[key])) {\n obj[key] = iframeMirror.getIds(iframeEl, obj[key]);\n }\n else {\n obj[key] = iframeMirror.getId(iframeEl, obj[key]);\n }\n }\n return obj;\n }\n replaceIds(obj, iframeEl, keys) {\n return this.replace(this.crossOriginIframeMirror, obj, iframeEl, keys);\n }\n replaceStyleIds(obj, iframeEl, keys) {\n return this.replace(this.crossOriginIframeStyleMirror, obj, iframeEl, keys);\n }\n replaceIdOnNode(node, iframeEl) {\n this.replaceIds(node, iframeEl, ['id', 'rootId']);\n if ('childNodes' in node) {\n node.childNodes.forEach((child) => {\n this.replaceIdOnNode(child, iframeEl);\n });\n }\n }\n patchRootIdOnNode(node, rootId) {\n if (node.type !== NodeType$1.Document && !node.rootId)\n node.rootId = rootId;\n if ('childNodes' in node) {\n node.childNodes.forEach((child) => {\n this.patchRootIdOnNode(child, rootId);\n });\n }\n }\n}\n\nclass ShadowDomManagerNoop {\n init() {\n }\n addShadowRoot() {\n }\n observeAttachShadow() {\n }\n reset() {\n }\n}\nclass ShadowDomManager {\n constructor(options) {\n this.shadowDoms = new WeakSet();\n this.restoreHandlers = [];\n this.mutationCb = options.mutationCb;\n this.scrollCb = options.scrollCb;\n this.bypassOptions = options.bypassOptions;\n this.mirror = options.mirror;\n this.init();\n }\n init() {\n this.reset();\n this.patchAttachShadow(Element, document);\n }\n addShadowRoot(shadowRoot, doc) {\n if (!isNativeShadowDom(shadowRoot))\n return;\n if (this.shadowDoms.has(shadowRoot))\n return;\n this.shadowDoms.add(shadowRoot);\n const observer = initMutationObserver({\n ...this.bypassOptions,\n doc,\n mutationCb: this.mutationCb,\n mirror: this.mirror,\n shadowDomManager: this,\n }, shadowRoot);\n this.restoreHandlers.push(() => observer.disconnect());\n this.restoreHandlers.push(initScrollObserver({\n ...this.bypassOptions,\n scrollCb: this.scrollCb,\n doc: shadowRoot,\n mirror: this.mirror,\n }));\n setTimeout(() => {\n if (shadowRoot.adoptedStyleSheets &&\n shadowRoot.adoptedStyleSheets.length > 0)\n this.bypassOptions.stylesheetManager.adoptStyleSheets(shadowRoot.adoptedStyleSheets, this.mirror.getId(shadowRoot.host));\n this.restoreHandlers.push(initAdoptedStyleSheetObserver({\n mirror: this.mirror,\n stylesheetManager: this.bypassOptions.stylesheetManager,\n }, shadowRoot));\n }, 0);\n }\n observeAttachShadow(iframeElement) {\n if (!iframeElement.contentWindow || !iframeElement.contentDocument)\n return;\n this.patchAttachShadow(iframeElement.contentWindow.Element, iframeElement.contentDocument);\n }\n patchAttachShadow(element, doc) {\n const manager = this;\n this.restoreHandlers.push(patch(element.prototype, 'attachShadow', function (original) {\n return function (option) {\n const shadowRoot = original.call(this, option);\n if (this.shadowRoot && inDom(this))\n manager.addShadowRoot(this.shadowRoot, doc);\n return shadowRoot;\n };\n }));\n }\n reset() {\n this.restoreHandlers.forEach((handler) => {\n try {\n handler();\n }\n catch (e) {\n }\n });\n this.restoreHandlers = [];\n this.shadowDoms = new WeakSet();\n }\n}\n\nclass CanvasManagerNoop {\n reset() {\n }\n freeze() {\n }\n unfreeze() {\n }\n lock() {\n }\n unlock() {\n }\n snapshot() {\n }\n}\n\nclass StylesheetManager {\n constructor(options) {\n this.trackedLinkElements = new WeakSet();\n this.styleMirror = new StyleSheetMirror();\n this.mutationCb = options.mutationCb;\n this.adoptedStyleSheetCb = options.adoptedStyleSheetCb;\n }\n attachLinkElement(linkEl, childSn) {\n if ('_cssText' in childSn.attributes)\n this.mutationCb({\n adds: [],\n removes: [],\n texts: [],\n attributes: [\n {\n id: childSn.id,\n attributes: childSn\n .attributes,\n },\n ],\n });\n this.trackLinkElement(linkEl);\n }\n trackLinkElement(linkEl) {\n if (this.trackedLinkElements.has(linkEl))\n return;\n this.trackedLinkElements.add(linkEl);\n this.trackStylesheetInLinkElement(linkEl);\n }\n adoptStyleSheets(sheets, hostId) {\n if (sheets.length === 0)\n return;\n const adoptedStyleSheetData = {\n id: hostId,\n styleIds: [],\n };\n const styles = [];\n for (const sheet of sheets) {\n let styleId;\n if (!this.styleMirror.has(sheet)) {\n styleId = this.styleMirror.add(sheet);\n styles.push({\n styleId,\n rules: Array.from(sheet.rules || CSSRule, (r, index) => ({\n rule: stringifyRule(r),\n index,\n })),\n });\n }\n else\n styleId = this.styleMirror.getId(sheet);\n adoptedStyleSheetData.styleIds.push(styleId);\n }\n if (styles.length > 0)\n adoptedStyleSheetData.styles = styles;\n this.adoptedStyleSheetCb(adoptedStyleSheetData);\n }\n reset() {\n this.styleMirror.reset();\n this.trackedLinkElements = new WeakSet();\n }\n trackStylesheetInLinkElement(linkEl) {\n }\n}\n\nclass ProcessedNodeManager {\n constructor() {\n this.nodeMap = new WeakMap();\n this.loop = true;\n this.periodicallyClear();\n }\n periodicallyClear() {\n onRequestAnimationFrame(() => {\n this.clear();\n if (this.loop)\n this.periodicallyClear();\n });\n }\n inOtherBuffer(node, thisBuffer) {\n const buffers = this.nodeMap.get(node);\n return (buffers && Array.from(buffers).some((buffer) => buffer !== thisBuffer));\n }\n add(node, buffer) {\n this.nodeMap.set(node, (this.nodeMap.get(node) || new Set()).add(buffer));\n }\n clear() {\n this.nodeMap = new WeakMap();\n }\n destroy() {\n this.loop = false;\n }\n}\n\nfunction wrapEvent(e) {\n const eWithTime = e;\n eWithTime.timestamp = nowTimestamp();\n return eWithTime;\n}\nlet _takeFullSnapshot;\nconst mirror = createMirror();\nfunction record(options = {}) {\n const { emit, checkoutEveryNms, checkoutEveryNth, blockClass = 'rr-block', blockSelector = null, unblockSelector = null, ignoreClass = 'rr-ignore', ignoreSelector = null, maskAllText = false, maskTextClass = 'rr-mask', unmaskTextClass = null, maskTextSelector = null, unmaskTextSelector = null, inlineStylesheet = true, maskAllInputs, maskInputOptions: _maskInputOptions, slimDOMOptions: _slimDOMOptions, maskAttributeFn, maskInputFn, maskTextFn, packFn, sampling = {}, dataURLOptions = {}, mousemoveWait, recordCanvas = false, recordCrossOriginIframes = false, recordAfter = options.recordAfter === 'DOMContentLoaded'\n ? options.recordAfter\n : 'load', userTriggeredOnInput = false, collectFonts = false, inlineImages = false, plugins, keepIframeSrcFn = () => false, ignoreCSSAttributes = new Set([]), errorHandler, onMutation, getCanvasManager, } = options;\n registerErrorHandler(errorHandler);\n const inEmittingFrame = recordCrossOriginIframes\n ? window.parent === window\n : true;\n let passEmitsToParent = false;\n if (!inEmittingFrame) {\n try {\n if (window.parent.document) {\n passEmitsToParent = false;\n }\n }\n catch (e) {\n passEmitsToParent = true;\n }\n }\n if (inEmittingFrame && !emit) {\n throw new Error('emit function is required');\n }\n if (mousemoveWait !== undefined && sampling.mousemove === undefined) {\n sampling.mousemove = mousemoveWait;\n }\n mirror.reset();\n const maskInputOptions = maskAllInputs === true\n ? {\n color: true,\n date: true,\n 'datetime-local': true,\n email: true,\n month: true,\n number: true,\n range: true,\n search: true,\n tel: true,\n text: true,\n time: true,\n url: true,\n week: true,\n textarea: true,\n select: true,\n radio: true,\n checkbox: true,\n }\n : _maskInputOptions !== undefined\n ? _maskInputOptions\n : {};\n const slimDOMOptions = _slimDOMOptions === true || _slimDOMOptions === 'all'\n ? {\n script: true,\n comment: true,\n headFavicon: true,\n headWhitespace: true,\n headMetaSocial: true,\n headMetaRobots: true,\n headMetaHttpEquiv: true,\n headMetaVerification: true,\n headMetaAuthorship: _slimDOMOptions === 'all',\n headMetaDescKeywords: _slimDOMOptions === 'all',\n }\n : _slimDOMOptions\n ? _slimDOMOptions\n : {};\n polyfill();\n let lastFullSnapshotEvent;\n let incrementalSnapshotCount = 0;\n const eventProcessor = (e) => {\n for (const plugin of plugins || []) {\n if (plugin.eventProcessor) {\n e = plugin.eventProcessor(e);\n }\n }\n if (packFn &&\n !passEmitsToParent) {\n e = packFn(e);\n }\n return e;\n };\n const wrappedEmit = (e, isCheckout) => {\n if (_optionalChain([mutationBuffers, 'access', _ => _[0], 'optionalAccess', _2 => _2.isFrozen, 'call', _3 => _3()]) &&\n e.type !== EventType.FullSnapshot &&\n !(e.type === EventType.IncrementalSnapshot &&\n e.data.source === IncrementalSource.Mutation)) {\n mutationBuffers.forEach((buf) => buf.unfreeze());\n }\n if (inEmittingFrame) {\n _optionalChain([emit, 'optionalCall', _4 => _4(eventProcessor(e), isCheckout)]);\n }\n else if (passEmitsToParent) {\n const message = {\n type: 'rrweb',\n event: eventProcessor(e),\n origin: window.location.origin,\n isCheckout,\n };\n window.parent.postMessage(message, '*');\n }\n if (e.type === EventType.FullSnapshot) {\n lastFullSnapshotEvent = e;\n incrementalSnapshotCount = 0;\n }\n else if (e.type === EventType.IncrementalSnapshot) {\n if (e.data.source === IncrementalSource.Mutation &&\n e.data.isAttachIframe) {\n return;\n }\n incrementalSnapshotCount++;\n const exceedCount = checkoutEveryNth && incrementalSnapshotCount >= checkoutEveryNth;\n const exceedTime = checkoutEveryNms &&\n e.timestamp - lastFullSnapshotEvent.timestamp > checkoutEveryNms;\n if (exceedCount || exceedTime) {\n takeFullSnapshot(true);\n }\n }\n };\n const wrappedMutationEmit = (m) => {\n wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.Mutation,\n ...m,\n },\n }));\n };\n const wrappedScrollEmit = (p) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.Scroll,\n ...p,\n },\n }));\n const wrappedCanvasMutationEmit = (p) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.CanvasMutation,\n ...p,\n },\n }));\n const wrappedAdoptedStyleSheetEmit = (a) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.AdoptedStyleSheet,\n ...a,\n },\n }));\n const stylesheetManager = new StylesheetManager({\n mutationCb: wrappedMutationEmit,\n adoptedStyleSheetCb: wrappedAdoptedStyleSheetEmit,\n });\n const iframeManager = typeof __RRWEB_EXCLUDE_IFRAME__ === 'boolean' && __RRWEB_EXCLUDE_IFRAME__\n ? new IframeManagerNoop()\n : new IframeManager({\n mirror,\n mutationCb: wrappedMutationEmit,\n stylesheetManager: stylesheetManager,\n recordCrossOriginIframes,\n wrappedEmit,\n });\n for (const plugin of plugins || []) {\n if (plugin.getMirror)\n plugin.getMirror({\n nodeMirror: mirror,\n crossOriginIframeMirror: iframeManager.crossOriginIframeMirror,\n crossOriginIframeStyleMirror: iframeManager.crossOriginIframeStyleMirror,\n });\n }\n const processedNodeManager = new ProcessedNodeManager();\n const canvasManager = _getCanvasManager(getCanvasManager, {\n mirror,\n win: window,\n mutationCb: (p) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.CanvasMutation,\n ...p,\n },\n })),\n recordCanvas,\n blockClass,\n blockSelector,\n unblockSelector,\n sampling: sampling['canvas'],\n dataURLOptions,\n });\n const shadowDomManager = typeof __RRWEB_EXCLUDE_SHADOW_DOM__ === 'boolean' &&\n __RRWEB_EXCLUDE_SHADOW_DOM__\n ? new ShadowDomManagerNoop()\n : new ShadowDomManager({\n mutationCb: wrappedMutationEmit,\n scrollCb: wrappedScrollEmit,\n bypassOptions: {\n onMutation,\n blockClass,\n blockSelector,\n unblockSelector,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n inlineStylesheet,\n maskInputOptions,\n dataURLOptions,\n maskAttributeFn,\n maskTextFn,\n maskInputFn,\n recordCanvas,\n inlineImages,\n sampling,\n slimDOMOptions,\n iframeManager,\n stylesheetManager,\n canvasManager,\n keepIframeSrcFn,\n processedNodeManager,\n },\n mirror,\n });\n const takeFullSnapshot = (isCheckout = false) => {\n wrappedEmit(wrapEvent({\n type: EventType.Meta,\n data: {\n href: window.location.href,\n width: getWindowWidth(),\n height: getWindowHeight(),\n },\n }), isCheckout);\n stylesheetManager.reset();\n shadowDomManager.init();\n mutationBuffers.forEach((buf) => buf.lock());\n const node = snapshot(document, {\n mirror,\n blockClass,\n blockSelector,\n unblockSelector,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n inlineStylesheet,\n maskAllInputs: maskInputOptions,\n maskAttributeFn,\n maskInputFn,\n maskTextFn,\n slimDOM: slimDOMOptions,\n dataURLOptions,\n recordCanvas,\n inlineImages,\n onSerialize: (n) => {\n if (isSerializedIframe(n, mirror)) {\n iframeManager.addIframe(n);\n }\n if (isSerializedStylesheet(n, mirror)) {\n stylesheetManager.trackLinkElement(n);\n }\n if (hasShadowRoot(n)) {\n shadowDomManager.addShadowRoot(n.shadowRoot, document);\n }\n },\n onIframeLoad: (iframe, childSn) => {\n iframeManager.attachIframe(iframe, childSn);\n shadowDomManager.observeAttachShadow(iframe);\n },\n onStylesheetLoad: (linkEl, childSn) => {\n stylesheetManager.attachLinkElement(linkEl, childSn);\n },\n keepIframeSrcFn,\n });\n if (!node) {\n return console.warn('Failed to snapshot the document');\n }\n wrappedEmit(wrapEvent({\n type: EventType.FullSnapshot,\n data: {\n node,\n initialOffset: getWindowScroll(window),\n },\n }));\n mutationBuffers.forEach((buf) => buf.unlock());\n if (document.adoptedStyleSheets && document.adoptedStyleSheets.length > 0)\n stylesheetManager.adoptStyleSheets(document.adoptedStyleSheets, mirror.getId(document));\n };\n _takeFullSnapshot = takeFullSnapshot;\n try {\n const handlers = [];\n const observe = (doc) => {\n return callbackWrapper(initObservers)({\n onMutation,\n mutationCb: wrappedMutationEmit,\n mousemoveCb: (positions, source) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source,\n positions,\n },\n })),\n mouseInteractionCb: (d) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.MouseInteraction,\n ...d,\n },\n })),\n scrollCb: wrappedScrollEmit,\n viewportResizeCb: (d) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.ViewportResize,\n ...d,\n },\n })),\n inputCb: (v) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.Input,\n ...v,\n },\n })),\n mediaInteractionCb: (p) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.MediaInteraction,\n ...p,\n },\n })),\n styleSheetRuleCb: (r) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.StyleSheetRule,\n ...r,\n },\n })),\n styleDeclarationCb: (r) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.StyleDeclaration,\n ...r,\n },\n })),\n canvasMutationCb: wrappedCanvasMutationEmit,\n fontCb: (p) => wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.Font,\n ...p,\n },\n })),\n selectionCb: (p) => {\n wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.Selection,\n ...p,\n },\n }));\n },\n customElementCb: (c) => {\n wrappedEmit(wrapEvent({\n type: EventType.IncrementalSnapshot,\n data: {\n source: IncrementalSource.CustomElement,\n ...c,\n },\n }));\n },\n blockClass,\n ignoreClass,\n ignoreSelector,\n maskAllText,\n maskTextClass,\n unmaskTextClass,\n maskTextSelector,\n unmaskTextSelector,\n maskInputOptions,\n inlineStylesheet,\n sampling,\n recordCanvas,\n inlineImages,\n userTriggeredOnInput,\n collectFonts,\n doc,\n maskAttributeFn,\n maskInputFn,\n maskTextFn,\n keepIframeSrcFn,\n blockSelector,\n unblockSelector,\n slimDOMOptions,\n dataURLOptions,\n mirror,\n iframeManager,\n stylesheetManager,\n shadowDomManager,\n processedNodeManager,\n canvasManager,\n ignoreCSSAttributes,\n plugins: _optionalChain([plugins\n, 'optionalAccess', _5 => _5.filter, 'call', _6 => _6((p) => p.observer)\n, 'optionalAccess', _7 => _7.map, 'call', _8 => _8((p) => ({\n observer: p.observer,\n options: p.options,\n callback: (payload) => wrappedEmit(wrapEvent({\n type: EventType.Plugin,\n data: {\n plugin: p.name,\n payload,\n },\n })),\n }))]) || [],\n }, {});\n };\n iframeManager.addLoadListener((iframeEl) => {\n try {\n handlers.push(observe(iframeEl.contentDocument));\n }\n catch (error) {\n console.warn(error);\n }\n });\n const init = () => {\n takeFullSnapshot();\n handlers.push(observe(document));\n };\n if (document.readyState === 'interactive' ||\n document.readyState === 'complete') {\n init();\n }\n else {\n handlers.push(on('DOMContentLoaded', () => {\n wrappedEmit(wrapEvent({\n type: EventType.DomContentLoaded,\n data: {},\n }));\n if (recordAfter === 'DOMContentLoaded')\n init();\n }));\n handlers.push(on('load', () => {\n wrappedEmit(wrapEvent({\n type: EventType.Load,\n data: {},\n }));\n if (recordAfter === 'load')\n init();\n }, window));\n }\n return () => {\n handlers.forEach((h) => h());\n processedNodeManager.destroy();\n _takeFullSnapshot = undefined;\n unregisterErrorHandler();\n };\n }\n catch (error) {\n console.warn(error);\n }\n}\nfunction takeFullSnapshot(isCheckout) {\n if (!_takeFullSnapshot) {\n throw new Error('please take full snapshot after start recording');\n }\n _takeFullSnapshot(isCheckout);\n}\nrecord.mirror = mirror;\nrecord.takeFullSnapshot = takeFullSnapshot;\nfunction _getCanvasManager(getCanvasManagerFn, options) {\n try {\n return getCanvasManagerFn\n ? getCanvasManagerFn(options)\n : new CanvasManagerNoop();\n }\n catch (e2) {\n console.warn('Unable to initialize CanvasManager');\n return new CanvasManagerNoop();\n }\n}\n\nconst ReplayEventTypeIncrementalSnapshot = 3;\nconst ReplayEventTypeCustom = 5;\n\n/**\n * Converts a timestamp to ms, if it was in s, or keeps it as ms.\n */\nfunction timestampToMs(timestamp) {\n const isMs = timestamp > 9999999999;\n return isMs ? timestamp : timestamp * 1000;\n}\n\n/**\n * Converts a timestamp to s, if it was in ms, or keeps it as s.\n */\nfunction timestampToS(timestamp) {\n const isMs = timestamp > 9999999999;\n return isMs ? timestamp / 1000 : timestamp;\n}\n\n/**\n * Add a breadcrumb event to replay.\n */\nfunction addBreadcrumbEvent(replay, breadcrumb) {\n if (breadcrumb.category === 'sentry.transaction') {\n return;\n }\n\n if (['ui.click', 'ui.input'].includes(breadcrumb.category )) {\n replay.triggerUserActivity();\n } else {\n replay.checkAndHandleExpiredSession();\n }\n\n replay.addUpdate(() => {\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n replay.throttledAddEvent({\n type: EventType.Custom,\n // TODO: We were converting from ms to seconds for breadcrumbs, spans,\n // but maybe we should just keep them as milliseconds\n timestamp: (breadcrumb.timestamp || 0) * 1000,\n data: {\n tag: 'breadcrumb',\n // normalize to max. 10 depth and 1_000 properties per object\n payload: normalize(breadcrumb, 10, 1000),\n },\n });\n\n // Do not flush after console log messages\n return breadcrumb.category === 'console';\n });\n}\n\nconst INTERACTIVE_SELECTOR = 'button,a';\n\n/** Get the closest interactive parent element, or else return the given element. */\nfunction getClosestInteractive(element) {\n const closestInteractive = element.closest(INTERACTIVE_SELECTOR);\n return closestInteractive || element;\n}\n\n/**\n * For clicks, we check if the target is inside of a button or link\n * If so, we use this as the target instead\n * This is useful because if you click on the image in ,\n * The target will be the image, not the button, which we don't want here\n */\nfunction getClickTargetNode(event) {\n const target = getTargetNode(event);\n\n if (!target || !(target instanceof Element)) {\n return target;\n }\n\n return getClosestInteractive(target);\n}\n\n/** Get the event target node. */\nfunction getTargetNode(event) {\n if (isEventWithTarget(event)) {\n return event.target ;\n }\n\n return event;\n}\n\nfunction isEventWithTarget(event) {\n return typeof event === 'object' && !!event && 'target' in event;\n}\n\nlet handlers;\n\n/**\n * Register a handler to be called when `window.open()` is called.\n * Returns a cleanup function.\n */\nfunction onWindowOpen(cb) {\n // Ensure to only register this once\n if (!handlers) {\n handlers = [];\n monkeyPatchWindowOpen();\n }\n\n handlers.push(cb);\n\n return () => {\n const pos = handlers ? handlers.indexOf(cb) : -1;\n if (pos > -1) {\n (handlers ).splice(pos, 1);\n }\n };\n}\n\nfunction monkeyPatchWindowOpen() {\n fill(WINDOW, 'open', function (originalWindowOpen) {\n return function (...args) {\n if (handlers) {\n try {\n handlers.forEach(handler => handler());\n } catch (e) {\n // ignore errors in here\n }\n }\n\n return originalWindowOpen.apply(WINDOW, args);\n };\n });\n}\n\n/** Handle a click. */\nfunction handleClick(clickDetector, clickBreadcrumb, node) {\n clickDetector.handleClick(clickBreadcrumb, node);\n}\n\n/** A click detector class that can be used to detect slow or rage clicks on elements. */\nclass ClickDetector {\n // protected for testing\n\n constructor(\n replay,\n slowClickConfig,\n // Just for easier testing\n _addBreadcrumbEvent = addBreadcrumbEvent,\n ) {\n this._lastMutation = 0;\n this._lastScroll = 0;\n this._clicks = [];\n\n // We want everything in s, but options are in ms\n this._timeout = slowClickConfig.timeout / 1000;\n this._threshold = slowClickConfig.threshold / 1000;\n this._scollTimeout = slowClickConfig.scrollTimeout / 1000;\n this._replay = replay;\n this._ignoreSelector = slowClickConfig.ignoreSelector;\n this._addBreadcrumbEvent = _addBreadcrumbEvent;\n }\n\n /** Register click detection handlers on mutation or scroll. */\n addListeners() {\n const cleanupWindowOpen = onWindowOpen(() => {\n // Treat window.open as mutation\n this._lastMutation = nowInSeconds();\n });\n\n this._teardown = () => {\n cleanupWindowOpen();\n\n this._clicks = [];\n this._lastMutation = 0;\n this._lastScroll = 0;\n };\n }\n\n /** Clean up listeners. */\n removeListeners() {\n if (this._teardown) {\n this._teardown();\n }\n\n if (this._checkClickTimeout) {\n clearTimeout(this._checkClickTimeout);\n }\n }\n\n /** @inheritDoc */\n handleClick(breadcrumb, node) {\n if (ignoreElement(node, this._ignoreSelector) || !isClickBreadcrumb(breadcrumb)) {\n return;\n }\n\n const newClick = {\n timestamp: timestampToS(breadcrumb.timestamp),\n clickBreadcrumb: breadcrumb,\n // Set this to 0 so we know it originates from the click breadcrumb\n clickCount: 0,\n node,\n };\n\n // If there was a click in the last 1s on the same element, ignore it - only keep a single reference per second\n if (\n this._clicks.some(click => click.node === newClick.node && Math.abs(click.timestamp - newClick.timestamp) < 1)\n ) {\n return;\n }\n\n this._clicks.push(newClick);\n\n // If this is the first new click, set a timeout to check for multi clicks\n if (this._clicks.length === 1) {\n this._scheduleCheckClicks();\n }\n }\n\n /** @inheritDoc */\n registerMutation(timestamp = Date.now()) {\n this._lastMutation = timestampToS(timestamp);\n }\n\n /** @inheritDoc */\n registerScroll(timestamp = Date.now()) {\n this._lastScroll = timestampToS(timestamp);\n }\n\n /** @inheritDoc */\n registerClick(element) {\n const node = getClosestInteractive(element);\n this._handleMultiClick(node );\n }\n\n /** Count multiple clicks on elements. */\n _handleMultiClick(node) {\n this._getClicks(node).forEach(click => {\n click.clickCount++;\n });\n }\n\n /** Get all pending clicks for a given node. */\n _getClicks(node) {\n return this._clicks.filter(click => click.node === node);\n }\n\n /** Check the clicks that happened. */\n _checkClicks() {\n const timedOutClicks = [];\n\n const now = nowInSeconds();\n\n this._clicks.forEach(click => {\n if (!click.mutationAfter && this._lastMutation) {\n click.mutationAfter = click.timestamp <= this._lastMutation ? this._lastMutation - click.timestamp : undefined;\n }\n if (!click.scrollAfter && this._lastScroll) {\n click.scrollAfter = click.timestamp <= this._lastScroll ? this._lastScroll - click.timestamp : undefined;\n }\n\n // All of these are in seconds!\n if (click.timestamp + this._timeout <= now) {\n timedOutClicks.push(click);\n }\n });\n\n // Remove \"old\" clicks\n for (const click of timedOutClicks) {\n const pos = this._clicks.indexOf(click);\n\n if (pos > -1) {\n this._generateBreadcrumbs(click);\n this._clicks.splice(pos, 1);\n }\n }\n\n // Trigger new check, unless no clicks left\n if (this._clicks.length) {\n this._scheduleCheckClicks();\n }\n }\n\n /** Generate matching breadcrumb(s) for the click. */\n _generateBreadcrumbs(click) {\n const replay = this._replay;\n const hadScroll = click.scrollAfter && click.scrollAfter <= this._scollTimeout;\n const hadMutation = click.mutationAfter && click.mutationAfter <= this._threshold;\n\n const isSlowClick = !hadScroll && !hadMutation;\n const { clickCount, clickBreadcrumb } = click;\n\n // Slow click\n if (isSlowClick) {\n // If `mutationAfter` is set, it means a mutation happened after the threshold, but before the timeout\n // If not, it means we just timed out without scroll & mutation\n const timeAfterClickMs = Math.min(click.mutationAfter || this._timeout, this._timeout) * 1000;\n const endReason = timeAfterClickMs < this._timeout * 1000 ? 'mutation' : 'timeout';\n\n const breadcrumb = {\n type: 'default',\n message: clickBreadcrumb.message,\n timestamp: clickBreadcrumb.timestamp,\n category: 'ui.slowClickDetected',\n data: {\n ...clickBreadcrumb.data,\n url: WINDOW.location.href,\n route: replay.getCurrentRoute(),\n timeAfterClickMs,\n endReason,\n // If clickCount === 0, it means multiClick was not correctly captured here\n // - we still want to send 1 in this case\n clickCount: clickCount || 1,\n },\n };\n\n this._addBreadcrumbEvent(replay, breadcrumb);\n return;\n }\n\n // Multi click\n if (clickCount > 1) {\n const breadcrumb = {\n type: 'default',\n message: clickBreadcrumb.message,\n timestamp: clickBreadcrumb.timestamp,\n category: 'ui.multiClick',\n data: {\n ...clickBreadcrumb.data,\n url: WINDOW.location.href,\n route: replay.getCurrentRoute(),\n clickCount,\n metric: true,\n },\n };\n\n this._addBreadcrumbEvent(replay, breadcrumb);\n }\n }\n\n /** Schedule to check current clicks. */\n _scheduleCheckClicks() {\n if (this._checkClickTimeout) {\n clearTimeout(this._checkClickTimeout);\n }\n\n this._checkClickTimeout = setTimeout(() => this._checkClicks(), 1000);\n }\n}\n\nconst SLOW_CLICK_TAGS = ['A', 'BUTTON', 'INPUT'];\n\n/** exported for tests only */\nfunction ignoreElement(node, ignoreSelector) {\n if (!SLOW_CLICK_TAGS.includes(node.tagName)) {\n return true;\n }\n\n // If tag, we only want to consider input[type='submit'] & input[type='button']\n if (node.tagName === 'INPUT' && !['submit', 'button'].includes(node.getAttribute('type') || '')) {\n return true;\n }\n\n // If tag, detect special variants that may not lead to an action\n // If target !== _self, we may open the link somewhere else, which would lead to no action\n // Also, when downloading a file, we may not leave the page, but still not trigger an action\n if (\n node.tagName === 'A' &&\n (node.hasAttribute('download') || (node.hasAttribute('target') && node.getAttribute('target') !== '_self'))\n ) {\n return true;\n }\n\n if (ignoreSelector && node.matches(ignoreSelector)) {\n return true;\n }\n\n return false;\n}\n\nfunction isClickBreadcrumb(breadcrumb) {\n return !!(breadcrumb.data && typeof breadcrumb.data.nodeId === 'number' && breadcrumb.timestamp);\n}\n\n// This is good enough for us, and is easier to test/mock than `timestampInSeconds`\nfunction nowInSeconds() {\n return Date.now() / 1000;\n}\n\n/** Update the click detector based on a recording event of rrweb. */\nfunction updateClickDetectorForRecordingEvent(clickDetector, event) {\n try {\n // note: We only consider incremental snapshots here\n // This means that any full snapshot is ignored for mutation detection - the reason is that we simply cannot know if a mutation happened here.\n // E.g. think that we are buffering, an error happens and we take a full snapshot because we switched to session mode -\n // in this scenario, we would not know if a dead click happened because of the error, which is a key dead click scenario.\n // Instead, by ignoring full snapshots, we have the risk that we generate a false positive\n // (if a mutation _did_ happen but was \"swallowed\" by the full snapshot)\n // But this should be more unlikely as we'd generally capture the incremental snapshot right away\n\n if (!isIncrementalEvent(event)) {\n return;\n }\n\n const { source } = event.data;\n if (source === IncrementalSource.Mutation) {\n clickDetector.registerMutation(event.timestamp);\n }\n\n if (source === IncrementalSource.Scroll) {\n clickDetector.registerScroll(event.timestamp);\n }\n\n if (isIncrementalMouseInteraction(event)) {\n const { type, id } = event.data;\n const node = record.mirror.getNode(id);\n\n if (node instanceof HTMLElement && type === MouseInteractions.Click) {\n clickDetector.registerClick(node);\n }\n }\n } catch (e) {\n // ignore errors here, e.g. if accessing something that does not exist\n }\n}\n\nfunction isIncrementalEvent(event) {\n return event.type === ReplayEventTypeIncrementalSnapshot;\n}\n\nfunction isIncrementalMouseInteraction(\n event,\n) {\n return event.data.source === IncrementalSource.MouseInteraction;\n}\n\n/**\n * Create a breadcrumb for a replay.\n */\nfunction createBreadcrumb(\n breadcrumb,\n) {\n return {\n timestamp: Date.now() / 1000,\n type: 'default',\n ...breadcrumb,\n };\n}\n\nvar NodeType;\n(function (NodeType) {\n NodeType[NodeType[\"Document\"] = 0] = \"Document\";\n NodeType[NodeType[\"DocumentType\"] = 1] = \"DocumentType\";\n NodeType[NodeType[\"Element\"] = 2] = \"Element\";\n NodeType[NodeType[\"Text\"] = 3] = \"Text\";\n NodeType[NodeType[\"CDATA\"] = 4] = \"CDATA\";\n NodeType[NodeType[\"Comment\"] = 5] = \"Comment\";\n})(NodeType || (NodeType = {}));\n\n// Note that these are the serialized attributes and not attributes directly on\n// the DOM Node. Attributes we are interested in:\nconst ATTRIBUTES_TO_RECORD = new Set([\n 'id',\n 'class',\n 'aria-label',\n 'role',\n 'name',\n 'alt',\n 'title',\n 'data-test-id',\n 'data-testid',\n 'disabled',\n 'aria-disabled',\n 'data-sentry-component',\n]);\n\n/**\n * Inclusion list of attributes that we want to record from the DOM element\n */\nfunction getAttributesToRecord(attributes) {\n const obj = {};\n for (const key in attributes) {\n if (ATTRIBUTES_TO_RECORD.has(key)) {\n let normalizedKey = key;\n\n if (key === 'data-testid' || key === 'data-test-id') {\n normalizedKey = 'testId';\n }\n\n obj[normalizedKey] = attributes[key];\n }\n }\n\n return obj;\n}\n\nconst handleDomListener = (\n replay,\n) => {\n return (handlerData) => {\n if (!replay.isEnabled()) {\n return;\n }\n\n const result = handleDom(handlerData);\n\n if (!result) {\n return;\n }\n\n const isClick = handlerData.name === 'click';\n const event = isClick ? (handlerData.event ) : undefined;\n // Ignore clicks if ctrl/alt/meta/shift keys are held down as they alter behavior of clicks (e.g. open in new tab)\n if (\n isClick &&\n replay.clickDetector &&\n event &&\n event.target &&\n !event.altKey &&\n !event.metaKey &&\n !event.ctrlKey &&\n !event.shiftKey\n ) {\n handleClick(\n replay.clickDetector,\n result ,\n getClickTargetNode(handlerData.event ) ,\n );\n }\n\n addBreadcrumbEvent(replay, result);\n };\n};\n\n/** Get the base DOM breadcrumb. */\nfunction getBaseDomBreadcrumb(target, message) {\n const nodeId = record.mirror.getId(target);\n const node = nodeId && record.mirror.getNode(nodeId);\n const meta = node && record.mirror.getMeta(node);\n const element = meta && isElement(meta) ? meta : null;\n\n return {\n message,\n data: element\n ? {\n nodeId,\n node: {\n id: nodeId,\n tagName: element.tagName,\n textContent: Array.from(element.childNodes)\n .map((node) => node.type === NodeType.Text && node.textContent)\n .filter(Boolean) // filter out empty values\n .map(text => (text ).trim())\n .join(''),\n attributes: getAttributesToRecord(element.attributes),\n },\n }\n : {},\n };\n}\n\n/**\n * An event handler to react to DOM events.\n * Exported for tests.\n */\nfunction handleDom(handlerData) {\n const { target, message } = getDomTarget(handlerData);\n\n return createBreadcrumb({\n category: `ui.${handlerData.name}`,\n ...getBaseDomBreadcrumb(target, message),\n });\n}\n\nfunction getDomTarget(handlerData) {\n const isClick = handlerData.name === 'click';\n\n let message;\n let target = null;\n\n // Accessing event.target can throw (see getsentry/raven-js#838, #768)\n try {\n target = isClick ? getClickTargetNode(handlerData.event ) : getTargetNode(handlerData.event );\n message = htmlTreeAsString(target, { maxStringLength: 200 }) || '';\n } catch (e) {\n message = '';\n }\n\n return { target, message };\n}\n\nfunction isElement(node) {\n return node.type === NodeType.Element;\n}\n\n/** Handle keyboard events & create breadcrumbs. */\nfunction handleKeyboardEvent(replay, event) {\n if (!replay.isEnabled()) {\n return;\n }\n\n // Update user activity, but do not restart recording as it can create\n // noisy/low-value replays (e.g. user comes back from idle, hits alt-tab, new\n // session with a single \"keydown\" breadcrumb is created)\n replay.updateUserActivity();\n\n const breadcrumb = getKeyboardBreadcrumb(event);\n\n if (!breadcrumb) {\n return;\n }\n\n addBreadcrumbEvent(replay, breadcrumb);\n}\n\n/** exported only for tests */\nfunction getKeyboardBreadcrumb(event) {\n const { metaKey, shiftKey, ctrlKey, altKey, key, target } = event;\n\n // never capture for input fields\n if (!target || isInputElement(target ) || !key) {\n return null;\n }\n\n // Note: We do not consider shift here, as that means \"uppercase\"\n const hasModifierKey = metaKey || ctrlKey || altKey;\n const isCharacterKey = key.length === 1; // other keys like Escape, Tab, etc have a longer length\n\n // Do not capture breadcrumb if only a word key is pressed\n // This could leak e.g. user input\n if (!hasModifierKey && isCharacterKey) {\n return null;\n }\n\n const message = htmlTreeAsString(target, { maxStringLength: 200 }) || '';\n const baseBreadcrumb = getBaseDomBreadcrumb(target , message);\n\n return createBreadcrumb({\n category: 'ui.keyDown',\n message,\n data: {\n ...baseBreadcrumb.data,\n metaKey,\n shiftKey,\n ctrlKey,\n altKey,\n key,\n },\n });\n}\n\nfunction isInputElement(target) {\n return target.tagName === 'INPUT' || target.tagName === 'TEXTAREA' || target.isContentEditable;\n}\n\n// Map entryType -> function to normalize data for event\nconst ENTRY_TYPES\n\n = {\n // @ts-expect-error TODO: entry type does not fit the create* functions entry type\n resource: createResourceEntry,\n paint: createPaintEntry,\n // @ts-expect-error TODO: entry type does not fit the create* functions entry type\n navigation: createNavigationEntry,\n};\n\n/**\n * Create replay performance entries from the browser performance entries.\n */\nfunction createPerformanceEntries(\n entries,\n) {\n return entries.map(createPerformanceEntry).filter(Boolean) ;\n}\n\nfunction createPerformanceEntry(entry) {\n if (!ENTRY_TYPES[entry.entryType]) {\n return null;\n }\n\n return ENTRY_TYPES[entry.entryType](entry);\n}\n\nfunction getAbsoluteTime(time) {\n // browserPerformanceTimeOrigin can be undefined if `performance` or\n // `performance.now` doesn't exist, but this is already checked by this integration\n return ((browserPerformanceTimeOrigin || WINDOW.performance.timeOrigin) + time) / 1000;\n}\n\nfunction createPaintEntry(entry) {\n const { duration, entryType, name, startTime } = entry;\n\n const start = getAbsoluteTime(startTime);\n return {\n type: entryType,\n name,\n start,\n end: start + duration,\n data: undefined,\n };\n}\n\nfunction createNavigationEntry(entry) {\n const {\n entryType,\n name,\n decodedBodySize,\n duration,\n domComplete,\n encodedBodySize,\n domContentLoadedEventStart,\n domContentLoadedEventEnd,\n domInteractive,\n loadEventStart,\n loadEventEnd,\n redirectCount,\n startTime,\n transferSize,\n type,\n } = entry;\n\n // Ignore entries with no duration, they do not seem to be useful and cause dupes\n if (duration === 0) {\n return null;\n }\n\n return {\n type: `${entryType}.${type}`,\n start: getAbsoluteTime(startTime),\n end: getAbsoluteTime(domComplete),\n name,\n data: {\n size: transferSize,\n decodedBodySize,\n encodedBodySize,\n duration,\n domInteractive,\n domContentLoadedEventStart,\n domContentLoadedEventEnd,\n loadEventStart,\n loadEventEnd,\n domComplete,\n redirectCount,\n },\n };\n}\n\nfunction createResourceEntry(\n entry,\n) {\n const {\n entryType,\n initiatorType,\n name,\n responseEnd,\n startTime,\n decodedBodySize,\n encodedBodySize,\n responseStatus,\n transferSize,\n } = entry;\n\n // Core SDK handles these\n if (['fetch', 'xmlhttprequest'].includes(initiatorType)) {\n return null;\n }\n\n return {\n type: `${entryType}.${initiatorType}`,\n start: getAbsoluteTime(startTime),\n end: getAbsoluteTime(responseEnd),\n name,\n data: {\n size: transferSize,\n statusCode: responseStatus,\n decodedBodySize,\n encodedBodySize,\n },\n };\n}\n\n/**\n * Add a LCP event to the replay based on an LCP metric.\n */\nfunction getLargestContentfulPaint(metric\n\n) {\n const entries = metric.entries;\n const lastEntry = entries[entries.length - 1] ;\n const element = lastEntry ? lastEntry.element : undefined;\n\n const value = metric.value;\n\n const end = getAbsoluteTime(value);\n\n const data = {\n type: 'largest-contentful-paint',\n name: 'largest-contentful-paint',\n start: end,\n end,\n data: {\n value,\n size: value,\n nodeId: element ? record.mirror.getId(element) : undefined,\n },\n };\n\n return data;\n}\n\n/**\n * Sets up a PerformanceObserver to listen to all performance entry types.\n * Returns a callback to stop observing.\n */\nfunction setupPerformanceObserver(replay) {\n function addPerformanceEntry(entry) {\n // It is possible for entries to come up multiple times\n if (!replay.performanceEntries.includes(entry)) {\n replay.performanceEntries.push(entry);\n }\n }\n\n function onEntries({ entries }) {\n entries.forEach(addPerformanceEntry);\n }\n\n const clearCallbacks = [];\n\n (['navigation', 'paint', 'resource'] ).forEach(type => {\n clearCallbacks.push(addPerformanceInstrumentationHandler(type, onEntries));\n });\n\n clearCallbacks.push(\n addLcpInstrumentationHandler(({ metric }) => {\n replay.replayPerformanceEntries.push(getLargestContentfulPaint(metric));\n }),\n );\n\n // A callback to cleanup all handlers\n return () => {\n clearCallbacks.forEach(clearCallback => clearCallback());\n };\n}\n\n/**\n * This serves as a build time flag that will be true by default, but false in non-debug builds or if users replace `__SENTRY_DEBUG__` in their generated code.\n *\n * ATTENTION: This constant must never cross package boundaries (i.e. be exported) to guarantee that it can be used for tree shaking.\n */\nconst DEBUG_BUILD = (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__);\n\nconst r = `var t=Uint8Array,n=Uint16Array,r=Int32Array,e=new t([0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0,0,0,0]),i=new t([0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,0,0]),a=new t([16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15]),s=function(t,e){for(var i=new n(31),a=0;a<31;++a)i[a]=e+=1<>1|(21845&c)<<1;v=(61680&(v=(52428&v)>>2|(13107&v)<<2))>>4|(3855&v)<<4,u[c]=((65280&v)>>8|(255&v)<<8)>>1}var d=function(t,r,e){for(var i=t.length,a=0,s=new n(r);a>h]=l}else for(o=new n(i),a=0;a>15-t[a]);return o},g=new t(288);for(c=0;c<144;++c)g[c]=8;for(c=144;c<256;++c)g[c]=9;for(c=256;c<280;++c)g[c]=7;for(c=280;c<288;++c)g[c]=8;var w=new t(32);for(c=0;c<32;++c)w[c]=5;var p=d(g,9,0),y=d(w,5,0),m=function(t){return(t+7)/8|0},b=function(n,r,e){return(null==r||r<0)&&(r=0),(null==e||e>n.length)&&(e=n.length),new t(n.subarray(r,e))},M=[\"unexpected EOF\",\"invalid block type\",\"invalid length/literal\",\"invalid distance\",\"stream finished\",\"no stream handler\",,\"no callback\",\"invalid UTF-8 data\",\"extra field too long\",\"date not in range 1980-2099\",\"filename too long\",\"stream finishing\",\"invalid zip data\"],E=function(t,n,r){var e=new Error(n||M[t]);if(e.code=t,Error.captureStackTrace&&Error.captureStackTrace(e,E),!r)throw e;return e},z=function(t,n,r){r<<=7&n;var e=n/8|0;t[e]|=r,t[e+1]|=r>>8},A=function(t,n,r){r<<=7&n;var e=n/8|0;t[e]|=r,t[e+1]|=r>>8,t[e+2]|=r>>16},_=function(r,e){for(var i=[],a=0;ad&&(d=o[a].s);var g=new n(d+1),w=x(i[c-1],g,0);if(w>e){a=0;var p=0,y=w-e,m=1<e))break;p+=m-(1<>=y;p>0;){var M=o[a].s;g[M]=0&&p;--a){var E=o[a].s;g[E]==e&&(--g[E],++p)}w=e}return{t:new t(g),l:w}},x=function(t,n,r){return-1==t.s?Math.max(x(t.l,n,r+1),x(t.r,n,r+1)):n[t.s]=r},D=function(t){for(var r=t.length;r&&!t[--r];);for(var e=new n(++r),i=0,a=t[0],s=1,o=function(t){e[i++]=t},f=1;f<=r;++f)if(t[f]==a&&f!=r)++s;else{if(!a&&s>2){for(;s>138;s-=138)o(32754);s>2&&(o(s>10?s-11<<5|28690:s-3<<5|12305),s=0)}else if(s>3){for(o(a),--s;s>6;s-=6)o(8304);s>2&&(o(s-3<<5|8208),s=0)}for(;s--;)o(a);s=1,a=t[f]}return{c:e.subarray(0,i),n:r}},T=function(t,n){for(var r=0,e=0;e>8,t[i+2]=255^t[i],t[i+3]=255^t[i+1];for(var a=0;a4&&!H[a[K-1]];--K);var N,P,Q,R,V=v+5<<3,W=T(f,g)+T(h,w)+l,X=T(f,M)+T(h,C)+l+14+3*K+T(q,H)+2*q[16]+3*q[17]+7*q[18];if(c>=0&&V<=W&&V<=X)return k(r,m,t.subarray(c,c+v));if(z(r,m,1+(X15&&(z(r,m,tt[B]>>5&127),m+=tt[B]>>12)}}}else N=p,P=g,Q=y,R=w;for(B=0;B255){A(r,m,N[(nt=rt>>18&31)+257]),m+=P[nt+257],nt>7&&(z(r,m,rt>>23&31),m+=e[nt]);var et=31&rt;A(r,m,Q[et]),m+=R[et],et>3&&(A(r,m,rt>>5&8191),m+=i[et])}else A(r,m,N[rt]),m+=P[rt]}return A(r,m,N[256]),m+P[256]},U=new r([65540,131080,131088,131104,262176,1048704,1048832,2114560,2117632]),F=new t(0),I=function(){for(var t=new Int32Array(256),n=0;n<256;++n){for(var r=n,e=9;--e;)r=(1&r&&-306674912)^r>>>1;t[n]=r}return t}(),S=function(){var t=1,n=0;return{p:function(r){for(var e=t,i=n,a=0|r.length,s=0;s!=a;){for(var o=Math.min(s+2655,a);s>16),i=(65535&i)+15*(i>>16)}t=e,n=i},d:function(){return(255&(t%=65521))<<24|(65280&t)<<8|(255&(n%=65521))<<8|n>>8}}},L=function(a,s,o,f,u){if(!u&&(u={l:1},s.dictionary)){var c=s.dictionary.subarray(-32768),v=new t(c.length+a.length);v.set(c),v.set(a,c.length),a=v,u.w=c.length}return function(a,s,o,f,u,c){var v=c.z||a.length,d=new t(f+v+5*(1+Math.ceil(v/7e3))+u),g=d.subarray(f,d.length-u),w=c.l,p=7&(c.r||0);if(s){p&&(g[0]=c.r>>3);for(var y=U[s-1],M=y>>13,E=8191&y,z=(1<7e3||q>24576)&&(N>423||!w)){p=C(a,g,0,F,I,S,O,q,G,j-G,p),q=L=O=0,G=j;for(var P=0;P<286;++P)I[P]=0;for(P=0;P<30;++P)S[P]=0}var Q=2,R=0,V=E,W=J-K&32767;if(N>2&&H==T(j-W))for(var X=Math.min(M,N)-1,Y=Math.min(32767,j),Z=Math.min(258,N);W<=Y&&--V&&J!=K;){if(a[j+Q]==a[j+Q-W]){for(var $=0;$Q){if(Q=$,R=W,$>X)break;var tt=Math.min(W,$-2),nt=0;for(P=0;Pnt&&(nt=et,K=rt)}}}W+=(J=K)-(K=A[J])&32767}if(R){F[q++]=268435456|h[Q]<<18|l[R];var it=31&h[Q],at=31&l[R];O+=e[it]+i[at],++I[257+it],++S[at],B=j+Q,++L}else F[q++]=a[j],++I[a[j]]}}for(j=Math.max(j,B);j=v&&(g[p/8|0]=w,st=v),p=k(g,p+1,a.subarray(j,st))}c.i=v}return b(d,0,f+m(p)+u)}(a,null==s.level?6:s.level,null==s.mem?Math.ceil(1.5*Math.max(8,Math.min(13,Math.log(a.length)))):12+s.mem,o,f,u)},O=function(t,n,r){for(;r;++n)t[n]=r,r>>>=8},j=function(){function n(n,r){if(\"function\"==typeof n&&(r=n,n={}),this.ondata=r,this.o=n||{},this.s={l:0,i:32768,w:32768,z:32768},this.b=new t(98304),this.o.dictionary){var e=this.o.dictionary.subarray(-32768);this.b.set(e,32768-e.length),this.s.i=32768-e.length}}return n.prototype.p=function(t,n){this.ondata(L(t,this.o,0,0,this.s),n)},n.prototype.push=function(n,r){this.ondata||E(5),this.s.l&&E(4);var e=n.length+this.s.z;if(e>this.b.length){if(e>2*this.b.length-32768){var i=new t(-32768&e);i.set(this.b.subarray(0,this.s.z)),this.b=i}var a=this.b.length-this.s.z;a&&(this.b.set(n.subarray(0,a),this.s.z),this.s.z=this.b.length,this.p(this.b,!1)),this.b.set(this.b.subarray(-32768)),this.b.set(n.subarray(a),32768),this.s.z=n.length-a+32768,this.s.i=32766,this.s.w=32768}else this.b.set(n,this.s.z),this.s.z+=n.length;this.s.l=1&r,(this.s.z>this.s.w+8191||r)&&(this.p(this.b,r||!1),this.s.w=this.s.i,this.s.i-=2)},n}();function q(t,n){n||(n={});var r=function(){var t=-1;return{p:function(n){for(var r=t,e=0;e>>8;t=r},d:function(){return~t}}}(),e=t.length;r.p(t);var i,a=L(t,n,10+((i=n).filename?i.filename.length+1:0),8),s=a.length;return function(t,n){var r=n.filename;if(t[0]=31,t[1]=139,t[2]=8,t[8]=n.level<2?4:9==n.level?2:0,t[9]=3,0!=n.mtime&&O(t,4,Math.floor(new Date(n.mtime||Date.now())/1e3)),r){t[3]=8;for(var e=0;e<=r.length;++e)t[e+10]=r.charCodeAt(e)}}(a,n),O(a,s-8,r.d()),O(a,s-4,e),a}var B=function(){function t(t,n){this.c=S(),this.v=1,j.call(this,t,n)}return t.prototype.push=function(t,n){this.c.p(t),j.prototype.push.call(this,t,n)},t.prototype.p=function(t,n){var r=L(t,this.o,this.v&&(this.o.dictionary?6:2),n&&4,this.s);this.v&&(function(t,n){var r=n.level,e=0==r?0:r<6?1:9==r?3:2;if(t[0]=120,t[1]=e<<6|(n.dictionary&&32),t[1]|=31-(t[0]<<8|t[1])%31,n.dictionary){var i=S();i.p(n.dictionary),O(t,2,i.d())}}(r,this.o),this.v=0),n&&O(r,r.length-4,this.c.d()),this.ondata(r,n)},t}(),G=\"undefined\"!=typeof TextEncoder&&new TextEncoder,H=\"undefined\"!=typeof TextDecoder&&new TextDecoder;try{H.decode(F,{stream:!0})}catch(t){}var J=function(){function t(t){this.ondata=t}return t.prototype.push=function(t,n){this.ondata||E(5),this.d&&E(4),this.ondata(K(t),this.d=n||!1)},t}();function K(n,r){if(r){for(var e=new t(n.length),i=0;i>1)),o=0,f=function(t){s[o++]=t};for(i=0;is.length){var h=new t(o+8+(a-i<<1));h.set(s),s=h}var l=n.charCodeAt(i);l<128||r?f(l):l<2048?(f(192|l>>6),f(128|63&l)):l>55295&&l<57344?(f(240|(l=65536+(1047552&l)|1023&n.charCodeAt(++i))>>18),f(128|l>>12&63),f(128|l>>6&63),f(128|63&l)):(f(224|l>>12),f(128|l>>6&63),f(128|63&l))}return b(s,0,o)}const N=new class{constructor(){this._init()}clear(){this._init()}addEvent(t){if(!t)throw new Error(\"Adding invalid event\");const n=this._hasEvents?\",\":\"\";this.stream.push(n+t),this._hasEvents=!0}finish(){this.stream.push(\"]\",!0);const t=function(t){let n=0;for(let r=0,e=t.length;r{this._deflatedData.push(t)},this.stream=new J(((t,n)=>{this.deflate.push(t,n)})),this.stream.push(\"[\")}},P={clear:()=>{N.clear()},addEvent:t=>N.addEvent(t),finish:()=>N.finish(),compress:t=>function(t){return q(K(t))}(t)};addEventListener(\"message\",(function(t){const n=t.data.method,r=t.data.id,e=t.data.arg;if(n in P&&\"function\"==typeof P[n])try{const t=P[n](e);postMessage({id:r,method:n,success:!0,response:t})}catch(t){postMessage({id:r,method:n,success:!1,response:t.message}),console.error(t)}})),postMessage({id:void 0,method:\"init\",success:!0,response:void 0});`;\n\nfunction e(){const e=new Blob([r]);return URL.createObjectURL(e)}\n\n/**\n * Log a message in debug mode, and add a breadcrumb when _experiment.traceInternals is enabled.\n */\nfunction logInfo(message, shouldAddBreadcrumb) {\n if (!DEBUG_BUILD) {\n return;\n }\n\n logger.info(message);\n\n if (shouldAddBreadcrumb) {\n addLogBreadcrumb(message);\n }\n}\n\n/**\n * Log a message, and add a breadcrumb in the next tick.\n * This is necessary when the breadcrumb may be added before the replay is initialized.\n */\nfunction logInfoNextTick(message, shouldAddBreadcrumb) {\n if (!DEBUG_BUILD) {\n return;\n }\n\n logger.info(message);\n\n if (shouldAddBreadcrumb) {\n // Wait a tick here to avoid race conditions for some initial logs\n // which may be added before replay is initialized\n setTimeout(() => {\n addLogBreadcrumb(message);\n }, 0);\n }\n}\n\nfunction addLogBreadcrumb(message) {\n addBreadcrumb(\n {\n category: 'console',\n data: {\n logger: 'replay',\n },\n level: 'info',\n message,\n },\n { level: 'info' },\n );\n}\n\n/** This error indicates that the event buffer size exceeded the limit.. */\nclass EventBufferSizeExceededError extends Error {\n constructor() {\n super(`Event buffer exceeded maximum size of ${REPLAY_MAX_EVENT_BUFFER_SIZE}.`);\n }\n}\n\n/**\n * A basic event buffer that does not do any compression.\n * Used as fallback if the compression worker cannot be loaded or is disabled.\n */\nclass EventBufferArray {\n /** All the events that are buffered to be sent. */\n\n /** @inheritdoc */\n\n constructor() {\n this.events = [];\n this._totalSize = 0;\n this.hasCheckout = false;\n }\n\n /** @inheritdoc */\n get hasEvents() {\n return this.events.length > 0;\n }\n\n /** @inheritdoc */\n get type() {\n return 'sync';\n }\n\n /** @inheritdoc */\n destroy() {\n this.events = [];\n }\n\n /** @inheritdoc */\n async addEvent(event) {\n const eventSize = JSON.stringify(event).length;\n this._totalSize += eventSize;\n if (this._totalSize > REPLAY_MAX_EVENT_BUFFER_SIZE) {\n throw new EventBufferSizeExceededError();\n }\n\n this.events.push(event);\n }\n\n /** @inheritdoc */\n finish() {\n return new Promise(resolve => {\n // Make a copy of the events array reference and immediately clear the\n // events member so that we do not lose new events while uploading\n // attachment.\n const eventsRet = this.events;\n this.clear();\n resolve(JSON.stringify(eventsRet));\n });\n }\n\n /** @inheritdoc */\n clear() {\n this.events = [];\n this._totalSize = 0;\n this.hasCheckout = false;\n }\n\n /** @inheritdoc */\n getEarliestTimestamp() {\n const timestamp = this.events.map(event => event.timestamp).sort()[0];\n\n if (!timestamp) {\n return null;\n }\n\n return timestampToMs(timestamp);\n }\n}\n\n/**\n * Event buffer that uses a web worker to compress events.\n * Exported only for testing.\n */\nclass WorkerHandler {\n\n constructor(worker) {\n this._worker = worker;\n this._id = 0;\n }\n\n /**\n * Ensure the worker is ready (or not).\n * This will either resolve when the worker is ready, or reject if an error occured.\n */\n ensureReady() {\n // Ensure we only check once\n if (this._ensureReadyPromise) {\n return this._ensureReadyPromise;\n }\n\n this._ensureReadyPromise = new Promise((resolve, reject) => {\n this._worker.addEventListener(\n 'message',\n ({ data }) => {\n if ((data ).success) {\n resolve();\n } else {\n reject();\n }\n },\n { once: true },\n );\n\n this._worker.addEventListener(\n 'error',\n error => {\n reject(error);\n },\n { once: true },\n );\n });\n\n return this._ensureReadyPromise;\n }\n\n /**\n * Destroy the worker.\n */\n destroy() {\n logInfo('[Replay] Destroying compression worker');\n this._worker.terminate();\n }\n\n /**\n * Post message to worker and wait for response before resolving promise.\n */\n postMessage(method, arg) {\n const id = this._getAndIncrementId();\n\n return new Promise((resolve, reject) => {\n const listener = ({ data }) => {\n const response = data ;\n if (response.method !== method) {\n return;\n }\n\n // There can be multiple listeners for a single method, the id ensures\n // that the response matches the caller.\n if (response.id !== id) {\n return;\n }\n\n // At this point, we'll always want to remove listener regardless of result status\n this._worker.removeEventListener('message', listener);\n\n if (!response.success) {\n // TODO: Do some error handling, not sure what\n DEBUG_BUILD && logger.error('[Replay]', response.response);\n\n reject(new Error('Error in compression worker'));\n return;\n }\n\n resolve(response.response );\n };\n\n // Note: we can't use `once` option because it's possible it needs to\n // listen to multiple messages\n this._worker.addEventListener('message', listener);\n this._worker.postMessage({ id, method, arg });\n });\n }\n\n /** Get the current ID and increment it for the next call. */\n _getAndIncrementId() {\n return this._id++;\n }\n}\n\n/**\n * Event buffer that uses a web worker to compress events.\n * Exported only for testing.\n */\nclass EventBufferCompressionWorker {\n /** @inheritdoc */\n\n constructor(worker) {\n this._worker = new WorkerHandler(worker);\n this._earliestTimestamp = null;\n this._totalSize = 0;\n this.hasCheckout = false;\n }\n\n /** @inheritdoc */\n get hasEvents() {\n return !!this._earliestTimestamp;\n }\n\n /** @inheritdoc */\n get type() {\n return 'worker';\n }\n\n /**\n * Ensure the worker is ready (or not).\n * This will either resolve when the worker is ready, or reject if an error occured.\n */\n ensureReady() {\n return this._worker.ensureReady();\n }\n\n /**\n * Destroy the event buffer.\n */\n destroy() {\n this._worker.destroy();\n }\n\n /**\n * Add an event to the event buffer.\n *\n * Returns true if event was successfuly received and processed by worker.\n */\n addEvent(event) {\n const timestamp = timestampToMs(event.timestamp);\n if (!this._earliestTimestamp || timestamp < this._earliestTimestamp) {\n this._earliestTimestamp = timestamp;\n }\n\n const data = JSON.stringify(event);\n this._totalSize += data.length;\n\n if (this._totalSize > REPLAY_MAX_EVENT_BUFFER_SIZE) {\n return Promise.reject(new EventBufferSizeExceededError());\n }\n\n return this._sendEventToWorker(data);\n }\n\n /**\n * Finish the event buffer and return the compressed data.\n */\n finish() {\n return this._finishRequest();\n }\n\n /** @inheritdoc */\n clear() {\n this._earliestTimestamp = null;\n this._totalSize = 0;\n this.hasCheckout = false;\n\n // We do not wait on this, as we assume the order of messages is consistent for the worker\n this._worker.postMessage('clear').then(null, e => {\n DEBUG_BUILD && logger.warn('[Replay] Sending \"clear\" message to worker failed', e);\n });\n }\n\n /** @inheritdoc */\n getEarliestTimestamp() {\n return this._earliestTimestamp;\n }\n\n /**\n * Send the event to the worker.\n */\n _sendEventToWorker(data) {\n return this._worker.postMessage('addEvent', data);\n }\n\n /**\n * Finish the request and return the compressed data from the worker.\n */\n async _finishRequest() {\n const response = await this._worker.postMessage('finish');\n\n this._earliestTimestamp = null;\n this._totalSize = 0;\n\n return response;\n }\n}\n\n/**\n * This proxy will try to use the compression worker, and fall back to use the simple buffer if an error occurs there.\n * This can happen e.g. if the worker cannot be loaded.\n * Exported only for testing.\n */\nclass EventBufferProxy {\n\n constructor(worker) {\n this._fallback = new EventBufferArray();\n this._compression = new EventBufferCompressionWorker(worker);\n this._used = this._fallback;\n\n this._ensureWorkerIsLoadedPromise = this._ensureWorkerIsLoaded();\n }\n\n /** @inheritdoc */\n get type() {\n return this._used.type;\n }\n\n /** @inheritDoc */\n get hasEvents() {\n return this._used.hasEvents;\n }\n\n /** @inheritdoc */\n get hasCheckout() {\n return this._used.hasCheckout;\n }\n /** @inheritdoc */\n set hasCheckout(value) {\n this._used.hasCheckout = value;\n }\n\n /** @inheritDoc */\n destroy() {\n this._fallback.destroy();\n this._compression.destroy();\n }\n\n /** @inheritdoc */\n clear() {\n return this._used.clear();\n }\n\n /** @inheritdoc */\n getEarliestTimestamp() {\n return this._used.getEarliestTimestamp();\n }\n\n /**\n * Add an event to the event buffer.\n *\n * Returns true if event was successfully added.\n */\n addEvent(event) {\n return this._used.addEvent(event);\n }\n\n /** @inheritDoc */\n async finish() {\n // Ensure the worker is loaded, so the sent event is compressed\n await this.ensureWorkerIsLoaded();\n\n return this._used.finish();\n }\n\n /** Ensure the worker has loaded. */\n ensureWorkerIsLoaded() {\n return this._ensureWorkerIsLoadedPromise;\n }\n\n /** Actually check if the worker has been loaded. */\n async _ensureWorkerIsLoaded() {\n try {\n await this._compression.ensureReady();\n } catch (error) {\n // If the worker fails to load, we fall back to the simple buffer.\n // Nothing more to do from our side here\n logInfo('[Replay] Failed to load the compression worker, falling back to simple buffer');\n return;\n }\n\n // Now we need to switch over the array buffer to the compression worker\n await this._switchToCompressionWorker();\n }\n\n /** Switch the used buffer to the compression worker. */\n async _switchToCompressionWorker() {\n const { events, hasCheckout } = this._fallback;\n\n const addEventPromises = [];\n for (const event of events) {\n addEventPromises.push(this._compression.addEvent(event));\n }\n\n this._compression.hasCheckout = hasCheckout;\n\n // We switch over to the new buffer immediately - any further events will be added\n // after the previously buffered ones\n this._used = this._compression;\n\n // Wait for original events to be re-added before resolving\n try {\n await Promise.all(addEventPromises);\n } catch (error) {\n DEBUG_BUILD && logger.warn('[Replay] Failed to add events when switching buffers.', error);\n }\n }\n}\n\n/**\n * Create an event buffer for replays.\n */\nfunction createEventBuffer({\n useCompression,\n workerUrl: customWorkerUrl,\n}) {\n if (\n useCompression &&\n // eslint-disable-next-line no-restricted-globals\n window.Worker\n ) {\n const worker = _loadWorker(customWorkerUrl);\n\n if (worker) {\n return worker;\n }\n }\n\n logInfo('[Replay] Using simple buffer');\n return new EventBufferArray();\n}\n\nfunction _loadWorker(customWorkerUrl) {\n try {\n const workerUrl = customWorkerUrl || _getWorkerUrl();\n\n if (!workerUrl) {\n return;\n }\n\n logInfo(`[Replay] Using compression worker${customWorkerUrl ? ` from ${customWorkerUrl}` : ''}`);\n const worker = new Worker(workerUrl);\n return new EventBufferProxy(worker);\n } catch (error) {\n logInfo('[Replay] Failed to create compression worker');\n // Fall back to use simple event buffer array\n }\n}\n\nfunction _getWorkerUrl() {\n if (typeof __SENTRY_EXCLUDE_REPLAY_WORKER__ === 'undefined' || !__SENTRY_EXCLUDE_REPLAY_WORKER__) {\n return e();\n }\n\n return '';\n}\n\n/** If sessionStorage is available. */\nfunction hasSessionStorage() {\n try {\n // This can throw, e.g. when being accessed in a sandboxed iframe\n return 'sessionStorage' in WINDOW && !!WINDOW.sessionStorage;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Removes the session from Session Storage and unsets session in replay instance\n */\nfunction clearSession(replay) {\n deleteSession();\n replay.session = undefined;\n}\n\n/**\n * Deletes a session from storage\n */\nfunction deleteSession() {\n if (!hasSessionStorage()) {\n return;\n }\n\n try {\n WINDOW.sessionStorage.removeItem(REPLAY_SESSION_KEY);\n } catch (e) {\n // Ignore potential SecurityError exceptions\n }\n}\n\n/**\n * Given a sample rate, returns true if replay should be sampled.\n *\n * 1.0 = 100% sampling\n * 0.0 = 0% sampling\n */\nfunction isSampled(sampleRate) {\n if (sampleRate === undefined) {\n return false;\n }\n\n // Math.random() returns a number in range of 0 to 1 (inclusive of 0, but not 1)\n return Math.random() < sampleRate;\n}\n\n/**\n * Get a session with defaults & applied sampling.\n */\nfunction makeSession(session) {\n const now = Date.now();\n const id = session.id || uuid4();\n // Note that this means we cannot set a started/lastActivity of `0`, but this should not be relevant outside of tests.\n const started = session.started || now;\n const lastActivity = session.lastActivity || now;\n const segmentId = session.segmentId || 0;\n const sampled = session.sampled;\n const previousSessionId = session.previousSessionId;\n\n return {\n id,\n started,\n lastActivity,\n segmentId,\n sampled,\n previousSessionId,\n };\n}\n\n/**\n * Save a session to session storage.\n */\nfunction saveSession(session) {\n if (!hasSessionStorage()) {\n return;\n }\n\n try {\n WINDOW.sessionStorage.setItem(REPLAY_SESSION_KEY, JSON.stringify(session));\n } catch (e) {\n // Ignore potential SecurityError exceptions\n }\n}\n\n/**\n * Get the sampled status for a session based on sample rates & current sampled status.\n */\nfunction getSessionSampleType(sessionSampleRate, allowBuffering) {\n return isSampled(sessionSampleRate) ? 'session' : allowBuffering ? 'buffer' : false;\n}\n\n/**\n * Create a new session, which in its current implementation is a Sentry event\n * that all replays will be saved to as attachments. Currently, we only expect\n * one of these Sentry events per \"replay session\".\n */\nfunction createSession(\n { sessionSampleRate, allowBuffering, stickySession = false },\n { previousSessionId } = {},\n) {\n const sampled = getSessionSampleType(sessionSampleRate, allowBuffering);\n const session = makeSession({\n sampled,\n previousSessionId,\n });\n\n if (stickySession) {\n saveSession(session);\n }\n\n return session;\n}\n\n/**\n * Fetches a session from storage\n */\nfunction fetchSession(traceInternals) {\n if (!hasSessionStorage()) {\n return null;\n }\n\n try {\n // This can throw if cookies are disabled\n const sessionStringFromStorage = WINDOW.sessionStorage.getItem(REPLAY_SESSION_KEY);\n\n if (!sessionStringFromStorage) {\n return null;\n }\n\n const sessionObj = JSON.parse(sessionStringFromStorage) ;\n\n logInfoNextTick('[Replay] Loading existing session', traceInternals);\n\n return makeSession(sessionObj);\n } catch (e) {\n return null;\n }\n}\n\n/**\n * Given an initial timestamp and an expiry duration, checks to see if current\n * time should be considered as expired.\n */\nfunction isExpired(\n initialTime,\n expiry,\n targetTime = +new Date(),\n) {\n // Always expired if < 0\n if (initialTime === null || expiry === undefined || expiry < 0) {\n return true;\n }\n\n // Never expires if == 0\n if (expiry === 0) {\n return false;\n }\n\n return initialTime + expiry <= targetTime;\n}\n\n/**\n * Checks to see if session is expired\n */\nfunction isSessionExpired(\n session,\n {\n maxReplayDuration,\n sessionIdleExpire,\n targetTime = Date.now(),\n },\n) {\n return (\n // First, check that maximum session length has not been exceeded\n isExpired(session.started, maxReplayDuration, targetTime) ||\n // check that the idle timeout has not been exceeded (i.e. user has\n // performed an action within the last `sessionIdleExpire` ms)\n isExpired(session.lastActivity, sessionIdleExpire, targetTime)\n );\n}\n\n/** If the session should be refreshed or not. */\nfunction shouldRefreshSession(\n session,\n { sessionIdleExpire, maxReplayDuration },\n) {\n // If not expired, all good, just keep the session\n if (!isSessionExpired(session, { sessionIdleExpire, maxReplayDuration })) {\n return false;\n }\n\n // If we are buffering & haven't ever flushed yet, always continue\n if (session.sampled === 'buffer' && session.segmentId === 0) {\n return false;\n }\n\n return true;\n}\n\n/**\n * Get or create a session, when initializing the replay.\n * Returns a session that may be unsampled.\n */\nfunction loadOrCreateSession(\n {\n traceInternals,\n sessionIdleExpire,\n maxReplayDuration,\n previousSessionId,\n }\n\n,\n sessionOptions,\n) {\n const existingSession = sessionOptions.stickySession && fetchSession(traceInternals);\n\n // No session exists yet, just create a new one\n if (!existingSession) {\n logInfoNextTick('[Replay] Creating new session', traceInternals);\n return createSession(sessionOptions, { previousSessionId });\n }\n\n if (!shouldRefreshSession(existingSession, { sessionIdleExpire, maxReplayDuration })) {\n return existingSession;\n }\n\n logInfoNextTick('[Replay] Session in sessionStorage is expired, creating new one...');\n return createSession(sessionOptions, { previousSessionId: existingSession.id });\n}\n\nfunction isCustomEvent(event) {\n return event.type === EventType.Custom;\n}\n\n/**\n * Add an event to the event buffer.\n * In contrast to `addEvent`, this does not return a promise & does not wait for the adding of the event to succeed/fail.\n * Instead this returns `true` if we tried to add the event, else false.\n * It returns `false` e.g. if we are paused, disabled, or out of the max replay duration.\n *\n * `isCheckout` is true if this is either the very first event, or an event triggered by `checkoutEveryNms`.\n */\nfunction addEventSync(replay, event, isCheckout) {\n if (!shouldAddEvent(replay, event)) {\n return false;\n }\n\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n _addEvent(replay, event, isCheckout);\n\n return true;\n}\n\n/**\n * Add an event to the event buffer.\n * Resolves to `null` if no event was added, else to `void`.\n *\n * `isCheckout` is true if this is either the very first event, or an event triggered by `checkoutEveryNms`.\n */\nfunction addEvent(\n replay,\n event,\n isCheckout,\n) {\n if (!shouldAddEvent(replay, event)) {\n return Promise.resolve(null);\n }\n\n return _addEvent(replay, event, isCheckout);\n}\n\nasync function _addEvent(\n replay,\n event,\n isCheckout,\n) {\n if (!replay.eventBuffer) {\n return null;\n }\n\n try {\n if (isCheckout && replay.recordingMode === 'buffer') {\n replay.eventBuffer.clear();\n }\n\n if (isCheckout) {\n replay.eventBuffer.hasCheckout = true;\n }\n\n const replayOptions = replay.getOptions();\n\n const eventAfterPossibleCallback = maybeApplyCallback(event, replayOptions.beforeAddRecordingEvent);\n\n if (!eventAfterPossibleCallback) {\n return;\n }\n\n return await replay.eventBuffer.addEvent(eventAfterPossibleCallback);\n } catch (error) {\n const reason = error && error instanceof EventBufferSizeExceededError ? 'addEventSizeExceeded' : 'addEvent';\n\n DEBUG_BUILD && logger.error(error);\n await replay.stop({ reason });\n\n const client = getClient();\n\n if (client) {\n client.recordDroppedEvent('internal_sdk_error', 'replay');\n }\n }\n}\n\n/** Exported only for tests. */\nfunction shouldAddEvent(replay, event) {\n if (!replay.eventBuffer || replay.isPaused() || !replay.isEnabled()) {\n return false;\n }\n\n const timestampInMs = timestampToMs(event.timestamp);\n\n // Throw out events that happen more than 5 minutes ago. This can happen if\n // page has been left open and idle for a long period of time and user\n // comes back to trigger a new session. The performance entries rely on\n // `performance.timeOrigin`, which is when the page first opened.\n if (timestampInMs + replay.timeouts.sessionIdlePause < Date.now()) {\n return false;\n }\n\n // Throw out events that are +60min from the initial timestamp\n if (timestampInMs > replay.getContext().initialTimestamp + replay.getOptions().maxReplayDuration) {\n logInfo(\n `[Replay] Skipping event with timestamp ${timestampInMs} because it is after maxReplayDuration`,\n replay.getOptions()._experiments.traceInternals,\n );\n return false;\n }\n\n return true;\n}\n\nfunction maybeApplyCallback(\n event,\n callback,\n) {\n try {\n if (typeof callback === 'function' && isCustomEvent(event)) {\n return callback(event);\n }\n } catch (error) {\n DEBUG_BUILD &&\n logger.error('[Replay] An error occured in the `beforeAddRecordingEvent` callback, skipping the event...', error);\n return null;\n }\n\n return event;\n}\n\n/** If the event is an error event */\nfunction isErrorEvent(event) {\n return !event.type;\n}\n\n/** If the event is a transaction event */\nfunction isTransactionEvent(event) {\n return event.type === 'transaction';\n}\n\n/** If the event is an replay event */\nfunction isReplayEvent(event) {\n return event.type === 'replay_event';\n}\n\n/** If the event is a feedback event */\nfunction isFeedbackEvent(event) {\n return event.type === 'feedback';\n}\n\n/**\n * Returns a listener to be added to `client.on('afterSendErrorEvent, listener)`.\n */\nfunction handleAfterSendEvent(replay) {\n // Custom transports may still be returning `Promise`, which means we cannot expect the status code to be available there\n // TODO (v8): remove this check as it will no longer be necessary\n const enforceStatusCode = isBaseTransportSend();\n\n return (event, sendResponse) => {\n if (!replay.isEnabled() || (!isErrorEvent(event) && !isTransactionEvent(event))) {\n return;\n }\n\n const statusCode = sendResponse && sendResponse.statusCode;\n\n // We only want to do stuff on successful error sending, otherwise you get error replays without errors attached\n // If not using the base transport, we allow `undefined` response (as a custom transport may not implement this correctly yet)\n // If we do use the base transport, we skip if we encountered an non-OK status code\n if (enforceStatusCode && (!statusCode || statusCode < 200 || statusCode >= 300)) {\n return;\n }\n\n if (isTransactionEvent(event)) {\n handleTransactionEvent(replay, event);\n return;\n }\n\n handleErrorEvent(replay, event);\n };\n}\n\nfunction handleTransactionEvent(replay, event) {\n const replayContext = replay.getContext();\n\n // Collect traceIds in _context regardless of `recordingMode`\n // In error mode, _context gets cleared on every checkout\n // We limit to max. 100 transactions linked\n if (event.contexts && event.contexts.trace && event.contexts.trace.trace_id && replayContext.traceIds.size < 100) {\n replayContext.traceIds.add(event.contexts.trace.trace_id );\n }\n}\n\nfunction handleErrorEvent(replay, event) {\n const replayContext = replay.getContext();\n\n // Add error to list of errorIds of replay. This is ok to do even if not\n // sampled because context will get reset at next checkout.\n // XXX: There is also a race condition where it's possible to capture an\n // error to Sentry before Replay SDK has loaded, but response returns after\n // it was loaded, and this gets called.\n // We limit to max. 100 errors linked\n if (event.event_id && replayContext.errorIds.size < 100) {\n replayContext.errorIds.add(event.event_id);\n }\n\n // If error event is tagged with replay id it means it was sampled (when in buffer mode)\n // Need to be very careful that this does not cause an infinite loop\n if (replay.recordingMode !== 'buffer' || !event.tags || !event.tags.replayId) {\n return;\n }\n\n const { beforeErrorSampling } = replay.getOptions();\n if (typeof beforeErrorSampling === 'function' && !beforeErrorSampling(event)) {\n return;\n }\n\n setTimeout(() => {\n // Capture current event buffer as new replay\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n replay.sendBufferedReplayOrFlush();\n });\n}\n\nfunction isBaseTransportSend() {\n const client = getClient();\n if (!client) {\n return false;\n }\n\n const transport = client.getTransport();\n if (!transport) {\n return false;\n }\n\n return (\n (transport.send ).__sentry__baseTransport__ || false\n );\n}\n\n/**\n * Returns a listener to be added to `client.on('afterSendErrorEvent, listener)`.\n */\nfunction handleBeforeSendEvent(replay) {\n return (event) => {\n if (!replay.isEnabled() || !isErrorEvent(event)) {\n return;\n }\n\n handleHydrationError(replay, event);\n };\n}\n\nfunction handleHydrationError(replay, event) {\n const exceptionValue = event.exception && event.exception.values && event.exception.values[0].value;\n if (typeof exceptionValue !== 'string') {\n return;\n }\n\n if (\n // Only matches errors in production builds of react-dom\n // Example https://reactjs.org/docs/error-decoder.html?invariant=423\n exceptionValue.match(/reactjs\\.org\\/docs\\/error-decoder\\.html\\?invariant=(418|419|422|423|425)/) ||\n // Development builds of react-dom\n // Error 1: Hydration failed because the initial UI does not match what was rendered on the server.\n // Error 2: Text content does not match server-rendered HTML. Warning: Text content did not match.\n exceptionValue.match(/(does not match server-rendered HTML|Hydration failed because)/i)\n ) {\n const breadcrumb = createBreadcrumb({\n category: 'replay.hydrate-error',\n });\n addBreadcrumbEvent(replay, breadcrumb);\n }\n}\n\n/**\n * Returns true if we think the given event is an error originating inside of rrweb.\n */\nfunction isRrwebError(event, hint) {\n if (event.type || !event.exception || !event.exception.values || !event.exception.values.length) {\n return false;\n }\n\n // @ts-expect-error this may be set by rrweb when it finds errors\n if (hint.originalException && hint.originalException.__rrweb__) {\n return true;\n }\n\n return false;\n}\n\n/**\n * Add a feedback breadcrumb event to replay.\n */\nfunction addFeedbackBreadcrumb(replay, event) {\n replay.triggerUserActivity();\n replay.addUpdate(() => {\n if (!event.timestamp) {\n // Ignore events that don't have timestamps (this shouldn't happen, more of a typing issue)\n // Return true here so that we don't flush\n return true;\n }\n\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n replay.throttledAddEvent({\n type: EventType.Custom,\n timestamp: event.timestamp * 1000,\n data: {\n timestamp: event.timestamp,\n tag: 'breadcrumb',\n payload: {\n category: 'sentry.feedback',\n data: {\n feedbackId: event.event_id,\n },\n },\n },\n });\n\n return false;\n });\n}\n\n/**\n * Determine if event should be sampled (only applies in buffer mode).\n * When an event is captured by `hanldleGlobalEvent`, when in buffer mode\n * we determine if we want to sample the error or not.\n */\nfunction shouldSampleForBufferEvent(replay, event) {\n if (replay.recordingMode !== 'buffer') {\n return false;\n }\n\n // ignore this error because otherwise we could loop indefinitely with\n // trying to capture replay and failing\n if (event.message === UNABLE_TO_SEND_REPLAY) {\n return false;\n }\n\n // Require the event to be an error event & to have an exception\n if (!event.exception || event.type) {\n return false;\n }\n\n return isSampled(replay.getOptions().errorSampleRate);\n}\n\n/**\n * Returns a listener to be added to `addEventProcessor(listener)`.\n */\nfunction handleGlobalEventListener(\n replay,\n includeAfterSendEventHandling = false,\n) {\n const afterSendHandler = includeAfterSendEventHandling ? handleAfterSendEvent(replay) : undefined;\n\n return Object.assign(\n (event, hint) => {\n // Do nothing if replay has been disabled\n if (!replay.isEnabled()) {\n return event;\n }\n\n if (isReplayEvent(event)) {\n // Replays have separate set of breadcrumbs, do not include breadcrumbs\n // from core SDK\n delete event.breadcrumbs;\n return event;\n }\n\n // We only want to handle errors, transactions, and feedbacks, nothing else\n if (!isErrorEvent(event) && !isTransactionEvent(event) && !isFeedbackEvent(event)) {\n return event;\n }\n\n // Ensure we do not add replay_id if the session is expired\n const isSessionActive = replay.checkAndHandleExpiredSession();\n if (!isSessionActive) {\n return event;\n }\n\n if (isFeedbackEvent(event)) {\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n replay.flush();\n event.contexts.feedback.replay_id = replay.getSessionId();\n // Add a replay breadcrumb for this piece of feedback\n addFeedbackBreadcrumb(replay, event);\n return event;\n }\n\n // Unless `captureExceptions` is enabled, we want to ignore errors coming from rrweb\n // As there can be a bunch of stuff going wrong in internals there, that we don't want to bubble up to users\n if (isRrwebError(event, hint) && !replay.getOptions()._experiments.captureExceptions) {\n DEBUG_BUILD && logger.log('[Replay] Ignoring error from rrweb internals', event);\n return null;\n }\n\n // When in buffer mode, we decide to sample here.\n // Later, in `handleAfterSendEvent`, if the replayId is set, we know that we sampled\n // And convert the buffer session to a full session\n const isErrorEventSampled = shouldSampleForBufferEvent(replay, event);\n\n // Tag errors if it has been sampled in buffer mode, or if it is session mode\n // Only tag transactions if in session mode\n const shouldTagReplayId = isErrorEventSampled || replay.recordingMode === 'session';\n\n if (shouldTagReplayId) {\n event.tags = { ...event.tags, replayId: replay.getSessionId() };\n }\n\n // In cases where a custom client is used that does not support the new hooks (yet),\n // we manually call this hook method here\n if (afterSendHandler) {\n // Pretend the error had a 200 response so we always capture it\n afterSendHandler(event, { statusCode: 200 });\n }\n\n return event;\n },\n { id: 'Replay' },\n );\n}\n\n/**\n * Create a \"span\" for each performance entry.\n */\nfunction createPerformanceSpans(\n replay,\n entries,\n) {\n return entries.map(({ type, start, end, name, data }) => {\n const response = replay.throttledAddEvent({\n type: EventType.Custom,\n timestamp: start,\n data: {\n tag: 'performanceSpan',\n payload: {\n op: type,\n description: name,\n startTimestamp: start,\n endTimestamp: end,\n data,\n },\n },\n });\n\n // If response is a string, it means its either THROTTLED or SKIPPED\n return typeof response === 'string' ? Promise.resolve(null) : response;\n });\n}\n\nfunction handleHistory(handlerData) {\n const { from, to } = handlerData;\n\n const now = Date.now() / 1000;\n\n return {\n type: 'navigation.push',\n start: now,\n end: now,\n name: to,\n data: {\n previous: from,\n },\n };\n}\n\n/**\n * Returns a listener to be added to `addHistoryInstrumentationHandler(listener)`.\n */\nfunction handleHistorySpanListener(replay) {\n return (handlerData) => {\n if (!replay.isEnabled()) {\n return;\n }\n\n const result = handleHistory(handlerData);\n\n if (result === null) {\n return;\n }\n\n // Need to collect visited URLs\n replay.getContext().urls.push(result.name);\n replay.triggerUserActivity();\n\n replay.addUpdate(() => {\n createPerformanceSpans(replay, [result]);\n // Returning false to flush\n return false;\n });\n };\n}\n\n/**\n * Check whether a given request URL should be filtered out. This is so we\n * don't log Sentry ingest requests.\n */\nfunction shouldFilterRequest(replay, url) {\n // If we enabled the `traceInternals` experiment, we want to trace everything\n if (DEBUG_BUILD && replay.getOptions()._experiments.traceInternals) {\n return false;\n }\n\n return isSentryRequestUrl(url, getClient());\n}\n\n/** Add a performance entry breadcrumb */\nfunction addNetworkBreadcrumb(\n replay,\n result,\n) {\n if (!replay.isEnabled()) {\n return;\n }\n\n if (result === null) {\n return;\n }\n\n if (shouldFilterRequest(replay, result.name)) {\n return;\n }\n\n replay.addUpdate(() => {\n createPerformanceSpans(replay, [result]);\n // Returning true will cause `addUpdate` to not flush\n // We do not want network requests to cause a flush. This will prevent\n // recurring/polling requests from keeping the replay session alive.\n return true;\n });\n}\n\n/** only exported for tests */\nfunction handleFetch(handlerData) {\n const { startTimestamp, endTimestamp, fetchData, response } = handlerData;\n\n if (!endTimestamp) {\n return null;\n }\n\n // This is only used as a fallback, so we know the body sizes are never set here\n const { method, url } = fetchData;\n\n return {\n type: 'resource.fetch',\n start: startTimestamp / 1000,\n end: endTimestamp / 1000,\n name: url,\n data: {\n method,\n statusCode: response ? (response ).status : undefined,\n },\n };\n}\n\n/**\n * Returns a listener to be added to `addFetchInstrumentationHandler(listener)`.\n */\nfunction handleFetchSpanListener(replay) {\n return (handlerData) => {\n if (!replay.isEnabled()) {\n return;\n }\n\n const result = handleFetch(handlerData);\n\n addNetworkBreadcrumb(replay, result);\n };\n}\n\n/** only exported for tests */\nfunction handleXhr(handlerData) {\n const { startTimestamp, endTimestamp, xhr } = handlerData;\n\n const sentryXhrData = xhr[SENTRY_XHR_DATA_KEY];\n\n if (!startTimestamp || !endTimestamp || !sentryXhrData) {\n return null;\n }\n\n // This is only used as a fallback, so we know the body sizes are never set here\n const { method, url, status_code: statusCode } = sentryXhrData;\n\n if (url === undefined) {\n return null;\n }\n\n return {\n type: 'resource.xhr',\n name: url,\n start: startTimestamp / 1000,\n end: endTimestamp / 1000,\n data: {\n method,\n statusCode,\n },\n };\n}\n\n/**\n * Returns a listener to be added to `addXhrInstrumentationHandler(listener)`.\n */\nfunction handleXhrSpanListener(replay) {\n return (handlerData) => {\n if (!replay.isEnabled()) {\n return;\n }\n\n const result = handleXhr(handlerData);\n\n addNetworkBreadcrumb(replay, result);\n };\n}\n\n/** Get the size of a body. */\nfunction getBodySize(\n body,\n textEncoder,\n) {\n if (!body) {\n return undefined;\n }\n\n try {\n if (typeof body === 'string') {\n return textEncoder.encode(body).length;\n }\n\n if (body instanceof URLSearchParams) {\n return textEncoder.encode(body.toString()).length;\n }\n\n if (body instanceof FormData) {\n const formDataStr = _serializeFormData(body);\n return textEncoder.encode(formDataStr).length;\n }\n\n if (body instanceof Blob) {\n return body.size;\n }\n\n if (body instanceof ArrayBuffer) {\n return body.byteLength;\n }\n\n // Currently unhandled types: ArrayBufferView, ReadableStream\n } catch (e) {\n // just return undefined\n }\n\n return undefined;\n}\n\n/** Convert a Content-Length header to number/undefined. */\nfunction parseContentLengthHeader(header) {\n if (!header) {\n return undefined;\n }\n\n const size = parseInt(header, 10);\n return isNaN(size) ? undefined : size;\n}\n\n/** Get the string representation of a body. */\nfunction getBodyString(body) {\n try {\n if (typeof body === 'string') {\n return [body];\n }\n\n if (body instanceof URLSearchParams) {\n return [body.toString()];\n }\n\n if (body instanceof FormData) {\n return [_serializeFormData(body)];\n }\n\n if (!body) {\n return [undefined];\n }\n } catch (e2) {\n DEBUG_BUILD && logger.warn('[Replay] Failed to serialize body', body);\n return [undefined, 'BODY_PARSE_ERROR'];\n }\n\n DEBUG_BUILD && logger.info('[Replay] Skipping network body because of body type', body);\n\n return [undefined, 'UNPARSEABLE_BODY_TYPE'];\n}\n\n/** Merge a warning into an existing network request/response. */\nfunction mergeWarning(\n info,\n warning,\n) {\n if (!info) {\n return {\n headers: {},\n size: undefined,\n _meta: {\n warnings: [warning],\n },\n };\n }\n\n const newMeta = { ...info._meta };\n const existingWarnings = newMeta.warnings || [];\n newMeta.warnings = [...existingWarnings, warning];\n\n info._meta = newMeta;\n return info;\n}\n\n/** Convert ReplayNetworkRequestData to a PerformanceEntry. */\nfunction makeNetworkReplayBreadcrumb(\n type,\n data,\n) {\n if (!data) {\n return null;\n }\n\n const { startTimestamp, endTimestamp, url, method, statusCode, request, response } = data;\n\n const result = {\n type,\n start: startTimestamp / 1000,\n end: endTimestamp / 1000,\n name: url,\n data: dropUndefinedKeys({\n method,\n statusCode,\n request,\n response,\n }),\n };\n\n return result;\n}\n\n/** Build the request or response part of a replay network breadcrumb that was skipped. */\nfunction buildSkippedNetworkRequestOrResponse(bodySize) {\n return {\n headers: {},\n size: bodySize,\n _meta: {\n warnings: ['URL_SKIPPED'],\n },\n };\n}\n\n/** Build the request or response part of a replay network breadcrumb. */\nfunction buildNetworkRequestOrResponse(\n headers,\n bodySize,\n body,\n) {\n if (!bodySize && Object.keys(headers).length === 0) {\n return undefined;\n }\n\n if (!bodySize) {\n return {\n headers,\n };\n }\n\n if (!body) {\n return {\n headers,\n size: bodySize,\n };\n }\n\n const info = {\n headers,\n size: bodySize,\n };\n\n const { body: normalizedBody, warnings } = normalizeNetworkBody(body);\n info.body = normalizedBody;\n if (warnings && warnings.length > 0) {\n info._meta = {\n warnings,\n };\n }\n\n return info;\n}\n\n/** Filter a set of headers */\nfunction getAllowedHeaders(headers, allowedHeaders) {\n return Object.keys(headers).reduce((filteredHeaders, key) => {\n const normalizedKey = key.toLowerCase();\n // Avoid putting empty strings into the headers\n if (allowedHeaders.includes(normalizedKey) && headers[key]) {\n filteredHeaders[normalizedKey] = headers[key];\n }\n return filteredHeaders;\n }, {});\n}\n\nfunction _serializeFormData(formData) {\n // This is a bit simplified, but gives us a decent estimate\n // This converts e.g. { name: 'Anne Smith', age: 13 } to 'name=Anne+Smith&age=13'\n // @ts-expect-error passing FormData to URLSearchParams actually works\n return new URLSearchParams(formData).toString();\n}\n\nfunction normalizeNetworkBody(body)\n\n {\n if (!body || typeof body !== 'string') {\n return {\n body,\n };\n }\n\n const exceedsSizeLimit = body.length > NETWORK_BODY_MAX_SIZE;\n const isProbablyJson = _strIsProbablyJson(body);\n\n if (exceedsSizeLimit) {\n const truncatedBody = body.slice(0, NETWORK_BODY_MAX_SIZE);\n\n if (isProbablyJson) {\n return {\n body: truncatedBody,\n warnings: ['MAYBE_JSON_TRUNCATED'],\n };\n }\n\n return {\n body: `${truncatedBody}…`,\n warnings: ['TEXT_TRUNCATED'],\n };\n }\n\n if (isProbablyJson) {\n try {\n const jsonBody = JSON.parse(body);\n return {\n body: jsonBody,\n };\n } catch (e3) {\n // fall back to just send the body as string\n }\n }\n\n return {\n body,\n };\n}\n\nfunction _strIsProbablyJson(str) {\n const first = str[0];\n const last = str[str.length - 1];\n\n // Simple check: If this does not start & end with {} or [], it's not JSON\n return (first === '[' && last === ']') || (first === '{' && last === '}');\n}\n\n/** Match an URL against a list of strings/Regex. */\nfunction urlMatches(url, urls) {\n const fullUrl = getFullUrl(url);\n\n return stringMatchesSomePattern(fullUrl, urls);\n}\n\n/** exported for tests */\nfunction getFullUrl(url, baseURI = WINDOW.document.baseURI) {\n // Short circuit for common cases:\n if (url.startsWith('http://') || url.startsWith('https://') || url.startsWith(WINDOW.location.origin)) {\n return url;\n }\n const fixedUrl = new URL(url, baseURI);\n\n // If these do not match, we are not dealing with a relative URL, so just return it\n if (fixedUrl.origin !== new URL(baseURI).origin) {\n return url;\n }\n\n const fullUrl = fixedUrl.href;\n\n // Remove trailing slashes, if they don't match the original URL\n if (!url.endsWith('/') && fullUrl.endsWith('/')) {\n return fullUrl.slice(0, -1);\n }\n\n return fullUrl;\n}\n\n/**\n * Capture a fetch breadcrumb to a replay.\n * This adds additional data (where approriate).\n */\nasync function captureFetchBreadcrumbToReplay(\n breadcrumb,\n hint,\n options\n\n,\n) {\n try {\n const data = await _prepareFetchData(breadcrumb, hint, options);\n\n // Create a replay performance entry from this breadcrumb\n const result = makeNetworkReplayBreadcrumb('resource.fetch', data);\n addNetworkBreadcrumb(options.replay, result);\n } catch (error) {\n DEBUG_BUILD && logger.error('[Replay] Failed to capture fetch breadcrumb', error);\n }\n}\n\n/**\n * Enrich a breadcrumb with additional data.\n * This has to be sync & mutate the given breadcrumb,\n * as the breadcrumb is afterwards consumed by other handlers.\n */\nfunction enrichFetchBreadcrumb(\n breadcrumb,\n hint,\n options,\n) {\n const { input, response } = hint;\n\n const body = input ? _getFetchRequestArgBody(input) : undefined;\n const reqSize = getBodySize(body, options.textEncoder);\n\n const resSize = response ? parseContentLengthHeader(response.headers.get('content-length')) : undefined;\n\n if (reqSize !== undefined) {\n breadcrumb.data.request_body_size = reqSize;\n }\n if (resSize !== undefined) {\n breadcrumb.data.response_body_size = resSize;\n }\n}\n\nasync function _prepareFetchData(\n breadcrumb,\n hint,\n options\n\n,\n) {\n const now = Date.now();\n const { startTimestamp = now, endTimestamp = now } = hint;\n\n const {\n url,\n method,\n status_code: statusCode = 0,\n request_body_size: requestBodySize,\n response_body_size: responseBodySize,\n } = breadcrumb.data;\n\n const captureDetails =\n urlMatches(url, options.networkDetailAllowUrls) && !urlMatches(url, options.networkDetailDenyUrls);\n\n const request = captureDetails\n ? _getRequestInfo(options, hint.input, requestBodySize)\n : buildSkippedNetworkRequestOrResponse(requestBodySize);\n const response = await _getResponseInfo(captureDetails, options, hint.response, responseBodySize);\n\n return {\n startTimestamp,\n endTimestamp,\n url,\n method,\n statusCode,\n request,\n response,\n };\n}\n\nfunction _getRequestInfo(\n { networkCaptureBodies, networkRequestHeaders },\n input,\n requestBodySize,\n) {\n const headers = input ? getRequestHeaders(input, networkRequestHeaders) : {};\n\n if (!networkCaptureBodies) {\n return buildNetworkRequestOrResponse(headers, requestBodySize, undefined);\n }\n\n // We only want to transmit string or string-like bodies\n const requestBody = _getFetchRequestArgBody(input);\n const [bodyStr, warning] = getBodyString(requestBody);\n const data = buildNetworkRequestOrResponse(headers, requestBodySize, bodyStr);\n\n if (warning) {\n return mergeWarning(data, warning);\n }\n\n return data;\n}\n\n/** Exported only for tests. */\nasync function _getResponseInfo(\n captureDetails,\n {\n networkCaptureBodies,\n textEncoder,\n networkResponseHeaders,\n }\n\n,\n response,\n responseBodySize,\n) {\n if (!captureDetails && responseBodySize !== undefined) {\n return buildSkippedNetworkRequestOrResponse(responseBodySize);\n }\n\n const headers = response ? getAllHeaders(response.headers, networkResponseHeaders) : {};\n\n if (!response || (!networkCaptureBodies && responseBodySize !== undefined)) {\n return buildNetworkRequestOrResponse(headers, responseBodySize, undefined);\n }\n\n const [bodyText, warning] = await _parseFetchResponseBody(response);\n const result = getResponseData(bodyText, {\n networkCaptureBodies,\n textEncoder,\n responseBodySize,\n captureDetails,\n headers,\n });\n\n if (warning) {\n return mergeWarning(result, warning);\n }\n\n return result;\n}\n\nfunction getResponseData(\n bodyText,\n {\n networkCaptureBodies,\n textEncoder,\n responseBodySize,\n captureDetails,\n headers,\n }\n\n,\n) {\n try {\n const size =\n bodyText && bodyText.length && responseBodySize === undefined\n ? getBodySize(bodyText, textEncoder)\n : responseBodySize;\n\n if (!captureDetails) {\n return buildSkippedNetworkRequestOrResponse(size);\n }\n\n if (networkCaptureBodies) {\n return buildNetworkRequestOrResponse(headers, size, bodyText);\n }\n\n return buildNetworkRequestOrResponse(headers, size, undefined);\n } catch (error) {\n DEBUG_BUILD && logger.warn('[Replay] Failed to serialize response body', error);\n // fallback\n return buildNetworkRequestOrResponse(headers, responseBodySize, undefined);\n }\n}\n\nasync function _parseFetchResponseBody(response) {\n const res = _tryCloneResponse(response);\n\n if (!res) {\n return [undefined, 'BODY_PARSE_ERROR'];\n }\n\n try {\n const text = await _tryGetResponseText(res);\n return [text];\n } catch (error) {\n DEBUG_BUILD && logger.warn('[Replay] Failed to get text body from response', error);\n return [undefined, 'BODY_PARSE_ERROR'];\n }\n}\n\nfunction _getFetchRequestArgBody(fetchArgs = []) {\n // We only support getting the body from the fetch options\n if (fetchArgs.length !== 2 || typeof fetchArgs[1] !== 'object') {\n return undefined;\n }\n\n return (fetchArgs[1] ).body;\n}\n\nfunction getAllHeaders(headers, allowedHeaders) {\n const allHeaders = {};\n\n allowedHeaders.forEach(header => {\n if (headers.get(header)) {\n allHeaders[header] = headers.get(header) ;\n }\n });\n\n return allHeaders;\n}\n\nfunction getRequestHeaders(fetchArgs, allowedHeaders) {\n if (fetchArgs.length === 1 && typeof fetchArgs[0] !== 'string') {\n return getHeadersFromOptions(fetchArgs[0] , allowedHeaders);\n }\n\n if (fetchArgs.length === 2) {\n return getHeadersFromOptions(fetchArgs[1] , allowedHeaders);\n }\n\n return {};\n}\n\nfunction getHeadersFromOptions(\n input,\n allowedHeaders,\n) {\n if (!input) {\n return {};\n }\n\n const headers = input.headers;\n\n if (!headers) {\n return {};\n }\n\n if (headers instanceof Headers) {\n return getAllHeaders(headers, allowedHeaders);\n }\n\n // We do not support this, as it is not really documented (anymore?)\n if (Array.isArray(headers)) {\n return {};\n }\n\n return getAllowedHeaders(headers, allowedHeaders);\n}\n\nfunction _tryCloneResponse(response) {\n try {\n // We have to clone this, as the body can only be read once\n return response.clone();\n } catch (error) {\n // this can throw if the response was already consumed before\n DEBUG_BUILD && logger.warn('[Replay] Failed to clone response body', error);\n }\n}\n\n/**\n * Get the response body of a fetch request, or timeout after 500ms.\n * Fetch can return a streaming body, that may not resolve (or not for a long time).\n * If that happens, we rather abort after a short time than keep waiting for this.\n */\nfunction _tryGetResponseText(response) {\n return new Promise((resolve, reject) => {\n const timeout = setTimeout(() => reject(new Error('Timeout while trying to read response body')), 500);\n\n _getResponseText(response)\n .then(\n txt => resolve(txt),\n reason => reject(reason),\n )\n .finally(() => clearTimeout(timeout));\n });\n}\n\nasync function _getResponseText(response) {\n // Force this to be a promise, just to be safe\n // eslint-disable-next-line no-return-await\n return await response.text();\n}\n\n/**\n * Capture an XHR breadcrumb to a replay.\n * This adds additional data (where approriate).\n */\nasync function captureXhrBreadcrumbToReplay(\n breadcrumb,\n hint,\n options,\n) {\n try {\n const data = _prepareXhrData(breadcrumb, hint, options);\n\n // Create a replay performance entry from this breadcrumb\n const result = makeNetworkReplayBreadcrumb('resource.xhr', data);\n addNetworkBreadcrumb(options.replay, result);\n } catch (error) {\n DEBUG_BUILD && logger.error('[Replay] Failed to capture xhr breadcrumb', error);\n }\n}\n\n/**\n * Enrich a breadcrumb with additional data.\n * This has to be sync & mutate the given breadcrumb,\n * as the breadcrumb is afterwards consumed by other handlers.\n */\nfunction enrichXhrBreadcrumb(\n breadcrumb,\n hint,\n options,\n) {\n const { xhr, input } = hint;\n\n if (!xhr) {\n return;\n }\n\n const reqSize = getBodySize(input, options.textEncoder);\n const resSize = xhr.getResponseHeader('content-length')\n ? parseContentLengthHeader(xhr.getResponseHeader('content-length'))\n : _getBodySize(xhr.response, xhr.responseType, options.textEncoder);\n\n if (reqSize !== undefined) {\n breadcrumb.data.request_body_size = reqSize;\n }\n if (resSize !== undefined) {\n breadcrumb.data.response_body_size = resSize;\n }\n}\n\nfunction _prepareXhrData(\n breadcrumb,\n hint,\n options,\n) {\n const now = Date.now();\n const { startTimestamp = now, endTimestamp = now, input, xhr } = hint;\n\n const {\n url,\n method,\n status_code: statusCode = 0,\n request_body_size: requestBodySize,\n response_body_size: responseBodySize,\n } = breadcrumb.data;\n\n if (!url) {\n return null;\n }\n\n if (!xhr || !urlMatches(url, options.networkDetailAllowUrls) || urlMatches(url, options.networkDetailDenyUrls)) {\n const request = buildSkippedNetworkRequestOrResponse(requestBodySize);\n const response = buildSkippedNetworkRequestOrResponse(responseBodySize);\n return {\n startTimestamp,\n endTimestamp,\n url,\n method,\n statusCode,\n request,\n response,\n };\n }\n\n const xhrInfo = xhr[SENTRY_XHR_DATA_KEY];\n const networkRequestHeaders = xhrInfo\n ? getAllowedHeaders(xhrInfo.request_headers, options.networkRequestHeaders)\n : {};\n const networkResponseHeaders = getAllowedHeaders(getResponseHeaders(xhr), options.networkResponseHeaders);\n\n const [requestBody, requestWarning] = options.networkCaptureBodies ? getBodyString(input) : [undefined];\n const [responseBody, responseWarning] = options.networkCaptureBodies ? _getXhrResponseBody(xhr) : [undefined];\n\n const request = buildNetworkRequestOrResponse(networkRequestHeaders, requestBodySize, requestBody);\n const response = buildNetworkRequestOrResponse(networkResponseHeaders, responseBodySize, responseBody);\n\n return {\n startTimestamp,\n endTimestamp,\n url,\n method,\n statusCode,\n request: requestWarning ? mergeWarning(request, requestWarning) : request,\n response: responseWarning ? mergeWarning(response, responseWarning) : response,\n };\n}\n\nfunction getResponseHeaders(xhr) {\n const headers = xhr.getAllResponseHeaders();\n\n if (!headers) {\n return {};\n }\n\n return headers.split('\\r\\n').reduce((acc, line) => {\n const [key, value] = line.split(': ');\n acc[key.toLowerCase()] = value;\n return acc;\n }, {});\n}\n\nfunction _getXhrResponseBody(xhr) {\n // We collect errors that happen, but only log them if we can't get any response body\n const errors = [];\n\n try {\n return [xhr.responseText];\n } catch (e) {\n errors.push(e);\n }\n\n // Try to manually parse the response body, if responseText fails\n try {\n return _parseXhrResponse(xhr.response, xhr.responseType);\n } catch (e) {\n errors.push(e);\n }\n\n DEBUG_BUILD && logger.warn('[Replay] Failed to get xhr response body', ...errors);\n\n return [undefined];\n}\n\n/**\n * Get the string representation of the XHR response.\n * Based on MDN, these are the possible types of the response:\n * string\n * ArrayBuffer\n * Blob\n * Document\n * POJO\n *\n * Exported only for tests.\n */\nfunction _parseXhrResponse(\n body,\n responseType,\n) {\n try {\n if (typeof body === 'string') {\n return [body];\n }\n\n if (body instanceof Document) {\n return [body.body.outerHTML];\n }\n\n if (responseType === 'json' && body && typeof body === 'object') {\n return [JSON.stringify(body)];\n }\n\n if (!body) {\n return [undefined];\n }\n } catch (e2) {\n DEBUG_BUILD && logger.warn('[Replay] Failed to serialize body', body);\n return [undefined, 'BODY_PARSE_ERROR'];\n }\n\n DEBUG_BUILD && logger.info('[Replay] Skipping network body because of body type', body);\n\n return [undefined, 'UNPARSEABLE_BODY_TYPE'];\n}\n\nfunction _getBodySize(\n body,\n responseType,\n textEncoder,\n) {\n try {\n const bodyStr = responseType === 'json' && body && typeof body === 'object' ? JSON.stringify(body) : body;\n return getBodySize(bodyStr, textEncoder);\n } catch (e3) {\n return undefined;\n }\n}\n\n/**\n * This method does two things:\n * - It enriches the regular XHR/fetch breadcrumbs with request/response size data\n * - It captures the XHR/fetch breadcrumbs to the replay\n * (enriching it with further data that is _not_ added to the regular breadcrumbs)\n */\nfunction handleNetworkBreadcrumbs(replay) {\n const client = getClient();\n\n try {\n const textEncoder = new TextEncoder();\n\n const {\n networkDetailAllowUrls,\n networkDetailDenyUrls,\n networkCaptureBodies,\n networkRequestHeaders,\n networkResponseHeaders,\n } = replay.getOptions();\n\n const options = {\n replay,\n textEncoder,\n networkDetailAllowUrls,\n networkDetailDenyUrls,\n networkCaptureBodies,\n networkRequestHeaders,\n networkResponseHeaders,\n };\n\n if (client && client.on) {\n client.on('beforeAddBreadcrumb', (breadcrumb, hint) => beforeAddNetworkBreadcrumb(options, breadcrumb, hint));\n } else {\n // Fallback behavior\n addFetchInstrumentationHandler(handleFetchSpanListener(replay));\n addXhrInstrumentationHandler(handleXhrSpanListener(replay));\n }\n } catch (e2) {\n // Do nothing\n }\n}\n\n/** just exported for tests */\nfunction beforeAddNetworkBreadcrumb(\n options,\n breadcrumb,\n hint,\n) {\n if (!breadcrumb.data) {\n return;\n }\n\n try {\n if (_isXhrBreadcrumb(breadcrumb) && _isXhrHint(hint)) {\n // This has to be sync, as we need to ensure the breadcrumb is enriched in the same tick\n // Because the hook runs synchronously, and the breadcrumb is afterwards passed on\n // So any async mutations to it will not be reflected in the final breadcrumb\n enrichXhrBreadcrumb(breadcrumb, hint, options);\n\n // This call should not reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n captureXhrBreadcrumbToReplay(breadcrumb, hint, options);\n }\n\n if (_isFetchBreadcrumb(breadcrumb) && _isFetchHint(hint)) {\n // This has to be sync, as we need to ensure the breadcrumb is enriched in the same tick\n // Because the hook runs synchronously, and the breadcrumb is afterwards passed on\n // So any async mutations to it will not be reflected in the final breadcrumb\n enrichFetchBreadcrumb(breadcrumb, hint, options);\n\n // This call should not reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n captureFetchBreadcrumbToReplay(breadcrumb, hint, options);\n }\n } catch (e) {\n DEBUG_BUILD && logger.warn('Error when enriching network breadcrumb');\n }\n}\n\nfunction _isXhrBreadcrumb(breadcrumb) {\n return breadcrumb.category === 'xhr';\n}\n\nfunction _isFetchBreadcrumb(breadcrumb) {\n return breadcrumb.category === 'fetch';\n}\n\nfunction _isXhrHint(hint) {\n return hint && hint.xhr;\n}\n\nfunction _isFetchHint(hint) {\n return hint && hint.response;\n}\n\nlet _LAST_BREADCRUMB = null;\n\nfunction isBreadcrumbWithCategory(breadcrumb) {\n return !!breadcrumb.category;\n}\n\nconst handleScopeListener =\n (replay) =>\n (scope) => {\n if (!replay.isEnabled()) {\n return;\n }\n\n const result = handleScope(scope);\n\n if (!result) {\n return;\n }\n\n addBreadcrumbEvent(replay, result);\n };\n\n/**\n * An event handler to handle scope changes.\n */\nfunction handleScope(scope) {\n // TODO (v8): Remove this guard. This was put in place because we introduced\n // Scope.getLastBreadcrumb mid-v7 which caused incompatibilities with older SDKs.\n // For now, we'll just return null if the method doesn't exist but we should eventually\n // get rid of this guard.\n const newBreadcrumb = scope.getLastBreadcrumb && scope.getLastBreadcrumb();\n\n // Listener can be called when breadcrumbs have not changed, so we store the\n // reference to the last crumb and only return a crumb if it has changed\n if (_LAST_BREADCRUMB === newBreadcrumb || !newBreadcrumb) {\n return null;\n }\n\n _LAST_BREADCRUMB = newBreadcrumb;\n\n if (\n !isBreadcrumbWithCategory(newBreadcrumb) ||\n ['fetch', 'xhr', 'sentry.event', 'sentry.transaction'].includes(newBreadcrumb.category) ||\n newBreadcrumb.category.startsWith('ui.')\n ) {\n return null;\n }\n\n if (newBreadcrumb.category === 'console') {\n return normalizeConsoleBreadcrumb(newBreadcrumb);\n }\n\n return createBreadcrumb(newBreadcrumb);\n}\n\n/** exported for tests only */\nfunction normalizeConsoleBreadcrumb(\n breadcrumb,\n) {\n const args = breadcrumb.data && breadcrumb.data.arguments;\n\n if (!Array.isArray(args) || args.length === 0) {\n return createBreadcrumb(breadcrumb);\n }\n\n let isTruncated = false;\n\n // Avoid giant args captures\n const normalizedArgs = args.map(arg => {\n if (!arg) {\n return arg;\n }\n if (typeof arg === 'string') {\n if (arg.length > CONSOLE_ARG_MAX_SIZE) {\n isTruncated = true;\n return `${arg.slice(0, CONSOLE_ARG_MAX_SIZE)}…`;\n }\n\n return arg;\n }\n if (typeof arg === 'object') {\n try {\n const normalizedArg = normalize(arg, 7);\n const stringified = JSON.stringify(normalizedArg);\n if (stringified.length > CONSOLE_ARG_MAX_SIZE) {\n isTruncated = true;\n // We use the pretty printed JSON string here as a base\n return `${JSON.stringify(normalizedArg, null, 2).slice(0, CONSOLE_ARG_MAX_SIZE)}…`;\n }\n return normalizedArg;\n } catch (e) {\n // fall back to default\n }\n }\n\n return arg;\n });\n\n return createBreadcrumb({\n ...breadcrumb,\n data: {\n ...breadcrumb.data,\n arguments: normalizedArgs,\n ...(isTruncated ? { _meta: { warnings: ['CONSOLE_ARG_TRUNCATED'] } } : {}),\n },\n });\n}\n\n/**\n * Add global listeners that cannot be removed.\n */\nfunction addGlobalListeners(replay) {\n // Listeners from core SDK //\n const scope = getCurrentScope();\n const client = getClient();\n\n scope.addScopeListener(handleScopeListener(replay));\n addClickKeypressInstrumentationHandler(handleDomListener(replay));\n addHistoryInstrumentationHandler(handleHistorySpanListener(replay));\n handleNetworkBreadcrumbs(replay);\n\n // Tag all (non replay) events that get sent to Sentry with the current\n // replay ID so that we can reference them later in the UI\n const eventProcessor = handleGlobalEventListener(replay, !hasHooks(client));\n if (client && client.addEventProcessor) {\n client.addEventProcessor(eventProcessor);\n } else {\n addEventProcessor(eventProcessor);\n }\n\n // If a custom client has no hooks yet, we continue to use the \"old\" implementation\n if (hasHooks(client)) {\n client.on('beforeSendEvent', handleBeforeSendEvent(replay));\n client.on('afterSendEvent', handleAfterSendEvent(replay));\n client.on('createDsc', (dsc) => {\n const replayId = replay.getSessionId();\n // We do not want to set the DSC when in buffer mode, as that means the replay has not been sent (yet)\n if (replayId && replay.isEnabled() && replay.recordingMode === 'session') {\n // Ensure to check that the session is still active - it could have expired in the meanwhile\n const isSessionActive = replay.checkAndHandleExpiredSession();\n if (isSessionActive) {\n dsc.replay_id = replayId;\n }\n }\n });\n\n client.on('startTransaction', transaction => {\n replay.lastTransaction = transaction;\n });\n\n // We may be missing the initial startTransaction due to timing issues,\n // so we capture it on finish again.\n client.on('finishTransaction', transaction => {\n replay.lastTransaction = transaction;\n });\n\n // We want to flush replay\n client.on('beforeSendFeedback', (feedbackEvent, options) => {\n const replayId = replay.getSessionId();\n if (options && options.includeReplay && replay.isEnabled() && replayId) {\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n replay.flush();\n if (feedbackEvent.contexts && feedbackEvent.contexts.feedback) {\n feedbackEvent.contexts.feedback.replay_id = replayId;\n }\n }\n });\n }\n}\n\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction hasHooks(client) {\n return !!(client && client.on);\n}\n\n/**\n * Create a \"span\" for the total amount of memory being used by JS objects\n * (including v8 internal objects).\n */\nasync function addMemoryEntry(replay) {\n // window.performance.memory is a non-standard API and doesn't work on all browsers, so we try-catch this\n try {\n return Promise.all(\n createPerformanceSpans(replay, [\n // @ts-expect-error memory doesn't exist on type Performance as the API is non-standard (we check that it exists above)\n createMemoryEntry(WINDOW.performance.memory),\n ]),\n );\n } catch (error) {\n // Do nothing\n return [];\n }\n}\n\nfunction createMemoryEntry(memoryEntry) {\n const { jsHeapSizeLimit, totalJSHeapSize, usedJSHeapSize } = memoryEntry;\n // we don't want to use `getAbsoluteTime` because it adds the event time to the\n // time origin, so we get the current timestamp instead\n const time = Date.now() / 1000;\n return {\n type: 'memory',\n name: 'memory',\n start: time,\n end: time,\n data: {\n memory: {\n jsHeapSizeLimit,\n totalJSHeapSize,\n usedJSHeapSize,\n },\n },\n };\n}\n\n/**\n * Heavily simplified debounce function based on lodash.debounce.\n *\n * This function takes a callback function (@param fun) and delays its invocation\n * by @param wait milliseconds. Optionally, a maxWait can be specified in @param options,\n * which ensures that the callback is invoked at least once after the specified max. wait time.\n *\n * @param func the function whose invocation is to be debounced\n * @param wait the minimum time until the function is invoked after it was called once\n * @param options the options object, which can contain the `maxWait` property\n *\n * @returns the debounced version of the function, which needs to be called at least once to start the\n * debouncing process. Subsequent calls will reset the debouncing timer and, in case @paramfunc\n * was already invoked in the meantime, return @param func's return value.\n * The debounced function has two additional properties:\n * - `flush`: Invokes the debounced function immediately and returns its return value\n * - `cancel`: Cancels the debouncing process and resets the debouncing timer\n */\nfunction debounce(func, wait, options) {\n let callbackReturnValue;\n\n let timerId;\n let maxTimerId;\n\n const maxWait = options && options.maxWait ? Math.max(options.maxWait, wait) : 0;\n\n function invokeFunc() {\n cancelTimers();\n callbackReturnValue = func();\n return callbackReturnValue;\n }\n\n function cancelTimers() {\n timerId !== undefined && clearTimeout(timerId);\n maxTimerId !== undefined && clearTimeout(maxTimerId);\n timerId = maxTimerId = undefined;\n }\n\n function flush() {\n if (timerId !== undefined || maxTimerId !== undefined) {\n return invokeFunc();\n }\n return callbackReturnValue;\n }\n\n function debounced() {\n if (timerId) {\n clearTimeout(timerId);\n }\n timerId = setTimeout(invokeFunc, wait);\n\n if (maxWait && maxTimerId === undefined) {\n maxTimerId = setTimeout(invokeFunc, maxWait);\n }\n\n return callbackReturnValue;\n }\n\n debounced.cancel = cancelTimers;\n debounced.flush = flush;\n return debounced;\n}\n\n/**\n * Handler for recording events.\n *\n * Adds to event buffer, and has varying flushing behaviors if the event was a checkout.\n */\nfunction getHandleRecordingEmit(replay) {\n let hadFirstEvent = false;\n\n return (event, _isCheckout) => {\n // If this is false, it means session is expired, create and a new session and wait for checkout\n if (!replay.checkAndHandleExpiredSession()) {\n DEBUG_BUILD && logger.warn('[Replay] Received replay event after session expired.');\n\n return;\n }\n\n // `_isCheckout` is only set when the checkout is due to `checkoutEveryNms`\n // We also want to treat the first event as a checkout, so we handle this specifically here\n const isCheckout = _isCheckout || !hadFirstEvent;\n hadFirstEvent = true;\n\n if (replay.clickDetector) {\n updateClickDetectorForRecordingEvent(replay.clickDetector, event);\n }\n\n // The handler returns `true` if we do not want to trigger debounced flush, `false` if we want to debounce flush.\n replay.addUpdate(() => {\n // The session is always started immediately on pageload/init, but for\n // error-only replays, it should reflect the most recent checkout\n // when an error occurs. Clear any state that happens before this current\n // checkout. This needs to happen before `addEvent()` which updates state\n // dependent on this reset.\n if (replay.recordingMode === 'buffer' && isCheckout) {\n replay.setInitialState();\n }\n\n // If the event is not added (e.g. due to being paused, disabled, or out of the max replay duration),\n // Skip all further steps\n if (!addEventSync(replay, event, isCheckout)) {\n // Return true to skip scheduling a debounced flush\n return true;\n }\n\n // Different behavior for full snapshots (type=2), ignore other event types\n // See https://github.com/rrweb-io/rrweb/blob/d8f9290ca496712aa1e7d472549480c4e7876594/packages/rrweb/src/types.ts#L16\n if (!isCheckout) {\n return false;\n }\n\n // Additionally, create a meta event that will capture certain SDK settings.\n // In order to handle buffer mode, this needs to either be done when we\n // receive checkout events or at flush time.\n //\n // `isCheckout` is always true, but want to be explicit that it should\n // only be added for checkouts\n addSettingsEvent(replay, isCheckout);\n\n // If there is a previousSessionId after a full snapshot occurs, then\n // the replay session was started due to session expiration. The new session\n // is started before triggering a new checkout and contains the id\n // of the previous session. Do not immediately flush in this case\n // to avoid capturing only the checkout and instead the replay will\n // be captured if they perform any follow-up actions.\n if (replay.session && replay.session.previousSessionId) {\n return true;\n }\n\n // When in buffer mode, make sure we adjust the session started date to the current earliest event of the buffer\n // this should usually be the timestamp of the checkout event, but to be safe...\n if (replay.recordingMode === 'buffer' && replay.session && replay.eventBuffer) {\n const earliestEvent = replay.eventBuffer.getEarliestTimestamp();\n if (earliestEvent) {\n logInfo(\n `[Replay] Updating session start time to earliest event in buffer to ${new Date(earliestEvent)}`,\n replay.getOptions()._experiments.traceInternals,\n );\n\n replay.session.started = earliestEvent;\n\n if (replay.getOptions().stickySession) {\n saveSession(replay.session);\n }\n }\n }\n\n if (replay.recordingMode === 'session') {\n // If the full snapshot is due to an initial load, we will not have\n // a previous session ID. In this case, we want to buffer events\n // for a set amount of time before flushing. This can help avoid\n // capturing replays of users that immediately close the window.\n\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n void replay.flush();\n }\n\n return true;\n });\n };\n}\n\n/**\n * Exported for tests\n */\nfunction createOptionsEvent(replay) {\n const options = replay.getOptions();\n return {\n type: EventType.Custom,\n timestamp: Date.now(),\n data: {\n tag: 'options',\n payload: {\n shouldRecordCanvas: replay.isRecordingCanvas(),\n sessionSampleRate: options.sessionSampleRate,\n errorSampleRate: options.errorSampleRate,\n useCompressionOption: options.useCompression,\n blockAllMedia: options.blockAllMedia,\n maskAllText: options.maskAllText,\n maskAllInputs: options.maskAllInputs,\n useCompression: replay.eventBuffer ? replay.eventBuffer.type === 'worker' : false,\n networkDetailHasUrls: options.networkDetailAllowUrls.length > 0,\n networkCaptureBodies: options.networkCaptureBodies,\n networkRequestHasHeaders: options.networkRequestHeaders.length > 0,\n networkResponseHasHeaders: options.networkResponseHeaders.length > 0,\n },\n },\n };\n}\n\n/**\n * Add a \"meta\" event that contains a simplified view on current configuration\n * options. This should only be included on the first segment of a recording.\n */\nfunction addSettingsEvent(replay, isCheckout) {\n // Only need to add this event when sending the first segment\n if (!isCheckout || !replay.session || replay.session.segmentId !== 0) {\n return;\n }\n\n addEventSync(replay, createOptionsEvent(replay), false);\n}\n\n/**\n * Create a replay envelope ready to be sent.\n * This includes both the replay event, as well as the recording data.\n */\nfunction createReplayEnvelope(\n replayEvent,\n recordingData,\n dsn,\n tunnel,\n) {\n return createEnvelope(\n createEventEnvelopeHeaders(replayEvent, getSdkMetadataForEnvelopeHeader(replayEvent), tunnel, dsn),\n [\n [{ type: 'replay_event' }, replayEvent],\n [\n {\n type: 'replay_recording',\n // If string then we need to encode to UTF8, otherwise will have\n // wrong size. TextEncoder has similar browser support to\n // MutationObserver, although it does not accept IE11.\n length:\n typeof recordingData === 'string' ? new TextEncoder().encode(recordingData).length : recordingData.length,\n },\n recordingData,\n ],\n ],\n );\n}\n\n/**\n * Prepare the recording data ready to be sent.\n */\nfunction prepareRecordingData({\n recordingData,\n headers,\n}\n\n) {\n let payloadWithSequence;\n\n // XXX: newline is needed to separate sequence id from events\n const replayHeaders = `${JSON.stringify(headers)}\n`;\n\n if (typeof recordingData === 'string') {\n payloadWithSequence = `${replayHeaders}${recordingData}`;\n } else {\n const enc = new TextEncoder();\n // XXX: newline is needed to separate sequence id from events\n const sequence = enc.encode(replayHeaders);\n // Merge the two Uint8Arrays\n payloadWithSequence = new Uint8Array(sequence.length + recordingData.length);\n payloadWithSequence.set(sequence);\n payloadWithSequence.set(recordingData, sequence.length);\n }\n\n return payloadWithSequence;\n}\n\n/**\n * Prepare a replay event & enrich it with the SDK metadata.\n */\nasync function prepareReplayEvent({\n client,\n scope,\n replayId: event_id,\n event,\n}\n\n) {\n const integrations =\n typeof client._integrations === 'object' && client._integrations !== null && !Array.isArray(client._integrations)\n ? Object.keys(client._integrations)\n : undefined;\n\n const eventHint = { event_id, integrations };\n\n if (client.emit) {\n client.emit('preprocessEvent', event, eventHint);\n }\n\n const preparedEvent = (await prepareEvent(\n client.getOptions(),\n event,\n eventHint,\n scope,\n client,\n getIsolationScope(),\n )) ;\n\n // If e.g. a global event processor returned null\n if (!preparedEvent) {\n return null;\n }\n\n // This normally happens in browser client \"_prepareEvent\"\n // but since we do not use this private method from the client, but rather the plain import\n // we need to do this manually.\n preparedEvent.platform = preparedEvent.platform || 'javascript';\n\n // extract the SDK name because `client._prepareEvent` doesn't add it to the event\n const metadata = client.getSdkMetadata && client.getSdkMetadata();\n const { name, version } = (metadata && metadata.sdk) || {};\n\n preparedEvent.sdk = {\n ...preparedEvent.sdk,\n name: name || 'sentry.javascript.unknown',\n version: version || '0.0.0',\n };\n\n return preparedEvent;\n}\n\n/**\n * Send replay attachment using `fetch()`\n */\nasync function sendReplayRequest({\n recordingData,\n replayId,\n segmentId: segment_id,\n eventContext,\n timestamp,\n session,\n}) {\n const preparedRecordingData = prepareRecordingData({\n recordingData,\n headers: {\n segment_id,\n },\n });\n\n const { urls, errorIds, traceIds, initialTimestamp } = eventContext;\n\n const client = getClient();\n const scope = getCurrentScope();\n const transport = client && client.getTransport();\n const dsn = client && client.getDsn();\n\n if (!client || !transport || !dsn || !session.sampled) {\n return;\n }\n\n const baseEvent = {\n type: REPLAY_EVENT_NAME,\n replay_start_timestamp: initialTimestamp / 1000,\n timestamp: timestamp / 1000,\n error_ids: errorIds,\n trace_ids: traceIds,\n urls,\n replay_id: replayId,\n segment_id,\n replay_type: session.sampled,\n };\n\n const replayEvent = await prepareReplayEvent({ scope, client, replayId, event: baseEvent });\n\n if (!replayEvent) {\n // Taken from baseclient's `_processEvent` method, where this is handled for errors/transactions\n client.recordDroppedEvent('event_processor', 'replay', baseEvent);\n logInfo('An event processor returned `null`, will not send event.');\n return;\n }\n\n /*\n For reference, the fully built event looks something like this:\n {\n \"type\": \"replay_event\",\n \"timestamp\": 1670837008.634,\n \"error_ids\": [\n \"errorId\"\n ],\n \"trace_ids\": [\n \"traceId\"\n ],\n \"urls\": [\n \"https://example.com\"\n ],\n \"replay_id\": \"eventId\",\n \"segment_id\": 3,\n \"replay_type\": \"error\",\n \"platform\": \"javascript\",\n \"event_id\": \"eventId\",\n \"environment\": \"production\",\n \"sdk\": {\n \"integrations\": [\n \"BrowserTracing\",\n \"Replay\"\n ],\n \"name\": \"sentry.javascript.browser\",\n \"version\": \"7.25.0\"\n },\n \"sdkProcessingMetadata\": {},\n \"contexts\": {\n },\n }\n */\n\n // Prevent this data (which, if it exists, was used in earlier steps in the processing pipeline) from being sent to\n // sentry. (Note: Our use of this property comes and goes with whatever we might be debugging, whatever hacks we may\n // have temporarily added, etc. Even if we don't happen to be using it at some point in the future, let's not get rid\n // of this `delete`, lest we miss putting it back in the next time the property is in use.)\n delete replayEvent.sdkProcessingMetadata;\n\n const envelope = createReplayEnvelope(replayEvent, preparedRecordingData, dsn, client.getOptions().tunnel);\n\n let response;\n\n try {\n response = await transport.send(envelope);\n } catch (err) {\n const error = new Error(UNABLE_TO_SEND_REPLAY);\n\n try {\n // In case browsers don't allow this property to be writable\n // @ts-expect-error This needs lib es2022 and newer\n error.cause = err;\n } catch (e) {\n // nothing to do\n }\n throw error;\n }\n\n // TODO (v8): we can remove this guard once transport.send's type signature doesn't include void anymore\n if (!response) {\n return response;\n }\n\n // If the status code is invalid, we want to immediately stop & not retry\n if (typeof response.statusCode === 'number' && (response.statusCode < 200 || response.statusCode >= 300)) {\n throw new TransportStatusCodeError(response.statusCode);\n }\n\n const rateLimits = updateRateLimits({}, response);\n if (isRateLimited(rateLimits, 'replay')) {\n throw new RateLimitError(rateLimits);\n }\n\n return response;\n}\n\n/**\n * This error indicates that the transport returned an invalid status code.\n */\nclass TransportStatusCodeError extends Error {\n constructor(statusCode) {\n super(`Transport returned status code ${statusCode}`);\n }\n}\n\n/**\n * This error indicates that we hit a rate limit API error.\n */\nclass RateLimitError extends Error {\n\n constructor(rateLimits) {\n super('Rate limit hit');\n this.rateLimits = rateLimits;\n }\n}\n\n/**\n * Finalize and send the current replay event to Sentry\n */\nasync function sendReplay(\n replayData,\n retryConfig = {\n count: 0,\n interval: RETRY_BASE_INTERVAL,\n },\n) {\n const { recordingData, options } = replayData;\n\n // short circuit if there's no events to upload (this shouldn't happen as _runFlush makes this check)\n if (!recordingData.length) {\n return;\n }\n\n try {\n await sendReplayRequest(replayData);\n return true;\n } catch (err) {\n if (err instanceof TransportStatusCodeError || err instanceof RateLimitError) {\n throw err;\n }\n\n // Capture error for every failed replay\n setContext('Replays', {\n _retryCount: retryConfig.count,\n });\n\n if (DEBUG_BUILD && options._experiments && options._experiments.captureExceptions) {\n captureException(err);\n }\n\n // If an error happened here, it's likely that uploading the attachment\n // failed, we'll can retry with the same events payload\n if (retryConfig.count >= RETRY_MAX_COUNT) {\n const error = new Error(`${UNABLE_TO_SEND_REPLAY} - max retries exceeded`);\n\n try {\n // In case browsers don't allow this property to be writable\n // @ts-expect-error This needs lib es2022 and newer\n error.cause = err;\n } catch (e) {\n // nothing to do\n }\n\n throw error;\n }\n\n // will retry in intervals of 5, 10, 30\n retryConfig.interval *= ++retryConfig.count;\n\n return new Promise((resolve, reject) => {\n setTimeout(async () => {\n try {\n await sendReplay(replayData, retryConfig);\n resolve(true);\n } catch (err) {\n reject(err);\n }\n }, retryConfig.interval);\n });\n }\n}\n\nconst THROTTLED = '__THROTTLED';\nconst SKIPPED = '__SKIPPED';\n\n/**\n * Create a throttled function off a given function.\n * When calling the throttled function, it will call the original function only\n * if it hasn't been called more than `maxCount` times in the last `durationSeconds`.\n *\n * Returns `THROTTLED` if throttled for the first time, after that `SKIPPED`,\n * or else the return value of the original function.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction throttle(\n fn,\n maxCount,\n durationSeconds,\n) {\n const counter = new Map();\n\n const _cleanup = (now) => {\n const threshold = now - durationSeconds;\n counter.forEach((_value, key) => {\n if (key < threshold) {\n counter.delete(key);\n }\n });\n };\n\n const _getTotalCount = () => {\n return [...counter.values()].reduce((a, b) => a + b, 0);\n };\n\n let isThrottled = false;\n\n return (...rest) => {\n // Date in second-precision, which we use as basis for the throttling\n const now = Math.floor(Date.now() / 1000);\n\n // First, make sure to delete any old entries\n _cleanup(now);\n\n // If already over limit, do nothing\n if (_getTotalCount() >= maxCount) {\n const wasThrottled = isThrottled;\n isThrottled = true;\n return wasThrottled ? SKIPPED : THROTTLED;\n }\n\n isThrottled = false;\n const count = counter.get(now) || 0;\n counter.set(now, count + 1);\n\n return fn(...rest);\n };\n}\n\n/* eslint-disable max-lines */ // TODO: We might want to split this file up\n\n/**\n * The main replay container class, which holds all the state and methods for recording and sending replays.\n */\nclass ReplayContainer {\n\n /**\n * Recording can happen in one of three modes:\n * - session: Record the whole session, sending it continuously\n * - buffer: Always keep the last 60s of recording, requires:\n * - having replaysOnErrorSampleRate > 0 to capture replay when an error occurs\n * - or calling `flush()` to send the replay\n */\n\n /**\n * The current or last active transcation.\n * This is only available when performance is enabled.\n */\n\n /**\n * These are here so we can overwrite them in tests etc.\n * @hidden\n */\n\n /**\n * Options to pass to `rrweb.record()`\n */\n\n /**\n * Timestamp of the last user activity. This lives across sessions.\n */\n\n /**\n * Is the integration currently active?\n */\n\n /**\n * Paused is a state where:\n * - DOM Recording is not listening at all\n * - Nothing will be added to event buffer (e.g. core SDK events)\n */\n\n /**\n * Have we attached listeners to the core SDK?\n * Note we have to track this as there is no way to remove instrumentation handlers.\n */\n\n /**\n * Function to stop recording\n */\n\n /**\n * Internal use for canvas recording options\n */\n\n constructor({\n options,\n recordingOptions,\n }\n\n) {ReplayContainer.prototype.__init.call(this);ReplayContainer.prototype.__init2.call(this);ReplayContainer.prototype.__init3.call(this);ReplayContainer.prototype.__init4.call(this);ReplayContainer.prototype.__init5.call(this);ReplayContainer.prototype.__init6.call(this);\n this.eventBuffer = null;\n this.performanceEntries = [];\n this.replayPerformanceEntries = [];\n this.recordingMode = 'session';\n this.timeouts = {\n sessionIdlePause: SESSION_IDLE_PAUSE_DURATION,\n sessionIdleExpire: SESSION_IDLE_EXPIRE_DURATION,\n } ;\n this._lastActivity = Date.now();\n this._isEnabled = false;\n this._isPaused = false;\n this._hasInitializedCoreListeners = false;\n this._context = {\n errorIds: new Set(),\n traceIds: new Set(),\n urls: [],\n initialTimestamp: Date.now(),\n initialUrl: '',\n };\n\n this._recordingOptions = recordingOptions;\n this._options = options;\n\n this._debouncedFlush = debounce(() => this._flush(), this._options.flushMinDelay, {\n maxWait: this._options.flushMaxDelay,\n });\n\n this._throttledAddEvent = throttle(\n (event, isCheckout) => addEvent(this, event, isCheckout),\n // Max 300 events...\n 300,\n // ... per 5s\n 5,\n );\n\n const { slowClickTimeout, slowClickIgnoreSelectors } = this.getOptions();\n\n const slowClickConfig = slowClickTimeout\n ? {\n threshold: Math.min(SLOW_CLICK_THRESHOLD, slowClickTimeout),\n timeout: slowClickTimeout,\n scrollTimeout: SLOW_CLICK_SCROLL_TIMEOUT,\n ignoreSelector: slowClickIgnoreSelectors ? slowClickIgnoreSelectors.join(',') : '',\n }\n : undefined;\n\n if (slowClickConfig) {\n this.clickDetector = new ClickDetector(this, slowClickConfig);\n }\n }\n\n /** Get the event context. */\n getContext() {\n return this._context;\n }\n\n /** If recording is currently enabled. */\n isEnabled() {\n return this._isEnabled;\n }\n\n /** If recording is currently paused. */\n isPaused() {\n return this._isPaused;\n }\n\n /**\n * Determine if canvas recording is enabled\n */\n isRecordingCanvas() {\n return Boolean(this._canvas);\n }\n\n /** Get the replay integration options. */\n getOptions() {\n return this._options;\n }\n\n /**\n * Initializes the plugin based on sampling configuration. Should not be\n * called outside of constructor.\n */\n initializeSampling(previousSessionId) {\n const { errorSampleRate, sessionSampleRate } = this._options;\n\n // If neither sample rate is > 0, then do nothing - user will need to call one of\n // `start()` or `startBuffering` themselves.\n if (errorSampleRate <= 0 && sessionSampleRate <= 0) {\n return;\n }\n\n // Otherwise if there is _any_ sample rate set, try to load an existing\n // session, or create a new one.\n this._initializeSessionForSampling(previousSessionId);\n\n if (!this.session) {\n // This should not happen, something wrong has occurred\n this._handleException(new Error('Unable to initialize and create session'));\n return;\n }\n\n if (this.session.sampled === false) {\n // This should only occur if `errorSampleRate` is 0 and was unsampled for\n // session-based replay. In this case there is nothing to do.\n return;\n }\n\n // If segmentId > 0, it means we've previously already captured this session\n // In this case, we still want to continue in `session` recording mode\n this.recordingMode = this.session.sampled === 'buffer' && this.session.segmentId === 0 ? 'buffer' : 'session';\n\n logInfoNextTick(\n `[Replay] Starting replay in ${this.recordingMode} mode`,\n this._options._experiments.traceInternals,\n );\n\n this._initializeRecording();\n }\n\n /**\n * Start a replay regardless of sampling rate. Calling this will always\n * create a new session. Will throw an error if replay is already in progress.\n *\n * Creates or loads a session, attaches listeners to varying events (DOM,\n * _performanceObserver, Recording, Sentry SDK, etc)\n */\n start() {\n if (this._isEnabled && this.recordingMode === 'session') {\n throw new Error('Replay recording is already in progress');\n }\n\n if (this._isEnabled && this.recordingMode === 'buffer') {\n throw new Error('Replay buffering is in progress, call `flush()` to save the replay');\n }\n\n logInfoNextTick('[Replay] Starting replay in session mode', this._options._experiments.traceInternals);\n\n const session = loadOrCreateSession(\n {\n maxReplayDuration: this._options.maxReplayDuration,\n sessionIdleExpire: this.timeouts.sessionIdleExpire,\n traceInternals: this._options._experiments.traceInternals,\n },\n {\n stickySession: this._options.stickySession,\n // This is intentional: create a new session-based replay when calling `start()`\n sessionSampleRate: 1,\n allowBuffering: false,\n },\n );\n\n this.session = session;\n\n this._initializeRecording();\n }\n\n /**\n * Start replay buffering. Buffers until `flush()` is called or, if\n * `replaysOnErrorSampleRate` > 0, an error occurs.\n */\n startBuffering() {\n if (this._isEnabled) {\n throw new Error('Replay recording is already in progress');\n }\n\n logInfoNextTick('[Replay] Starting replay in buffer mode', this._options._experiments.traceInternals);\n\n const session = loadOrCreateSession(\n {\n sessionIdleExpire: this.timeouts.sessionIdleExpire,\n maxReplayDuration: this._options.maxReplayDuration,\n traceInternals: this._options._experiments.traceInternals,\n },\n {\n stickySession: this._options.stickySession,\n sessionSampleRate: 0,\n allowBuffering: true,\n },\n );\n\n this.session = session;\n\n this.recordingMode = 'buffer';\n this._initializeRecording();\n }\n\n /**\n * Start recording.\n *\n * Note that this will cause a new DOM checkout\n */\n startRecording() {\n try {\n const canvasOptions = this._canvas;\n\n this._stopRecording = record({\n ...this._recordingOptions,\n // When running in error sampling mode, we need to overwrite `checkoutEveryNms`\n // Without this, it would record forever, until an error happens, which we don't want\n // instead, we'll always keep the last 60 seconds of replay before an error happened\n ...(this.recordingMode === 'buffer' && { checkoutEveryNms: BUFFER_CHECKOUT_TIME }),\n emit: getHandleRecordingEmit(this),\n onMutation: this._onMutationHandler,\n ...(canvasOptions\n ? {\n recordCanvas: canvasOptions.recordCanvas,\n getCanvasManager: canvasOptions.getCanvasManager,\n sampling: canvasOptions.sampling,\n dataURLOptions: canvasOptions.dataURLOptions,\n }\n : {}),\n });\n } catch (err) {\n this._handleException(err);\n }\n }\n\n /**\n * Stops the recording, if it was running.\n *\n * Returns true if it was previously stopped, or is now stopped,\n * otherwise false.\n */\n stopRecording() {\n try {\n if (this._stopRecording) {\n this._stopRecording();\n this._stopRecording = undefined;\n }\n\n return true;\n } catch (err) {\n this._handleException(err);\n return false;\n }\n }\n\n /**\n * Currently, this needs to be manually called (e.g. for tests). Sentry SDK\n * does not support a teardown\n */\n async stop({ forceFlush = false, reason } = {}) {\n if (!this._isEnabled) {\n return;\n }\n\n // We can't move `_isEnabled` after awaiting a flush, otherwise we can\n // enter into an infinite loop when `stop()` is called while flushing.\n this._isEnabled = false;\n\n try {\n logInfo(\n `[Replay] Stopping Replay${reason ? ` triggered by ${reason}` : ''}`,\n this._options._experiments.traceInternals,\n );\n\n this._removeListeners();\n this.stopRecording();\n\n this._debouncedFlush.cancel();\n // See comment above re: `_isEnabled`, we \"force\" a flush, ignoring the\n // `_isEnabled` state of the plugin since it was disabled above.\n if (forceFlush) {\n await this._flush({ force: true });\n }\n\n // After flush, destroy event buffer\n this.eventBuffer && this.eventBuffer.destroy();\n this.eventBuffer = null;\n\n // Clear session from session storage, note this means if a new session\n // is started after, it will not have `previousSessionId`\n clearSession(this);\n } catch (err) {\n this._handleException(err);\n }\n }\n\n /**\n * Pause some replay functionality. See comments for `_isPaused`.\n * This differs from stop as this only stops DOM recording, it is\n * not as thorough of a shutdown as `stop()`.\n */\n pause() {\n if (this._isPaused) {\n return;\n }\n\n this._isPaused = true;\n this.stopRecording();\n\n logInfo('[Replay] Pausing replay', this._options._experiments.traceInternals);\n }\n\n /**\n * Resumes recording, see notes for `pause().\n *\n * Note that calling `startRecording()` here will cause a\n * new DOM checkout.`\n */\n resume() {\n if (!this._isPaused || !this._checkSession()) {\n return;\n }\n\n this._isPaused = false;\n this.startRecording();\n\n logInfo('[Replay] Resuming replay', this._options._experiments.traceInternals);\n }\n\n /**\n * If not in \"session\" recording mode, flush event buffer which will create a new replay.\n * Unless `continueRecording` is false, the replay will continue to record and\n * behave as a \"session\"-based replay.\n *\n * Otherwise, queue up a flush.\n */\n async sendBufferedReplayOrFlush({ continueRecording = true } = {}) {\n if (this.recordingMode === 'session') {\n return this.flushImmediate();\n }\n\n const activityTime = Date.now();\n\n logInfo('[Replay] Converting buffer to session', this._options._experiments.traceInternals);\n\n // Allow flush to complete before resuming as a session recording, otherwise\n // the checkout from `startRecording` may be included in the payload.\n // Prefer to keep the error replay as a separate (and smaller) segment\n // than the session replay.\n await this.flushImmediate();\n\n const hasStoppedRecording = this.stopRecording();\n\n if (!continueRecording || !hasStoppedRecording) {\n return;\n }\n\n // To avoid race conditions where this is called multiple times, we check here again that we are still buffering\n if ((this.recordingMode ) === 'session') {\n return;\n }\n\n // Re-start recording in session-mode\n this.recordingMode = 'session';\n\n // Once this session ends, we do not want to refresh it\n if (this.session) {\n this._updateUserActivity(activityTime);\n this._updateSessionActivity(activityTime);\n this._maybeSaveSession();\n }\n\n this.startRecording();\n }\n\n /**\n * We want to batch uploads of replay events. Save events only if\n * `` milliseconds have elapsed since the last event\n * *OR* if `` milliseconds have elapsed.\n *\n * Accepts a callback to perform side-effects and returns true to stop batch\n * processing and hand back control to caller.\n */\n addUpdate(cb) {\n // We need to always run `cb` (e.g. in the case of `this.recordingMode == 'buffer'`)\n const cbResult = cb();\n\n // If this option is turned on then we will only want to call `flush`\n // explicitly\n if (this.recordingMode === 'buffer') {\n return;\n }\n\n // If callback is true, we do not want to continue with flushing -- the\n // caller will need to handle it.\n if (cbResult === true) {\n return;\n }\n\n // addUpdate is called quite frequently - use _debouncedFlush so that it\n // respects the flush delays and does not flush immediately\n this._debouncedFlush();\n }\n\n /**\n * Updates the user activity timestamp and resumes recording. This should be\n * called in an event handler for a user action that we consider as the user\n * being \"active\" (e.g. a mouse click).\n */\n triggerUserActivity() {\n this._updateUserActivity();\n\n // This case means that recording was once stopped due to inactivity.\n // Ensure that recording is resumed.\n if (!this._stopRecording) {\n // Create a new session, otherwise when the user action is flushed, it\n // will get rejected due to an expired session.\n if (!this._checkSession()) {\n return;\n }\n\n // Note: This will cause a new DOM checkout\n this.resume();\n return;\n }\n\n // Otherwise... recording was never suspended, continue as normalish\n this.checkAndHandleExpiredSession();\n\n this._updateSessionActivity();\n }\n\n /**\n * Updates the user activity timestamp *without* resuming\n * recording. Some user events (e.g. keydown) can be create\n * low-value replays that only contain the keypress as a\n * breadcrumb. Instead this would require other events to\n * create a new replay after a session has expired.\n */\n updateUserActivity() {\n this._updateUserActivity();\n this._updateSessionActivity();\n }\n\n /**\n * Only flush if `this.recordingMode === 'session'`\n */\n conditionalFlush() {\n if (this.recordingMode === 'buffer') {\n return Promise.resolve();\n }\n\n return this.flushImmediate();\n }\n\n /**\n * Flush using debounce flush\n */\n flush() {\n return this._debouncedFlush() ;\n }\n\n /**\n * Always flush via `_debouncedFlush` so that we do not have flushes triggered\n * from calling both `flush` and `_debouncedFlush`. Otherwise, there could be\n * cases of mulitple flushes happening closely together.\n */\n flushImmediate() {\n this._debouncedFlush();\n // `.flush` is provided by the debounced function, analogously to lodash.debounce\n return this._debouncedFlush.flush() ;\n }\n\n /**\n * Cancels queued up flushes.\n */\n cancelFlush() {\n this._debouncedFlush.cancel();\n }\n\n /** Get the current sesion (=replay) ID */\n getSessionId() {\n return this.session && this.session.id;\n }\n\n /**\n * Checks if recording should be stopped due to user inactivity. Otherwise\n * check if session is expired and create a new session if so. Triggers a new\n * full snapshot on new session.\n *\n * Returns true if session is not expired, false otherwise.\n * @hidden\n */\n checkAndHandleExpiredSession() {\n // Prevent starting a new session if the last user activity is older than\n // SESSION_IDLE_PAUSE_DURATION. Otherwise non-user activity can trigger a new\n // session+recording. This creates noisy replays that do not have much\n // content in them.\n if (\n this._lastActivity &&\n isExpired(this._lastActivity, this.timeouts.sessionIdlePause) &&\n this.session &&\n this.session.sampled === 'session'\n ) {\n // Pause recording only for session-based replays. Otherwise, resuming\n // will create a new replay and will conflict with users who only choose\n // to record error-based replays only. (e.g. the resumed replay will not\n // contain a reference to an error)\n this.pause();\n return;\n }\n\n // --- There is recent user activity --- //\n // This will create a new session if expired, based on expiry length\n if (!this._checkSession()) {\n // Check session handles the refreshing itself\n return false;\n }\n\n return true;\n }\n\n /**\n * Capture some initial state that can change throughout the lifespan of the\n * replay. This is required because otherwise they would be captured at the\n * first flush.\n */\n setInitialState() {\n const urlPath = `${WINDOW.location.pathname}${WINDOW.location.hash}${WINDOW.location.search}`;\n const url = `${WINDOW.location.origin}${urlPath}`;\n\n this.performanceEntries = [];\n this.replayPerformanceEntries = [];\n\n // Reset _context as well\n this._clearContext();\n\n this._context.initialUrl = url;\n this._context.initialTimestamp = Date.now();\n this._context.urls.push(url);\n }\n\n /**\n * Add a breadcrumb event, that may be throttled.\n * If it was throttled, we add a custom breadcrumb to indicate that.\n */\n throttledAddEvent(\n event,\n isCheckout,\n ) {\n const res = this._throttledAddEvent(event, isCheckout);\n\n // If this is THROTTLED, it means we have throttled the event for the first time\n // In this case, we want to add a breadcrumb indicating that something was skipped\n if (res === THROTTLED) {\n const breadcrumb = createBreadcrumb({\n category: 'replay.throttled',\n });\n\n this.addUpdate(() => {\n // Return `false` if the event _was_ added, as that means we schedule a flush\n return !addEventSync(this, {\n type: ReplayEventTypeCustom,\n timestamp: breadcrumb.timestamp || 0,\n data: {\n tag: 'breadcrumb',\n payload: breadcrumb,\n metric: true,\n },\n });\n });\n }\n\n return res;\n }\n\n /**\n * This will get the parametrized route name of the current page.\n * This is only available if performance is enabled, and if an instrumented router is used.\n */\n getCurrentRoute() {\n // eslint-disable-next-line deprecation/deprecation\n const lastTransaction = this.lastTransaction || getCurrentScope().getTransaction();\n\n const attributes = (lastTransaction && spanToJSON(lastTransaction).data) || {};\n const source = attributes[SEMANTIC_ATTRIBUTE_SENTRY_SOURCE];\n if (!lastTransaction || !source || !['route', 'custom'].includes(source)) {\n return undefined;\n }\n\n return spanToJSON(lastTransaction).description;\n }\n\n /**\n * Initialize and start all listeners to varying events (DOM,\n * Performance Observer, Recording, Sentry SDK, etc)\n */\n _initializeRecording() {\n this.setInitialState();\n\n // this method is generally called on page load or manually - in both cases\n // we should treat it as an activity\n this._updateSessionActivity();\n\n this.eventBuffer = createEventBuffer({\n useCompression: this._options.useCompression,\n workerUrl: this._options.workerUrl,\n });\n\n this._removeListeners();\n this._addListeners();\n\n // Need to set as enabled before we start recording, as `record()` can trigger a flush with a new checkout\n this._isEnabled = true;\n this._isPaused = false;\n\n this.startRecording();\n }\n\n /** A wrapper to conditionally capture exceptions. */\n _handleException(error) {\n DEBUG_BUILD && logger.error('[Replay]', error);\n\n if (DEBUG_BUILD && this._options._experiments && this._options._experiments.captureExceptions) {\n captureException(error);\n }\n }\n\n /**\n * Loads (or refreshes) the current session.\n */\n _initializeSessionForSampling(previousSessionId) {\n // Whenever there is _any_ error sample rate, we always allow buffering\n // Because we decide on sampling when an error occurs, we need to buffer at all times if sampling for errors\n const allowBuffering = this._options.errorSampleRate > 0;\n\n const session = loadOrCreateSession(\n {\n sessionIdleExpire: this.timeouts.sessionIdleExpire,\n maxReplayDuration: this._options.maxReplayDuration,\n traceInternals: this._options._experiments.traceInternals,\n previousSessionId,\n },\n {\n stickySession: this._options.stickySession,\n sessionSampleRate: this._options.sessionSampleRate,\n allowBuffering,\n },\n );\n\n this.session = session;\n }\n\n /**\n * Checks and potentially refreshes the current session.\n * Returns false if session is not recorded.\n */\n _checkSession() {\n // If there is no session yet, we do not want to refresh anything\n // This should generally not happen, but to be safe....\n if (!this.session) {\n return false;\n }\n\n const currentSession = this.session;\n\n if (\n shouldRefreshSession(currentSession, {\n sessionIdleExpire: this.timeouts.sessionIdleExpire,\n maxReplayDuration: this._options.maxReplayDuration,\n })\n ) {\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this._refreshSession(currentSession);\n return false;\n }\n\n return true;\n }\n\n /**\n * Refresh a session with a new one.\n * This stops the current session (without forcing a flush, as that would never work since we are expired),\n * and then does a new sampling based on the refreshed session.\n */\n async _refreshSession(session) {\n if (!this._isEnabled) {\n return;\n }\n await this.stop({ reason: 'refresh session' });\n this.initializeSampling(session.id);\n }\n\n /**\n * Adds listeners to record events for the replay\n */\n _addListeners() {\n try {\n WINDOW.document.addEventListener('visibilitychange', this._handleVisibilityChange);\n WINDOW.addEventListener('blur', this._handleWindowBlur);\n WINDOW.addEventListener('focus', this._handleWindowFocus);\n WINDOW.addEventListener('keydown', this._handleKeyboardEvent);\n\n if (this.clickDetector) {\n this.clickDetector.addListeners();\n }\n\n // There is no way to remove these listeners, so ensure they are only added once\n if (!this._hasInitializedCoreListeners) {\n addGlobalListeners(this);\n\n this._hasInitializedCoreListeners = true;\n }\n } catch (err) {\n this._handleException(err);\n }\n\n this._performanceCleanupCallback = setupPerformanceObserver(this);\n }\n\n /**\n * Cleans up listeners that were created in `_addListeners`\n */\n _removeListeners() {\n try {\n WINDOW.document.removeEventListener('visibilitychange', this._handleVisibilityChange);\n\n WINDOW.removeEventListener('blur', this._handleWindowBlur);\n WINDOW.removeEventListener('focus', this._handleWindowFocus);\n WINDOW.removeEventListener('keydown', this._handleKeyboardEvent);\n\n if (this.clickDetector) {\n this.clickDetector.removeListeners();\n }\n\n if (this._performanceCleanupCallback) {\n this._performanceCleanupCallback();\n }\n } catch (err) {\n this._handleException(err);\n }\n }\n\n /**\n * Handle when visibility of the page content changes. Opening a new tab will\n * cause the state to change to hidden because of content of current page will\n * be hidden. Likewise, moving a different window to cover the contents of the\n * page will also trigger a change to a hidden state.\n */\n __init() {this._handleVisibilityChange = () => {\n if (WINDOW.document.visibilityState === 'visible') {\n this._doChangeToForegroundTasks();\n } else {\n this._doChangeToBackgroundTasks();\n }\n };}\n\n /**\n * Handle when page is blurred\n */\n __init2() {this._handleWindowBlur = () => {\n const breadcrumb = createBreadcrumb({\n category: 'ui.blur',\n });\n\n // Do not count blur as a user action -- it's part of the process of them\n // leaving the page\n this._doChangeToBackgroundTasks(breadcrumb);\n };}\n\n /**\n * Handle when page is focused\n */\n __init3() {this._handleWindowFocus = () => {\n const breadcrumb = createBreadcrumb({\n category: 'ui.focus',\n });\n\n // Do not count focus as a user action -- instead wait until they focus and\n // interactive with page\n this._doChangeToForegroundTasks(breadcrumb);\n };}\n\n /** Ensure page remains active when a key is pressed. */\n __init4() {this._handleKeyboardEvent = (event) => {\n handleKeyboardEvent(this, event);\n };}\n\n /**\n * Tasks to run when we consider a page to be hidden (via blurring and/or visibility)\n */\n _doChangeToBackgroundTasks(breadcrumb) {\n if (!this.session) {\n return;\n }\n\n const expired = isSessionExpired(this.session, {\n maxReplayDuration: this._options.maxReplayDuration,\n sessionIdleExpire: this.timeouts.sessionIdleExpire,\n });\n\n if (expired) {\n return;\n }\n\n if (breadcrumb) {\n this._createCustomBreadcrumb(breadcrumb);\n }\n\n // Send replay when the page/tab becomes hidden. There is no reason to send\n // replay if it becomes visible, since no actions we care about were done\n // while it was hidden\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n void this.conditionalFlush();\n }\n\n /**\n * Tasks to run when we consider a page to be visible (via focus and/or visibility)\n */\n _doChangeToForegroundTasks(breadcrumb) {\n if (!this.session) {\n return;\n }\n\n const isSessionActive = this.checkAndHandleExpiredSession();\n\n if (!isSessionActive) {\n // If the user has come back to the page within SESSION_IDLE_PAUSE_DURATION\n // ms, we will re-use the existing session, otherwise create a new\n // session\n logInfo('[Replay] Document has become active, but session has expired');\n return;\n }\n\n if (breadcrumb) {\n this._createCustomBreadcrumb(breadcrumb);\n }\n }\n\n /**\n * Update user activity (across session lifespans)\n */\n _updateUserActivity(_lastActivity = Date.now()) {\n this._lastActivity = _lastActivity;\n }\n\n /**\n * Updates the session's last activity timestamp\n */\n _updateSessionActivity(_lastActivity = Date.now()) {\n if (this.session) {\n this.session.lastActivity = _lastActivity;\n this._maybeSaveSession();\n }\n }\n\n /**\n * Helper to create (and buffer) a replay breadcrumb from a core SDK breadcrumb\n */\n _createCustomBreadcrumb(breadcrumb) {\n this.addUpdate(() => {\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this.throttledAddEvent({\n type: EventType.Custom,\n timestamp: breadcrumb.timestamp || 0,\n data: {\n tag: 'breadcrumb',\n payload: breadcrumb,\n },\n });\n });\n }\n\n /**\n * Observed performance events are added to `this.performanceEntries`. These\n * are included in the replay event before it is finished and sent to Sentry.\n */\n _addPerformanceEntries() {\n const performanceEntries = createPerformanceEntries(this.performanceEntries).concat(this.replayPerformanceEntries);\n\n this.performanceEntries = [];\n this.replayPerformanceEntries = [];\n\n return Promise.all(createPerformanceSpans(this, performanceEntries));\n }\n\n /**\n * Clear _context\n */\n _clearContext() {\n // XXX: `initialTimestamp` and `initialUrl` do not get cleared\n this._context.errorIds.clear();\n this._context.traceIds.clear();\n this._context.urls = [];\n }\n\n /** Update the initial timestamp based on the buffer content. */\n _updateInitialTimestampFromEventBuffer() {\n const { session, eventBuffer } = this;\n if (!session || !eventBuffer) {\n return;\n }\n\n // we only ever update this on the initial segment\n if (session.segmentId) {\n return;\n }\n\n const earliestEvent = eventBuffer.getEarliestTimestamp();\n if (earliestEvent && earliestEvent < this._context.initialTimestamp) {\n this._context.initialTimestamp = earliestEvent;\n }\n }\n\n /**\n * Return and clear _context\n */\n _popEventContext() {\n const _context = {\n initialTimestamp: this._context.initialTimestamp,\n initialUrl: this._context.initialUrl,\n errorIds: Array.from(this._context.errorIds),\n traceIds: Array.from(this._context.traceIds),\n urls: this._context.urls,\n };\n\n this._clearContext();\n\n return _context;\n }\n\n /**\n * Flushes replay event buffer to Sentry.\n *\n * Performance events are only added right before flushing - this is\n * due to the buffered performance observer events.\n *\n * Should never be called directly, only by `flush`\n */\n async _runFlush() {\n const replayId = this.getSessionId();\n\n if (!this.session || !this.eventBuffer || !replayId) {\n DEBUG_BUILD && logger.error('[Replay] No session or eventBuffer found to flush.');\n return;\n }\n\n await this._addPerformanceEntries();\n\n // Check eventBuffer again, as it could have been stopped in the meanwhile\n if (!this.eventBuffer || !this.eventBuffer.hasEvents) {\n return;\n }\n\n // Only attach memory event if eventBuffer is not empty\n await addMemoryEntry(this);\n\n // Check eventBuffer again, as it could have been stopped in the meanwhile\n if (!this.eventBuffer) {\n return;\n }\n\n // if this changed in the meanwhile, e.g. because the session was refreshed or similar, we abort here\n if (replayId !== this.getSessionId()) {\n return;\n }\n\n try {\n // This uses the data from the eventBuffer, so we need to call this before `finish()\n this._updateInitialTimestampFromEventBuffer();\n\n const timestamp = Date.now();\n\n // Check total duration again, to avoid sending outdated stuff\n // We leave 30s wiggle room to accomodate late flushing etc.\n // This _could_ happen when the browser is suspended during flushing, in which case we just want to stop\n if (timestamp - this._context.initialTimestamp > this._options.maxReplayDuration + 30000) {\n throw new Error('Session is too long, not sending replay');\n }\n\n const eventContext = this._popEventContext();\n // Always increment segmentId regardless of outcome of sending replay\n const segmentId = this.session.segmentId++;\n this._maybeSaveSession();\n\n // Note this empties the event buffer regardless of outcome of sending replay\n const recordingData = await this.eventBuffer.finish();\n\n await sendReplay({\n replayId,\n recordingData,\n segmentId,\n eventContext,\n session: this.session,\n options: this.getOptions(),\n timestamp,\n });\n } catch (err) {\n this._handleException(err);\n\n // This means we retried 3 times and all of them failed,\n // or we ran into a problem we don't want to retry, like rate limiting.\n // In this case, we want to completely stop the replay - otherwise, we may get inconsistent segments\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this.stop({ reason: 'sendReplay' });\n\n const client = getClient();\n\n if (client) {\n client.recordDroppedEvent('send_error', 'replay');\n }\n }\n }\n\n /**\n * Flush recording data to Sentry. Creates a lock so that only a single flush\n * can be active at a time. Do not call this directly.\n */\n __init5() {this._flush = async ({\n force = false,\n }\n\n = {}) => {\n if (!this._isEnabled && !force) {\n // This can happen if e.g. the replay was stopped because of exceeding the retry limit\n return;\n }\n\n if (!this.checkAndHandleExpiredSession()) {\n DEBUG_BUILD && logger.error('[Replay] Attempting to finish replay event after session expired.');\n return;\n }\n\n if (!this.session) {\n // should never happen, as we would have bailed out before\n return;\n }\n\n const start = this.session.started;\n const now = Date.now();\n const duration = now - start;\n\n // A flush is about to happen, cancel any queued flushes\n this._debouncedFlush.cancel();\n\n // If session is too short, or too long (allow some wiggle room over maxReplayDuration), do not send it\n // This _should_ not happen, but it may happen if flush is triggered due to a page activity change or similar\n const tooShort = duration < this._options.minReplayDuration;\n const tooLong = duration > this._options.maxReplayDuration + 5000;\n if (tooShort || tooLong) {\n logInfo(\n `[Replay] Session duration (${Math.floor(duration / 1000)}s) is too ${\n tooShort ? 'short' : 'long'\n }, not sending replay.`,\n this._options._experiments.traceInternals,\n );\n\n if (tooShort) {\n this._debouncedFlush();\n }\n return;\n }\n\n const eventBuffer = this.eventBuffer;\n if (eventBuffer && this.session.segmentId === 0 && !eventBuffer.hasCheckout) {\n logInfo('[Replay] Flushing initial segment without checkout.', this._options._experiments.traceInternals);\n // TODO FN: Evaluate if we want to stop here, or remove this again?\n }\n\n // this._flushLock acts as a lock so that future calls to `_flush()`\n // will be blocked until this promise resolves\n if (!this._flushLock) {\n this._flushLock = this._runFlush();\n await this._flushLock;\n this._flushLock = undefined;\n return;\n }\n\n // Wait for previous flush to finish, then call the debounced `_flush()`.\n // It's possible there are other flush requests queued and waiting for it\n // to resolve. We want to reduce all outstanding requests (as well as any\n // new flush requests that occur within a second of the locked flush\n // completing) into a single flush.\n\n try {\n await this._flushLock;\n } catch (err) {\n DEBUG_BUILD && logger.error(err);\n } finally {\n this._debouncedFlush();\n }\n };}\n\n /** Save the session, if it is sticky */\n _maybeSaveSession() {\n if (this.session && this._options.stickySession) {\n saveSession(this.session);\n }\n }\n\n /** Handler for rrweb.record.onMutation */\n __init6() {this._onMutationHandler = (mutations) => {\n const count = mutations.length;\n\n const mutationLimit = this._options.mutationLimit;\n const mutationBreadcrumbLimit = this._options.mutationBreadcrumbLimit;\n const overMutationLimit = mutationLimit && count > mutationLimit;\n\n // Create a breadcrumb if a lot of mutations happen at the same time\n // We can show this in the UI as an information with potential performance improvements\n if (count > mutationBreadcrumbLimit || overMutationLimit) {\n const breadcrumb = createBreadcrumb({\n category: 'replay.mutations',\n data: {\n count,\n limit: overMutationLimit,\n },\n });\n this._createCustomBreadcrumb(breadcrumb);\n }\n\n // Stop replay if over the mutation limit\n if (overMutationLimit) {\n // This should never reject\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n this.stop({ reason: 'mutationLimit', forceFlush: this.recordingMode === 'session' });\n return false;\n }\n\n // `true` means we use the regular mutation handling by rrweb\n return true;\n };}\n}\n\nfunction getOption(\n selectors,\n defaultSelectors,\n deprecatedClassOption,\n deprecatedSelectorOption,\n) {\n const deprecatedSelectors = typeof deprecatedSelectorOption === 'string' ? deprecatedSelectorOption.split(',') : [];\n\n const allSelectors = [\n ...selectors,\n // @deprecated\n ...deprecatedSelectors,\n\n // sentry defaults\n ...defaultSelectors,\n ];\n\n // @deprecated\n if (typeof deprecatedClassOption !== 'undefined') {\n // NOTE: No support for RegExp\n if (typeof deprecatedClassOption === 'string') {\n allSelectors.push(`.${deprecatedClassOption}`);\n }\n\n consoleSandbox(() => {\n // eslint-disable-next-line no-console\n console.warn(\n '[Replay] You are using a deprecated configuration item for privacy. Read the documentation on how to use the new privacy configuration.',\n );\n });\n }\n\n return allSelectors.join(',');\n}\n\n/**\n * Returns privacy related configuration for use in rrweb\n */\nfunction getPrivacyOptions({\n mask,\n unmask,\n block,\n unblock,\n ignore,\n\n // eslint-disable-next-line deprecation/deprecation\n blockClass,\n // eslint-disable-next-line deprecation/deprecation\n blockSelector,\n // eslint-disable-next-line deprecation/deprecation\n maskTextClass,\n // eslint-disable-next-line deprecation/deprecation\n maskTextSelector,\n // eslint-disable-next-line deprecation/deprecation\n ignoreClass,\n}) {\n const defaultBlockedElements = ['base[href=\"/\"]'];\n\n const maskSelector = getOption(mask, ['.sentry-mask', '[data-sentry-mask]'], maskTextClass, maskTextSelector);\n const unmaskSelector = getOption(unmask, ['.sentry-unmask', '[data-sentry-unmask]']);\n\n const options = {\n // We are making the decision to make text and input selectors the same\n maskTextSelector: maskSelector,\n unmaskTextSelector: unmaskSelector,\n\n blockSelector: getOption(\n block,\n ['.sentry-block', '[data-sentry-block]', ...defaultBlockedElements],\n blockClass,\n blockSelector,\n ),\n unblockSelector: getOption(unblock, ['.sentry-unblock', '[data-sentry-unblock]']),\n ignoreSelector: getOption(ignore, ['.sentry-ignore', '[data-sentry-ignore]', 'input[type=\"file\"]'], ignoreClass),\n };\n\n if (blockClass instanceof RegExp) {\n options.blockClass = blockClass;\n }\n\n if (maskTextClass instanceof RegExp) {\n options.maskTextClass = maskTextClass;\n }\n\n return options;\n}\n\n/**\n * Masks an attribute if necessary, otherwise return attribute value as-is.\n */\nfunction maskAttribute({\n el,\n key,\n maskAttributes,\n maskAllText,\n privacyOptions,\n value,\n}) {\n // We only mask attributes if `maskAllText` is true\n if (!maskAllText) {\n return value;\n }\n\n // unmaskTextSelector takes precendence\n if (privacyOptions.unmaskTextSelector && el.matches(privacyOptions.unmaskTextSelector)) {\n return value;\n }\n\n if (\n maskAttributes.includes(key) ||\n // Need to mask `value` attribute for `` if it's a button-like\n // type\n (key === 'value' && el.tagName === 'INPUT' && ['submit', 'button'].includes(el.getAttribute('type') || ''))\n ) {\n return value.replace(/[\\S]/g, '*');\n }\n\n return value;\n}\n\nconst MEDIA_SELECTORS =\n 'img,image,svg,video,object,picture,embed,map,audio,link[rel=\"icon\"],link[rel=\"apple-touch-icon\"]';\n\nconst DEFAULT_NETWORK_HEADERS = ['content-length', 'content-type', 'accept'];\n\nlet _initialized = false;\n\nconst replayIntegration = ((options) => {\n // eslint-disable-next-line deprecation/deprecation\n return new Replay(options);\n}) ;\n\n/**\n * The main replay integration class, to be passed to `init({ integrations: [] })`.\n * @deprecated Use `replayIntegration()` instead.\n */\nclass Replay {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'Replay';}\n\n /**\n * @inheritDoc\n */\n\n /**\n * Options to pass to `rrweb.record()`\n */\n\n /**\n * Initial options passed to the replay integration, merged with default values.\n * Note: `sessionSampleRate` and `errorSampleRate` are not required here, as they\n * can only be finally set when setupOnce() is called.\n *\n * @private\n */\n\n constructor({\n flushMinDelay = DEFAULT_FLUSH_MIN_DELAY,\n flushMaxDelay = DEFAULT_FLUSH_MAX_DELAY,\n minReplayDuration = MIN_REPLAY_DURATION,\n maxReplayDuration = MAX_REPLAY_DURATION,\n stickySession = true,\n useCompression = true,\n workerUrl,\n _experiments = {},\n sessionSampleRate,\n errorSampleRate,\n maskAllText = true,\n maskAllInputs = true,\n blockAllMedia = true,\n\n mutationBreadcrumbLimit = 750,\n mutationLimit = 10000,\n\n slowClickTimeout = 7000,\n slowClickIgnoreSelectors = [],\n\n networkDetailAllowUrls = [],\n networkDetailDenyUrls = [],\n networkCaptureBodies = true,\n networkRequestHeaders = [],\n networkResponseHeaders = [],\n\n mask = [],\n maskAttributes = ['title', 'placeholder'],\n unmask = [],\n block = [],\n unblock = [],\n ignore = [],\n maskFn,\n\n beforeAddRecordingEvent,\n beforeErrorSampling,\n\n // eslint-disable-next-line deprecation/deprecation\n blockClass,\n // eslint-disable-next-line deprecation/deprecation\n blockSelector,\n // eslint-disable-next-line deprecation/deprecation\n maskInputOptions,\n // eslint-disable-next-line deprecation/deprecation\n maskTextClass,\n // eslint-disable-next-line deprecation/deprecation\n maskTextSelector,\n // eslint-disable-next-line deprecation/deprecation\n ignoreClass,\n } = {}) {\n // eslint-disable-next-line deprecation/deprecation\n this.name = Replay.id;\n\n const privacyOptions = getPrivacyOptions({\n mask,\n unmask,\n block,\n unblock,\n ignore,\n blockClass,\n blockSelector,\n maskTextClass,\n maskTextSelector,\n ignoreClass,\n });\n\n this._recordingOptions = {\n maskAllInputs,\n maskAllText,\n maskInputOptions: { ...(maskInputOptions || {}), password: true },\n maskTextFn: maskFn,\n maskInputFn: maskFn,\n maskAttributeFn: (key, value, el) =>\n maskAttribute({\n maskAttributes,\n maskAllText,\n privacyOptions,\n key,\n value,\n el,\n }),\n\n ...privacyOptions,\n\n // Our defaults\n slimDOMOptions: 'all',\n inlineStylesheet: true,\n // Disable inline images as it will increase segment/replay size\n inlineImages: false,\n // collect fonts, but be aware that `sentry.io` needs to be an allowed\n // origin for playback\n collectFonts: true,\n errorHandler: (err) => {\n try {\n err.__rrweb__ = true;\n } catch (error) {\n // ignore errors here\n // this can happen if the error is frozen or does not allow mutation for other reasons\n }\n },\n };\n\n this._initialOptions = {\n flushMinDelay,\n flushMaxDelay,\n minReplayDuration: Math.min(minReplayDuration, MIN_REPLAY_DURATION_LIMIT),\n maxReplayDuration: Math.min(maxReplayDuration, MAX_REPLAY_DURATION),\n stickySession,\n sessionSampleRate,\n errorSampleRate,\n useCompression,\n workerUrl,\n blockAllMedia,\n maskAllInputs,\n maskAllText,\n mutationBreadcrumbLimit,\n mutationLimit,\n slowClickTimeout,\n slowClickIgnoreSelectors,\n networkDetailAllowUrls,\n networkDetailDenyUrls,\n networkCaptureBodies,\n networkRequestHeaders: _getMergedNetworkHeaders(networkRequestHeaders),\n networkResponseHeaders: _getMergedNetworkHeaders(networkResponseHeaders),\n beforeAddRecordingEvent,\n beforeErrorSampling,\n\n _experiments,\n };\n\n if (typeof sessionSampleRate === 'number') {\n // eslint-disable-next-line\n console.warn(\n `[Replay] You are passing \\`sessionSampleRate\\` to the Replay integration.\nThis option is deprecated and will be removed soon.\nInstead, configure \\`replaysSessionSampleRate\\` directly in the SDK init options, e.g.:\nSentry.init({ replaysSessionSampleRate: ${sessionSampleRate} })`,\n );\n\n this._initialOptions.sessionSampleRate = sessionSampleRate;\n }\n\n if (typeof errorSampleRate === 'number') {\n // eslint-disable-next-line\n console.warn(\n `[Replay] You are passing \\`errorSampleRate\\` to the Replay integration.\nThis option is deprecated and will be removed soon.\nInstead, configure \\`replaysOnErrorSampleRate\\` directly in the SDK init options, e.g.:\nSentry.init({ replaysOnErrorSampleRate: ${errorSampleRate} })`,\n );\n\n this._initialOptions.errorSampleRate = errorSampleRate;\n }\n\n if (this._initialOptions.blockAllMedia) {\n // `blockAllMedia` is a more user friendly option to configure blocking\n // embedded media elements\n this._recordingOptions.blockSelector = !this._recordingOptions.blockSelector\n ? MEDIA_SELECTORS\n : `${this._recordingOptions.blockSelector},${MEDIA_SELECTORS}`;\n }\n\n if (this._isInitialized && isBrowser()) {\n throw new Error('Multiple Sentry Session Replay instances are not supported');\n }\n\n this._isInitialized = true;\n }\n\n /** If replay has already been initialized */\n get _isInitialized() {\n return _initialized;\n }\n\n /** Update _isInitialized */\n set _isInitialized(value) {\n _initialized = value;\n }\n\n /**\n * Setup and initialize replay container\n */\n setupOnce() {\n if (!isBrowser()) {\n return;\n }\n\n this._setup();\n\n // Once upon a time, we tried to create a transaction in `setupOnce` and it would\n // potentially create a transaction before some native SDK integrations have run\n // and applied their own global event processor. An example is:\n // https://github.com/getsentry/sentry-javascript/blob/b47ceafbdac7f8b99093ce6023726ad4687edc48/packages/browser/src/integrations/useragent.ts\n //\n // So we call `this._initialize()` in next event loop as a workaround to wait for other\n // global event processors to finish. This is no longer needed, but keeping it\n // here to avoid any future issues.\n setTimeout(() => this._initialize());\n }\n\n /**\n * Start a replay regardless of sampling rate. Calling this will always\n * create a new session. Will throw an error if replay is already in progress.\n *\n * Creates or loads a session, attaches listeners to varying events (DOM,\n * PerformanceObserver, Recording, Sentry SDK, etc)\n */\n start() {\n if (!this._replay) {\n return;\n }\n\n this._replay.start();\n }\n\n /**\n * Start replay buffering. Buffers until `flush()` is called or, if\n * `replaysOnErrorSampleRate` > 0, until an error occurs.\n */\n startBuffering() {\n if (!this._replay) {\n return;\n }\n\n this._replay.startBuffering();\n }\n\n /**\n * Currently, this needs to be manually called (e.g. for tests). Sentry SDK\n * does not support a teardown\n */\n stop() {\n if (!this._replay) {\n return Promise.resolve();\n }\n\n return this._replay.stop({ forceFlush: this._replay.recordingMode === 'session' });\n }\n\n /**\n * If not in \"session\" recording mode, flush event buffer which will create a new replay.\n * Unless `continueRecording` is false, the replay will continue to record and\n * behave as a \"session\"-based replay.\n *\n * Otherwise, queue up a flush.\n */\n flush(options) {\n if (!this._replay || !this._replay.isEnabled()) {\n return Promise.resolve();\n }\n\n return this._replay.sendBufferedReplayOrFlush(options);\n }\n\n /**\n * Get the current session ID.\n */\n getReplayId() {\n if (!this._replay || !this._replay.isEnabled()) {\n return;\n }\n\n return this._replay.getSessionId();\n }\n\n /**\n * Initializes replay.\n */\n _initialize() {\n if (!this._replay) {\n return;\n }\n\n // We have to run this in _initialize, because this runs in setTimeout\n // So when this runs all integrations have been added\n // Before this, we cannot access integrations on the client,\n // so we need to mutate the options here\n this._maybeLoadFromReplayCanvasIntegration();\n\n this._replay.initializeSampling();\n }\n\n /** Setup the integration. */\n _setup() {\n // Client is not available in constructor, so we need to wait until setupOnce\n const finalOptions = loadReplayOptionsFromClient(this._initialOptions);\n\n this._replay = new ReplayContainer({\n options: finalOptions,\n recordingOptions: this._recordingOptions,\n });\n }\n\n /** Get canvas options from ReplayCanvas integration, if it is also added. */\n _maybeLoadFromReplayCanvasIntegration() {\n // To save bundle size, we skip checking for stuff here\n // and instead just try-catch everything - as generally this should all be defined\n /* eslint-disable @typescript-eslint/no-non-null-assertion */\n try {\n const client = getClient();\n const canvasIntegration = client.getIntegrationByName('ReplayCanvas')\n\n;\n if (!canvasIntegration) {\n return;\n }\n\n this._replay['_canvas'] = canvasIntegration.getOptions();\n } catch (e) {\n // ignore errors here\n }\n /* eslint-enable @typescript-eslint/no-non-null-assertion */\n }\n}Replay.__initStatic();\n\n/** Parse Replay-related options from SDK options */\nfunction loadReplayOptionsFromClient(initialOptions) {\n const client = getClient();\n const opt = client && (client.getOptions() );\n\n const finalOptions = { sessionSampleRate: 0, errorSampleRate: 0, ...dropUndefinedKeys(initialOptions) };\n\n if (!opt) {\n consoleSandbox(() => {\n // eslint-disable-next-line no-console\n console.warn('SDK client is not available.');\n });\n return finalOptions;\n }\n\n if (\n initialOptions.sessionSampleRate == null && // TODO remove once deprecated rates are removed\n initialOptions.errorSampleRate == null && // TODO remove once deprecated rates are removed\n opt.replaysSessionSampleRate == null &&\n opt.replaysOnErrorSampleRate == null\n ) {\n consoleSandbox(() => {\n // eslint-disable-next-line no-console\n console.warn(\n 'Replay is disabled because neither `replaysSessionSampleRate` nor `replaysOnErrorSampleRate` are set.',\n );\n });\n }\n\n if (typeof opt.replaysSessionSampleRate === 'number') {\n finalOptions.sessionSampleRate = opt.replaysSessionSampleRate;\n }\n\n if (typeof opt.replaysOnErrorSampleRate === 'number') {\n finalOptions.errorSampleRate = opt.replaysOnErrorSampleRate;\n }\n\n return finalOptions;\n}\n\nfunction _getMergedNetworkHeaders(headers) {\n return [...DEFAULT_NETWORK_HEADERS, ...headers.map(header => header.toLowerCase())];\n}\n\nexport { Replay, replayIntegration };\n","// https://github.com/alangpierce/sucrase/tree/265887868966917f3b924ce38dfad01fbab1329f\n//\n// The MIT License (MIT)\n//\n// Copyright (c) 2012-2018 various contributors (see AUTHORS)\n//\n// Permission is hereby granted, free of charge, to any person obtaining a copy\n// of this software and associated documentation files (the \"Software\"), to deal\n// in the Software without restriction, including without limitation the rights\n// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n// copies of the Software, and to permit persons to whom the Software is\n// furnished to do so, subject to the following conditions:\n//\n// The above copyright notice and this permission notice shall be included in all\n// copies or substantial portions of the Software.\n//\n// THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE\n// SOFTWARE.\n\n/**\n * Polyfill for the nullish coalescing operator (`??`).\n *\n * Note that the RHS is wrapped in a function so that if it's a computed value, that evaluation won't happen unless the\n * LHS evaluates to a nullish value, to mimic the operator's short-circuiting behavior.\n *\n * Adapted from Sucrase (https://github.com/alangpierce/sucrase)\n *\n * @param lhs The value of the expression to the left of the `??`\n * @param rhsFn A function returning the value of the expression to the right of the `??`\n * @returns The LHS value, unless it's `null` or `undefined`, in which case, the RHS value\n */\nfunction _nullishCoalesce(lhs, rhsFn) {\n // by checking for loose equality to `null`, we catch both `null` and `undefined`\n return lhs != null ? lhs : rhsFn();\n}\n\n// Sucrase version:\n// function _nullishCoalesce(lhs, rhsFn) {\n// if (lhs != null) {\n// return lhs;\n// } else {\n// return rhsFn();\n// }\n// }\n\nexport { _nullishCoalesce };\n","import { Component } from '@angular/core';\r\n\r\n@Component({\r\n selector: 'app-navigation-primary',\r\n templateUrl: './navigation-primary.component.html',\r\n styleUrls: ['./navigation-primary.component.css']\r\n})\r\nexport class NavigationPrimaryComponent {\r\n isMenuOpen = false;\r\n\r\n toggleMenu() {\r\n this.isMenuOpen = !this.isMenuOpen;\r\n }\r\n\r\n closeMenu() {\r\n this.isMenuOpen = false;\r\n }\r\n}\r\n","\r\n\r\n","import { Component } from '@angular/core';\r\n\r\n@Component({\r\n selector: 'app-header',\r\n templateUrl: './header.component.html',\r\n styleUrls: ['./header.component.css']\r\n})\r\nexport class HeaderComponent {\r\n\r\n}\r\n","
\r\n
\r\n \r\n \r\n \r\n
\r\n
\r\n","import { Component } from '@angular/core';\r\n\r\n@Component({\r\n selector: 'app-footer',\r\n templateUrl: './footer.component.html',\r\n styleUrls: ['./footer.component.css']\r\n})\r\nexport class FooterComponent {\r\n\r\n}\r\n","
\r\n
\r\n
\r\n
\r\n \"Чорнобильський\r\n
\r\n

Геоінформаційний портал

\r\n

Чорнобильського радіаційно-екологічного біосферного заповідника

\r\n

Проект розроблено Всеукраїнською аеро-геодезичною громадською організацією в рамках

\r\n

Програми ООН з навколишнього середовища UNEP

\r\n
\r\n
\r\n
\r\n
\r\n
\r\n \r\n

\r\n ©2024 \r\n

\r\n
\r\n
","import { Component } from '@angular/core';\r\n\r\n@Component({\r\n selector: 'app-section-confirmation',\r\n templateUrl: './section-confirmation.component.html',\r\n styleUrls: ['./section-confirmation.component.css']\r\n})\r\nexport class SectionConfirmationComponent {\r\n\r\n}\r\n","
\r\n
\r\n
\r\n
\r\n

\r\n Всі матеріали, розміщені на цьому сайті, призначені виключно для особистого використання та не можуть бути використані в комерційних цілях без попередньої письмової згоди власника сайту.\r\n

\r\n

\r\n Будь ласка, звертайтеся за додатковою інформацією та дозволом.\r\n

\r\n
\r\n
\r\n \r\n
\r\n
\r\n
\r\n
","\r\n
\r\n \r\n
\r\n
\r\n \r\n \r\n \r\n
\r\n\r\n\r\n","import { Component, OnInit } from '@angular/core';\r\n\r\n@Component({\r\n selector: 'app-root',\r\n templateUrl: './app.component.html',\r\n styleUrls: ['./app.component.css']\r\n})\r\nexport class AppComponent implements OnInit {\r\n title = 'portalGISApp';\r\n\r\n isConfirmed: boolean = true;\r\n constructor() { }\r\n\r\n ngOnInit(): void {\r\n let confirmed = localStorage.getItem('userConfirmed');\r\n if (confirmed) {\r\n this.isConfirmed = true;\r\n } else {\r\n this.isConfirmed = false;\r\n }\r\n }\r\n\r\n confirmUser() {\r\n localStorage.setItem('userConfirmed', 'confirmed');\r\n this.isConfirmed = true;\r\n }\r\n}\r\n","import { NgModule } from '@angular/core';\r\nimport { RouterModule, Routes } from '@angular/router';\r\n\r\n\r\nconst routes: Routes = [\r\n\r\n { path: 'home', loadChildren: () => import('./pages/home/home.module').then(m => m.HomeModule) },\r\n { path: 'about', loadChildren: () => import('./pages/about/about.module').then(m => m.AboutModule) },\r\n { path: 'webgis', loadChildren: () => import('./pages/webgis/webgis.module').then(m => m.WebgisModule) },\r\n { path: 'library', loadChildren: () => import('./pages/library/library.module').then(m => m.LibraryModule)},\r\n { path: 'media-library', loadChildren: () => import('./pages/media-library/media-library.module').then(m => m.MediaLibraryModule) },\r\n { path: '', redirectTo: 'home', pathMatch: 'full' },\r\n { path: '**', redirectTo: 'home' } \r\n];\r\n\r\n@NgModule({\r\n imports: [RouterModule.forRoot(routes,{ scrollPositionRestoration: 'enabled', anchorScrolling: 'enabled' })],\r\n exports: [RouterModule]\r\n})\r\nexport class AppRoutingModule { }\r\n","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { NavigationPrimaryComponent } from './navigation-primary.component';\r\nimport { AppRoutingModule } from 'src/app/app-routing.module';\r\n\r\n\r\n@NgModule({\r\n declarations: [\r\n NavigationPrimaryComponent\r\n ],\r\n imports: [\r\n CommonModule,\r\n AppRoutingModule\r\n ],\r\n exports: [ NavigationPrimaryComponent]\r\n})\r\nexport class NavigationModule { }\r\n","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { HeaderComponent } from './header.component';\r\nimport { LogoModule } from '../logo/logo.module';\r\nimport { ExternalLinksModule } from '../external-links/external-links.module';\r\nimport { NavigationModule } from '../navigation-primary/navigation.module';\r\n\r\n\r\n@NgModule({\r\n declarations: [HeaderComponent],\r\n imports: [\r\n CommonModule,\r\n LogoModule,\r\n ExternalLinksModule,\r\n NavigationModule\r\n ],\r\n exports: [HeaderComponent]\r\n})\r\nexport class HeaderModule { }\r\n","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { FooterComponent } from './footer.component';\r\nimport { ExternalLinksModule } from '../external-links/external-links.module';\r\n\r\n\r\n@NgModule({\r\n declarations: [FooterComponent],\r\n imports: [\r\n CommonModule,\r\n ExternalLinksModule,\r\n ],\r\n exports: [FooterComponent]\r\n})\r\nexport class FooterModule { }\r\n","import { Injectable } from '@angular/core';\r\nimport {\r\n HttpRequest,\r\n HttpHandler,\r\n HttpEvent,\r\n HttpInterceptor\r\n} from '@angular/common/http';\r\nimport { Observable } from 'rxjs';\r\nimport { ConfigService } from '../../services/config.service';\r\n\r\n@Injectable()\r\nexport class ApiKeyInterceptor implements HttpInterceptor {\r\n\r\n constructor(private config: ConfigService) { }\r\n\r\n intercept(request: HttpRequest, next: HttpHandler): Observable> {\r\n \r\n const modifiedRequest = request.clone({\r\n headers: request.headers.set('X-API-KEY', this.config.ApiKey)\r\n });\r\n\r\n return next.handle(modifiedRequest);\r\n }\r\n}\r\n","import { ErrorHandler, Injectable } from '@angular/core';\r\n\r\n@Injectable({\r\n providedIn: 'root'\r\n})\r\nexport class ErrorHandlerService extends ErrorHandler {\r\n\r\n constructor() {\r\n super();\r\n }\r\n\r\n override handleError(error: Error) {\r\n // TODO Manually log exception\r\n }\r\n}\r\n","import { NgModule } from '@angular/core';\r\nimport { CommonModule } from '@angular/common';\r\nimport { SectionConfirmationComponent } from './section-confirmation.component';\r\n\r\n\r\n\r\n@NgModule({\r\n declarations: [\r\n SectionConfirmationComponent\r\n ],\r\n imports: [\r\n CommonModule\r\n ],\r\n exports: [SectionConfirmationComponent]\r\n})\r\nexport class SectionConfirmationModule { }\r\n","import { APP_INITIALIZER, ErrorHandler, NgModule } from '@angular/core';\r\nimport { Router } from \"@angular/router\";\r\nimport { BrowserModule } from '@angular/platform-browser';\r\nimport { AppComponent } from './app.component';\r\nimport { AppRoutingModule } from './app-routing.module';\r\n\r\nimport { HeaderModule } from './components/header/header.module';\r\nimport { FooterModule } from './components/footer/footer.module';\r\n\r\nimport { HTTP_INTERCEPTORS, HttpClientModule } from '@angular/common/http';\r\nimport { ApiKeyInterceptor } from './core/interceptors/api-key.interceptor'\r\nimport { RouterModule } from '@angular/router';\r\nimport { CommonModule } from '@angular/common';\r\nimport { ErrorHandlerService } from './services/error-handler.service';\r\n\r\nimport { SectionConfirmationModule } from './components/section-confirmation/section-confirmation.module';\r\nimport * as Sentry from \"@sentry/angular-ivy\";\r\n\r\n@NgModule({\r\n declarations: [\r\n AppComponent,\r\n ],\r\n imports: [\r\n BrowserModule,\r\n AppRoutingModule,\r\n HttpClientModule,\r\n RouterModule,\r\n CommonModule,\r\n HeaderModule,\r\n FooterModule,\r\n SectionConfirmationModule \r\n ],\r\n providers: [\r\n { provide: HTTP_INTERCEPTORS, useClass: ApiKeyInterceptor, multi: true },\r\n {\r\n provide: ErrorHandler,\r\n useClass: ErrorHandlerService,\r\n useValue: Sentry.createErrorHandler({\r\n showDialog: false,\r\n }),\r\n }, {\r\n provide: Sentry.TraceService,\r\n deps: [Router],\r\n },\r\n {\r\n provide: APP_INITIALIZER,\r\n useFactory: () => () => { },\r\n deps: [Sentry.TraceService],\r\n multi: true,\r\n },\r\n ],\r\n bootstrap: [AppComponent]\r\n})\r\nexport class AppModule { }\r\n","import { platformBrowserDynamic } from '@angular/platform-browser-dynamic';\r\nimport * as Sentry from \"@sentry/angular-ivy\";\r\nimport { AppModule } from './app/app.module';\r\nimport { environment } from './environments/environment';\r\n\r\nif (environment.sentryEnable) {\r\n Sentry.init({\r\n dsn: \"https://119cf0555ff394a7d36a2a84c220e019@o4505942746136576.ingest.sentry.io/4506502082920448\",\r\n release: \"1.1\",\r\n integrations: [\r\n new Sentry.BrowserTracing({\r\n routingInstrumentation: Sentry.routingInstrumentation,\r\n }),\r\n Sentry.replayIntegration({\r\n maskAllText: false,\r\n blockAllMedia: false,\r\n }),\r\n ],\r\n // Performance Monitoring\r\n tracesSampleRate: 1.0, // Capture 100% of the transactions\r\n // Set 'tracePropagationTargets' to control for which URLs distributed tracing should be enabled , /^https:\\/\\/ecoportal\\.azurewebsites\\.net\\//\r\n tracePropagationTargets: [/^https:\\/\\/www\\.geo-portal\\.org\\.net\\//],\r\n // Session Replay\r\n replaysSessionSampleRate: 0.1, // This sets the sample rate at 10%. You may want to change it to 100% while in development and then sample at a lower rate in production.\r\n replaysOnErrorSampleRate: 1.0, // If you're not already sampling the entire session, change the sample rate to 100% when sampling sessions where errors occur.\r\n });\r\n Sentry.setTag(\"projectName\", \"geo-portal\");\r\n}\r\n\r\nplatformBrowserDynamic()\r\n .bootstrapModule(AppModule)\r\n .then((success) => console.log('EcoGis success'))\r\n .catch((err) => console.error(err));\r\n","import { getActiveTransaction, spanToJSON } from '@sentry/core';\nimport { logger } from '@sentry/utils';\nimport { DEBUG_BUILD } from '../common/debug-build.js';\nimport { WINDOW } from './types.js';\n\n/**\n * Add a listener that cancels and finishes a transaction when the global\n * document is hidden.\n */\nfunction registerBackgroundTabDetection() {\n if (WINDOW && WINDOW.document) {\n WINDOW.document.addEventListener('visibilitychange', () => {\n // eslint-disable-next-line deprecation/deprecation\n const activeTransaction = getActiveTransaction() ;\n if (WINDOW.document.hidden && activeTransaction) {\n const statusType = 'cancelled';\n\n const { op, status } = spanToJSON(activeTransaction);\n\n DEBUG_BUILD &&\n logger.log(`[Tracing] Transaction: ${statusType} -> since tab moved to the background, op: ${op}`);\n // We should not set status if it is already set, this prevent important statuses like\n // error or data loss from being overwritten on transaction.\n if (!status) {\n activeTransaction.setStatus(statusType);\n }\n // TODO: Can we rewrite this to an attribute?\n // eslint-disable-next-line deprecation/deprecation\n activeTransaction.setTag('visibilitychange', 'document.hidden');\n activeTransaction.end();\n }\n });\n } else {\n DEBUG_BUILD && logger.warn('[Tracing] Could not set up background tab detection due to lack of global document');\n }\n}\n\nexport { registerBackgroundTabDetection };\n","import { getActiveTransaction } from './utils.js';\n\n/**\n * Adds a measurement to the current active transaction.\n */\nfunction setMeasurement(name, value, unit) {\n // eslint-disable-next-line deprecation/deprecation\n const transaction = getActiveTransaction();\n if (transaction) {\n // eslint-disable-next-line deprecation/deprecation\n transaction.setMeasurement(name, value, unit);\n }\n}\n\nexport { setMeasurement };\n","/*\n * This module exists for optimizations in the build process through rollup and terser. We define some global\n * constants, which can be overridden during build. By guarding certain pieces of code with functions that return these\n * constants, we can control whether or not they appear in the final bundle. (Any code guarded by a false condition will\n * never run, and will hence be dropped during treeshaking.) The two primary uses for this are stripping out calls to\n * `logger` and preventing node-related code from appearing in browser bundles.\n *\n * Attention:\n * This file should not be used to define constants/flags that are intended to be used for tree-shaking conducted by\n * users. These flags should live in their respective packages, as we identified user tooling (specifically webpack)\n * having issues tree-shaking these constants across package boundaries.\n * An example for this is the __SENTRY_DEBUG__ constant. It is declared in each package individually because we want\n * users to be able to shake away expressions that it guards.\n */\n\n/**\n * Figures out if we're building a browser bundle.\n *\n * @returns true if this is a browser bundle build.\n */\nfunction isBrowserBundle() {\n return typeof __SENTRY_BROWSER_BUNDLE__ !== 'undefined' && !!__SENTRY_BROWSER_BUNDLE__;\n}\n\n/**\n * Get source of SDK.\n */\nfunction getSDKSource() {\n // @ts-expect-error \"npm\" is injected by rollup during build process\n return \"npm\";\n}\n\nexport { getSDKSource, isBrowserBundle };\n","import { isBrowserBundle } from './env.js';\n\n/**\n * NOTE: In order to avoid circular dependencies, if you add a function to this module and it needs to print something,\n * you must either a) use `console.log` rather than the logger, or b) put your function elsewhere.\n */\n\n/**\n * Checks whether we're in the Node.js or Browser environment\n *\n * @returns Answer to given question\n */\nfunction isNodeEnv() {\n // explicitly check for browser bundles as those can be optimized statically\n // by terser/rollup.\n return (\n !isBrowserBundle() &&\n Object.prototype.toString.call(typeof process !== 'undefined' ? process : 0) === '[object process]'\n );\n}\n\n/**\n * Requires a module which is protected against bundler minification.\n *\n * @param request The module path to resolve\n */\n// eslint-disable-next-line @typescript-eslint/explicit-module-boundary-types, @typescript-eslint/no-explicit-any\nfunction dynamicRequire(mod, request) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return mod.require(request);\n}\n\n/**\n * Helper for dynamically loading module that should work with linked dependencies.\n * The problem is that we _should_ be using `require(require.resolve(moduleName, { paths: [cwd()] }))`\n * However it's _not possible_ to do that with Webpack, as it has to know all the dependencies during\n * build time. `require.resolve` is also not available in any other way, so we cannot create,\n * a fake helper like we do with `dynamicRequire`.\n *\n * We always prefer to use local package, thus the value is not returned early from each `try/catch` block.\n * That is to mimic the behavior of `require.resolve` exactly.\n *\n * @param moduleName module name to require\n * @returns possibly required module\n */\nfunction loadModule(moduleName) {\n let mod;\n\n try {\n mod = dynamicRequire(module, moduleName);\n } catch (e) {\n // no-empty\n }\n\n try {\n const { cwd } = dynamicRequire(module, 'process');\n mod = dynamicRequire(module, `${cwd()}/node_modules/${moduleName}`) ;\n } catch (e) {\n // no-empty\n }\n\n return mod;\n}\n\nexport { dynamicRequire, isNodeEnv, loadModule };\n","import { Subject } from './Subject';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n !subscription.closed && subscriber.next(this._value);\n return subscription;\n }\n getValue() {\n const { hasError, thrownError, _value } = this;\n if (hasError) {\n throw thrownError;\n }\n this._throwIfClosed();\n return _value;\n }\n next(value) {\n super.next((this._value = value));\n }\n}\n","import { SafeSubscriber, Subscriber } from './Subscriber';\nimport { isSubscription } from './Subscription';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nimport { isFunction } from './util/isFunction';\nimport { errorContext } from './util/errorContext';\nexport class Observable {\n constructor(subscribe) {\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const subscriber = isSubscriber(observerOrNext) ? observerOrNext : new SafeSubscriber(observerOrNext, error, complete);\n errorContext(() => {\n const { operator, source } = this;\n subscriber.add(operator\n ?\n operator.call(subscriber, source)\n : source\n ?\n this._subscribe(subscriber)\n :\n this._trySubscribe(subscriber));\n });\n return subscriber;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n sink.error(err);\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n const subscriber = new SafeSubscriber({\n next: (value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n subscriber.unsubscribe();\n }\n },\n error: reject,\n complete: resolve,\n });\n this.subscribe(subscriber);\n });\n }\n _subscribe(subscriber) {\n var _a;\n return (_a = this.source) === null || _a === void 0 ? void 0 : _a.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => (value = x), (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n var _a;\n return (_a = promiseCtor !== null && promiseCtor !== void 0 ? promiseCtor : config.Promise) !== null && _a !== void 0 ? _a : Promise;\n}\nfunction isObserver(value) {\n return value && isFunction(value.next) && isFunction(value.error) && isFunction(value.complete);\n}\nfunction isSubscriber(value) {\n return (value && value instanceof Subscriber) || (isObserver(value) && isSubscription(value));\n}\n","import { createErrorClass } from './createErrorClass';\nexport const ObjectUnsubscribedError = createErrorClass((_super) => function ObjectUnsubscribedErrorImpl() {\n _super(this);\n this.name = 'ObjectUnsubscribedError';\n this.message = 'object unsubscribed';\n});\n","import { Observable } from './Observable';\nimport { Subscription, EMPTY_SUBSCRIPTION } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { arrRemove } from './util/arrRemove';\nimport { errorContext } from './util/errorContext';\nexport class Subject extends Observable {\n constructor() {\n super();\n this.closed = false;\n this.currentObservers = null;\n this.observers = [];\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n _throwIfClosed() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n }\n next(value) {\n errorContext(() => {\n this._throwIfClosed();\n if (!this.isStopped) {\n if (!this.currentObservers) {\n this.currentObservers = Array.from(this.observers);\n }\n for (const observer of this.currentObservers) {\n observer.next(value);\n }\n }\n });\n }\n error(err) {\n errorContext(() => {\n this._throwIfClosed();\n if (!this.isStopped) {\n this.hasError = this.isStopped = true;\n this.thrownError = err;\n const { observers } = this;\n while (observers.length) {\n observers.shift().error(err);\n }\n }\n });\n }\n complete() {\n errorContext(() => {\n this._throwIfClosed();\n if (!this.isStopped) {\n this.isStopped = true;\n const { observers } = this;\n while (observers.length) {\n observers.shift().complete();\n }\n }\n });\n }\n unsubscribe() {\n this.isStopped = this.closed = true;\n this.observers = this.currentObservers = null;\n }\n get observed() {\n var _a;\n return ((_a = this.observers) === null || _a === void 0 ? void 0 : _a.length) > 0;\n }\n _trySubscribe(subscriber) {\n this._throwIfClosed();\n return super._trySubscribe(subscriber);\n }\n _subscribe(subscriber) {\n this._throwIfClosed();\n this._checkFinalizedStatuses(subscriber);\n return this._innerSubscribe(subscriber);\n }\n _innerSubscribe(subscriber) {\n const { hasError, isStopped, observers } = this;\n if (hasError || isStopped) {\n return EMPTY_SUBSCRIPTION;\n }\n this.currentObservers = null;\n observers.push(subscriber);\n return new Subscription(() => {\n this.currentObservers = null;\n arrRemove(observers, subscriber);\n });\n }\n _checkFinalizedStatuses(subscriber) {\n const { hasError, thrownError, isStopped } = this;\n if (hasError) {\n subscriber.error(thrownError);\n }\n else if (isStopped) {\n subscriber.complete();\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n var _a, _b;\n (_b = (_a = this.destination) === null || _a === void 0 ? void 0 : _a.next) === null || _b === void 0 ? void 0 : _b.call(_a, value);\n }\n error(err) {\n var _a, _b;\n (_b = (_a = this.destination) === null || _a === void 0 ? void 0 : _a.error) === null || _b === void 0 ? void 0 : _b.call(_a, err);\n }\n complete() {\n var _a, _b;\n (_b = (_a = this.destination) === null || _a === void 0 ? void 0 : _a.complete) === null || _b === void 0 ? void 0 : _b.call(_a);\n }\n _subscribe(subscriber) {\n var _a, _b;\n return (_b = (_a = this.source) === null || _a === void 0 ? void 0 : _a.subscribe(subscriber)) !== null && _b !== void 0 ? _b : EMPTY_SUBSCRIPTION;\n }\n}\n","export const COMPLETE_NOTIFICATION = (() => createNotification('C', undefined, undefined))();\nexport function errorNotification(error) {\n return createNotification('E', undefined, error);\n}\nexport function nextNotification(value) {\n return createNotification('N', value, undefined);\n}\nexport function createNotification(kind, value, error) {\n return {\n kind,\n value,\n error,\n };\n}\n","import { isFunction } from './util/isFunction';\nimport { isSubscription, Subscription } from './Subscription';\nimport { config } from './config';\nimport { reportUnhandledError } from './util/reportUnhandledError';\nimport { noop } from './util/noop';\nimport { nextNotification, errorNotification, COMPLETE_NOTIFICATION } from './NotificationFactories';\nimport { timeoutProvider } from './scheduler/timeoutProvider';\nimport { captureError } from './util/errorContext';\nexport class Subscriber extends Subscription {\n constructor(destination) {\n super();\n this.isStopped = false;\n if (destination) {\n this.destination = destination;\n if (isSubscription(destination)) {\n destination.add(this);\n }\n }\n else {\n this.destination = EMPTY_OBSERVER;\n }\n }\n static create(next, error, complete) {\n return new SafeSubscriber(next, error, complete);\n }\n next(value) {\n if (this.isStopped) {\n handleStoppedNotification(nextNotification(value), this);\n }\n else {\n this._next(value);\n }\n }\n error(err) {\n if (this.isStopped) {\n handleStoppedNotification(errorNotification(err), this);\n }\n else {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (this.isStopped) {\n handleStoppedNotification(COMPLETE_NOTIFICATION, this);\n }\n else {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (!this.closed) {\n this.isStopped = true;\n super.unsubscribe();\n this.destination = null;\n }\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n try {\n this.destination.error(err);\n }\n finally {\n this.unsubscribe();\n }\n }\n _complete() {\n try {\n this.destination.complete();\n }\n finally {\n this.unsubscribe();\n }\n }\n}\nconst _bind = Function.prototype.bind;\nfunction bind(fn, thisArg) {\n return _bind.call(fn, thisArg);\n}\nclass ConsumerObserver {\n constructor(partialObserver) {\n this.partialObserver = partialObserver;\n }\n next(value) {\n const { partialObserver } = this;\n if (partialObserver.next) {\n try {\n partialObserver.next(value);\n }\n catch (error) {\n handleUnhandledError(error);\n }\n }\n }\n error(err) {\n const { partialObserver } = this;\n if (partialObserver.error) {\n try {\n partialObserver.error(err);\n }\n catch (error) {\n handleUnhandledError(error);\n }\n }\n else {\n handleUnhandledError(err);\n }\n }\n complete() {\n const { partialObserver } = this;\n if (partialObserver.complete) {\n try {\n partialObserver.complete();\n }\n catch (error) {\n handleUnhandledError(error);\n }\n }\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(observerOrNext, error, complete) {\n super();\n let partialObserver;\n if (isFunction(observerOrNext) || !observerOrNext) {\n partialObserver = {\n next: (observerOrNext !== null && observerOrNext !== void 0 ? observerOrNext : undefined),\n error: error !== null && error !== void 0 ? error : undefined,\n complete: complete !== null && complete !== void 0 ? complete : undefined,\n };\n }\n else {\n let context;\n if (this && config.useDeprecatedNextContext) {\n context = Object.create(observerOrNext);\n context.unsubscribe = () => this.unsubscribe();\n partialObserver = {\n next: observerOrNext.next && bind(observerOrNext.next, context),\n error: observerOrNext.error && bind(observerOrNext.error, context),\n complete: observerOrNext.complete && bind(observerOrNext.complete, context),\n };\n }\n else {\n partialObserver = observerOrNext;\n }\n }\n this.destination = new ConsumerObserver(partialObserver);\n }\n}\nfunction handleUnhandledError(error) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n captureError(error);\n }\n else {\n reportUnhandledError(error);\n }\n}\nfunction defaultErrorHandler(err) {\n throw err;\n}\nfunction handleStoppedNotification(notification, subscriber) {\n const { onStoppedNotification } = config;\n onStoppedNotification && timeoutProvider.setTimeout(() => onStoppedNotification(notification, subscriber));\n}\nexport const EMPTY_OBSERVER = {\n closed: true,\n next: noop,\n error: defaultErrorHandler,\n complete: noop,\n};\n","import { createErrorClass } from './createErrorClass';\nexport const UnsubscriptionError = createErrorClass((_super) => function UnsubscriptionErrorImpl(errors) {\n _super(this);\n this.message = errors\n ? `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}`\n : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n});\n","import { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nimport { arrRemove } from './util/arrRemove';\nexport class Subscription {\n constructor(initialTeardown) {\n this.initialTeardown = initialTeardown;\n this.closed = false;\n this._parentage = null;\n this._finalizers = null;\n }\n unsubscribe() {\n let errors;\n if (!this.closed) {\n this.closed = true;\n const { _parentage } = this;\n if (_parentage) {\n this._parentage = null;\n if (Array.isArray(_parentage)) {\n for (const parent of _parentage) {\n parent.remove(this);\n }\n }\n else {\n _parentage.remove(this);\n }\n }\n const { initialTeardown: initialFinalizer } = this;\n if (isFunction(initialFinalizer)) {\n try {\n initialFinalizer();\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? e.errors : [e];\n }\n }\n const { _finalizers } = this;\n if (_finalizers) {\n this._finalizers = null;\n for (const finalizer of _finalizers) {\n try {\n execFinalizer(finalizer);\n }\n catch (err) {\n errors = errors !== null && errors !== void 0 ? errors : [];\n if (err instanceof UnsubscriptionError) {\n errors = [...errors, ...err.errors];\n }\n else {\n errors.push(err);\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n }\n add(teardown) {\n var _a;\n if (teardown && teardown !== this) {\n if (this.closed) {\n execFinalizer(teardown);\n }\n else {\n if (teardown instanceof Subscription) {\n if (teardown.closed || teardown._hasParent(this)) {\n return;\n }\n teardown._addParent(this);\n }\n (this._finalizers = (_a = this._finalizers) !== null && _a !== void 0 ? _a : []).push(teardown);\n }\n }\n }\n _hasParent(parent) {\n const { _parentage } = this;\n return _parentage === parent || (Array.isArray(_parentage) && _parentage.includes(parent));\n }\n _addParent(parent) {\n const { _parentage } = this;\n this._parentage = Array.isArray(_parentage) ? (_parentage.push(parent), _parentage) : _parentage ? [_parentage, parent] : parent;\n }\n _removeParent(parent) {\n const { _parentage } = this;\n if (_parentage === parent) {\n this._parentage = null;\n }\n else if (Array.isArray(_parentage)) {\n arrRemove(_parentage, parent);\n }\n }\n remove(teardown) {\n const { _finalizers } = this;\n _finalizers && arrRemove(_finalizers, teardown);\n if (teardown instanceof Subscription) {\n teardown._removeParent(this);\n }\n }\n}\nSubscription.EMPTY = (() => {\n const empty = new Subscription();\n empty.closed = true;\n return empty;\n})();\nexport const EMPTY_SUBSCRIPTION = Subscription.EMPTY;\nexport function isSubscription(value) {\n return (value instanceof Subscription ||\n (value && 'closed' in value && isFunction(value.remove) && isFunction(value.add) && isFunction(value.unsubscribe)));\n}\nfunction execFinalizer(finalizer) {\n if (isFunction(finalizer)) {\n finalizer();\n }\n else {\n finalizer.unsubscribe();\n }\n}\n","export const config = {\n onUnhandledError: null,\n onStoppedNotification: null,\n Promise: undefined,\n useDeprecatedSynchronousErrorHandling: false,\n useDeprecatedNextContext: false,\n};\n","import { Observable } from '../Observable';\nimport { argsArgArrayOrObject } from '../util/argsArgArrayOrObject';\nimport { from } from './from';\nimport { identity } from '../util/identity';\nimport { mapOneOrManyArgs } from '../util/mapOneOrManyArgs';\nimport { popResultSelector, popScheduler } from '../util/args';\nimport { createObject } from '../util/createObject';\nimport { createOperatorSubscriber } from '../operators/OperatorSubscriber';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function combineLatest(...args) {\n const scheduler = popScheduler(args);\n const resultSelector = popResultSelector(args);\n const { args: observables, keys } = argsArgArrayOrObject(args);\n if (observables.length === 0) {\n return from([], scheduler);\n }\n const result = new Observable(combineLatestInit(observables, scheduler, keys\n ?\n (values) => createObject(keys, values)\n :\n identity));\n return resultSelector ? result.pipe(mapOneOrManyArgs(resultSelector)) : result;\n}\nexport function combineLatestInit(observables, scheduler, valueTransform = identity) {\n return (subscriber) => {\n maybeSchedule(scheduler, () => {\n const { length } = observables;\n const values = new Array(length);\n let active = length;\n let remainingFirstValues = length;\n for (let i = 0; i < length; i++) {\n maybeSchedule(scheduler, () => {\n const source = from(observables[i], scheduler);\n let hasFirstValue = false;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n values[i] = value;\n if (!hasFirstValue) {\n hasFirstValue = true;\n remainingFirstValues--;\n }\n if (!remainingFirstValues) {\n subscriber.next(valueTransform(values.slice()));\n }\n }, () => {\n if (!--active) {\n subscriber.complete();\n }\n }));\n }, subscriber);\n }\n }, subscriber);\n };\n}\nfunction maybeSchedule(scheduler, execute, subscription) {\n if (scheduler) {\n executeSchedule(subscription, scheduler, execute);\n }\n else {\n execute();\n }\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable((subscriber) => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable((subscriber) => scheduler.schedule(() => subscriber.complete()));\n}\n","import { executeSchedule } from '../util/executeSchedule';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function observeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n source.subscribe(createOperatorSubscriber(subscriber, (value) => executeSchedule(subscriber, scheduler, () => subscriber.next(value), delay), () => executeSchedule(subscriber, scheduler, () => subscriber.complete(), delay), (err) => executeSchedule(subscriber, scheduler, () => subscriber.error(err), delay)));\n });\n}\n","import { operate } from '../util/lift';\nexport function subscribeOn(scheduler, delay = 0) {\n return operate((source, subscriber) => {\n subscriber.add(scheduler.schedule(() => source.subscribe(subscriber), delay));\n });\n}\n","import { Observable } from '../Observable';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleAsyncIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable((subscriber) => {\n executeSchedule(subscriber, scheduler, () => {\n const iterator = input[Symbol.asyncIterator]();\n executeSchedule(subscriber, scheduler, () => {\n iterator.next().then((result) => {\n if (result.done) {\n subscriber.complete();\n }\n else {\n subscriber.next(result.value);\n }\n });\n }, 0, true);\n });\n });\n}\n","import { scheduled } from '../scheduled/scheduled';\nimport { innerFrom } from './innerFrom';\nexport function from(input, scheduler) {\n return scheduler ? scheduled(input, scheduler) : innerFrom(input);\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nimport { isAsyncIterable } from '../util/isAsyncIterable';\nimport { createInvalidObservableTypeError } from '../util/throwUnobservableError';\nimport { isReadableStreamLike } from '../util/isReadableStreamLike';\nimport { scheduleReadableStreamLike } from './scheduleReadableStreamLike';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n if (isAsyncIterable(input)) {\n return scheduleAsyncIterable(input, scheduler);\n }\n if (isIterable(input)) {\n return scheduleIterable(input, scheduler);\n }\n if (isReadableStreamLike(input)) {\n return scheduleReadableStreamLike(input, scheduler);\n }\n }\n throw createInvalidObservableTypeError(input);\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function scheduleObservable(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nexport function scheduleArray(input, scheduler) {\n return new Observable((subscriber) => {\n let i = 0;\n return scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n }\n else {\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n this.schedule();\n }\n }\n });\n });\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { observeOn } from '../operators/observeOn';\nimport { subscribeOn } from '../operators/subscribeOn';\nexport function schedulePromise(input, scheduler) {\n return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));\n}\n","import { Observable } from '../Observable';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { isFunction } from '../util/isFunction';\nimport { executeSchedule } from '../util/executeSchedule';\nexport function scheduleIterable(input, scheduler) {\n return new Observable((subscriber) => {\n let iterator;\n executeSchedule(subscriber, scheduler, () => {\n iterator = input[Symbol_iterator]();\n executeSchedule(subscriber, scheduler, () => {\n let value;\n let done;\n try {\n ({ value, done } = iterator.next());\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n }\n }, 0, true);\n });\n return () => isFunction(iterator === null || iterator === void 0 ? void 0 : iterator.return) && iterator.return();\n });\n}\n","import { scheduleAsyncIterable } from './scheduleAsyncIterable';\nimport { readableStreamLikeToAsyncGenerator } from '../util/isReadableStreamLike';\nexport function scheduleReadableStreamLike(input, scheduler) {\n return scheduleAsyncIterable(readableStreamLikeToAsyncGenerator(input), scheduler);\n}\n","import { __asyncValues, __awaiter } from \"tslib\";\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isPromise } from '../util/isPromise';\nimport { Observable } from '../Observable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isAsyncIterable } from '../util/isAsyncIterable';\nimport { createInvalidObservableTypeError } from '../util/throwUnobservableError';\nimport { isIterable } from '../util/isIterable';\nimport { isReadableStreamLike, readableStreamLikeToAsyncGenerator } from '../util/isReadableStreamLike';\nimport { isFunction } from '../util/isFunction';\nimport { reportUnhandledError } from '../util/reportUnhandledError';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function innerFrom(input) {\n if (input instanceof Observable) {\n return input;\n }\n if (input != null) {\n if (isInteropObservable(input)) {\n return fromInteropObservable(input);\n }\n if (isArrayLike(input)) {\n return fromArrayLike(input);\n }\n if (isPromise(input)) {\n return fromPromise(input);\n }\n if (isAsyncIterable(input)) {\n return fromAsyncIterable(input);\n }\n if (isIterable(input)) {\n return fromIterable(input);\n }\n if (isReadableStreamLike(input)) {\n return fromReadableStreamLike(input);\n }\n }\n throw createInvalidObservableTypeError(input);\n}\nexport function fromInteropObservable(obj) {\n return new Observable((subscriber) => {\n const obs = obj[Symbol_observable]();\n if (isFunction(obs.subscribe)) {\n return obs.subscribe(subscriber);\n }\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n });\n}\nexport function fromArrayLike(array) {\n return new Observable((subscriber) => {\n for (let i = 0; i < array.length && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n });\n}\nexport function fromPromise(promise) {\n return new Observable((subscriber) => {\n promise\n .then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, reportUnhandledError);\n });\n}\nexport function fromIterable(iterable) {\n return new Observable((subscriber) => {\n for (const value of iterable) {\n subscriber.next(value);\n if (subscriber.closed) {\n return;\n }\n }\n subscriber.complete();\n });\n}\nexport function fromAsyncIterable(asyncIterable) {\n return new Observable((subscriber) => {\n process(asyncIterable, subscriber).catch((err) => subscriber.error(err));\n });\n}\nexport function fromReadableStreamLike(readableStream) {\n return fromAsyncIterable(readableStreamLikeToAsyncGenerator(readableStream));\n}\nfunction process(asyncIterable, subscriber) {\n var asyncIterable_1, asyncIterable_1_1;\n var e_1, _a;\n return __awaiter(this, void 0, void 0, function* () {\n try {\n for (asyncIterable_1 = __asyncValues(asyncIterable); asyncIterable_1_1 = yield asyncIterable_1.next(), !asyncIterable_1_1.done;) {\n const value = asyncIterable_1_1.value;\n subscriber.next(value);\n if (subscriber.closed) {\n return;\n }\n }\n }\n catch (e_1_1) { e_1 = { error: e_1_1 }; }\n finally {\n try {\n if (asyncIterable_1_1 && !asyncIterable_1_1.done && (_a = asyncIterable_1.return)) yield _a.call(asyncIterable_1);\n }\n finally { if (e_1) throw e_1.error; }\n }\n subscriber.complete();\n });\n}\n","import { popScheduler } from '../util/args';\nimport { from } from './from';\nexport function of(...args) {\n const scheduler = popScheduler(args);\n return from(args, scheduler);\n}\n","import { Observable } from '../Observable';\nimport { isFunction } from '../util/isFunction';\nexport function throwError(errorOrErrorFactory, scheduler) {\n const errorFactory = isFunction(errorOrErrorFactory) ? errorOrErrorFactory : () => errorOrErrorFactory;\n const init = (subscriber) => subscriber.error(errorFactory());\n return new Observable(scheduler ? (subscriber) => scheduler.schedule(init, 0, subscriber) : init);\n}\n","import { Subscriber } from '../Subscriber';\nexport function createOperatorSubscriber(destination, onNext, onComplete, onError, onFinalize) {\n return new OperatorSubscriber(destination, onNext, onComplete, onError, onFinalize);\n}\nexport class OperatorSubscriber extends Subscriber {\n constructor(destination, onNext, onComplete, onError, onFinalize, shouldUnsubscribe) {\n super(destination);\n this.onFinalize = onFinalize;\n this.shouldUnsubscribe = shouldUnsubscribe;\n this._next = onNext\n ? function (value) {\n try {\n onNext(value);\n }\n catch (err) {\n destination.error(err);\n }\n }\n : super._next;\n this._error = onError\n ? function (err) {\n try {\n onError(err);\n }\n catch (err) {\n destination.error(err);\n }\n finally {\n this.unsubscribe();\n }\n }\n : super._error;\n this._complete = onComplete\n ? function () {\n try {\n onComplete();\n }\n catch (err) {\n destination.error(err);\n }\n finally {\n this.unsubscribe();\n }\n }\n : super._complete;\n }\n unsubscribe() {\n var _a;\n if (!this.shouldUnsubscribe || this.shouldUnsubscribe()) {\n const { closed } = this;\n super.unsubscribe();\n !closed && ((_a = this.onFinalize) === null || _a === void 0 ? void 0 : _a.call(this));\n }\n }\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { operate } from '../util/lift';\nexport function catchError(selector) {\n return operate((source, subscriber) => {\n let innerSub = null;\n let syncUnsub = false;\n let handledResult;\n innerSub = source.subscribe(createOperatorSubscriber(subscriber, undefined, undefined, (err) => {\n handledResult = innerFrom(selector(err, catchError(selector)(source)));\n if (innerSub) {\n innerSub.unsubscribe();\n innerSub = null;\n handledResult.subscribe(subscriber);\n }\n else {\n syncUnsub = true;\n }\n }));\n if (syncUnsub) {\n innerSub.unsubscribe();\n innerSub = null;\n handledResult.subscribe(subscriber);\n }\n });\n}\n","import { mergeMap } from './mergeMap';\nimport { isFunction } from '../util/isFunction';\nexport function concatMap(project, resultSelector) {\n return isFunction(resultSelector) ? mergeMap(project, resultSelector, 1) : mergeMap(project, 1);\n}\n","import { identity } from '../util/identity';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function distinctUntilChanged(comparator, keySelector = identity) {\n comparator = comparator !== null && comparator !== void 0 ? comparator : defaultCompare;\n return operate((source, subscriber) => {\n let previousKey;\n let first = true;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n const currentKey = keySelector(value);\n if (first || !comparator(previousKey, currentKey)) {\n first = false;\n previousKey = currentKey;\n subscriber.next(value);\n }\n }));\n });\n}\nfunction defaultCompare(a, b) {\n return a === b;\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function filter(predicate, thisArg) {\n return operate((source, subscriber) => {\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => predicate.call(thisArg, value, index++) && subscriber.next(value)));\n });\n}\n","import { operate } from '../util/lift';\nexport function finalize(callback) {\n return operate((source, subscriber) => {\n try {\n source.subscribe(subscriber);\n }\n finally {\n subscriber.add(callback);\n }\n });\n}\n","import { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function map(project, thisArg) {\n return operate((source, subscriber) => {\n let index = 0;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n subscriber.next(project.call(thisArg, value, index++));\n }));\n });\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Infinity) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { innerFrom } from '../observable/innerFrom';\nimport { operate } from '../util/lift';\nimport { mergeInternals } from './mergeInternals';\nimport { isFunction } from '../util/isFunction';\nexport function mergeMap(project, resultSelector, concurrent = Infinity) {\n if (isFunction(resultSelector)) {\n return mergeMap((a, i) => map((b, ii) => resultSelector(a, b, i, ii))(innerFrom(project(a, i))), concurrent);\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return operate((source, subscriber) => mergeInternals(source, subscriber, project, concurrent));\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { executeSchedule } from '../util/executeSchedule';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function mergeInternals(source, subscriber, project, concurrent, onBeforeNext, expand, innerSubScheduler, additionalFinalizer) {\n const buffer = [];\n let active = 0;\n let index = 0;\n let isComplete = false;\n const checkComplete = () => {\n if (isComplete && !buffer.length && !active) {\n subscriber.complete();\n }\n };\n const outerNext = (value) => (active < concurrent ? doInnerSub(value) : buffer.push(value));\n const doInnerSub = (value) => {\n expand && subscriber.next(value);\n active++;\n let innerComplete = false;\n innerFrom(project(value, index++)).subscribe(createOperatorSubscriber(subscriber, (innerValue) => {\n onBeforeNext === null || onBeforeNext === void 0 ? void 0 : onBeforeNext(innerValue);\n if (expand) {\n outerNext(innerValue);\n }\n else {\n subscriber.next(innerValue);\n }\n }, () => {\n innerComplete = true;\n }, undefined, () => {\n if (innerComplete) {\n try {\n active--;\n while (buffer.length && active < concurrent) {\n const bufferedValue = buffer.shift();\n if (innerSubScheduler) {\n executeSchedule(subscriber, innerSubScheduler, () => doInnerSub(bufferedValue));\n }\n else {\n doInnerSub(bufferedValue);\n }\n }\n checkComplete();\n }\n catch (err) {\n subscriber.error(err);\n }\n }\n }));\n };\n source.subscribe(createOperatorSubscriber(subscriber, outerNext, () => {\n isComplete = true;\n checkComplete();\n }));\n return () => {\n additionalFinalizer === null || additionalFinalizer === void 0 ? void 0 : additionalFinalizer();\n };\n}\n","import { innerFrom } from '../observable/innerFrom';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nexport function switchMap(project, resultSelector) {\n return operate((source, subscriber) => {\n let innerSubscriber = null;\n let index = 0;\n let isComplete = false;\n const checkComplete = () => isComplete && !innerSubscriber && subscriber.complete();\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n innerSubscriber === null || innerSubscriber === void 0 ? void 0 : innerSubscriber.unsubscribe();\n let innerIndex = 0;\n const outerIndex = index++;\n innerFrom(project(value, outerIndex)).subscribe((innerSubscriber = createOperatorSubscriber(subscriber, (innerValue) => subscriber.next(resultSelector ? resultSelector(value, innerValue, outerIndex, innerIndex++) : innerValue), () => {\n innerSubscriber = null;\n checkComplete();\n })));\n }, () => {\n isComplete = true;\n checkComplete();\n }));\n });\n}\n","import { isFunction } from '../util/isFunction';\nimport { operate } from '../util/lift';\nimport { createOperatorSubscriber } from './OperatorSubscriber';\nimport { identity } from '../util/identity';\nexport function tap(observerOrNext, error, complete) {\n const tapObserver = isFunction(observerOrNext) || error || complete\n ?\n { next: observerOrNext, error, complete }\n : observerOrNext;\n return tapObserver\n ? operate((source, subscriber) => {\n var _a;\n (_a = tapObserver.subscribe) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n let isUnsub = true;\n source.subscribe(createOperatorSubscriber(subscriber, (value) => {\n var _a;\n (_a = tapObserver.next) === null || _a === void 0 ? void 0 : _a.call(tapObserver, value);\n subscriber.next(value);\n }, () => {\n var _a;\n isUnsub = false;\n (_a = tapObserver.complete) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n subscriber.complete();\n }, (err) => {\n var _a;\n isUnsub = false;\n (_a = tapObserver.error) === null || _a === void 0 ? void 0 : _a.call(tapObserver, err);\n subscriber.error(err);\n }, () => {\n var _a, _b;\n if (isUnsub) {\n (_a = tapObserver.unsubscribe) === null || _a === void 0 ? void 0 : _a.call(tapObserver);\n }\n (_b = tapObserver.finalize) === null || _b === void 0 ? void 0 : _b.call(tapObserver);\n }));\n })\n :\n identity;\n}\n","export const timeoutProvider = {\n setTimeout(handler, timeout, ...args) {\n const { delegate } = timeoutProvider;\n if (delegate === null || delegate === void 0 ? void 0 : delegate.setTimeout) {\n return delegate.setTimeout(handler, timeout, ...args);\n }\n return setTimeout(handler, timeout, ...args);\n },\n clearTimeout(handle) {\n const { delegate } = timeoutProvider;\n return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearTimeout) || clearTimeout)(handle);\n },\n delegate: undefined,\n};\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\n","export const observable = (() => (typeof Symbol === 'function' && Symbol.observable) || '@@observable')();\n","import { isFunction } from './isFunction';\nimport { isScheduler } from './isScheduler';\nfunction last(arr) {\n return arr[arr.length - 1];\n}\nexport function popResultSelector(args) {\n return isFunction(last(args)) ? args.pop() : undefined;\n}\nexport function popScheduler(args) {\n return isScheduler(last(args)) ? args.pop() : undefined;\n}\nexport function popNumber(args, defaultValue) {\n return typeof last(args) === 'number' ? args.pop() : defaultValue;\n}\n","import { isFunction } from './isFunction';\nexport function isScheduler(value) {\n return value && isFunction(value.schedule);\n}\n","const { isArray } = Array;\nconst { getPrototypeOf, prototype: objectProto, keys: getKeys } = Object;\nexport function argsArgArrayOrObject(args) {\n if (args.length === 1) {\n const first = args[0];\n if (isArray(first)) {\n return { args: first, keys: null };\n }\n if (isPOJO(first)) {\n const keys = getKeys(first);\n return {\n args: keys.map((key) => first[key]),\n keys,\n };\n }\n }\n return { args: args, keys: null };\n}\nfunction isPOJO(obj) {\n return obj && typeof obj === 'object' && getPrototypeOf(obj) === objectProto;\n}\n","export function arrRemove(arr, item) {\n if (arr) {\n const index = arr.indexOf(item);\n 0 <= index && arr.splice(index, 1);\n }\n}\n","export function createErrorClass(createImpl) {\n const _super = (instance) => {\n Error.call(instance);\n instance.stack = new Error().stack;\n };\n const ctorFunc = createImpl(_super);\n ctorFunc.prototype = Object.create(Error.prototype);\n ctorFunc.prototype.constructor = ctorFunc;\n return ctorFunc;\n}\n","export function createObject(keys, values) {\n return keys.reduce((result, key, i) => ((result[key] = values[i]), result), {});\n}\n","import { config } from '../config';\nlet context = null;\nexport function errorContext(cb) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n const isRoot = !context;\n if (isRoot) {\n context = { errorThrown: false, error: null };\n }\n cb();\n if (isRoot) {\n const { errorThrown, error } = context;\n context = null;\n if (errorThrown) {\n throw error;\n }\n }\n }\n else {\n cb();\n }\n}\nexport function captureError(err) {\n if (config.useDeprecatedSynchronousErrorHandling && context) {\n context.errorThrown = true;\n context.error = err;\n }\n}\n","export function executeSchedule(parentSubscription, scheduler, work, delay = 0, repeat = false) {\n const scheduleSubscription = scheduler.schedule(function () {\n work();\n if (repeat) {\n parentSubscription.add(this.schedule(null, delay));\n }\n else {\n this.unsubscribe();\n }\n }, delay);\n parentSubscription.add(scheduleSubscription);\n if (!repeat) {\n return scheduleSubscription;\n }\n}\n","export function identity(x) {\n return x;\n}\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","import { isFunction } from './isFunction';\nexport function isAsyncIterable(obj) {\n return Symbol.asyncIterator && isFunction(obj === null || obj === void 0 ? void 0 : obj[Symbol.asyncIterator]);\n}\n","export function isFunction(value) {\n return typeof value === 'function';\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nimport { isFunction } from './isFunction';\nexport function isInteropObservable(input) {\n return isFunction(input[Symbol_observable]);\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { isFunction } from './isFunction';\nexport function isIterable(input) {\n return isFunction(input === null || input === void 0 ? void 0 : input[Symbol_iterator]);\n}\n","import { isFunction } from \"./isFunction\";\nexport function isPromise(value) {\n return isFunction(value === null || value === void 0 ? void 0 : value.then);\n}\n","import { __asyncGenerator, __await } from \"tslib\";\nimport { isFunction } from './isFunction';\nexport function readableStreamLikeToAsyncGenerator(readableStream) {\n return __asyncGenerator(this, arguments, function* readableStreamLikeToAsyncGenerator_1() {\n const reader = readableStream.getReader();\n try {\n while (true) {\n const { value, done } = yield __await(reader.read());\n if (done) {\n return yield __await(void 0);\n }\n yield yield __await(value);\n }\n }\n finally {\n reader.releaseLock();\n }\n });\n}\nexport function isReadableStreamLike(obj) {\n return isFunction(obj === null || obj === void 0 ? void 0 : obj.getReader);\n}\n","import { isFunction } from './isFunction';\nexport function hasLift(source) {\n return isFunction(source === null || source === void 0 ? void 0 : source.lift);\n}\nexport function operate(init) {\n return (source) => {\n if (hasLift(source)) {\n return source.lift(function (liftedSource) {\n try {\n return init(liftedSource, this);\n }\n catch (err) {\n this.error(err);\n }\n });\n }\n throw new TypeError('Unable to lift unknown Observable type');\n };\n}\n","import { map } from \"../operators/map\";\nconst { isArray } = Array;\nfunction callOrApply(fn, args) {\n return isArray(args) ? fn(...args) : fn(args);\n}\nexport function mapOneOrManyArgs(fn) {\n return map(args => callOrApply(fn, args));\n}\n","export function noop() { }\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { config } from '../config';\nimport { timeoutProvider } from '../scheduler/timeoutProvider';\nexport function reportUnhandledError(err) {\n timeoutProvider.setTimeout(() => {\n const { onUnhandledError } = config;\n if (onUnhandledError) {\n onUnhandledError(err);\n }\n else {\n throw err;\n }\n });\n}\n","export function createInvalidObservableTypeError(input) {\n return new TypeError(`You provided ${input !== null && typeof input === 'object' ? 'an invalid object' : `'${input}'`} where a stream was expected. You can provide an Observable, Promise, ReadableStream, Array, AsyncIterable, or Iterable.`);\n}\n","/**\n * @license Angular v16.2.12\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, inject, Injectable, Optional, Inject, EventEmitter, ɵɵinject, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, untracked, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, Renderer2, ElementRef, Injector, PLATFORM_ID, NgZone, numberAttribute, booleanAttribute, ɵunwrapSafeValue } from '@angular/core';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }]\n }] });\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor() {\n super();\n this._doc = inject(DOCUMENT);\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n this._history.pushState(state, title, url);\n }\n replaceState(state, title, url) {\n this._history.replaceState(state, title, url);\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BrowserPlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: () => new BrowserPlatformLocation() }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n useFactory: () => new BrowserPlatformLocation(),\n }]\n }], ctorParameters: function () { return []; } });\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n this._baseHref = href ?? this._platformLocation.getBaseHrefFromDOM() ??\n inject(DOCUMENT).location?.origin ?? '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HashLocationStrategy }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(locationStrategy) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n /** @internal */\n this._urlChangeSubscription = null;\n this._locationStrategy = locationStrategy;\n const baseHref = this._locationStrategy.getBaseHref();\n // Note: This class's interaction with base HREF does not fully follow the rules\n // outlined in the spec https://www.freesoft.org/CIE/RFC/1808/18.htm.\n // Instead of trying to fix individual bugs with more and more code, we should\n // investigate using the URL constructor and providing the base as a second\n // argument.\n // https://developer.mozilla.org/en-US/docs/Web/API/URL/URL#parameters\n this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));\n this._locationStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n this._locationStrategy.historyGo?.(relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n return () => {\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n /**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\n static { this.normalizeQueryParams = normalizeQueryParams; }\n /**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\n static { this.joinWithSlash = joinWithSlash; }\n /**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\n static { this.stripTrailingSlash = stripTrailingSlash; }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBasePath(basePath, url) {\n if (!basePath || !url.startsWith(basePath)) {\n return url;\n }\n const strippedUrl = url.substring(basePath.length);\n if (strippedUrl === '' || ['/', ';', '?', '#'].includes(strippedUrl[0])) {\n return strippedUrl;\n }\n return url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\nfunction _stripOrigin(baseHref) {\n // DO NOT REFACTOR! Previously, this check looked like this:\n // `/^(https?:)?\\/\\//.test(baseHref)`, but that resulted in\n // syntactically incorrect code after Closure Compiler minification.\n // This was likely caused by a bug in Closure Compiler, but\n // for now, the check is rewritten to use `new RegExp` instead.\n const isAbsoluteUrl = (new RegExp('^(https?:)?//')).test(baseHref);\n if (isAbsoluteUrl) {\n const [, pathname] = baseHref.split(/\\/\\/[^\\/]+/);\n return pathname;\n }\n return baseHref;\n}\n\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * Format styles that can be used to represent numbers.\n * @see {@link getLocaleNumberFormat}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see {@link NgPlural}\n * @see {@link NgPluralCase}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see {@link getLocaleDateFormat}\n * @see {@link getLocaleTimeFormat}\n * @see {@link getLocaleDateTimeFormat}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see {@link getLocaleNumberSymbol}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see {@link FormatWidth}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see {@link FormatWidth}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see {@link FormatWidth}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see {@link NumberSymbol}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see {@link NumberFormatStyle}\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see {@link getLocaleExtraDayPeriods}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see {@link getLocaleExtraDayPeriodRules}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see {@link DatePipe}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgLocaleLocalization }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(\n // leaving references to differs in place since flex layout is extending NgClass...\n _iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this.initialClasses = EMPTY_ARRAY;\n this.stateMap = new Map();\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInputs`: Optional component inputs object, which will be bind to the\n * component.\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * With inputs\n * ```\n * \n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n /**\n * A helper data structure that allows us to track inputs that were part of the\n * ngComponentOutletInputs expression. Tracking inputs is necessary for proper removal of ones\n * that are no longer referenced.\n */\n this._inputsUsed = new Map();\n }\n _needToReCreateNgModuleInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return changes['ngComponentOutletNgModule'] !== undefined ||\n changes['ngComponentOutletNgModuleFactory'] !== undefined;\n }\n _needToReCreateComponentInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return changes['ngComponentOutlet'] !== undefined ||\n changes['ngComponentOutletContent'] !== undefined ||\n changes['ngComponentOutletInjector'] !== undefined ||\n this._needToReCreateNgModuleInstance(changes);\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (this._needToReCreateComponentInstance(changes)) {\n this._viewContainerRef.clear();\n this._inputsUsed.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (this._needToReCreateNgModuleInstance(changes)) {\n this._moduleRef?.destroy();\n if (this.ngComponentOutletNgModule) {\n this._moduleRef =\n createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));\n }\n else if (this.ngComponentOutletNgModuleFactory) {\n this._moduleRef =\n this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n }\n /** @nodoc */\n ngDoCheck() {\n if (this._componentRef) {\n if (this.ngComponentOutletInputs) {\n for (const inputName of Object.keys(this.ngComponentOutletInputs)) {\n this._inputsUsed.set(inputName, true);\n }\n }\n this._applyInputStateDiff(this._componentRef);\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n this._moduleRef?.destroy();\n }\n _applyInputStateDiff(componentRef) {\n for (const [inputName, touched] of this._inputsUsed) {\n if (!touched) {\n // The input that was previously active no longer exists and needs to be set to undefined.\n componentRef.setInput(inputName, undefined);\n this._inputsUsed.delete(inputName);\n }\n else {\n // Since touched is true, it can be asserted that the inputs object is not empty.\n componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);\n this._inputsUsed.set(inputName, false);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInputs: \"ngComponentOutletInputs\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInputs: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
  • ` element.\n *\n * ```\n *
  • ...
  • \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
  • ` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
  • ...
  • \n *
    \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
  • \n * {{i}}/{{users.length}}. {{user}} default\n *
  • \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see {@link TrackByFunction}\n */\n set ngForTrackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
    Content to render when condition is true.
    \n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
    Content to render when condition is\n * true.
    \n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
    Content to render when condition is true.
    \n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n *
    \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
    {{value}}
    \n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
    \n * ...\n *
    \n *\n * \n *
    Loading...
    \n *
    \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
    \n * ...\n *
    \n *
    \n *\n * \n *
    Loading...
    \n *
    \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see {@link NgSwitchCase}\n * @see {@link NgSwitchDefault}\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultViews = [];\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchDefault}\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchCase}\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; } });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n this.ngTemplateOutletInjector = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet'] || changes['ngTemplateOutletInjector']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n if (this.ngTemplateOutlet) {\n const { ngTemplateOutlet: template, ngTemplateOutletContext: context, ngTemplateOutletInjector: injector, } = this;\n this._viewRef =\n viewContainerRef.createEmbeddedView(template, context, injector ? { injector } : undefined);\n }\n else {\n this._viewRef = null;\n }\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"16.2.12\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n // Subscription can be side-effectful, and we don't want any signal reads which happen in the\n // side effect of the subscription to be tracked by a component's template when that\n // subscription is triggered via the async pipe. So we wrap the subscription in `untracked` to\n // decouple from the current reactive context.\n //\n // `untracked` also prevents signal _writes_ which happen in the subscription side effect from\n // being treated as signal writes during the template evaluation (which throws errors).\n return untracked(() => async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n }));\n }\n dispose(subscription) {\n // See the comment in `createSubscription` above on the use of `untracked`.\n untracked(() => subscription.unsubscribe());\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(ref) {\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n // Note: `this._ref` is only cleared in `ngOnDestroy` so is known to be available when a\n // value is being updated.\n this._ref.markForCheck();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * Transforms text to all lower case.\n *\n * @see {@link UpperCasePipe}\n * @see {@link TitleCasePipe}\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n standalone: true,\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see {@link LowerCasePipe}\n * @see {@link UpperCasePipe}\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.slice(1).toLowerCase()));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n standalone: true,\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see {@link LowerCasePipe}\n * @see {@link TitleCasePipe}\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n standalone: true,\n }]\n }] });\n\n/**\n * The default date format of Angular date pipe, which corresponds to the following format:\n * `'MMM d,y'` (e.g. `Jun 15, 2015`)\n */\nconst DEFAULT_DATE_FORMAT = 'mediumDate';\n\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n *\n * @deprecated use DATE_PIPE_DEFAULT_OPTIONS token to configure DatePipe\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n/**\n * DI token that allows to provide default configuration for the `DatePipe` instances in an\n * application. The value is an object which can include the following fields:\n * - `dateFormat`: configures the default date format. If not provided, the `DatePipe`\n * will use the 'mediumDate' as a value.\n * - `timezone`: configures the default timezone. If not provided, the `DatePipe` will\n * use the end-user's local system timezone.\n *\n * @see {@link DatePipeConfig}\n *\n * @usageNotes\n *\n * Various date pipe default values can be overwritten by providing this token with\n * the value that has this interface.\n *\n * For example:\n *\n * Override the default date format by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {dateFormat: 'shortDate'}}\n * ]\n * ```\n *\n * Override the default timezone by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {timezone: '-1200'}}\n * ]\n * ```\n */\nconst DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken('DATE_PIPE_DEFAULT_OPTIONS');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_OPTIONS`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see {@link formatDate}\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * {{ dateObj | date:\"MMM dd, yyyy 'at' hh:mm a\" }} // output is 'Jun 15, 2015 at 09:43 PM'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
    \n *

    Today is {{today | date}}

    \n *

    Or if you prefer, {{today | date:'fullDate'}}

    \n *

    The time is {{today | date:'h:mm a z'}}

    \n *
    `\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale, defaultTimezone, defaultOptions) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n this.defaultOptions = defaultOptions;\n }\n transform(value, format, timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;\n const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? undefined;\n return formatDate(value, _format, locale || this.locale, _timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }, { token: DATE_PIPE_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_OPTIONS]\n }, {\n type: Optional\n }] }]; } });\n\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * https://unicode-org.github.io/icu/userguide/format_parse/messages/.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; } });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n pure: true,\n standalone: true,\n }]\n }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n standalone: true,\n }]\n }] });\n\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.KeyValueDiffers }]; } });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see {@link formatNumber}\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format:
    \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see {@link formatPercent}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see {@link getCurrencySymbol}\n * @see {@link formatCurrency}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
  • b
  • \n *
  • c
  • \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"16.2.12\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: CommonModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n * @deprecated This function serves no purpose since the removal of the Webworker platform. It will\n * always return `false`.\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n * @deprecated This function serves no purpose since the removal of the Webworker platform. It will\n * always return `false`.\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('16.2.12');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n // De-sugared tree-shakable injection\n // See #23917\n /** @nocollapse */\n static { this.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n }); }\n}\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportsScrolling()) {\n this.window.history.scrollRestoration = scrollRestoration;\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch {\n return false;\n }\n }\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n typeof document.body.attachShadow === 'function') {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n let urlSegments;\n if (width) {\n const params = `tr:w-${width}`;\n urlSegments = [path, params, src];\n }\n else {\n urlSegments = [path, src];\n }\n return urlSegments.join('/');\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc ? `(activated on an element with the \\`ngSrc=\"${ngSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const img = this.images.get(imgSrc);\n if (!img)\n return;\n if (!img.priority && !img.alreadyWarnedPriority) {\n img.alreadyWarnedPriority = true;\n logMissingPriorityWarning(imgSrc);\n }\n if (img.modified && !img.alreadyWarnedModified) {\n img.alreadyWarnedModified = true;\n logModifiedWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc, isPriority) {\n if (!this.observer)\n return;\n const newObservedImageState = {\n priority: isPriority,\n modified: false,\n alreadyWarnedModified: false,\n alreadyWarnedPriority: false\n };\n this.images.set(getUrl(rewrittenSrc, this.window).href, newObservedImageState);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n updateImage(originalSrc, newSrc) {\n const originalUrl = getUrl(originalSrc, this.window).href;\n const img = this.images.get(originalUrl);\n if (img) {\n img.modified = true;\n this.images.set(getUrl(newSrc, this.window).href, img);\n this.images.delete(originalUrl);\n }\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\nfunction logModifiedWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2964 /* RuntimeErrorCode.LCP_IMG_NGSRC_MODIFIED */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element and has had its \"ngSrc\" attribute modified. This can cause ` +\n `slower loading performance. It is recommended not to modify the \"ngSrc\" ` +\n `property on any image which could be the LCP element.`));\n}\n\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n this.document = inject(DOCUMENT);\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * In SSR scenarios, a preload `` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken('NG_OPTIMIZED_PRELOADED_IMAGES', { providedIn: 'root', factory: () => new Set() });\n\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n constructor() {\n this.preloadedImages = inject(PRELOADED_IMAGES);\n this.document = inject(DOCUMENT);\n }\n /**\n * @description Add a preload `` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload `` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the `` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* RuntimeErrorCode.TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo];\nconst defaultConfig = {\n breakpoints: [16, 32, 48, 64, 96, 128, 256, 384, 640, 750, 828, 1080, 1200, 1920, 2048, 3840],\n};\n/**\n * Injection token that configures the image optimized image functionality.\n *\n * @see {@link NgOptimizedImage}\n * @publicApi\n */\nconst IMAGE_CONFIG = new InjectionToken('ImageConfig', { providedIn: 'root', factory: () => defaultConfig });\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/standalone-components) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * \n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.config = processConfig(inject(IMAGE_CONFIG));\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n this.isServer = isPlatformServer(inject(PLATFORM_ID));\n this.preloadLinkCreator = inject(PreloadLinkCreator);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n /**\n * Indicates whether this image should have a high priority.\n */\n this.priority = false;\n /**\n * Disables automatic srcset generation for this image.\n */\n this.disableOptimizedSrcset = false;\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n */\n this.fill = false;\n }\n /** @nodoc */\n ngOnInit() {\n if (ngDevMode) {\n const ngZone = this.injector.get(NgZone);\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n // This leaves the Angular zone to avoid triggering unnecessary change detection cycles when\n // `load` tasks are invoked on images.\n ngZone.runOutsideAngular(() => assertNonZeroRenderedHeight(this, this.imgElement, this.renderer));\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n if (this.height !== undefined) {\n assertGreaterThanZero(this, this.height, 'height');\n }\n if (this.width !== undefined) {\n assertGreaterThanZero(this, this.width, 'width');\n }\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n ngZone.runOutsideAngular(() => assertNoImageDistortion(this, this.imgElement, this.renderer));\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc, this.priority);\n });\n }\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n if (!this.sizes) {\n this.sizes = '100vw';\n }\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrcset = this.updateSrcAndSrcset();\n if (this.sizes) {\n this.setHostAttribute('sizes', this.sizes);\n }\n if (this.isServer && this.priority) {\n this.preloadLinkCreator.createPreloadLinkTag(this.renderer, this.getRewrittenSrc(), rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n if (changes['ngSrc'] && !changes['ngSrc'].isFirstChange()) {\n const oldSrc = this._renderedSrc;\n this.updateSrcAndSrcset(true);\n const newSrc = this._renderedSrc;\n if (this.lcpObserver !== null && oldSrc && newSrc && oldSrc !== newSrc) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver?.updateImage(oldSrc, newSrc);\n });\n }\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter(bp => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map(bp => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n updateSrcAndSrcset(forceSrcRecalc = false) {\n if (forceSrcRecalc) {\n // Reset cached value, so that the followup `getRewrittenSrc()` call\n // will recalculate it and update the cache.\n this._renderedSrc = null;\n }\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n return rewrittenSrcset;\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map(multiplier => `${this.callImageLoader({\n src: this.ngSrc,\n width: this.width * multiplier\n })} ${multiplier}x`);\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n let oversizedImage = false;\n if (!this.sizes) {\n oversizedImage =\n this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT;\n }\n return !this.disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader &&\n !oversizedImage;\n }\n /** @nodoc */\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"16.2.12\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc]\", inputs: { ngSrc: [\"ngSrc\", \"ngSrc\", unwrapSafeUrl], ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: [\"width\", \"width\", numberAttribute], height: [\"height\", \"height\", numberAttribute], loading: \"loading\", priority: [\"priority\", \"priority\", booleanAttribute], loaderParams: \"loaderParams\", disableOptimizedSrcset: [\"disableOptimizedSrcset\", \"disableOptimizedSrcset\", booleanAttribute], fill: [\"fill\", \"fill\", booleanAttribute], src: \"src\", srcset: \"srcset\" }, host: { properties: { \"style.position\": \"fill ? \\\"absolute\\\" : null\", \"style.width\": \"fill ? \\\"100%\\\" : null\", \"style.height\": \"fill ? \\\"100%\\\" : null\", \"style.inset\": \"fill ? \\\"0px\\\" : null\" } }, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[ngSrc]',\n host: {\n '[style.position]': 'fill ? \"absolute\" : null',\n '[style.width]': 'fill ? \"100%\" : null',\n '[style.height]': 'fill ? \"100%\" : null',\n '[style.inset]': 'fill ? \"0px\" : null'\n }\n }]\n }], propDecorators: { ngSrc: [{\n type: Input,\n args: [{ required: true, transform: unwrapSafeUrl }]\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], height: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], fill: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, defaultConfig, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason = `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason = `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value. ` +\n `To fix this, provide \\`${inputName}\\` as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const computedStyle = window.getComputedStyle(img);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n const boxSizing = computedStyle.getPropertyValue('box-sizing');\n if (boxSizing === 'border-box') {\n const paddingTop = computedStyle.getPropertyValue('padding-top');\n const paddingRight = computedStyle.getPropertyValue('padding-right');\n const paddingBottom = computedStyle.getPropertyValue('padding-bottom');\n const paddingLeft = computedStyle.getPropertyValue('padding-left');\n renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);\n renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);\n }\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${round(intrinsicAspectRatio)}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${round(suppliedAspectRatio)}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${round(intrinsicAspectRatio)}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${round(renderedAspectRatio)}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n });\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* RuntimeErrorCode.MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\nfunction round(input) {\n return Number.isInteger(input) ? input : input.toFixed(2);\n}\n// Transform function to handle SafeValue input for ngSrc. This doesn't do any sanitization,\n// as that is not needed for img.src and img.srcset. This transform is purely for compatibility.\nfunction unwrapSafeUrl(value) {\n if (typeof value === 'string') {\n return value;\n }\n return ɵunwrapSafeValue(value);\n}\n\n// These exports represent the set of symbols exposed as a public API.\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, BrowserPlatformLocation, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_OPTIONS, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_CONFIG, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v16.2.12\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { Injectable, inject, NgZone, InjectionToken, ɵInitialRenderPendingTasks, Inject, ɵRuntimeError, PLATFORM_ID, makeEnvironmentProviders, NgModule, TransferState, makeStateKey, ɵENABLED_SSR_FEATURES, APP_BOOTSTRAP_LISTENER, ApplicationRef } from '@angular/core';\nimport { of, Observable, from } from 'rxjs';\nimport { concatMap, filter, map, finalize, switchMap, tap, first } from 'rxjs/operators';\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue } from '@angular/common';\n\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else if (typeof Headers !== 'undefined' && headers instanceof Headers) {\n this.headers = new Map();\n headers.forEach((values, name) => {\n this.setHeaderEntries(name, values);\n });\n }\n else {\n this.lazyInit = () => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertValidHeaders(headers);\n }\n this.headers = new Map();\n Object.entries(headers).forEach(([name, values]) => {\n this.setHeaderEntries(name, values);\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or override for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n setHeaderEntries(name, values) {\n const headerValues = (Array.isArray(values) ? values : [values]).map((value) => value.toString());\n const key = name.toLowerCase();\n this.headers.set(key, headerValues);\n this.maybeSetNormalizedName(name, key);\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n/**\n * Verifies that the headers object has the right shape: the values\n * must be either strings, numbers or arrays. Throws an error if an invalid\n * header value is present.\n */\nfunction assertValidHeaders(headers) {\n for (const [key, value] of Object.entries(headers)) {\n if (!(typeof value === 'string' || typeof value === 'number') && !Array.isArray(value)) {\n throw new Error(`Unexpected value of the \\`${key}\\` header provided. ` +\n `Expecting either a string, a number or an array, but got: \\`${value}\\`.`);\n }\n }\n}\n\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n // convert the values to strings\n const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];\n this.map.set(key, values);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n *\n * Note: The `FetchBackend` doesn't support progress report on uploads.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n *\n * Note: The `FetchBackend` doesn't support progress report on uploads.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* HttpStatusCode.Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/tour-of-heroes/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/understanding-communicating-with-http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HttpClient }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\nconst XSSI_PREFIX$1 = /^\\)\\]\\}',?\\n/;\nconst REQUEST_URL_HEADER = `X-Request-URL`;\n/**\n * Determine an appropriate URL for the response, by checking either\n * response url or the X-Request-URL header.\n */\nfunction getResponseUrl$1(response) {\n if (response.url) {\n return response.url;\n }\n // stored as lowercase in the map\n const xRequestUrl = REQUEST_URL_HEADER.toLocaleLowerCase();\n return response.headers.get(xRequestUrl);\n}\n/**\n * Uses `fetch` to send requests to a backend server.\n *\n * This `FetchBackend` requires the support of the\n * [Fetch API](https://developer.mozilla.org/en-US/docs/Web/API/Fetch_API) which is available on all\n * supported browsers and on Node.js v18 or later.\n *\n * @see {@link HttpHandler}\n *\n * @publicApi\n * @developerPreview\n */\nclass FetchBackend {\n constructor() {\n // We need to bind the native fetch to its context or it will throw an \"illegal invocation\"\n this.fetchImpl = inject(FetchFactory, { optional: true })?.fetch ?? fetch.bind(globalThis);\n this.ngZone = inject(NgZone);\n }\n handle(request) {\n return new Observable(observer => {\n const aborter = new AbortController();\n this.doRequest(request, aborter.signal, observer)\n .then(noop, error => observer.error(new HttpErrorResponse({ error })));\n return () => aborter.abort();\n });\n }\n async doRequest(request, signal, observer) {\n const init = this.createRequestInit(request);\n let response;\n try {\n const fetchPromise = this.fetchImpl(request.urlWithParams, { signal, ...init });\n // Make sure Zone.js doesn't trigger false-positive unhandled promise\n // error in case the Promise is rejected synchronously. See function\n // description for additional information.\n silenceSuperfluousUnhandledPromiseRejection(fetchPromise);\n // Send the `Sent` event before awaiting the response.\n observer.next({ type: HttpEventType.Sent });\n response = await fetchPromise;\n }\n catch (error) {\n observer.error(new HttpErrorResponse({\n error,\n status: error.status ?? 0,\n statusText: error.statusText,\n url: request.urlWithParams,\n headers: error.headers,\n }));\n return;\n }\n const headers = new HttpHeaders(response.headers);\n const statusText = response.statusText;\n const url = getResponseUrl$1(response) ?? request.urlWithParams;\n let status = response.status;\n let body = null;\n if (request.reportProgress) {\n observer.next(new HttpHeaderResponse({ headers, status, statusText, url }));\n }\n if (response.body) {\n // Read Progress\n const contentLength = response.headers.get('content-length');\n const chunks = [];\n const reader = response.body.getReader();\n let receivedLength = 0;\n let decoder;\n let partialText;\n // We have to check whether the Zone is defined in the global scope because this may be called\n // when the zone is nooped.\n const reqZone = typeof Zone !== 'undefined' && Zone.current;\n // Perform response processing outside of Angular zone to\n // ensure no excessive change detection runs are executed\n // Here calling the async ReadableStreamDefaultReader.read() is responsible for triggering CD\n await this.ngZone.runOutsideAngular(async () => {\n while (true) {\n const { done, value } = await reader.read();\n if (done) {\n break;\n }\n chunks.push(value);\n receivedLength += value.length;\n if (request.reportProgress) {\n partialText = request.responseType === 'text' ?\n (partialText ?? '') + (decoder ??= new TextDecoder).decode(value, { stream: true }) :\n undefined;\n const reportProgress = () => observer.next({\n type: HttpEventType.DownloadProgress,\n total: contentLength ? +contentLength : undefined,\n loaded: receivedLength,\n partialText,\n });\n reqZone ? reqZone.run(reportProgress) : reportProgress();\n }\n }\n });\n // Combine all chunks.\n const chunksAll = this.concatChunks(chunks, receivedLength);\n try {\n body = this.parseBody(request, chunksAll);\n }\n catch (error) {\n // Body loading or parsing failed\n observer.error(new HttpErrorResponse({\n error,\n headers: new HttpHeaders(response.headers),\n status: response.status,\n statusText: response.statusText,\n url: getResponseUrl$1(response) ?? request.urlWithParams,\n }));\n return;\n }\n }\n // Same behavior as the XhrBackend\n if (status === 0) {\n status = body ? 200 /* HttpStatusCode.Ok */ : 0;\n }\n // ok determines whether the response will be transmitted on the event or\n // error channel. Unsuccessful status codes (not 2xx) will always be errors,\n // but a successful status code can still result in an error if the user\n // asked for JSON data and the body cannot be parsed as such.\n const ok = status >= 200 && status < 300;\n if (ok) {\n observer.next(new HttpResponse({\n body,\n headers,\n status,\n statusText,\n url,\n }));\n // The full body has been received and delivered, no further events\n // are possible. This request is complete.\n observer.complete();\n }\n else {\n observer.error(new HttpErrorResponse({\n error: body,\n headers,\n status,\n statusText,\n url,\n }));\n }\n }\n parseBody(request, binContent) {\n switch (request.responseType) {\n case 'json':\n // stripping the XSSI when present\n const text = new TextDecoder().decode(binContent).replace(XSSI_PREFIX$1, '');\n return text === '' ? null : JSON.parse(text);\n case 'text':\n return new TextDecoder().decode(binContent);\n case 'blob':\n return new Blob([binContent]);\n case 'arraybuffer':\n return binContent.buffer;\n }\n }\n createRequestInit(req) {\n // We could share some of this logic with the XhrBackend\n const headers = {};\n const credentials = req.withCredentials ? 'include' : undefined;\n // Setting all the requested headers.\n req.headers.forEach((name, values) => (headers[name] = values.join(',')));\n // Add an Accept header if one isn't present already.\n headers['Accept'] ??= 'application/json, text/plain, */*';\n // Auto-detect the Content-Type header if one isn't present already.\n if (!headers['Content-Type']) {\n const detectedType = req.detectContentTypeHeader();\n // Sometimes Content-Type detection fails.\n if (detectedType !== null) {\n headers['Content-Type'] = detectedType;\n }\n }\n return {\n body: req.serializeBody(),\n method: req.method,\n headers,\n credentials,\n };\n }\n concatChunks(chunks, totalLength) {\n const chunksAll = new Uint8Array(totalLength);\n let position = 0;\n for (const chunk of chunks) {\n chunksAll.set(chunk, position);\n position += chunk.length;\n }\n return chunksAll;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: FetchBackend, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: FetchBackend }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: FetchBackend, decorators: [{\n type: Injectable\n }] });\n/**\n * Abstract class to provide a mocked implementation of `fetch()`\n */\nclass FetchFactory {\n}\nfunction noop() { }\n/**\n * Zone.js treats a rejected promise that has not yet been awaited\n * as an unhandled error. This function adds a noop `.then` to make\n * sure that Zone.js doesn't throw an error if the Promise is rejected\n * synchronously.\n */\nfunction silenceSuperfluousUnhandledPromiseRejection(promise) {\n promise.then(noop, noop);\n}\n\nfunction interceptorChainEndFn(req, finalHandlerFn) {\n return finalHandlerFn(req);\n}\n/**\n * Constructs a `ChainedInterceptorFn` which adapts a legacy `HttpInterceptor` to the\n * `ChainedInterceptorFn` interface.\n */\nfunction adaptLegacyInterceptorToChain(chainTailFn, interceptor) {\n return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {\n handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn),\n });\n}\n/**\n * Constructs a `ChainedInterceptorFn` which wraps and invokes a functional interceptor in the given\n * injector.\n */\nfunction chainedInterceptorFn(chainTailFn, interceptorFn, injector) {\n // clang-format off\n return (initialRequest, finalHandlerFn) => injector.runInContext(() => interceptorFn(initialRequest, downstreamRequest => chainTailFn(downstreamRequest, finalHandlerFn)));\n // clang-format on\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken(ngDevMode ? 'HTTP_INTERCEPTORS' : '');\n/**\n * A multi-provided token of `HttpInterceptorFn`s.\n */\nconst HTTP_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? 'HTTP_INTERCEPTOR_FNS' : '');\n/**\n * A multi-provided token of `HttpInterceptorFn`s that are only set in root.\n */\nconst HTTP_ROOT_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? 'HTTP_ROOT_INTERCEPTOR_FNS' : '');\n/**\n * Creates an `HttpInterceptorFn` which lazily initializes an interceptor chain from the legacy\n * class-based interceptors and runs the request through it.\n */\nfunction legacyInterceptorFnFactory() {\n let chain = null;\n return (req, handler) => {\n if (chain === null) {\n const interceptors = inject(HTTP_INTERCEPTORS, { optional: true }) ?? [];\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `interceptors` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);\n }\n const pendingTasks = inject(ɵInitialRenderPendingTasks);\n const taskId = pendingTasks.add();\n return chain(req, handler).pipe(finalize(() => pendingTasks.remove(taskId)));\n };\n}\nclass HttpInterceptorHandler extends HttpHandler {\n constructor(backend, injector) {\n super();\n this.backend = backend;\n this.injector = injector;\n this.chain = null;\n this.pendingTasks = inject(ɵInitialRenderPendingTasks);\n }\n handle(initialRequest) {\n if (this.chain === null) {\n const dedupedInterceptorFns = Array.from(new Set([\n ...this.injector.get(HTTP_INTERCEPTOR_FNS),\n ...this.injector.get(HTTP_ROOT_INTERCEPTOR_FNS, []),\n ]));\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `dedupedInterceptorFns` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);\n }\n const taskId = this.pendingTasks.add();\n return this.chain(initialRequest, downstreamRequest => this.backend.handle(downstreamRequest))\n .pipe(finalize(() => this.pendingTasks.remove(taskId)));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HttpInterceptorHandler, deps: [{ token: HttpBackend }, { token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HttpInterceptorHandler }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"16.2.12\", ngImport: i0, type: HttpInterceptorHandler, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpBackend }, { type: i0.EnvironmentInjector }]; } });\n\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending